SU730299A3 - Способ получени производных гуанидина или их солей - Google Patents
Способ получени производных гуанидина или их солей Download PDFInfo
- Publication number
- SU730299A3 SU730299A3 SU782607390A SU2607390A SU730299A3 SU 730299 A3 SU730299 A3 SU 730299A3 SU 782607390 A SU782607390 A SU 782607390A SU 2607390 A SU2607390 A SU 2607390A SU 730299 A3 SU730299 A3 SU 730299A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mixture
- solution
- ethanol
- thiazole
- guanidine
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims abstract description 13
- 238000000034 method Methods 0.000 title claims abstract description 9
- 150000002357 guanidines Chemical class 0.000 title claims abstract description 7
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 title abstract description 6
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 12
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 10
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 3
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 3
- 150000002367 halogens Chemical group 0.000 claims abstract description 3
- 229910052760 oxygen Inorganic materials 0.000 claims abstract 4
- 125000003435 aroyl group Chemical group 0.000 claims abstract 2
- 125000001589 carboacyl group Chemical group 0.000 claims abstract 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 27
- -1 methylene, sulfinyl Chemical group 0.000 claims description 21
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 10
- 125000004429 atom Chemical group 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 125000004434 sulfur atom Chemical group 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims 2
- 206010011732 Cyst Diseases 0.000 claims 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 208000031513 cyst Diseases 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 239000011435 rock Substances 0.000 claims 1
- 229920002554 vinyl polymer Polymers 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 73
- 239000001257 hydrogen Substances 0.000 abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 7
- 125000003342 alkenyl group Chemical group 0.000 abstract description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract description 2
- 125000003545 alkoxy group Chemical group 0.000 abstract description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 abstract description 2
- 125000003118 aryl group Chemical group 0.000 abstract description 2
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 abstract 2
- 101000989653 Homo sapiens Membrane frizzled-related protein Proteins 0.000 abstract 1
- 102100029357 Membrane frizzled-related protein Human genes 0.000 abstract 1
- 210000004211 gastric acid Anatomy 0.000 abstract 1
- 229960001340 histamine Drugs 0.000 abstract 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 abstract 1
- 238000004519 manufacturing process Methods 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 230000028327 secretion Effects 0.000 abstract 1
- 150000003557 thiazoles Chemical class 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 118
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 105
- 239000000243 solution Substances 0.000 description 68
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 45
