SK287277B6 - Deriváty imidazol-5-yl-2-anilinopyrimidínov, spôsob ich prípravy a farmaceutická kompozícia, ktorá ich obsahuje - Google Patents
Deriváty imidazol-5-yl-2-anilinopyrimidínov, spôsob ich prípravy a farmaceutická kompozícia, ktorá ich obsahuje Download PDFInfo
- Publication number
- SK287277B6 SK287277B6 SK241-2003A SK2412003A SK287277B6 SK 287277 B6 SK287277 B6 SK 287277B6 SK 2412003 A SK2412003 A SK 2412003A SK 287277 B6 SK287277 B6 SK 287277B6
- Authority
- SK
- Slovakia
- Prior art keywords
- sulfamoyl
- group
- alkyl
- carbon atoms
- pyrimidine
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 15
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 10
- 238000000034 method Methods 0.000 title abstract description 287
- 150000003839 salts Chemical class 0.000 claims abstract description 57
- 238000001727 in vivo Methods 0.000 claims abstract description 56
- 150000002148 esters Chemical class 0.000 claims abstract description 55
- 241001465754 Metazoa Species 0.000 claims abstract description 26
- 230000022131 cell cycle Effects 0.000 claims abstract description 14
- 239000003814 drug Substances 0.000 claims abstract description 13
- -1 nitro, cyano, hydroxy, amino, carboxy, carbamoyl Chemical group 0.000 claims description 448
- 150000001875 compounds Chemical class 0.000 claims description 244
- 125000004432 carbon atom Chemical group C* 0.000 claims description 207
- 125000000217 alkyl group Chemical group 0.000 claims description 191
- 229910052757 nitrogen Inorganic materials 0.000 claims description 72
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 63
- 229910052799 carbon Inorganic materials 0.000 claims description 55
- 125000000623 heterocyclic group Chemical group 0.000 claims description 45
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 42
- 229910052739 hydrogen Inorganic materials 0.000 claims description 35
- 239000001257 hydrogen Substances 0.000 claims description 34
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 31
- 229910052736 halogen Inorganic materials 0.000 claims description 27
- 150000001721 carbon Chemical group 0.000 claims description 26
- 150000002367 halogens Chemical class 0.000 claims description 26
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 26
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 26
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 23
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 20
- 125000003545 alkoxy group Chemical group 0.000 claims description 20
- 125000005843 halogen group Chemical group 0.000 claims description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 16
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 16
- 125000003342 alkenyl group Chemical group 0.000 claims description 15
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 14
- 150000002431 hydrogen Chemical class 0.000 claims description 14
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 14
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 13
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 claims description 13
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 13
- 125000002252 acyl group Chemical group 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 13
- 230000005764 inhibitory process Effects 0.000 claims description 12
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 11
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 11
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 11
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 11
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 10
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 10
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 10
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 9
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 8
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 8
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- 125000004845 (C1-C6) alkylsulfonylamino group Chemical group 0.000 claims description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 7
- 125000000304 alkynyl group Chemical group 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 239000003085 diluting agent Substances 0.000 claims description 7
- 125000006125 ethylsulfonyl group Chemical group 0.000 claims description 7
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 7
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 6
- 125000004423 acyloxy group Chemical group 0.000 claims description 5
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 5
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 5
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 5
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 claims description 4
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 4
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 4
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 4
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 3
- 125000005862 (C1-C6)alkanoyl group Chemical group 0.000 claims description 3
- KVJXNCXRESCVKS-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-methoxyethyl)benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCOC)=N1 KVJXNCXRESCVKS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 3
- 125000001589 carboacyl group Chemical group 0.000 claims description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 3
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 2
- HIDAXOGGMZCOCG-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(3-methoxypropyl)benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCCOC)=N1 HIDAXOGGMZCOCG-UHFFFAOYSA-N 0.000 claims description 2
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- BUPDQZDNTBNFFR-UHFFFAOYSA-N n-(cyclopropylmethyl)-4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC2CC2)=N1 BUPDQZDNTBNFFR-UHFFFAOYSA-N 0.000 claims description 2
- ZJDZXCYQBNODMM-UHFFFAOYSA-N n-(cyclopropylmethyl)-4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC2CC2)=N1 ZJDZXCYQBNODMM-UHFFFAOYSA-N 0.000 claims description 2
- DYOCFCUPENQNPU-UHFFFAOYSA-N n-cyclobutyl-4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NC2CCC2)=N1 DYOCFCUPENQNPU-UHFFFAOYSA-N 0.000 claims description 2
- PDPLSGKAGFEBII-UHFFFAOYSA-N n-cyclobutyl-4-[[4-(2-methyl-3-propan-2-ylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CC(C)N1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NC2CCC2)=N1 PDPLSGKAGFEBII-UHFFFAOYSA-N 0.000 claims description 2
- YUBLGYSOQYIMIG-UHFFFAOYSA-N n-cyclopropyl-4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NC2CC2)=N1 YUBLGYSOQYIMIG-UHFFFAOYSA-N 0.000 claims description 2
- SGMLRJXBDRNXBJ-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2,2,2-trifluoroethyl)benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC(F)(F)F)=N1 SGMLRJXBDRNXBJ-UHFFFAOYSA-N 0.000 claims 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- MDUHIEIIDZPVRB-UHFFFAOYSA-N n-cyclopropyl-4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NC2CC2)=N1 MDUHIEIIDZPVRB-UHFFFAOYSA-N 0.000 claims 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 15
- 230000008569 process Effects 0.000 abstract description 14
- 230000002401 inhibitory effect Effects 0.000 abstract description 13
- 230000035755 proliferation Effects 0.000 abstract description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 164
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 153
- 238000005481 NMR spectroscopy Methods 0.000 description 92
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 90
- 239000000203 mixture Substances 0.000 description 86
- 239000000243 solution Substances 0.000 description 85
- 239000007787 solid Substances 0.000 description 71
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 55
- 238000001704 evaporation Methods 0.000 description 51
- 230000008020 evaporation Effects 0.000 description 51
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 47
- 235000019439 ethyl acetate Nutrition 0.000 description 45
- 239000011541 reaction mixture Substances 0.000 description 37
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 35
- 239000002904 solvent Substances 0.000 description 35
- 239000003039 volatile agent Substances 0.000 description 34
- 238000003818 flash chromatography Methods 0.000 description 31
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 29
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 28
- 238000001914 filtration Methods 0.000 description 28
- 206010028980 Neoplasm Diseases 0.000 description 27
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 27
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 27
- 238000011282 treatment Methods 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- 210000004027 cell Anatomy 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 26
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 24
- 239000000741 silica gel Substances 0.000 description 24
- 229910002027 silica gel Inorganic materials 0.000 description 24
- 239000007858 starting material Substances 0.000 description 23
- 239000012267 brine Substances 0.000 description 21
- 229920006395 saturated elastomer Polymers 0.000 description 21
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 21
- 108091007914 CDKs Proteins 0.000 description 19
- 108010024986 Cyclin-Dependent Kinase 2 Proteins 0.000 description 19
- 102100036239 Cyclin-dependent kinase 2 Human genes 0.000 description 19
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 19
- 235000017557 sodium bicarbonate Nutrition 0.000 description 17
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 17
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 16
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 16
- 241000282414 Homo sapiens Species 0.000 description 15
- 239000000284 extract Substances 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 14
- 238000004440 column chromatography Methods 0.000 description 14
- 230000004663 cell proliferation Effects 0.000 description 13
- 239000008177 pharmaceutical agent Substances 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 12
- 239000003112 inhibitor Substances 0.000 description 12
- 125000006239 protecting group Chemical group 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 150000001412 amines Chemical class 0.000 description 11
- 201000011510 cancer Diseases 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- 239000000872 buffer Substances 0.000 description 10
- 201000010099 disease Diseases 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N phenylmethanesulfonyl fluoride Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 102000003909 Cyclin E Human genes 0.000 description 9
- 108090000257 Cyclin E Proteins 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 9
- 235000011114 ammonium hydroxide Nutrition 0.000 description 9
- 238000010898 silica gel chromatography Methods 0.000 description 9
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- GVAHJJWRUPHVGW-UHFFFAOYSA-N 3-(dimethylamino)-1-(2,3-dimethylimidazol-4-yl)prop-2-en-1-one Chemical compound CN(C)C=CC(=O)C1=CN=C(C)N1C GVAHJJWRUPHVGW-UHFFFAOYSA-N 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 7
- 206010003210 Arteriosclerosis Diseases 0.000 description 7
- 208000037260 Atherosclerotic Plaque Diseases 0.000 description 7
- 208000020084 Bone disease Diseases 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- 108010025464 Cyclin-Dependent Kinase 4 Proteins 0.000 description 7
- 108010025468 Cyclin-Dependent Kinase 6 Proteins 0.000 description 7
- 102100036252 Cyclin-dependent kinase 4 Human genes 0.000 description 7
- 102100026804 Cyclin-dependent kinase 6 Human genes 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- 208000032839 leukemia Diseases 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- 102000004169 proteins and genes Human genes 0.000 description 7
- 238000010561 standard procedure Methods 0.000 description 7
- 229910052717 sulfur Inorganic materials 0.000 description 7
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 102000016736 Cyclin Human genes 0.000 description 6
- 108050006400 Cyclin Proteins 0.000 description 6
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 6
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 125000004429 atom Chemical group 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 6
- 238000000605 extraction Methods 0.000 description 6
- 230000003211 malignant effect Effects 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 230000003658 preventing hair loss Effects 0.000 description 6
- 150000003230 pyrimidines Chemical class 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- QAVCQCQQTYJKSO-UHFFFAOYSA-N 2-chloro-11-cyclopropyl-4-methyl-5h-dipyrido[2,3-b:2',3'-f][1,4]diazepin-6-one Chemical compound C12=NC=CC=C2C(=O)NC=2C(C)=CC(Cl)=NC=2N1C1CC1 QAVCQCQQTYJKSO-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 5
