SU574145A3 - Способ получени производных тетрациклина - Google Patents
Способ получени производных тетрациклинаInfo
- Publication number
- SU574145A3 SU574145A3 SU7301957942A SU1957942A SU574145A3 SU 574145 A3 SU574145 A3 SU 574145A3 SU 7301957942 A SU7301957942 A SU 7301957942A SU 1957942 A SU1957942 A SU 1957942A SU 574145 A3 SU574145 A3 SU 574145A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- demethyl
- butyl
- tert
- methyl
- solution
- Prior art date
Links
- 239000004098 Tetracycline Substances 0.000 title claims description 6
- 229960002180 tetracycline Drugs 0.000 title claims description 6
- 235000019364 tetracycline Nutrition 0.000 title claims description 6
- 229930101283 tetracycline Natural products 0.000 title claims description 6
- 238000000034 method Methods 0.000 title claims description 5
- 150000003522 tetracyclines Chemical class 0.000 title claims description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 93
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 33
- 239000000243 solution Substances 0.000 claims description 31
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 24
- -1 trifluoroacetamidomethyl Chemical group 0.000 claims description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 20
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 19
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 17
- 229910000040 hydrogen fluoride Inorganic materials 0.000 claims description 16
- 239000003208 petroleum Substances 0.000 claims description 15
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 12
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 11
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 11
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 11
- 235000011152 sodium sulphate Nutrition 0.000 claims description 11
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 9
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 8
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 claims description 8
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 8
- 239000003610 charcoal Substances 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 claims description 6
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 claims description 4
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000012074 organic phase Substances 0.000 claims description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 2
- 239000008098 formaldehyde solution Substances 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052697 platinum Inorganic materials 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- VIZVGXOLAURPQI-UHFFFAOYSA-N 2,2,2-trichloro-n-(chloromethyl)acetamide Chemical compound ClCNC(=O)C(Cl)(Cl)Cl VIZVGXOLAURPQI-UHFFFAOYSA-N 0.000 claims 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 2
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 claims 1
- WXBWKMLIVXELSF-UHFFFAOYSA-N 2,2,2-trifluoro-n,n-dimethylacetamide Chemical compound CN(C)C(=O)C(F)(F)F WXBWKMLIVXELSF-UHFFFAOYSA-N 0.000 claims 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 1
- 125000004423 acyloxy group Chemical group 0.000 claims 1
- 150000001345 alkine derivatives Chemical class 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 claims 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000012452 mother liquor Substances 0.000 claims 1
- 229910052700 potassium Inorganic materials 0.000 claims 1
- 239000011591 potassium Substances 0.000 claims 1
- 150000005376 secondary alkyl halides Chemical class 0.000 claims 1