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 30
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 25
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 12
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 11
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 230000002378 acidificating effect Effects 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- BGPJLYIFDLICMR-UHFFFAOYSA-N 1,4,2,3-dioxadithiolan-5-one Chemical compound O=C1OSSO1 BGPJLYIFDLICMR-UHFFFAOYSA-N 0.000 description 6
- ZAIUXDUGEUNTHO-UHFFFAOYSA-N 2-(ethylsulfanylmethyl)-1,3-thiazole Chemical compound CCSCC1=NC=CS1 ZAIUXDUGEUNTHO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000004430 oxygen atom Chemical group O* 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- QOJMQILDLLFGEE-UHFFFAOYSA-N 2-butyl-1,3-thiazole Chemical compound CCCCC1=NC=CS1 QOJMQILDLLFGEE-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000011976 maleic acid Substances 0.000 description 4
- CHJJGSNFBQVOTG-UHFFFAOYSA-N methylguanidine Chemical compound CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- ORECNKBJIMKZNX-UHFFFAOYSA-N 1,3-thiazol-3-ium;chloride Chemical compound Cl.C1=CSC=N1 ORECNKBJIMKZNX-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 150000002688 maleic acid derivatives Chemical class 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- SIQWQBQGWREFSE-UHFFFAOYSA-N 1-cyano-2-methylguanidine Chemical compound CNC(N)=NC#N SIQWQBQGWREFSE-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 2
- 230000001766 physiological effect Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- DDGHBOLOCQWPKE-UHFFFAOYSA-N 1,3-thiazole;hydrobromide Chemical compound [Br-].C1=CSC=[NH+]1 DDGHBOLOCQWPKE-UHFFFAOYSA-N 0.000 description 1
- KTCBLMXNWYGCRT-UHFFFAOYSA-N 1-[2-(1h-indol-3-yl)ethyl]-3-methylthiourea Chemical compound C1=CC=C2C(CCNC(=S)NC)=CNC2=C1 KTCBLMXNWYGCRT-UHFFFAOYSA-N 0.000 description 1
- UXIYVCPFEURLFN-UHFFFAOYSA-N 1-cyano-2-(2-methoxyethyl)guanidine Chemical compound COCCNC(N)=NC#N UXIYVCPFEURLFN-UHFFFAOYSA-N 0.000 description 1
- IKKZUUMAGYBBFE-UHFFFAOYSA-N 1-cyano-2-ethylguanidine Chemical compound CCNC(N)=NC#N IKKZUUMAGYBBFE-UHFFFAOYSA-N 0.000 description 1
- AJUZRVYAIZERFL-UHFFFAOYSA-N 2-(1,3-thiazol-2-yl)guanidine Chemical compound NC(N)=NC1=NC=CS1 AJUZRVYAIZERFL-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- FICQFRCPSFCFBY-UHFFFAOYSA-N 2-[bis(methylsulfanyl)methylidene]propanedinitrile Chemical compound CSC(SC)=C(C#N)C#N FICQFRCPSFCFBY-UHFFFAOYSA-N 0.000 description 1
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- QFYWDJHDOCZKRF-UHFFFAOYSA-N 2-pentyl-1,3-thiazole Chemical compound CCCCCC1=NC=CS1 QFYWDJHDOCZKRF-UHFFFAOYSA-N 0.000 description 1
- SZBNZTGCAMLMJY-UHFFFAOYSA-N 3,4-dimethoxycyclobut-3-ene-1,2-dione Chemical compound COC1=C(OC)C(=O)C1=O SZBNZTGCAMLMJY-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 101710178747 Phosphatidate cytidylyltransferase 1 Proteins 0.000 description 1
