AT392852B - Elektrophotographisches aufzeichnungsmaterial - Google Patents
Elektrophotographisches aufzeichnungsmaterial Download PDFInfo
- Publication number
- AT392852B AT392852B AT2967/79A AT296779A AT392852B AT 392852 B AT392852 B AT 392852B AT 2967/79 A AT2967/79 A AT 2967/79A AT 296779 A AT296779 A AT 296779A AT 392852 B AT392852 B AT 392852B
- Authority
- AT
- Austria
- Prior art keywords
- dye
- yellow
- orange
- astrazone
- mixture
- Prior art date
Links
- 239000000463 material Substances 0.000 title claims description 17
- 239000000975 dye Substances 0.000 claims description 48
- 239000000203 mixture Substances 0.000 claims description 20
- 230000001235 sensitizing effect Effects 0.000 claims description 16
- 229960001506 brilliant green Drugs 0.000 claims description 9
- HXCILVUBKWANLN-UHFFFAOYSA-N brilliant green cation Chemical compound C1=CC(N(CC)CC)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](CC)CC)C=C1 HXCILVUBKWANLN-UHFFFAOYSA-N 0.000 claims description 9
- 239000001003 triarylmethane dye Substances 0.000 claims description 9
- 238000010521 absorption reaction Methods 0.000 claims description 8
- 238000007639 printing Methods 0.000 claims description 7
- ZOMLUNRKXJYKPD-UHFFFAOYSA-N 1,3,3-trimethyl-2-[2-(2-methylindol-3-ylidene)ethylidene]indole;hydrochloride Chemical compound [Cl-].C1=CC=C2C(C)(C)C(/C=C/C=3C4=CC=CC=C4NC=3C)=[N+](C)C2=C1 ZOMLUNRKXJYKPD-UHFFFAOYSA-N 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 6
- 239000013078 crystal Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 5
- LORKUZBPMQEQET-UHFFFAOYSA-M (2e)-1,3,3-trimethyl-2-[(2z)-2-(1-methyl-2-phenylindol-1-ium-3-ylidene)ethylidene]indole;chloride Chemical compound [Cl-].CC1(C)C2=CC=CC=C2N(C)\C1=C/C=C(C1=CC=CC=C1[N+]=1C)/C=1C1=CC=CC=C1 LORKUZBPMQEQET-UHFFFAOYSA-M 0.000 claims description 4
- DSZCWNRVMXBILR-UHFFFAOYSA-M (2z)-1,3,3-trimethyl-2-[2-(2-methyl-2,3-dihydroindol-1-ium-1-ylidene)ethylidene]indole;chloride Chemical compound [Cl-].CN/1C2=CC=CC=C2C(C)(C)C\1=C/C=[N+]1C2=CC=CC=C2CC1C DSZCWNRVMXBILR-UHFFFAOYSA-M 0.000 claims description 3
- 239000000654 additive Substances 0.000 claims description 3
- 229940107698 malachite green Drugs 0.000 claims description 3
- FDZZZRQASAIRJF-UHFFFAOYSA-M malachite green Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 FDZZZRQASAIRJF-UHFFFAOYSA-M 0.000 claims description 3
- LLWJPGAKXJBKKA-UHFFFAOYSA-N victoria blue B Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC(=CC=1)N(C)C)=C(C=C1)C2=CC=CC=C2C1=[NH+]C1=CC=CC=C1 LLWJPGAKXJBKKA-UHFFFAOYSA-N 0.000 claims description 3
- JROAZQFKSSYEBL-TWNXTNBYSA-L disodium;5-[(z)-(3-carboxy-5-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)-(2,6-dichlorophenyl)methyl]-3-methyl-2-oxidobenzoate Chemical compound [Na+].[Na+].C1=C(C([O-])=O)C(=O)C(C)=C\C1=C(C=1C(=CC=CC=1Cl)Cl)/C1=CC(C)=C(O)C(C([O-])=O)=C1 JROAZQFKSSYEBL-TWNXTNBYSA-L 0.000 claims description 2
- 230000008020 evaporation Effects 0.000 claims description 2
- 238000001704 evaporation Methods 0.000 claims description 2
- UWGCNDBLFSEBDW-UHFFFAOYSA-M sodium;4-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]naphthalene-2,7-disulfonate Chemical compound [Na+].C1=CC(N(CC)CC)=CC=C1C(C=1C2=CC=C(C=C2C=C(C=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 UWGCNDBLFSEBDW-UHFFFAOYSA-M 0.000 claims description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims 3
