SU516349A3 - Способ получени производных пиперидина - Google Patents
Способ получени производных пиперидинаInfo
- Publication number
- SU516349A3 SU516349A3 SU1867104A SU1867104A SU516349A3 SU 516349 A3 SU516349 A3 SU 516349A3 SU 1867104 A SU1867104 A SU 1867104A SU 1867104 A SU1867104 A SU 1867104A SU 516349 A3 SU516349 A3 SU 516349A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- group
- radical
- carbon atoms
- hydrogen
- symbols
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims 3
- 150000003053 piperidines Chemical class 0.000 title claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- -1 pyrrolidylpiperidyl- Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 239000002798 polar solvent Substances 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 125000001544 thienyl group Chemical group 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 15
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 13
- 239000000047 product Substances 0.000 description 12
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 239000002253 acid Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- PMTFGZGSCGRVAJ-UHFFFAOYSA-N 1-piperidin-1-ylbutan-1-ol Chemical compound CCCC(O)N1CCCCC1 PMTFGZGSCGRVAJ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- XMGMFRIEKMMMSU-UHFFFAOYSA-N phenylmethylbenzene Chemical group C=1C=CC=CC=1[C]C1=CC=CC=C1 XMGMFRIEKMMMSU-UHFFFAOYSA-N 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/14—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US221820*A US3862173A (en) | 1972-01-28 | 1972-01-28 | Olefinic 4-substituted piperidino derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU516349A3 true SU516349A3 (ru) | 1976-05-30 |
Family
ID=22829533
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1867104A SU516349A3 (ru) | 1972-01-28 | 1972-12-28 | Способ получени производных пиперидина |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US3862173A (https=) |
| JP (1) | JPS5115036B2 (https=) |
| AR (1) | AR195412A1 (https=) |
| AT (1) | AT323743B (https=) |
| AU (1) | AU467362B2 (https=) |
| BE (1) | BE794598A (https=) |
| CA (1) | CA994780A (https=) |
| CH (1) | CH582673A5 (https=) |
| CS (1) | CS177833B2 (https=) |
| DD (1) | DD103238A5 (https=) |
| DE (2) | DE2365896C3 (https=) |
| DK (1) | DK137327B (https=) |
| ES (1) | ES410732A1 (https=) |
| FR (1) | FR2181689B1 (https=) |
| GB (1) | GB1413140A (https=) |
| HU (1) | HU166479B (https=) |
| IE (1) | IE37226B1 (https=) |
| IL (1) | IL41061A (https=) |
| LU (1) | LU66914A1 (https=) |
| NL (1) | NL7300872A (https=) |
| NO (1) | NO140056C (https=) |
| PH (1) | PH9203A (https=) |
| PL (1) | PL89094B1 (https=) |
| SE (1) | SE382455B (https=) |
| SU (1) | SU516349A3 (https=) |
| YU (1) | YU36014B (https=) |
| ZA (1) | ZA728545B (https=) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4105849A (en) * | 1974-09-30 | 1978-08-08 | G. D. Searle & Co. | [(Substituted )phenyl]phenylmethyl-1-(dialkylaminoalkyl)piperidines |
| US3996214A (en) * | 1976-02-23 | 1976-12-07 | G. D. Searle & Co. | 5-(1,1-Diphenyl-4-(cyclic amino) but-2-trans-en-1-yl)-2-alkyl-1,3,4-oxadiazoles and intermediates thereto |
| EP0000896B1 (en) * | 1977-08-19 | 1982-10-13 | Sandoz Ag | Propenyl amines, processes for their production and pharmaceutical compositions containing them |