- 102100031075 Serine/threonine-protein kinase Chk2 Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- HPXWWLGOFMSKHV-UHFFFAOYSA-N [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium;chloride Chemical compound Cl.NC(N)=NC1=NC(CCl)=CS1 HPXWWLGOFMSKHV-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-ONCXSQPRSA-N abietic acid Chemical compound C([C@@H]12)CC(C(C)C)=CC1=CC[C@@H]1[C@]2(C)CCC[C@@]1(C)C(O)=O RSWGJHLUYNHPMX-ONCXSQPRSA-N 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- VJRITMATACIYAF-UHFFFAOYSA-N benzenesulfonohydrazide Chemical compound NNS(=O)(=O)C1=CC=CC=C1 VJRITMATACIYAF-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 208000036550 childhood-onset striatonigral degeneration Diseases 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000012045 crude solution Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- UESSEMPSSAXQJC-UHFFFAOYSA-N ethanol;methanamine Chemical compound NC.CCO UESSEMPSSAXQJC-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N monoethanolamine hydrochloride Natural products NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 235000015927 pasta Nutrition 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000012262 resinous product Substances 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229960003288 sulfaethidole Drugs 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 1
- 150000007979 thiazole derivatives Chemical class 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/88—Nitrogen atoms, e.g. allantoin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/48—Acylated amino or imino radicals by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof, e.g. carbonylguanidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1638977 | 1977-04-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU730299A3 true SU730299A3 (ru) | 1980-04-25 |
Family
ID=10076448
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU782607390A SU730299A3 (ru) | 1977-04-20 | 1978-04-20 | Способ получени производных гуанидина или их солей |
Country Status (28)
| Country | Link |
|---|---|
| US (4) | US4165377A (enExample) |
| JP (3) | JPS53147069A (enExample) |
| AR (1) | AR223315A1 (enExample) |
| AT (1) | AT363099B (enExample) |
| AU (1) | AU516297B2 (enExample) |
| BE (1) | BE866156A (enExample) |
| CA (1) | CA1097658A (enExample) |
| CS (2) | CS200546B2 (enExample) |
| DD (1) | DD135824A5 (enExample) |
| DK (1) | DK172778A (enExample) |
| ES (3) | ES468985A1 (enExample) |
| FI (1) | FI781230A7 (enExample) |
| FR (2) | FR2387970A1 (enExample) |
| GB (1) | GB2060607B (enExample) |
| GR (1) | GR62452B (enExample) |
| HU (1) | HU176807B (enExample) |
| IE (1) | IE47044B1 (enExample) |
| IL (1) | IL54549A0 (enExample) |
| IN (1) | IN148903B (enExample) |
| IT (1) | IT1094469B (enExample) |
| NL (1) | NL190486C (enExample) |
| NO (1) | NO781300L (enExample) |
| NZ (1) | NZ186965A (enExample) |
| PL (2) | PL113054B1 (enExample) |
| PT (1) | PT67921B (enExample) |
| SE (1) | SE7804461L (enExample) |
| SU (1) | SU730299A3 (enExample) |
| ZA (1) | ZA782129B (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL49528A (en) * | 1975-05-21 | 1980-11-30 | Smith Kline French Lab | Imidazolyl(or thiazolyl)methylthio(or butyl)guanidine or thiourea derivatives,their preparation and pharmaceutical compositions comprising them |
