PL160277B1 - S rodek grzybobójczy, owadobójczy lub roztoczobójczy PL PL PL PL PL PL - Google Patents
S rodek grzybobójczy, owadobójczy lub roztoczobójczy PL PL PL PL PL PLInfo
- Publication number
- PL160277B1 PL160277B1 PL1989282378A PL28237889A PL160277B1 PL 160277 B1 PL160277 B1 PL 160277B1 PL 1989282378 A PL1989282378 A PL 1989282378A PL 28237889 A PL28237889 A PL 28237889A PL 160277 B1 PL160277 B1 PL 160277B1
- Authority
- PL
- Poland
- Prior art keywords
- phenyl
- ppm
- oil
- cyano
- group
- Prior art date
Links
- 230000000855 fungicidal effect Effects 0.000 title claims description 11
- 239000000417 fungicide Substances 0.000 title claims description 8
- 239000002917 insecticide Substances 0.000 title claims description 7
- 230000000895 acaricidal effect Effects 0.000 title claims description 6
- 239000000642 acaricide Substances 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 68
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 50
- -1 phoncksyl Chemical group 0.000 claims description 22
- 239000003795 chemical substances by application Substances 0.000 claims description 19
- 125000005843 halogen group Chemical group 0.000 claims description 19
- 239000004480 active ingredient Substances 0.000 claims description 18
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 125000000623 heterocyclic group Chemical group 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 239000003085 diluting agent Substances 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 241000282320 Panthera leo Species 0.000 claims description 3
- 239000013543 active substance Substances 0.000 claims description 3
- 125000005553 heteroaryloxy group Chemical group 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 3
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 claims 3
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 claims 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- 125000004423 acyloxy group Chemical group 0.000 claims 1
- 125000004414 alkyl thio group Chemical group 0.000 claims 1
- 230000001054 cortical effect Effects 0.000 claims 1
- 125000000000 cycloalkoxy group Chemical group 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 235000013580 sausages Nutrition 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 5
- 239000003905 agrochemical Substances 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- 239000003921 oil Substances 0.000 description 93
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 41
- 241000196324 Embryophyta Species 0.000 description 29
- 239000000203 mixture Substances 0.000 description 20
- 238000012360 testing method Methods 0.000 description 13
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 12
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 12
- 201000010099 disease Diseases 0.000 description 11
- 239000008187 granular material Substances 0.000 description 10
- 238000005507 spraying Methods 0.000 description 10
- 241000607479 Yersinia pestis Species 0.000 description 8
- 239000002689 soil Substances 0.000 description 8
- 240000007594 Oryza sativa Species 0.000 description 7
- 235000007164 Oryza sativa Nutrition 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 235000009566 rice Nutrition 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- 235000011430 Malus pumila Nutrition 0.000 description 5
- 244000070406 Malus silvestris Species 0.000 description 5
- 235000015103 Malus silvestris Nutrition 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 241000209140 Triticum Species 0.000 description 5
- 235000021307 Triticum Nutrition 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 239000011575 calcium Substances 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 150000002923 oximes Chemical class 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 241000894007 species Species 0.000 description 5
- 238000011282 treatment Methods 0.000 description 5
- 235000013311 vegetables Nutrition 0.000 description 5
- 241000238876 Acari Species 0.000 description 4
- 241000238631 Hexapoda Species 0.000 description 4
- 240000005979 Hordeum vulgare Species 0.000 description 4
- 235000007340 Hordeum vulgare Nutrition 0.000 description 4
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 4
- 240000003768 Solanum lycopersicum Species 0.000 description 4
- 235000014787 Vitis vinifera Nutrition 0.000 description 4
- 240000006365 Vitis vinifera Species 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 238000000227 grinding Methods 0.000 description 4
- 238000000338 in vitro Methods 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000000375 suspending agent Substances 0.000 description 4
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- 241000239290 Araneae Species 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- 241000257229 Musca <genus> Species 0.000 description 3
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 3
- 244000061176 Nicotiana tabacum Species 0.000 description 3
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 3
- 244000046052 Phaseolus vulgaris Species 0.000 description 3
- 241000221300 Puccinia Species 0.000 description 3
- 241000221535 Pucciniales Species 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 239000013011 aqueous formulation Substances 0.000 description 3
- 239000000440 bentonite Substances 0.000 description 3
- 229910000278 bentonite Inorganic materials 0.000 description 3
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 230000001276 controlling effect Effects 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000003337 fertilizer Substances 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 230000000749 insecticidal effect Effects 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- 229920001983 poloxamer Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229920005552 sodium lignosulfonate Polymers 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000009736 wetting Methods 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- JLIDBLDQVAYHNE-YKALOCIXSA-N (+)-Abscisic acid Chemical compound OC(=O)/C=C(/C)\C=C\[C@@]1(O)C(C)=CC(=O)CC1(C)C JLIDBLDQVAYHNE-YKALOCIXSA-N 0.000 description 2
- PRPINYUDVPFIRX-UHFFFAOYSA-N 1-naphthaleneacetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CC=CC2=C1 PRPINYUDVPFIRX-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 2
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- VFUQDUGKYYDRMT-UHFFFAOYSA-N 3-methoxyprop-2-enoic acid Chemical group COC=CC(O)=O VFUQDUGKYYDRMT-UHFFFAOYSA-N 0.000 description 2
- 241001157813 Cercospora Species 0.000 description 2
- 244000024469 Cucumis prophetarum Species 0.000 description 2
- 241000255925 Diptera Species 0.000 description 2
- 206010061818 Disease progression Diseases 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 240000005561 Musa balbisiana Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241000244206 Nematoda Species 0.000 description 2
- 241000819999 Nymphes Species 0.000 description 2
- 241000233679 Peronosporaceae Species 0.000 description 2
- 241001123569 Puccinia recondita Species 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 230000000843 anti-fungal effect Effects 0.000 description 2
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 230000005750 disease progression Effects 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 235000014571 nuts Nutrition 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 2
- QJBZDBLBQWFTPZ-UHFFFAOYSA-N pyrrolnitrin Chemical compound [O-][N+](=O)C1=C(Cl)C=CC=C1C1=CNC=C1Cl QJBZDBLBQWFTPZ-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 description 1
- UDPGUMQDCGORJQ-UHFFFAOYSA-N (2-chloroethyl)phosphonic acid Chemical compound OP(O)(=O)CCCl UDPGUMQDCGORJQ-UHFFFAOYSA-N 0.000 description 1
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 1
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- CKPCAYZTYMHQEX-NBVRZTHBSA-N (e)-1-(2,4-dichlorophenyl)-n-methoxy-2-pyridin-3-ylethanimine Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=N/OC)/CC1=CC=CN=C1 CKPCAYZTYMHQEX-NBVRZTHBSA-N 0.000 description 1
- JWUCHKBSVLQQCO-UHFFFAOYSA-N 1-(2-fluorophenyl)-1-(4-fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanol Chemical compound C=1C=C(F)C=CC=1C(C=1C(=CC=CC=1)F)(O)CN1C=NC=N1 JWUCHKBSVLQQCO-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- OWDLFBLNMPCXSD-UHFFFAOYSA-N 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxotetrahydrofuran-3-yl)acetamide Chemical compound CC1=CC=CC(C)=C1N(C(=O)CCl)C1C(=O)OCC1 OWDLFBLNMPCXSD-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- ZOMKCDYJHAQMCU-UHFFFAOYSA-N 4-butyl-1,2,4-triazole Chemical group CCCCN1C=NN=C1 ZOMKCDYJHAQMCU-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000004938 5-pyridyl group Chemical group N1=CC=CC(=C1)* 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 241000238658 Blattella Species 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- 241001480061 Blumeria graminis Species 0.000 description 1
- 241000895523 Blumeria graminis f. sp. hordei Species 0.000 description 1
- 241000895502 Blumeria graminis f. sp. tritici Species 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 241000233685 Bremia lactucae Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- 101100203596 Caenorhabditis elegans sol-1 gene Proteins 0.000 description 1
- 235000002566 Capsicum Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- NYNKCGWJPNZJMI-UHFFFAOYSA-N Clebopride malate Chemical compound [O-]C(=O)C(O)CC(O)=O.COC1=CC(N)=C(Cl)C=C1C(=O)NC1CC[NH+](CC=2C=CC=CC=2)CC1 NYNKCGWJPNZJMI-UHFFFAOYSA-N 0.000 description 1
- 244000205754 Colocasia esculenta Species 0.000 description 1
- 235000006481 Colocasia esculenta Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000221787 Erysiphe Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 239000005976 Ethephon Substances 0.000 description 1
- 229920003958 FORMION® Polymers 0.000 description 1
- 239000005787 Flutriafol Substances 0.000 description 1
- 239000005789 Folpet Substances 0.000 description 1
- 235000016623 Fragaria vesca Nutrition 0.000 description 1
- 240000009088 Fragaria x ananassa Species 0.000 description 1
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FAIXYKHYOGVFKA-UHFFFAOYSA-N Kinetin Natural products N=1C=NC=2N=CNC=2C=1N(C)C1=CC=CO1 FAIXYKHYOGVFKA-UHFFFAOYSA-N 0.000 description 1
- 235000003228 Lactuca sativa Nutrition 0.000 description 1
- 240000008415 Lactuca sativa Species 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 101150056612 PPIA gene Proteins 0.000 description 1
- 241000315044 Passalora arachidicola Species 0.000 description 1
- 239000006002 Pepper Substances 0.000 description 1
- 241001223281 Peronospora Species 0.000 description 1
- 244000025272 Persea americana Species 0.000 description 1
- 235000008673 Persea americana Nutrition 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 241000233614 Phytophthora Species 0.000 description 1
- 241000233622 Phytophthora infestans Species 0.000 description 1
- 235000016761 Piper aduncum Nutrition 0.000 description 1
- 240000003889 Piper guineense Species 0.000 description 1
- 235000017804 Piper guineense Nutrition 0.000 description 1
- 235000008184 Piper nigrum Nutrition 0.000 description 1
- 241000233626 Plasmopara Species 0.000 description 1
- 241000896242 Podosphaera Species 0.000 description 1
- 229930182764 Polyoxin Natural products 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000005820 Prochloraz Substances 0.000 description 1
- 239000005821 Propamocarb Substances 0.000 description 1
- 239000005823 Propineb Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 241000682843 Pseudocercosporella Species 0.000 description 1
- 241001281802 Pseudoperonospora Species 0.000 description 1
- 241001281805 Pseudoperonospora cubensis Species 0.000 description 1
- 241001123559 Puccinia hordei Species 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- 241000813090 Rhizoctonia solani Species 0.000 description 1
- 206010039509 Scab Diseases 0.000 description 1
- 241001533598 Septoria Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 241000610375 Sparisoma viride Species 0.000 description 1
- 241000256247 Spodoptera exigua Species 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 241000221372 Thanatephorus Species 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 239000005843 Thiram Substances 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000722133 Tilletia Species 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 241000221566 Ustilago Species 0.000 description 1
- 241000219094 Vitaceae Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 229920005550 ammonium lignosulfonate Polymers 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000005018 aryl alkenyl group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005015 aryl alkynyl group Chemical group 0.000 description 1
- 235000021015 bananas Nutrition 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229920002988 biodegradable polymer Polymers 0.000 description 1
