CA1200052A - Protective helmet with securing collar - Google Patents
Protective helmet with securing collarInfo
- Publication number
- CA1200052A CA1200052A CA000421736A CA421736A CA1200052A CA 1200052 A CA1200052 A CA 1200052A CA 000421736 A CA000421736 A CA 000421736A CA 421736 A CA421736 A CA 421736A CA 1200052 A CA1200052 A CA 1200052A
- Authority
- CA
- Canada
- Prior art keywords
- helmet
- collar
- wearer
- aperture
- diaphragm
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000001681 protective effect Effects 0.000 title claims abstract description 6
- 210000003414 extremity Anatomy 0.000 claims description 9
- 210000003141 lower extremity Anatomy 0.000 claims description 4
- 239000012858 resilient material Substances 0.000 claims description 2
- 210000004712 air sac Anatomy 0.000 claims 1
- 230000000903 blocking effect Effects 0.000 abstract 1
- ZTMKADLOSYKWCA-UHFFFAOYSA-N lenacil Chemical compound O=C1NC=2CCCC=2C(=O)N1C1CCCCC1 ZTMKADLOSYKWCA-UHFFFAOYSA-N 0.000 description 11
- 230000002093 peripheral effect Effects 0.000 description 4
- 230000000717 retained effect Effects 0.000 description 4
- 238000009423 ventilation Methods 0.000 description 4
- 238000005273 aeration Methods 0.000 description 3
- 230000014759 maintenance of location Effects 0.000 description 3
- 230000006978 adaptation Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- SYOKIDBDQMKNDQ-XWTIBIIYSA-N vildagliptin Chemical compound C1C(O)(C2)CC(C3)CC1CC32NCC(=O)N1CCC[C@H]1C#N SYOKIDBDQMKNDQ-XWTIBIIYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A42—HEADWEAR
- A42B—HATS; HEAD COVERINGS
- A42B3/00—Helmets; Helmet covers ; Other protective head coverings
- A42B3/04—Parts, details or accessories of helmets
- A42B3/18—Face protection devices
- A42B3/22—Visors
- A42B3/24—Visors with means for avoiding fogging or misting
-
- A—HUMAN NECESSITIES
- A42—HEADWEAR
- A42B—HATS; HEAD COVERINGS
- A42B3/00—Helmets; Helmet covers ; Other protective head coverings
- A42B3/04—Parts, details or accessories of helmets
- A42B3/28—Ventilating arrangements
-
- A—HUMAN NECESSITIES
- A42—HEADWEAR
- A42B—HATS; HEAD COVERINGS
- A42B3/00—Helmets; Helmet covers ; Other protective head coverings
- A42B3/32—Collapsible helmets; Helmets made of separable parts ; Helmets with movable parts, e.g. adjustable
- A42B3/326—Helmets with movable or separable chin or jaw guard
Landscapes
- Helmets And Other Head Coverings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH2542/82A CH649450A5 (it) | 1982-04-26 | 1982-04-26 | Casco protettivo con collare di trattenuta alla testa dell'utente. |
| CH2542/82 | 1982-04-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1200052A true CA1200052A (en) | 1986-02-04 |
Family
ID=4236136
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000421736A Expired CA1200052A (en) | 1982-04-26 | 1983-02-16 | Protective helmet with securing collar |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4553270A (enExample) |
| JP (1) | JPS5930907A (enExample) |
| AU (1) | AU1173483A (enExample) |
| BE (1) | BE896087A (enExample) |
| BR (1) | BR8302095A (enExample) |
| CA (1) | CA1200052A (enExample) |