| DE2961923D1 (en) * | 1978-01-18 | 1982-03-11 | Ici Plc | Antisecretory guanidine derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| EP0006679B1 (en) * | 1978-05-24 | 1982-07-21 | Imperial Chemical Industries Plc | Antisecretory thiadiazole derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| US4200578A (en) | 1978-12-18 | 1980-04-29 | Bristol-Myers Company | Thiazole derivatives |
| EP0014057B1 (en) * | 1979-01-18 | 1985-01-02 | Imperial Chemical Industries Plc | Guanidine derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| US4521418A (en) * | 1979-02-21 | 1985-06-04 | Smith Kline & French Laboratories Limited | Guanidinothiazolyl derivatives |
| PH16099A (en) * | 1979-03-06 | 1983-06-24 | Yamanouchi Pharma Co Ltd | Guanidinothiazole compounds,process for preparing them and medical composition containing them |
| JPS6056143B2 (ja) * | 1979-08-02 | 1985-12-09 | 山之内製薬株式会社 | アミジン誘導体ならびにその製造法 |
| CH644369A5 (de) * | 1979-05-03 | 1984-07-31 | Sandoz Ag | 2-amino-4-chlorthiazolverbindungen. |
| US4242351A (en) * | 1979-05-07 | 1980-12-30 | Imperial Chemical Industries Limited | Antisecretory oxadiazoles and pharmaceutical compositions containing them |
| FI76795C (fi) * | 1979-09-04 | 1988-12-12 | Bristol Myers Co | Foerfarande foer framstaellning av nya, terapeutiskt anvaendbara 3,4-disubstituerade 1,2,5-tiadiazol-1-oxider och -1,1-dioxider samt nya mellanprodukter. |
| US4359466A (en) * | 1979-10-24 | 1982-11-16 | Smith Kline & French Laboratories Limited | Guanidine compounds |
| IL61234A (en) * | 1979-10-24 | 1984-03-30 | Smith Kline French Lab | Guanidino thiazolyl alkylamino(alkylthioalkylamino)nitrotetrahydropyridines,process for preparing them and pharmaceutical compositions containing them |
| GR71929B (enExample) * | 1979-11-13 | 1983-08-19 | Ici Ltd | |
| NZ196923A (en) * | 1980-04-29 | 1983-12-16 | Shionogi & Co | 2-guanidino-4-(-acylaminoalkyl(thio)methyl)thiazoles and analogs |
| DE3168031D1 (en) * | 1980-07-30 | 1985-02-14 | Ici Plc | Guanidine derivatives |
| WO1982000462A1 (fr) * | 1980-08-11 | 1982-02-18 | Rech Syntheses Organ | Imino-alkyle et amino-nitrile cyano-guanidines |
| US4760075A (en) * | 1980-10-02 | 1988-07-26 | Eli Lilly And Company | N-thiazolylmethylthioalkyl-N-alkyl-amidines and related compounds |
| US4904792A (en) * | 1980-10-02 | 1990-02-27 | Eli Lilly And Company | N-thiazolymethylthioalkyl-N'-alkylamidines and related compounds |
| US4374843A (en) * | 1980-10-14 | 1983-02-22 | Pfizer Inc. | 2-Guanidino-4-heteroarylthiazoles |
| EP0059597B1 (en) * | 1981-02-27 | 1986-04-23 | Imperial Chemical Industries Plc | Guanidino-substituted heterocyclic derivatives having histamine h-2 antagonist activity |
| CA1209998A (en) * | 1981-03-09 | 1986-08-19 | David J. Gilman | Amide derivatives as histamine h-2 receptor antagonists |
| CA1233818A (en) * | 1981-03-09 | 1988-03-08 | David J. Gilman | Guanidine derivatives as histamine h-2 receptor antagonists |
| US4460584A (en) * | 1981-03-13 | 1984-07-17 | Imperial Chemical Industries Plc | Nitrogen heterocycles |
| IN158869B (enExample) * | 1981-03-18 | 1987-02-07 | Ici Plc | |
| EP0065823A1 (en) * | 1981-05-13 | 1982-12-01 | Imperial Chemical Industries Plc | Heterocyclic guanidines as histamine H-2 antagonists |
| DE3267110D1 (de) * | 1981-05-18 | 1985-12-05 | Ici Plc | Amidine derivatives |
| US4510313A (en) * | 1981-08-20 | 1985-04-09 | Pfizer Inc. | 2-Guanidino-4-heteroarylthiazoles |