- 101150008563 spir gene Proteins 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 238000006467 substitution reaction Methods 0.000 claims 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- 239000000284 extract Substances 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 6
- 229940098779 methanesulfonic acid Drugs 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- VFTOHJFKIJLYKN-UHFFFAOYSA-N 7-nitro-9h-fluoren-2-ol Chemical group [O-][N+](=O)C1=CC=C2C3=CC=C(O)C=C3CC2=C1 VFTOHJFKIJLYKN-UHFFFAOYSA-N 0.000 description 3
- 239000004100 Oxytetracycline Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229960000625 oxytetracycline Drugs 0.000 description 3
- 239000004323 potassium nitrate Substances 0.000 description 3
- 235000010333 potassium nitrate Nutrition 0.000 description 3
- MTCQOMXDZUULRV-ADOAZJKMSA-N (4s,4as,5ar,12ar)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide Chemical compound C1C2=CC=CC(O)=C2C(O)=C2[C@@H]1C[C@H]1[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]1(O)C2=O MTCQOMXDZUULRV-ADOAZJKMSA-N 0.000 description 2
- SWWQQSDRUYSMAR-UHFFFAOYSA-N 1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride Chemical group Cl.C1=CC(O)=CC=C1CC1C2=CC(O)=C(O)C=C2CCN1 SWWQQSDRUYSMAR-UHFFFAOYSA-N 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- YKWNUSJLICDQEO-UHFFFAOYSA-N ethoxyethane;propan-2-ol Chemical compound CC(C)O.CCOCC YKWNUSJLICDQEO-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 235000019366 oxytetracycline Nutrition 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- IWVCMVBTMGNXQD-UHFFFAOYSA-N terramycin dehydrate Natural products C1=CC=C2C(O)(C)C3C(O)C4C(N(C)C)C(O)=C(C(N)=O)C(=O)C4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-UHFFFAOYSA-N 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- FFTVPQUHLQBXQZ-KVUCHLLUSA-N (4s,4as,5ar,12ar)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide Chemical compound C1C2=C(N(C)C)C=CC(O)=C2C(O)=C2[C@@H]1C[C@H]1[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]1(O)C2=O FFTVPQUHLQBXQZ-KVUCHLLUSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical compound NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 229910019020 PtO2 Inorganic materials 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 241001413693 Tetrastes Species 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- QRTXZGIQTYDABO-UHFFFAOYSA-N carbanolate Chemical compound CNC(=O)OC1=CC(C)=C(C)C=C1Cl QRTXZGIQTYDABO-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- QSPOJWMZYOMAEI-UHFFFAOYSA-N ethyl n-[(ethoxycarbonylamino)methyl]carbamate Chemical compound CCOC(=O)NCNC(=O)OCC QSPOJWMZYOMAEI-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- DGEYTDCFMQMLTH-UHFFFAOYSA-N methanol;propan-2-ol Chemical compound OC.CC(C)O DGEYTDCFMQMLTH-UHFFFAOYSA-N 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- IWVCMVBTMGNXQD-PXOLEDIWSA-N oxytetracycline Chemical compound C1=CC=C2[C@](O)(C)[C@H]3[C@H](O)[C@H]4[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-PXOLEDIWSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- OSUYWXKKGWZOJT-UHFFFAOYSA-N prop-1-en-2-yl n,n-diethylcarbamate Chemical compound CCN(CC)C(=O)OC(C)=C OSUYWXKKGWZOJT-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Inorganic materials [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- PCZXEAAHGUQDNV-XBNKRBCZSA-N tetrahymanol Natural products CC1(C)CC[C@]2(C)CC[C@]3(C)[C@H]4CC[C@H]5[C@@H](CC[C@H](O)C5(C)C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 PCZXEAAHGUQDNV-XBNKRBCZSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2932872 | 1972-09-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU574145A3 true SU574145A3 (ru) | 1977-09-25 |
Family
ID=11226772