| CH (1) | CH649450A5 (enExample) |
| DE (1) | DE3312832A1 (enExample) |
| DK (1) | DK184583A (enExample) |
| ES (1) | ES8402501A1 (enExample) |
| FR (1) | FR2525441B1 (enExample) |
| GB (1) | GB2120081B (enExample) |
| GR (1) | GR78578B (enExample) |
| IT (1) | IT1168920B (enExample) |
| LU (1) | LU84762A1 (enExample) |
| NL (1) | NL8301208A (enExample) |
| PT (1) | PT76590B (enExample) |
| SE (1) | SE8300294L (enExample) |
| ZA (1) | ZA832741B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5231703A (en) * | 1991-05-31 | 1993-08-03 | Louis Garneau | Protective headgear |
| US5351342A (en) * | 1992-02-03 | 1994-10-04 | Louis Garneau | Protective headgear |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3316920C1 (de) * | 1983-05-09 | 1984-11-08 | Schuberth-Werk Gmbh & Co Kg, 3300 Braunschweig | Sturzhelm mit einer Einrichtung zur Belüftung des Helminnenraums |
| FR2560503B2 (fr) * | 1983-08-19 | 1990-10-05 | Gessalin Jean | Dispositif d'assujettissement pour casque de protection pour motocyclistes et similaires |
| FR2550692B1 (fr) * | 1983-08-19 | 1986-06-13 | Gessalin Jean | Dispositif d'assujettissement pour casque de protection pour motocyclistes et similaires |
| IT1169648B (it) * | 1983-10-28 | 1987-06-03 | Pier Luigi Nava | Casco integrale particolarmente per usi sportivi |
| DE3344706C2 (de) * | 1983-12-10 | 1986-07-17 | Bayerische Motoren Werke AG, 8000 München | Schutzhelm für Motorradfahrer oder dergleichen |
| IT1177288B (it) * | 1984-11-22 | 1987-08-26 | Pier Luigi Nava | Casco integrale |
| IT206876Z2 (it) * | 1985-11-05 | 1987-10-12 | Vitaloni Spa | Casco per motociclismo ed attivita analoghe con visiera e mentoniera mobili |
| FR2595920A1 (fr) * | 1986-03-18 | 1987-09-25 | Gpa Int | Casque integral a dispositif de retention comprenant une demi-jupe d'assujettissement verrouillable sur la coque et a mouvement pendulaire |
| DE3628493A1 (de) * | 1986-08-22 | 1988-02-25 | Artur Foehl | Betaetigungsanordnung an schutzhelmen |
| US5203034A (en) * | 1986-08-22 | 1993-04-20 | Artur Foehl | Operating device for protective helmets |
| DE3628739C1 (de) * | 1986-08-23 | 1988-02-11 | Schuberth Werk Kg | Integral-Sturzhelm |
| IT1197145B (it) * | 1986-09-02 | 1988-11-25 | Marco Cianfanelli | Casco integrale dotato di mentoniera in un sol pezzo, sollevabile mediante movimento di traslazione e rotazione |
| IT1197183B (it) * | 1986-09-05 | 1988-11-30 | Nolan Spa | Casco sportivo, di tipo avvolgente, inglobante dei mezzi atti a garantire un corretto vincolo al mento dell'utente |
| CH669716A5 (enExample) * | 1986-10-30 | 1989-04-14 | Kiwi Sa | |
| JPS63159508A (ja) * | 1986-12-17 | 1988-07-02 | 昭栄化工株式会社 | ヘルメツト |
| FR2627958B1 (fr) * | 1988-03-03 | 1990-08-10 | Chaise Francois | Casque de protection sans jugulaire et systeme d'amortissement des mouvements du dispositif d'assujettissement des casques sans jugulaire |
| DE3822252A1 (de) * | 1988-07-01 | 1990-01-25 | Bayerische Motoren Werke Ag | Schutzhelm |
| FR2638618A1 (fr) * | 1988-11-04 | 1990-05-11 | Bianchi Vittorio | Dispositif de retenue d'un objet amovible sur un support, notamment d'un accessoire de protection dudit support, et accessoire de protection comportant un tel dispositif |