| US4254129A (en) * | 1979-04-10 | 1981-03-03 | Richardson-Merrell Inc. | Piperidine derivatives |
| US4285957A (en) * | 1979-04-10 | 1981-08-25 | Richardson-Merrell Inc. | 1-Piperidine-alkanol derivatives, pharmaceutical compositions thereof, and method of use thereof |
| US4285958A (en) * | 1979-04-10 | 1981-08-25 | Richardson-Merrell Inc. | 1-Piperidine-alkylene ketones, pharmaceutical compositions thereof and method of use thereof |
| US4254130A (en) * | 1979-04-10 | 1981-03-03 | Richardson-Merrell Inc. | Piperidine derivatives |
| US4562258A (en) * | 1982-02-04 | 1985-12-31 | Findlay John W A | 6-[3-Amino-1-(4-tolyl)prop-1E-enyl]pyridine-2-carboxylic acid derivatives having antihistaminic activity |
| US4584382A (en) * | 1983-02-01 | 1986-04-22 | Findlay John W A | Pyridyl acrylate compound |
| US4639459A (en) * | 1983-02-01 | 1987-01-27 | Burroughs Wellcome Co. | Use of trifluoromethyl compounds |
| US4564685A (en) * | 1983-03-10 | 1986-01-14 | Findlay John W A | Diphenylmethane compounds |
| US4621094A (en) * | 1983-03-10 | 1986-11-04 | Findlay John W A | Anti-histaminic pyridyl compounds |
| US4640925A (en) * | 1983-06-02 | 1987-02-03 | Warner-Lambert Company | Diphenylmethylene piperidines, compositions and use |
| JPS6020406U (ja) * | 1983-07-19 | 1985-02-13 | マツダ株式会社 | 自動車空調装置の空気吹出口の風向調整装置 |
| US4650874A (en) * | 1984-11-26 | 1987-03-17 | G. D. Searle & Co. | N-(aralkoxybenzyl)-4(benzhydryl) piperidines |
| US4810713A (en) * | 1985-12-20 | 1989-03-07 | A. H. Robins Company, Incorporated | Arylalkyl-heterocyclic amines, n-substituted by aryloxyalkyl groups used in a method for allergy treatment |
| US4912222A (en) * | 1988-06-17 | 1990-03-27 | Fisons Corporation | Antihistamines related to cyproheptadine |
| US20020007068A1 (en) | 1999-07-16 | 2002-01-17 | D'ambra Thomas E. | Piperidine derivatives and process for their production |
| EP1369409B1 (en) | 1993-06-24 | 2006-04-05 | AMR Technology, Inc. | Process for preparing compounds useful as intermediates |
| DK0705245T3 (da) | 1993-06-25 | 2003-04-14 | Merrell Pharma Inc | Nye mellemprodukter til fremstilling af antihistaminiske 4-diphenylmethyl/diphenylmethoxy-piperidinforbindelser |
| US6147216A (en) * | 1993-06-25 | 2000-11-14 | Merrell Pharmaceuticals Inc. | Intermediates useful for the preparation of antihistaminic piperidine derivatives |
| US20030045722A1 (en) * | 1994-05-18 | 2003-03-06 | Henton Daniel R. | Processes for preparing anhydrous and hydrate forms of antihistaminic piperidine derivatives, polymorphs and pseudomorphs thereof |
| EP1178041A1 (en) * | 1994-05-18 | 2002-02-06 | Aventis Pharmaceuticals Inc. | Process for preparing anhydrous and hydrate forms of antihistaminic piperidine derivatives |
| CA2198084C (en) | 1994-08-25 | 2000-03-28 | Timothy P. Burkholder | Novel substituted piperidines useful for the treatment of allergic diseases |
| US6211199B1 (en) | 1995-11-17 | 2001-04-03 | Aventis Pharmaceuticals Inc. | Substituted 4-(1H-benzimidazol-2-yl-amino)piperidines useful for the treatment of allergic diseases |
| US6423704B2 (en) | 1995-12-20 | 2002-07-23 | Aventis Pharmaceuticals Inc. | Substituted 4-(1H-benzimidazol-2-yl)[1,4]diazepanes useful for the treatment of allergic diseases |