- 201000004681 Psoriasis Diseases 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 230000001154 acute effect Effects 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- XDSYAIICRRZSJX-UHFFFAOYSA-N carbamimidoyl(phenyl)azanium;hydrogen carbonate Chemical compound OC(O)=O.NC(N)=NC1=CC=CC=C1 XDSYAIICRRZSJX-UHFFFAOYSA-N 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000001684 chronic effect Effects 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 230000000893 fibroproliferative effect Effects 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 125000001153 fluoro group Chemical group F* 0.000 description 5
- 201000011066 hemangioma Diseases 0.000 description 5
- 208000017169 kidney disease Diseases 0.000 description 5
- 230000036210 malignancy Effects 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- DWLMIHRZURMFAQ-UHFFFAOYSA-N 2-(3-chlorophenyl)guanidine Chemical compound NC(N)=NC1=CC=CC(Cl)=C1 DWLMIHRZURMFAQ-UHFFFAOYSA-N 0.000 description 4
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 4
- XKPFKMJJVRQAPO-UHFFFAOYSA-N 4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-amine Chemical compound CN1C(C)=NC=C1C1=CC=NC(N)=N1 XKPFKMJJVRQAPO-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- 201000004384 Alopecia Diseases 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- 206010051113 Arterial restenosis Diseases 0.000 description 4
- 201000001320 Atherosclerosis Diseases 0.000 description 4
- 208000023275 Autoimmune disease Diseases 0.000 description 4
- 229940123587 Cell cycle inhibitor Drugs 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- 239000007995 HEPES buffer Substances 0.000 description 4
- 208000007766 Kaposi sarcoma Diseases 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- 239000002841 Lewis acid Substances 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 108091000080 Phosphotransferase Proteins 0.000 description 4
- 230000018199 S phase Effects 0.000 description 4
- 241000700605 Viruses Species 0.000 description 4
- 208000038016 acute inflammation Diseases 0.000 description 4
- 230000006022 acute inflammation Effects 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 208000037976 chronic inflammation Diseases 0.000 description 4
- 230000006020 chronic inflammation Effects 0.000 description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- 208000030533 eye disease Diseases 0.000 description 4
- 230000003676 hair loss Effects 0.000 description 4
- 208000024963 hair loss Diseases 0.000 description 4
- 238000011534 incubation Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 4
- 125000000842 isoxazolyl group Chemical group 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 150000007517 lewis acids Chemical class 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- REPVNSJSTLRQEQ-UHFFFAOYSA-N n,n-dimethylacetamide;n,n-dimethylformamide Chemical compound CN(C)C=O.CN(C)C(C)=O REPVNSJSTLRQEQ-UHFFFAOYSA-N 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 102000020233 phosphotransferase Human genes 0.000 description 4
- 210000002307 prostate Anatomy 0.000 description 4
- 125000004076 pyridyl group Chemical group 0.000 description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 125000004434 sulfur atom Chemical group 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- IZBKLEBLCPWCQI-UHFFFAOYSA-N 3-(dimethylamino)-1-(2-methyl-1h-imidazol-5-yl)prop-2-en-1-one Chemical compound CN(C)C=CC(=O)C1=CN=C(C)N1 IZBKLEBLCPWCQI-UHFFFAOYSA-N 0.000 description 3
- DAUUUCULWCEHGZ-UHFFFAOYSA-N 4-(3-ethyl-2-methylimidazol-4-yl)-n-phenylpyrimidin-2-amine Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC=CC=2)=N1 DAUUUCULWCEHGZ-UHFFFAOYSA-N 0.000 description 3
- UAKCGBGWTHBQPH-UHFFFAOYSA-N 4-(3-methylimidazol-4-yl)-n-phenylpyrimidin-2-amine Chemical compound CN1C=NC=C1C1=CC=NC(NC=2C=CC=CC=2)=N1 UAKCGBGWTHBQPH-UHFFFAOYSA-N 0.000 description 3
- FTBCOQFMQSTCQQ-UHFFFAOYSA-N 4-bromobenzenethiol Chemical compound SC1=CC=C(Br)C=C1 FTBCOQFMQSTCQQ-UHFFFAOYSA-N 0.000 description 3
- MRCSGMSWDXJCPY-UHFFFAOYSA-N 4-iodo-n-(2-methoxyethyl)benzenesulfonamide Chemical compound COCCNS(=O)(=O)C1=CC=C(I)C=C1 MRCSGMSWDXJCPY-UHFFFAOYSA-N 0.000 description 3
- POXFXTSTVWDWIR-UHFFFAOYSA-N 4-iodobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(I)C=C1 POXFXTSTVWDWIR-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 108010039627 Aprotinin Proteins 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- 229920002785 Croscarmellose sodium Polymers 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 241000588724 Escherichia coli Species 0.000 description 3
- GDBQQVLCIARPGH-UHFFFAOYSA-N Leupeptin Natural products CC(C)CC(NC(C)=O)C(=O)NC(CC(C)C)C(=O)NC(C=O)CCCN=C(N)N GDBQQVLCIARPGH-UHFFFAOYSA-N 0.000 description 3
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- 201000000582 Retinoblastoma Diseases 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 229960004405 aprotinin Drugs 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 238000007080 aromatic substitution reaction Methods 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 210000001072 colon Anatomy 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 229960001681 croscarmellose sodium Drugs 0.000 description 3
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 description 3
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 229940088598 enzyme Drugs 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- RWSXRVCMGQZWBV-WDSKDSINSA-N glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 239000003102 growth factor Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- ZPNFWUPYTFPOJU-LPYSRVMUSA-N iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- GDBQQVLCIARPGH-ULQDDVLXSA-N leupeptin Chemical compound CC(C)C[C@H](NC(C)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)CCCN=C(N)N GDBQQVLCIARPGH-ULQDDVLXSA-N 0.000 description 3
- 108010052968 leupeptin Proteins 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- FYGTYCKLWZVDDV-UHFFFAOYSA-N n-(3-chlorophenyl)-4-(1-tritylimidazol-4-yl)pyrimidin-2-amine Chemical compound ClC1=CC=CC(NC=2N=C(C=CN=2)C=2N=CN(C=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 FYGTYCKLWZVDDV-UHFFFAOYSA-N 0.000 description 3
- 230000017095 negative regulation of cell growth Effects 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 125000003373 pyrazinyl group Chemical group 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 230000002207 retinal effect Effects 0.000 description 3
- 238000002821 scintillation proximity assay Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000001984 thiazolidinyl group Chemical group 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- 230000002792 vascular Effects 0.000 description 3
- 239000008215 water for injection Substances 0.000 description 3
- FUOSTELFLYZQCW-UHFFFAOYSA-N 1,2-oxazol-3-one Chemical compound OC=1C=CON=1 FUOSTELFLYZQCW-UHFFFAOYSA-N 0.000 description 2
- IBXMKLPFLZYRQZ-UHFFFAOYSA-N 1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1C=CC(=O)C=CC1=CC=CC=C1 IBXMKLPFLZYRQZ-UHFFFAOYSA-N 0.000 description 2
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 2
- AMCBMIZVYBLKQA-UHFFFAOYSA-N 1-(1-tritylimidazol-4-yl)ethanol Chemical compound C1=NC(C(O)C)=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 AMCBMIZVYBLKQA-UHFFFAOYSA-N 0.000 description 2
- CXHBDLBUHRTUCX-UHFFFAOYSA-N 1-(1-tritylimidazol-4-yl)ethanone Chemical compound C1=NC(C(=O)C)=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CXHBDLBUHRTUCX-UHFFFAOYSA-N 0.000 description 2
- YISBSCKPBDXRLO-UHFFFAOYSA-N 1-(2-methyl-1-tritylimidazol-4-yl)ethanone Chemical compound CC1=NC(C(=O)C)=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 YISBSCKPBDXRLO-UHFFFAOYSA-N 0.000 description 2
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- MNKMNMXRPSSOIY-UHFFFAOYSA-N 2-[2-[5-[2-(3-chloroanilino)pyrimidin-4-yl]imidazol-1-yl]ethyl]isoindole-1,3-dione Chemical compound ClC1=CC=CC(NC=2N=C(C=CN=2)C=2N(C=NC=2)CCN2C(C3=CC=CC=C3C2=O)=O)=C1 MNKMNMXRPSSOIY-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 2
- ZPVPPQGNYLYSRQ-UHFFFAOYSA-N 3-(4-bromophenyl)sulfanyl-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCSC1=CC=C(Br)C=C1 ZPVPPQGNYLYSRQ-UHFFFAOYSA-N 0.000 description 2
- PMTVSTZYSDEWJT-UHFFFAOYSA-N 3-(dimethylamino)-1-(3-ethyl-2-methylimidazol-4-yl)prop-2-en-1-one Chemical compound CCN1C(C)=NC=C1C(=O)C=CN(C)C PMTVSTZYSDEWJT-UHFFFAOYSA-N 0.000 description 2
- FAXDZWQIWUSWJH-UHFFFAOYSA-N 3-methoxypropan-1-amine Chemical compound COCCCN FAXDZWQIWUSWJH-UHFFFAOYSA-N 0.000 description 2
- QMEHPLCOBIOVAP-UHFFFAOYSA-N 4-(2,3-dimethylimidazol-4-yl)-n-phenylpyrimidin-2-amine Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC=CC=2)=N1 QMEHPLCOBIOVAP-UHFFFAOYSA-N 0.000 description 2
- MUIGUCQQCWKTFW-UHFFFAOYSA-N 4-[3-(2-aminoethyl)imidazol-4-yl]-n-(3-chlorophenyl)pyrimidin-2-amine Chemical compound NCCN1C=NC=C1C1=CC=NC(NC=2C=C(Cl)C=CC=2)=N1 MUIGUCQQCWKTFW-UHFFFAOYSA-N 0.000 description 2
- MDQRGAHTHCBASJ-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonyl fluoride Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(F)(=O)=O)=N1 MDQRGAHTHCBASJ-UHFFFAOYSA-N 0.000 description 2
- ICIBYHFYXSNHTA-UHFFFAOYSA-N 4-[[4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(N)(=O)=O)=N1 ICIBYHFYXSNHTA-UHFFFAOYSA-N 0.000 description 2
- OISQSDKFWKJEBA-UHFFFAOYSA-N 4-amino-n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(N)C=C1 OISQSDKFWKJEBA-UHFFFAOYSA-N 0.000 description 2
- BPUKPIBWYZWYQV-UHFFFAOYSA-N 4-aminobenzenesulfonyl fluoride Chemical compound NC1=CC=C(S(F)(=O)=O)C=C1 BPUKPIBWYZWYQV-UHFFFAOYSA-N 0.000 description 2
- XFAREXHITCIFFQ-UHFFFAOYSA-N 4-n-[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]benzene-1,4-diamine Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(N)=CC=2)=N1 XFAREXHITCIFFQ-UHFFFAOYSA-N 0.000 description 2
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- 208000026310 Breast neoplasm Diseases 0.000 description 2
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 2
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 2
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 108010024636 Glutathione Proteins 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 2
- 208000022873 Ocular disease Diseases 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- 229930012538 Paclitaxel Natural products 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 206010039491 Sarcoma Diseases 0.000 description 2
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 2
- MUMGGOZAMZWBJJ-DYKIIFRCSA-N Testostosterone Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 MUMGGOZAMZWBJJ-DYKIIFRCSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229930013930 alkaloid Natural products 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- XYXNTHIYBIDHGM-UHFFFAOYSA-N ammonium thiosulfate Chemical compound [NH4+].[NH4+].[O-]S([O-])(=O)=S XYXNTHIYBIDHGM-UHFFFAOYSA-N 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000001093 anti-cancer Effects 0.000 description 2
- 230000000340 anti-metabolite Effects 0.000 description 2
- 229940100197 antimetabolite Drugs 0.000 description 2
- 239000002256 antimetabolite Substances 0.000 description 2
- 239000002246 antineoplastic agent Substances 0.000 description 2
- 208000011775 arteriosclerosis disease Diseases 0.000 description 2
- 125000005101 aryl methoxy carbonyl group Chemical group 0.000 description 2
- 125000005002 aryl methyl group Chemical group 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 210000000481 breast Anatomy 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 101150073031 cdk2 gene Proteins 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 238000002512 chemotherapy Methods 0.000 description 2
- 208000029742 colonic neoplasm Diseases 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 229960004397 cyclophosphamide Drugs 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 230000004069 differentiation Effects 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 229960004679 doxorubicin Drugs 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 2
- 229960005420 etoposide Drugs 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 229960003180 glutathione Drugs 0.000 description 2
- 229960001101 ifosfamide Drugs 0.000 description 2
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- 239000006166 lysate Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229960000485 methotrexate Drugs 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229960004857 mitomycin Drugs 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- AJZLRGRVWJKCMV-UHFFFAOYSA-N n-[4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 AJZLRGRVWJKCMV-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229960001592 paclitaxel Drugs 0.000 description 2
- 210000000496 pancreas Anatomy 0.000 description 2
- 229950000964 pepstatin Drugs 0.000 description 2
- 108010091212 pepstatin Proteins 0.000 description 2
- FAXGPCHRFPCXOO-LXTPJMTPSA-N pepstatin A Chemical compound OC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)CC(C)C FAXGPCHRFPCXOO-LXTPJMTPSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 230000002062 proliferating effect Effects 0.000 description 2
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 2