- 239000004621 biodegradable polymer Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- JIJAYWGYIDJVJI-UHFFFAOYSA-N butyl naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)OCCCC)=CC=CC2=C1 JIJAYWGYIDJVJI-UHFFFAOYSA-N 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- LDVVMCZRFWMZSG-UHFFFAOYSA-N captan Chemical compound C1C=CCC2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C21 LDVVMCZRFWMZSG-UHFFFAOYSA-N 0.000 description 1
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 1
- 229960005286 carbaryl Drugs 0.000 description 1
- DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- JLQUFIHWVLZVTJ-UHFFFAOYSA-N carbosulfan Chemical compound CCCCN(CCCC)SN(C)C(=O)OC1=CC=CC2=C1OC(C)(C)C2 JLQUFIHWVLZVTJ-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 235000016213 coffee Nutrition 0.000 description 1
- 235000013353 coffee beverage Nutrition 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000005159 cyanoalkoxy group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- FCRACOPGPMPSHN-UHFFFAOYSA-N desoxyabscisic acid Natural products OC(=O)C=C(C)C=CC1C(C)=CC(=O)CC1(C)C FCRACOPGPMPSHN-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- 208000032625 disorder of ear Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000008451 emotion Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- DIRFUJHNVNOBMY-UHFFFAOYSA-N fenobucarb Chemical compound CCC(C)C1=CC=CC=C1OC(=O)NC DIRFUJHNVNOBMY-UHFFFAOYSA-N 0.000 description 1
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical compound C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 description 1
- 238000003958 fumigation Methods 0.000 description 1
- 235000021021 grapes Nutrition 0.000 description 1
- 238000009499 grossing Methods 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 230000003394 haemopoietic effect Effects 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 235000012907 honey Nutrition 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000003617 indole-3-acetic acid Substances 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- QBSJMKIUCUGGNG-UHFFFAOYSA-N isoprocarb Chemical compound CNC(=O)OC1=CC=CC=C1C(C)C QBSJMKIUCUGGNG-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- QANMHLXAZMSUEX-UHFFFAOYSA-N kinetin Chemical compound N=1C=NC=2N=CNC=2C=1NCC1=CC=CO1 QANMHLXAZMSUEX-UHFFFAOYSA-N 0.000 description 1
- 229960001669 kinetin Drugs 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000002362 mulch Substances 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- SQDFHQJTAWCFIB-UHFFFAOYSA-N n-methylidenehydroxylamine Chemical compound ON=C SQDFHQJTAWCFIB-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- UWVQIROCRJWDKL-UHFFFAOYSA-N oxadixyl Chemical compound CC=1C=CC=C(C)C=1N(C(=O)COC)N1CCOC1=O UWVQIROCRJWDKL-UHFFFAOYSA-N 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-N pent-4-enoic acid Chemical compound OC(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- YEBIHIICWDDQOL-YBHNRIQQSA-N polyoxin Polymers O[C@@H]1[C@H](O)[C@@H](C(C=O)N)O[C@H]1N1C(=O)NC(=O)C(C(O)=O)=C1 YEBIHIICWDDQOL-YBHNRIQQSA-N 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- WHHIPMZEDGBUCC-UHFFFAOYSA-N probenazole Chemical compound C1=CC=C2C(OCC=C)=NS(=O)(=O)C2=C1 WHHIPMZEDGBUCC-UHFFFAOYSA-N 0.000 description 1
- TVLSRXXIMLFWEO-UHFFFAOYSA-N prochloraz Chemical compound C1=CN=CN1C(=O)N(CCC)CCOC1=C(Cl)C=C(Cl)C=C1Cl TVLSRXXIMLFWEO-UHFFFAOYSA-N 0.000 description 1
- WZZLDXDUQPOXNW-UHFFFAOYSA-N propamocarb Chemical compound CCCOC(=O)NCCCN(C)C WZZLDXDUQPOXNW-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- KKMLIVYBGSAJPM-UHFFFAOYSA-L propineb Chemical compound [Zn+2].[S-]C(=S)NC(C)CNC([S-])=S KKMLIVYBGSAJPM-UHFFFAOYSA-L 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- YRRBXJLFCBCKNW-UHFFFAOYSA-N prothiocarb Chemical compound CCSC(=O)NCCCN(C)C YRRBXJLFCBCKNW-UHFFFAOYSA-N 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- JOOMJVFZQRQWKR-UHFFFAOYSA-N pyrazophos Chemical compound N1=C(C)C(C(=O)OCC)=CN2N=C(OP(=S)(OCC)OCC)C=C21 JOOMJVFZQRQWKR-UHFFFAOYSA-N 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 229960002132 pyrrolnitrin Drugs 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- XQTLDIFVVHJORV-UHFFFAOYSA-N tecnazene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=CC(Cl)=C1Cl XQTLDIFVVHJORV-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical class 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- YFNCATAIYKQPOO-UHFFFAOYSA-N thiophanate Chemical compound CCOC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OCC YFNCATAIYKQPOO-UHFFFAOYSA-N 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
- 229960002447 thiram Drugs 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/335—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
- A01N37/38—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids having at least one oxygen or sulfur atom attached to an aromatic ring system
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
- A01N37/38—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids having at least one oxygen or sulfur atom attached to an aromatic ring system
- A01N37/40—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids having at least one oxygen or sulfur atom attached to an aromatic ring system having at least one carboxylic group or a thio analogue, or a derivative thereof, and one oxygen or sulfur atom attached to the same aromatic ring system
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/44—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a nitrogen atom attached to the same carbon skeleton by a single or double bond, this nitrogen atom not being a member of a derivative or of a thio analogue of a carboxylic group, e.g. amino-carboxylic acids
- A01N37/50—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a nitrogen atom attached to the same carbon skeleton by a single or double bond, this nitrogen atom not being a member of a derivative or of a thio analogue of a carboxylic group, e.g. amino-carboxylic acids the nitrogen atom being doubly bound to the carbon skeleton
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N41/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a sulfur atom bound to a hetero atom
- A01N41/02—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a sulfur atom bound to a hetero atom containing a sulfur-to-oxygen double bond
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N41/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a sulfur atom bound to a hetero atom
- A01N41/02—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a sulfur atom bound to a hetero atom containing a sulfur-to-oxygen double bond
- A01N41/10—Sulfones; Sulfoxides
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/06—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings
- A01N43/08—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings with oxygen as the ring hetero atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/06—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings
- A01N43/10—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings with sulfur as the ring hetero atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/14—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom six-membered rings
- A01N43/16—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom six-membered rings with oxygen as the ring hetero atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/14—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom six-membered rings
- A01N43/18—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom six-membered rings with sulfur as the ring hetero atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/36—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom five-membered rings
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
- A01N43/42—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings condensed with carbocyclic rings
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/54—1,3-Diazines; Hydrogenated 1,3-diazines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/58—1,2-Diazines; Hydrogenated 1,2-diazines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/60—1,4-Diazines; Hydrogenated 1,4-diazines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/647—Triazoles; Hydrogenated triazoles
- A01N43/653—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/707—1,2,3- or 1,2,4-triazines; Hydrogenated 1,2,3- or 1,2,4-triazines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/74—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,3
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/74—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,3
- A01N43/76—1,3-Oxazoles; Hydrogenated 1,3-oxazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/74—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,3
- A01N43/78—1,3-Thiazoles; Hydrogenated 1,3-thiazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/80—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,2
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/34—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the groups, e.g. biuret; Thio analogues thereof; Urea-aldehyde condensation products
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/32—Oximes
- C07C251/50—Oximes having oxygen atoms of oxyimino groups bound to carbon atoms of substituted hydrocarbon radicals
- C07C251/60—Oximes having oxygen atoms of oxyimino groups bound to carbon atoms of substituted hydrocarbon radicals of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/63—Carboxylic acid nitriles containing cyano groups and nitrogen atoms further bound to other hetero atoms, other than oxygen atoms of nitro or nitroso groups, bound to the same carbon skeleton
- C07C255/64—Carboxylic acid nitriles containing cyano groups and nitrogen atoms further bound to other hetero atoms, other than oxygen atoms of nitro or nitroso groups, bound to the same carbon skeleton with the nitrogen atoms further bound to oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/53—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/55—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/57—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/50—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/26—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/74—Quinazolines; Hydrogenated quinazolines with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached to ring carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/12—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/16—Halogen atoms; Nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/18—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/42—Benzopyrazines with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/50—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to ring nitrogen atoms
- C07D241/52—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/28—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/14—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/66—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/08—One of the condensed rings being a six-membered aromatic ring the other ring being five-membered, e.g. indane
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/10—One of the condensed rings being a six-membered aromatic ring the other ring being six-membered, e.g. tetraline
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Environmental Sciences (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyridine Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Quinoline Compounds (AREA)
- Furan Compounds (AREA)
- Pyrane Compounds (AREA)
- Pyrrole Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
Abstract
1. Srodek grzybobójczy, owadobójczy lub roztoczo- bójczy, znamienny tym, ze jako substancje czynna zawiera zwiazek o wzorze 1, w którym R1 i R2 moga byc takie same lub rózne i oznaczaja wodór, chlorowiec, grupe Ci-6alkilo- wa, C3-6 c ykloalkilowa, fenylowa, fenoksylowa, fenylo/C1- 4/alkilowa, heteroarylowa, cyjanowa, - CO2R 3 -COR3, -SO2R3, gdzie R3 oznacza wodór, grupe C 1- 6 alkilowa lub fenylowa, albo R1 i R2 razem tworza pierscien C5-10 kar- bocykllczny lub heterocykliczny, ewentualnie zawierajacy sprzezony pierscien benzenowy, przy czym pierscien hete- rocykliczny zawiera 1 lub 2 atomy tlenu lub azotu, kazda z wymienionych wyzej grup fenylowych albo heteroar ylo- wych, bedacych 5- lub 6-czlonowymi pierscieniami, zawie- rajacymi 1, 2 lub 3 atomy tlenu, azotu lub siarki, moze byc ewentualnie podstawiona chlorowcem, grupa C1-4 alkilo- wa, C1-4 alkoksylowa, C1-4 alkilotio, chlorowco/C1-4/alkilo- wa, chlorowco/C1- 4/alkoksylowa, C2-6 alkenyloksylowa, C2-4 alkinyloksylowa, heteroar yloksylowa, fenylowa, feno- ksylowa, nitrowa, cyjanowa. N-oksy, fenylo-/C1-4 alkil owa. fenylo/C1 -4 / alkoksylowa, -NR3R4, -CO2R3, -CONR3R4 lub -SO2R3, gdzie R3 i R4 moga byc takie same lub rózne i maja znaczenie wyzej podane dla R3, a grupy fenylowe sa ewen- tualnie podstawione chlorowcem lub grupa cyjanowa oraz j ego stereoizomery, w polaczeniu z grzybobójczo, owadobój- czo lub roztoczotójczo dopuszczalnym nosnikiem lub roz- cienczalnikiem W Z Ó R 1 PL PL PL PL PL PL
Description
Przedmiotem wynalazku Jost środek grzybobójczy, owadobóóczy lub roztoczobójczy, zawierający jako substancję czynną nowo pochodne kwasu proponowego.