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU7301957942A SU574145A3 (ru) | 1972-09-18 | 1973-09-17 | Способ получени производных тетрациклина |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3901942A (enExample) |
| JP (1) | JPS5741458B2 (enExample) |
| AT (1) | AT328613B (enExample) |
| BE (1) | BE804913A (enExample) |
| CA (1) | CA999855A (enExample) |
| DE (1) | DE2346535C3 (enExample) |
| ES (1) | ES418809A1 (enExample) |
| FR (1) | FR2208885B1 (enExample) |
| GB (1) | GB1413347A (enExample) |
| HU (1) | HU167850B (enExample) |
| IE (1) | IE38820B1 (enExample) |
| NL (1) | NL158172B (enExample) |
| SU (1) | SU574145A3 (enExample) |
| ZA (1) | ZA737317B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2577331C2 (ru) * | 2007-02-23 | 2016-03-20 | Ховионе Сциентиа Лимитед | Кристаллическое основание миноциклина и способы его получения |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2437487A1 (de) * | 1974-08-03 | 1976-02-19 | Merck Patent Gmbh | 7-methoxy-6-thia-tetracycline und verfahren zu ihrer herstellung |
| AU578068B2 (en) * | 1984-03-08 | 1988-10-13 | Nippon Zoki Pharmaceutical Co., Ltd. | Hydantoin derivatives and pharmaceutical compositions containing them |
| JPH0737433B2 (ja) * | 1987-06-11 | 1995-04-26 | 協和醗酵工業株式会社 | 7−アミノ−6−デメチル−6−デオキシテトラサイクリンの製造法 |
| US4837030A (en) * | 1987-10-06 | 1989-06-06 | American Cyanamid Company | Novel controlled release formulations of tetracycline compounds |
| JPH01116549U (enExample) * | 1988-01-29 | 1989-08-07 | ||
| USRE40183E1 (en) | 1991-10-04 | 2008-03-25 | Wyeth Holdings Corporation | 7-Substituted-9-substituted amino-6-demethyl-6-deoxytetracyclines |
| US5494903A (en) | 1991-10-04 | 1996-02-27 | American Cyanamid Company | 7-substituted-9-substituted amino-6-demethyl-6-deoxytetracyclines |
| US5281628A (en) * | 1991-10-04 | 1994-01-25 | American Cyanamid Company | 9-amino-7-(substituted)-6-demethyl-6-deoxytetracyclines |
| US5675030A (en) * | 1994-11-16 | 1997-10-07 | American Cyanamid Company | Method for selective extracting a 7-(hydrogen or substituted amino)-9- (substituted glycyl) amido!-6-demethyl-6-deoxytetracycline compound |
| IL137445A0 (en) * | 1998-01-23 | 2001-07-24 | Tufts College | Pharmaceutically active compounds and methods of use thereof |
| CZ301835B6 (cs) * | 1999-09-14 | 2010-07-07 | Trustees Of Tufts College | Zpusob prípravy 7-, 9- nebo 13- substituované tetracyklinové slouceniny, reaktivní tetracyklinový chemický komplex a tetracyklinová sloucenina substituovaná v poloze 7 nebo 9 |
| US8106225B2 (en) * | 1999-09-14 | 2012-01-31 | Trustees Of Tufts College | Methods of preparing substituted tetracyclines with transition metal-based chemistries |
| US20040224927A1 (en) | 2000-06-16 | 2004-11-11 | Trustees Of Tufts College | 7-N-substituted phenyl tetracycline compounds |
| US20020132798A1 (en) | 2000-06-16 | 2002-09-19 | Nelson Mark L. | 7-phenyl-substituted tetracycline compounds |
| AU2001268475A1 (en) * | 2000-06-16 | 2002-01-02 | Trustees Of Tufts College | 7-phenyl-substituted tetracycline compounds |
| KR101027625B1 (ko) | 2000-07-07 | 2011-04-06 | 파라테크 파마슈티컬스, 인크. | 7-치환 테트라사이클린 화합물 |
| US7094806B2 (en) * | 2000-07-07 | 2006-08-22 | Trustees Of Tufts College | 7, 8 and 9-substituted tetracycline compounds |
| AU2001286388B2 (en) * | 2000-07-07 | 2005-07-14 | Paratek Pharmaceuticals, Inc. | 9-substituted minocycline compounds |
| AU2002250331A1 (en) * | 2001-03-13 | 2002-09-24 | Paratek Pharmaceuticals, Inc. | 7-pyrollyl tetracycline compounds and methods of use thereof |
| US7553828B2 (en) | 2001-03-13 | 2009-06-30 | Paratek Pharmaceuticals, Inc. | 9-aminomethyl substituted minocycline compounds |
