SE432951B - Pappersprodukt innehallande cellulosafibrer och ett bindemedelssystem som omfattar kolloidal kiselsyra och katjonisk sterkelse samt forfarande for framstellning av pappersprodukten - Google Patents
Pappersprodukt innehallande cellulosafibrer och ett bindemedelssystem som omfattar kolloidal kiselsyra och katjonisk sterkelse samt forfarande for framstellning av pappersproduktenInfo
- Publication number
- SE432951B SE432951B SE8003948A SE8003948A SE432951B SE 432951 B SE432951 B SE 432951B SE 8003948 A SE8003948 A SE 8003948A SE 8003948 A SE8003948 A SE 8003948A SE 432951 B SE432951 B SE 432951B
- Authority
- SE
- Sweden
- Prior art keywords
- paper
- silicic acid
- binder
- pulp
- weight
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 29
- 239000000835 fiber Substances 0.000 title claims description 27
- 239000002253 acid Substances 0.000 title description 3
- 239000000123 paper Substances 0.000 claims description 117
- 235000012239 silicon dioxide Nutrition 0.000 claims description 83
- 239000011230 binding agent Substances 0.000 claims description 78
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 76
- 229920002472 Starch Polymers 0.000 claims description 74
- 235000019698 starch Nutrition 0.000 claims description 73
- 239000008107 starch Substances 0.000 claims description 72
- 125000002091 cationic group Chemical group 0.000 claims description 60
- 239000012764 mineral filler Substances 0.000 claims description 31
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 21
- 239000007787 solid Substances 0.000 claims description 19
- 229920001131 Pulp (paper) Polymers 0.000 claims description 15
- 239000002245 particle Substances 0.000 claims description 13
- 239000000945 filler Substances 0.000 claims description 12
- 230000008569 process Effects 0.000 claims description 11
- 239000000377 silicon dioxide Substances 0.000 claims description 10
- 238000006467 substitution reaction Methods 0.000 claims description 10
- 229910052681 coesite Inorganic materials 0.000 claims description 8
- 229910052906 cristobalite Inorganic materials 0.000 claims description 8
- 229910052682 stishovite Inorganic materials 0.000 claims description 8
- 229910052905 tridymite Inorganic materials 0.000 claims description 8
- 229920003043 Cellulose fiber Polymers 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 229920002678 cellulose Polymers 0.000 claims description 6
- 239000001913 cellulose Substances 0.000 claims description 6
- 239000000084 colloidal system Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 230000014759 maintenance of location Effects 0.000 description 23
- 239000004927 clay Substances 0.000 description 17
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 13
- 239000005995 Aluminium silicate Substances 0.000 description 11
- 235000012211 aluminium silicate Nutrition 0.000 description 11
- 238000001035 drying Methods 0.000 description 10
- 229910052500 inorganic mineral Inorganic materials 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 239000011707 mineral Substances 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 229910004298 SiO 2 Inorganic materials 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 8
- 238000002156 mixing Methods 0.000 description 8
- 239000002002 slurry Substances 0.000 description 8
- 238000010586 diagram Methods 0.000 description 7
- 239000011122 softwood Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 229910021653 sulphate ion Inorganic materials 0.000 description 7
- 125000000129 anionic group Chemical group 0.000 description 6
- 239000010456 wollastonite Substances 0.000 description 6
- 229910052882 wollastonite Inorganic materials 0.000 description 6
- 230000003247 decreasing effect Effects 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 230000000717 retained effect Effects 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 235000019353 potassium silicate Nutrition 0.000 description 4
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 229920006319 cationized starch Polymers 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000003365 glass fiber Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000008119 colloidal silica Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000002657 fibrous material Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 239000011121 hardwood Substances 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 229920001592 potato starch Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000003746 surface roughness Effects 0.000 description 2
- LTVDFSLWFKLJDQ-UHFFFAOYSA-N α-tocopherolquinone Chemical compound CC(C)CCCC(C)CCCC(C)CCCC(C)(O)CCC1=C(C)C(=O)C(C)=C(C)C1=O LTVDFSLWFKLJDQ-UHFFFAOYSA-N 0.000 description 2