- IHZXTIBMKNSJCJ-UHFFFAOYSA-N 3-{[(4-{[4-(dimethylamino)phenyl](4-{ethyl[(3-sulfophenyl)methyl]amino}phenyl)methylidene}cyclohexa-2,5-dien-1-ylidene)(ethyl)azaniumyl]methyl}benzene-1-sulfonate Chemical compound C=1C=C(C(=C2C=CC(C=C2)=[N+](C)C)C=2C=CC(=CC=2)N(CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S(O)(=O)=O)=C1 IHZXTIBMKNSJCJ-UHFFFAOYSA-N 0.000 claims 1
- AMGQUBHHOARCQH-UHFFFAOYSA-N indium;oxotin Chemical compound [In].[Sn]=O AMGQUBHHOARCQH-UHFFFAOYSA-N 0.000 claims 1
- 239000002245 particle Substances 0.000 claims 1
- 229920006267 polyester film Polymers 0.000 claims 1
- 210000002268 wool Anatomy 0.000 claims 1
- 230000035945 sensitivity Effects 0.000 description 12
- 230000003595 spectral effect Effects 0.000 description 12
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 8
- 239000011888 foil Substances 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 5
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 4
- -1 p-diethylaminophenyl Chemical group 0.000 description 4
- 230000005855 radiation Effects 0.000 description 4
- 230000033458 reproduction Effects 0.000 description 4
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000007645 offset printing Methods 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical compound [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- FJKUOCCQEBLPNX-UHFFFAOYSA-N 8-hydroxyquinoline N-oxide Chemical compound C1=C[N+]([O-])=C2C(O)=CC=CC2=C1 FJKUOCCQEBLPNX-UHFFFAOYSA-N 0.000 description 2
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- DPKHZNPWBDQZCN-UHFFFAOYSA-N acridine orange free base Chemical compound C1=CC(N(C)C)=CC2=NC3=CC(N(C)C)=CC=C3C=C21 DPKHZNPWBDQZCN-UHFFFAOYSA-N 0.000 description 2
- BGLGAKMTYHWWKW-UHFFFAOYSA-N acridine yellow Chemical compound [H+].[Cl-].CC1=C(N)C=C2N=C(C=C(C(C)=C3)N)C3=CC2=C1 BGLGAKMTYHWWKW-UHFFFAOYSA-N 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N benzoquinolinylidene Natural products C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- KKFHAJHLJHVUDM-UHFFFAOYSA-N n-vinylcarbazole Chemical compound C1=CC=C2N(C=C)C3=CC=CC=C3C2=C1 KKFHAJHLJHVUDM-UHFFFAOYSA-N 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N perisophthalic acid Natural products OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- HYGLETVERPVXOS-UHFFFAOYSA-N 1-bromopyrene Chemical compound C1=C2C(Br)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 HYGLETVERPVXOS-UHFFFAOYSA-N 0.000 description 1
- QAMCXJOYXRSXDU-UHFFFAOYSA-N 2,4-dimethoxy-n-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline;chloride Chemical compound [Cl-].COC1=CC(OC)=CC=C1NC=CC1=[N+](C)C2=CC=CC=C2C1(C)C QAMCXJOYXRSXDU-UHFFFAOYSA-N 0.000 description 1
- JJQOKUCYWIGCIN-UHFFFAOYSA-N 4-[4-(2-chlorophenyl)-2-ethenyl-1,3-oxazol-5-yl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=C(C=2C(=CC=CC=2)Cl)N=C(C=C)O1 JJQOKUCYWIGCIN-UHFFFAOYSA-N 0.000 description 1
- UZGVMZRBRRYLIP-UHFFFAOYSA-N 4-[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)N(CC)CC)O1 UZGVMZRBRRYLIP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 150000007978 oxazole derivatives Chemical class 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- 229940043267 rhodamine b Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 150000001651 triphenylamine derivatives Chemical class 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/09—Sensitisors or activators, e.g. dyestuffs