| HUP0402047A3 (en) * | 2001-03-13 | 2012-10-29 | Paratek Pharmaceuticals | 7,9-substituted tetracycline compounds, their use and pharmaceutical compositions containing them |
| AU2002254714C1 (en) * | 2001-04-24 | 2010-01-07 | Paratek Pharmaceuticals, Inc. | Substituted tetracycline compounds for the treatment of malaria |
| US20030181371A1 (en) * | 2001-12-28 | 2003-09-25 | Angiotech Pharmaceuticals, Inc. | Compositions and methods of using collajolie |
| EP2322501B1 (en) * | 2002-01-08 | 2015-08-05 | Paratek Pharmaceuticals, Inc. | 4-dedimethylamino tetracycline compounds |
| KR101014918B1 (ko) * | 2002-03-08 | 2011-02-15 | 파라테크 파마슈티컬스, 인크. | 아미노-메틸 치환된 테트라시클린 화합물 |
| EP2481723A3 (en) | 2002-03-21 | 2013-02-13 | Paratek Pharmaceuticals, Inc. | Substituted tetracycline compounds |
| CA2531728A1 (en) | 2003-07-09 | 2005-02-03 | Paratek Pharmaceuticals, Inc. | Substituted tetracycline compounds |
| US20060287283A1 (en) * | 2003-07-09 | 2006-12-21 | Paratek Pharmaceuticals, Inc. | Prodrugs of 9-aminomethyl tetracycline compounds |
| AU2006210406C1 (en) | 2005-02-04 | 2013-03-07 | Paratek Pharmaceuticals, Inc. | 11a, 12-derivatives of tetracycline compounds |
| TR201818983T4 (tr) | 2006-12-21 | 2019-01-21 | Paratek Pharm Innc | İnflamatuvar Cilt Bozukluklarının Tedavisine Yönelik Olarak Sübstitüe Edilmiş Tetrasiklin Bileşikleri |
| IL302749A (en) | 2006-12-21 | 2023-07-01 | Paratek Pharm Innc | A tetracycline compound, a pharmaceutical preparation containing the tetracycline compound, and the tetracycline compound or the pharmaceutical preparation for the treatment of the tetracycline-responsive condition |
| EP2144614A1 (en) | 2007-04-12 | 2010-01-20 | Paratek Pharmaceuticals, Inc. | Methods for treating spinal muscular atrophy using tetracycline compounds |
| MX2010009693A (es) | 2008-03-05 | 2010-12-20 | Paratek Pharm Innc | Compuestos de monociclina y metodos de uso de la misma. |
| TW202216656A (zh) * | 2008-05-19 | 2022-05-01 | 美商Prtk Spv2公司 | 四環素化合物之甲苯磺酸鹽及同素異形體 |
| BR112019008897A2 (pt) | 2016-11-01 | 2019-08-13 | Paratek Pharm Innc | método para tratar pneumonia bacteriana adquirida na comunidade. |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2895993A (en) * | 1957-05-16 | 1959-07-21 | Pfizer & Co C | Alkyl substituted anhydrotetracycline compounds and process of preparing the same |
| US2997471A (en) * | 1958-08-18 | 1961-08-22 | Bristol Myers Co | Tetracycline derivatives |
| US3029284A (en) * | 1960-09-14 | 1962-04-10 | Pfizer & Co C | Nu-dealkylation of carboxamido-nu-alkyltetracycline and its analogs |
| US3239499A (en) * | 1961-05-19 | 1966-03-08 | Pfizer & Co C | Tetracycline derivative |
| US3165551A (en) * | 1961-06-26 | 1965-01-12 | Pfizer & Co C | New antibacterial agents |
| US3148212A (en) * | 1961-12-22 | 1964-09-08 | American Cyanamid Co | Reductive alkylation process |
| USRE26253E (en) * | 1963-05-17 | 1967-08-15 | And z-alkylamino-g-deoxytetracycline | |
| US3388162A (en) * | 1966-03-14 | 1968-06-11 | American Cyanamid Co | 7-and/or 9-nitro or amino tetracyclines |
| US3403179A (en) * | 1967-01-10 | 1968-09-24 | American Cyanamid Co | Novel 7-(1, 2-bis-substituted-hydrazino)-tetracyclines and methods of preparing same |
| US3483251A (en) * | 1967-03-03 | 1969-12-09 | American Cyanamid Co | Reductive alkylation process |
| US3373196A (en) * | 1967-03-21 | 1968-03-12 | American Cyanamid Co | 7-and/or 9-(lower alkyl) amino-5a, 6-anhydrotetracyclines |
-
1973
- 1973-09-13 NL NL7312648.A patent/NL158172B/xx unknown
- 1973-09-13 CA CA181,034A patent/CA999855A/en not_active Expired
- 1973-09-14 FR FR7333067A patent/FR2208885B1/fr not_active Expired