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229920002522 Wood fibre Polymers 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229940099112 cornstarch Drugs 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000032798 delamination Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005189 flocculation Methods 0.000 description 1
- 230000016615 flocculation Effects 0.000 description 1
- -1 for example Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229940116317 potato starch Drugs 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000003134 recirculating effect Effects 0.000 description 1
- 239000013074 reference sample Substances 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 125000005624 silicic acid group Chemical group 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 230000000930 thermomechanical effect Effects 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 239000002025 wood fiber Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H21/00—Non-fibrous material added to the pulp, characterised by its function, form or properties; Paper-impregnating or coating material, characterised by its function, form or properties
- D21H21/50—Non-fibrous material added to the pulp, characterised by its function, form or properties; Paper-impregnating or coating material, characterised by its function, form or properties characterised by form
- D21H21/52—Additives of definite length or shape
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21F—PAPER-MAKING MACHINES; METHODS OF PRODUCING PAPER THEREON
- D21F1/00—Wet end of machines for making continuous webs of paper
- D21F1/66—Pulp catching, de-watering, or recovering; Re-use of pulp-water
- D21F1/82—Pulp catching, de-watering, or recovering; Re-use of pulp-water adding fibre agglomeration compositions
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/20—Macromolecular organic compounds
- D21H17/21—Macromolecular organic compounds of natural origin; Derivatives thereof
- D21H17/24—Polysaccharides
- D21H17/28—Starch
- D21H17/29—Starch cationic
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/63—Inorganic compounds
- D21H17/67—Water-insoluble compounds, e.g. fillers, pigments
- D21H17/68—Water-insoluble compounds, e.g. fillers, pigments siliceous, e.g. clays
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H23/00—Processes or apparatus for adding material to the pulp or to the paper
- D21H23/76—Processes or apparatus for adding material to the pulp or to the paper characterised by choice of auxiliary compounds which are added separately from at least one other compound, e.g. to improve the incorporation of the latter or to obtain an enhanced combined effect
- D21H23/765—Addition of all compounds to the pulp
Landscapes
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Paper (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE8003948A SE432951B (sv) | 1980-05-28 | 1980-05-28 | Pappersprodukt innehallande cellulosafibrer och ett bindemedelssystem som omfattar kolloidal kiselsyra och katjonisk sterkelse samt forfarande for framstellning av pappersprodukten |
| US06/238,635 US4388150A (en) | 1980-05-28 | 1981-02-26 | Papermaking and products made thereby |
| CA000373025A CA1154563A (en) | 1980-05-28 | 1981-03-16 | Papermaking and products made thereby |
| AU70514/81A AU546999B2 (en) | 1980-05-28 | 1981-05-13 | Adding binder to paper making stock |
| AT81850084T ATE8916T1 (de) | 1980-05-28 | 1981-05-18 | Papierherstellung. |
| DE8181850084T DE3165370D1 (en) | 1980-05-28 | 1981-05-18 | Papermaking |
| EP81850084A EP0041056B1 (en) | 1980-05-28 | 1981-05-18 | Papermaking |
| MX187534A MX158106A (es) | 1980-05-28 | 1981-05-23 | Mejoras en un procedimiento para la fabricacion de papel y producto de papel obtenido mediante el mismo |
| NZ197223A NZ197223A (en) | 1980-05-28 | 1981-05-27 | Papermaking process using cationic starch/colloidal silicic acid complex binder |
| FI811628A FI68283C (fi) | 1980-05-28 | 1981-05-27 | Foerfarande foer papperstillverkning |
| SU813315051A SU1228793A3 (ru) | 1980-05-28 | 1981-05-27 | Способ изготовлени бумаги |
| NO811811A NO161334C (no) | 1980-05-28 | 1981-05-27 | Papirprodukt og fremgangsmaate til fremstilling av papir. |
| ES502531A ES8304247A1 (es) | 1980-05-28 | 1981-05-27 | Un procedimiento mejorado para fabricar papel |
| BR8103345A BR8103345A (pt) | 1980-05-28 | 1981-05-28 | Processo para fazer papel e produto de papel |
| AR285497A AR231848A1 (es) | 1980-05-28 | 1981-05-28 | Procedimiento de fabricacion de papel y producto de papel fabricado por dicho procedimiento |
| JP56081777A JPS5751900A (en) | 1980-05-28 | 1981-05-28 | Papermaking method |