| US4942628A (en) * | 1989-09-20 | 1990-07-24 | Mine Safety Appliances Company | Helmet suspension having ratchet adjustment |
| USD332844S (en) | 1989-11-27 | 1993-01-26 | Suplick George E | Face guard for a motorcycle helmet |
| FR2655823B1 (enExample) * | 1989-12-14 | 1992-03-13 | Gallet Sa | |
| JPH0663125B2 (ja) * | 1990-08-31 | 1994-08-17 | 昭栄化工株式会社 | 乗車用ヘルメット |
| DE9013217U1 (de) * | 1990-09-18 | 1990-12-06 | Römer Helme und Schutzausrüstungen GmbH, 7910 Neu-Ulm | Schutzhelm |
| IT220163Z2 (it) * | 1990-09-19 | 1993-06-24 | Nava Pierluigi | Casco integrale per motocicletta provvisto di mezzi per impedire l'appannamento della visiera dello stesso. |
| FR2706257B1 (fr) * | 1993-06-10 | 1995-08-04 | Gallet Sa | Casque de protection. |
| FR2717990B1 (fr) * | 1994-03-31 | 1996-06-07 | Nicolas Guerre | Casque modulable pour adaptation à des sports différents. |
| US5901369A (en) * | 1997-08-15 | 1999-05-11 | Honeywell Inc. | Headgear having an articulated mounting mechanism for a visor |
| US6108824A (en) * | 1998-08-12 | 2000-08-29 | Sport Maska Inc. | Helmet adjustment mechanism with quick release |
| CA2357690C (en) * | 2001-09-25 | 2009-01-20 | Bertrand Racine | Locking device for adjustable helmets |
| FR2843855B1 (fr) * | 2002-08-30 | 2004-12-03 | Motive | Casque de protection contenant une coque avant et une coque arriere articulees |
| US20070163158A1 (en) * | 2006-01-17 | 2007-07-19 | Bentz William G | Shields and billboards |
| JP5232505B2 (ja) * | 2008-03-06 | 2013-07-10 | 株式会社アライヘルメット | ネックパッドの取付け構造 |
| US8621672B2 (en) * | 2011-05-06 | 2014-01-07 | John CHUBACK | Head and neck protection apparatus |
| ES2905906T3 (es) * | 2015-05-19 | 2022-04-12 | Paranhos Torres Mauricio | Mejoras en la célula de protección del cráneo |
| WO2017152151A1 (en) * | 2016-03-04 | 2017-09-08 | Apex Biomedical Company, Llc | Protective liner for helmets and other articles |
| US11026467B2 (en) * | 2016-05-05 | 2021-06-08 | Fox Head, Inc. | In-molded helmet chinbar |
| KR102050313B1 (ko) * | 2018-10-31 | 2019-11-29 | 김두태 | 가변차양이 구비된 모자 |
Family Cites Families (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2861272A (en) * | 1957-02-21 | 1958-11-25 | Whitney A Stuart | Hinged helmet |
| DE1185929B (de) * | 1961-03-14 | 1965-01-21 | Ml Aviation Co Ltd | Kopfhaube fuer Druckanzuege mit einer Atemmaske und die Ohren ueberdeckenden Schalen |
| GB1158495A (en) * | 1966-03-03 | 1969-07-16 | Ml Aviation Co Ltd | Airmen's Helmets |
| FR2141431B1 (enExample) * | 1971-06-02 | 1973-06-29 | Fuks Robert | |
| US3897597A (en) * | 1972-05-31 | 1975-08-05 | Dale R Kasper | Face and head protector |
| DE2526336A1 (de) * | 1975-06-12 | 1976-12-16 | Kalman Gyoery | Einsatz fuer sicherheitshelme, insbesondere motorradhelme |
| BE832996A (fr) * | 1975-09-02 | 1975-12-31 | Casque de protection | |
| IT1050962B (it) * | 1975-10-13 | 1981-03-20 | Sole Spa | Casco perfezionato per piloti |
| US4042974A (en) * | 1975-10-14 | 1977-08-23 | Wheelsport Distributing Co. | Helmet face guard accessory for motorcycle riders |