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782817428 DE2817428A1 (de) | 1978-04-21 | 1978-04-21 | Material fuer elektrophotographische reproduktion |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA296779A ATA296779A (de) | 1990-11-15 |
| AT392852B true AT392852B (de) | 1991-06-25 |
Family
ID=6037636
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT2967/79A AT392852B (de) | 1978-04-21 | 1979-04-19 | Elektrophotographisches aufzeichnungsmaterial |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4252880A (enExample) |
| EP (1) | EP0004944B1 (enExample) |
| JP (1) | JPS54145538A (enExample) |
| AT (1) | AT392852B (enExample) |
| BR (1) | BR7902457A (enExample) |
| CA (1) | CA1123254A (enExample) |
| DE (2) | DE2817428A1 (enExample) |
| ZA (1) | ZA791899B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2949826A1 (de) * | 1979-12-12 | 1981-06-19 | Hoechst Ag, 6230 Frankfurt | Material fuer elektrophotographische reproduktion |
| JPS57147656A (en) * | 1981-03-09 | 1982-09-11 | Fuji Photo Film Co Ltd | Electrophotographic sensitive printing plate material |
| DE3210576A1 (de) * | 1982-03-23 | 1983-10-06 | Hoechst Ag | Elektrophotographisches aufzeichnungsmaterial |
| JPS60118847A (ja) * | 1983-11-30 | 1985-06-26 | Dainippon Printing Co Ltd | 画像形成材料及び画像形成方法 |
| EP0152889B1 (de) * | 1984-02-18 | 1987-09-16 | BASF Aktiengesellschaft | Lichtempfindliche Aufzeichnungsmaterialien |
| DE3506436A1 (de) * | 1985-02-23 | 1986-08-28 | Hoechst Ag, 6230 Frankfurt | Neue sulfonhaltige styrolderivate, verfahren zu deren herstellung und deren verwendung |
| DE3509147A1 (de) * | 1985-03-14 | 1986-09-18 | Hoechst Ag, 6230 Frankfurt | Elektrophotographisches aufzeichnungsmaterial |
| DE3513747A1 (de) * | 1985-04-17 | 1986-10-23 | Hoechst Ag, 6230 Frankfurt | Elektrophotographisches aufzeichnungsmaterial |
| DE3541534A1 (de) * | 1985-11-25 | 1987-05-27 | Hoechst Ag | Positiv arbeitendes strahlungsempfindliches gemisch |
| JPH02216160A (ja) * | 1989-02-17 | 1990-08-29 | Iwatsu Electric Co Ltd | 電子写真感光体 |
| DE3938708A1 (de) * | 1989-11-17 | 1991-05-23 | Berolina Schriftbild | Verfahren zur behandlung eines fotoleiters |
| KR100939468B1 (ko) * | 2001-03-10 | 2010-01-29 | 메르크 파텐트 게엠베하 | 유기 반도체 용액 및 분산액 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE538610A (enExample) * | 1954-06-02 | |||
| US3238149A (en) * | 1961-07-10 | 1966-03-01 | Method for improxvlnxg the the photocondug thqe response of dye sensitized zinc ox de | |
| NL137097C (enExample) * | 1962-02-17 | |||
| FR1375297A (fr) * | 1962-09-21 | 1964-10-16 | Kalle Ag | Couches sensibles pour électrophotographie et leur procédé de préparation |
| DE1447907A1 (de) * | 1964-01-11 | 1968-12-05 | Kalle Ag | Elektrophotographischer Mehrfarbendruck |
| US3512966A (en) * | 1965-07-26 | 1970-05-19 | Ibm | Process of electrophotographic recording employing persistent organic photoconductive compositions |
| JPS492638B1 (enExample) * | 1970-11-17 | 1974-01-22 | ||
| US4025340A (en) * | 1971-11-10 | 1977-05-24 | Fuji Photo Film Co., Ltd. | Process for toning electrophotographic photosensitive material |