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 230000000306 recurrent effect Effects 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 229910000162 sodium phosphate Inorganic materials 0.000 description 2
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 2
- 239000002594 sorbent Substances 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- DBQNXSQYHOYDCO-UHFFFAOYSA-N tert-butyl n-[2-(1,2-oxazol-3-yloxy)ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCOC=1C=CON=1 DBQNXSQYHOYDCO-UHFFFAOYSA-N 0.000 description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000003396 thiol group Chemical class [H]S* 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- 229960000303 topotecan Drugs 0.000 description 2
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- IHIXIJGXTJIKRB-UHFFFAOYSA-N trisodium vanadate Chemical compound [Na+].[Na+].[Na+].[O-][V]([O-])([O-])=O IHIXIJGXTJIKRB-UHFFFAOYSA-N 0.000 description 2
- OVPWEQROJNJHAG-UHFFFAOYSA-N (1-naphthalen-1-ylnaphthalen-2-yl)-diphenylphosphane Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1)C1=CC=CC=C1 OVPWEQROJNJHAG-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 description 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 description 1
- LKJPYSCBVHEWIU-KRWDZBQOSA-N (R)-bicalutamide Chemical compound C([C@@](O)(C)C(=O)NC=1C=C(C(C#N)=CC=1)C(F)(F)F)S(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-KRWDZBQOSA-N 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- GIWQSPITLQVMSG-UHFFFAOYSA-N 1,2-dimethylimidazole Chemical compound CC1=NC=CN1C GIWQSPITLQVMSG-UHFFFAOYSA-N 0.000 description 1
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- MZJZNADJWQEIIG-UHFFFAOYSA-N 1-(2-methyl-1h-imidazol-5-yl)ethanone Chemical compound CC(=O)C1=CN=C(C)N1 MZJZNADJWQEIIG-UHFFFAOYSA-N 0.000 description 1
- JBHNCCUZQLCDFX-UHFFFAOYSA-N 1-(2-methyl-3-propan-2-ylimidazol-4-yl)ethanone Chemical compound CC(C)N1C(C)=NC=C1C(C)=O JBHNCCUZQLCDFX-UHFFFAOYSA-N 0.000 description 1
- HJORCZCMNWLHMB-UHFFFAOYSA-N 1-(3-aminopropyl)pyrrolidin-2-one Chemical compound NCCCN1CCCC1=O HJORCZCMNWLHMB-UHFFFAOYSA-N 0.000 description 1
- UAMRPCWGGNWUEF-UHFFFAOYSA-N 1-(3-benzyl-2-methylimidazol-4-yl)-3-(dimethylamino)prop-2-en-1-one Chemical compound CN(C)C=CC(=O)C1=CN=C(C)N1CC1=CC=CC=C1 UAMRPCWGGNWUEF-UHFFFAOYSA-N 0.000 description 1
- BFQRFDJWRSRVRM-UHFFFAOYSA-N 1-(3-benzyl-2-methylimidazol-4-yl)ethanol Chemical compound CC(O)C1=CN=C(C)N1CC1=CC=CC=C1 BFQRFDJWRSRVRM-UHFFFAOYSA-N 0.000 description 1
- JTYOMGIKRQBZIE-UHFFFAOYSA-N 1-(3-benzyl-2-methylimidazol-4-yl)ethanone Chemical compound CC(=O)C1=CN=C(C)N1CC1=CC=CC=C1 JTYOMGIKRQBZIE-UHFFFAOYSA-N 0.000 description 1
- LCTKNNKPTHHMRU-UHFFFAOYSA-N 1-(3-but-3-enyl-2-methylimidazol-4-yl)-3-(dimethylamino)prop-2-en-1-one Chemical compound CN(C)C=CC(=O)C1=CN=C(C)N1CCC=C LCTKNNKPTHHMRU-UHFFFAOYSA-N 0.000 description 1
- DARZKTBWZJGBSD-UHFFFAOYSA-N 1-(3-methylimidazol-4-yl)ethanone Chemical compound CC(=O)C1=CN=CN1C DARZKTBWZJGBSD-UHFFFAOYSA-N 0.000 description 1
- HURJACVTWYOLKG-UHFFFAOYSA-N 1-(5-ethyl-2-methyl-1H-imidazol-4-yl)ethanone Chemical compound CCC=1NC(C)=NC=1C(C)=O HURJACVTWYOLKG-UHFFFAOYSA-N 0.000 description 1
- CMANKEARZXIIGT-UHFFFAOYSA-N 1-[2-(methoxymethyl)-1h-imidazol-5-yl]ethanone Chemical compound COCC1=NC=C(C(C)=O)N1 CMANKEARZXIIGT-UHFFFAOYSA-N 0.000 description 1
- WOVPBIZADKZIOS-UHFFFAOYSA-N 1-[2-(trifluoromethyl)-1h-imidazol-5-yl]ethanone Chemical compound CC(=O)C1=CN=C(C(F)(F)F)N1 WOVPBIZADKZIOS-UHFFFAOYSA-N 0.000 description 1
- GPPHOHWSCRJMCY-UHFFFAOYSA-N 1-[2-methyl-3-(2,2,2-trifluoroethyl)imidazol-4-yl]ethanone Chemical compound CC(=O)C1=CN=C(C)N1CC(F)(F)F GPPHOHWSCRJMCY-UHFFFAOYSA-N 0.000 description 1
- BYEDDTKLQQQEQP-UHFFFAOYSA-N 1-[3-(2-methoxyethyl)-2-methylimidazol-4-yl]ethanone Chemical compound COCCN1C(C)=NC=C1C(C)=O BYEDDTKLQQQEQP-UHFFFAOYSA-N 0.000 description 1
- UELKIIFZVNFDDY-UHFFFAOYSA-N 1-bromo-4-(3,3,3-trifluoropropylsulfanyl)benzene Chemical compound FC(F)(F)CCSC1=CC=C(Br)C=C1 UELKIIFZVNFDDY-UHFFFAOYSA-N 0.000 description 1
- NVZZKSUKAQCUDG-UHFFFAOYSA-N 1-bromo-4-(3,3,3-trifluoropropylsulfonyl)benzene Chemical compound FC(F)(F)CCS(=O)(=O)C1=CC=C(Br)C=C1 NVZZKSUKAQCUDG-UHFFFAOYSA-N 0.000 description 1
- YEUYZNNBXLMFCW-UHFFFAOYSA-N 1-bromo-4-methylsulfanylbenzene Chemical compound CSC1=CC=C(Br)C=C1 YEUYZNNBXLMFCW-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- YGDWUQFZMXWDKE-UHFFFAOYSA-N 1-oxido-1,3-thiazole Chemical group [O-]S1=CN=C=C1 YGDWUQFZMXWDKE-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- UHORBCRVJMCUMW-UHFFFAOYSA-N 2,2,2-trifluoro-n-(5-methyl-1,2-oxazol-4-yl)acetamide Chemical compound CC=1ON=CC=1NC(=O)C(F)(F)F UHORBCRVJMCUMW-UHFFFAOYSA-N 0.000 description 1
- OAQQHAGNIVIPNV-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethoxyperoxymethyl 2,2-dimethylpropanoate Chemical compound CC(C(=O)OCOOOCOC(C(C)(C)C)=O)(C)C OAQQHAGNIVIPNV-UHFFFAOYSA-N 0.000 description 1
- DRZCZBODVWOOHD-UHFFFAOYSA-N 2-(1,2,5-thiadiazol-3-yloxy)ethanamine;hydrochloride Chemical compound Cl.NCCOC=1C=NSN=1 DRZCZBODVWOOHD-UHFFFAOYSA-N 0.000 description 1
- TWRUAOUDLJOMMI-UHFFFAOYSA-N 2-(1,2-oxazol-3-yloxy)ethanamine;hydrochloride Chemical compound Cl.NCCOC=1C=CON=1 TWRUAOUDLJOMMI-UHFFFAOYSA-N 0.000 description 1
- HIXUMZQBGZEFIF-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)ethyl trifluoromethanesulfonate Chemical compound C1=CC=C2C(=O)N(CCOS(=O)(=O)C(F)(F)F)C(=O)C2=C1 HIXUMZQBGZEFIF-UHFFFAOYSA-N 0.000 description 1
- UZPIRAFSNIRTDY-UHFFFAOYSA-N 2-(2-methyl-1-tritylimidazol-4-yl)ethanol Chemical compound CC1=NC(CCO)=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 UZPIRAFSNIRTDY-UHFFFAOYSA-N 0.000 description 1
- GPMQSZDCZSXGCH-UHFFFAOYSA-N 2-(2-methyl-1h-imidazol-5-yl)ethanol Chemical compound CC1=NC(CCO)=CN1 GPMQSZDCZSXGCH-UHFFFAOYSA-N 0.000 description 1
- WOXFMYVTSLAQMO-UHFFFAOYSA-N 2-Pyridinemethanamine Chemical compound NCC1=CC=CC=N1 WOXFMYVTSLAQMO-UHFFFAOYSA-N 0.000 description 1
- AVNSWJDOOOMINV-UHFFFAOYSA-N 2-[[4-[[4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]phenyl]sulfonylamino]acetamide Chemical compound CN1C=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC(N)=O)=N1 AVNSWJDOOOMINV-UHFFFAOYSA-N 0.000 description 1
- AXAVXPMQTGXXJZ-UHFFFAOYSA-N 2-aminoacetic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol Chemical compound NCC(O)=O.OCC(N)(CO)CO AXAVXPMQTGXXJZ-UHFFFAOYSA-N 0.000 description 1
- LUNMJRJMSXZSLC-UHFFFAOYSA-N 2-cyclopropylethanol Chemical compound OCCC1CC1 LUNMJRJMSXZSLC-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- ZPNWNLNPDRYULE-UHFFFAOYSA-N 2-iodobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1I ZPNWNLNPDRYULE-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- XCVDRKJGVQKLMR-UHFFFAOYSA-N 2-methoxyethyl trifluoromethanesulfonate Chemical compound COCCOS(=O)(=O)C(F)(F)F XCVDRKJGVQKLMR-UHFFFAOYSA-N 0.000 description 1
- ZWULFIBGPXWGFG-UHFFFAOYSA-N 2-methyl-1h-imidazole-5-carbaldehyde Chemical compound CC1=NC=C(C=O)N1 ZWULFIBGPXWGFG-UHFFFAOYSA-N 0.000 description 1
- SVTBMSDMJJWYQN-UHFFFAOYSA-N 2-methylpentane-2,4-diol Chemical compound CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- NDMPLJNOPCLANR-UHFFFAOYSA-N 3,4-dihydroxy-15-(4-hydroxy-18-methoxycarbonyl-5,18-seco-ibogamin-18-yl)-16-methoxy-1-methyl-6,7-didehydro-aspidospermidine-3-carboxylic acid methyl ester Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 NDMPLJNOPCLANR-UHFFFAOYSA-N 0.000 description 1
- INSUSOZBMWJGDG-UHFFFAOYSA-N 3,5-dimethyl-1,2-oxazol-4-amine Chemical compound CC1=NOC(C)=C1N INSUSOZBMWJGDG-UHFFFAOYSA-N 0.000 description 1
- YGRACZUPGBWHJA-UHFFFAOYSA-N 3-(4-bromophenyl)sulfonyl-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCS(=O)(=O)C1=CC=C(Br)C=C1 YGRACZUPGBWHJA-UHFFFAOYSA-N 0.000 description 1
- FXLUXSTWBTZSKD-UHFFFAOYSA-N 3-(dimethylamino)-1-(1-tritylimidazol-4-yl)prop-2-en-1-one Chemical compound C1=NC(C(=O)C=CN(C)C)=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 FXLUXSTWBTZSKD-UHFFFAOYSA-N 0.000 description 1
- FKVMOGIPTRWLOZ-UHFFFAOYSA-N 3-(dimethylamino)-1-(2,3,5-trimethylimidazol-4-yl)prop-2-en-1-one Chemical compound CN(C)C=CC(=O)C1=C(C)N=C(C)N1C FKVMOGIPTRWLOZ-UHFFFAOYSA-N 0.000 description 1
- RMXXGLKUDDNLIC-UHFFFAOYSA-N 3-(dimethylamino)-1-(3-methylimidazol-4-yl)prop-2-en-1-one Chemical compound CN(C)C=CC(=O)C1=CN=CN1C RMXXGLKUDDNLIC-UHFFFAOYSA-N 0.000 description 1
- LLKJMSYHLYWBNI-UHFFFAOYSA-N 3-(dimethylamino)-1-[2-methyl-3-(2,2,2-trifluoroethyl)imidazol-4-yl]prop-2-en-1-one Chemical compound CN(C)C=CC(=O)C1=CN=C(C)N1CC(F)(F)F LLKJMSYHLYWBNI-UHFFFAOYSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- OYWXYRRKTGPYJB-UHFFFAOYSA-N 3-benzyl-2-methylimidazole-4-carbaldehyde Chemical compound CC1=NC=C(C=O)N1CC1=CC=CC=C1 OYWXYRRKTGPYJB-UHFFFAOYSA-N 0.000 description 1
- SAUGMJLWYLQPEM-UHFFFAOYSA-N 3-bromo-1,1,1-trifluoropropane Chemical compound FC(F)(F)CCBr SAUGMJLWYLQPEM-UHFFFAOYSA-N 0.000 description 1
- LJQNMDZRCXJETK-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine;hydron;chloride Chemical compound Cl.CN(C)CCCCl LJQNMDZRCXJETK-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- JDFDHBSESGTDAL-UHFFFAOYSA-N 3-methoxypropan-1-ol Chemical compound COCCCO JDFDHBSESGTDAL-UHFFFAOYSA-N 0.000 description 1
- FRQCAZXFZRBMRX-UHFFFAOYSA-N 3-methoxypropyl methanesulfonate Chemical compound COCCCOS(C)(=O)=O FRQCAZXFZRBMRX-UHFFFAOYSA-N 0.000 description 1
- BNYKZFOZWZMEJD-UHFFFAOYSA-N 3-methylimidazole-4-carbaldehyde Chemical compound CN1C=NC=C1C=O BNYKZFOZWZMEJD-UHFFFAOYSA-N 0.000 description 1
- UIKUBYKUYUSRSM-UHFFFAOYSA-N 3-morpholinopropylamine Chemical compound NCCCN1CCOCC1 UIKUBYKUYUSRSM-UHFFFAOYSA-N 0.000 description 1
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 1
- MEUUZKKFBGNBSX-UHFFFAOYSA-N 4-(2,3-dimethylimidazol-4-yl)-n-(4-methylsulfonylphenyl)pyrimidin-2-amine Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(C)(=O)=O)=N1 MEUUZKKFBGNBSX-UHFFFAOYSA-N 0.000 description 1
- MRRNQVNLAWINOU-UHFFFAOYSA-N 4-(2,3-dimethylimidazol-4-yl)-n-[4-(3,3,3-trifluoropropylsulfonyl)phenyl]pyrimidin-2-amine Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)CCC(F)(F)F)=N1 MRRNQVNLAWINOU-UHFFFAOYSA-N 0.000 description 1
- LHVGXWFGIYCUKP-UHFFFAOYSA-N 4-(2-ethyl-3-methylimidazol-4-yl)-n-phenylpyrimidin-2-amine Chemical compound CN1C(CC)=NC=C1C1=CC=NC(NC=2C=CC=CC=2)=N1 LHVGXWFGIYCUKP-UHFFFAOYSA-N 0.000 description 1
- ZXVIBHPNBKNBPR-UHFFFAOYSA-N 4-(2-ethyl-3-methylimidazol-4-yl)pyrimidin-2-amine Chemical compound CN1C(CC)=NC=C1C1=CC=NC(N)=N1 ZXVIBHPNBKNBPR-UHFFFAOYSA-N 0.000 description 1
- GEKVGYUULFDKLT-UHFFFAOYSA-N 4-(2-methyl-1h-imidazol-5-yl)-n-phenylpyrimidin-2-amine Chemical compound N1C(C)=NC=C1C1=CC=NC(NC=2C=CC=CC=2)=N1 GEKVGYUULFDKLT-UHFFFAOYSA-N 0.000 description 1
- IXGNQQMKOJKKCS-UHFFFAOYSA-N 4-(2-methyl-3-propan-2-ylimidazol-4-yl)-n-phenylpyrimidin-2-amine Chemical compound CC(C)N1C(C)=NC=C1C1=CC=NC(NC=2C=CC=CC=2)=N1 IXGNQQMKOJKKCS-UHFFFAOYSA-N 0.000 description 1
- TZNBHFIWOSIMED-UHFFFAOYSA-N 4-(3-benzyl-2-methylimidazol-4-yl)-n-(3-chlorophenyl)pyrimidin-2-amine Chemical compound C=1C=CC=CC=1CN1C(C)=NC=C1C(N=1)=CC=NC=1NC1=CC=CC(Cl)=C1 TZNBHFIWOSIMED-UHFFFAOYSA-N 0.000 description 1
- NQRHWIMDWOMIPM-UHFFFAOYSA-N 4-(3-but-3-enyl-2-methylimidazol-4-yl)pyrimidin-2-amine Chemical compound C=CCCN1C(C)=NC=C1C1=CC=NC(N)=N1 NQRHWIMDWOMIPM-UHFFFAOYSA-N 0.000 description 1
- SBIUSNLOEPXBRG-UHFFFAOYSA-N 4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-amine Chemical compound CCN1C(C)=NC=C1C1=CC=NC(N)=N1 SBIUSNLOEPXBRG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- BAFGXOQLAATIGP-UHFFFAOYSA-N 4-(3-methyl-2-propan-2-ylimidazol-4-yl)pyrimidin-2-amine Chemical compound CN1C(C(C)C)=NC=C1C1=CC=NC(N)=N1 BAFGXOQLAATIGP-UHFFFAOYSA-N 0.000 description 1
- RNGIZAXCOZSOOS-UHFFFAOYSA-N 4-[2-(methoxymethyl)-3-methylimidazol-4-yl]-n-phenylpyrimidin-2-amine Chemical compound CN1C(COC)=NC=C1C1=CC=NC(NC=2C=CC=CC=2)=N1 RNGIZAXCOZSOOS-UHFFFAOYSA-N 0.000 description 1
- QKQKMMCOQFWYHV-UHFFFAOYSA-N 4-[3-(2-methoxyethyl)-2-methylimidazol-4-yl]pyrimidin-2-amine Chemical compound COCCN1C(C)=NC=C1C1=CC=NC(N)=N1 QKQKMMCOQFWYHV-UHFFFAOYSA-N 0.000 description 1
- JYWMTFVHGCGTOH-UHFFFAOYSA-N 4-[3-methyl-2-(trifluoromethyl)imidazol-4-yl]pyrimidin-2-amine Chemical compound N1=C(C(F)(F)F)N(C)C(C=2N=C(N)N=CC=2)=C1 JYWMTFVHGCGTOH-UHFFFAOYSA-N 0.000 description 1
- HPCXEFQQBDUUAD-UHFFFAOYSA-N 4-[[4-(2,3,5-trimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound N1=C(C)N(C)C(C=2N=C(NC=3C=CC(=CC=3)S(N)(=O)=O)N=CC=2)=C1C HPCXEFQQBDUUAD-UHFFFAOYSA-N 0.000 description 1
- DDUYUYUACKLAHP-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-N-(4,5-dimethyl-1,3-oxazol-2-yl)benzenesulfonamide Chemical compound Cc1nc(NS(=O)(=O)c2ccc(Nc3nccc(n3)-c3cnc(C)n3C)cc2)oc1C DDUYUYUACKLAHP-UHFFFAOYSA-N 0.000 description 1
- PQDCQDGMRKAUQR-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-N-methyl-N-(3-morpholin-4-ylpropyl)benzenesulfonamide Chemical compound CN1C(=NC=C1C1=NC(=NC=C1)NC1=CC=C(C=C1)S(N(C)CCCN1CCOCC1)(=O)=O)C PQDCQDGMRKAUQR-UHFFFAOYSA-N 0.000 description 1