| JP62019576A JPS62223395A (ja) | 1980-05-28 | 1987-01-29 | 製紙方法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE8003948A SE432951B (sv) | 1980-05-28 | 1980-05-28 | Pappersprodukt innehallande cellulosafibrer och ett bindemedelssystem som omfattar kolloidal kiselsyra och katjonisk sterkelse samt forfarande for framstellning av pappersprodukten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8003948L SE8003948L (sv) | 1981-11-29 |
| SE432951B true SE432951B (sv) | 1984-04-30 |
Family
ID=20341052
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8003948A SE432951B (sv) | 1980-05-28 | 1980-05-28 | Pappersprodukt innehallande cellulosafibrer och ett bindemedelssystem som omfattar kolloidal kiselsyra och katjonisk sterkelse samt forfarande for framstellning av pappersprodukten |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4388150A (esLanguage) |
| JP (2) | JPS5751900A (esLanguage) |
| CA (1) | CA1154563A (esLanguage) |
| SE (1) | SE432951B (esLanguage) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1986000100A1 (en) * | 1984-06-07 | 1986-01-03 | Eka Ab | Papermaking process |
Families Citing this family (160)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8107078L (sv) * | 1981-11-27 | 1983-05-28 | Eka Ab | Forfarande for papperstillverkning |
| FI72557C (fi) * | 1984-01-11 | 1992-01-08 | Kemira Oy | Pappersframstaellningsfoerfarande och aemneskomposition foer anvaendning daeri. |
| US4604163A (en) * | 1984-03-02 | 1986-08-05 | Monsanto Company | Viscosity modifiers for grafted starch polymer solutions |
| SE451739B (sv) * | 1985-04-03 | 1987-10-26 | Eka Nobel Ab | Papperstillverkningsforfarande och pappersprodukt varvid som avvattnings- och retentionsforbettrande kemikalie anvends katjonisk polyakrylamid och en speciell oorganisk kolloid |
| JPH0663197B2 (ja) * | 1985-11-07 | 1994-08-17 | 三菱製紙株式会社 | 中性紙の製紙方法 |
| GB8602121D0 (en) * | 1986-01-29 | 1986-03-05 | Allied Colloids Ltd | Paper & paper board |
| US4913775A (en) * | 1986-01-29 | 1990-04-03 | Allied Colloids Ltd. | Production of paper and paper board |
| US4750974A (en) * | 1986-02-24 | 1988-06-14 | Nalco Chemical Company | Papermaking aid |
| US4840705A (en) * | 1987-02-02 | 1989-06-20 | Nissan Chemical Industries Ltd. | Papermaking method |
| SE8701252D0 (sv) * | 1987-03-03 | 1987-03-25 | Eka Nobel Ab | Sett vid framstellning av papper |
| US4795531A (en) * | 1987-09-22 | 1989-01-03 | Nalco Chemical Company | Method for dewatering paper |
| JPH0192498A (ja) * | 1987-10-02 | 1989-04-11 | Hokuetsu Paper Mills Ltd | 中性紙の製造方法 |
| US4927498A (en) * | 1988-01-13 | 1990-05-22 | E. I. Du Pont De Nemours And Company | Retention and drainage aid for papermaking |
| US5176891A (en) * | 1988-01-13 | 1993-01-05 | Eka Chemicals, Inc. | Polyaluminosilicate process |
| US4798653A (en) * | 1988-03-08 | 1989-01-17 | Procomp, Inc. | Retention and drainage aid for papermaking |
| SE461156B (sv) * | 1988-05-25 | 1990-01-15 | Eka Nobel Ab | Saett foer framstaellning av papper varvid formning och avvattning aeger rum i naervaro av en aluminiumfoerening, ett katjoniskt retentionsmedel och en polymer kiselsyra |
| US5061346A (en) * | 1988-09-02 | 1991-10-29 | Betz Paperchem, Inc. | Papermaking using cationic starch and carboxymethyl cellulose or its additionally substituted derivatives |
| ES2055084T3 (es) * | 1988-09-16 | 1994-08-16 | Du Pont | Microgeles de polisilicato como coadyuvantes de retencion/drenaje en la fabricacion del papel. |
| US5294299A (en) * | 1988-11-07 | 1994-03-15 | Manfred Zeuner | Paper, cardboard or paperboard-like material and a process for its production |
| SE500367C2 (sv) * | 1989-11-09 | 1994-06-13 | Eka Nobel Ab | Silikasoler och förfarande för framställning av papper |
| SE500387C2 (sv) * | 1989-11-09 | 1994-06-13 | Eka Nobel Ab | Silikasoler, förfarande för framställning av silikasoler samt användning av solerna i pappersframställning |
| US5274055A (en) * | 1990-06-11 | 1993-12-28 | American Cyanamid Company | Charged organic polymer microbeads in paper-making process |
| SE9003954L (sv) * | 1990-12-11 | 1992-06-12 | Eka Nobel Ab | Saett foer framstaellning av ark- eller banformiga cellulosafiberinnehaallande produkter |
| US5098520A (en) * | 1991-01-25 | 1992-03-24 | Nalco Chemcial Company | Papermaking process with improved retention and drainage |
| US5221435A (en) * | 1991-09-27 | 1993-06-22 | Nalco Chemical Company | Papermaking process |
| US5571380A (en) * | 1992-01-08 | 1996-11-05 | Nalco Chemical Company | Papermaking process with improved retention and maintained formation |
| SE501216C2 (sv) * | 1992-08-31 | 1994-12-12 | Eka Nobel Ab | Vattenhaltig, stabil suspension av kolloidala partiklar samt framställning och användning av densamma |