| US6194406B1 (en) | 1995-12-20 | 2001-02-27 | Aventis Pharmaceuticals Inc. | Substituted 4-(1H-benzimidazol-2-yl)[1,4]diazepanes useful for the treatment of allergic disease |
| US6153754A (en) * | 1995-12-21 | 2000-11-28 | Albany Molecular Research, Inc. | Process for production of piperidine derivatives |
| US6201124B1 (en) * | 1995-12-21 | 2001-03-13 | Albany Molecular Research, Inc. | Process for production of piperidine derivatives |
| US5932571A (en) * | 1996-02-21 | 1999-08-03 | Hoechst Marion Roussel, Inc. | Substituted N-methyl-N-(4-(4-(1H-benzimidazol-2-yl) {1,4}diazepan-1-yl)-2-(aryl) butyl) benzamides useful for the treatment of allergic diseases |
| US5998439A (en) | 1996-02-21 | 1999-12-07 | Hoescht Marion Roussel, Inc. | Substituted N-methyl-N-(4-(piperidin-1-yl)-2-(aryl)butyl)benzamides useful for the treatment of allergic diseases |
| US5922737A (en) * | 1996-02-21 | 1999-07-13 | Hoechst Marion Roussel, Inc. | Substituted N-methyl-N-(4-(4-(1H-Benzimidazol-2-YL-amino) piperidin-1-YL)-2-(arlyl) butyl) benzamides useful for the treatment of allergic diseases |
| US6613907B2 (en) | 2000-11-08 | 2003-09-02 | Amr Technology, Inc. | Process for the production of piperidine derivatives with microorganisms |
| US7498345B2 (en) * | 2004-09-17 | 2009-03-03 | Albany Molecular Research, Inc. | Process for production of piperidine derivatives |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3141021A (en) * | 1964-07-14 | N-arylalkyl and n-arylalkenyl deriva- | ||
| NL88235C (https=) * | 1950-12-05 | |||
| US2962501A (en) * | 1956-09-19 | 1960-11-29 | Merck & Co Inc | 1-substituted propyl piperidines and processes of preparing same |
| US3043844A (en) * | 1958-05-12 | 1962-07-10 | Sterling Drug Inc | Lower-alkyl 1-[3-(monocarbocyclic-aryl)-2-propenyl]-4-phenyl-4-piperidyl ketones and their preparation |
| NL130088C (https=) * | 1960-03-14 | |||
| US3080372A (en) * | 1960-03-25 | 1963-03-05 | Res Lab Dr C Janssen | 1-aroylalkyl-4-arylpiperidine derivatives |
| US3068237A (en) * | 1961-03-17 | 1962-12-11 | Searle & Co | N-[(chloro/nitro/amino)phenylalkyl]-alpha, alpha-diphenylpipidinemethanols |
| US3073835A (en) * | 1961-07-13 | 1963-01-15 | Searle & Co | 1-acyl-alpha, alpha-diphenyl-4-piperidinemethanols |
| US3081303A (en) * | 1961-10-13 | 1963-03-12 | Searle & Co | 1-aminoalkyl-alpha, alpha-diphenylpiperidine-methanols |
| US3423406A (en) * | 1967-05-08 | 1969-01-21 | Ciba Geigy Corp | N-alkenyl-3-aralkyl-alkyleneimines |
| GB1242169A (en) * | 1969-04-09 | 1971-08-11 | Ucb Sa | Piperidine derivatives |
| GB1252315A (https=) * | 1969-06-05 | 1971-11-03 | ||
| US3806526A (en) * | 1972-01-28 | 1974-04-23 | Richardson Merrell Inc | 1-aroylalkyl-4-diphenylmethyl piperidines |
-
0
- BE BE794598D patent/BE794598A/xx unknown
-
1972
- 1972-01-28 US US221820*A patent/US3862173A/en not_active Expired - Lifetime
- 1972-12-04 ZA ZA728545A patent/ZA728545B/xx unknown
- 1972-12-05 IE IE1688/72A patent/IE37226B1/xx unknown
- 1972-12-08 PH PH14155*UA patent/PH9203A/en unknown
- 1972-12-11 AU AU49901/72A patent/AU467362B2/en not_active Expired
- 1972-12-12 IL IL41061A patent/IL41061A/en unknown
- 1972-12-15 GB GB5799772A patent/GB1413140A/en not_active Expired
