SK282548B6 - Substituované aminoalkánfosfónové kyseliny, spôsob ich prípravy, farmaceutické prostriedky, ktoré ich obsahujú, a ich použitie - Google Patents
Substituované aminoalkánfosfónové kyseliny, spôsob ich prípravy, farmaceutické prostriedky, ktoré ich obsahujú, a ich použitie Download PDFInfo
- Publication number
- SK282548B6 SK282548B6 SK523-99A SK52399A SK282548B6 SK 282548 B6 SK282548 B6 SK 282548B6 SK 52399 A SK52399 A SK 52399A SK 282548 B6 SK282548 B6 SK 282548B6
- Authority
- SK
- Slovakia
- Prior art keywords
- ylmethyl
- dioxo
- acid
- tetrahydroquinoxalin
- nitro
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 19
- 239000000825 pharmaceutical preparation Substances 0.000 title abstract 2
- 150000003009 phosphonic acids Chemical class 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 129
- 125000001118 alkylidene group Chemical group 0.000 claims abstract description 72
- 150000003839 salts Chemical class 0.000 claims abstract description 57
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 40
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 30
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 19
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 18
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 18
- 239000001257 hydrogen Substances 0.000 claims abstract description 17
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 16
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 16
- 150000002367 halogens Chemical class 0.000 claims abstract description 16
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 13
- 125000003118 aryl group Chemical group 0.000 claims abstract description 5
- 230000000903 blocking effect Effects 0.000 claims abstract description 4
- 230000001575 pathological effect Effects 0.000 claims abstract 3
- 239000003814 drug Substances 0.000 claims abstract 2
- -1 aromatic radical Chemical class 0.000 claims description 221
- 239000002253 acid Substances 0.000 claims description 74
- 239000000203 mixture Substances 0.000 claims description 58
- 125000004432 carbon atom Chemical group C* 0.000 claims description 50
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 47
- 125000000217 alkyl group Chemical group 0.000 claims description 45
- 125000002947 alkylene group Chemical group 0.000 claims description 36
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 36
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 32
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 31
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 19
- 150000003254 radicals Chemical class 0.000 claims description 19
- 125000006239 protecting group Chemical group 0.000 claims description 18
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 16
- 150000007513 acids Chemical class 0.000 claims description 15
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 14
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 11
- 229910052794 bromium Inorganic materials 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 125000004980 cyclopropylene group Chemical group 0.000 claims description 11
- 239000008194 pharmaceutical composition Substances 0.000 claims description 11
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 9
- 125000001624 naphthyl group Chemical group 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 8
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 7
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- GATNOFPXSDHULC-UHFFFAOYSA-N ethylphosphonic acid Chemical compound CCP(O)(O)=O GATNOFPXSDHULC-UHFFFAOYSA-N 0.000 claims description 6
- 125000004957 naphthylene group Chemical group 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- MGRVRXRGTBOSHW-UHFFFAOYSA-N (aminomethyl)phosphonic acid Chemical compound NCP(O)(O)=O MGRVRXRGTBOSHW-UHFFFAOYSA-N 0.000 claims description 5
- 125000005654 1,2-cyclohexylene group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([*:2])C([H])([*:1])C1([H])[H] 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 102000018899 Glutamate Receptors Human genes 0.000 claims description 5
- 108010027915 Glutamate Receptors Proteins 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 5
- UYLUJGRCKKSWHS-UHFFFAOYSA-N prop-1-en-1-one Chemical group CC=C=O UYLUJGRCKKSWHS-UHFFFAOYSA-N 0.000 claims description 5
- AYPCRYQYBWTXNP-UHFFFAOYSA-N 2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propan-2-ylphosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(C)(C)P(O)(O)=O AYPCRYQYBWTXNP-UHFFFAOYSA-N 0.000 claims description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- 241001465754 Metazoa Species 0.000 claims description 4
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical group C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 claims description 4
- WWQAGDWTJOKFQB-UHFFFAOYSA-N penta-1,2,3-triene Chemical group CC=C=C=C WWQAGDWTJOKFQB-UHFFFAOYSA-N 0.000 claims description 4
- RZGZTQYTDRQOEY-UHFFFAOYSA-N 2-phenylethenone Chemical group O=C=CC1=CC=CC=C1 RZGZTQYTDRQOEY-UHFFFAOYSA-N 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 238000003776 cleavage reaction Methods 0.000 claims description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 3
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 claims description 3
- 230000007017 scission Effects 0.000 claims description 3
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 3
- KCEGUPPDVPWCCX-UHFFFAOYSA-N 6-bromo-1,4-dihydroquinoxaline-2,3-dione Chemical compound C1=C(Br)C=C2N=C(O)C(O)=NC2=C1 KCEGUPPDVPWCCX-UHFFFAOYSA-N 0.000 claims description 2
- DPFHVUSPVHRVFL-YFKPBYRVSA-N CGP 78608 Chemical compound N1C(=O)C(=O)NC2=C1C=C(Br)C=C2CN[C@H](C)P(O)(O)=O DPFHVUSPVHRVFL-YFKPBYRVSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- RDTOXUOEIJUIMX-RXMQYKEDSA-N [(1r)-1-[[2,3-dioxo-7-(trifluoromethyl)-1,4-dihydroquinoxalin-5-yl]methylamino]ethyl]phosphonic acid Chemical compound OC1=C(O)N=C2C(CN[C@@H](C)P(O)(O)=O)=CC(C(F)(F)F)=CC2=N1 RDTOXUOEIJUIMX-RXMQYKEDSA-N 0.000 claims description 2
- FFNKJJGOLMFZKR-UHFFFAOYSA-N [1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-2-methylpropyl]phosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C(Br)C=C2CNC(C(C)C)P(O)(O)=O FFNKJJGOLMFZKR-UHFFFAOYSA-N 0.000 claims description 2
- YEDFXUYTNVGXMI-UHFFFAOYSA-N [acetyl-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]methylphosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C(Br)C=C2CN(C(=O)C)CP(O)(O)=O YEDFXUYTNVGXMI-UHFFFAOYSA-N 0.000 claims description 2
- IGMCOMPQIJDGTG-UHFFFAOYSA-N [acetyl-[(7-chloro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]methylphosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C(Cl)C=C2CN(C(=O)C)CP(O)(O)=O IGMCOMPQIJDGTG-UHFFFAOYSA-N 0.000 claims description 2
- ZSWDXFYLSPZCAS-UHFFFAOYSA-N [acetyl-[(7-fluoro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]methylphosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C(F)C=C2CN(C(=O)C)CP(O)(O)=O ZSWDXFYLSPZCAS-UHFFFAOYSA-N 0.000 claims description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 2