środek według wynalazku zawiera jako substancję czynną związek o wzorze 1, w którym R i R mocą byc takio same lub różno i oznaczają wodór, chlorowiec, grupę Cj_g-llkllooę,
Cg gCykkoalkilową, C^gglkoksylową, chlonwco/Cj_4/a kł^wą , fenylową, fonoksyl^ową, fenylo/ Cj 3/alkilooę, fotyll/Cg_4/alkenklową, yhlorowco/C3_4/akkoksylooą, fonylo/Cj 4/llkoksklloę, ho torocykllic/Ci_4/llk iłową , hβteroaΓklooę, cyJatooę, -NRJR4 , -COgR-COR5,-S/o/ r3 ,,-PC//cr3/2 gdzie R3 i r4 mogą być takie samo lub różno i oznaczają woddr, grupę C. likllową iuo i u fetkiooę, i n Jost równo 0, 1 lub 2, albo R i R razem tworzą pierścień karbacy^iczny lub heterocykliczny, owoetualnle zawierający sprzężony pierścień benzenowy, przy czym pierścień heterocykliczny zawiera 1 lub 2 atomy tlenu lub azotu, każda z wymienionych wyżej grup fenklookyh albo heterockklllowych lub hθtoolrklowych, będących 5- lub 6-czln^υokii pierścieniami, zawierającymi 1, 2 lub 3 atomy tlenu, azotu lub siarki, owθetu8lnie sprzężonymi z piorścienOam lOtzenooym, możo byc owenoalnie podstawiona chlorOwcem, grupą C3 4 aiklOooą, C3_3llkoksylowę, yhiorowyo/Ci_4/elknową , chlorowco/Cj_4/alkoksk4
160 277
Iową, C2_6alkenyl^oksyl^ową, C2_4-alkinyloksylowę, cykloalkokeylową, Ci^alkoksy/C^^ alkoksy/Cj^/alkoksylową, cyjanoalkoksylową, heteroaryloksylowę, fenylową, fenoksylową, nitrową, cyjanową, N-ol<sy. fenylo/C, ./eai.koksylową, -NR3R4, -CO„R3, -CONR3R4,, -CSNR3R4 τ 34 * lub -S/O/ftR , gdzie R , R l n maje wyżej podane znaczenie, a grupy fenylowe są eweetualnie podstawione chlon^wc^B lub grupą cyjanową oraz Jego etereoZkomery.
Związki o wzorze 1 zawierają co najmniej jedno podwójne wiązanie węąiel - azot 1 co najmniej Jedno podwójne wiązanie węgial-węgiel i czasami otrzymuje sią Je w postaci mieszaniny Izomerów geometrycznych. Mieszaniny te można rozdzielać na Indywidualne Izomery. Wynalazek obejmuje Izomery i lch mieszaniny we wszystkich proporcjach.
Izomery wynnkające z niesymeerycznie podstawionego podwójnego wiązenia grupy propeniamwej oraz oksymu określa się zazwyczaj stosowanymi terminami £· 1 Z. Deeinicja ta Jest zgodne z syseemem CahnnIngcld-PΓelkg, opisanym w lieeaaturze /patrz np. 3. March, Advanced Organie 011811^81^, 3-cie wyd., Wlley-lnterscieacβ, etr. 109 i nastąpna/.
Przy podwójnym wiązaniu węągel-węgiel grupy prkpenlankoej zazwyczaj Jeden z izomerów jest bardziej aktywny grzybobójczo nlZ drugi, zazwyczaj bardziej aktw»nym Jest izomer, w którym grupy -ΟΟ,,ΟΗ^ i -OCH3 są po przecn^ewnych stronach wiązenia oitftkowego grup·/ prkpealankweJ /nomer /E/ż Korzystną postacią wynalazku aą izomery /E/. Chlorowiec oznacza fluor, chlor, brom i Jod.
Grupy flkUowe oraz cząści alkUowe grup aikkkeylkwych, ara^Honych 1 a^^ksymogą mieć łańcuch prosty lub rozgałęziony 1 jeśli nie zaznaczono inaczej, dogodnie zawierają 1-6 atomów węgla. Przykładami są grupy metylowβ, etylowa, izopropylowa i tbutylowa. Eιoottualayml podstawnikami mogą być atomy chlorowca, zwłaszcza chlor i fluor, grupy hydroksylowe i C^^alkoksylowa. Przykładami podstawionych grup 1 alkkksylowych są grupy triflkOkemαtylooα i trfflookemelokeylowa.
Grupą cyklkalklkooą Jest dogodnie grupa C3_gCcklooekilowa. np. cyklopropylowa i cyki.kheksylkwa, a grupą cyklk3lklloalkikową Jest dogodnie grupa C3_gCctklkflklo/Cl_4/ aH^owa, np. cyklopmpyloetylowa.
Grupy alkenylowe 1 aH^y^we dogodnie zawierają 2-6 alt omów węgla, zazwyczaj 2-4 atomów węgla, w postaci prostej lub rozgalązionee. Przykładami są grupy tteayiooa. αΙΗ^α i propargilc^wa. Podstawione grupy aikeaylowe i alkinykowt obejmują eoontuufnie podstawione grupy aryloalkenykowe /zwłaszcza ewenhalnie podstawioną grupą feaylketθaylooę/ i aryloalkinylowe.
□ako grupy Bryłowe i cząści arylowt grup aralklkooych, aryloalkenykooych, aryloaiktnykowych, aryloleykooych i eryloleyalklewych wystąpują grupy fenylowa i na^ykows.
Gdy R i R razem tworzą karbkcykliczay luo heterocykliczny układ pierścieniowy, to jest to dogodnie Cg ^alifatyczny, aromatyczny lub mieszany flifatyzao--akmmatyczny układ pierśctenlooy, np. cyklkpentylkoy, cyklohekeylkoy, cykiohekeadienknylowy oraz te grupy podstawione sp^ązonym piersc«nemm benzenowym ι/Hjb podstawnikami takim jak grupa mtylkoa, albo może to być 5-10-czlnnooy heterocykliczny układ pierśclθnkooy np. tetrahydropiranyy.
Określenie grupa hettrkfrykoof obejmuje aromatyczne grupy heterocykliczne. Grupy heteroarykowa i heterkyykllkoot oraz cząści heterkfrylowe i heterocyklllooe innych grup, takie jak grapa nsttrkarylokeyalklloof i heterocykloalkιkoWf są zazwyczaj 5- lub 6- członowym pltrsyltalfm, zawieraj ącymi jeden lub nącej htttroalmmJo O, N luo S i mogą być sp^ązone z jednym lub wiącej laayel aromatyyzayne, htttΓkakOlatyyzayml lub hsterdcykl·icznymi pierścieniami, takimi jak pierścień benzenowy. Przykładami są grupy tleaylkoa, fuzlowa, pirolilowa, trlfzolllooa, tιazkilkoo3, lirydylkoα, pi rymldy.tylkof, p irazynyiowa, lirydazynylko^, tr 1 azyaylooa. craml lny Iowa i yhlakks^llnylooa oraz ich '.-tlent!.
:^azek obejmuje znązlki o wzorze 1 w którym R^ oznacza grupę C__afl^l|kwą, ynlcrooto/Cl_4/flkikooę, Cl_z-filckeylkΌ, chlorowcc/C^_4/ailkkeylkoą, Cj_4filllokfΓbkaylkCj_4flkkleykfrbknylkoę, cyjanową, ienylk/C^_4/alklkową, fenylową, 5- lub 6-yzlonooą aromatyczną grupą haterocyk1lczną zawierającą jeden lub wiącej atomów O, N lub S 1 ewenhalnie sp^ążoną z pierśceeciem benzenowym, przy czym ^^i^i^nnne wyżej cząści aromatyczne lub
160 277 heteroaromatyczne sę ewentualnie podstawione jednym lub więcej atomaM. chlorowca, grupami hydroksylową, C^^elkilowę, chlorowco/C,_4/alkilowę, Cj^alkoksylowę, chlorowco/Cj^/alkoksylowę, Cl_4alkilonabbonyllwę, C^^akkoksykarbonylowę, mtrowę, cyjanowa, fenylowa, fenoksylowę, benzylową lub benzyloksyjw^ r2 oznacza wodiir, chlorlwlec, grupę C^^allkilowę, chlorowco/C^_4/alkllowę, Cj^alkiookarbonylowę, C j^alkoksykarbonylowę, cyjanowa lub fenylowę, albo R1 i R2 razem tworzę O5_10-karblcykliczay układ pierścieniowy.
Wynalazelc pona<jto obejrauje znęzki o wzorze 1 w którym R* oznacza grupę C^^allkilowę, benzylową, Cj_4nlkilokarbonylowę, Cj^alkoksykarbonylowę, cyjanową, fenylowę, tienylowę, triazolioowę, tiazolHowę, pirydylowę, pirymidynylowę, pirazynylowę, pirydazynylowę, tnazynylowę, chlnollnylowę lub chinoksalinylowę, przy czym wymienione części aromatyczne lub heteroaTematyczne sę nwθetualain podstawione Jednym lub więcej atomami chlorowca, grupami Ci_4alkHowę, trfluudOTety^owę, Cj^alkoksylowę, tnff^^K^r^m^^U^l^sylc^wę, mtrowę cyjaaowę, Jnylowę lub benzyloksylowę, r2 oznacza wodór, grupę Cj^alkUwę, Cl_4alkllokβrbonylowę, Cj^alkoksykerbonylowę, cyjanowę lub fenylowę, albo R i R razem tworzę pierścień cyklopantylowy lub cykloheksylowy, ewθntuulnle sprzężony z pierścieneem benzenowym.
W następującej tabeli 1 zestawiono zwięzki o wzorze 1. Grupa 3-metokeypropenianu omeylu ma konfigurację /£/.