- GHAFHOLMBHEAKY-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-hydroxypropyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCC(O)C)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 GHAFHOLMBHEAKY-UHFFFAOYSA-N 0.000 description 1
- XYZNJJAFIUQYLC-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-methoxyethyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCOC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 XYZNJJAFIUQYLC-UHFFFAOYSA-N 0.000 description 1
- XTKJUUYDCRLRIG-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-piperidin-1-ylethyl)benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCN2CCCCC2)=N1 XTKJUUYDCRLRIG-UHFFFAOYSA-N 0.000 description 1
- OOSPIWPDTDOQCE-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-pyridin-2-ylethyl)benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCC=2N=CC=CC=2)=N1 OOSPIWPDTDOQCE-UHFFFAOYSA-N 0.000 description 1
- ZJKBZYCYOUCLTR-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-pyridin-4-ylethyl)benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCC=2C=CN=CC=2)=N1 ZJKBZYCYOUCLTR-UHFFFAOYSA-N 0.000 description 1
- SBJGSBMUEKSUHR-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(3-ethoxypropyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCCOCC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 SBJGSBMUEKSUHR-UHFFFAOYSA-N 0.000 description 1
- ZIRPTTUXMPEPRP-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(3-hydroxypropyl)benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCCO)=N1 ZIRPTTUXMPEPRP-UHFFFAOYSA-N 0.000 description 1
- INGZIYZMPDPGHZ-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(3-morpholin-4-ylpropyl)benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCCN2CCOCC2)=N1 INGZIYZMPDPGHZ-UHFFFAOYSA-N 0.000 description 1
- YDAZSMGTKCIGJO-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(3-propan-2-yloxypropyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCCOC(C)C)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 YDAZSMGTKCIGJO-UHFFFAOYSA-N 0.000 description 1
- ZSSUYMDUNMDLNM-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(pyridin-2-ylmethyl)benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC=2N=CC=CC=2)=N1 ZSSUYMDUNMDLNM-UHFFFAOYSA-N 0.000 description 1
- HDNVGBDXMKLRNV-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(pyridin-3-ylmethyl)benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC=2C=NC=CC=2)=N1 HDNVGBDXMKLRNV-UHFFFAOYSA-N 0.000 description 1
- WZTZNANCAAYIJE-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-[2-(2-methoxyethoxy)ethyl]benzenesulfonamide;hydrochloride Chemical compound Cl.C1=CC(S(=O)(=O)NCCOCCOC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 WZTZNANCAAYIJE-UHFFFAOYSA-N 0.000 description 1
- ZCTMWNJWEFYWMX-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-ethylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 ZCTMWNJWEFYWMX-UHFFFAOYSA-N 0.000 description 1
- JDDURTXKKBIAJU-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-methylbenzamide Chemical compound C1=CC(C(=O)NC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 JDDURTXKKBIAJU-UHFFFAOYSA-N 0.000 description 1
- MYLOKGPRUSRDBK-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-methylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 MYLOKGPRUSRDBK-UHFFFAOYSA-N 0.000 description 1
- UXUARRIYECKRHM-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-pentylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCCCC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 UXUARRIYECKRHM-UHFFFAOYSA-N 0.000 description 1
- NCBRXRVBVKOOKO-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-propylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 NCBRXRVBVKOOKO-UHFFFAOYSA-N 0.000 description 1
- UQEPZHPATDPKPO-UHFFFAOYSA-N 4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(N)(=O)=O)=N1 UQEPZHPATDPKPO-UHFFFAOYSA-N 0.000 description 1
- IQSFAMSAFMMKSL-UHFFFAOYSA-N 4-[[4-(2-methyl-1h-imidazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound N1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(N)(=O)=O)=N1 IQSFAMSAFMMKSL-UHFFFAOYSA-N 0.000 description 1
- KIPWYTKEXAFLLF-UHFFFAOYSA-N 4-[[4-(2-methyl-3-propan-2-ylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(pyridin-2-ylmethyl)benzenesulfonamide Chemical compound CC(C)N1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC=2N=CC=CC=2)=N1 KIPWYTKEXAFLLF-UHFFFAOYSA-N 0.000 description 1
- GHFHLOBBONASMV-UHFFFAOYSA-N 4-[[4-(3-but-3-enyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-N-(2-methoxyethyl)benzenesulfonamide Chemical compound C=CCCN1C(=NC=C1C1=NC(=NC=C1)NC1=CC=C(C=C1)S(NCCOC)(=O)=O)C GHFHLOBBONASMV-UHFFFAOYSA-N 0.000 description 1
- NMNKQDPNWWTWCZ-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-N-(2-methoxyethyl)-N-methylbenzenesulfonamide Chemical compound CCn1c(C)ncc1-c1ccnc(Nc2ccc(cc2)S(=O)(=O)N(C)CCOC)n1 NMNKQDPNWWTWCZ-UHFFFAOYSA-N 0.000 description 1
- VRGRABYAYPZQRM-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzenesulfonamide Chemical compound CCn1c(C)ncc1-c1ccnc(Nc2ccc(cc2)S(=O)(=O)NCc2nc(C)cs2)n1 VRGRABYAYPZQRM-UHFFFAOYSA-N 0.000 description 1
- QCVKFVIXVKABFX-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-hydroxy-3-propan-2-yloxypropyl)benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC(O)COC(C)C)=N1 QCVKFVIXVKABFX-UHFFFAOYSA-N 0.000 description 1
- WQWSTOXCTQPWKG-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-hydroxyethyl)benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCO)=N1 WQWSTOXCTQPWKG-UHFFFAOYSA-N 0.000 description 1
- VZADGUDIKKASPI-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-[(3-methyl-1,2-oxazol-5-yl)methyl]benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC=2ON=C(C)C=2)=N1 VZADGUDIKKASPI-UHFFFAOYSA-N 0.000 description 1
- KCLQKOPGQRTAON-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-[(5-methylpyrazin-2-yl)methyl]benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC=2N=CC(C)=NC=2)=N1 KCLQKOPGQRTAON-UHFFFAOYSA-N 0.000 description 1
- KULOSWLTRNDEMM-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-[2-(1,2-thiazol-3-yloxy)ethyl]benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCOC2=NSC=C2)=N1 KULOSWLTRNDEMM-UHFFFAOYSA-N 0.000 description 1
- LPLUGQBRNPAWHD-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-[3-(1,2-oxazol-3-yloxy)propyl]benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCCOC2=NOC=C2)=N1 LPLUGQBRNPAWHD-UHFFFAOYSA-N 0.000 description 1
- PJTXBTJXJBROHZ-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-methylbenzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NC)=N1 PJTXBTJXJBROHZ-UHFFFAOYSA-N 0.000 description 1
- RWPYQTLCJDHQHR-UHFFFAOYSA-N 4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-prop-2-ynylbenzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC#C)=N1 RWPYQTLCJDHQHR-UHFFFAOYSA-N 0.000 description 1
- JQZCEEAFAUEXHL-UHFFFAOYSA-N 4-[[4-[3-(2-methoxyethyl)-2-methylimidazol-4-yl]pyrimidin-2-yl]amino]-n-(3-methoxypropyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCCOC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)CCOC)=N1 JQZCEEAFAUEXHL-UHFFFAOYSA-N 0.000 description 1
- ZKBGPKSHYXXVOE-UHFFFAOYSA-N 4-[[5-bromo-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-N-(3-methoxypropyl)benzenesulfonamide Chemical compound COCCCNS(=O)(=O)c1ccc(Nc2ncc(Br)c(n2)-c2cnc(C)n2C)cc1 ZKBGPKSHYXXVOE-UHFFFAOYSA-N 0.000 description 1
- CXOIRUKCQXCKPR-UHFFFAOYSA-N 4-[[5-bromo-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-methoxyethyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCOC)=CC=C1NC1=NC=C(Br)C(C=2N(C(C)=NC=2)C)=N1 CXOIRUKCQXCKPR-UHFFFAOYSA-N 0.000 description 1
- SWKRLGSKBYOIHR-UHFFFAOYSA-N 4-[[5-bromo-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-methylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NC)=CC=C1NC1=NC=C(Br)C(C=2N(C(C)=NC=2)C)=N1 SWKRLGSKBYOIHR-UHFFFAOYSA-N 0.000 description 1
- YLUHMVUWNWRIEB-UHFFFAOYSA-N 4-[[5-bromo-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-propylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCC)=CC=C1NC1=NC=C(Br)C(C=2N(C(C)=NC=2)C)=N1 YLUHMVUWNWRIEB-UHFFFAOYSA-N 0.000 description 1
- PHXDUEKNJLLESW-UHFFFAOYSA-N 4-[[5-bromo-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=NC(NC=2C=CC(=CC=2)S(N)(=O)=O)=NC=C1Br PHXDUEKNJLLESW-UHFFFAOYSA-N 0.000 description 1
- UEZXEBBLXZCFTG-UHFFFAOYSA-N 4-[[5-bromo-4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-methoxyethyl)benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCOC)=NC=C1Br UEZXEBBLXZCFTG-UHFFFAOYSA-N 0.000 description 1
- QHXRYOSNKJOSGW-UHFFFAOYSA-N 4-[[5-bromo-4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C=NC=C1C1=NC(NC=2C=CC(=CC=2)S(N)(=O)=O)=NC=C1Br QHXRYOSNKJOSGW-UHFFFAOYSA-N 0.000 description 1
- DAFUZVIPBBNFRD-UHFFFAOYSA-N 4-[[5-bromo-4-[3-(2-methoxyethyl)-2-methylimidazol-4-yl]pyrimidin-2-yl]amino]-n-(2-methoxyethyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCOC)=CC=C1NC1=NC=C(Br)C(C=2N(C(C)=NC=2)CCOC)=N1 DAFUZVIPBBNFRD-UHFFFAOYSA-N 0.000 description 1
- PLGWJBXAAMJXHI-UHFFFAOYSA-N 4-[[5-bromo-4-[3-(2-methoxyethyl)-2-methylimidazol-4-yl]pyrimidin-2-yl]amino]-n-(3-methoxypropyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCCOC)=CC=C1NC1=NC=C(Br)C(C=2N(C(C)=NC=2)CCOC)=N1 PLGWJBXAAMJXHI-UHFFFAOYSA-N 0.000 description 1
- DTTNWXZGGKVDQL-UHFFFAOYSA-N 4-[[5-chloro-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-methoxyethyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCOC)=CC=C1NC1=NC=C(Cl)C(C=2N(C(C)=NC=2)C)=N1 DTTNWXZGGKVDQL-UHFFFAOYSA-N 0.000 description 1
- NXSWLMGGDXBPGY-UHFFFAOYSA-N 4-[[5-chloro-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]-n-propylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCC)=CC=C1NC1=NC=C(Cl)C(C=2N(C(C)=NC=2)C)=N1 NXSWLMGGDXBPGY-UHFFFAOYSA-N 0.000 description 1
- ZVFHXORCDVURDC-UHFFFAOYSA-N 4-[[5-chloro-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=NC(NC=2C=CC(=CC=2)S(N)(=O)=O)=NC=C1Cl ZVFHXORCDVURDC-UHFFFAOYSA-N 0.000 description 1
- RLHGHGNMIHBMIM-UHFFFAOYSA-N 4-[[5-chloro-4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(2-methoxyethyl)benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCOC)=NC=C1Cl RLHGHGNMIHBMIM-UHFFFAOYSA-N 0.000 description 1
- HWAKJXNEWUAJKH-UHFFFAOYSA-N 4-[[5-chloro-4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-(oxolan-2-ylmethyl)benzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC2OCCC2)=NC=C1Cl HWAKJXNEWUAJKH-UHFFFAOYSA-N 0.000 description 1
- QGJKKXDQFLSHKW-UHFFFAOYSA-N 4-[[5-chloro-4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]-n-cyclopropylbenzenesulfonamide Chemical compound CCN1C(C)=NC=C1C1=NC(NC=2C=CC(=CC=2)S(=O)(=O)NC2CC2)=NC=C1Cl QGJKKXDQFLSHKW-UHFFFAOYSA-N 0.000 description 1
- VMEVGHCDYBARHQ-UHFFFAOYSA-N 4-[[5-chloro-4-[3-(2-methoxyethyl)-2-methylimidazol-4-yl]pyrimidin-2-yl]amino]-n-(2-methoxyethyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCOC)=CC=C1NC1=NC=C(Cl)C(C=2N(C(C)=NC=2)CCOC)=N1 VMEVGHCDYBARHQ-UHFFFAOYSA-N 0.000 description 1
- OJMPLCRVIRCWAV-UHFFFAOYSA-N 4-amino-n-(oxolan-2-ylmethyl)benzenesulfonamide Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NCC1OCCC1 OJMPLCRVIRCWAV-UHFFFAOYSA-N 0.000 description 1
- XVGUXFWBYAHLPP-UHFFFAOYSA-N 4-amino-n-[3-(2-oxopyrrolidin-1-yl)propyl]benzenesulfonamide Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NCCCN1C(=O)CCC1 XVGUXFWBYAHLPP-UHFFFAOYSA-N 0.000 description 1
- BLFRQYKZFKYQLO-UHFFFAOYSA-N 4-aminobutan-1-ol Chemical compound NCCCCO BLFRQYKZFKYQLO-UHFFFAOYSA-N 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- GCNTZFIIOFTKIY-UHFFFAOYSA-N 4-hydroxypyridine Chemical compound OC1=CC=NC=C1 GCNTZFIIOFTKIY-UHFFFAOYSA-N 0.000 description 1
- QSXNHVJOJOJHAV-UHFFFAOYSA-N 4-iodo-n-(2-methoxyethyl)-n-methylbenzenesulfonamide Chemical compound COCCN(C)S(=O)(=O)C1=CC=C(I)C=C1 QSXNHVJOJOJHAV-UHFFFAOYSA-N 0.000 description 1
- OYTUOYHWJQXUBA-UHFFFAOYSA-N 4-iodo-n-(2-phenylmethoxyethyl)benzenesulfonamide Chemical compound C1=CC(I)=CC=C1S(=O)(=O)NCCOCC1=CC=CC=C1 OYTUOYHWJQXUBA-UHFFFAOYSA-N 0.000 description 1
- VDTIVCTUKJSFJA-UHFFFAOYSA-N 4-iodo-n-(3-methoxypropyl)benzenesulfonamide Chemical compound COCCCNS(=O)(=O)C1=CC=C(I)C=C1 VDTIVCTUKJSFJA-UHFFFAOYSA-N 0.000 description 1
- WEFGQYOIWCQPST-UHFFFAOYSA-N 4-iodo-n-(3-morpholin-4-ylpropyl)benzenesulfonamide Chemical compound C1=CC(I)=CC=C1S(=O)(=O)NCCCN1CCOCC1 WEFGQYOIWCQPST-UHFFFAOYSA-N 0.000 description 1
- HIHXBQSAMAPHMI-UHFFFAOYSA-N 4-iodo-n-[2-(methoxymethoxy)ethyl]benzenesulfonamide Chemical compound COCOCCNS(=O)(=O)C1=CC=C(I)C=C1 HIHXBQSAMAPHMI-UHFFFAOYSA-N 0.000 description 1
- MFOWHFYQZPHNEU-UHFFFAOYSA-N 4-iodo-n-methyl-n-(3-morpholin-4-ylpropyl)benzenesulfonamide Chemical compound C=1C=C(I)C=CC=1S(=O)(=O)N(C)CCCN1CCOCC1 MFOWHFYQZPHNEU-UHFFFAOYSA-N 0.000 description 1
- JVINXWDULSIWOF-UHFFFAOYSA-N 4-iodo-n-prop-2-enylbenzenesulfonamide Chemical compound IC1=CC=C(S(=O)(=O)NCC=C)C=C1 JVINXWDULSIWOF-UHFFFAOYSA-N 0.000 description 1
- KGYDARINJYFOEP-UHFFFAOYSA-N 4-iodo-n-propylbenzenesulfonamide Chemical compound CCCNS(=O)(=O)C1=CC=C(I)C=C1 KGYDARINJYFOEP-UHFFFAOYSA-N 0.000 description 1