| US4590299A (en) * | 1981-08-20 | 1986-05-20 | Pfizer Inc. | 2-guanidino-4-heteroarylthiazoles |
| US4452987A (en) * | 1981-08-20 | 1984-06-05 | Pfizer Inc. | Haloacetyl imidazoles |
| JPS5872571A (ja) * | 1981-10-27 | 1983-04-30 | Shionogi & Co Ltd | 2−グアニジノ−4−〔2−(ホルムアミド)エチルチオメチル〕チアゾ−ルの製法 |
| US4647557A (en) * | 1982-12-28 | 1987-03-03 | Gerard Moinet | Novel heterocyclic derivatives bearing an amino radical, processes for their production and the pharmaceutical compositions containing them |
| JPS59227870A (ja) * | 1983-06-07 | 1984-12-21 | Yamanouchi Pharmaceut Co Ltd | 新規2−グアニジノチアゾリン誘導体ならびにその製造法 |
| JPS60255756A (ja) * | 1984-06-01 | 1985-12-17 | Ikeda Mohandou:Kk | アミノアルキルフエノキシ誘導体 |
| JPS6160673A (ja) * | 1984-08-30 | 1986-03-28 | Yamanouchi Pharmaceut Co Ltd | グアニジノチアゾ−ル誘導体の製造法 |
| US4814341A (en) * | 1986-08-26 | 1989-03-21 | Reiter Lawrence A | 2-guanidino-4-(2-furyl) thiazoles as antiulcer agents |
| FI892035L (fi) * | 1986-10-29 | 1989-04-28 | Pfizer | Foerfaranden foer 2-(1-pentyl-3-guanidino)-4-(2-metyl-4-imidazolyl) tiazol och analoger. |
| CA2237384A1 (en) * | 1995-11-13 | 1997-05-22 | The Albany Medical College | Analgesic compounds and uses thereof |
| WO1998040367A1 (en) * | 1997-03-11 | 1998-09-17 | Albemarle Corporation | Novel thiazole derivatives and their preparation |
| US5731442A (en) * | 1997-03-11 | 1998-03-24 | Albemarle Corporation | Synthesis of thiazole derivatives |
| US5856500A (en) * | 1997-03-11 | 1999-01-05 | Albemarle Corporation | Synthesis of thiazole derivatives |
| JP6378179B2 (ja) * | 2013-07-03 | 2018-08-22 | 株式会社新日本科学 | 新規化合物,有機カチオントランスポーター3の検出剤及び活性阻害剤 |
| DE102019200350B4 (de) | 2019-01-14 | 2023-05-11 | Rud Ketten Rieger & Dietz Gmbh U. Co. Kg | Nutzfahrzeugreifenkette, Nutzfahrzeugreifen und Stollenplatte für eine Nutzfahrzeugreifenkette |
| WO2022034121A1 (en) | 2020-08-11 | 2022-02-17 | Université De Strasbourg | H2 blockers targeting liver macrophages for the prevention and treatment of liver disease and cancer |
Family Cites Families (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1305547A (enExample) | 1969-10-29 | 1973-02-07 | ||
| GB1305548A (enExample) | 1969-10-29 | 1973-02-07 | ||
| GB1305550A (enExample) | 1969-10-29 | 1973-02-07 | ||
| BE758145A (fr) | 1969-10-29 | 1971-04-28 | Smith Kline French Lab | Iso-thio-urees et derives |
| GB1305549A (enExample) | 1969-10-29 | 1973-02-07 | ||
| BE758146A (fr) | 1969-10-29 | 1971-04-28 | Smith Kline French Lab | Derives de l'amidine |
| GB1341375A (en) | 1969-11-19 | 1973-12-19 | Smith Kline French Lab | Aminoalkylimidazoles and process for their production |
| GB1341376A (en) | 1969-11-19 | 1973-12-19 | Smith Kline French Lab | Pharmaceutical compositions comprising 4-methyl-5-2-aminoethyl imidazole |
| CA946968A (en) | 1970-05-18 | 1974-05-07 | Xerox Corporation | System for generating laser light of the three primary colors |
| GB1307539A (en) | 1970-06-25 | 1973-02-21 | Smith Kline French Lab | Thiourea derivatives |
| GB1336061A (en) | 1971-02-03 | 1973-11-07 | Ilford Ltd | Photographic emulsions |
| US4018931A (en) * | 1971-03-09 | 1977-04-19 | Smith Kline & French Laboratories Limited | Pharmacologically active thiourea and urea compounds |