| US5368690A (en) * | 1992-12-23 | 1994-11-29 | National Starch And Chemical Investment Holding Corporation | Method of papermaking using crosslinked cationic/amphoteric starches |
| US5567277A (en) * | 1993-05-28 | 1996-10-22 | Calgon Corporation | Cellulosic, modified lignin and cationic polymer composition and process for making improved paper or paperboard |
| US5647956A (en) * | 1993-05-28 | 1997-07-15 | Calgon Corporation | Cellulosic, modified lignin and cationic polymer composition and process for making improved paper or paperboard |
| US5501773A (en) * | 1993-05-28 | 1996-03-26 | Calgon Corporation | Cellulosic, modified lignin and cationic polymer composition and process for making improved paper or paperboard |
| GB9313956D0 (en) * | 1993-07-06 | 1993-08-18 | Allied Colloids Ltd | Production of paper |
| US5447603A (en) * | 1993-07-09 | 1995-09-05 | The Dow Chemical Company | Process for removing metal ions from liquids |
| US5431783A (en) * | 1993-07-19 | 1995-07-11 | Cytec Technology Corp. | Compositions and methods for improving performance during separation of solids from liquid particulate dispersions |
| US5876563A (en) * | 1994-06-01 | 1999-03-02 | Allied Colloids Limited | Manufacture of paper |
| DE4436317C2 (de) * | 1994-10-11 | 1998-10-29 | Nalco Chemical Co | Verfahren zur Verbesserung der Retention von Mineral-Füllstoffen und Cellulosefasern auf einem Cellulose-Faserbogen |
| US20030192664A1 (en) * | 1995-01-30 | 2003-10-16 | Kulick Russell J. | Use of vinylamine polymers with ionic, organic, cross-linked polymeric microbeads in paper-making |
| SE9501769D0 (sv) * | 1995-05-12 | 1995-05-12 | Eka Nobel Ab | A process for the production of paper |
| US5846384A (en) * | 1995-06-15 | 1998-12-08 | Eka Chemicals Ab | Process for the production of paper |
| SE9502522D0 (sv) * | 1995-07-07 | 1995-07-07 | Eka Nobel Ab | A process for the production of paper |
| US5595629A (en) * | 1995-09-22 | 1997-01-21 | Nalco Chemical Company | Papermaking process |
| US5840158A (en) * | 1995-09-28 | 1998-11-24 | Nalco Chemical Company | Colloidal silica/polyelectrolyte blends for pulp and paper applications |
| EP0773319A1 (en) * | 1995-11-08 | 1997-05-14 | Nalco Chemical Company | Method to enhance the performance of polymers and copolymers of acrylamide as flocculants and retention aids |
| GB9603909D0 (en) | 1996-02-23 | 1996-04-24 | Allied Colloids Ltd | Production of paper |
| US6238521B1 (en) | 1996-05-01 | 2001-05-29 | Nalco Chemical Company | Use of diallyldimethylammonium chloride acrylamide dispersion copolymer in a papermaking process |
| US6007679A (en) * | 1996-05-01 | 1999-12-28 | Nalco Chemical Company | Papermaking process |
| US5798023A (en) * | 1996-05-14 | 1998-08-25 | Nalco Chemical Company | Combination of talc-bentonite for deposition control in papermaking processes |
| US5858076A (en) * | 1996-06-07 | 1999-01-12 | Albion Kaolin Company | Coating composition for paper and paper boards containing starch and smectite clay |
| CA2210776A1 (en) * | 1996-07-03 | 1999-01-18 | Nalco Chemical Company | Use of blends of dispersion polymers and coagulants for coated broke treatment |
| US5837100A (en) * | 1996-07-03 | 1998-11-17 | Nalco Chemical Company | Use of blends of dispersion polymers and coagulants for coated broke treatment |
| US6059930A (en) * | 1996-09-24 | 2000-05-09 | Nalco Chemical Company | Papermaking process utilizing hydrophilic dispersion polymers of dimethylaminoethyl acrylate methyl chloride quaternary and acrylamide as retention and drainage aids |
| US6071379A (en) * | 1996-09-24 | 2000-06-06 | Nalco Chemical Company | Papermaking process utilizing hydrophilic dispersion polymers of diallyldimethyl ammonium chloride and acrylamide as retention and drainage aids |
| US6113741A (en) * | 1996-12-06 | 2000-09-05 | Eka Chemicals Ab | Process for the production of paper |
| GB2333290B (en) | 1997-05-19 | 1999-12-08 | Sortwell & Co | Method of water treatment using zeolite crystalloid coagulants |
| US5900116A (en) * | 1997-05-19 | 1999-05-04 | Sortwell & Co. | Method of making paper |
| ATE321735T1 (de) | 1997-06-09 | 2006-04-15 | Akzo Nobel Nv | Polysilikat-mikrogele |
| CA2292577C (en) | 1997-06-09 | 2005-02-08 | Akzo Nobel N.V. | Polysilicate microgels and silica-based materials |
| FI104502B (fi) | 1997-09-16 | 2000-02-15 | Metsae Serla Oyj | Menetelmä paperirainan valmistamiseksi |
| FI107274B (fi) * | 1997-09-16 | 2001-06-29 | Metsae Serla Oyj | Menetelmä hienopaperin pohjapaperin valmistamiseksi |
| FI103417B1 (fi) * | 1997-09-16 | 1999-06-30 | Metsae Serla Oyj | Paperiraina ja menetelmä sen valmistamiseksi |
| KR20010030796A (ko) * | 1997-09-30 | 2001-04-16 | 로날드 제이. 알레인, 지이 엠 브랜논, 더블유 이 패리 | 콜로이드 붕규산염 및 제지에서 이의 사용 방법 |