- KQZFABSTXSNEQH-UHFFFAOYSA-N 4-iodobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(I)C=C1 KQZFABSTXSNEQH-UHFFFAOYSA-N 0.000 description 1
- NOVPUEUJDUZKBM-UHFFFAOYSA-N 4-methoxybutane-1-sulfonic acid Chemical compound COCCCCS(O)(=O)=O NOVPUEUJDUZKBM-UHFFFAOYSA-N 0.000 description 1
- XOQYTAPKHPKVDP-UHFFFAOYSA-N 5-bromo-4-(2,3-dimethylimidazol-4-yl)-n-phenylpyrimidin-2-amine Chemical compound CN1C(C)=NC=C1C1=NC(NC=2C=CC=CC=2)=NC=C1Br XOQYTAPKHPKVDP-UHFFFAOYSA-N 0.000 description 1
- QSNLDUOQYSMBMI-UHFFFAOYSA-N 5-bromo-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-amine Chemical compound CN1C(C)=NC=C1C1=NC(N)=NC=C1Br QSNLDUOQYSMBMI-UHFFFAOYSA-N 0.000 description 1
- SBQNLTUOJQMPKQ-UHFFFAOYSA-N 5-chloro-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-amine Chemical compound CN1C(C)=NC=C1C1=NC(N)=NC=C1Cl SBQNLTUOJQMPKQ-UHFFFAOYSA-N 0.000 description 1
- NZOYZYHMHMREMM-UHFFFAOYSA-N 5-methyl-1,3-oxazol-4-amine Chemical compound CC=1OC=NC=1N NZOYZYHMHMREMM-UHFFFAOYSA-N 0.000 description 1
- SRTACPRMYNTZHO-UHFFFAOYSA-N 5-methyl-n-propan-2-yl-1,2-oxazol-4-amine Chemical compound CC(C)NC=1C=NOC=1C SRTACPRMYNTZHO-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 101000606657 Arabidopsis thaliana Peroxidase 56 Proteins 0.000 description 1
- BFYIZQONLCFLEV-DAELLWKTSA-N Aromasine Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(=C)C2=C1 BFYIZQONLCFLEV-DAELLWKTSA-N 0.000 description 1
- 206010003178 Arterial thrombosis Diseases 0.000 description 1
- 238000007125 Buchwald synthesis reaction Methods 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- FQYMRXKMMJDGQU-UHFFFAOYSA-N C(C)N1C(=NC=C1C1=NC(=NC=C1)NC1=CC=C(C=C1)S(NCCCCO)(=O)=O)C Chemical compound C(C)N1C(=NC=C1C1=NC(=NC=C1)NC1=CC=C(C=C1)S(NCCCCO)(=O)=O)C FQYMRXKMMJDGQU-UHFFFAOYSA-N 0.000 description 1
- JIERJRRGUHGHMO-UHFFFAOYSA-N CCC1=NC=C(N1C)CC=CN(C)C Chemical compound CCC1=NC=C(N1C)CC=CN(C)C JIERJRRGUHGHMO-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- GTWBNHZTVGOYSK-UHFFFAOYSA-N CN(C=CC(=O)C=1N=CN(C1)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)C.ClC=1C=C(NC2=NC=CC(=N2)C=2N=CN(C2)C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=CC1 Chemical compound CN(C=CC(=O)C=1N=CN(C1)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)C.ClC=1C=C(NC2=NC=CC(=N2)C=2N=CN(C2)C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=CC1 GTWBNHZTVGOYSK-UHFFFAOYSA-N 0.000 description 1
- IAQFZRXAIJLRCT-UHFFFAOYSA-N CN(C=CCC1=CN=C(N1CCOC)C)C Chemical compound CN(C=CCC1=CN=C(N1CCOC)C)C IAQFZRXAIJLRCT-UHFFFAOYSA-N 0.000 description 1
- UMKINXWKENZKJI-UHFFFAOYSA-N CN(C=CCC1=CN=CN1C)C Chemical compound CN(C=CCC1=CN=CN1C)C UMKINXWKENZKJI-UHFFFAOYSA-N 0.000 description 1
- LASDBENZWOXEHR-UHFFFAOYSA-N CN1C(=CN=C1COC)CC=CN(C)C Chemical compound CN1C(=CN=C1COC)CC=CN(C)C LASDBENZWOXEHR-UHFFFAOYSA-N 0.000 description 1
- WEWLLTJZIZQCSE-UHFFFAOYSA-N CN1C(=NC=C1C1=NC(=NC=C1)NC1=CC=C(C=C1)S(NCC1OC(OC1)(C)C)(=O)=O)C Chemical compound CN1C(=NC=C1C1=NC(=NC=C1)NC1=CC=C(C=C1)S(NCC1OC(OC1)(C)C)(=O)=O)C WEWLLTJZIZQCSE-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 1
- 108091026890 Coding region Proteins 0.000 description 1
- 208000003322 Coinfection Diseases 0.000 description 1
- 102000002554 Cyclin A Human genes 0.000 description 1
- 108010068192 Cyclin A Proteins 0.000 description 1
- 102100032857 Cyclin-dependent kinase 1 Human genes 0.000 description 1
- 101710106279 Cyclin-dependent kinase 1 Proteins 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- 230000006820 DNA synthesis Effects 0.000 description 1
- 229940123780 DNA topoisomerase I inhibitor Drugs 0.000 description 1
- 108010092160 Dactinomycin Proteins 0.000 description 1
- WEAHRLBPCANXCN-UHFFFAOYSA-N Daunomycin Natural products CCC1(O)CC(OC2CC(N)C(O)C(C)O2)c3cc4C(=O)c5c(OC)cccc5C(=O)c4c(O)c3C1 WEAHRLBPCANXCN-UHFFFAOYSA-N 0.000 description 1
- ZQZFYGIXNQKOAV-OCEACIFDSA-N Droloxifene Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=C(O)C=CC=1)\C1=CC=C(OCCN(C)C)C=C1 ZQZFYGIXNQKOAV-OCEACIFDSA-N 0.000 description 1
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 108010069236 Goserelin Proteins 0.000 description 1
- 102000009465 Growth Factor Receptors Human genes 0.000 description 1
- 108010009202 Growth Factor Receptors Proteins 0.000 description 1
- 108090000100 Hepatocyte Growth Factor Proteins 0.000 description 1
- 102100021866 Hepatocyte growth factor Human genes 0.000 description 1
- 101000904173 Homo sapiens Progonadoliberin-1 Proteins 0.000 description 1
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 1
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- 229930192392 Mitomycin Natural products 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- NVCQFBFOEDBHKR-UHFFFAOYSA-N N,N-dimethyl-3-(2-methyl-3-propan-2-ylimidazol-4-yl)prop-1-en-1-amine Chemical compound CC(C)N1C(C)=NC=C1CC=CN(C)C NVCQFBFOEDBHKR-UHFFFAOYSA-N 0.000 description 1
- BQSZNDLRJAJUDU-UHFFFAOYSA-N N,N-dimethyl-3-(3-methyl-2-propan-2-ylimidazol-4-yl)prop-1-en-1-amine Chemical compound CN(C=CCC1=CN=C(N1C)C(C)C)C BQSZNDLRJAJUDU-UHFFFAOYSA-N 0.000 description 1
- LAOOYTROHDFOQA-UHFFFAOYSA-N N-(1,4-dioxan-2-ylmethyl)-4-[[4-(3-ethyl-2-methylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CCn1c(C)ncc1-c1ccnc(Nc2ccc(cc2)S(=O)(=O)NCC2COCCO2)n1 LAOOYTROHDFOQA-UHFFFAOYSA-N 0.000 description 1
- VKJWGLVNBHLMSX-UHFFFAOYSA-N N-(2-methoxyethyl)-4-[[4-[3-(2-methoxyethyl)-2-methylimidazol-4-yl]pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound COCCN1C(=NC=C1C1=NC(=NC=C1)NC1=CC=C(C=C1)S(NCCOC)(=O)=O)C VKJWGLVNBHLMSX-UHFFFAOYSA-N 0.000 description 1
- NNFODCUCDWWVSH-UHFFFAOYSA-N N-(2-methylbutan-2-yl)-4-[[4-(2,3,5-trimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CCC(C)(C)NS(=O)(=O)c1ccc(Nc2nccc(n2)-c2c(C)nc(C)n2C)cc1 NNFODCUCDWWVSH-UHFFFAOYSA-N 0.000 description 1
- DMWTYTYIVZFFSB-UHFFFAOYSA-N N-(furan-2-ylmethyl)-4-[[4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound O1C(=CC=C1)CNS(=O)(=O)C1=CC=C(NC2=NC=CC(=N2)C2=CN=CN2C)C=C1 DMWTYTYIVZFFSB-UHFFFAOYSA-N 0.000 description 1
- GPMZQRREMIOCQH-UHFFFAOYSA-N N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-iodobenzenesulfonamide Chemical compound O1C(C)(C)OCC1CNS(=O)(=O)C1=CC=C(I)C=C1 GPMZQRREMIOCQH-UHFFFAOYSA-N 0.000 description 1
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 206010029098 Neoplasm skin Diseases 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 102000043276 Oncogene Human genes 0.000 description 1
- 108700020796 Oncogene Proteins 0.000 description 1
- 108700026244 Open Reading Frames Proteins 0.000 description 1
- 206010033128 Ovarian cancer Diseases 0.000 description 1
- 206010061535 Ovarian neoplasm Diseases 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 102100038124 Plasminogen Human genes 0.000 description 1
- 108010051456 Plasminogen Proteins 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 102100024028 Progonadoliberin-1 Human genes 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- GIIWGCBLYNDKBO-UHFFFAOYSA-N Quinoline 1-oxide Chemical group C1=CC=C2[N+]([O-])=CC=CC2=C1 GIIWGCBLYNDKBO-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 208000015634 Rectal Neoplasms Diseases 0.000 description 1
- 208000017442 Retinal disease Diseases 0.000 description 1
- 108700025701 Retinoblastoma Genes Proteins 0.000 description 1
- 108050002653 Retinoblastoma protein Proteins 0.000 description 1
- 229940124639 Selective inhibitor Drugs 0.000 description 1
- 229920002684 Sepharose Polymers 0.000 description 1
- 208000000453 Skin Neoplasms Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 241000256251 Spodoptera frugiperda Species 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- 101000996723 Sus scrofa Gonadotropin-releasing hormone receptor Proteins 0.000 description 1
- 210000001744 T-lymphocyte Anatomy 0.000 description 1
- 229940123237 Taxane Drugs 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- 239000000365 Topoisomerase I Inhibitor Substances 0.000 description 1
- 102000004357 Transferases Human genes 0.000 description 1
- 108090000992 Transferases Proteins 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 108700025716 Tumor Suppressor Genes Proteins 0.000 description 1
- 102000044209 Tumor Suppressor Genes Human genes 0.000 description 1
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 1
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 1
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 1
- 208000004354 Vulvar Neoplasms Diseases 0.000 description 1
- UXZMLECYBHANRH-UHFFFAOYSA-K [B+3].[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F Chemical compound [B+3].[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F UXZMLECYBHANRH-UHFFFAOYSA-K 0.000 description 1
- DJPVONPSNBLDSU-UHFFFAOYSA-A [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DJPVONPSNBLDSU-UHFFFAOYSA-A 0.000 description 1
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- NJWPUHJETQMBGJ-UHFFFAOYSA-N acetyloxymethoxyperoxymethyl acetate Chemical compound C(C)(=O)OCOOOCOC(C)=O NJWPUHJETQMBGJ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000003838 adenosines Chemical class 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- DFNYGALUNNFWKJ-UHFFFAOYSA-N aminoacetonitrile Chemical compound NCC#N DFNYGALUNNFWKJ-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- XCPGHVQEEXUHNC-UHFFFAOYSA-N amsacrine Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1NC1=C(C=CC=C2)C2=NC2=CC=CC=C12 XCPGHVQEEXUHNC-UHFFFAOYSA-N 0.000 description 1
- 229960001220 amsacrine Drugs 0.000 description 1
- 229960002932 anastrozole Drugs 0.000 description 1
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 238000005349 anion exchange Methods 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 229940045799 anthracyclines and related substance Drugs 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940046836 anti-estrogen Drugs 0.000 description 1
- 230000001833 anti-estrogenic effect Effects 0.000 description 1
- 230000003432 anti-folate effect Effects 0.000 description 1
- 230000001740 anti-invasion Effects 0.000 description 1
- 230000001028 anti-proliverative effect Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940127074 antifolate Drugs 0.000 description 1
- 239000003080 antimitotic agent Substances 0.000 description 1
- 229940045719 antineoplastic alkylating agent nitrosoureas Drugs 0.000 description 1
- 239000003972 antineoplastic antibiotic Substances 0.000 description 1
- 229940041181 antineoplastic drug Drugs 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000003886 aromatase inhibitor Substances 0.000 description 1
- 229940046844 aromatase inhibitors Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000001363 autoimmune Effects 0.000 description 1
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 229960000997 bicalutamide Drugs 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 229960002092 busulfan Drugs 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 229960004562 carboplatin Drugs 0.000 description 1
- 125000001721 carboxyacetyl group Chemical group 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000000451 chemical ionisation Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229960004630 chlorambucil Drugs 0.000 description 1
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 1
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 238000011284 combination treatment Methods 0.000 description 1
- 229940046044 combinations of antineoplastic agent Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- IGSKHXTUVXSOMB-UHFFFAOYSA-N cyclopropylmethanamine Chemical compound NCC1CC1 IGSKHXTUVXSOMB-UHFFFAOYSA-N 0.000 description 1
- 229960000978 cyproterone acetate Drugs 0.000 description 1
- UWFYSQMTEOIJJG-FDTZYFLXSA-N cyproterone acetate Chemical compound C1=C(Cl)C2=CC(=O)[C@@H]3C[C@@H]3[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(C)=O)(OC(=O)C)[C@@]1(C)CC2 UWFYSQMTEOIJJG-FDTZYFLXSA-N 0.000 description 1
- 229960000684 cytarabine Drugs 0.000 description 1
- 239000000824 cytostatic agent Substances 0.000 description 1
- 231100000135 cytotoxicity Toxicity 0.000 description 1
- 230000003013 cytotoxicity Effects 0.000 description 1
- 229960000640 dactinomycin Drugs 0.000 description 1
- 229960000975 daunorubicin Drugs 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003831 deregulation Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 description 1
- 239000002027 dichloromethane extract Substances 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 229960003668 docetaxel Drugs 0.000 description 1
- 229950004203 droloxifene Drugs 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229960001904 epirubicin Drugs 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- 239000000328 estrogen antagonist Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- OCLXJTCGWSSVOE-UHFFFAOYSA-N ethanol etoh Chemical compound CCO.CCO OCLXJTCGWSSVOE-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- FMVJYQGSRWVMQV-UHFFFAOYSA-N ethyl propiolate Chemical compound CCOC(=O)C#C FMVJYQGSRWVMQV-UHFFFAOYSA-N 0.000 description 1