Tabela I _ZwiS*ki_o_wzorze 1
| Zwięzek | ' r1 | I | R2 | , Oksym* | 1 | Olefnnowy | * 1 Temmeeatura |
| nr | topnienia | ||||||
| 1 | l_ _ _ _ | J | 1 °C | ||||
| 1 | ; 2-CH3O-C6H4 | 1 1 | H | ‘ 8,50 | 1 f | 7,60 | , olej |
| 2 | ' 3-CH30-C6H4 | 1 | H | ' 8,05 | 1 | 7,60 | ' olej |
| 3 | 1 3-CH3c6H4 | 1 | H | , 8,05 | 1 | 7,59 | 1 olej |
| 4 | ' 4-CH3-C6H4 | 1 1 | H | ' 8,07 | 1 1 | 7,60 | , olej |
| 5 | • 3-Cl-C6H4 | 1 | H | < 8,04 | 1 | 7,59 | ' olej |
| 6 | 3-n02-C6H4 | 1 1 | H | , 8,14 | 1 | 7,61 | 1 olej |
| 7 | i 3-CF3-C6H4 | 1 1 | H | '8.12 | 1 1 | 7,60 | 1 , olej |
| 6 | 1 C6H5 | 1 | H | ' 8,10 | 1 | 7.60 | 1 63-6 |
| 9 | 1 V5 | 1 1 | CH3 | 1 | 1 | 7,59 | 1 dlej |
| 10 | • 3-/0^^/-0^4 | 1 | H | 1 8,06 1 | 1 1 | 7,60 | ' olej |
| 11 | , 3-cyJaao-CgH4 | 1 | H | 1 8,07 | 1 | 7,60 | 1 olej |
| 12 | piryd-2-yl | 1 1 | H | 8,19 | 1 1 | 7,60 | 1 olej |
| 13 | 1 piryd-3-yi | 1 | H | '6.10 | 1 | 7,60 | 1 olej |
| 14 | , piryd-4-yl | H | 1 8,03 | 1 | 7.51 | 1110,5-111,5 | |
| 15 | 1 piryd-2-yl I | O3 | I I | 1 1 | 7,60 | 1 , olej | |
| 16 | 1 piryd-2-yl | 1 | cyjano | 1 | 1 | 7,53 | 1 144-6 |
| 17 | , piryd-2-yl | ,co | 2C2H5 | 1 | 1 | 7,55 | 1 olej |
| 18 | • piryndyn-4-y 1 | 1 | | H | *8,07 I | 1 1 | 7,51 | ' 56-3 t |
| 19 | , tien-2-yl | 1 | CH3 | 1 | f | 7,56 | ' olej |
| 20 | I C02C2H5 | ,C0 | 2C2H5 | 1 1 | 1 ł | 7,56 | tolej |
Stosunek izomerów*
19sl
16:1
160 277
Tabele I /c.d,/
| 1 Związek 1 | Rl ' 1 1 | r2 | Oksym 1 | X 1 | Olef mowy | * l | Temppraturd topnienia °C 1 | Stosunek 1 Izomerów**i t | ||
| nr | 1 1 | |||||||||
| - -i ł | τ - “ | 1 | t | I | ||||||
| 21 | 1 | β ' | β | 1 | 7,58 | olej i | 1 | |||
| 22 | 1 | 1 pirazyn-2-yl , | CH3 | 1 | 7,61 | 1 116-118,5 i | 1 1 | |||
| 23 | 1 1 | 6-CHg-pirydd3-yl 1 | CH3 | 1 f | 7,60 | 67-73 ' | 1 | |||
| 24 | 1 | plryd-2-yl i | C2Hs | 1 | 7,60 | 70-80 , | 1 | |||
| 25 | 1 1 | piryd-3-yl f | CH3 | 1 B | 7,60 | olej * | 24 il ' 1 | |||
| 26 | 1 | | piryoldyn-5-yl ' | H7 | 7,60 | olej · | 1 | ||||
| 27 | 1 | izo-C3H7 i | pirymidyn· | 7,53 | oleJ , | 1 1 | ||||
| | | 5-yl | |||||||||
| 26 | t | 4-cyJenn-plryd-2-yl | Ch3 | 7,61 | 93-99 1 t | 1 | ||||
| 29 | 1 | 6-Br-piryd-2-yl 1 | CH3 | 7,59 | olej i | 1 | ||||
| 30 | 1 | 6pCH3ppiryd-2-yl , | CH3 | 7,58 | dej ‘ | t 1 | ||||
| 31 | 1 ł | 3pCH3ppirazyn-2-yl 1 | CH3 | 7,60 | 106-8 1 | 1 | ||||
| 32 | 1 | 3pC2Hgppirazynp2pyli | CH3 | 7,39 | 74-76,5 , | 1 | ||||
| 33 | 1 | 1 3-0CHH-pllazγy-p2yl) | CH3 | 7,58 | dej J | ł 1 | ||||
| 34 | 1 | 5-C0,,CH,,-pirazyn- ' | 1 | 1 | ||||||
| 2-yl2 3 < | CH3 | 7,60 | olej i | 4:1 , | ||||||
| 3S | 1 2p0CH--pirymtdyn- | CH3 | 115-116 J | 1 | ||||||
| 4-yl J ( | ||||||||||
| 36 | tiazol-2-yl | CH3 | 7,60 | 107-114 1 | 10:1 1 1 | |||||
| 37 | tien-3-yl 1 | CH3 | 7,60 | olej * | 1 | |||||
| 38 | 2^0Ch3p26 h4 . | Ch3 | 7,57 | olej , | ł | |||||
| 39 | 1 | 3p°CH3pC6H4 ; | CH3 | 7,64 | 81-33 * 1 | 1 1 | ||||
| 40 | 1 | 4-och3-c6h4 ' | CH3 | 7,57 | 85-7 » | 1 | ||||
| 41 | 1 | ^3-^4 . | CH3 | 7,58 | dej , | 1 1 | ||||
| 42 | 1 1 | ^chj-c^4 ; | CH3 | 7,58 | olej 1 I | < l | ||||
| 43 | I | 4pCH3pC6H4 · | CK3 | 7,58 | olej i | |||||
| 44 | 1 1 | 2-F-c6H4 : | CH3 | 7,59 | dej J | t 1 | ||||
| 45 | f 1 | 3-f-c6H4 ; | CK3 | 7,60 | olej ' | 1 | ||||
| 46 | 1 | 4-F-C-H. i 0 4 | CH3 | 7,59 | olej , | ł | ||||
| 47 | 1 1 | 2-c1pc6H4 ; | CH3 | 7,58 | olej ΐ | 1 1 | ||||
| 48 | ł | 3«c1-c_hΛ · c 4 , | CH3 | 7,59 | dej ' | 1 | ||||
| 49 | t | 4-ClpC5H4 , | CH3 | 7,55 | dej , | 1 f | ||||
| 50 | f 1 | 3-Br-CcH. 1 O 4 1 | ch3 | 7,55 | dej 1 1 | 1 l | ||||
| 51 | r I | 2-N°2'CóH4 ' | CH3 | 7,59 | 70-72 i | 1 | ||||
| 52 | 1 | 3^ΝΟ2-°6Η4 I | CH3 | 7,66 | olej , | 1 ł | ||||
| 53 | 1 1 | 4-Ν02'06Η4 ' | CH3 | 7,60 | 100-2 1 | 1 | ||||
| 54 | i | 2-CF3>C6H4 1 | CH3 | 7,57 | olej , | 1 | ||||
| 55 | 1 1 1 | 3-CF3’C6H4 i 1 | CH-J | 7,60 | dej J 1 | ł 1 1 |
160 277
| Tabela | I /c.d./ | |||||||||
| - - - - Γ Związek, | r1 | > · r—' ' R2 . | 3kaynx· • | Olekno | 1 | Temneratura | Stosunek _ | |||
| nr | l 1 | | 1 1 | wy ♦ | 1 1 | tlpnienia °C | izomerów** | ||||
| 1 | ||||||||||
| 56 | 1 | 4-cf3-c6h4 | J CH3 ' | 1 | | 7,59 | 1 | 125 | |||
| 57 | 1 1 | 3-cyJeno-C5H4 | * CH3 | i | 7,60 | 1 1 | 75.5-77 | |||
| 58 | 1 | | 4-cyJano-CgH4 | : ch3 ; | 1 | 7,59 | 1 | olej | |||
| 59 | 1 | 6-CH3ypi rydazyη-3-yi | ;cH3 · | 1 1 | 1 | 89-91 | ||||
| 60 | 1 1 | 4-cyjano-chinolln-2-yl CH3 | 1 | 7,63 | 1 1 | 160.5-162 | ||||
| 61 | 1 | chinokaalin-2-yl | ,CH3 ; | I 1 | 7.62 | 1 | 179-181 | |||
| 62 | 1 | 6-CH3-piryraldyn-4-yl | ; -3 : | 1 1 | 7,60 | 1 1 | olej | 4:1 | ||
| 63 | 1 1 | 4-CH3-pirynidynn5-yi | • -h3 ; | • | 7,58 | 1 1 | olej | 6:1 | ||
| 64 | 1 | 4-CH^-pi rynidynn2-yi | : ch3 ' | 1 1 | 7.57 | I | olej | |||
| 65 | 1 | 4,6-d!CH,-pirynidyn- · | 1 | 1 | ||||||
| 1 | 2-yi | •cH3 , | • | 7,56 | 1 | 107 | ||||
| 66 | 1 1 | 2,6- d 10 H3-p 1 r y n i dyn-4-yi | 1 ;cH3 · | 1 1 1 | 7,48 | I | 102 | |||
| 57 | 1 1 | f | 1 ' f , | 1 | 7,58 | 1 | olej | |||
| 68 | 1 | f | : f ' | 1 | 7,58 | 109-110 | ||||
| 69 | 1 | ΝΊlenek-piryd-2-yi | ' CH3 1 | 1 I | 7,52 | olej | ||||
| 70 | 1 1 | CH3CO | -a ; | • | 7,59 | 78 | ||||
| 71 | 1 | C5H5CO | -3 · | 1 | 7.56 | e Ξ, | ||||
| 72 | 1 | N-CH3-pirol--2ii | ; -3 : | 1 | 7,57 | olej | ||||
| 1 ι | 73 | 1 | | 4-Cl-chinolm-2-ii | : -3 ; | • | 7,62 | | | 114-116 | ||
| 74 | 1 | 2,4-diCl-C,-H- | 1 1.2,4- 1 | 1 | 7,61 | I | oiej | |||
| | | ’ triazoi-1- | 1 | | | |||||||
| 1 | ' x1-Ch2 . | 1 | 1 | |||||||
| 75 | 1 | 2,4-di-CH_-t nzol5-ii 3 | 1CH- · | 1 1 | 7,58 | ł | olej | |||
| 76 | 1 | furan-2-yl | •-K3 1 | 1 | 7,58 | 1 | olej | |||
| 77 | piryd^-yl | piryd-2-yi | 1 1 | 7,56 | 1 | olej | ||||
| 78 | 6--,^^1 rynnyn-4-?l“ | 1 HH3 1 | 1 1 | 7,51 | 1 1 | 102 | ||||
| 75 | 3-SCH_-l ,2,4t r-iaz^^-yi | 1 1 CK, 1 1 J | 1 1 1 | 7,52 | 1 1 | 122-123 | ||||
| 80 | 3-CCH3-I,2,4tnazyn-e-yi | 1 1 ch3 ; | 1 f | 7,61 | 1 1 1 | olej | ||||
| 81 | 1 Cg · | 1 1 | 7,60 | 1 | 146-16 | 3:1 | ||||
| 62 | 1 | 5-cyjano-pirozym-i-yi | ' HH2 1 | 1 | 7,62 | 1 1 | 85-52 | |||
| 83 | I | 3·.-.-/-,-2-yi CH, ' | ł | 7,53 | 1 | 114-6 | ||||
| 64 | 1 1 | 3 ,£-di-CH.-pirazyn2-yi 3 | 1 Ch3 1 | 1 1 | 7.89 | 1 1 | 55-6- | 7 :3 | ||
| 65 | 1 1 | 3.6-di-CK--p i razyr.2-yi 3 | 1 1 ' CH3 i | 1 1 | 7.59 | 1 1 | olej | |||
| 86 | ł | 4-S°2CH3--gH4 | • -H 1 1 3 1 | ł 1 | 7,59 | 1 | olej | |||
| 87 | 1 | 4-NH2-C6H4 | , -H3 1 | 1 | 7,58 | 1 | olej | |||
| 1 | 1 · | * |
δ
160 277
Tabela I /c.d./
| Zwięz nr | ek 1 1 • 1. | Stosunek i Izomerów*^ | |||||
| r1 | RZ ' Oksy 1 1 | yx( Olefinowy·* l 1 | Temppeaturai topnienia l °C · | ||||
| 68 | 1 | | 2,4<^did3^-Cgł^5 | CH3 ; | * 7,60 J | 79-82 , | ||
| 89 | 1 | 2.4-di-CH3-C6H3 | ch3 ; | 1 7,57 ' | 66-6Θ.5 1 I | ||
| 90 | 1 | C H 6 5 | cykropropyl | ' 7,57 1 | olej · | 8sl · | |
| 91 | C6H5 | Cl 1 t | • 7,61 J | oleJ , | |||
| 92 | 4^3^4 | 1 1 7.55 , | t olej , | ||||
| 93 | C6H5 | sch3 · | i 7.57 ’ 1 | olej ' 1 | |||
| 94 | C/CH3/3 | CH3 ' | ‘ 7.57 i | olej l | |||
| 95 | C6H5-CH2 | CH3 · | 1 7.57 J | olej J | |||
| 96 | 1 | /E/-CgHc- CH«0H | CH3 , | , 7,58 ' I | olej ' | ||
| 97 | 6-0CH3~pirazyn-2-yl | CH3 : | 1 7,60 , 1 | 111 i | |||
| 98 | 1 | 3-8r-i.zok8aaol-55 3Ll | CH3 · | • 7,60 J | dej ' | ||
| 99 | 1 1 | C6H5 | 0CH3 \ | J 7,53 ' | żywica 1 | ||
| 100 | 1 1 | 0CH3 | c6hs ; | ' 7,58 , | | żywica , | ||
| 101 | 1 | C6ri5 | CH3S/0/ 1 | i 7,60 1 1 | żywice * 1 | ||