| US5928474A (en) * | 1997-10-30 | 1999-07-27 | E. I. Du Pont De Nemours And Company | Modified starch composition for removing particles from aqueous dispersions |
| US5859128A (en) * | 1997-10-30 | 1999-01-12 | E. I. Du Pont De Nemours And Company | Modified cationic starch composition for removing particles from aqueous dispersions |
| US6033525A (en) * | 1997-10-30 | 2000-03-07 | Moffett; Robert Harvey | Modified cationic starch composition for removing particles from aqueous dispersions |
| US6033524A (en) * | 1997-11-24 | 2000-03-07 | Nalco Chemical Company | Selective retention of filling components and improved control of sheet properties by enhancing additive pretreatment |
| US5942087A (en) * | 1998-02-17 | 1999-08-24 | Nalco Chemical Company | Starch retention in paper and board production |
| US6099689A (en) * | 1998-02-17 | 2000-08-08 | Nalco Chemical Company | Production of paper and board products with improved retention, drainage and formation |
| US7306700B1 (en) | 1998-04-27 | 2007-12-11 | Akzo Nobel Nv | Process for the production of paper |
| KR100403840B1 (ko) | 1998-04-27 | 2003-11-01 | 악조 노벨 엔.브이. | 제지 방법 |
| EP0953680A1 (en) * | 1998-04-27 | 1999-11-03 | Akzo Nobel N.V. | A process for the production of paper |
| DE19832241A1 (de) * | 1998-07-17 | 2000-01-27 | Stockhausen Chem Fab Gmbh | Verwendung von modifizierten Stärkeprodukten als Retentionsmittel bei der Papierherstellung |
| US6083997A (en) * | 1998-07-28 | 2000-07-04 | Nalco Chemical Company | Preparation of anionic nanocomposites and their use as retention and drainage aids in papermaking |
| CA2282211C (en) | 1998-10-16 | 2007-01-09 | Grain Processing Corporation | Process for preparing a paper web |
| US6835282B2 (en) * | 1998-10-16 | 2004-12-28 | Grain Processing Corporation | Paper web with pre-flocculated filler incorporated therein |
| US6217709B1 (en) | 1998-11-23 | 2001-04-17 | Hercules Incorporated | Cationic starch/cationic galactomannan gum blends as strength and drainage aids |
| WO2000066492A1 (en) * | 1999-05-04 | 2000-11-09 | Akzo Nobel N.V. | Silica-based sols |
| US7169261B2 (en) | 1999-05-04 | 2007-01-30 | Akzo Nobel N.V. | Silica-based sols |
| TW524910B (en) | 1999-11-08 | 2003-03-21 | Ciba Spec Chem Water Treat Ltd | Manufacture of paper and paperboard |
| TW483970B (en) | 1999-11-08 | 2002-04-21 | Ciba Spec Chem Water Treat Ltd | A process for making paper and paperboard |
| TW550325B (en) | 1999-11-08 | 2003-09-01 | Ciba Spec Chem Water Treat Ltd | Manufacture of paper and paperboard |
| TW527457B (en) | 1999-11-08 | 2003-04-11 | Ciba Spec Chem Water Treat Ltd | Manufacture of paper and paperboard |
| US6417268B1 (en) | 1999-12-06 | 2002-07-09 | Hercules Incorporated | Method for making hydrophobically associative polymers, methods of use and compositions |
| CA2393797C (en) | 1999-12-20 | 2007-04-24 | Akzo Nobel N.V. | Silica-based sols |
| US6315866B1 (en) * | 2000-02-29 | 2001-11-13 | Nalco Chemical Company | Method of increasing the dry strength of paper products using cationic dispersion polymers |
| DE10024437A1 (de) * | 2000-05-19 | 2001-11-29 | Aventis Res & Tech Gmbh & Co | Verfahren zur selektiven Herstellung von Essigsäure durch katalytische Oxidation von Ethan |
| USRE44519E1 (en) | 2000-08-10 | 2013-10-08 | Cargill, Incorporated | Starch compositions and methods for use in papermaking |
| US6451170B1 (en) * | 2000-08-10 | 2002-09-17 | Cargill, Incorporated | Starch compositions and methods for use in papermaking |
| AU2001288175A1 (en) | 2000-09-20 | 2002-04-02 | Akzo Nobel N.V. | A process for the production of paper |
| MY140287A (en) | 2000-10-16 | 2009-12-31 | Ciba Spec Chem Water Treat Ltd | Manufacture of paper and paperboard |
| US7189776B2 (en) * | 2001-06-12 | 2007-03-13 | Akzo Nobel N.V. | Aqueous composition |
| US6699363B2 (en) | 2001-11-13 | 2004-03-02 | E. I. Du Pont De Nemours And Company | Modified starch and process therefor |
| BR0214994B1 (pt) * | 2001-12-07 | 2012-12-11 | composição compreendendo fibra de celulose e um copolìmero aniÈnico solúvel em água, método para fabricar uma composição de fibra de celulose e método para preparar um copolìmero. | |
| US20030136534A1 (en) * | 2001-12-21 | 2003-07-24 | Hans Johansson-Vestin | Aqueous silica-containing composition |
| US7156955B2 (en) * | 2001-12-21 | 2007-01-02 | Akzo Nobel N.V. | Papermaking process using a specified NSF to silica-based particle ratio |
| JP4206344B2 (ja) * | 2002-04-03 | 2009-01-07 | 星光Pmc株式会社 | 紙の製造方法及び歩留り向上剤 |
| RU2309210C2 (ru) * | 2002-04-08 | 2007-10-27 | Циба Спешиалти Кемикэлз Уотер Тритментс Лимитед | Обработка отложения белой смолы |