| US3905984A (en) * | 1971-03-09 | 1975-09-16 | Smith Kline French Lab | Pyridyl substituted thioalkyl-and oxyalkyl-thioureas and ureas |
| US4018928A (en) * | 1971-03-09 | 1977-04-19 | Smith Kline & French Laboratories Limited | Pyridyl substituted aminoalkyl-thioureas and ureas |
| US3932427A (en) * | 1971-03-09 | 1976-01-13 | Smith Kline & French Laboratories, Inc. | Pyridyl substituted aminoalkyl-thioureas and ureas |
| GB1338169A (en) * | 1971-03-09 | 1973-11-21 | Smith Kline French Lab | Ureas thioureas and guanidines |
| US4049672A (en) * | 1971-03-09 | 1977-09-20 | Smith Kline & French Laboratories Limited | 4-Methyl-5-imidazolylmethylthioethylamine and -S-methylisothiourea |
| US3950353A (en) * | 1971-03-09 | 1976-04-13 | Smith Kline & French Laboratories Limited | Pharmacologically active thiourea and urea compounds |
| US4053473A (en) * | 1971-07-22 | 1977-10-11 | Smith Kline & French Laboratories Limited | Pharmacologically active thiourea and urea compounds |
| GB1395929A (en) | 1972-08-08 | 1975-05-29 | Smith Kline French Lab | Thioureas |
| GB1400319A (en) | 1972-04-20 | 1975-07-16 | Smith Kline French Lab | Pharmaceutical compositions |
| GB1399283A (en) | 1972-04-20 | 1975-07-02 | Smith Kline French Lab | Pharmaceutical compositions |
| GB1397436A (en) * | 1972-09-05 | 1975-06-11 | Smith Kline French Lab | Heterocyclic n-cyanoguinidines |
| GB1398426A (en) | 1972-09-05 | 1975-06-18 | Smith Kline French Lab | Heterocyclic substituted guanidines |
| US3920822A (en) * | 1972-09-05 | 1975-11-18 | Smith Kline French Lab | Inhibition of histamine activity with cyanoguanidines |
| US3975530A (en) * | 1972-09-05 | 1976-08-17 | Smith Kline & French Laboratories Limited | N-cyano-N'-heterocyclic-alkyl quanidine inhibitors of H2 histamine receptors |
| GB1421999A (en) | 1973-02-08 | 1976-01-21 | Smith Kline French Lab | Heterocyclic containing sulphoxides |
| GB1419994A (en) | 1973-05-03 | 1976-01-07 | Smith Kline French Lab | Heterocyclicalkylaminotheterocyclic compounds methods for their preparation and compositions comprising them |
| GB1421792A (en) | 1973-05-17 | 1976-01-21 | Smith Kline French Lab | Heterocyclic substituted-1, 1-diamino-ethylene derivatives methods for their preparation and compositions containing them |
| GB1422408A (en) | 1973-06-12 | 1976-01-28 | Smith Kline French Lab | Imidazo 1,2-a pyridines |
| GB1431589A (en) | 1973-07-13 | 1976-04-07 | Smith Kline French Lab | Ureas, thioureas and guanidines n,n-disubstituted by heterocyclo- alkylene and/or heterocycloalkylenethioalkylene groups |
| GB1565205A (en) * | 1975-07-31 | 1980-04-16 | Smith Kline French Lab | Heterocyclic sulphoxides |
| GB1493931A (en) | 1974-02-07 | 1977-11-30 | Smith Kline French Lab | Guanidines isothioureas and thioureas |
| GB1496787A (en) | 1974-03-12 | 1978-01-05 | Smith Kline French Lab | Heteroalkylthioalkyl amidine derivatives |
| CA1004576A (en) * | 1974-05-24 | 1977-02-01 | Ralph O. Jacobsen | Bale shredder |
| GB1497260A (en) | 1974-06-28 | 1978-01-05 | Smith Kline French Lab | Guanidine derivatives |
| GB1531221A (en) | 1974-09-02 | 1978-11-08 | Smith Kline French Lab | Process for preparing guanidine derivatives |