| AU507694B2 (en) * | 1975-06-14 | 1980-02-21 | Hoechst Aktiengesellschaft | Electrophotographic reproduction |
-
1978
- 1978-04-21 DE DE19782817428 patent/DE2817428A1/de not_active Withdrawn
-
1979
- 1979-04-12 EP EP79101123A patent/EP0004944B1/de not_active Expired
- 1979-04-12 DE DE7979101123T patent/DE2964691D1/de not_active Expired
- 1979-04-19 AT AT2967/79A patent/AT392852B/de not_active IP Right Cessation
- 1979-04-19 JP JP4731479A patent/JPS54145538A/ja active Granted
- 1979-04-19 CA CA325,898A patent/CA1123254A/en not_active Expired
- 1979-04-20 BR BR7902457A patent/BR7902457A/pt unknown
- 1979-04-20 ZA ZA791899A patent/ZA791899B/xx unknown
- 1979-04-20 US US06/031,971 patent/US4252880A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0004944B1 (de) | 1983-02-09 |
| DE2964691D1 (en) | 1983-03-17 |
| US4252880A (en) | 1981-02-24 |
| BR7902457A (pt) | 1979-10-30 |
| CA1123254A (en) | 1982-05-11 |
| EP0004944A3 (en) | 1979-11-14 |
| ATA296779A (de) | 1990-11-15 |
| EP0004944A2 (de) | 1979-10-31 |
| JPS54145538A (en) | 1979-11-13 |
| ZA791899B (en) | 1980-04-30 |
| DE2817428A1 (de) | 1979-10-31 |
| JPS6251462B2 (enExample) | 1987-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2939483C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| EP0001599B1 (de) | Elektrophotographisches Aufzeichnungsmaterial und dessen Verwendung in einem Kopierverfahren | |
| DE2941509C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1622364C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| AT392852B (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2009346A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1522644B2 (de) | Verwendung persistenter organischer photoleiter in einem elektrophotographischen aufzeichnungsverfahren | |
| DE2160812C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3790394C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| EP0201725B1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| EP0031481B1 (de) | Material für elektrophotographische Reproduktion | |
| EP0093329B1 (de) | Elektrographische Aufzeichnungsmaterialien mit speziellen Ladungsträger transportierenden Verbindungen | |
| EP0131215B1 (de) | Elektrophotographische Aufzeichnungsmaterialien mit verbesserter Photoempfindlichkeit | |
| DE3236477A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE1943386B2 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| EP0093330A1 (de) | Elektrographische Aufzeichnungsmaterialien mit speziellen Ladungsträger transportierenden Verbindungen | |
| DE1797137C3 (enExample) | ||
| DE1921246B2 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| EP0152047B1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| EP0194624B1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2059540B2 (de) | Elektrophotographisches Aufzeichnungsmaterial mit einer photoleitfänigen Schicht | |
| DE2016395B2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2726116A1 (de) | Material zur herstellung von druckformen | |
| DE2126660A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1522644C3 (de) | Verwendung persistenter organischer Photoleiter in einem elektrophotographischen Aufzeichnungsverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee | ||
| ELJ | Ceased due to non-payment of the annual fee |