- 1972-12-20 CH CH1854572A patent/CH582673A5/xx not_active IP Right Cessation
- 1972-12-27 JP JP47130137A patent/JPS5115036B2/ja not_active Expired
- 1972-12-28 SU SU1867104A patent/SU516349A3/ru active
- 1972-12-29 AT AT1115272A patent/AT323743B/de not_active IP Right Cessation
-
1973
- 1973-01-08 YU YU35/73A patent/YU36014B/xx unknown
- 1973-01-16 CA CA161,412A patent/CA994780A/en not_active Expired
- 1973-01-17 HU HURI500A patent/HU166479B/hu unknown
- 1973-01-18 ES ES410732A patent/ES410732A1/es not_active Expired
- 1973-01-22 NL NL7300872A patent/NL7300872A/xx not_active Application Discontinuation
- 1973-01-24 DE DE2365896A patent/DE2365896C3/de not_active Expired
- 1973-01-24 FR FR7302502A patent/FR2181689B1/fr not_active Expired
- 1973-01-24 DE DE2303245A patent/DE2303245C3/de not_active Expired
- 1973-01-24 SE SE7300973A patent/SE382455B/xx unknown
- 1973-01-25 DD DD168483A patent/DD103238A5/xx unknown
- 1973-01-26 NO NO325/73A patent/NO140056C/no unknown
- 1973-01-26 LU LU66914A patent/LU66914A1/xx unknown
- 1973-01-26 AR AR246315A patent/AR195412A1/es active
- 1973-01-26 CS CS629A patent/CS177833B2/cs unknown
- 1973-01-26 PL PL1973160416A patent/PL89094B1/pl unknown
- 1973-01-26 DK DK44873AA patent/DK137327B/da unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU516349A3 (ru) | Способ получени производных пиперидина | |
| SU472502A3 (ru) | Способ получени производных замещенного пиперидина | |
| SU552025A3 (ru) | Способ получени производных фенил-имидазолил-алканов | |
| SU543343A3 (ru) | Способ получени производных индола или их солей | |
| CA1193264A (en) | Pharmaceutically active (3-aminopropoxy)bibenzyl derivatives | |
| SU578002A3 (ru) | Способ получени производных бензо(в)тиофена или их солей | |
| US3818017A (en) | 1-{8 1-(2-hydroxy-3-aryloxypropyl)-4-piperidyl{9 -2-benzimidazolinones and related compounds | |
| SU464997A3 (ru) | Способ получени -арил-4замещенных пиперидино-алканольных производных | |
| SU545256A3 (ru) | Способ получени производных изохинолина или их солей | |
| SU481155A3 (ru) | Способ получени -(фурил-метил)морфинанов | |
| SU469246A3 (ru) | Способ получени 2-фурилметил/-6,7бензоморфанов | |
| US2355659A (en) | Piperidine derivatives and process for the manufacture of the same | |
| US2416258A (en) | 3-(5-ethoxy-3-indolyl)-propyl compounds | |
| JPS58219176A (ja) | 4−〔ω−(クマリン−7−イル−オキシ)−アルキル〕−ピペラジン誘導体の製法 | |
| GB2131016A (en) | Piperazine derivatives | |
| US2683145A (en) | Azacycloheptanones | |
| NO781618L (no) | Fremgangsmaate ved fremstilling av nye chromenderivater | |
| SU545262A3 (ru) | Способ получени производных 4-оксо4н-пирано-(3,2-с) хинолин-2-карбоновых кислот или их солей | |
| SU680648A3 (ru) | Способ получени производных пиперидина или их кислотноаддитивных солей | |
| US2626948A (en) | 1-alkyl-2 or 4-[(n-alkyl-n-beta-dialkyl-aminoalkyl) aminophenethyl]-piperidines and salts thereof | |
| US4238612A (en) | Process for the isomerization of derivatives of 3-vinyl-piperidine | |
| US2589943A (en) | 4-aryl-4-acyl-oxy-piperidines | |
| SU525426A3 (ru) | Способ получени производных 2-аминоэтилбензимидазола | |
| US2965641A (en) | Derivatives of 1-(2-aminoethyl)-5-alkoxy-4-pyridones | |
| SU603336A3 (ru) | Способ получени эфиров оксимов или их солей |