| US6723204B2 (en) * | 2002-04-08 | 2004-04-20 | Hercules Incorporated | Process for increasing the dry strength of paper |
| US20040104004A1 (en) * | 2002-10-01 | 2004-06-03 | Fredrik Solhage | Cationised polysaccharide product |
| US20040138438A1 (en) * | 2002-10-01 | 2004-07-15 | Fredrik Solhage | Cationised polysaccharide product |
| AU2003288955A1 (en) * | 2002-10-31 | 2004-06-07 | Stora Enso North America Corporation | High strength dimensionally stable core |
| US7303654B2 (en) * | 2002-11-19 | 2007-12-04 | Akzo Nobel N.V. | Cellulosic product and process for its production |
| US7396874B2 (en) * | 2002-12-06 | 2008-07-08 | Hercules Incorporated | Cationic or amphoteric copolymers prepared in an inverse emulsion matrix and their use in preparing cellulosic fiber compositions |
| MXPA05009123A (es) * | 2003-02-27 | 2006-03-08 | Univ Maine | Composiciones y metodos de almidon para hacer composiciones de almidon. |
| CN1768006B (zh) * | 2003-04-02 | 2010-05-26 | 西巴特殊化学水处理有限公司 | 含水组合物及其在纸和纸板生产中的用途 |
| WO2004088034A2 (en) * | 2003-04-02 | 2004-10-14 | Ciba Specialty Chemicals Water Treatments Limited | Aqueous compositions and their use in the manufacture of paper and paperboard |
| CN1784525A (zh) * | 2003-05-09 | 2006-06-07 | 阿克佐诺贝尔公司 | 一种造纸方法 |
| AR044128A1 (es) * | 2003-05-09 | 2005-08-24 | Akzo Nobel Nv | Proceso para la produccion de papel |
| US6906404B2 (en) * | 2003-05-16 | 2005-06-14 | Ballard Power Systems Corporation | Power module with voltage overshoot limiting |
| KR20060028783A (ko) * | 2003-07-01 | 2006-04-03 | 더 유니버시티 오브 메인 보드 오브 트러스티스 | 겔화된 전분 조성물 및 겔화된 전분 조성물의 제조 방법 |
| DE10346750A1 (de) * | 2003-10-06 | 2005-04-21 | Basf Ag | Verfahren zur Herstellung von Papier, Pappe und Karton |
| AU2005206565A1 (en) * | 2004-01-23 | 2005-08-04 | Buckman Laboratories International Inc | Process for making paper |
| GB0402469D0 (en) * | 2004-02-04 | 2004-03-10 | Ciba Spec Chem Water Treat Ltd | Production of a fermentation product |
| GB0402470D0 (en) | 2004-02-04 | 2004-03-10 | Ciba Spec Chem Water Treat Ltd | Production of a fermentation product |
| US7629392B2 (en) * | 2004-04-07 | 2009-12-08 | Akzo Nobel N.V. | Silica-based sols and their production and use |
| US7732495B2 (en) * | 2004-04-07 | 2010-06-08 | Akzo Nobel N.V. | Silica-based sols and their production and use |
| US7201826B2 (en) * | 2004-05-17 | 2007-04-10 | Zo Mineral Partners Ltd. | High performance natural zeolite microparticle retention aid for papermaking |
| US20050257909A1 (en) * | 2004-05-18 | 2005-11-24 | Erik Lindgren | Board, packaging material and package as well as production and uses thereof |
| ES2424293T3 (es) * | 2004-11-03 | 2013-09-30 | J. Rettenmaier & Sohne Gmbh + Co. Kg | Carga que contiene celulosa para productos de papel, papel tisú o cartón así como procedimientos de producción para la misma así como producto de papel, papel tisú o cartón que contiene tal carga o mezcla seca usada para ello |
| US7955473B2 (en) * | 2004-12-22 | 2011-06-07 | Akzo Nobel N.V. | Process for the production of paper |
| US20060142431A1 (en) | 2004-12-29 | 2006-06-29 | Sutman Frank J | Retention and drainage in the manufacture of paper |
| US20060254464A1 (en) | 2005-05-16 | 2006-11-16 | Akzo Nobel N.V. | Process for the production of paper |
| US20060266488A1 (en) * | 2005-05-26 | 2006-11-30 | Doherty Erin A S | Hydrophobic polymers and their use in preparing cellulosic fiber compositions |
| US8273216B2 (en) * | 2005-12-30 | 2012-09-25 | Akzo Nobel N.V. | Process for the production of paper |
| PT1969183E (pt) | 2005-12-30 | 2015-03-06 | Akzo Nobel Nv | Processo para a produção de papel |
| US10227238B2 (en) | 2006-04-04 | 2019-03-12 | Ecolab Usa Inc. | Production and use of polysilicate particulate materials |
| US8728274B2 (en) * | 2006-09-22 | 2014-05-20 | Akzo Nobel N.V. | Treatment of pulp |
| EP2069573A2 (en) * | 2006-09-27 | 2009-06-17 | Ciba Holding Inc. | Siliceous composition and its use in papermaking |
| WO2008052970A1 (de) * | 2006-10-31 | 2008-05-08 | Basf Se | Verfahren zur herstellung einer mehrschichtigen faserstoffbahn aus zellulosefasern |
| EP2086757A1 (en) * | 2006-12-01 | 2009-08-12 | Akzo Nobel N.V. | Packaging laminate |
| EP2122051B1 (en) * | 2006-12-21 | 2012-02-22 | Akzo Nobel N.V. | Process for the production of cellulosic product |
| CN101680191A (zh) * | 2007-05-23 | 2010-03-24 | 阿克佐诺贝尔股份有限公司 | 生产纤维素产品的方法 |
| AR066831A1 (es) | 2007-06-07 | 2009-09-16 | Akzo Nobel Nv | Soles a base de silice |
| CL2008002019A1 (es) * | 2007-07-16 | 2009-01-16 | Akzo Nobel Chemicals Int Bv | Composicion de carga que comprende una carga, un compuesto inorganico cationico, un compuesto organico cationico y un polisacarido anionico; metodo para preparar dicha composicion; uso como aditivo para una suspension celulosica acuosa; procedimiento para producir papel; y papel. |