- 1973-09-14 ZA ZA737317A patent/ZA737317B/xx unknown
- 1973-09-14 IE IE1645/73A patent/IE38820B1/xx unknown
- 1973-09-14 JP JP48104458A patent/JPS5741458B2/ja not_active Expired
- 1973-09-15 DE DE2346535A patent/DE2346535C3/de not_active Expired
- 1973-09-17 AT AT799673A patent/AT328613B/de not_active IP Right Cessation
- 1973-09-17 GB GB4356473A patent/GB1413347A/en not_active Expired
- 1973-09-17 BE BE135695A patent/BE804913A/xx unknown
- 1973-09-17 ES ES418809A patent/ES418809A1/es not_active Expired
- 1973-09-17 HU HUSO1098A patent/HU167850B/hu unknown
- 1973-09-17 US US397691A patent/US3901942A/en not_active Expired - Lifetime
- 1973-09-17 SU SU7301957942A patent/SU574145A3/ru active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2577331C2 (ru) * | 2007-02-23 | 2016-03-20 | Ховионе Сциентиа Лимитед | Кристаллическое основание миноциклина и способы его получения |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1413347A (en) | 1975-11-12 |
| JPS4969653A (enExample) | 1974-07-05 |
| FR2208885A1 (enExample) | 1974-06-28 |
| IE38820L (en) | 1974-03-18 |
| AT328613B (de) | 1976-03-25 |
| FR2208885B1 (enExample) | 1977-05-20 |
| IE38820B1 (en) | 1978-06-07 |
| CA999855A (en) | 1976-11-16 |
| ES418809A1 (es) | 1976-03-16 |
| DE2346535B2 (de) | 1980-09-11 |
| AU6033373A (en) | 1975-03-20 |
| BE804913A (fr) | 1974-03-18 |
| DE2346535A1 (de) | 1974-04-11 |
| NL7312648A (enExample) | 1974-03-20 |
| JPS5741458B2 (enExample) | 1982-09-03 |
| ATA799673A (de) | 1975-06-15 |
| HU167850B (enExample) | 1975-12-25 |
| DE2346535C3 (de) | 1981-05-21 |
| US3901942A (en) | 1975-08-26 |
| ZA737317B (en) | 1974-09-25 |
| NL158172B (nl) | 1978-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU574145A3 (ru) | Способ получени производных тетрациклина | |
| SU1077566A3 (ru) | Способ получени производных пиридоксина или их солей с кислотами | |
| US2936308A (en) | Novel reductones and methods of making them | |
| US2764590A (en) | Certain 4, 4'-disubstituted-diphenylpyridyl methanes and process | |
| SU1356960A3 (ru) | Способ получени производных пиридазина | |
| US2734904A (en) | Xcxnhxc-nh | |
| Knaak et al. | Metabolism of 2-Methyl-2-(methylthio) propionaldehyde O-(Methylcarbamoyl) oxime in Rat | |
| SU628822A3 (ru) | Способ получени хлоргидрата 4 -эпи-6 оксиадриамицина | |
| SU1264836A3 (ru) | Способ получени ( @ )4-(3,4,5-триметоксифенил)-4-оксо-2-бутеновой кислоты | |
| US2185220A (en) | Medicinal agent | |
| SU564805A3 (ru) | Способ получени производных -(3,3-дифенилпропил)пропилендиамина или их солей | |
| US3665037A (en) | 4-methylcylohexylhydroxy amine | |
| US2725399A (en) | Tertiary dialkylamino propanols | |
| US3467710A (en) | Beta-(4- or 5-phenyl-1-naphthalene) ethylamines | |
| US3886195A (en) | 1-Trifluoromethylphenyl-2-cyanoalkylamine propane | |
| US2878254A (en) | N, n'-alkylene-bis-(3-hydroxypiperidine) compounds and preparation thereof | |
| Ross | The tumour growth inhibitory activity of some sulphur mustard gas derivatives | |
| US3417100A (en) | 8,(9)-dehydro-6-thiaestrone-3-methyl ether | |
| CN115385777B (zh) | 一种基于硼氢化钠还原生成的醇的纯化方法 | |
| Holly et al. | Carcinolytic Compounds. III. 9-(1'-Glycityl)-isoalloxazines | |
| Cambanis et al. | Potential anticancer agents. V. Aromatic nitrogen mustards related to 3-[N, N-bis (2-chloroethyl) amino]-4-methylbenzoic acid | |
| CA1116631A (en) | Phenoxy alcoylamides | |
| US2538104A (en) | Glutamyl-glutamyl-glutamic esters | |
| NO137498B (no) | Mellomprodukt for fremstilling av lokalanestetisk virksomt 2-(n-n-propyl-tert.-amylamino)-2`, 6`-acetoxylidid | |
| SU486670A1 (ru) | Способ получени производных 5-окси-6-аминометилбензофурана |