| 102 | 1 1 | C6h5 | CH3s/o/2 ; | J 7.60 i | żywica i | ||
| 103 | 1 | C6H5° | CH3 ; | ' 7,57 ' | dej ' | ||
| 104 | 1 | 3-0C2H5-P1raoyn-2-yl | CH , | , 7,50 ' | 01-82 1 | ||
| 105 | 1 1 | Piryd-2-yl | soh3 ; | * 7,59 i 1 | olej l | ||
| 106 | 1 | Pirydd2-yl | SO2CH3 1 | i 7,60 | 150-154 ’ 1 | ||
| 107 | 1 | Plryd-2-yl | SOCH3 , | 1 7.60 · | 124-127 1 | ||
| 108 | 1 l | 3,5-di-CH3-oksazol-4-il | cH3 ; | ' 7.58 , | dej , | ||
| 109 | 1 | Piryd-2-yl | 0CH3 I | f 7.59 * 1 | olej 1 1 | ||
| 110 | 1 1 | Piryd-2-yl | SC2H5 | J 7,57 i | 102-106 i | ||
| 111 | 1 1 | Piryd-2-yl | <^5 ; | ' 7,54 , | olej ' | ||
| 112 | 1 | Piryd-2-yl | 0CH2C6Hó | I 7,57 1 1 | olej 1 1 | ||
| 113 | 1 1 | 6-0C2H5-pLrymidyn-4-yl | ch3 1 | 1 7,50 i 1 | 87-88 l | ||
| 114 | 1 | Piryd-2-yl | NH'2 j | 1 7,59 J | dej J | ||
| 115 | 1 | SCH3 | Piryd-2-yl | , 7,56 ' | olej 1 | ||
| 116 | 1 1 | 2,4-dl-F-C6H3 | CH3 ί | * 7,56 l 1 | dej l | ||
| 117 | 1 | 2,4-dlOCH3^ę„H„ | CH„ » o | ' 7,56 ' | 96 1 1 | ||
| 118 | 1 | 5-In,-pirymidyn-2-yl | Ch3 , | , 7.57 ' | 122-123 ' | ||
| 119 | 1 1 | SC2CH3 | Piryd-2-yl | * 7,56 , 1 | 122-127 , | ||
| 120 | 1 | Piryd-3-yl | sch3 ; | 1 7,60 1 t | olej 1 | ||
| 121 | 1 1 | Piryd-3-yl | 0CH3 I | J 7.61 · | dej l | ||
| 122 | I | 6-CF3-piryd-2-yl | CH3 | ' 7.60 | dej ' | ||
| 123 | 1 1 1 | 3-CF3,4-F-C6H3 | ck3 ; 1 | i 7,60 ' 1 1 1 1 | olej 1 1 1 |
160 277
Tabela I /c.d./
| Zniąze | r1 | R2 J £ | )keymx Olafi- | Tempeertura | Stosunek |
| nr | nowy* | topnienia | izomerów | ||
| 1 | 1 1 | °c | |||
| 124 | 6-CF3-pirymidyn-4-yl | CH . | l 7,62 l | 87,2-88,4 | |
| 125 | 3,5-^dl-F^BH3 | CH3 ' | ; 7,60 | olej | |
| 126 | 2^CH3S-pii'^aldyr^-^‘^-yl | C*3 · | 1 7,60 ' | 1 | 102,2-104 | .4 |
| 127 | 2-CF3-pirymidyn-4-yl | CH3 I | 1 7,61 1 | 105-106 | |
| 128 | 4-CF3-piryd-2-yl | C*3 ', | 7.^1 J | olej | |
| 129 | 2-f enylo t iazol-4-il | C*3 ' | • 7,59 · | olej | |
| 130 | 3-NH2C/O/-C3H4 | Ch3 i | l 7·59 l | olej | |
| 131 | 4-CF3-pirymidyn-2-yl | C*3 ; | 1 7,58 1 I I | olej | |
| 132 | 3,5-d^CF3^C3H3 | C*3 · | • 7,60 i | 108-110 | |
| 133 | 2-/2CCNC3H4-0-/ | 1 | 1 1 | ||
| plrymidyn-4-y1 | C*3 ' | 1 7,60 1 I i | 108-110 | ||
| 134 | 3-η-%Η70-%Η4 | C*3 ' | • 7.59 i | olej | |
| 135 | 2-CH/CH3/2-O- | 1 | 1 1 | ||
| pirynidyη-4-yl | CH , | l 7,60 , | 88-90 | ||
| 136 | 6-CF3-pirazyn-2-yl | C*3 ' | ‘ 7,61 ' | 72-74 | |
| 137 | 4-C2H5O-pirymidynn2-yl | CH3 ' | 1 7,58 · | 87-89 | |
| 138 | 6-C2F3-pi^r^^nJ^dy^^4“yl | ch ; | » 7,61 , | olej | |
| 139 | ^C^0--^4 | C*3 ' | 1 7,60 1 1 1 | olej | |
| 140 | 4-CH30-piryd-2-yl | CH · | i 7,60 1 | 60-62 | |
| 141 | 2-Propargilokeypiryoidyn | ||||
| -4-yl | % : | 1 7,60 ( | 121-122,4 | ||
| 142 | 2-^2^0--11^1^1^4.^1 | CH . | ' 7,60 » | 94 - 96 | |
| 143 | 2-AllllokrypplΓy«lldrn- | ||||
| -4-yl | C*3 ' | • 7,60 1 | 74 - 76 | ||
| 144 | 3-CH3O-plrrdazyn-6-rl | C*3 . | ' 7,60 ' | 124-126 | |
| 145 | 3-C2 HgO--i. ry da zy n-£6· y 1 | C*3 ; | , 7,59 , | 90 - 91 | |
| 146 | 3-Alll 10^--0^4 | C*3 ' | 1 7,59 1 1 1 | olej | |
| 147 | 4-CH3S-pirymldyn-2-rl | C*3 ' | I 7,57 i | 7S - 81 | |
| 148 | 4-^30^ l^mió^-i-yl | Ch'3 | ' 7,58 i | olej | |
| 149 | 3-CF3C6H4 | SC*3 ; | ’ 7,59 ' | olej | |
| 150 | 3-CF -CrH 3 6 4 | CF3 ; | ' 7,56 ' | olej | |
| 151 | 3-CF3-C6H4 | C2H5 ' | i 7,60 · | olej | |
| 152 | 3-CF3-c6H4 | N*2 . | . 7,51 , | 98 - 8 | |
| 153 | ^3-^4 | Imidaaz1il1 1 | 1 7,58 1 1 I | olej | |
| 154 | 3-CF3-C6H4 | n/ch3/2 i | 1 7,52 1 | olej | |
| 155 | 3-CF3-C6 H4 | NHC*3 I | 1 7,58 1 | olej | |
| 156 | -0/002*5/2 | CH ' | ' 7,56 1 1 a | olej | |
| 157 | PO/OC2Hh32 | C6H5 1 | 1 7,53 l | olej |
160 277
| T a b | ale 1 | /e.d./ | |||||
| Zwięze^ | łt* | 1 r2 | , Oksym'* | ,0lefi- ' | Temppratury | 1 | |
| nr | 1 | 1 | 1 1 | nowy* 1 • 1 | topnienia °C . | 1 t | |
| 158 | t | 4-0^0-6-/COgCt^/pirymidyn-2-yl | 1 ; cH3 | 1 1 | 1 , 7,59 1 1 | olej | 1 1 1 |
| 159 | 1 1 | Pirol-2-il | • CH3 | 1 1 | 7.58 t | olej | 1 |
| 160 | CH3 | ' Pirol- | 2-yl | ' 7,56 ; | olej | 1 1 | |
| 161 | 1 | 5-CF3-p1ryd-3-yl | ; ch3 | 1 1 | ί 7,61 ' | 96,4-97,6 | 1 |
| 162 | 3-/pryy»idnyylokyy7cC u ' ‘ ‘ n t> « | * CH3 | 1 1 | 1 7,59 , 1 | olej | ||
| 163 | 3-PropyrgllkksycC H O 4 | : CH3 | 1 | • 7,60 | olej | 1 1 | |
| 164 | CH3 | ♦ H | 1 1 | I 7.56 · | olej | 1 | |
| 165 | 5-/2,4-d1fluorofenylo/furyn-2-yl | 1 ch3 | 1 1 | 1 1 7,60 ( | 104-105 | 1 t | |
| 166 | CH_ | ‘ 5-/2, | 1 4-dlfluoro | - 7,58 ' | 136-139 | 1 | |
| 167 | 3 C2H5° | • fanyloZ-furyn-Z-yl * • CH3 ' ' 7,56 ' | 1 c1yło styłe 1 I | ||||
| 168 | 4—tertouutyloCCgH4 | • CH3 | 1 | . 7,59 i | 10,2-101, | 6. | |
| 169 | 4-propergiloksy-plrym1- | • CH3 | 1 | ' 7,58 ' | dęło styłe | ||
| 170 | dyn-2-yl 2-C2H50-CóH4 | I CH3 | 1 1 | 1 1 1 7·58 , | 107,6-109, | 8 ’ 1 | |
| 171 | 1 | 4-C2H5- C6H4 | • CH | I | ' 7,59 ' | olej | 1 |
| 172 | 3-C2H50-C6H4 | ί ch3 | 1 | , 7,59 , | 83-84,2 | 1 | |
| 173 | CH3S | ; cH3 | 1 1 | 1 7,57 1 I 1 | olej | i 1 | |
| 174 | 1 | CH3S02 | • CH3 | 1 7,60 1 | olej | » | |
| 175 | P | . P | 1 1 | 1 7,60 , | olej | 1 | |
| 176 | 1 | 4-n-C3H70-pirymidyn-2-yl | • cH3 | 1 1 | * 7,58 ' i 1 | olej | 1 |
| 177 | 1 | 3- n-Hyksylokay-Cg^ | • CH3 | r | 1 7,59 1 | olej | 1 |
| 178 | 1 | 4- n-Bu ty loksy-pi rymidyn-2-yl | • cH3 | 1 1 1 | , 7,50 1 | olej | 1 , |
| 179 | 1 i | Benzotiofen-3-yl | • CH3 | 1 | • 7,58 1 | 125-126 | 1 |
| 180 | 1 • 1 | 3-/ /CH3/2-C«CHCH20 /C6H4 | 1 • C«3 | 1 1 | 1 ł 1 7,50 1 | olej | 1 1 |
| 181 | 1 1 1 | 2 J-diCHO-pirymidyn6-yl | ; ch3 | 1 1 1 | * 7,60 ' i 1 | 93-94 | 1 I |
| 162 | 1 1 | 3-CF--C-H. J Ξ 4 | 1 1,23 1 zol-1 | -tfia- -il | t 1 . 7,58 , | 54 | 1 I |
| 183 | 1 1 | 3-CH3S-Piryzyn-2-yl, | : ch3 | 1 1 | ' 1 l 1 | 82-83 | 1 1 |
| 184 | l | 3-n^CH3/2-C5H4 | 1 Ch3 | 1 | 1 7,58 1 | olej | 1 |
| 165 | i | 3-CF3-C5% | Cl | 1 | 1 7,61 , | olej | , |
| 186 | 1 | P | ' P | 1 1 | ' 7,57 ' 1 1 | olej | 1 1 |
| 167 | Benzofuran-2-yl | • CH3 | 1 | 1 7,5e 1 | olej | 1 | |
| 188 | 1 | 2-CH_S/0/-pi rymi^^nn^^yl | ' CH3 | 1 | 1 7·53 : | cloło styłe | |
| 1 I 1 | I 1 1 | 1 1 1 | 1 t 1 1 1 1 | /rozkład przy ogrzewaniu// 1 I |
Stosunek izomerów
150 277
Tabela I /c.d./
| _ --- | |||
| Zwięzek nr | . r1 | 1 r2 | |
| L | i - -___...--- | I | |
| 189 | • 3-nh2c/s/-c6h4 | • CH3 | |
| 190 | , 4-NH2C/S/-piryd-2-yl | 1 CH3 | |
| 191 | ' ^^//CH^OCHgCH^OCH^O/- | 1 | |
| ^6H4 | ; ch3 | ||
| 192 | ' 3-CCNCH20/-CgH4 | 1 cH3 | |
| 193 | 9 | 1 9 | |
| 194 | ' 3-F2HCcO-/-C6H4 | 1 cH3 | |
| 195 | • 6-C2H560-irazyn-2-yl | 1 cH3 | |
| 1 Temnptatura topnienia L . 2C___ • 158-151 , 162-163 | 1 , Stosunek izomerów** 1. . . . « 1 t 1 | Ί J | ||||
| Oksym 1 1 1 1 1 1 1 | Olafinowy* 7,59 7,59 | |||||
| i 1 | 7,60 | o^j | 1 1 | |||
| 1 1 | 7.59 | • olej | 1 | |||
| 1 | 7,63 | , 139-140 | 1 | |||
| 1 | 7,60 | 1 olej I | 1 1 | |||
| 1 | 7,51 | 1 71-73 | 1 | |||
| L - - - --- | u |
Ob jaśnienia do tabeli · « Chemiczne przesunięcie singletu z olefnoowego protonu grupy β -metoksypropenianowej głównego izomeru eteru oksymu /ppm wobec tetranatylosllanu/, x Chemiczne przesunięcie singletu z protonu aldoksymu ++ Izomerów wynnkajęcycn z niesymetrycznie podstawionego podwOjnego więżenia oksymu
| Grupy R | 1 1 | R3 2 | razem tworzą następujące pierścienie: |
| związek | nr | 21 | wzór 2 |
| związek | nr | 67 | wzór 3 |
| związek | nr | 68 | wzó r 4 |
| związek | nr | 175 | wzór 5 |
| związek | nr | 186 | wzór 6 |
| związek | nr | 193 | wzór 7 |
Tabela I!