| JP2009120967A (ja) * | 2007-11-12 | 2009-06-04 | Nippon Shokuhin Kako Co Ltd | 天然紙力剤、及びこれを用いた板紙の製造方法 |
| FI20085227L (fi) * | 2008-03-14 | 2009-09-15 | Kautar Oy | Lujitettu huokoinen kuitutuote |
| EP2199462A1 (en) | 2008-12-18 | 2010-06-23 | Coöperatie Avebe U.A. | A process for making paper |
| CA2766790A1 (en) * | 2009-06-29 | 2011-01-06 | Buckman Laboratories International, Inc. | Papermaking and products made thereby with high solids glyoxalated-polyacrylamide and silicon-containing microparticle |
| US20100330366A1 (en) * | 2009-06-30 | 2010-12-30 | Keiser Bruce A | Silica-based particle composition |
| EP2402503A1 (en) | 2010-06-30 | 2012-01-04 | Akzo Nobel Chemicals International B.V. | Process for the production of a cellulosic product |
| CA2803904C (en) | 2010-07-26 | 2014-01-28 | Sortwell & Co. | Method for dispersing and aggregating components of mineral slurries and high-molecular weight multivalent anionic polymers for clay aggregation |
| FR2963364B1 (fr) | 2010-08-02 | 2014-12-26 | Snf Sas | Procede de fabrication de papier et carton presentant des proprietes de retention et d'egouttage ameliorees. |
| US8721896B2 (en) | 2012-01-25 | 2014-05-13 | Sortwell & Co. | Method for dispersing and aggregating components of mineral slurries and low molecular weight multivalent polymers for mineral aggregation |
| BR112014017989B1 (pt) | 2012-02-01 | 2021-02-23 | Basf Se | processo para a fabricação de papel ou papelão |
| US9631319B2 (en) | 2012-03-01 | 2017-04-25 | Basf Se | Process for the manufacture of paper and paperboard |
| CA2897185C (en) | 2013-01-11 | 2018-10-09 | Basf Se | Process for the manufacture of paper and paperboard |
| US10087081B2 (en) | 2013-03-08 | 2018-10-02 | Ecolab Usa Inc. | Process for producing high solids colloidal silica |
| US9656914B2 (en) | 2013-05-01 | 2017-05-23 | Ecolab Usa Inc. | Rheology modifying agents for slurries |
| US9410288B2 (en) | 2013-08-08 | 2016-08-09 | Ecolab Usa Inc. | Use of nanocrystaline cellulose and polymer grafted nanocrystaline cellulose for increasing retention in papermaking process |
| US9034145B2 (en) | 2013-08-08 | 2015-05-19 | Ecolab Usa Inc. | Use of nanocrystaline cellulose and polymer grafted nanocrystaline cellulose for increasing retention, wet strength, and dry strength in papermaking process |
| US9303360B2 (en) | 2013-08-08 | 2016-04-05 | Ecolab Usa Inc. | Use of nanocrystaline cellulose and polymer grafted nanocrystaline cellulose for increasing retention in papermaking process |
| KR20160048836A (ko) | 2013-08-23 | 2016-05-04 | 아크조 노벨 케미칼즈 인터내셔널 비.브이. | 실리카 졸 |
| US9834730B2 (en) | 2014-01-23 | 2017-12-05 | Ecolab Usa Inc. | Use of emulsion polymers to flocculate solids in organic liquids |
| US20160073686A1 (en) | 2014-09-12 | 2016-03-17 | R.J. Reynolds Tobacco Company | Tobacco-derived filter element |
| US9950858B2 (en) | 2015-01-16 | 2018-04-24 | R.J. Reynolds Tobacco Company | Tobacco-derived cellulose material and products formed thereof |
| EP3325590B1 (en) | 2015-07-18 | 2020-09-30 | Ecolab USA Inc. | Chemical additives to improve oil separation in stillage process operations |
| US9873982B2 (en) | 2015-10-12 | 2018-01-23 | Solenis Technologies, L.P. | Method of increasing drainage performance of a pulp slurry during manufacture of paper products, and products therefrom |
| CA3001717A1 (en) | 2015-10-15 | 2017-04-20 | Ecolab Usa Inc. | Nanocrystalline cellulose and polymer-grafted nanocrystalline cellulose as rheology modifying agents for magnesium oxide and lime slurries |
| US10851498B2 (en) | 2016-09-16 | 2020-12-01 | Solenis Technologies, L.P. | Increased drainage performance in papermaking systems using microfibrillated cellulose |
| EP3655373A1 (en) | 2017-07-17 | 2020-05-27 | Ecolab USA, Inc. | Rheology-modifying agents for slurries |
| CN113201965A (zh) * | 2021-03-30 | 2021-08-03 | 金光纸业(中国)投资有限公司 | 一种纸张挺度剂的制备方法、纸张及其制备方法 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB645354A (en) * | 1947-04-18 | 1950-11-01 | Oldham & Son Ltd | A new or improved acid-resisting, micro-porous material and method of making the same |
| US2865743A (en) * | 1957-03-11 | 1958-12-23 | Hercules Powder Co Ltd | Ketene dimer sizing composition and process for sizing paper therewith |
| US3022213A (en) * | 1958-02-13 | 1962-02-20 | Michigan Res Lab Inc | Conductive web and method of making same |
| US3253978A (en) * | 1961-07-19 | 1966-05-31 | C H Dexter & Sons Inc | Method of forming an inorganic waterlaid sheet containing colloidal silica and cationic starch |
| US3224927A (en) * | 1963-10-04 | 1965-12-21 | Du Pont | Forming inorganic fiber material containing cationic starch and colloidal silica |