| DE2659324C3 (de) * | 1976-12-29 | 1981-01-15 | Kalman 3141 Garlstorf Gyoery | Schutzhelm für Motorradfahrer |
| US4028739A (en) * | 1976-07-02 | 1977-06-14 | The United States Of America As Represented By The Secretary Of The Navy | Ventilated helmet with selected weight distribution |
| DE2720785C3 (de) * | 1977-05-09 | 1980-10-16 | Kurt 8351 Schwanenkirchen Zeisler | Sturzhelm |
| IT1094571B (it) * | 1977-05-09 | 1985-08-02 | Zeisler Kurt | Casco di sicurezza |
| US4081865A (en) * | 1977-07-08 | 1978-04-04 | Bergee Mark A | Protective helmet and ventilating system therefor |
| FR2430736A2 (fr) * | 1978-07-13 | 1980-02-08 | Guerre Berthelot Pierre | Dispositif d'assujetissement ameliore des casques |
| US4290150A (en) * | 1977-11-08 | 1981-09-22 | G P A International | Protective helmets and fastening devices therefor |
| DE2846636C3 (de) * | 1978-10-26 | 1981-04-02 | Schuberth-Werk Gmbh & Co Kg, 3300 Braunschweig | Integralhelm |
| DE2853260C3 (de) * | 1978-12-09 | 1982-01-28 | Röttig, Gerhard, 6348 Herborn | Integralsturzhelm |
| DE7906871U1 (de) * | 1979-03-12 | 1979-06-07 | Roettig, Gerhard, 6349 Mittenaar | Sturzhelm |
| IT1207216B (it) * | 1979-07-27 | 1989-05-17 | Nava Pier Luigi | Dispositivo per azionare visiere di caschi, particolarmente per motociclisti. |
| JPS5653735U (enExample) * | 1979-09-29 | 1981-05-12 | ||
| DE3017099A1 (de) * | 1980-05-03 | 1981-11-19 | Schuberth-Werk Gmbh & Co Kg, 3300 Braunschweig | Schutzhelm |
| IT8060475U1 (it) * | 1980-11-19 | 1982-05-19 | Zago Gianni | Casco di protezione della testa con chiusura di tenuta |
| WO1983000605A1 (fr) * | 1981-08-19 | 1983-03-03 | CHAISE, François | Casque de protection de motocycliste equipe d'un dispositif de retention sans jugulaire |
| IT8122834U1 (it) * | 1981-09-09 | 1983-03-09 | Nolan Spa | Guarnizione attrezzata per visiere di caschi integrali. |
| DE3143796A1 (de) * | 1981-11-04 | 1983-05-11 | Berner, Reinhard, 8000 München | "integralsturzhelm" |
| IT1210029B (it) * | 1982-06-17 | 1989-09-06 | Mpa Mecc Plastica Agordina | Casco integrale con mentoniera sganciabile ed apribile. |
| DE8229801U1 (de) * | 1982-09-16 | 1983-01-27 | Hans Römer GmbH + Co, 7910 Neu-Ulm | Schutzhelm, insbesondere Motorradhelm |
-
1982
- 1982-04-26 CH CH2542/82A patent/CH649450A5/it not_active IP Right Cessation
-
1983
- 1983-01-21 SE SE8300294A patent/SE8300294L/ not_active Application Discontinuation
- 1983-02-01 US US06/462,894 patent/US4553270A/en not_active Expired - Fee Related
- 1983-02-09 ES ES519641A patent/ES8402501A1/es not_active Expired
- 1983-02-16 CA CA000421736A patent/CA1200052A/en not_active Expired
- 1983-02-22 AU AU11734/83A patent/AU1173483A/en not_active Abandoned
- 1983-03-04 BE BE0/210264A patent/BE896087A/fr not_active IP Right Cessation
- 1983-03-08 JP JP58036783A patent/JPS5930907A/ja active Granted
- 1983-04-06 NL NL8301208A patent/NL8301208A/nl not_active Application Discontinuation
- 1983-04-09 DE DE19833312832 patent/DE3312832A1/de not_active Ceased
- 1983-04-15 IT IT20627/83A patent/IT1168920B/it active
- 1983-04-19 ZA ZA832741A patent/ZA832741B/xx unknown
- 1983-04-20 GR GR71140A patent/GR78578B/el unknown