- UVECLJDRPFNRRQ-UHFFFAOYSA-N ethyl trifluoromethanesulfonate Chemical compound CCOS(=O)(=O)C(F)(F)F UVECLJDRPFNRRQ-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 description 1
- 229960000255 exemestane Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000013604 expression vector Substances 0.000 description 1
- 238000010265 fast atom bombardment Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- DBEPLOCGEIEOCV-WSBQPABSSA-N finasteride Chemical compound N([C@@H]1CC2)C(=O)C=C[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](C(=O)NC(C)(C)C)[C@@]2(C)CC1 DBEPLOCGEIEOCV-WSBQPABSSA-N 0.000 description 1
- 229960004039 finasteride Drugs 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 150000005699 fluoropyrimidines Chemical class 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 239000004052 folic acid antagonist Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 229960005277 gemcitabine Drugs 0.000 description 1
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 1
- BEBCJVAWIBVWNZ-UHFFFAOYSA-N glycinamide Chemical compound NCC(N)=O BEBCJVAWIBVWNZ-UHFFFAOYSA-N 0.000 description 1
- XLXSAKCOAKORKW-UHFFFAOYSA-N gonadorelin Chemical compound C1CCC(C(=O)NCC(N)=O)N1C(=O)C(CCCN=C(N)N)NC(=O)C(CC(C)C)NC(=O)CNC(=O)C(NC(=O)C(CO)NC(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C(CC=1NC=NC=1)NC(=O)C1NC(=O)CC1)CC1=CC=C(O)C=C1 XLXSAKCOAKORKW-UHFFFAOYSA-N 0.000 description 1
- 229960003690 goserelin acetate Drugs 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 229960000789 guanidine hydrochloride Drugs 0.000 description 1
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 description 1
- 229960000908 idarubicin Drugs 0.000 description 1
- 125000000336 imidazol-5-yl group Chemical group [H]N1C([H])=NC([H])=C1[*] 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 150000002485 inorganic esters Chemical class 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229960004768 irinotecan Drugs 0.000 description 1
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- VDBNYAPERZTOOF-UHFFFAOYSA-N isoquinolin-1(2H)-one Chemical group C1=CC=C2C(=O)NC=CC2=C1 VDBNYAPERZTOOF-UHFFFAOYSA-N 0.000 description 1
- MGIYRDNGCNKGJU-UHFFFAOYSA-N isothiazolinone Chemical compound O=C1C=CSN1 MGIYRDNGCNKGJU-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 238000000021 kinase assay Methods 0.000 description 1
- 229940043355 kinase inhibitor Drugs 0.000 description 1
- 101150109249 lacI gene Proteins 0.000 description 1
- 229960003881 letrozole Drugs 0.000 description 1
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 208000020816 lung neoplasm Diseases 0.000 description 1
- 208000037841 lung tumor Diseases 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- OCSMOTCMPXTDND-OUAUKWLOSA-N marimastat Chemical compound CNC(=O)[C@H](C(C)(C)C)NC(=O)[C@H](CC(C)C)[C@H](O)C(=O)NO OCSMOTCMPXTDND-OUAUKWLOSA-N 0.000 description 1
- 229950008959 marimastat Drugs 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229960004961 mechlorethamine Drugs 0.000 description 1
- HAWPXGHAZFHHAD-UHFFFAOYSA-N mechlorethamine Chemical class ClCCN(C)CCCl HAWPXGHAZFHHAD-UHFFFAOYSA-N 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229960004296 megestrol acetate Drugs 0.000 description 1
- RQZAXGRLVPAYTJ-GQFGMJRRSA-N megestrol acetate Chemical compound C1=C(C)C2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(C)=O)(OC(=O)C)[C@@]1(C)CC2 RQZAXGRLVPAYTJ-GQFGMJRRSA-N 0.000 description 1
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 1
- 229960001924 melphalan Drugs 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 239000003475 metalloproteinase inhibitor Substances 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- IMAKHNTVDGLIRY-UHFFFAOYSA-N methyl prop-2-ynoate Chemical compound COC(=O)C#C IMAKHNTVDGLIRY-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- CFCUWKMKBJTWLW-BKHRDMLASA-N mithramycin Chemical compound O([C@@H]1C[C@@H](O[C@H](C)[C@H]1O)OC=1C=C2C=C3C[C@H]([C@@H](C(=O)C3=C(O)C2=C(O)C=1C)O[C@@H]1O[C@H](C)[C@@H](O)[C@H](O[C@@H]2O[C@H](C)[C@H](O)[C@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@@](C)(O)C3)C2)C1)[C@H](OC)C(=O)[C@@H](O)[C@@H](C)O)[C@H]1C[C@@H](O)[C@H](O)[C@@H](C)O1 CFCUWKMKBJTWLW-BKHRDMLASA-N 0.000 description 1
- 230000002297 mitogenic effect Effects 0.000 description 1
- 230000011278 mitosis Effects 0.000 description 1
- 229960001156 mitoxantrone Drugs 0.000 description 1
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 1
- 239000003068 molecular probe Substances 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- XJGCXGOCKGESLO-UHFFFAOYSA-N n,5-dimethyl-1,2-oxazol-4-amine;hydrochloride Chemical compound Cl.CNC=1C=NOC=1C XJGCXGOCKGESLO-UHFFFAOYSA-N 0.000 description 1
- PNDCEKOXYZALFH-UHFFFAOYSA-N n,n,3-trimethyl-2-oxobutanamide Chemical compound CC(C)C(=O)C(=O)N(C)C PNDCEKOXYZALFH-UHFFFAOYSA-N 0.000 description 1
- DAZXVJBJRMWXJP-UHFFFAOYSA-N n,n-dimethylethylamine Chemical compound CCN(C)C DAZXVJBJRMWXJP-UHFFFAOYSA-N 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- DVJVZSQCRZSFQJ-UHFFFAOYSA-N n-(1,4-dioxan-2-ylmethyl)-4-iodobenzenesulfonamide Chemical compound C1=CC(I)=CC=C1S(=O)(=O)NCC1OCCOC1 DVJVZSQCRZSFQJ-UHFFFAOYSA-N 0.000 description 1
- IUJVESGCBXCOIM-UHFFFAOYSA-N n-(2,2-dimethoxyethyl)-4-iodobenzenesulfonamide Chemical compound COC(OC)CNS(=O)(=O)C1=CC=C(I)C=C1 IUJVESGCBXCOIM-UHFFFAOYSA-N 0.000 description 1
- JRHMCAJLKYKKHE-UHFFFAOYSA-N n-(2,3-dihydroxypropyl)-4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC(O)CO)=N1 JRHMCAJLKYKKHE-UHFFFAOYSA-N 0.000 description 1
- GNQJMRPDQCWOQH-UHFFFAOYSA-N n-(2-hydroxyethyl)-4-[[4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCO)=N1 GNQJMRPDQCWOQH-UHFFFAOYSA-N 0.000 description 1
- LDXLQEXLXZCYSR-UHFFFAOYSA-N n-(2-methoxyethyl)-4-({4-[2-methyl-1-(1-methylethyl)-1h-imidazol-5-yl]pyrimidin-2-yl}amino)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCOC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C(C)C)=N1 LDXLQEXLXZCYSR-UHFFFAOYSA-N 0.000 description 1
- LGCAIPXMWBZXAJ-UHFFFAOYSA-N n-(2-methoxyethyl)-4-[[4-(2,3,5-trimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCOC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2C)C)=N1 LGCAIPXMWBZXAJ-UHFFFAOYSA-N 0.000 description 1
- URVXFLYFLFKCTH-UHFFFAOYSA-N n-(2-methoxyethyl)-4-[[4-[2-(methoxymethyl)-3-methylimidazol-4-yl]pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCOC)=CC=C1NC1=NC=CC(C=2N(C(COC)=NC=2)C)=N1 URVXFLYFLFKCTH-UHFFFAOYSA-N 0.000 description 1
- SHBOKXDRGFPAET-UHFFFAOYSA-N n-(3-chlorophenyl)-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-amine Chemical compound CN1C(C)=NC=C1C1=CC=NC(NC=2C=C(Cl)C=CC=2)=N1 SHBOKXDRGFPAET-UHFFFAOYSA-N 0.000 description 1
- RDHIHTLXZSEYFY-UHFFFAOYSA-N n-(3-chlorophenyl)-4-(2-methyl-1h-imidazol-5-yl)pyrimidin-2-amine Chemical compound N1C(C)=NC=C1C1=CC=NC(NC=2C=C(Cl)C=CC=2)=N1 RDHIHTLXZSEYFY-UHFFFAOYSA-N 0.000 description 1
- XLEWSRPCJLADPZ-UHFFFAOYSA-N n-(3-chlorophenyl)-4-(3-ethylimidazol-4-yl)pyrimidin-2-amine Chemical compound CCN1C=NC=C1C1=CC=NC(NC=2C=C(Cl)C=CC=2)=N1 XLEWSRPCJLADPZ-UHFFFAOYSA-N 0.000 description 1
- BBQOKCFROVIJCM-UHFFFAOYSA-N n-(3-chlorophenyl)-4-[3-(2-methoxyethyl)imidazol-4-yl]pyrimidin-2-amine;hydrochloride Chemical compound Cl.COCCN1C=NC=C1C1=CC=NC(NC=2C=C(Cl)C=CC=2)=N1 BBQOKCFROVIJCM-UHFFFAOYSA-N 0.000 description 1
- PEVWQXWQEPYRMK-UHFFFAOYSA-N n-(3-methoxypropyl)-4-[[4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCCOC)=CC=C1NC1=NC=CC(C=2N(C=NC=2)C)=N1 PEVWQXWQEPYRMK-UHFFFAOYSA-N 0.000 description 1
- CGFNOPGGQFERED-UHFFFAOYSA-N n-(4-butylsulfonylphenyl)-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-amine Chemical compound C1=CC(S(=O)(=O)CCCC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 CGFNOPGGQFERED-UHFFFAOYSA-N 0.000 description 1
- FMEQISYFQLXUBA-UHFFFAOYSA-N n-(cyanomethyl)-4-[[4-(2-methyl-3-propan-2-ylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CC(C)N1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC#N)=N1 FMEQISYFQLXUBA-UHFFFAOYSA-N 0.000 description 1
- AGKUBFJBRSWSMR-UHFFFAOYSA-N n-(cyclopropylmethyl)-4-[[4-(2-methyl-3-propan-2-ylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CC(C)N1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC2CC2)=N1 AGKUBFJBRSWSMR-UHFFFAOYSA-N 0.000 description 1
- CAMYNKCGQBSANI-UHFFFAOYSA-N n-(cyclopropylmethyl)-4-[[4-[3-(2-methoxyethyl)-2-methylimidazol-4-yl]pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound COCCN1C(C)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCC2CC2)=N1 CAMYNKCGQBSANI-UHFFFAOYSA-N 0.000 description 1
- JJHBECGKZPZEJE-UHFFFAOYSA-N n-(cyclopropylmethyl)-4-iodobenzenesulfonamide Chemical compound C1=CC(I)=CC=C1S(=O)(=O)NCC1CC1 JJHBECGKZPZEJE-UHFFFAOYSA-N 0.000 description 1
- BLCLNMBMMGCOAS-UHFFFAOYSA-N n-[1-[[1-[[1-[[1-[[1-[[1-[[1-[2-[(carbamoylamino)carbamoyl]pyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amin Chemical compound C1CCC(C(=O)NNC(N)=O)N1C(=O)C(CCCN=C(N)N)NC(=O)C(CC(C)C)NC(=O)C(COC(C)(C)C)NC(=O)C(NC(=O)C(CO)NC(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C(CC=1NC=NC=1)NC(=O)C1NC(=O)CC1)CC1=CC=C(O)C=C1 BLCLNMBMMGCOAS-UHFFFAOYSA-N 0.000 description 1
- MEZRXUMYCYLYBP-UHFFFAOYSA-N n-[2-(2-hydroxyethoxy)ethyl]-4-[[4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NCCOCCO)=N1 MEZRXUMYCYLYBP-UHFFFAOYSA-N 0.000 description 1
- HIKMYPBLGKUYLS-UHFFFAOYSA-N n-[2-(dimethylamino)ethyl]-4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCN(C)C)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 HIKMYPBLGKUYLS-UHFFFAOYSA-N 0.000 description 1
- MRZPMESDEQERNK-UHFFFAOYSA-N n-[2-[5-[2-(3-chloroanilino)pyrimidin-4-yl]imidazol-1-yl]ethyl]methanesulfonamide Chemical compound CS(=O)(=O)NCCN1C=NC=C1C1=CC=NC(NC=2C=C(Cl)C=CC=2)=N1 MRZPMESDEQERNK-UHFFFAOYSA-N 0.000 description 1
- AXRLMUXJHUDPKS-UHFFFAOYSA-N n-[4-[3-(dimethylamino)propylsulfonyl]phenyl]-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-amine Chemical compound C1=CC(S(=O)(=O)CCCN(C)C)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 AXRLMUXJHUDPKS-UHFFFAOYSA-N 0.000 description 1
- DPLJHZNDUNQHIB-UHFFFAOYSA-N n-cyclobutyl-4-[[4-(2-ethyl-3-methylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C(CC)=NC=C1C1=CC=NC(NC=2C=CC(=CC=2)S(=O)(=O)NC2CCC2)=N1 DPLJHZNDUNQHIB-UHFFFAOYSA-N 0.000 description 1
- IQJPPOOJQIAFPH-UHFFFAOYSA-N n-cyclopropyl-4-[[4-(2,3,5-trimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound N1=C(C)N(C)C(C=2N=C(NC=3C=CC(=CC=3)S(=O)(=O)NC3CC3)N=CC=2)=C1C IQJPPOOJQIAFPH-UHFFFAOYSA-N 0.000 description 1
- ILCZGONWLWIQSZ-UHFFFAOYSA-N n-cyclopropyl-4-iodobenzenesulfonamide Chemical compound C1=CC(I)=CC=C1S(=O)(=O)NC1CC1 ILCZGONWLWIQSZ-UHFFFAOYSA-N 0.000 description 1
- GNVRJGIVDSQCOP-UHFFFAOYSA-N n-ethyl-n-methylethanamine Chemical compound CCN(C)CC GNVRJGIVDSQCOP-UHFFFAOYSA-N 0.000 description 1
- AAHMGKDKKIWWFX-UHFFFAOYSA-N n-methyl-4-[[4-(2,3,5-trimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2C)C)=N1 AAHMGKDKKIWWFX-UHFFFAOYSA-N 0.000 description 1
- GCUXNPPBUYEOEL-UHFFFAOYSA-N n-methyl-n-(5-methyl-1,2-oxazol-4-yl)propanamide Chemical compound CCC(=O)N(C)C=1C=NOC=1C GCUXNPPBUYEOEL-UHFFFAOYSA-N 0.000 description 1
- VQMJBAUUDZYOQW-UHFFFAOYSA-N n-phenyl-4-(2,3,5-trimethylimidazol-4-yl)pyrimidin-2-amine Chemical compound N1=C(C)N(C)C(C=2N=C(NC=3C=CC=CC=3)N=CC=2)=C1C VQMJBAUUDZYOQW-UHFFFAOYSA-N 0.000 description 1
- XGXNTJHZPBRBHJ-UHFFFAOYSA-N n-phenylpyrimidin-2-amine Chemical compound N=1C=CC=NC=1NC1=CC=CC=C1 XGXNTJHZPBRBHJ-UHFFFAOYSA-N 0.000 description 1
- ZIRMLOBDKNGFMD-UHFFFAOYSA-N n-tert-butyl-4-[[5-chloro-4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound CN1C(C)=NC=C1C1=NC(NC=2C=CC(=CC=2)S(=O)(=O)NC(C)(C)C)=NC=C1Cl ZIRMLOBDKNGFMD-UHFFFAOYSA-N 0.000 description 1
- UKSYUHKSMJJDNK-UHFFFAOYSA-N n-tert-butyl-4-iodo-n-methylbenzenesulfonamide Chemical compound CC(C)(C)N(C)S(=O)(=O)C1=CC=C(I)C=C1 UKSYUHKSMJJDNK-UHFFFAOYSA-N 0.000 description 1
- UZUMOUHLKKPBQT-UHFFFAOYSA-N n-tert-butyl-4-iodobenzenesulfonamide Chemical compound CC(C)(C)NS(=O)(=O)C1=CC=C(I)C=C1 UZUMOUHLKKPBQT-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000005959 oncogenic signaling Effects 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- YNOGYQAEJGADFJ-UHFFFAOYSA-N oxolan-2-ylmethanamine Chemical compound NCC1CCCO1 YNOGYQAEJGADFJ-UHFFFAOYSA-N 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- 125000005543 phthalimide group Chemical group 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 239000013612 plasmid Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 150000003057 platinum Chemical class 0.000 description 1
- 229960003171 plicamycin Drugs 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 238000003752 polymerase chain reaction Methods 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 238000011165 process development Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000000583 progesterone congener Substances 0.000 description 1
- 229940095055 progestogen systemic hormonal contraceptives Drugs 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 201000001514 prostate carcinoma Diseases 0.000 description 1