| US3227607A (en) * | 1963-10-15 | 1966-01-04 | Huber Corp J M | Method of adding silica pigments to newsprint pulp to improve ink strike properties of the newsprint and pigment therefor |
| DE1636335A1 (de) * | 1964-11-10 | 1971-05-27 | Zschimmer & Schwarz | Verfahren zur Reinigung von Papierstoff enthaltenden Waessern durch Flotation oder Sedimentation |
| US3592834A (en) | 1969-01-27 | 1971-07-13 | Buckman Labor Inc | Organo-silica polymers |
| US3737370A (en) * | 1970-02-27 | 1973-06-05 | Nat Starch Chem Corp | Process for making paper and paper made therefrom using liquid cationic starch derivatives |
| US3779912A (en) * | 1970-10-12 | 1973-12-18 | Petrolite Corp | Water clarification process using silicon-containing aminomethyl phosphonates |
| US3721575A (en) * | 1971-01-05 | 1973-03-20 | Nat Starch Chem Corp | Continuous process for the preparation of modified starch dispersions |
| HU168869B (esLanguage) * | 1971-02-22 | 1976-07-28 | ||
| DE2412452C3 (de) | 1974-03-15 | 1981-01-08 | Benckiser-Knapsack Gmbh, 6802 Ladenburg | Verfahren zum Entfernen von ölen, Lösungsmitteln und Lackstoffen aus Abwasser |
| FI54805C (fi) | 1976-12-27 | 1979-03-12 | Medipolar Oy | Vattenloesning av ett staerkelsederivat avsedd att anvaendas foer utfaellning av negativt laddade partiklar i vattensuspension och foerfarande foer dess framstaellning |
| JPS53149879A (en) | 1977-01-31 | 1978-12-27 | Tokyo Yuuki Kagaku Kougiyou Kk | Method of manufacturing glanular aggregating agent |
| GR65316B (en) * | 1978-06-20 | 1980-08-02 | Arjomari Prioux | Method for the preparation of fibrous leaf |
| FR2429293A1 (fr) * | 1978-06-20 | 1980-01-18 | Arjomari Prioux | Feuille minerale, son procede de preparation et son utilisation notamment dans le domaine des revetements et des supports d'impression-ecriture |
| SE419236B (sv) * | 1979-06-01 | 1981-07-20 | Eka Ab | Ytmodifierat pigment av naturligt kaolinmaterial, samt for dess framstellning |
-
1980
- 1980-05-28 SE SE8003948A patent/SE432951B/sv not_active Application Discontinuation
-
1981
- 1981-02-26 US US06/238,635 patent/US4388150A/en not_active Expired - Lifetime
- 1981-03-16 CA CA000373025A patent/CA1154563A/en not_active Expired
- 1981-05-28 JP JP56081777A patent/JPS5751900A/ja active Granted
-
1987
- 1987-01-29 JP JP62019576A patent/JPS62223395A/ja active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1986000100A1 (en) * | 1984-06-07 | 1986-01-03 | Eka Ab | Papermaking process |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5751900A (en) | 1982-03-26 |
| CA1154563A (en) | 1983-10-04 |
| US4388150A (en) | 1983-06-14 |
| SE8003948L (sv) | 1981-11-29 |
| JPS62223395A (ja) | 1987-10-01 |
| JPH0341598B2 (esLanguage) | 1991-06-24 |
| JPS6231120B2 (esLanguage) | 1987-07-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE432951B (sv) | Pappersprodukt innehallande cellulosafibrer och ett bindemedelssystem som omfattar kolloidal kiselsyra och katjonisk sterkelse samt forfarande for framstellning av pappersprodukten | |
| EP0041056B1 (en) | Papermaking | |
| US6579410B1 (en) | Pigment materials and their preparation and use | |
| DE69101427T2 (de) | Verfahren zur Herstellung von Zellulosefasern enthaltenden Verbindungen als Blatt oder Gewebe. | |
| EP0080986B1 (en) | A process for papermaking | |
| US4913775A (en) | Production of paper and paper board | |
| EP0791685B1 (en) | Procedure for adding a filler into a pulp based on cellulose fibres | |
| EP2122051B1 (en) | Process for the production of cellulosic product | |
| EP0235893B1 (en) | Production of paper and paperboard | |
| US4964955A (en) | Method of reducing pitch in pulping and papermaking operations | |
| CN1213200C (zh) | 矿物填料填充造纸用纤维素纤维细胞腔的方法 | |
| JPH06294095A (ja) | 填料含有紙の製造方法 | |
| CZ49595A3 (en) | Water suspension of colloidal particles, process of its preparation and use | |
| US20080011438A1 (en) | Cellulosic product and process for its production | |
| ZA200508659B (en) | A process for the production of paper | |
| KR20040068321A (ko) | 수성 실리카-함유 조성물 그리고 종이의 제조 공정 | |
| KR20050083897A (ko) | 셀룰로오스계 제품 및 제조 공정 | |
| WO2000078874A1 (en) | Pigment materials and their preparation and use | |
| CN111788347A (zh) | 制造包含微原纤化纤维素的组合物的方法 | |
| JP2007501344A (ja) | 紙の製造方法 | |
| US20070131372A1 (en) | Phyllosilicate Slurry For Papermaking | |
| KR20060009008A (ko) | 종이의 제조 방법 | |
| SK14193A3 (sk) | Viaczložkový retenčný systém | |
| NO174783B (no) | Fremgangsmåte ved fremstilling av papir |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAV | Patent application has lapsed |
Ref document number: 8003948-0 Effective date: 19880526 Format of ref document f/p: F |