| GB1531231A (en) | 1974-09-02 | 1978-11-08 | Smith Kline French Lab | Process for the production of cyanoguanidine derivatives |
| GB1533378A (en) | 1974-09-02 | 1978-11-22 | Smith Kline French Lab | Process for the preparation of heterocyclic substituted thioureas |
| GB1533379A (en) | 1974-09-02 | 1978-11-22 | Smith Kline French Lab | Process for the preparation of heterocyclic substituted ureas |
| GB1530895A (en) | 1974-09-02 | 1978-11-01 | Smith Kline French Lab | Electrochemical reduction of 4-imidazole carboxylic acids |
| GB1533380A (en) | 1974-09-02 | 1978-11-22 | Smith Kline French Lab | Process for the preparation of heterocyclic substituted thioureas and h-cyanoguanidines |
| GB1542840A (en) | 1975-02-03 | 1979-03-28 | Smith Kline French Lab | Heterocyclic dithiocarbamates and isothioureas |
| GB1554153A (en) | 1975-05-15 | 1979-10-17 | Smith Kline French Lab | Process for making 2-amino-2-alkylthionitroethylenes |
| GB1563090A (en) | 1975-07-31 | 1980-03-19 | Smith Kline French Lab | Cyclobutene-diones |
| FR2317591B1 (fr) | 1975-07-08 | 1979-06-15 | Clarel | Appareil d'eclairage pour lampes fluorescentes |
| GB1564502A (en) | 1975-07-31 | 1980-04-10 | Smith Kline French Lab | Guanidines thioureas and 1,1-diamino-2-nitroethylene derivatives |
| GB1565647A (en) | 1975-07-31 | 1980-04-23 | Smith Kline French Lab | Pharmacologically active compounds 4-substituted-imidazole-5-methanols |
| IN146736B (enExample) | 1975-10-02 | 1979-08-25 | Smith Kline French Lab | |
| US4099672A (en) * | 1977-02-28 | 1978-07-11 | Ray Albert Sheahan | Shower-head fixture |
| US4309435A (en) * | 1978-10-16 | 1982-01-05 | Imperial Chemical Industries Ltd. | Antisecretory guanidine derivatives and pharmaceutical compositions containing them |
| JPS6056143B2 (ja) * | 1979-08-02 | 1985-12-09 | 山之内製薬株式会社 | アミジン誘導体ならびにその製造法 |
-
1978
- 1978-04-13 GR GR55969A patent/GR62452B/el unknown
- 1978-04-13 NO NO781300A patent/NO781300L/no unknown
- 1978-04-13 ZA ZA00782129A patent/ZA782129B/xx unknown
- 1978-04-13 IE IE728/78A patent/IE47044B1/en not_active IP Right Cessation
- 1978-04-13 NZ NZ186965A patent/NZ186965A/xx unknown
- 1978-04-14 AU AU35106/78A patent/AU516297B2/en not_active Expired
- 1978-04-15 IN IN274/DEL/78A patent/IN148903B/en unknown
- 1978-04-17 CA CA301,263A patent/CA1097658A/en not_active Expired
- 1978-04-18 PL PL1978218009A patent/PL113054B1/pl unknown
- 1978-04-18 PL PL1978206191A patent/PL113082B1/pl unknown
- 1978-04-19 AT AT0276978A patent/AT363099B/de not_active IP Right Cessation
- 1978-04-19 IL IL54549A patent/IL54549A0/xx not_active IP Right Cessation
- 1978-04-19 US US05/897,910 patent/US4165377A/en not_active Expired - Lifetime
- 1978-04-19 DD DD78204901A patent/DD135824A5/xx unknown
- 1978-04-19 BE BE186933A patent/BE866156A/xx not_active IP Right Cessation
- 1978-04-19 SE SE7804461A patent/SE7804461L/xx unknown
- 1978-04-19 FR FR7811536A patent/FR2387970A1/fr active Granted
- 1978-04-19 CS CS788113A patent/CS200546B2/cs unknown
- 1978-04-19 NL NLAANVRAGE7804159,A patent/NL190486C/xx not_active IP Right Cessation
- 1978-04-19 PT PT67921A patent/PT67921B/pt unknown
- 1978-04-19 CS CS782521A patent/CS200545B2/cs unknown
- 1978-04-20 AR AR271843A patent/AR223315A1/es active
- 1978-04-20 JP JP4713678A patent/JPS53147069A/ja active Granted