- 208000023958 prostate neoplasm Diseases 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000006514 pyridin-2-ylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical group [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- IDXKTTNFXPPXJY-UHFFFAOYSA-N pyrimidin-1-ium;chloride Chemical compound Cl.C1=CN=CN=C1 IDXKTTNFXPPXJY-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical group O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 229960004622 raloxifene Drugs 0.000 description 1
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000022983 regulation of cell cycle Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 210000001210 retinal vessel Anatomy 0.000 description 1
- 238000012340 reverse transcriptase PCR Methods 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- BTIHMVBBUGXLCJ-OAHLLOKOSA-N seliciclib Chemical compound C=12N=CN(C(C)C)C2=NC(N[C@@H](CO)CC)=NC=1NCC1=CC=CC=C1 BTIHMVBBUGXLCJ-OAHLLOKOSA-N 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- FZHAPNGMFPVSLP-UHFFFAOYSA-N silanamine Chemical compound [SiH3]N FZHAPNGMFPVSLP-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229960002901 sodium glycerophosphate Drugs 0.000 description 1
- REULQIKBNNDNDX-UHFFFAOYSA-M sodium;2,3-dihydroxypropyl hydrogen phosphate Chemical compound [Na+].OCC(O)COP(O)([O-])=O REULQIKBNNDNDX-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 201000000498 stomach carcinoma Diseases 0.000 description 1
- 239000012089 stop solution Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 231100000338 sulforhodamine B assay Toxicity 0.000 description 1
- 238000003210 sulforhodamine B staining Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 229960001603 tamoxifen Drugs 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 1
- 229960001278 teniposide Drugs 0.000 description 1
- GPTXCAZYUMDUMN-UHFFFAOYSA-N tert-butyl n-(2-hydroxyethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCO GPTXCAZYUMDUMN-UHFFFAOYSA-N 0.000 description 1
- SAQUDYJOOPIKFF-UHFFFAOYSA-N tert-butyl n-(4-iodophenyl)sulfonylcarbamate Chemical compound CC(C)(C)OC(=O)NS(=O)(=O)C1=CC=C(I)C=C1 SAQUDYJOOPIKFF-UHFFFAOYSA-N 0.000 description 1
- WUJNTNXFXWMBDH-UHFFFAOYSA-N tert-butyl n-[3-(1,2,5-thiadiazol-3-yloxy)propyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCCOC=1C=NSN=1 WUJNTNXFXWMBDH-UHFFFAOYSA-N 0.000 description 1
- BRFLDTCCHALRFI-UHFFFAOYSA-N tert-butyl n-[3-(1,2-oxazol-3-yloxy)propyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCCOC=1C=CON=1 BRFLDTCCHALRFI-UHFFFAOYSA-N 0.000 description 1
- UXAXBLKYGFILKW-UHFFFAOYSA-N tert-butyl n-[4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]phenyl]sulfonyl-n-[2-(2-methoxyethoxy)ethyl]carbamate Chemical compound C1=CC(S(=O)(=O)N(C(=O)OC(C)(C)C)CCOCCOC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 UXAXBLKYGFILKW-UHFFFAOYSA-N 0.000 description 1
- XOXWZWJVPAFDCF-UHFFFAOYSA-N tert-butyl n-[4-[[4-(2,3-dimethylimidazol-4-yl)pyrimidin-2-yl]amino]phenyl]sulfonyl-n-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]carbamate Chemical compound C1=CC(S(=O)(=O)N(C(=O)OC(C)(C)C)CCOCCOCCOCCOC)=CC=C1NC1=NC=CC(C=2N(C(C)=NC=2)C)=N1 XOXWZWJVPAFDCF-UHFFFAOYSA-N 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229960003604 testosterone Drugs 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000004192 tetrahydrofuran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000003527 tetrahydropyrans Chemical group 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 125000005505 thiomorpholino group Chemical group 0.000 description 1
- 229960001196 thiotepa Drugs 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- XFCLJVABOIYOMF-QPLCGJKRSA-N toremifene Chemical compound C1=CC(OCCN(C)C)=CC=C1C(\C=1C=CC=CC=1)=C(\CCCl)C1=CC=CC=C1 XFCLJVABOIYOMF-QPLCGJKRSA-N 0.000 description 1
- 229960005026 toremifene Drugs 0.000 description 1
- 229960001727 tretinoin Drugs 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000004565 tumor cell growth Effects 0.000 description 1
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 1
- 239000005483 tyrosine kinase inhibitor Substances 0.000 description 1
- 210000003932 urinary bladder Anatomy 0.000 description 1
- 229960005356 urokinase Drugs 0.000 description 1
- 239000013598 vector Substances 0.000 description 1
- 229960004528 vincristine Drugs 0.000 description 1
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 1
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 1
- UGGWPQSBPIFKDZ-KOTLKJBCSA-N vindesine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(N)=O)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1N=C1[C]2C=CC=C1 UGGWPQSBPIFKDZ-KOTLKJBCSA-N 0.000 description 1
- 229960004355 vindesine Drugs 0.000 description 1
- GBABOYUKABKIAF-GHYRFKGUSA-N vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-GHYRFKGUSA-N 0.000 description 1
- 229960002066 vinorelbine Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 210000003905 vulva Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910000166 zirconium phosphate Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/06—Antipsoriatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Rheumatology (AREA)
- Immunology (AREA)
- Physical Education & Sports Medicine (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Hematology (AREA)
- Urology & Nephrology (AREA)
- Cardiology (AREA)
- Ophthalmology & Optometry (AREA)
- Pain & Pain Management (AREA)
- Oncology (AREA)
- Vascular Medicine (AREA)
- Heart & Thoracic Surgery (AREA)
- Dermatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Adhesives Or Adhesive Processes (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0021726.5A GB0021726D0 (en) | 2000-09-05 | 2000-09-05 | Chemical compounds |
| PCT/GB2001/003864 WO2002020512A1 (en) | 2000-09-05 | 2001-08-30 | Imidazolo-5-yl-2-anilino-pyrimidines as agents for the inhibition of the cell proliferation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SK2412003A3 SK2412003A3 (en) | 2003-09-11 |
| SK287277B6 true SK287277B6 (sk) | 2010-05-07 |
Family
ID=9898838
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK241-2003A SK287277B6 (sk) | 2000-09-05 | 2001-08-30 | Deriváty imidazol-5-yl-2-anilinopyrimidínov, spôsob ich prípravy a farmaceutická kompozícia, ktorá ich obsahuje |
Country Status (32)
| Country | Link |
|---|---|
| US (2) | US6969714B2 (enExample) |
| EP (1) | EP1351958B1 (enExample) |
| JP (1) | JP3523641B2 (enExample) |
| KR (1) | KR100802368B1 (enExample) |
| CN (1) | CN1269813C (enExample) |
| AR (1) | AR033836A1 (enExample) |
| AT (1) | ATE269327T1 (enExample) |
| AU (2) | AU2001284192B2 (enExample) |
| BG (1) | BG107579A (enExample) |
| BR (1) | BR0113496A (enExample) |
| CA (1) | CA2417148C (enExample) |
| CZ (1) | CZ2003617A3 (enExample) |
| DE (1) | DE60103935T2 (enExample) |
| DK (1) | DK1351958T3 (enExample) |
| EE (1) | EE05430B1 (enExample) |
| ES (1) | ES2221904T3 (enExample) |
| GB (1) | GB0021726D0 (enExample) |
| HU (1) | HUP0302922A3 (enExample) |
| IL (1) | IL154292A0 (enExample) |
| IS (1) | IS2055B (enExample) |
| MX (1) | MXPA03001511A (enExample) |
| MY (1) | MY127126A (enExample) |
| NO (1) | NO324059B1 (enExample) |
| NZ (1) | NZ523787A (enExample) |
| PL (1) | PL360627A1 (enExample) |
| PT (1) | PT1351958E (enExample) |
| RU (1) | RU2284327C2 (enExample) |
| SK (1) | SK287277B6 (enExample) |
| TW (1) | TWI242559B (enExample) |
| UA (1) | UA74206C2 (enExample) |
| WO (1) | WO2002020512A1 (enExample) |
| ZA (1) | ZA200300612B (enExample) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9828511D0 (en) | 1998-12-24 | 1999-02-17 | Zeneca Ltd | Chemical compounds |
| GB9919778D0 (en) | 1999-08-21 | 1999-10-27 | Zeneca Ltd | Chemical compounds |
| GB0004887D0 (en) | 2000-03-01 | 2000-04-19 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0004888D0 (en) | 2000-03-01 | 2000-04-19 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0004886D0 (en) | 2000-03-01 | 2000-04-19 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0004890D0 (en) | 2000-03-01 | 2000-04-19 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0007371D0 (en) | 2000-03-28 | 2000-05-17 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0016877D0 (en) | 2000-07-11 | 2000-08-30 | Astrazeneca Ab | Chemical compounds |
| US7122544B2 (en) * | 2000-12-06 | 2006-10-17 | Signal Pharmaceuticals, Llc | Anilinopyrimidine derivatives as IKK inhibitors and compositions and methods related thereto |
| US7129242B2 (en) | 2000-12-06 | 2006-10-31 | Signal Pharmaceuticals, Llc | Anilinopyrimidine derivatives as JNK pathway inhibitors and compositions and methods related thereto |
| GB0103926D0 (en) | 2001-02-17 | 2001-04-04 | Astrazeneca Ab | Chemical compounds |
| GB0113041D0 (en) | 2001-05-30 | 2001-07-18 | Astrazeneca Ab | Chemical compounds |
| JP2005524672A (ja) * | 2002-03-09 | 2005-08-18 | アストラゼネカ アクチボラグ | Cdk阻害活性を有するイミダゾリル置換ピリミジン誘導体 |
| GB0205693D0 (en) * | 2002-03-09 | 2002-04-24 | Astrazeneca Ab | Chemical compounds |
| GB0205690D0 (en) * | 2002-03-09 | 2002-04-24 | Astrazeneca Ab | Chemical compounds |
| GB0205688D0 (en) * | 2002-03-09 | 2002-04-24 | Astrazeneca Ab | Chemical compounds |
| AR039241A1 (es) * | 2002-04-04 | 2005-02-16 | Biogen Inc | Heteroarilos trisustituidos y metodos para su produccion y uso de los mismos |
| DE10239042A1 (de) * | 2002-08-21 | 2004-03-04 | Schering Ag | Makrozyclische Pyrimidine, deren Herstellung und Verwendung als Arzneimittel |
| UA80295C2 (en) * | 2002-09-06 | 2007-09-10 | Biogen Inc | Pyrazolopyridines and using the same |
| GB0226583D0 (en) * | 2002-11-14 | 2002-12-18 | Cyclacel Ltd | Compounds |
| GB0311274D0 (en) * | 2003-05-16 | 2003-06-18 | Astrazeneca Ab | Chemical compounds |
| GB0311276D0 (en) * | 2003-05-16 | 2003-06-18 | Astrazeneca Ab | Chemical compounds |
| GB0402277D0 (en) * | 2004-02-03 | 2004-03-10 | Astrazeneca Ab | Chemical compounds |
| TW200528101A (en) * | 2004-02-03 | 2005-09-01 | Astrazeneca Ab | Chemical compounds |
| KR20070084067A (ko) * | 2004-10-13 | 2007-08-24 | 와이어쓰 | N-벤젠설포닐 치환 아닐리노-피리미딘 동족체 |
| EP1804803A4 (en) * | 2004-10-28 | 2008-07-30 | Irm Llc | COMPOUNDS AND COMPOSITIONS AS HEDGEHOG WALK MODULATORS |
| US20090099160A1 (en) * | 2004-12-17 | 2009-04-16 | David Andrews | 4-(4-(Imidazol-4-Yl) Pyrimidin-2-Ylamino) Benzamides as CDK Inhibitors |
| CN1939910A (zh) * | 2004-12-31 | 2007-04-04 | 孙飘扬 | 氨基嘧啶类化合物及其盐和其制备方法与药物用途 |
| GB0504753D0 (en) * | 2005-03-08 | 2005-04-13 | Astrazeneca Ab | Chemical compounds |
| CA2617170A1 (en) | 2005-07-30 | 2007-02-08 | Astrazeneca Ab | Imidazolyl-pyrimidine compounds for use in the treatment of proliferative disorders |
| KR100674813B1 (ko) * | 2005-08-05 | 2007-01-29 | 일양약품주식회사 | N-페닐-2-피리미딘-아민 유도체 및 그의 제조방법 |
| BRPI0616722A2 (pt) | 2005-09-30 | 2012-12-25 | Astrazeneca Ab | composto ou um sal farmaceuticamente aceitÁvel ou um Éster hidrolisÁvel in vivo do mesmo, processo para preparar o mesmo, composiÇço farmacÊutica, uso de um composto ou um sal farmaceuticamente aceitÁvel ou um Éster hidrolisÁvel in vivo do mesmo, e, mÉtodos para produzir um efeito anti-proliferaÇço celular e um efeito inibidor cdk2, para tratar cÂncer, e para tratar doenÇas |
| AR058073A1 (es) * | 2005-10-03 | 2008-01-23 | Astrazeneca Ab | Derivados de imidazol 5-il-pirimidina, procesos de obtencion, composiciones farmaceuticas y usos |
| US20080214560A1 (en) * | 2005-10-03 | 2008-09-04 | Astrazeneca Ab | Use of Pyrimidine Derivatives in the Manufacture of a Medicament for Prevention and/or Treatment of Alzheimer's Disease |
| US20090111860A1 (en) * | 2006-04-21 | 2009-04-30 | Astrazeneca Ab | Sulfonamide compounds useful as adg receptor modulators |
| TW200811169A (en) * | 2006-05-26 | 2008-03-01 | Astrazeneca Ab | Chemical compounds |
| ATE482948T1 (de) | 2006-06-21 | 2010-10-15 | Astrazeneca Ab | Chemische verbindungen |
| TW200815418A (en) * | 2006-06-27 | 2008-04-01 | Astrazeneca Ab | New compounds I |
| TW200815417A (en) * | 2006-06-27 | 2008-04-01 | Astrazeneca Ab | New compounds II |
| BRPI0909041A2 (pt) * | 2008-03-14 | 2015-07-28 | Basf Se | Compostos, uso de compostos, processo para preparar compostos, composições agroquímicas, método para combater fungos fitopatogênicos, e, semente. |
| WO2010009139A2 (en) * | 2008-07-14 | 2010-01-21 | Gilead Colorado, Inc. | Imidazolyl pyrimidine inhibitor compounds |
| CN101503402B (zh) * | 2009-03-10 | 2014-06-25 | 沈阳药科大学 | 2-苯胺嘧啶衍生物及其制备和用途 |
| US8178529B2 (en) | 2009-04-15 | 2012-05-15 | Astrazeneca Ab | Imidazole substituted pyrimidines |
| HUE029196T2 (en) | 2010-06-04 | 2017-02-28 | Hoffmann La Roche | Aminoprimidine derivatives as LRRK2 modulators |
| SG189043A1 (en) | 2010-11-10 | 2013-05-31 | Hoffmann La Roche | Pyrazole aminopyrimidine derivatives as lrrk2 modulators |
| CN106928192B (zh) * | 2015-12-29 | 2020-11-13 | 中国科学院广州生物医药与健康研究院 | 一种嘧啶类化合物及其制备方法和应用 |
| US11066404B2 (en) | 2018-10-11 | 2021-07-20 | Incyte Corporation | Dihydropyrido[2,3-d]pyrimidinone compounds as CDK2 inhibitors |
| US11384083B2 (en) | 2019-02-15 | 2022-07-12 | Incyte Corporation | Substituted spiro[cyclopropane-1,5′-pyrrolo[2,3-d]pyrimidin]-6′(7′h)-ones as CDK2 inhibitors |