Wybrane dane protonowe NMR
Tabela II ukazuje wybrane dane protonowe NMR dla pewnych związków wymienionych w tablicy
I. Chemiczne przesunięcia marzono w ppm z tetrametylosilanu a jako rozpuszczalnik stost^wano deuterochloroform. Kolumna “częstotliwość dotyczy częstotliwości działania spektrometru NMR.
Stosuje się następujące skróty:
br = szeroki s = single:
d a duolet t a triplet q a kwartet m a multiplet
Związek nr
Czę ltOtliWClC
MHz
270
3,69 /3H, s/, 3,82 /3H, s/, 3,83 /3H, s/, 5,12 /2H, s/, 6,84-6,25 /2H, m/, 7,11-7,2 /IH, m/, 7,25-7,4 /3H, m/, 7,5 - 7,62 /1H, m/, 7,60 /IH, s/, 7,74 - 7,8 /IH, m/, 6,50 /IH, s/ ppm.
400
3,70 /3H, s/, 3,80 /3H, V, 3,81 /3H, s/, 5,13 /2H, e/, 6,9-7,54 /8η, m/, 7,60 /IH, s/ ppm.
160 277
Tabele II /c.d./ r·
- - - - r
Związek , nr
Cząstotlww,ość
MHz . _ _ _ -__J
270 1
270
270
270
270
270
270
270
270
270
270
270
270 /główny izoaee/ 2,36 /3H, s/, 3,68 /3H, a/, 3,80
| /3H, | ej, 5,10 /2H, | s · | 7,1- | 7,5 /8H. a | /, 7,60 /1H, s/ | |
| 8,07 | /1H, s/ ppm. | |||||
| 3,70 | /3H, e/, 3.81 | /3H. | e/. | 5,14 /2H, | 8/, 7,15-7,20 | |
| /1H, | m/, 7,24-7,43 | /5H. | /. | 7,48-7,54 | /1H, m/, | |
| 7,58-7.62 /1H. m/. | 7,59 | / 1H | « 8/, 8,04 | /1H, 8/, ppm. | ||
| 3,70 | /3H, 8/, 3,84 | /3H, | e/. | 5,17 /2H, | 8/, 7,16-7.22 | |
| /1H, | a/, 7,32-7,39 | /2H. | «/. | 7,49-7,58 | /2H, m/, | |
| 7,60 | /1H, 8/, 7.88 | d/. | 8,14 /1H, | 8/. 8,17-8,23 | ||
| /1H, | «/, 8,42 /1H, | »/ p | pm. | |||
| 3,70 | /3H, 8/, 3.83 | /3H, | 9/. | 5,16 /2H, | s/, 7,14-7,20 | |
| /1H , | a/, 7,31-7,38 | /2H, | »/. | 7,46-7,55 | /2H, a/, 7,55 | - |
| 7,64 | /1H. m/, 7,60 | /1H. | 8/, | 7,7-7,77 /1H, d/. | ||
| 7,83 | /1H, 8/, 8,12 | /1H, | 8/ | ppm. | ||
| 2,25 | /3H, 8/, 3,69 | /3H, | 9/. | 3,81 /3H, | 8/, 5,16 /2H, | 8/. |
| 7,13- | -7,20 /1H, m/, | 7,3 | - 7, | 4 /5H, /. | 7,5-7,55 /1H, | «/. |
| 7,59 | /1H, 8/, 7,6 - 7,6 | 6 /2 | H, m/, ppm | , | ||
| 3,68 | /3H, 8/, 3,80 | /3H, | 8/, | 5,08 /2H, | 8/, 5,13 /2H, | s/, |
| 6,94-7,07 /1H, m/, | 7,07 | -7,5 | 6 /12H, a/ | 7,60 /1H, s/, | ||
| 8,06 | /1H, s/ ppm. | |||||
| 3,70 | /3H, a/, 3,83 | /3H, | 8/. | 5,14 /2H, | 8/. 7,1-7,9 |
| /8H, | m/> | 7,60 /1H, s/ | , 8,07 /1H, s/ | ppm | |
| 3,69 | /3H, | 6/ 3,81 /3H, | 6/. 5,18 /2H, | 6/, | 7,16-7,82 |
| /7H, | a/. | 7,60 /1H, 8/, | 8,1S /1H, 8/, | 8,6 | /IM, a/ ppm. |
| 3,69 | /3H, | s/ 3,82 /3H, | 3/, 5,14 /2H, | 8/. | 7,14-7,53 |
| /5H, | m/. | 7,60 /1H, a/. | 7,90-7,96 /1H, | . »/, | , 8,10/1^ s/ |
8,55-8,62 /1H, a/, 8,72 /1H, m/ ppm.
2,34 /3H, 8/, 3,69 /3H, s/, 3,81 /3H, s/, 5,19 /2H, s/ , 7,1-7,7 /6H, m/, 7,60 /1H, s/, 7,89 /1H, d/, 8,59 /1H, d/, ppm.
| 1,32-1,40 /3H, t/, 3,63 /3H, s/, 3,77 /3H, s/, 4,33- | ||||||
| 4,44 /2K, 7,42 /4H, 7,66-7,71 | 9/, m/, /1H | 5,25 /2H, s/. 7,56 /1H, s/, , m/ ppm, | 7,13-7,20 /1H, m/, 7,7-7.77 /2H, n/, | 7,26- | ||
| 2,24 /3H, | s/« | 3,69 | /3H, s/. | 3,82 /3H, | s/. 5,11 | /2«, s/, |
| 6,9-7,55 | /7H, | m/, | 7,58 /3H, | s/ ppm. |
1,3 /6H, Q, 3,70 /3H, s/, 3,63 /3H, s/, 4,36 /4H, q, 5.28 /2H, s/, 7,1-7,5 /4H, m/, 7,58 /1H, e/ ppm.