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 239000000470 constituent Substances 0.000 claims description 2
- FNIATMYXUPOJRW-UHFFFAOYSA-N cyclohexylidene Chemical group [C]1CCCCC1 FNIATMYXUPOJRW-UHFFFAOYSA-N 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 claims description 2
- AKWJYUMMADUPTI-UHFFFAOYSA-N methyl-[2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-2-phenylethyl]phosphinic acid Chemical compound C=1C([N+]([O-])=O)=CC=2NC(=O)C(=O)NC=2C=1CNC(CP(O)(=O)C)C1=CC=CC=C1 AKWJYUMMADUPTI-UHFFFAOYSA-N 0.000 claims description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 230000001225 therapeutic effect Effects 0.000 claims description 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 2
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 claims 2
- BPKBZWYRUMZASQ-UHFFFAOYSA-N [2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]phenyl]phosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1NCC1=CC([N+]([O-])=O)=CC2=C1NC(=O)C(=O)N2 BPKBZWYRUMZASQ-UHFFFAOYSA-N 0.000 claims 2
- FBWJHGIUUCOZRM-UHFFFAOYSA-N cyclopropylphosphonic acid Chemical compound OP(O)(=O)C1CC1 FBWJHGIUUCOZRM-UHFFFAOYSA-N 0.000 claims 2
- LIOJCWAFYUDVHX-UHFFFAOYSA-N 1-[methyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]ethylphosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CN(C)C(C)P(O)(O)=O LIOJCWAFYUDVHX-UHFFFAOYSA-N 0.000 claims 1
- SYYQEOFYTUZDNR-UHFFFAOYSA-N 2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]butylphosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(CP(O)(O)=O)CC SYYQEOFYTUZDNR-UHFFFAOYSA-N 0.000 claims 1
- ULDWFUDJBUUECX-UHFFFAOYSA-N 2-[ethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]ethylphosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CN(CCP(O)(O)=O)CC ULDWFUDJBUUECX-UHFFFAOYSA-N 0.000 claims 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims 1
- RNOLFZACEWWIHP-UHFFFAOYSA-N 6-chloro-1,4-dihydroquinoxaline-2,3-dione Chemical compound N1C(=O)C(=O)NC2=CC(Cl)=CC=C21 RNOLFZACEWWIHP-UHFFFAOYSA-N 0.000 claims 1
- RYMLSFWVYNAKAR-UHFFFAOYSA-N 6-nitro-1,4-dihydroquinoxaline-2,3-dione Chemical compound N1C(=O)C(=O)NC2=CC([N+](=O)[O-])=CC=C21 RYMLSFWVYNAKAR-UHFFFAOYSA-N 0.000 claims 1
- VFTOHJFKIJLYKN-UHFFFAOYSA-N 7-nitro-9h-fluoren-2-ol Chemical group [O-][N+](=O)C1=CC=C2C3=CC=C(O)C=C3CC2=C1 VFTOHJFKIJLYKN-UHFFFAOYSA-N 0.000 claims 1
- OHWRASKXEUIFFB-UHFFFAOYSA-N NCP(O)=O Chemical compound NCP(O)=O OHWRASKXEUIFFB-UHFFFAOYSA-N 0.000 claims 1
- MAFWWRJSLIPCQX-UHFFFAOYSA-N O=C1NC2=CC(=CC(=C2NC1=O)CCC(NCC)P(O)(O)=O)[N+](=O)[O-] Chemical compound O=C1NC2=CC(=CC(=C2NC1=O)CCC(NCC)P(O)(O)=O)[N+](=O)[O-] MAFWWRJSLIPCQX-UHFFFAOYSA-N 0.000 claims 1
- RRLCZKWJPVJUSD-UHFFFAOYSA-N [(3-hydroxyphenyl)-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]methyl]phosphonic acid Chemical compound OC1=CC=CC(C(NCC=2C=3NC(=O)C(=O)NC=3C=C(C=2)[N+]([O-])=O)P(O)(O)=O)=C1 RRLCZKWJPVJUSD-UHFFFAOYSA-N 0.000 claims 1
- UUIWLVZPDQFCPP-UHFFFAOYSA-N [1-(4-methoxyphenyl)-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid Chemical compound C1=CC(OC)=CC=C1C(P(O)(O)=O)CNCC1=CC([N+]([O-])=O)=CC2=C1NC(=O)C(=O)N2 UUIWLVZPDQFCPP-UHFFFAOYSA-N 0.000 claims 1
- GZTLDIMDXMFIAC-UHFFFAOYSA-N [1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]cyclopropyl]phosphonic acid Chemical compound C=1C(Br)=CC=2NC(=O)C(=O)NC=2C=1CNC1(P(O)(=O)O)CC1 GZTLDIMDXMFIAC-UHFFFAOYSA-N 0.000 claims 1
- VDHUUTXXAOWEMT-UHFFFAOYSA-N [2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-3-phenoxypropyl]phosphonic acid Chemical compound C=1C([N+]([O-])=O)=CC=2NC(=O)C(=O)NC=2C=1CNC(CP(O)(=O)O)COC1=CC=CC=C1 VDHUUTXXAOWEMT-UHFFFAOYSA-N 0.000 claims 1
- YKFXIXPHWMHGFH-UHFFFAOYSA-N [2-cyclohexyl-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid Chemical compound C=1C([N+]([O-])=O)=CC=2NC(=O)C(=O)NC=2C=1CNC(CP(O)(=O)O)C1CCCCC1 YKFXIXPHWMHGFH-UHFFFAOYSA-N 0.000 claims 1
- FRCPMEIRQMUAMA-UHFFFAOYSA-N [2-methoxy-1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(COC)P(O)(O)=O FRCPMEIRQMUAMA-UHFFFAOYSA-N 0.000 claims 1
- GONNEIKYHFCBGU-UHFFFAOYSA-N [2-methyl-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propyl]phosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(C)(CP(O)(O)=O)C GONNEIKYHFCBGU-UHFFFAOYSA-N 0.000 claims 1
- CYPZMRUQQQRAMY-UHFFFAOYSA-N [3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-3-oxoprop-1-enyl]phosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(=O)C=CP(O)(=O)O CYPZMRUQQQRAMY-UHFFFAOYSA-N 0.000 claims 1
- ZADLZIUBGJKARY-UHFFFAOYSA-N [3-methyl-1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]butyl]phosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(CC(C)C)P(O)(O)=O ZADLZIUBGJKARY-UHFFFAOYSA-N 0.000 claims 1
- XBNSDEAMAMVBJN-UHFFFAOYSA-N [benzyl-[(7-chloro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]methylphosphonic acid Chemical compound C=1C(Cl)=CC=2NC(=O)C(=O)NC=2C=1CN(CP(O)(=O)O)CC1=CC=CC=C1 XBNSDEAMAMVBJN-UHFFFAOYSA-N 0.000 claims 1
- 229940058182 aminoethylphosphinic acid Drugs 0.000 claims 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims 1
- 125000003884 phenylalkyl group Chemical group 0.000 claims 1
- 150000001413 amino acids Chemical class 0.000 abstract 1
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 90
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 52
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- 235000002639 sodium chloride Nutrition 0.000 description 48
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 45
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- 238000002844 melting Methods 0.000 description 42
- 230000008018 melting Effects 0.000 description 42
- 238000000354 decomposition reaction Methods 0.000 description 39
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 38
- 239000000243 solution Substances 0.000 description 32
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 30
- 238000005160 1H NMR spectroscopy Methods 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 27
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 25
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- 239000013078 crystal Substances 0.000 description 19
- 239000007787 solid Substances 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- 239000012074 organic phase Substances 0.000 description 18
- 239000002585 base Substances 0.000 description 17
- 239000007858 starting material Substances 0.000 description 17
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 15
- 235000019341 magnesium sulphate Nutrition 0.000 description 15
- 125000004043 oxo group Chemical group O=* 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 14
- 239000004480 active ingredient Substances 0.000 description 14
- 239000012267 brine Substances 0.000 description 14
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 14
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- 239000000725 suspension Substances 0.000 description 13
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 12
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- 239000002904 solvent Substances 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 9
- 238000004949 mass spectrometry Methods 0.000 description 9
- 239000000155 melt Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 229910052938 sodium sulfate Inorganic materials 0.000 description 9
- 235000011152 sodium sulphate Nutrition 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 125000003342 alkenyl group Chemical group 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 239000003826 tablet Substances 0.000 description 8
- 108010010803 Gelatin Proteins 0.000 description 7
- 229920002472 Starch Polymers 0.000 description 7
- 239000008273 gelatin Substances 0.000 description 7
- 229920000159 gelatin Polymers 0.000 description 7
- 235000019322 gelatine Nutrition 0.000 description 7
- 235000011852 gelatine desserts Nutrition 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 235000015424 sodium Nutrition 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 235000019698 starch Nutrition 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 102000003678 AMPA Receptors Human genes 0.000 description 6
- 108090000078 AMPA Receptors Proteins 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 102000005962 receptors Human genes 0.000 description 6
- 108020003175 receptors Proteins 0.000 description 6
- 125000001544 thienyl group Chemical group 0.000 description 6
- NPYSGAQZDKLFNW-UHFFFAOYSA-N (2,3-dimethoxy-7-nitroquinoxalin-5-yl)methanamine Chemical compound [O-][N+](=O)C1=CC(CN)=C2N=C(OC)C(OC)=NC2=C1 NPYSGAQZDKLFNW-UHFFFAOYSA-N 0.000 description 5
- WIQNHLFZBWOETQ-UHFFFAOYSA-N 5-(bromomethyl)-2,3-dimethoxy-7-nitroquinoxaline Chemical compound [O-][N+](=O)C1=CC(CBr)=C2N=C(OC)C(OC)=NC2=C1 WIQNHLFZBWOETQ-UHFFFAOYSA-N 0.000 description 5
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical group OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 5
- RSWGJHLUYNHPMX-ONCXSQPRSA-N abietic acid Chemical compound C([C@@H]12)CC(C(C)C)=CC1=CC[C@@H]1[C@]2(C)CCC[C@@]1(C)C(O)=O RSWGJHLUYNHPMX-ONCXSQPRSA-N 0.000 description 5
- 150000003973 alkyl amines Chemical class 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 125000002541 furyl group Chemical group 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000008107 starch Substances 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- BXONPISGPFGJBD-UHFFFAOYSA-N 5-(bromomethyl)-2,3-dimethoxyquinoxaline Chemical compound C1=CC(CBr)=C2N=C(OC)C(OC)=NC2=C1 BXONPISGPFGJBD-UHFFFAOYSA-N 0.000 description 4
- ALDVLDSZTBKTQX-UHFFFAOYSA-N 7-bromo-5-(bromomethyl)-2,3-dimethoxyquinoxaline Chemical compound BrC1=CC(CBr)=C2N=C(OC)C(OC)=NC2=C1 ALDVLDSZTBKTQX-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 206010010904 Convulsion Diseases 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- 102000004868 N-Methyl-D-Aspartate Receptors Human genes 0.000 description 4
- 108090001041 N-Methyl-D-Aspartate Receptors Proteins 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 235000006408 oxalic acid Nutrition 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 229920001592 potato starch Polymers 0.000 description 4
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- ZOBFQZDTPCNMRE-UHFFFAOYSA-N 2,3-dimethoxy-7-nitroquinoxaline-5-carbaldehyde Chemical compound [O-][N+](=O)C1=CC(C=O)=C2N=C(OC)C(OC)=NC2=C1 ZOBFQZDTPCNMRE-UHFFFAOYSA-N 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- RJQYGBGKHCCEHI-UHFFFAOYSA-N 7-bromo-2,3-dimethoxy-5-methylquinoxaline Chemical compound BrC1=CC(C)=C2N=C(OC)C(OC)=NC2=C1 RJQYGBGKHCCEHI-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- 229920000858 Cyclodextrin Polymers 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 239000004471 Glycine Substances 0.000 description 3
- 208000018737 Parkinson disease Diseases 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 125000004450 alkenylene group Chemical group 0.000 description 3
- 125000003282 alkyl amino group Chemical group 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- IYYIVELXUANFED-UHFFFAOYSA-N bromo(trimethyl)silane Chemical compound C[Si](C)(C)Br IYYIVELXUANFED-UHFFFAOYSA-N 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000036461 convulsion Effects 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 229940097362 cyclodextrins Drugs 0.000 description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- SCIVRAGECPBNSR-UHFFFAOYSA-N n-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-1-dimethoxyphosphorylethanamine Chemical compound [O-][N+](=O)C1=CC(CNC(C)P(=O)(OC)OC)=C2N=C(OC)C(OC)=NC2=C1 SCIVRAGECPBNSR-UHFFFAOYSA-N 0.000 description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 125000000168 pyrrolyl group Chemical group 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 150000003626 triacylglycerols Chemical class 0.000 description 3
- KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 2
- USQDTUQBMYGSMF-LLVKDONJSA-N (1r)-n-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-1-dimethoxyphosphoryl-n-ethylethanamine Chemical compound COC1=C(OC)N=C2C(CN(CC)[C@@H](C)P(=O)(OC)OC)=CC([N+]([O-])=O)=CC2=N1 USQDTUQBMYGSMF-LLVKDONJSA-N 0.000 description 2
- SCIVRAGECPBNSR-SECBINFHSA-N (1r)-n-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-1-dimethoxyphosphorylethanamine Chemical compound [O-][N+](=O)C1=CC(CN[C@@H](C)P(=O)(OC)OC)=C2N=C(OC)C(OC)=NC2=C1 SCIVRAGECPBNSR-SECBINFHSA-N 0.000 description 2
- VIEUAFSGNBPBCH-UHFFFAOYSA-N (7-bromo-2,3-dimethoxyquinoxalin-5-yl)methanamine Chemical compound BrC1=CC(CN)=C2N=C(OC)C(OC)=NC2=C1 VIEUAFSGNBPBCH-UHFFFAOYSA-N 0.000 description 2
- KMOCUZKEIUYVDJ-UHFFFAOYSA-N (7-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanamine Chemical compound FC1=CC(CN)=C2N=C(OC)C(OC)=NC2=C1 KMOCUZKEIUYVDJ-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
- OPGMBWTXOWDJCH-UHFFFAOYSA-N 2,3,7-trichloro-5-methylquinoxaline Chemical compound ClC1=C(Cl)N=C2C(C)=CC(Cl)=CC2=N1 OPGMBWTXOWDJCH-UHFFFAOYSA-N 0.000 description 2
- FQGJOIWUNJTHTA-UHFFFAOYSA-N 2,3-dichloro-7-fluoro-5-methylquinoxaline Chemical compound ClC1=C(Cl)N=C2C(C)=CC(F)=CC2=N1 FQGJOIWUNJTHTA-UHFFFAOYSA-N 0.000 description 2
- DAFJCYFWAYAWRE-UHFFFAOYSA-N 2,3-dimethoxy-8-methylquinoxaline-6-carbonitrile Chemical compound N#CC1=CC(C)=C2N=C(OC)C(OC)=NC2=C1 DAFJCYFWAYAWRE-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- MBWBDRZEHUQKHL-UHFFFAOYSA-N 5-(azidomethyl)-7-bromo-2,3-dimethoxyquinoxaline Chemical compound BrC1=CC(CN=[N+]=[N-])=C2N=C(OC)C(OC)=NC2=C1 MBWBDRZEHUQKHL-UHFFFAOYSA-N 0.000 description 2
- OKCLJPNHVQXYQL-UHFFFAOYSA-N 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline Chemical compound FC1=CC(CN=[N+]=[N-])=C2N=C(OC)C(OC)=NC2=C1 OKCLJPNHVQXYQL-UHFFFAOYSA-N 0.000 description 2
- IMPMNLFMEPKUHP-UHFFFAOYSA-N 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline Chemical compound FC1=CC(CBr)=C2N=C(OC)C(OC)=NC2=C1 IMPMNLFMEPKUHP-UHFFFAOYSA-N 0.000 description 2
- UOFSLKHZOPVGHG-UHFFFAOYSA-N 5-bromo-3-methylbenzene-1,2-diamine Chemical compound CC1=CC(Br)=CC(N)=C1N UOFSLKHZOPVGHG-UHFFFAOYSA-N 0.000 description 2
- BZQWMNWLDUNJJX-UHFFFAOYSA-N 5-fluoro-3-methylbenzene-1,2-diamine Chemical compound CC1=CC(F)=CC(N)=C1N BZQWMNWLDUNJJX-UHFFFAOYSA-N 0.000 description 2
- WTQVFAOHUSTAOE-UHFFFAOYSA-N 5-methyl-7-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione Chemical compound N1C(=O)C(=O)NC2=C1C=C(C(F)(F)F)C=C2C WTQVFAOHUSTAOE-UHFFFAOYSA-N 0.000 description 2
- VIRNTWOBZDFPTL-UHFFFAOYSA-N 7-bromo-2,3-dichloro-5-methylquinoxaline Chemical compound ClC1=C(Cl)N=C2C(C)=CC(Br)=CC2=N1 VIRNTWOBZDFPTL-UHFFFAOYSA-N 0.000 description 2
- GPMRDSHBSYWDAV-UHFFFAOYSA-N 7-bromo-5-methyl-1,4-dihydroquinoxaline-2,3-dione Chemical compound N1C(=O)C(=O)NC2=C1C=C(Br)C=C2C GPMRDSHBSYWDAV-UHFFFAOYSA-N 0.000 description 2
- QCKVMAWARJXBFX-UHFFFAOYSA-N 7-chloro-2,3-dimethoxy-5-methylquinoxaline Chemical compound ClC1=CC(C)=C2N=C(OC)C(OC)=NC2=C1 QCKVMAWARJXBFX-UHFFFAOYSA-N 0.000 description 2
- YJMKZEBSDVPXHF-UHFFFAOYSA-N 7-chloro-5-methyl-1,4-dihydroquinoxaline-2,3-dione Chemical compound N1C(=O)C(=O)NC2=C1C=C(Cl)C=C2C YJMKZEBSDVPXHF-UHFFFAOYSA-N 0.000 description 2
- KTLIKCGDJMYANC-UHFFFAOYSA-N 7-fluoro-2,3-dimethoxy-5-methylquinoxaline Chemical compound FC1=CC(C)=C2N=C(OC)C(OC)=NC2=C1 KTLIKCGDJMYANC-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 201000006474 Brain Ischemia Diseases 0.000 description 2
- HXEYVEBPSHOJBO-UHFFFAOYSA-N CCOP(=O)(C1=CC=CC=C1NCC2=CC(=CC3=NC(=O)C(=O)N=C23)[N+](=O)[O-])OCC Chemical compound CCOP(=O)(C1=CC=CC=C1NCC2=CC(=CC3=NC(=O)C(=O)N=C23)[N+](=O)[O-])OCC HXEYVEBPSHOJBO-UHFFFAOYSA-N 0.000 description 2
- 206010008120 Cerebral ischaemia Diseases 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N Heavy water Chemical compound [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- VLSMHEGGTFMBBZ-OOZYFLPDSA-M Kainate Chemical compound CC(=C)[C@H]1C[NH2+][C@H](C([O-])=O)[C@H]1CC([O-])=O VLSMHEGGTFMBBZ-OOZYFLPDSA-M 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- HOKKHZGPKSLGJE-GSVOUGTGSA-N N-Methyl-D-aspartic acid Chemical compound CN[C@@H](C(O)=O)CC(O)=O HOKKHZGPKSLGJE-GSVOUGTGSA-N 0.000 description 2
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 206010008118 cerebral infarction Diseases 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- CZHYKKAKFWLGJO-UHFFFAOYSA-N dimethyl phosphite Chemical compound COP([O-])OC CZHYKKAKFWLGJO-UHFFFAOYSA-N 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- WISOQQCEUVJSKD-UHFFFAOYSA-N ethyl 2-[2-methyl-6-nitro-4-(trifluoromethyl)anilino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)NC1=C(C)C=C(C(F)(F)F)C=C1[N+]([O-])=O WISOQQCEUVJSKD-UHFFFAOYSA-N 0.000 description 2
- 239000010685 fatty oil Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 2
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- FZKGMKBAWCTVMR-UHFFFAOYSA-N n-(diethoxyphosphorylmethyl)-n-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-1-phenylmethanamine Chemical compound C=1C([N+]([O-])=O)=CC2=NC(OC)=C(OC)N=C2C=1CN(CP(=O)(OCC)OCC)CC1=CC=CC=C1 FZKGMKBAWCTVMR-UHFFFAOYSA-N 0.000 description 2
- 230000004770 neurodegeneration Effects 0.000 description 2
- 208000015122 neurodegenerative disease Diseases 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- SOWBFZRMHSNYGE-UHFFFAOYSA-N oxamic acid Chemical compound NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- SEPKUNXLGWMPHL-UHFFFAOYSA-N quinoxaline-2,3-dione Chemical group C1=CC=CC2=NC(=O)C(=O)N=C21 SEPKUNXLGWMPHL-UHFFFAOYSA-N 0.000 description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- WMHZCTGZXQQYLB-UHFFFAOYSA-N tert-butyl N-(2,3-dimethoxy-6-methyl-7-nitroquinoxalin-5-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound C(C)(C)(C)OC(=O)N(C1=C2N=C(C(=NC2=CC(=C1C)[N+](=O)[O-])OC)OC)C(=O)OC(C)(C)C WMHZCTGZXQQYLB-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- 239000005051 trimethylchlorosilane Substances 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- SSJJAGQNMWUDET-UHFFFAOYSA-N (2-amino-2-methylpropyl)phosphonic acid Chemical compound CC(C)(N)CP(O)(O)=O SSJJAGQNMWUDET-UHFFFAOYSA-N 0.000 description 1
- SDOFMBGMRVAJNF-SLPGGIOYSA-N (2r,3r,4r,5s)-6-aminohexane-1,2,3,4,5-pentol Chemical compound NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO SDOFMBGMRVAJNF-SLPGGIOYSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 1
- IWYDHOAUDWTVEP-ZETCQYMHSA-N (S)-mandelic acid Chemical compound OC(=O)[C@@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-ZETCQYMHSA-N 0.000 description 1
- 125000005837 1,2-cyclopentylene group Chemical group [H]C1([H])C([H])([H])C([H])([*:1])C([H])([*:2])C1([H])[H] 0.000 description 1
- BINQYVWLAWZYPX-UHFFFAOYSA-N 1,3,5-triazine-2-carboxylic acid Chemical compound OC(=O)C1=NC=NC=N1 BINQYVWLAWZYPX-UHFFFAOYSA-N 0.000 description 1
- GDXJHRGCGDIVBF-UHFFFAOYSA-N 1-(7-bromo-2,3-dimethoxyquinoxalin-5-yl)-n-(dimethoxyphosphorylmethyl)methanamine Chemical compound BrC1=CC(CNCP(=O)(OC)OC)=C2N=C(OC)C(OC)=NC2=C1 GDXJHRGCGDIVBF-UHFFFAOYSA-N 0.000 description 1
- HFKRVPQZLUFYNY-UHFFFAOYSA-N 1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propylphosphonic acid Chemical compound OC1=C(O)N=C2C(CNC(CC)P(O)(O)=O)=CC(Br)=CC2=N1 HFKRVPQZLUFYNY-UHFFFAOYSA-N 0.000 description 1
- ZLIJLEWZZAOXBM-UHFFFAOYSA-N 1-[(7-chloro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethylphosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C(Cl)C=C2CNC(C)P(O)(O)=O ZLIJLEWZZAOXBM-UHFFFAOYSA-N 0.000 description 1
- QQTYMXDYFHVSCU-UHFFFAOYSA-N 1-[(7-cyano-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethylphosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C(C#N)C=C2CNC(C)P(O)(O)=O QQTYMXDYFHVSCU-UHFFFAOYSA-N 0.000 description 1
- OQBBXIJMKTYKAW-UHFFFAOYSA-N 1-[(7-fluoro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethylphosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C(F)C=C2CNC(C)P(O)(O)=O OQBBXIJMKTYKAW-UHFFFAOYSA-N 0.000 description 1
- DPJDDYZOLBQVOJ-UHFFFAOYSA-N 1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]butylphosphonic acid;hydrobromide Chemical compound Br.N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(CCC)P(O)(O)=O DPJDDYZOLBQVOJ-UHFFFAOYSA-N 0.000 description 1
- VLSPWPVZKZXYIX-UHFFFAOYSA-N 1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propylphosphonic acid;hydrochloride Chemical compound Cl.N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(CC)P(O)(O)=O VLSPWPVZKZXYIX-UHFFFAOYSA-N 0.000 description 1
- LTNCYOCKLSOHGK-UHFFFAOYSA-N 1-dimethoxyphosphoryl-N-[(7-fluoro-2,3-dimethoxyquinoxalin-5-yl)methyl]ethanamine Chemical compound FC1=CC(CNC(C)P(=O)(OC)OC)=C2N=C(OC)C(OC)=NC2=C1 LTNCYOCKLSOHGK-UHFFFAOYSA-N 0.000 description 1
- UOWIYNWMROWVDG-UHFFFAOYSA-N 1-dimethoxyphosphorylpropan-2-one Chemical compound COP(=O)(OC)CC(C)=O UOWIYNWMROWVDG-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- LXRBCVZPYMPIJF-UHFFFAOYSA-N 2,3-dimethoxyquinoxaline-5-carbaldehyde Chemical compound C1=CC(C=O)=C2N=C(OC)C(OC)=NC2=C1 LXRBCVZPYMPIJF-UHFFFAOYSA-N 0.000 description 1
- AMYDLNLHFSFJQO-UHFFFAOYSA-N 2-(benzylamino)ethylphosphonic acid Chemical compound OP(O)(=O)CCNCC1=CC=CC=C1 AMYDLNLHFSFJQO-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- PSYSVMKGZBEORX-UHFFFAOYSA-N 2-[benzyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]ethylphosphonic acid Chemical compound C=1C([N+]([O-])=O)=CC=2NC(=O)C(=O)NC=2C=1CN(CCP(O)(=O)O)CC1=CC=CC=C1 PSYSVMKGZBEORX-UHFFFAOYSA-N 0.000 description 1
- KTXOAHBYEAIQHH-UHFFFAOYSA-N 2-diethoxyphosphorylaniline Chemical compound CCOP(=O)(OCC)C1=CC=CC=C1N KTXOAHBYEAIQHH-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- PAXQXJDYVORMOO-UHFFFAOYSA-N 2-methyl-4-(trifluoromethyl)aniline Chemical compound CC1=CC(C(F)(F)F)=CC=C1N PAXQXJDYVORMOO-UHFFFAOYSA-N 0.000 description 1
- 125000004924 2-naphthylethyl group Chemical group C1=C(C=CC2=CC=CC=C12)CC* 0.000 description 1
- FGLBSLMDCBOPQK-UHFFFAOYSA-N 2-nitropropane Chemical compound CC(C)[N+]([O-])=O FGLBSLMDCBOPQK-UHFFFAOYSA-N 0.000 description 1
- GUGQQGROXHPINL-UHFFFAOYSA-N 2-oxobutanoyl chloride Chemical compound CCC(=O)C(Cl)=O GUGQQGROXHPINL-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- JEGMWWXJUXDNJN-UHFFFAOYSA-N 3-methylpiperidine Chemical compound CC1CCCNC1 JEGMWWXJUXDNJN-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZXFVKFUXKFPUQJ-UHFFFAOYSA-N 4-bromo-2-methyl-6-nitroaniline Chemical compound CC1=CC(Br)=CC([N+]([O-])=O)=C1N ZXFVKFUXKFPUQJ-UHFFFAOYSA-N 0.000 description 1
- PTCXVPXJIMWJBP-UHFFFAOYSA-N 4-dimethoxyphosphorylbutanoic acid Chemical compound COP(=O)(OC)CCCC(O)=O PTCXVPXJIMWJBP-UHFFFAOYSA-N 0.000 description 1
- RQJZBCXRJPJGGV-UHFFFAOYSA-N 4-fluoro-2-methyl-6-nitroaniline Chemical compound CC1=CC(F)=CC([N+]([O-])=O)=C1N RQJZBCXRJPJGGV-UHFFFAOYSA-N 0.000 description 1
- AXZZCWZPPAQQIA-UHFFFAOYSA-N 5-(bromomethyl)-7-chloro-2,3-dimethoxyquinoxaline Chemical compound ClC1=CC(CBr)=C2N=C(OC)C(OC)=NC2=C1 AXZZCWZPPAQQIA-UHFFFAOYSA-N 0.000 description 1
- ILFUDCXFXYNSQL-UHFFFAOYSA-N 5-[[4-(diethoxyphosphorylmethyl)anilino]methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione;hydrochloride Chemical compound Cl.C1=CC(CP(=O)(OCC)OCC)=CC=C1NCC1=CC([N+]([O-])=O)=CC2=C1NC(=O)C(=O)N2 ILFUDCXFXYNSQL-UHFFFAOYSA-N 0.000 description 1
- JCNVBPMFGXBWOI-UHFFFAOYSA-N 5-chloro-3-methylbenzene-1,2-diamine Chemical compound CC1=CC(Cl)=CC(N)=C1N JCNVBPMFGXBWOI-UHFFFAOYSA-N 0.000 description 1
- NQHDXXOCLASMDR-UHFFFAOYSA-N 5-methylquinoxaline-2,3-dione Chemical compound O=C1C(=O)N=C2C(C)=CC=CC2=N1 NQHDXXOCLASMDR-UHFFFAOYSA-N 0.000 description 1
- PIUMGKLDUYIDOU-UHFFFAOYSA-N 7-fluoro-5-methyl-1,4-dihydroquinoxaline-2,3-dione Chemical compound N1C(=O)C(=O)NC2=C1C=C(F)C=C2C PIUMGKLDUYIDOU-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 208000024827 Alzheimer disease Diseases 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- 206010002660 Anoxia Diseases 0.000 description 1
- 241000976983 Anoxia Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 208000014644 Brain disease Diseases 0.000 description 1
- PZDMVSLCHWPTGD-UHFFFAOYSA-N CC(C)(CP(=O)(OC)OC)NCC1=C2C(=CC(=C1)[N+](=O)[O-])N=C(C(=N2)OC)OC Chemical compound CC(C)(CP(=O)(OC)OC)NCC1=C2C(=CC(=C1)[N+](=O)[O-])N=C(C(=N2)OC)OC PZDMVSLCHWPTGD-UHFFFAOYSA-N 0.000 description 1
- UIDHFAZNMWAQAP-UHFFFAOYSA-N CC(CP(=O)(OC)OC)NCC1=CC(=CC2=NC(=O)C(=O)N=C12)[N+](=O)[O-] Chemical compound CC(CP(=O)(OC)OC)NCC1=CC(=CC2=NC(=O)C(=O)N=C12)[N+](=O)[O-] UIDHFAZNMWAQAP-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 206010008190 Cerebrovascular accident Diseases 0.000 description 1
- PCZJYCQWNFYKNX-UHFFFAOYSA-N ClC12N(C(NC1NC(N(C2=O)C#N)=O)=O)Cl Chemical compound ClC12N(C(NC1NC(N(C2=O)C#N)=O)=O)Cl PCZJYCQWNFYKNX-UHFFFAOYSA-N 0.000 description 1
- JMVCSTAWVMRZSW-UHFFFAOYSA-N ClC1=C(CCP(O)(O)=O)C=CC=C1 Chemical compound ClC1=C(CCP(O)(O)=O)C=CC=C1 JMVCSTAWVMRZSW-UHFFFAOYSA-N 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical group CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 208000010496 Heart Arrest Diseases 0.000 description 1
- 208000023105 Huntington disease Diseases 0.000 description 1
- 208000013016 Hypoglycemia Diseases 0.000 description 1
- 206010021143 Hypoxia Diseases 0.000 description 1
- 102000000079 Kainic Acid Receptors Human genes 0.000 description 1
- 108010069902 Kainic Acid Receptors Proteins 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- QKYSZAQJKCYNQH-UHFFFAOYSA-N N-[[benzyl(ethoxy)phosphoryl]methyl]-1-(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methanamine Chemical compound C=1C([N+]([O-])=O)=CC2=NC(OC)=C(OC)N=C2C=1CNCP(=O)(OCC)CC1=CC=CC=C1 QKYSZAQJKCYNQH-UHFFFAOYSA-N 0.000 description 1
- 101710138657 Neurotoxin Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- QMGVPVSNSZLJIA-UHFFFAOYSA-N Nux Vomica Natural products C1C2C3C4N(C=5C6=CC=CC=5)C(=O)CC3OCC=C2CN2C1C46CC2 QMGVPVSNSZLJIA-UHFFFAOYSA-N 0.000 description 1
- JAVDZXQCIFGMHA-UHFFFAOYSA-N OP(O)=O.C1=CC=CC2=NC(=O)C(=O)N=C21 Chemical class OP(O)=O.C1=CC=CC2=NC(=O)C(=O)N=C21 JAVDZXQCIFGMHA-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 206010033799 Paralysis Diseases 0.000 description 1
- 208000005374 Poisoning Diseases 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 241001247203 Syngnathidae Species 0.000 description 1
- 206010070863 Toxicity to various agents Diseases 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 206010047163 Vasospasm Diseases 0.000 description 1
- DPFHVUSPVHRVFL-RXMQYKEDSA-N [(1r)-1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid Chemical compound OC1=C(O)N=C2C(CN[C@@H](C)P(O)(O)=O)=CC(Br)=CC2=N1 DPFHVUSPVHRVFL-RXMQYKEDSA-N 0.000 description 1
- DZNNZZHXIWLRBE-NUBCRITNSA-N [(1r)-1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid;hydrochloride Chemical compound Cl.N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CN[C@@H](C)P(O)(O)=O DZNNZZHXIWLRBE-NUBCRITNSA-N 0.000 description 1
- WOAGSQCIFSCNIH-SSDOTTSWSA-N [(1r)-1-[ethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]ethyl]phosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CN(CC)[C@@H](C)P(O)(O)=O WOAGSQCIFSCNIH-SSDOTTSWSA-N 0.000 description 1
- DZNNZZHXIWLRBE-JEDNCBNOSA-N [(1s)-1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid;hydrochloride Chemical compound Cl.N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CN[C@H](C)P(O)(O)=O DZNNZZHXIWLRBE-JEDNCBNOSA-N 0.000 description 1
- RDTOXUOEIJUIMX-YFKPBYRVSA-N [(1s)-1-[[2,3-dioxo-7-(trifluoromethyl)-1,4-dihydroquinoxalin-5-yl]methylamino]ethyl]phosphonic acid Chemical compound OC1=C(O)N=C2C(CN[C@H](C)P(O)(O)=O)=CC(C(F)(F)F)=CC2=N1 RDTOXUOEIJUIMX-YFKPBYRVSA-N 0.000 description 1
- WOAGSQCIFSCNIH-ZETCQYMHSA-N [(1s)-1-[ethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]ethyl]phosphonic acid Chemical compound OC1=C(O)N=C2C(CN(CC)[C@H](C)P(O)(O)=O)=CC([N+]([O-])=O)=CC2=N1 WOAGSQCIFSCNIH-ZETCQYMHSA-N 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- PYCHKUAUWGWKOT-UHFFFAOYSA-N [(3-hydroxyphenyl)-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]methyl]phosphonic acid;hydrobromide Chemical compound Br.OC1=CC=CC(C(NCC=2C=3NC(=O)C(=O)NC=3C=C(C=2)[N+]([O-])=O)P(O)(O)=O)=C1 PYCHKUAUWGWKOT-UHFFFAOYSA-N 0.000 description 1
- WJCLOYCDMIQCML-UHFFFAOYSA-N [1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-2-phenylmethoxyethyl]phosphonic acid Chemical compound C=1C(Br)=CC=2NC(=O)C(=O)NC=2C=1CNC(P(O)(=O)O)COCC1=CC=CC=C1 WJCLOYCDMIQCML-UHFFFAOYSA-N 0.000 description 1
- YHZSBUCFFFRYPW-UHFFFAOYSA-N [2-(2-methoxyphenyl)-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid;hydrochloride Chemical compound Cl.COC1=CC=CC=C1C(CP(O)(O)=O)NCC1=CC([N+]([O-])=O)=CC2=C1NC(=O)C(=O)N2 YHZSBUCFFFRYPW-UHFFFAOYSA-N 0.000 description 1
- ZBZWNLFADORVMZ-UHFFFAOYSA-N [2-(4-fluorophenyl)-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid;hydrochloride Chemical compound Cl.C=1C([N+]([O-])=O)=CC=2NC(=O)C(=O)NC=2C=1CNC(CP(O)(=O)O)C1=CC=C(F)C=C1 ZBZWNLFADORVMZ-UHFFFAOYSA-N 0.000 description 1
- ZYPSIDXTXGSMDP-UHFFFAOYSA-N [2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-2-oxoethyl]phosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(=O)CP(O)(=O)O ZYPSIDXTXGSMDP-UHFFFAOYSA-N 0.000 description 1
- NQBWTNQVBKNAOO-UHFFFAOYSA-N [2-cyclohexyl-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid;hydrochloride Chemical compound Cl.C=1C([N+]([O-])=O)=CC=2NC(=O)C(=O)NC=2C=1CNC(CP(O)(=O)O)C1CCCCC1 NQBWTNQVBKNAOO-UHFFFAOYSA-N 0.000 description 1
- HUWLTFQXYIYSTN-UHFFFAOYSA-N [3-methyl-1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]butyl]phosphonic acid;hydrobromide Chemical compound Br.N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(CC(C)C)P(O)(O)=O HUWLTFQXYIYSTN-UHFFFAOYSA-N 0.000 description 1
- OQZDOXGUROQYME-UHFFFAOYSA-N [4-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-4-oxobutyl]phosphonic acid Chemical compound N1C(=O)C(=O)NC2=C1C=C([N+]([O-])=O)C=C2CNC(=O)CCCP(O)(=O)O OQZDOXGUROQYME-UHFFFAOYSA-N 0.000 description 1
- LBISKMRLTXJAOO-UHFFFAOYSA-N [4-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]phenyl]methylphosphonic acid;hydrobromide Chemical compound Br.C1=CC(CP(O)(=O)O)=CC=C1NCC1=CC([N+]([O-])=O)=CC2=C1NC(=O)C(=O)N2 LBISKMRLTXJAOO-UHFFFAOYSA-N 0.000 description 1
- LMCIDWXADVHQPA-UHFFFAOYSA-N [[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-(3,4,5-trimethoxyphenyl)methyl]phosphonic acid;hydrobromide Chemical compound Br.COC1=C(OC)C(OC)=CC(C(NCC=2C=3NC(=O)C(=O)NC=3C=C(C=2)[N+]([O-])=O)P(O)(O)=O)=C1 LMCIDWXADVHQPA-UHFFFAOYSA-N 0.000 description 1
- HLQNXJJMARKEJG-UHFFFAOYSA-N [[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-phenylmethyl]phosphonic acid;hydrobromide Chemical compound Br.C=1C([N+]([O-])=O)=CC=2NC(=O)C(=O)NC=2C=1CNC(P(O)(=O)O)C1=CC=CC=C1 HLQNXJJMARKEJG-UHFFFAOYSA-N 0.000 description 1
- TXAOTFPYGNFSTN-UHFFFAOYSA-N [benzyl-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]methylphosphonic acid Chemical compound C=1C(Br)=CC=2NC(=O)C(=O)NC=2C=1CN(CP(O)(=O)O)CC1=CC=CC=C1 TXAOTFPYGNFSTN-UHFFFAOYSA-N 0.000 description 1
- IUGHIBJATCNETC-UHFFFAOYSA-N [benzyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]methylphosphonic acid;hydrobromide Chemical compound Br.C=1C([N+]([O-])=O)=CC=2NC(=O)C(=O)NC=2C=1CN(CP(O)(=O)O)CC1=CC=CC=C1 IUGHIBJATCNETC-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 150000003797 alkaloid derivatives Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005103 alkyl silyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940025084 amphetamine Drugs 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000007953 anoxia Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- MRGOJMASOICDHE-UHFFFAOYSA-N benzyl(ethyl)phosphinic acid Chemical compound CCP(O)(=O)CC1=CC=CC=C1 MRGOJMASOICDHE-UHFFFAOYSA-N 0.000 description 1
- DSCKZQZZZRHKAF-UHFFFAOYSA-N benzyl-[[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]methyl]phosphinic acid Chemical compound C=1C([N+]([O-])=O)=CC=2NC(=O)C(=O)NC=2C=1CNCP(=O)(O)CC1=CC=CC=C1 DSCKZQZZZRHKAF-UHFFFAOYSA-N 0.000 description 1
- XWRHUSBWRHTWAL-UHFFFAOYSA-N benzyl-[[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]methyl]phosphinic acid;hydrobromide Chemical compound Br.C=1C([N+]([O-])=O)=CC=2NC(=O)C(=O)NC=2C=1CNCP(=O)(O)CC1=CC=CC=C1 XWRHUSBWRHTWAL-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- RRKTZKIUPZVBMF-IBTVXLQLSA-N brucine Chemical compound O([C@@H]1[C@H]([C@H]2C3)[C@@H]4N(C(C1)=O)C=1C=C(C(=CC=11)OC)OC)CC=C2CN2[C@@H]3[C@]41CC2 RRKTZKIUPZVBMF-IBTVXLQLSA-N 0.000 description 1
- RRKTZKIUPZVBMF-UHFFFAOYSA-N brucine Natural products C1=2C=C(OC)C(OC)=CC=2N(C(C2)=O)C3C(C4C5)C2OCC=C4CN2C5C31CC2 RRKTZKIUPZVBMF-UHFFFAOYSA-N 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 238000007675 cardiac surgery Methods 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 description 1
- KMPWYEUPVWOPIM-LSOMNZGLSA-N cinchonine Chemical compound C1=CC=C2C([C@@H]([C@H]3N4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-LSOMNZGLSA-N 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical class C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical class OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000132 electrospray ionisation Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 229960002179 ephedrine Drugs 0.000 description 1
- 206010015037 epilepsy Diseases 0.000 description 1
- OCJYPPZKWVTGBK-UHFFFAOYSA-N ethyl 2-[2-methyl-4-(trifluoromethyl)anilino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)NC1=CC=C(C(F)(F)F)C=C1C OCJYPPZKWVTGBK-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- QZJYHWXRWTVKSH-UHFFFAOYSA-N ethylaminomethylphosphonic acid Chemical compound CCNCP(O)(O)=O QZJYHWXRWTVKSH-UHFFFAOYSA-N 0.000 description 1
- 238000010265 fast atom bombardment Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000007941 film coated tablet Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 230000002178 gastroprotective effect Effects 0.000 description 1
- 229940014259 gelatin Drugs 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 208000023589 ischemic disease Diseases 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- GAPFWGOSHOCNBM-UHFFFAOYSA-N isopropyl nitrate Chemical compound CC(C)O[N+]([O-])=O GAPFWGOSHOCNBM-UHFFFAOYSA-N 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 229940116298 l- malic acid Drugs 0.000 description 1
- 150000003951 lactams Chemical group 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229960002900 methylcellulose Drugs 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 238000010172 mouse model Methods 0.000 description 1
- LVGBPTAQVCHILQ-UHFFFAOYSA-N n-(diethoxyphosphorylmethyl)-1-phenylmethanamine;hydrochloride Chemical compound Cl.CCOP(=O)(OCC)CNCC1=CC=CC=C1 LVGBPTAQVCHILQ-UHFFFAOYSA-N 0.000 description 1
- USQDTUQBMYGSMF-UHFFFAOYSA-N n-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-1-dimethoxyphosphoryl-n-ethylethanamine Chemical compound COC1=C(OC)N=C2C(CN(CC)C(C)P(=O)(OC)OC)=CC([N+]([O-])=O)=CC2=N1 USQDTUQBMYGSMF-UHFFFAOYSA-N 0.000 description 1
- CAPGBSJLONCVSI-UHFFFAOYSA-N n-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-4-dimethoxyphosphorylbutanamide Chemical compound [O-][N+](=O)C1=CC(CNC(=O)CCCP(=O)(OC)OC)=C2N=C(OC)C(OC)=NC2=C1 CAPGBSJLONCVSI-UHFFFAOYSA-N 0.000 description 1