- 1978-04-20 FI FI781230A patent/FI781230A7/fi not_active Application Discontinuation
- 1978-04-20 DK DK172778A patent/DK172778A/da active IP Right Grant
- 1978-04-20 IT IT22558/78A patent/IT1094469B/it active
- 1978-04-20 HU HU78IE834A patent/HU176807B/hu unknown
- 1978-04-20 ES ES468985A patent/ES468985A1/es not_active Expired
- 1978-04-20 SU SU782607390A patent/SU730299A3/ru active
- 1978-06-22 GB GB8006269A patent/GB2060607B/en not_active Expired
- 1978-11-08 ES ES474929A patent/ES474929A1/es not_active Expired
-
1979
- 1979-02-01 ES ES477387A patent/ES477387A1/es not_active Expired
- 1979-08-13 US US06/065,801 patent/US4234735A/en not_active Expired - Lifetime
- 1979-08-13 US US06/065,802 patent/US4262126A/en not_active Expired - Lifetime
-
1980
- 1980-07-25 US US06/172,302 patent/US4347370A/en not_active Expired - Lifetime
-
1982
- 1982-06-16 FR FR8210491A patent/FR2519341A1/fr active Granted
-
1983
- 1983-11-18 JP JP58216402A patent/JPS59130277A/ja active Granted
- 1983-11-18 JP JP58216401A patent/JPS59130276A/ja active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU730299A3 (ru) | Способ получени производных гуанидина или их солей | |
| CA1263115A (en) | Derivatives of 1,2,5-thiadiazole-1-oxides and 1,1- dioxides as histamine h2-antagonists | |
| AU593278B2 (en) | Pharmaceutically active 2-thiomethyl-substituted-1,4- dihydropyridines | |
| EP0003640B1 (en) | Antisecretory guanidine derivatives, processes for their manufacture and pharmaceutical compositions containing them | |
| US4255440A (en) | Furan derivatives having selective action on histamine receptors | |
| EP0040696B1 (en) | Aminothiadiazoles as gastric secretion inhibitors | |
| US4375547A (en) | N-Methyl-N'-2-([(2-dimethylaminomethyl)-4-thiazolyl]methylthio)ethyl 2-nitro-1,1-ethenediamine | |
| JPH0262547B2 (enExample) | ||
| NO791710L (no) | Analogifremgangsmaate for fremstilling av fysiologisk aktive tiadiazolderivater | |
| NZ206614A (en) | Dihydropyridine derivatives and pharmaceutical compositions | |
| KR870001144B1 (ko) | 삼환 옥스인돌 카복스아미드 유도체의 제조방법 | |
| NZ200892A (en) | Diaminoisothiazole-1-oxides and 1,1-dioxides | |
| US4288443A (en) | Substituted furan compounds and pharmaceutical compositions containing them | |
| KR920003927B1 (ko) | 헤테로사이클릭구아니딘 5ht_3 길항물질 | |
| US3274208A (en) | Processes for preparing 2-thiazolylbenzimidazole compounds | |
| CA1130806A (en) | 1,2,4-oxadiazole derivatives, their preparation and pharmaceutical use | |
| DE68917049T2 (de) | Furylthiazol-Derivate, Verfahren zu deren Herstellung und pharmazeutische Zusammensetzungen, die sie enthalten. | |
| CA1206151A (en) | Pyrimidone anti-ulcer agents | |
| US4169855A (en) | N'-derivatives of n-(2-mercapto-ethyl)-2-nitro-1,1-ethenediamine | |
| US4164579A (en) | Hydroxythiazolidine-2-thiones | |
| GB2129426A (en) | Compounds of thiatriazines | |
| CY1276A (en) | N,n'-bis(n-cyano-n'-alkynyl)methanimidamidyl cystamines | |
| EP0091220B1 (en) | Thiazole derivatives, process for their preparation and pharmaceutical compositions containing them | |
| HU190669B (en) | Process for preparing 3,4-disubstituted 1,2,5-thiadiazole-1-oxides and -1,1-dioxides | |
| US3956325A (en) | 5-Heterocyclic-1,2,3,6-tetrahydro-4(5H) pyrimidinone |