| US11472791B2 (en) | 2019-03-05 | 2022-10-18 | Incyte Corporation | Pyrazolyl pyrimidinylamine compounds as CDK2 inhibitors |
| WO2020205560A1 (en) | 2019-03-29 | 2020-10-08 | Incyte Corporation | Sulfonylamide compounds as cdk2 inhibitors |
| US11440914B2 (en) | 2019-05-01 | 2022-09-13 | Incyte Corporation | Tricyclic amine compounds as CDK2 inhibitors |
| US11447494B2 (en) | 2019-05-01 | 2022-09-20 | Incyte Corporation | Tricyclic amine compounds as CDK2 inhibitors |
| MX2022001940A (es) | 2019-08-14 | 2022-05-10 | Incyte Corp | Compuestos de imidazolil pirimidinilamina como inhibidores de cdk2. |
| CN119930610A (zh) | 2019-10-11 | 2025-05-06 | 因赛特公司 | 作为cdk2抑制剂的双环胺 |
| US12441707B2 (en) | 2019-12-30 | 2025-10-14 | Tyra Biosciences, Inc. | Indazole compounds |
| CN116528869A (zh) * | 2020-11-27 | 2023-08-01 | 安锐生物医药科技(广州)有限公司 | 氨基杂芳基激酶抑制剂 |
| JP2024523892A (ja) * | 2021-06-16 | 2024-07-02 | ブループリント メディシンズ コーポレイション | Cdk2阻害剤としての置換ピリミジニルーピラゾール |
| US11981671B2 (en) | 2021-06-21 | 2024-05-14 | Incyte Corporation | Bicyclic pyrazolyl amines as CDK2 inhibitors |
| CN113999210B (zh) * | 2021-12-03 | 2023-05-23 | 郑州大学第一附属医院 | 一组2-苯氨基-4-三氮唑基嘧啶类衍生物及其应用 |
| US11976073B2 (en) | 2021-12-10 | 2024-05-07 | Incyte Corporation | Bicyclic amines as CDK2 inhibitors |
| CN116751167B (zh) * | 2023-07-03 | 2025-09-23 | 苏州诚和医药化学有限公司 | 一种(e)-4-(1-苄基-2-甲基-1h-咪唑-5-基)-3-(乙氧基酰基)丁-3-烯酸的制备方法 |
Family Cites Families (66)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4659363A (en) | 1983-07-25 | 1987-04-21 | Ciba-Geigy Corporation | N-(2-nitrophenyl)-2-aminopyrimidine derivatives, the preparation and use thereof |
| US4946956A (en) | 1988-09-21 | 1990-08-07 | Uniroyal Chemical Company, Inc. | Arylenediamine substituted pyrimidines |
| HU206337B (en) | 1988-12-29 | 1992-10-28 | Mitsui Petrochemical Ind | Process for producing pyrimidine derivatives and pharmaceutical compositions |
| US4983608A (en) | 1989-09-05 | 1991-01-08 | Hoechst-Roussell Pharmaceuticals, Inc. | N-substituted-4-pyrimidinamines and pyrimidinediamines |
| GB9012592D0 (en) | 1990-06-06 | 1990-07-25 | Smithkline Beecham Intercredit | Compounds |
| AU658646B2 (en) | 1991-05-10 | 1995-04-27 | Rhone-Poulenc Rorer International (Holdings) Inc. | Bis mono-and bicyclic aryl and heteroaryl compounds which inhibit EGF and/or PDGF receptor tyrosine kinase |
| US5521184A (en) | 1992-04-03 | 1996-05-28 | Ciba-Geigy Corporation | Pyrimidine derivatives and processes for the preparation thereof |
| US5516775A (en) | 1992-08-31 | 1996-05-14 | Ciba-Geigy Corporation | Further use of pyrimidine derivatives |
| PT664291E (pt) | 1992-10-05 | 2000-11-30 | Ube Industries | Composto de pirimidina |
| IL110296A (en) * | 1993-07-16 | 1999-12-31 | Smithkline Beecham Corp | Imidazole compounds process for their preparation and pharmaceutical compositions containing them |
| US5543520A (en) | 1993-10-01 | 1996-08-06 | Ciba-Geigy Corporation | Pyrimidine derivatives |
| DE69434721T2 (de) | 1993-10-01 | 2006-11-09 | Novartis Ag | Pharmacologisch wirksame pyrimidinderivate und verfahren zu deren herstellung |
| DK0672041T3 (da) | 1993-10-01 | 2002-02-25 | Novartis Ag | Farmakologisk aktive pyridinderivater og fremgangsmåder til fremstilling deraf |
| EP0672035A1 (en) | 1993-10-01 | 1995-09-20 | Novartis AG | Pyrimidineamine derivatives and processes for the preparation thereof |
| GB9325217D0 (en) | 1993-12-09 | 1994-02-09 | Zeneca Ltd | Pyrimidine derivatives |
| US5494998A (en) | 1994-11-14 | 1996-02-27 | Akzo Nobel N.V. | Polymerization of carbon monoxide and ethylene using catalyst containing non-coordinating, non-acidic anion |
| ATE251141T1 (de) | 1995-03-10 | 2003-10-15 | Berlex Lab | Benzamidin-derivate, deren herstellung und deren verwendung als anti-koagulantien |
| US5739143A (en) | 1995-06-07 | 1998-04-14 | Smithkline Beecham Corporation | Imidazole compounds and compositions |
| US5658903A (en) | 1995-06-07 | 1997-08-19 | Smithkline Beecham Corporation | Imidazole compounds, compositions and use |
| GB9523675D0 (en) | 1995-11-20 | 1996-01-24 | Celltech Therapeutics Ltd | Chemical compounds |
| JP2000507558A (ja) | 1996-03-25 | 2000-06-20 | スミスクライン・ビーチャム・コーポレイション | Cns損傷についての新規な治療 |
| AU2381397A (en) | 1996-04-19 | 1997-11-12 | Novo Nordisk A/S | Modulators of molecules with phosphotyrosine recognition units |
| TW440563B (en) | 1996-05-23 | 2001-06-16 | Hoffmann La Roche | Aryl pyrimidine derivatives and a pharmaceutical composition thereof |
| EP0906307B1 (en) * | 1996-06-10 | 2005-04-27 | Merck & Co., Inc. | Substituted imidazoles having cytokine inhibitory activity |
| GB9619284D0 (en) | 1996-09-16 | 1996-10-30 | Celltech Therapeutics Ltd | Chemical compounds |
| AU5147598A (en) | 1996-10-17 | 1998-05-11 | Smithkline Beecham Corporation | Methods for reversibly inhibiting myelopoiesis in mammalian tissue |
| GB9622363D0 (en) | 1996-10-28 | 1997-01-08 | Celltech Therapeutics Ltd | Chemical compounds |
| ZA9711092B (en) | 1996-12-11 | 1999-07-22 | Smithkline Beecham Corp | Novel compounds. |
| DE69839338T2 (de) | 1997-02-05 | 2008-07-10 | Warner-Lambert Company Llc | Pyrido (2,3-d) pyrimidine und 4-amino-pyrimidine als inhibitoren der zellulären proliferation |
| DE19710435A1 (de) | 1997-03-13 | 1998-09-17 | Hoechst Ag | Verwendung von Pyrimidinderivaten zur Prävention von Krebs allein oder in Kombination mit anderen therapeutischen Maßnahmen |
| GB9705361D0 (en) | 1997-03-14 | 1997-04-30 | Celltech Therapeutics Ltd | Chemical compounds |
| AU734009B2 (en) | 1997-05-30 | 2001-05-31 | Merck & Co., Inc. | Novel angiogenesis inhibitors |
| PT988301E (pt) | 1997-06-12 | 2006-10-31 | Aventis Pharma Ltd | Acetais ciclicos de imidazolilo |
| TW517055B (en) | 1997-07-02 | 2003-01-11 | Smithkline Beecham Corp | Novel substituted imidazole compounds |
| JP2001519345A (ja) | 1997-10-02 | 2001-10-23 | メルク エンド カムパニー インコーポレーテッド | プレニルタンパク質トランスフェラーゼの阻害剤 |
| EP1021173A1 (en) | 1997-10-10 | 2000-07-26 | Imperial College Innovations Limited | Use of csaid?tm compounds for the management of uterine contractions |
| DE69839735D1 (de) | 1997-12-15 | 2008-08-28 | Astellas Pharma Inc | Pyrimidin-5-carboxamid-derivate |
| AU1924699A (en) * | 1997-12-19 | 1999-07-12 | Smithkline Beecham Corporation | Compounds of heteroaryl substituted imidazole, their pharmaceutical compositionsand uses |
| BR9908004A (pt) | 1998-02-17 | 2001-12-18 | Tularik Inc | Composto, composição e método para prevençãoou supressão de uma infecção viral |
| NZ506679A (en) | 1998-03-27 | 2002-11-26 | Janssen Pharmaceutica Nv | HIV inhibiting pyrimidine derivatives |
| GB9806739D0 (en) | 1998-03-28 | 1998-05-27 | Univ Newcastle Ventures Ltd | Cyclin dependent kinase inhibitors |
| DE69933680T2 (de) | 1998-08-29 | 2007-08-23 | Astrazeneca Ab | Pyrimidine verbindungen |
| DE69932828T2 (de) | 1998-08-29 | 2007-10-18 | Astrazeneca Ab | Pyrimidine verbindungen |
| JP2002527359A (ja) | 1998-09-18 | 2002-08-27 | ビーエーエスエフ アクチェンゲゼルシャフト | キナーゼインヒビターとしての4−アミノピロリピリミジン |
| AU6476599A (en) * | 1998-11-03 | 2000-05-22 | Novartis Ag | Anti-inflammatory 4-phenyl-5-pyrimidinyl-imidazoles |
| GB9828511D0 (en) | 1998-12-24 | 1999-02-17 | Zeneca Ltd | Chemical compounds |
| GB9903762D0 (en) | 1999-02-18 | 1999-04-14 | Novartis Ag | Organic compounds |
| GB9905075D0 (en) | 1999-03-06 | 1999-04-28 | Zeneca Ltd | Chemical compounds |
| US6627633B2 (en) | 1999-03-17 | 2003-09-30 | Albany Molecular Research, Inc. | 6-substituted biaryl purine derivatives as potent cyclin/CDK inhibitors and antiproliferative agents |
| GB9907658D0 (en) | 1999-04-06 | 1999-05-26 | Zeneca Ltd | Chemical compounds |
| GB9914258D0 (en) | 1999-06-18 | 1999-08-18 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9919778D0 (en) | 1999-08-21 | 1999-10-27 | Zeneca Ltd | Chemical compounds |
| GB9924862D0 (en) | 1999-10-20 | 1999-12-22 | Celltech Therapeutics Ltd | Chemical compounds |
| ES2254238T3 (es) | 1999-10-27 | 2006-06-16 | Novartis Ag | Compuestos de tiazol e imidazo(4,5-b)piridina y su uso farmaceutico. |
| HK1050190A1 (zh) | 1999-11-22 | 2003-06-13 | Smithkline Beecham Plc | 咪唑衍生物和它们做为raf激酶抑制剂的用途 |
| EP1246823A1 (en) | 1999-12-28 | 2002-10-09 | Pharmacopeia, Inc. | Pyrimidine and triazine kinase inhibitors |
| MXPA02007957A (es) | 2000-02-17 | 2002-11-29 | Amgen Inc | Inhibidores de cinasas. |
| GB0004888D0 (en) | 2000-03-01 | 2000-04-19 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0004887D0 (en) | 2000-03-01 | 2000-04-19 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0004890D0 (en) | 2000-03-01 | 2000-04-19 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0004886D0 (en) | 2000-03-01 | 2000-04-19 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0007371D0 (en) | 2000-03-28 | 2000-05-17 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0016877D0 (en) | 2000-07-11 | 2000-08-30 | Astrazeneca Ab | Chemical compounds |
| GB0103926D0 (en) | 2001-02-17 | 2001-04-04 | Astrazeneca Ab | Chemical compounds |
| GB0113041D0 (en) | 2001-05-30 | 2001-07-18 | Astrazeneca Ab | Chemical compounds |
| WO2003040131A1 (en) * | 2001-11-07 | 2003-05-15 | F. Hoffmann-La Roche Ag | Aminopyrimidines and pyridines |
-
2000
- 2000-09-05 GB GBGB0021726.5A patent/GB0021726D0/en not_active Ceased
-
2001
- 2001-08-30 CN CNB018151744A patent/CN1269813C/zh not_active Expired - Fee Related
- 2001-08-30 NZ NZ523787A patent/NZ523787A/en unknown
- 2001-08-30 EP EP01963159A patent/EP1351958B1/en not_active Expired - Lifetime
- 2001-08-30 CA CA2417148A patent/CA2417148C/en not_active Expired - Fee Related
- 2001-08-30 BR BR0113496-5A patent/BR0113496A/pt not_active Application Discontinuation
- 2001-08-30 WO PCT/GB2001/003864 patent/WO2002020512A1/en not_active Ceased
- 2001-08-30 UA UA2003042977A patent/UA74206C2/uk unknown
- 2001-08-30 AT AT01963159T patent/ATE269327T1/de active
- 2001-08-30 HU HU0302922A patent/HUP0302922A3/hu unknown
- 2001-08-30 CZ CZ2003617A patent/CZ2003617A3/cs unknown
- 2001-08-30 US US10/363,655 patent/US6969714B2/en not_active Expired - Fee Related
- 2001-08-30 ES ES01963159T patent/ES2221904T3/es not_active Expired - Lifetime
- 2001-08-30 DE DE60103935T patent/DE60103935T2/de not_active Expired - Lifetime
- 2001-08-30 PL PL36062701A patent/PL360627A1/xx not_active Application Discontinuation
- 2001-08-30 DK DK01963159T patent/DK1351958T3/da active
- 2001-08-30 SK SK241-2003A patent/SK287277B6/sk not_active IP Right Cessation
- 2001-08-30 RU RU2003109612/04A patent/RU2284327C2/ru not_active IP Right Cessation
- 2001-08-30 KR KR1020037003215A patent/KR100802368B1/ko not_active Expired - Fee Related
- 2001-08-30 AU AU2001284192A patent/AU2001284192B2/en not_active Ceased
- 2001-08-30 IL IL15429201A patent/IL154292A0/xx not_active IP Right Cessation
- 2001-08-30 JP JP2002525133A patent/JP3523641B2/ja not_active Expired - Fee Related
- 2001-08-30 MX MXPA03001511A patent/MXPA03001511A/es active IP Right Grant
- 2001-08-30 EE EEP200300088A patent/EE05430B1/xx not_active IP Right Cessation
- 2001-08-30 AU AU8419201A patent/AU8419201A/xx active Pending
- 2001-08-30 PT PT01963159T patent/PT1351958E/pt unknown
- 2001-09-03 MY MYPI20014136 patent/MY127126A/en unknown
- 2001-09-05 AR ARP010104228A patent/AR033836A1/es unknown
- 2001-09-11 TW TW090122494A patent/TWI242559B/zh not_active IP Right Cessation
-
2003
- 2003-01-22 ZA ZA200300612A patent/ZA200300612B/en unknown
- 2003-02-12 IS IS6715A patent/IS2055B/is unknown
- 2003-02-21 BG BG107579A patent/BG107579A/bg unknown
- 2003-03-04 NO NO20031006A patent/NO324059B1/no not_active IP Right Cessation
-
2005
- 2005-06-29 US US11/169,197 patent/US20060004033A1/en not_active Abandoned
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SK287277B6 (sk) | Deriváty imidazol-5-yl-2-anilinopyrimidínov, spôsob ich prípravy a farmaceutická kompozícia, ktorá ich obsahuje | |
| JP4913305B2 (ja) | ピリミジン化合物 | |
| JP4528131B2 (ja) | ピラゾール化合物 | |
| AU2005315392B2 (en) | 4- (4- (imidazol-4-yl) pyrimidin-2-ylamino) benzamides as CDK inhibitors | |
| SK282003A3 (en) | Pyrimidine derivatives, method for their preparation and pharmaceutical composition comprising the same | |
| CN112638373A (zh) | 细胞周期蛋白依赖性激酶抑制剂 | |
| AU2001284192A1 (en) | Imidazolo-5-yl-2-anilino-pyrimidines as agents for the inhibition of the cell proliferation | |
| JP2006508997A (ja) | Chk−、Pdk−およびAkt−阻害性ピリミジン、それらの製造および薬剤としての使用 | |
| BG65566B1 (bg) | Производни на имидазо[1,2-a] пиридин и пиразоло[2,3-a]пиридин | |
| PT1278735E (pt) | 2,4-di(hetero-)arilamino(-oxi)-pirimidinas substituídas na posição 5 como agentes antineoplásicos | |
| KR20060129040A (ko) | 세포 증식 억제제로서의이미다졸로-5-일-2-아닐리노피리미딘 | |
| TWI327146B (en) | Pyrimidine derivatives for inhibition of cell proliferation | |
| TWI291960B (en) | Pyrimidine compounds of formula (ι),and pharmaceutical composition having cell-cycle inhibitory activity comprising the | |
| HK1057553B (en) | Imidazolo-5-yl-2-anilino-pyrimidines as agents for the inhibition of the cell proliferation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed due to non-payment of maintenance fees |
Effective date: 20110830 |