- 1983-04-20 GB GB08310627A patent/GB2120081B/en not_active Expired
- 1983-04-21 FR FR8306591A patent/FR2525441B1/fr not_active Expired
- 1983-04-21 LU LU84762A patent/LU84762A1/fr unknown
- 1983-04-22 PT PT76590A patent/PT76590B/pt unknown
- 1983-04-25 BR BR8302095A patent/BR8302095A/pt unknown
- 1983-04-26 DK DK184583A patent/DK184583A/da not_active Application Discontinuation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5231703A (en) * | 1991-05-31 | 1993-08-03 | Louis Garneau | Protective headgear |
| US5351342A (en) * | 1992-02-03 | 1994-10-04 | Louis Garneau | Protective headgear |
Also Published As
| Publication number | Publication date |
|---|---|
| PT76590A (en) | 1983-05-01 |
| IT8320627A0 (it) | 1983-04-15 |
| AU1173483A (en) | 1983-11-03 |
| LU84762A1 (fr) | 1983-11-17 |
| DK184583A (da) | 1983-10-27 |
| IT1168920B (it) | 1987-05-20 |
| BR8302095A (pt) | 1983-12-27 |
| CH649450A5 (it) | 1985-05-31 |
| FR2525441B1 (fr) | 1988-07-22 |
| JPH0135922B2 (enExample) | 1989-07-27 |
| GB8310627D0 (en) | 1983-05-25 |
| ES519641A0 (es) | 1984-03-01 |
| DK184583D0 (da) | 1983-04-26 |
| SE8300294L (sv) | 1983-10-27 |
| ES8402501A1 (es) | 1984-03-01 |
| DE3312832A1 (de) | 1983-11-03 |
| GR78578B (enExample) | 1984-09-27 |
| PT76590B (en) | 1985-12-10 |
| BE896087A (fr) | 1983-07-01 |
| GB2120081A (en) | 1983-11-30 |
| FR2525441A1 (fr) | 1983-10-28 |
| GB2120081B (en) | 1987-03-25 |
| SE8300294D0 (sv) | 1983-01-21 |
| JPS5930907A (ja) | 1984-02-18 |
| NL8301208A (nl) | 1983-11-16 |
| US4553270A (en) | 1985-11-19 |
| ZA832741B (en) | 1983-12-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1200052A (en) | Protective helmet with securing collar | |
| EP0638252B1 (en) | Air intake device in helmet | |
| CA1125452A (en) | Actuating device for the vizors of helmets or similar headgears | |
| US4556994A (en) | Fullface-type helmet | |
| US4612675A (en) | Helmet with adjustable ventilation | |
| DE69818860T2 (de) | Schutzhelm | |
| EP0258552A1 (en) | Integral helmet fitted with a chin piece which may be lifted by forward shifting and swinging movements | |
| GB2198925A (en) | Helmet | |
| EP2229829B1 (en) | Helmet having a guiding mechanism for a compatible visor | |
| US5363512A (en) | Protective goggle and lens with adjustable ventilation | |
| EP2025255B1 (de) | Schutzhelm | |
| DE68909934T2 (de) | Schutzhelm. | |
| EP0097285B1 (en) | Unitary construction crash helmet | |
| US6105172A (en) | Helmet | |
| USD312513S (en) | Crash helmet | |
| EP0474939A1 (en) | Helmet | |
| EP0474941A1 (en) | Helmet with improved ventilation | |
| EP2592956A1 (de) | Innenausstattung für einen schutzhelm, insbesondere für forstarbeiter | |
| DE69911693T2 (de) | Helm | |
| EP4027824B1 (de) | Visiermechanik für einen schutzhelm | |
| US4581775A (en) | Tilting vizor for helmets particularly for sports use | |
| DE4009036A1 (de) | Schutzhelm, insbesondere sport-schutzhelm | |
| WO1996024265A1 (en) | Helmet visor mechanism with laterally moveable visors | |
| AU4264697A (en) | Curved visor mechanism for helmets with laterally moveable visors | |
| KR100300657B1 (ko) | 모자 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |