SE447897B - Forfarande for framstellning av i meta-stellning substituerade kloraniliner - Google Patents
Forfarande for framstellning av i meta-stellning substituerade kloranilinerInfo
- Publication number
- SE447897B SE447897B SE8001166A SE8001166A SE447897B SE 447897 B SE447897 B SE 447897B SE 8001166 A SE8001166 A SE 8001166A SE 8001166 A SE8001166 A SE 8001166A SE 447897 B SE447897 B SE 447897B
- Authority
- SE
- Sweden
- Prior art keywords
- ions
- chlorine
- atom
- hydrogen
- liter
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 23
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 15
- 150000002500 ions Chemical class 0.000 claims description 15
- 239000003054 catalyst Substances 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 9
- 239000007791 liquid phase Substances 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000012429 reaction media Substances 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 150000001448 anilines Chemical class 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910000510 noble metal Inorganic materials 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 claims description 4
- 150000001555 benzenes Chemical class 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- -1 chlorine-substituted nitrogen Chemical class 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- 239000010970 precious metal Substances 0.000 claims 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 235000011167 hydrochloric acid Nutrition 0.000 description 3
- 150000003840 hydrochlorides Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012808 vapor phase Substances 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- LOCIEHQKRSFTPA-UHFFFAOYSA-N 1,2,3,5-tetrachloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C=C(Cl)C(Cl)=C1Cl LOCIEHQKRSFTPA-UHFFFAOYSA-N 0.000 description 1
- BGKIECJVXXHLDP-UHFFFAOYSA-N 1,2,3-trichloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1Cl BGKIECJVXXHLDP-UHFFFAOYSA-N 0.000 description 1
- HHLCSFGOTLUREE-UHFFFAOYSA-N 1,2,3-trichloro-5-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)C(Cl)=C1 HHLCSFGOTLUREE-UHFFFAOYSA-N 0.000 description 1
- UDEAXERKYRDHTE-UHFFFAOYSA-N 1,2,4-trichloro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C=CC(Cl)=C1Cl UDEAXERKYRDHTE-UHFFFAOYSA-N 0.000 description 1
- IBRBMZRLVYKVRF-UHFFFAOYSA-N 1,2,4-trichloro-5-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)C=C1Cl IBRBMZRLVYKVRF-UHFFFAOYSA-N 0.000 description 1
- ZYJBTGNUWOMRBG-UHFFFAOYSA-N 1,2,5-trichloro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(Cl)=C1Cl ZYJBTGNUWOMRBG-UHFFFAOYSA-N 0.000 description 1
- CMVQZRLQEOAYSW-UHFFFAOYSA-N 1,2-dichloro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(Cl)=C1Cl CMVQZRLQEOAYSW-UHFFFAOYSA-N 0.000 description 1
- NTBYINQTYWZXLH-UHFFFAOYSA-N 1,2-dichloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1 NTBYINQTYWZXLH-UHFFFAOYSA-N 0.000 description 1
- RZKKOBGFCAHLCZ-UHFFFAOYSA-N 1,4-dichloro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC=C1Cl RZKKOBGFCAHLCZ-UHFFFAOYSA-N 0.000 description 1
- KHCZSJXTDDHLGJ-UHFFFAOYSA-N 2,3,4,5,6-pentachloroaniline Chemical compound NC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl KHCZSJXTDDHLGJ-UHFFFAOYSA-N 0.000 description 1
- GBKZRUCVLTWAML-UHFFFAOYSA-N 2,3,4,5-tetrachloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1Cl GBKZRUCVLTWAML-UHFFFAOYSA-N 0.000 description 1
- LXCLPHJRGDTDDB-UHFFFAOYSA-N 2,3,4,6-tetrachloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C(Cl)=C1Cl LXCLPHJRGDTDDB-UHFFFAOYSA-N 0.000 description 1
- RRJUYQOFOMFVQS-UHFFFAOYSA-N 2,3,4-trichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1Cl RRJUYQOFOMFVQS-UHFFFAOYSA-N 0.000 description 1
- YTDHEFNWWHSXSU-UHFFFAOYSA-N 2,3,5,6-tetrachloroaniline Chemical compound NC1=C(Cl)C(Cl)=CC(Cl)=C1Cl YTDHEFNWWHSXSU-UHFFFAOYSA-N 0.000 description 1
- MOTBXEPLFOLWHZ-UHFFFAOYSA-N 2,3,5-trichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1Cl MOTBXEPLFOLWHZ-UHFFFAOYSA-N 0.000 description 1
- ZJMMPUVJZQBMEM-UHFFFAOYSA-N 2,3,6-trichloroaniline Chemical compound NC1=C(Cl)C=CC(Cl)=C1Cl ZJMMPUVJZQBMEM-UHFFFAOYSA-N 0.000 description 1
- BRPSAOUFIJSKOT-UHFFFAOYSA-N 2,3-dichloroaniline Chemical compound NC1=CC=CC(Cl)=C1Cl BRPSAOUFIJSKOT-UHFFFAOYSA-N 0.000 description 1
- GUMCAKKKNKYFEB-UHFFFAOYSA-N 2,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1Cl GUMCAKKKNKYFEB-UHFFFAOYSA-N 0.000 description 1
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 1
- XOGYQVITULCUGU-UHFFFAOYSA-N 3,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1 XOGYQVITULCUGU-UHFFFAOYSA-N 0.000 description 1
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001617 alkaline earth metal chloride Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000003049 inorganic solvent Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910001510 metal chloride Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- DQNOIKMHTBFYTD-UHFFFAOYSA-N n,n,2,3-tetrachloroaniline Chemical compound ClN(Cl)C1=CC=CC(Cl)=C1Cl DQNOIKMHTBFYTD-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- LKPLKUMXSAEKID-UHFFFAOYSA-N pentachloronitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LKPLKUMXSAEKID-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- XQTLDIFVVHJORV-UHFFFAOYSA-N tecnazene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=CC(Cl)=C1Cl XQTLDIFVVHJORV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7904483A FR2449077A2 (fr) | 1979-02-15 | 1979-02-15 | Procede de preparation d'anilines metachlorees |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8001166L SE8001166L (sv) | 1980-08-16 |
| SE447897B true SE447897B (sv) | 1986-12-22 |
Family
ID=9222292
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8001166A SE447897B (sv) | 1979-02-15 | 1980-02-14 | Forfarande for framstellning av i meta-stellning substituerade kloraniliner |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4324914A (esLanguage) |
| JP (1) | JPS5928544B2 (esLanguage) |
| AT (1) | AT372370B (esLanguage) |
| BE (1) | BE881754A (esLanguage) |
| BR (1) | BR8000910A (esLanguage) |
| CA (1) | CA1139313A (esLanguage) |
| CH (1) | CH642049A5 (esLanguage) |
| DD (1) | DD149060A5 (esLanguage) |
| DE (1) | DE3003960A1 (esLanguage) |
| DK (1) | DK153392C (esLanguage) |
| ES (1) | ES488572A1 (esLanguage) |
| FR (1) | FR2449077A2 (esLanguage) |
| GB (1) | GB2042542B (esLanguage) |
| HU (1) | HU185214B (esLanguage) |
| IE (1) | IE49393B1 (esLanguage) |
| IL (1) | IL59190A (esLanguage) |
| IT (1) | IT1127360B (esLanguage) |
| LU (1) | LU82167A1 (esLanguage) |
| NL (1) | NL8000620A (esLanguage) |
| SE (1) | SE447897B (esLanguage) |
| SU (1) | SU1082316A3 (esLanguage) |
| YU (1) | YU42323B (esLanguage) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3127026A1 (de) * | 1981-07-09 | 1983-01-20 | Bayer Ag, 5090 Leverkusen | Verrfahren zur herstellung von m-chlorsubstituiertenanilinen |
| FR2521132A1 (fr) * | 1982-02-05 | 1983-08-12 | Rhone Poulenc Agrochimie | Procede de preparation de metahalogeno-anilines |
| US4888425A (en) * | 1982-04-30 | 1989-12-19 | Union Carbide Chemicals And Plastics Company Inc. | Preparation of polyalkylene polyamines |
| JPS5955855A (ja) * | 1982-09-27 | 1984-03-31 | Mitsui Toatsu Chem Inc | 3,3′−ジアミノジフエニルメタンの製造方法 |
| JPS62132400U (esLanguage) * | 1986-02-14 | 1987-08-20 | ||
| USRE34745E (en) * | 1986-10-30 | 1994-09-27 | The Dow Chemical Company | High purity process for the preparation of 4,6-diamino-1,3-benzenediol |
| US5001279A (en) * | 1989-11-17 | 1991-03-19 | The Dow Chemical Company | Aqueous synthesis of 2-halo-4,6-dinitroresorcinol and 4,6-diaminoresorcinol |
| US5294742A (en) * | 1992-03-21 | 1994-03-15 | Hoechst Atkiengesellschaft | Process for preparing 3,5-difluoroaniline |
| US8956378B2 (en) * | 2008-02-29 | 2015-02-17 | Cook Biotech Incorporated | Coated embolization device |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3148217A (en) * | 1961-11-16 | 1964-09-08 | Gen Aniline & Film Corp | Catalytic hydrogenation of halonitrobenzene compounds |
| DE2032565A1 (de) * | 1970-07-01 | 1972-01-05 | Farbwerke Hoechst AG, vormals Meister Lucius & Bruning, 6000 Frankfurt | Verfahren zur Herstellung von 3 Difluorchlormethylanihn |
| DE2036313C3 (de) * | 1970-07-22 | 1982-03-25 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Halogen-substituiertenaromatischen Aminen |
| CS188122B2 (en) * | 1971-02-08 | 1979-02-28 | Kurt Habig | Method of production the sulfide catalysts with the platinum on coal |
| DE2503187C3 (de) * | 1975-01-27 | 1979-05-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline |
| FR2403990A1 (fr) * | 1977-09-22 | 1979-04-20 | Philagro Sa | Procede de deshalogenation d'amines aromatiques halogenees |
| DE2758111A1 (de) * | 1977-12-24 | 1979-07-05 | Basf Ag | Verfahren zur herstellung von halogenanilinen |
-
1979
- 1979-02-15 FR FR7904483A patent/FR2449077A2/fr active Granted
-
1980
- 1980-01-22 IL IL59190A patent/IL59190A/xx unknown
- 1980-01-23 US US06/114,651 patent/US4324914A/en not_active Expired - Lifetime
- 1980-01-31 NL NL8000620A patent/NL8000620A/nl not_active Application Discontinuation
- 1980-02-04 DE DE19803003960 patent/DE3003960A1/de active Granted
- 1980-02-13 CA CA000345561A patent/CA1139313A/en not_active Expired
- 1980-02-13 IE IE277/80A patent/IE49393B1/en unknown
- 1980-02-13 IT IT47892/80A patent/IT1127360B/it active
- 1980-02-13 GB GB8004746A patent/GB2042542B/en not_active Expired
- 1980-02-13 DD DD80219034A patent/DD149060A5/de not_active IP Right Cessation
- 1980-02-13 YU YU378/80A patent/YU42323B/xx unknown
- 1980-02-14 SU SU802882799A patent/SU1082316A3/ru active
- 1980-02-14 ES ES488572A patent/ES488572A1/es not_active Expired
- 1980-02-14 JP JP55017165A patent/JPS5928544B2/ja not_active Expired
- 1980-02-14 BR BR8000910A patent/BR8000910A/pt unknown
- 1980-02-14 SE SE8001166A patent/SE447897B/sv not_active IP Right Cessation
- 1980-02-14 HU HU80337A patent/HU185214B/hu unknown
- 1980-02-14 DK DK062880A patent/DK153392C/da active
- 1980-02-14 CH CH123780A patent/CH642049A5/fr not_active IP Right Cessation
- 1980-02-14 LU LU82167A patent/LU82167A1/fr unknown
- 1980-02-15 BE BE0/199423A patent/BE881754A/fr unknown
- 1980-02-15 AT AT0085480A patent/AT372370B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2449077B2 (esLanguage) | 1983-04-29 |
| BR8000910A (pt) | 1980-10-29 |
| IT8047892A0 (it) | 1980-02-13 |
| ATA85480A (de) | 1983-02-15 |
| IL59190A (en) | 1983-06-15 |
| DK153392C (da) | 1988-11-28 |
| FR2449077A2 (fr) | 1980-09-12 |
| YU37880A (en) | 1983-01-21 |
| JPS5928544B2 (ja) | 1984-07-13 |
| JPS55149229A (en) | 1980-11-20 |
| AT372370B (de) | 1983-09-26 |
| SU1082316A3 (ru) | 1984-03-23 |
| IL59190A0 (en) | 1980-05-30 |
| GB2042542B (en) | 1983-05-05 |
| IE800277L (en) | 1980-08-15 |
| LU82167A1 (fr) | 1981-09-10 |
| IE49393B1 (en) | 1985-10-02 |
| DE3003960A1 (de) | 1980-08-28 |
| DE3003960C2 (esLanguage) | 1990-07-05 |
| ES488572A1 (es) | 1980-10-01 |
| GB2042542A (en) | 1980-09-24 |
| IT1127360B (it) | 1986-05-21 |
| CA1139313A (en) | 1983-01-11 |
| DK62880A (da) | 1980-08-16 |
| DK153392B (da) | 1988-07-11 |
| YU42323B (en) | 1988-08-31 |
| NL8000620A (nl) | 1980-08-19 |
| DD149060A5 (de) | 1981-06-24 |
| CH642049A5 (fr) | 1984-03-30 |
| BE881754A (fr) | 1980-08-18 |
| HU185214B (en) | 1984-12-28 |
| US4324914A (en) | 1982-04-13 |
| SE8001166L (sv) | 1980-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3989756A (en) | Process for the production of halogenated aromatic primary amines | |
| SE447897B (sv) | Forfarande for framstellning av i meta-stellning substituerade kloraniliner | |
| US4085141A (en) | Process for the preparation of anilines meta-substituted by chlorine | |
| DE112006001236T5 (de) | Verfahren zur Herstellung von 4-Aminodiphenylamin | |
| CN111072502B (zh) | 一种固定床连续加氢制备苯胺类化合物的方法 | |
| US4351959A (en) | Process for preparation of anilines substituted by chlorine in the meta-position | |
| CA1064966A (en) | Process for the manufacture of diamino naphthalene | |
| US4421694A (en) | Process for the preparation of nitroanilines | |
| CA1139315A (en) | Process for the preparation of anilines substituted in the meta-position (s) by chlorine | |
| US4429156A (en) | Process for the preparation of m-halogen-substituted anilines | |
| DD299175A5 (de) | Verfahren zur hydrierung von halogenierten nitroaromatischen verbindungen in gegenwart von katalysatoren auf der grundlage von edelmetallen | |
| US4362893A (en) | Preparation of C-nitrosodiarylamines from diarylamines | |
| US4532350A (en) | Process for the selective preparation of meta-chloroanilines | |
| EP0013554B1 (en) | Process for production of 1,17-diamino-9-azaheptadecane | |
| KR830002430B1 (ko) | 염소 치환아닐린류의 제조방법 | |
| KR20010102956A (ko) | 폴리할로겐화 파라트리플루오로메틸아닐린의 제조 방법 | |
| US4460788A (en) | Process for preparation of anilines which are m-substituted by chlorine | |
| US4289906A (en) | Chemical process for preparing methylene bis-anilines | |
| KR830002431B1 (ko) | 아닐린의 제조방법 | |
| US6054618A (en) | Preparation of N-phenyl-1-naphthylamine | |
| CN106008601B (zh) | 一种n-芳基磷代甲酰胺的制备方法 | |
| SU641984A1 (ru) | Способ приготовлени катализатора дл синтеза винилхлорида | |
| KR840001961B1 (ko) | 염소 치환 아닐린의 제조방법 | |
| CN108178728A (zh) | 一种双(2-氨基异丁基)胺的合成方法 | |
| JP2019131516A (ja) | 4級アンモニウム水酸化物水溶液の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 8001166-1 Effective date: 19910911 Format of ref document f/p: F |