- QGXVDBYAQYXGNI-UHFFFAOYSA-N n-[(7-bromo-2,3-dimethoxyquinoxalin-5-yl)methyl]-n-(dimethoxyphosphorylmethyl)acetamide Chemical compound BrC1=CC(CN(CP(=O)(OC)OC)C(C)=O)=C2N=C(OC)C(OC)=NC2=C1 QGXVDBYAQYXGNI-UHFFFAOYSA-N 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 239000002581 neurotoxin Substances 0.000 description 1
- 231100000618 neurotoxin Toxicity 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 230000009984 peri-natal effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 125000001476 phosphono group Chemical group [H]OP(*)(=O)O[H] 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 229940116317 potato starch Drugs 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 125000005930 sec-butyloxycarbonyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- XCAQIUOFDMREBA-UHFFFAOYSA-N tert-butyl n-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(=O)OC(C)(C)C XCAQIUOFDMREBA-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 206010044652 trigeminal neuralgia Diseases 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- GTLDTDOJJJZVBW-UHFFFAOYSA-N zinc cyanide Chemical compound [Zn+2].N#[C-].N#[C-] GTLDTDOJJJZVBW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/645—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having two nitrogen atoms as the only ring hetero atoms
- C07F9/6509—Six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/645—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having two nitrogen atoms as the only ring hetero atoms
- C07F9/6509—Six-membered rings
- C07F9/650952—Six-membered rings having the nitrogen atoms in the positions 1 and 4
- C07F9/650994—Six-membered rings having the nitrogen atoms in the positions 1 and 4 condensed with carbocyclic rings or carbocyclic ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P21/00—Drugs for disorders of the muscular or neuromuscular system
- A61P21/02—Muscle relaxants, e.g. for tetanus or cramps
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/02—Drugs for disorders of the nervous system for peripheral neuropathies
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/08—Antiepileptics; Anticonvulsants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Neurology (AREA)
- Biochemistry (AREA)
- Biomedical Technology (AREA)
- Neurosurgery (AREA)
- Molecular Biology (AREA)
- Pain & Pain Management (AREA)
- Heart & Thoracic Surgery (AREA)
- Ophthalmology & Optometry (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Physical Education & Sports Medicine (AREA)
- Cardiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH262196 | 1996-10-24 | ||
| PCT/EP1997/005843 WO1998017672A1 (de) | 1996-10-24 | 1997-10-22 | Substituierte aminoalkanphosphonsäuren |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SK52399A3 SK52399A3 (en) | 2000-04-10 |
| SK282548B6 true SK282548B6 (sk) | 2002-10-08 |
Family
ID=4237878
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK523-99A SK282548B6 (sk) | 1996-10-24 | 1997-10-22 | Substituované aminoalkánfosfónové kyseliny, spôsob ich prípravy, farmaceutické prostriedky, ktoré ich obsahujú, a ich použitie |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US6117873A (cs) |
| EP (1) | EP0934326B1 (cs) |
| JP (1) | JP3908790B2 (cs) |
| KR (1) | KR20000052747A (cs) |
| CN (1) | CN1092202C (cs) |
| AT (1) | ATE325128T1 (cs) |
| AU (1) | AU5188598A (cs) |
| BR (1) | BR9713489A (cs) |
| CA (1) | CA2269807C (cs) |
| CZ (1) | CZ141399A3 (cs) |
| DE (1) | DE59712642D1 (cs) |
| ES (1) | ES2264171T3 (cs) |
| HU (1) | HUP0000383A3 (cs) |
| ID (1) | ID21927A (cs) |
| IL (1) | IL129394A (cs) |
| NO (1) | NO991902L (cs) |
| NZ (1) | NZ334891A (cs) |
| PL (1) | PL192286B1 (cs) |
| PT (1) | PT934326E (cs) |
| RU (1) | RU2181362C2 (cs) |
| SK (1) | SK282548B6 (cs) |
| TR (1) | TR199900897T2 (cs) |
| WO (1) | WO1998017672A1 (cs) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU2645199A (en) * | 1998-11-18 | 2000-06-05 | Viktor Veniaminovich Tets | Dialkyl-1-aryl-1-(2,4-dioxo-5-amino-1,3-pyrimidin-5-yl)methy lphosphonates |
| US7205404B1 (en) | 1999-03-05 | 2007-04-17 | Metabasis Therapeutics, Inc. | Phosphorus-containing prodrugs |
| US20030114421A1 (en) * | 2000-09-27 | 2003-06-19 | Phan Hieu Trung | Alpha-substituted beta-aminoethyl phosphonate derivatives |
| WO2002026752A1 (en) * | 2000-09-27 | 2002-04-04 | Ilex Oncology Research S.A. | α-SUBSTITUTED β-AMINOETHYL PHOSPHONATES |
| GB0025849D0 (en) * | 2000-10-23 | 2000-12-06 | Smithkline Beecham Plc | Novel compounds |
| US6492517B1 (en) * | 2001-07-19 | 2002-12-10 | Air Products And Chemicals, Inc. | Method for preparing halomethyl heterocyclic compounds |
| TW200403066A (en) * | 2002-04-30 | 2004-03-01 | Novartis Ag | New uses of substituted aminoalkanephosphonic acids |
| GB0307860D0 (en) * | 2003-04-04 | 2003-05-14 | Novartis Ag | Organic compounds |
| GB0310868D0 (en) * | 2003-05-12 | 2003-06-18 | Novartis Ag | Organic compounds |
| GB0324542D0 (en) * | 2003-10-21 | 2003-11-26 | Novartis Ag | Organic compounds |
| GB0324541D0 (en) * | 2003-10-21 | 2003-11-26 | Novartis Ag | Organic compounds |
| GB0325175D0 (en) * | 2003-10-28 | 2003-12-03 | Novartis Ag | Organic compounds |
| GB0325173D0 (en) * | 2003-10-28 | 2003-12-03 | Novartis Ag | Organic compounds |
| GB0325172D0 (en) * | 2003-10-28 | 2003-12-03 | Novartis Ag | Organic compounds |
| GB0325390D0 (en) * | 2003-10-30 | 2003-12-03 | Novartis Ag | Organic compounds |
| EP2428516A1 (en) * | 2003-11-19 | 2012-03-14 | Metabasis Therapeutics, Inc. | Novel phosphorus-containing thyromimetics |
| GB0405034D0 (en) * | 2004-03-05 | 2004-04-07 | Novartis Ag | Organic compounds |
| AU2006232517A1 (en) * | 2005-04-04 | 2006-10-12 | Eisai R&D Management Co., Ltd. | Dihydropyridine compounds and compositions for headaches |
| GB0507298D0 (en) | 2005-04-11 | 2005-05-18 | Novartis Ag | Organic compounds |
| JP2008542301A (ja) | 2005-05-26 | 2008-11-27 | メタバシス・セラピューティクス・インコーポレイテッド | 脂肪性肝疾患の処置のための甲状腺ホルモン様薬剤 |
| AU2006249348B2 (en) * | 2005-05-26 | 2012-05-24 | Metabasis Therapeutics, Inc. | Novel phosphinic acid-containing thyromimetics |
| US20080108603A1 (en) * | 2006-10-19 | 2008-05-08 | Eisenach James C | Combination therapy for the treatment of pain |
| US20080108622A1 (en) * | 2006-10-19 | 2008-05-08 | Eisenach James C | Combination therapy for the treatment of pain |
| GB0708507D0 (en) | 2007-05-02 | 2007-06-13 | Queen Mary & Westfield College | Substituted phosphonates and their use |
| RU2010138648A (ru) | 2008-02-20 | 2012-03-27 | Актелион Фармасьютиклз Лтд (Ch) | Азатрициклические соединения антибиотиков |
| WO2010014943A2 (en) | 2008-08-01 | 2010-02-04 | Bioxiness Pharmaceutics, Inc. | Methionine analogs and methods of using same |
| WO2010041194A1 (en) | 2008-10-07 | 2010-04-15 | Actelion Pharmaceuticals Ltd | Tricyclic oxazolidinone antibiotic compounds |