160 277
Tabele II /c.d./
| Zwięzek nr 21 | 1 Częstotliwość | 1 1 1 f 1 | 2,85-3,12 /4H, ·/, 3,69 /3H, e/, 3.62 /3H, 9/. ' 5,14 /2^ e/, 7,1-7,7 /8h, m. 7,56 /1H, 8/ ppm. f | ||
| 1 1 1 1 | MHZ 270 | ||||
| 25 | 1 1 1 1 | | 270 | 1 1 • 1 | | /główny Izomer/ 2,24 /3H, s/, 3,68 /3H, 9/, 3,81 ( /3H, 9/, 5,16 /2H, 8/, 7,1-7,5 /5H, a/, 7,60 /1H, 8/, , 7,9 /1H, m/, 8,57 /1H, m/, 8,83 /1H, m/, ppm. i | |
| 26 | 1 1 1 1 | 270 | 1 1 1 | 1,22 /6H, d/, 3,57 /1H, m/, 3,69 /3H, 8/, 3,82 /3H, 8/,i 5,13 /2H, e/, 7,1-7,5 /4H, r/, 7,60 /1H, 8/, 8,81 /2H, 8/, 9,13 /1H, 8/ ppm. 1 | |
| 27 | 1 1 1 1 | 270 | 1,14 /6H, d/, 2,83 /1H, r/, 3,66 /3H, 8/, 3,78 /3H,e/, ' 5,00 /2^ 8/. 7,1-7,4 /4^ m^ 7,53 /1^ 8/, 8,66 ' /2H, 8/, 9,17 /1H, 8/ ppm. 1 | ||
| 33 | 1 1 1 1 | 270 | 2,26 /3H, 8/, 3,68 /3H, s/, 3,80 /3H, 8/, 4,00 /3H, V,' 5,21 /3H, 8/, 7,1-7,6 /4H, //, 7,58 /1H, s/. 8,08 1 /1H, d/, 8,16 /1H, d/ ppm. ( | ||
| 34 | 1 1 1 | 270 | 1 1 1 1 1 1 1 | /główny lzomr^ 2,30 /3H, s/, 3,69 /3H, 9/, 3,83 /3H, 1 8/, 4,03 /3H, 8/, 5,24 /2H, 9/, 7,1-7,55 /4H, m/, ' 7,60 /1H, s/, 9,20 /1H, a/, 9,23 /1K, m/, /uboczny ( izomer/ 2,30 /3H, 9/, 3,64 /3H, s/, 3,80 /3H, 9/, 1 4,03 /3H, 9/, 5,12 /2H, e/, 7,1-7,55 /4H, r/, 7,57 1 /1H, 8/, 9,32 /1H, m/, 9,37 /1H, m/ ppm. | |
| 37 | 270 | 1 1 1 | 2,22 /3H, 8/, 3,68 /3H, s/, 3,83 /3H, e/, 5,12 /2H, s/,1 7,15-7,55 /7^ «/, 7,60 /1H, 8/ ppm. ' | ||
| 36 | 1 t | 270 | 1 1 1 | 2,20 /3H, 9/, 3,67 /3H, 8/, 3,80 /3^ 8/, 3,83 /3^ 6/ 5,14 /2H, 8/, 6,87-7,60 /6ri, //, 7,57 /1H, 6/ ppm. , | |
| 41 | 1 1 1 1 1 | 270 | 1 1 1 1 1 | 2,20 /3H, 8/. 2,30 /3H, 8/. 3,68 /3H, 8/, 3,80 /3H, s/,( 5,13 /2H, s/, 7,15-7,4 /7h, m/, 7,54 /1H, /, 7,58 1 /1H, 9/ ppm. | |
| 42 | 1 1 1 | 270 | 1 1 1 | 2,23 /3H, 9/. 2,37 /3H, s/, 3,68 /3H, s/, 3,81 /3H, s// 5,16 /2H. s/, 7,1-7,55 /δH. m/, 7,58 /1^ s/ ppm. | |
| 43 | 1 1 1 | 270 | 1 1 1 | 2,22 /3^ s/, 2,35 /3H. s/, 3,68 /3H, s/, 3,81 /3H, s/^ 5,13 /3n, s/, 7,1-7,5 /8H, m/, 7,58 /1H, s/ ppm. , | |
| 44 | 1 1 1 1 | 2 70 | 1 1 1 | 2,26 /3H, s/, 3.65 /3H, s/, 3,81 /3H, 9/. 5,16 /2H, s/,, 7,0-7,55 /8h, m, 7,59 /lh, s/ ppm. 1 | |
| 45 | 1 1 1 | 270 | 1 1 1 | 2,02 /3H, s/, 3,68 /3H, s/, 3,62 /3H, s/, 5,15 /2r(, s/,< 7,0-7,55 /8H, m, 7,60 /1H, 9/ ppn. | |
| 45 | 1 1 1 1 1 1 | 270 | 1 I 1 1 1 ł | 2,22 /3H, s/, 9,6e /3H, 6/, 3,82 /3H, s/, 5,13 /2H, s// ó,9S-7,65 /6h, m/, 7,59 /1H, s/ ppm. |
160 277
Tabele II /c.d./
Zwięzek nr
Γ “ ~---, .Częstotliwość
MHZ
L______
270
270 ' 270 i
i · 270
270
270
270
270
270
270
270
270
270
2.21 /3H. s/, 3,69 /3H, e/. 3,81 /3H, s/, 5,16 /2H, s/, 7,14-7,66 /8H, //, 7,59 /IH, s/ ppr.
2.21 /3H, s/. 3,69 /3H, s/, 3,82 /3H, s/, 5,16 /2H, 3/. 7,1-7,55 /7H, m/, 7,59 /IH, s/, 7,81 /1H, m/ ppo.
2,26 /3H, s/, 3,69 /33, s/, 3,83 /3H, s/ 5,18 /2H, 9/, 7.15-7,92 /88. m/, 7,60 /1H, 9/ ppm.
2.22 /3H, s/, 3,68 /33, s/, 3,82 /3H, 9/. 5,18 /2H, 6/, 7,1-7,8 /8H, τι/, 7,59 /IH, s/ ppm.
/główny izomer/ 2,28 /3H, s/, 2,53 /3H, s/, 3,69 /3H, 6/, 3,83 /3H, 9/, 5,22 /2H, 9/, 7,1-7,5 /4H, //,
7.60 /IH, s/, 7,72 /IH, s/, 9,06 /IH, 9/ ppm. /uboczny izomee/ 2,27 /3H, s/, 2,48 /3H, 9/, 3,69 /3H, 9/, 3,83 /3H, s/, 5,21 /2H. 9/. 7,1-7,5 /4H, //,
7.61 /1H, 9/, 7,77 /IH, 9/, 9,10 /IH, s/ ppm.
/główny izomer/ 2,22 /3H, 9/, 2,50 /3H, 9/, 3,67
| /3H. | 3/. 3.81 | /3H, | s/, 5,14 | /2H, | s/, 7,1-7,5 /4H, m/ | t » |
| 7,58 | /1H. s/. | 6,53 | /1H, 5/. | 9,02 | /IH, s/, ppm. | |
| /uboczny izom | ar/ 2 | ,17 /3H, | 6/. 2 | ,40 /3H, 9/, 3,65 | ||
| /3H, | 9/. 3.77 | /3H, | s/, 5,00 | /2H, | 9/, 7,1-7,5 /4H, m/ | » | |
| 7,52 | /IH, 6/. | 8,37 | /1H, 9/, | 9,05 | /iH, 9/ ppm. | |
| 2,39 | /3H, s/. | 2,57 | /3H, 9/, | 3,66 | /3H, s/, 3,81 /3H, | s/t |
| 5,33 | /2H. s/. | 7.11 | /1H, d/, | 7,1- | 7,55 /4H, m/, 7,57 | |
| /1H, | 9/. 8,64 | /1H. | d/ ppm. |
2,92 /2H. :/ 3,68 /3H, 9/, 3,82 /3H, 9/, 4,18 /2H, t/, 5,14 /2H, s/, 6,8-7,0 /2H, m/, 7,1-7,5 /5H, m/,
7,58 /IH, s/, 7,87 /1H, m/ ppm.
2,22 /3H. s/, 3,61 /3H, 9/, 3,75 /3H, 9/, 5,08 /2H, s/ 7,0-7,5 /7H, //, 7,52 /IH, s/, 8,12 /iH, m/ ppm.
| 2,08 | /3H, s/, 3,67 /6H, 6/, | 3,80 /3H, | 9/. | 5,06 /2H, 3/ |
| 6,08 | /IH, n/, 6,36 /1H, m/, | 6,06 /IH, | //, | 7,1-7,5 |
| /4H, | //, 7,57 /IH. s/ ppm. | |||
| 3,69 | /3H, 3/, 3,82 /3H, 9/, | 5,19 /2H, | s/, | 5,42 /2H, s/ |
| 7,1- | 7,5 /7*. //, 7,61 /IH, | 9,. 7,77 /lh, | 3/, 6,05 |
| /1H, | s/ ppm. | ||||
| 2,21 | /3H, 9/, | 2,46 | /3n, s/ | 2,62 /3H, 5/, | 3,63 /3H, s/, |
| 3,82 | /3H, 9/, | 5,10 | /2h, s/, | 7,1 - 7.5 /4H | . //, 7,56 |
| /IH, | 9/ PP·7· | ||||
| 2,16 | /3H, s/, | 3,6e | /3H, 9/, | 3,81 /3H, 9/. | 5,17 /2H, 3/ |
| 6,42 | /1H, //, | 6,61 | /IH. //, | 7,1-7,55 /6H, | // 7,58 |
| /1H, | s/ ppi·, |
160 277 15
Tabela II /c.d.
• i . ·
Ziięzek , Częstotliwość , nr MHz
270
270
270
270
3,63 /3H, a/, 3,76 /3H, a/. 5,22 /2H, a/, 7,1-7,8 /10H, /, 7,56 /IH, a/, 8,55 /IH, d/, 8,70 /IH, d/ ppm.
2,29 /3H, a/, 2,51 /3H, a/, 2,5j /3H, a/. 3,68 /3H, a/, 3,81 /3K, a/, 5,15 /2H, a/, 7,1-7,5 /4H, ra/, 7,59 /IH, a/, 8,24 /IH, a/ ppm.
2,24 /3H, a/, 3,03 /3H, a/, 3,68 /3H, a/, 3,82 /3H, a/, 5,20 /2K, a/, 7,1-7,5 /4H, m/, 7,59 /IH, a/ . 7,8 - 8,0 /4H, m/ ppm.
2,18 /3H, a/, 3,67 /3H, a/, 3,78 /3H, a/, 3,80 /2H, br.a/ 5,11 /2H, a/, 6,59 /2H. d/, 7,1-7,55 /6H, m/, 7,58 /1H, a ppm.
270 /główny izomer/ 0,65 /2H, m/, 0,90 /2H, m/, 2,32 /IH, /, 3,67 /3H, a/, 3,80 /3H, a/, 5,13 /2H, a/, 7,1-7.6 /9h, m/ 7,57 /IH, a/ ppm.
/uboczny izomer/ 0,65 /2H. m/, 2,32 /IH, m/, 3,63 /3H, a/ 3,76 /3H, a/, 4,97 /2H, a/, 7,1-7,6 /9h, m/, 7,77 /IH, a/ ppm.
270
1,41 /3H, t/, 5,18 /2H, a/,
3,64 /3H, a/, 3,76 /3H, a/, 4,05 /2H, q, 6,8-7,55 /8H, ·/, 7,55 /IH, a/ ppm.