| EP2403860B1 (en) * | 2009-03-04 | 2015-11-04 | IDENIX Pharmaceuticals, Inc. | Phosphothiophene and phosphothiazole as hcv polymerase inhibitors |
| AU2015217221A1 (en) | 2014-02-13 | 2016-08-11 | Ligand Pharmaceuticals, Inc. | Prodrug compounds and their uses |
| JP2017520545A (ja) | 2014-07-02 | 2017-07-27 | リガンド・ファーマシューティカルズ・インコーポレイテッド | プロドラッグ化合物およびそれらの使用 |
| CN110198719A (zh) | 2016-11-21 | 2019-09-03 | 维京治疗公司 | 治疗糖原贮积病的方法 |
| WO2018226604A1 (en) | 2017-06-05 | 2018-12-13 | Viking Therapeutics, Inc. | Compositions for the treatment of fibrosis |
| JP2021509907A (ja) | 2018-01-09 | 2021-04-08 | リガンド・ファーマシューティカルズ・インコーポレイテッド | アセタール化合物およびその治療的使用 |
| CA3094167A1 (en) | 2018-03-22 | 2019-09-26 | Viking Therapeutics, Inc. | Crystalline forms and methods of producing crystalline forms of a compound |
| JP2022510691A (ja) | 2018-12-05 | 2022-01-27 | バイキング・セラピューティクス・インコーポレイテッド | 線維症及び炎症の処置のための組成物 |
| CN114409890A (zh) * | 2022-02-28 | 2022-04-29 | 中国科学院长春应用化学研究所 | 一种氨基功能化的聚乙二醇衍生物及其制备方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NO179551C (no) * | 1987-11-10 | 1996-10-30 | Novo Nordisk As | Analogifremgangsmåte for fremstilling av terapeutisk virksomme kinoxalinforbindelser |
| DK69790D0 (da) * | 1990-03-16 | 1990-03-16 | Novo Nordisk As | Heterocykliske forbindelser, deres fremstilling af anvendelse |
| DE69132340T2 (de) * | 1990-11-06 | 2001-02-08 | Yamanouchi Pharmaceutical Co., Ltd. | Kondensiertes pyrazinderivat |
| US5118675A (en) * | 1991-02-15 | 1992-06-02 | American Home Products Corporation | Quinoxaline phosphono-amino acids |
| US5480883A (en) * | 1991-05-10 | 1996-01-02 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Bis mono- and bicyclic aryl and heteroaryl compounds which inhibit EGF and/or PDGF receptor tyrosine kinase |
| WO1994000124A1 (en) * | 1992-06-22 | 1994-01-06 | Eckard Weber | Glycine receptor antagonists and the use thereof |
| IL109397A0 (en) * | 1993-04-28 | 1994-07-31 | Schering Ag | Quinoxalinedione derivatives, processes for the preparation thereof and pharmaceutical compositions containing the same |
| DE4314592A1 (de) * | 1993-04-28 | 1994-11-03 | Schering Ag | Benzo(f)chinoxalindionderivate, deren Herstellung und Verwendung in Arzneimitteln |
| BR9609644A (pt) * | 1995-07-10 | 1999-05-11 | Novartis Ag | Novo quiloxaina e ácidos quinoxalinailalcano-fosfônico |
| MY132385A (en) * | 1995-08-31 | 2007-10-31 | Novartis Ag | 2,3-dioxo-1,2,3,4-tetrahydro-quinoxalinyl derivatives |
-
1997
- 1997-10-22 CZ CZ991413A patent/CZ141399A3/cs unknown
- 1997-10-22 RU RU99110376/04A patent/RU2181362C2/ru not_active IP Right Cessation
- 1997-10-22 WO PCT/EP1997/005843 patent/WO1998017672A1/de not_active Ceased
- 1997-10-22 AT AT97946755T patent/ATE325128T1/de active
- 1997-10-22 JP JP51897098A patent/JP3908790B2/ja not_active Expired - Fee Related
- 1997-10-22 BR BR9713489-9A patent/BR9713489A/pt not_active IP Right Cessation
- 1997-10-22 IL IL12939497A patent/IL129394A/en not_active IP Right Cessation
- 1997-10-22 ES ES97946755T patent/ES2264171T3/es not_active Expired - Lifetime
- 1997-10-22 ID IDW990225A patent/ID21927A/id unknown
- 1997-10-22 PL PL332775A patent/PL192286B1/pl not_active IP Right Cessation
- 1997-10-22 AU AU51885/98A patent/AU5188598A/en not_active Abandoned
- 1997-10-22 DE DE59712642T patent/DE59712642D1/de not_active Expired - Lifetime
- 1997-10-22 PT PT97946755T patent/PT934326E/pt unknown
- 1997-10-22 US US09/297,010 patent/US6117873A/en not_active Expired - Lifetime
- 1997-10-22 EP EP97946755A patent/EP0934326B1/de not_active Expired - Lifetime
- 1997-10-22 SK SK523-99A patent/SK282548B6/sk unknown
- 1997-10-22 TR TR1999/00897T patent/TR199900897T2/xx unknown
- 1997-10-22 CA CA002269807A patent/CA2269807C/en not_active Expired - Fee Related
- 1997-10-22 CN CN97199101A patent/CN1092202C/zh not_active Expired - Fee Related
- 1997-10-22 HU HU0000383A patent/HUP0000383A3/hu unknown
- 1997-10-22 KR KR1019990703547A patent/KR20000052747A/ko not_active Abandoned
- 1997-10-22 NZ NZ334891A patent/NZ334891A/en unknown
-
1999
- 1999-04-21 NO NO991902A patent/NO991902L/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0934326B1 (de) | 2006-05-03 |
| SK52399A3 (en) | 2000-04-10 |
| JP3908790B2 (ja) | 2007-04-25 |
| NZ334891A (en) | 2001-04-27 |
| PL332775A1 (en) | 1999-10-11 |
| PL192286B1 (pl) | 2006-09-29 |
| CN1092202C (zh) | 2002-10-09 |
| KR20000052747A (ko) | 2000-08-25 |
| PT934326E (pt) | 2006-08-31 |
| CA2269807C (en) | 2007-04-10 |
| ATE325128T1 (de) | 2006-06-15 |
| ID21927A (id) | 1999-08-12 |
| JP2001502681A (ja) | 2001-02-27 |
| AU5188598A (en) | 1998-05-15 |
| RU2181362C2 (ru) | 2002-04-20 |
| EP0934326A1 (de) | 1999-08-11 |
| HUP0000383A2 (hu) | 2001-05-28 |
| HUP0000383A3 (en) | 2003-01-28 |
| WO1998017672A1 (de) | 1998-04-30 |
| US6117873A (en) | 2000-09-12 |
| ES2264171T3 (es) | 2006-12-16 |
| NO991902D0 (no) | 1999-04-21 |
| CN1234037A (zh) | 1999-11-03 |
| CZ141399A3 (cs) | 1999-07-14 |
| IL129394A (en) | 2002-05-23 |
| BR9713489A (pt) | 2000-02-29 |
| TR199900897T2 (xx) | 1999-07-21 |
| NO991902L (no) | 1999-06-21 |
| IL129394A0 (en) | 2000-02-17 |
| CA2269807A1 (en) | 1998-04-30 |
| DE59712642D1 (de) | 2006-06-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SK282548B6 (sk) | Substituované aminoalkánfosfónové kyseliny, spôsob ich prípravy, farmaceutické prostriedky, ktoré ich obsahujú, a ich použitie | |
| JP2866688B2 (ja) | プリン誘導体を含有する抗ウィルス剤 | |
| EP0853617B1 (en) | Novel 2,3-dioxo-1,2,3,4-tetrahydro-quinoyxalinyl derivatives | |
| NZ245414A (en) | Guanidinoalkyl-1,1-bisphosphonic acid derivatives and pharmaceutical compositions | |
| US3632587A (en) | Piperazino methyl isatinylidine 3 acetates | |
| US5284837A (en) | Derivatives of purine, process for their preparation and a pharmaceutical preparation | |
| NL8800412A (nl) | Piperazinecarbonzuurderivaat, bereiding ervan en farmaceutische preparaten die het bevatten. | |
| US5707979A (en) | Phosphinic acid derivatives, their preparation and their use | |
| EP0518414B1 (en) | Thioxanthenone antitumor agents | |
| US5134134A (en) | Unsaturated aminodicarboxylic acid derivatives | |
| US6420386B1 (en) | Aryl or heteroaryl quinolylphosphonic acid compounds | |
| MXPA99003819A (en) | Substituted aminoalkane phosphonic acids | |
| KR19990028839A (ko) | 신규 퀴녹살린- 및 퀴녹살리닐알칸-포스폰산 | |
| HU214628B (hu) | Eljárás amidinvegyületek és hatóanyagként ezeket tartalmazó gyógyszerkészítmények előállítására | |
| KR20010082702A (ko) | 6-아미노 또는 6-히드라지노-술포닐-3-퀴놀릴-포스폰산화합물, 이의 제조 방법 및 이를 함유하는 약제 조성물 | |
| NZ272639A (en) | Azaaliphatically bridged quinoxaline-2,3-dione derivatives, preparation and medicaments containing such derivatives | |
| EP0522494A1 (en) | Novel isatineoxime derivatives, their preparation and use | |
| JPH04264091A (ja) | 新規ベンゾヘテロ環アルキルアミノアルカンジホスホン酸 | |
| LU83893A1 (fr) | Nouveaux derives spiro-1 isobenzofuranniques et spiro-1 isobenzothiopheniques,leur procede de preparation et leur application en therapeutique | |
| HK1010196B (en) | Novel 2,3-dioxo-1,2,3,4-tetrahydro-quinoyxalinyl derivatives |