| 93 | 270 | 1 2.04 /3H, 8/. 3,66 /3H, a/, 3,78 /3H, a/, 5,19 /2H, a/, 1 7,1-7,4 /8H, a/, 7,5-7,6 /IH, ·/, 7,57 /IH, a/ ppm· | |
| 94 | 270 | 1 1 1 | 1,10 /9H, a/, 1,81 /3H, s/, 3,68 /3H, a/, 3,81 /3H, a/, 4,99 /2H, a/, 7,1-7,5 /4H, m/, 7,57 /IH, 8/ ppm. |
| 95 | 270 | 1 1 1 1 | 1,76 /3H, a/, 3,46 /2H, a/. 3,67 /3H, a/, 3,80 /3H, a/, 5,06 /2H, a/, 7,1-7,5 /9H, m/, 7,57 /IH, a/ ppm. |
| 96 | 270 | 1 1 1 | 2,10 /3H, a/, 3,69 /3H, a/, 3,82 /3H, a/, 5,11 /2H, a/, 6,85 /2H, a/, 7,1-7,5 /9H, /, 7,58 /IH, a/ ppm. |
| 99 | 270 | 1 1 1 | 3,50 /3H, a/, 3,70 /3h, a/, 3,78 /3H, a/, 4,94 /2H, a/, 7,1-7,5 /7h, ·/, 7,53 /IH, a/, 7,77-7,81 /2H, m/ ppm. |
| 100 | 2 70 | 1 1 1 | 3.66 /3H, a/, 3,77 /3H, a/, 3,98 /3H, a/, 5,04 /2H, a/, 7,10-7,58 /7H, ·/, 7,58 /IH. a/, 7,60-7.70 /2H, m/ pom. |
| 101 | 270 | 1 f 1 | 2,88 /3h, a/, 3,67 /3H, a/, 3,79 /3H, a/. 5.18 /2H, dd/ 7,1-7,6 /7h, m, 7,60 /IH, 8/, 7,6-7,7 /2H, m/ ppm. |
| 102 | 270 | 1 1 1 | 3,20 /3h, a/, 3,67 /3H, a/, 3,80 /3H, a/, 5,30 /2H, a/, 7,1-7,6 /9ri, ra/, 7,6C /IH, a/ ppm. |
| 29 | 270 | 1 1 | 2,29 /3H, a/, 3,68 /3H, a/, 3,81 /3H, a/, 5,18 /2H, a/. |
| 1 1 1 1 1 | 1 ł I t 1 | 7,10-7,50 /6H, m/, 7,59 /IH, a/, 7,94 /IH, d/ ppm. |
160 277
Tabela II /c.d./
| Γ | Zwlęzek nr | Częstotliwoś i MHz | ć « 1 i l |
| Γ | - -f-------- - - ------------------“ -n | ||
| 30 | • 270 | 1 2,34 /3H, 9/, 2,55 /3H, 9j, 3,68 /3H, 8/, 3,80 /3H, aj, ' 1 5,17 /2H, aj, 7,0-7^^5 /6H, ®/, 7,58 /1H, 9j, ' J 7,6 - 7,7 /1H, / pp«. , | |
| 47 | J 270 | , 2,24 /3H, ej , 3,68 /3h, ej, 3,80 /3H, aj, 5,15 /2H, 3/, , , 7,1-7,55 /8H, e/, 7,58 /IH, a/ ppm. i | |
| 49 | i 270 | i i 1 2,21 /3H, 8/, 3,68 /3H, , 3,81 /3H, a/f 6,14 /2H, 8/, , i 7,10 - 7,60 /6H, n/, 7,56 /IH, ppm. ' | |
| 52 | i 270 | 1 2,28 /3H, 8j, 3,68 /3H, 8j, 3,82 /3H, 8j, 5,20 /2H, aj , ' ’ 7,10-7,60 /5H, /, 7,60 /1H, aj, 7,99 /1H, //, 8,19 1 J /1H, //, 8,49 /IH, aj ppm. , | |
| 54 | ' 270 | ' 2,20 /3^ ej , 3,65 /3H, ej, 3,80 /3H, ej, 5,12 /2^ a/, ‘ , 7,18 /IH, aj, 7,35 /3H, aj. 7,50 /3H, a/, 7,57 /1H, ej. , 1 7,69 /1H, d/ ppia. 1 l i | |
| 80 | 1 270 | 1 2,24 /3H, aj, 3,70 /3H, ej, 3,85 /3H, 9/, 4,20 /3H, 9/, ' ' 5,26 /2H, 8j, 7,1-7,5 /4^ aj, 7,61 /1H, aj, 9,42 /1H, sj ' , PP®· 1 | |
| 103 | , 270 | , 1,82 /3H, 99, 3,66 /3H, aj, 3,79 /3H, 9/, 4,77 /2H, ej, , 1 6,98-7,06 /2H, m/, 7,11-7,22 /2H, aj, 77,2:3-7,03 /4H, rn/ , 1 ' 7,42-7448 /1H. ®n, 7,57 /1H, 8/ ppm. ' I | |
| 104 | ' 270 | 1 1,33 /3H, //, 2,20 /3H. 9/, 3,60 /3H, ej, 3,73 /3H, 9/, ' ' 4,35 /2H, q/, 5,14 /2H, 9/, 7,0-7,5 /4H, //, 7,50 /1H, a/,' , 7,95 - 8,10 /2H, ®/ ppm. , | |
| 105 | 270 | 1 1 , 2,23 /3H, sj, 3,68 /3H, 8j, 3,60 /3H, 9/, 5,20 /2H, 8j, , 1 7,10-7,20 /1H, m, 7,/5--,40 /3H, «1, 7,50--,60 /2H, m/, 1 1 7,59 /H, 9/, -,6--7,80 /1H, //, a,6/-8,7/ /1H, m/ ppm. · | |
| 108 | i 270 | 1 2,12 /3H, 8j, 2,22 /3H, 8j, 2,38 /3H. 8/, 3,67 /3H, sj, ' ' 3,81 9/, 5,08 /2^ 8/, 7.1-7.5 /4^ aj, 7^8 /1^ sj ' , PP«|. 1 | |
| 109 | , 270 | , 3,67 /3H, 8/, 3,80 /3H, 8j, 4,08 /3H, aj, 5,10 /2H, sj, , 1 7,10-7,^20 /1H, m/, -,//--,40 /3H, m/, 7,50-7,50 /H, //, 1 ' 7,59 /1H. 8j, -.6/--,86 /2H, //, 8,60-6,70 /1H, /, ppm. ' | |
| 111 | ' 270 | /,6/ /3H, ej, j3n, sj, 5,16 /2H, sj, 6,/4--,36 1 1 /10rl, //. -,5/ /lh, 9/, -,60--,90 /2H, m/, 8,55-6,-0 ' 1 1 , /1H, a/, ppm. , | |
| 112 | , 270 | 1 1 , 3,35 /3H, s/, 3,75 /3-, ej, 5,15 /21. s/, 5.15 /2H, s/, , 1 5,42 /2H, ss, 7,10-7,40 /9H, m/, 7,45-7,56 11H, //, 1 1 7,75 /1H, s/, 7,^^-7,70 /2H, m/, 6,60-8,70 /IH, m/ ppm. · | |
| 114 | ' 270 | ' 3,69 /3H. s/,3.80 ^H, e/, 5,06 22H, ej, 5.58 22H, s/, 1 1 7,10-7,40 /HH, m/, 75 50-7,60 11H, m/, Λδδ 1H, s8, ' -,60--,70 /1H, a/, 7.90-8.00 /IH, m/, 8,45-8555 /IH, m/ , 1 PPP· 1 |
160 277
Tabela II /c.d·/
| Zwięzek nr | Częstotliwość MHz | ”1 · 1 U . | ||
| 116 | 270 | 1 1 | 2,38 /3H, 9/, 3,62 | |
| 1 | 9/, 7,10-7,50 /5H, | |||
| 1 | | 7,96-8,06 /IH, m/, | |||
| 116 | 270 | 1 | 2,22 /3H, d/, 3,68 | |
| 1 1 | 6,7-7,6 /7H, «/, 7 | |||
| 120 | 270 | 1 1 | 2,13 /3H, 9/, 3,67 | |
| ł | 7,10-7,40 /4H, m, | |||
| « | | 7,70-7,80 / 1H, m, | |||
| 121 | 270 | 1 | 3,68 /3H, 9/, 9,89 | |
| 1 | 7,10-7,40 /4H, m, | |||
| 1 | 7,90-8,00 /IH, m/, | |||
| i | /IH, m/, ppm. | |||
| 122 | 270 | 1 | 2,34 /3H, 9/, 3,69 | |
| 1 | 7,10-7,60 /5H, m/, | |||
| 1 1 | /IH, d/. pp*n, | |||
| 123 | 270 | 2,22 /3H, 9/, 3,66 | ||
| 1 | 7,16 /2H, a/, 7,36 | |||
| 7,80 /IH, m/, 7,90 | ||||
| 125 | 270 | 1 1 | 2,13 /3H, 97, 3,68 |
S
270
13C
270
131
270
134
270
270
13S
7C
6,70-7,50 /7H, m, 7,60 /IH, 9/ PPm·
2,40 /HH, 9/, 3.70 /3ri, ·/, 3,83 /3H, a/, 5,18 /2H, 3/, /8H, m. 7,69 /IH, a/, 7,98 /2H, m/ ppm.
2,26 /3H, 9/, 3,62 /3H, 9/, 3,80 /3H, a/, 6.16 /2H, 9/, 6,66 /IH, ors/, 6,66 /IH, brs/, 7,17 /IH, m/, 7,33 /2H, m/, 7,40-7,50 /2H, m/, 7,69 /IH, 9/, 7,72 /IH, d/, 7,86 /IH, d/, 8,09 /IH, 9/ ppm,
2,40 /3H, 9/, 3,66 /3H, 9/, 3,82 /3H, 9/, 6,36 /2H, 9/,
7,16 /IH, m, 7,36 /2h, m/, 7,64 /IH, m/, 7,63 /IH, s/,
7,60 /IH, d/, 9,07 /IH, d/ ppm,
1,06 /3H, t/, 1,30 /2H, q/, 2,21 /3H, a/, 3,68 /3H, 9/,
3,82 /3H, 9/, 3,96 /2H, t/, 6,16 /2H, 9/, 6,89 /IH, d/,
7,20 /4H, */, 7,36 /2H, m, 7,62 /IH, m/, 7,69 /1H, 9/ opm,
2,30 /3H, 9·, 3,66 /3H, 9/, 3,63 /3H, 9/, 3,23 /2H, 9/ ,
7,16 /IH, r/, 7,36 /2H, m/, 7,48 /IH, rn/, 7,61 /IH, 9/ ,
9.22 /IH, 9/, 9,33 /IH, 9/ ppm,
2.22 /3rt, 9/, 3,68 /3n , 9/, 3,61 /3H, 9/ , 5,16 /2H, s/,
7,18 /2H, V. 7,36 /3H, m/ . 7,60 /3H, m/, 7,60 /IH, β/ ppm,
160 277
Tabela II /c.d./
Związek nr
Częstotliwość
MHz
| 1 146 , | 270 | , 2,22 | /3H, | s/. | 3,68 /3H, | 8/, 3,82 | /3H, | 8/ , | 4,56 | /2H, | d/, |
| a | i 5,15 | /2H, | s/. | 5,28 /1H, | d/, 5,42 | /1H, | d/, | 6,05 | /1H, | »/. | |
| 1 | » 6,90 | /1H, | d/. | 7,15-7,40 | /6h, m, | 7,52 | /1H | , «/, | 7,59 | ||
| 1 1 | ' /1H, 1 | s/ ppm. | |||||||||
| 14Θ 1 | 270 | ' 2,35 | /3H, | s/. | 3,68 /3H, | s/. 3,82 | /3H, | 8/, | 4,03 | /3H, | 8/ , |
| 1 | | ' 5,30 | /2H, | 8/ , | 6,68 /1H, | d/. 7,18 | /1H, | «/. | 7,34 | /2H, | ||
| 1 • | , 7,54 a | /1H, | s/, | 7,58 /lH. | s/, 8,50 | /1H, | d/ | ppm. | |||
| 1 149 ' | 270 | i • 2,09 | /3H, | s/, | 3,67 /3H, | 6/, 3,81 | /3H, | . | 5,20 | /2H, | 8/. |
| 1 | 1 7,10· | -7,20 | /1H | , m/, 7,25-7,45 /2H | 7,50-7,60 /2H | ||||||
| 1 1 | J 7,59 | /1H, | 8/. | 7,61-7,80 /3K, m/ | spm, | ||||||
| 150 , | 270 | ' 3.63 | /3H, | 8 , | 3,76 /3H, | s/, 5,20 | /2H, | 8/ , | 7,10-7,80 |
151
270 /8H, m/, 7,56 /1H, 6/ ppm.
1.15 /3H, t/, 2,78 /2H, <V. 3.66 /3H,<s/, 3.82 /3H, 8/,
5.15 /2H, 3/, 7,18 /1H, m/, 7,33 /2H, a/. 750 /2H, m/,
7,58 /1H, »/, 7,60 /1H, 8/, 7,80 / 1H, d/, 7,90 /1H, 8/,
PP®.
| 153 , 1 1 l | 400 | , 3.66 i /ΘΗ, • 7,88 i | /3H, m/, /1H, | 8/, 3,79 7,58 /1H, s/ ppm. | /3H, a/, 5,20 8/. 7,73 /W, | /2H, d/, | s/. 7,78 | 7,10-7,6^ | ||
| /1H, | s/. | |||||||||
| 154 1 | 270 | ' 2,66 | /6H, | 3/, 3,88 | /3H, 8/, 3,75 | /3H, | s/> | 4,82 /2H, | s/. ' | |
| 1 1 | 7,00-7,70 | /SH. m/, | 7,52 /1H, 8/ | ppm. | ||||||
| 1 155 , | 270 | , ^.8 | /HH. | d/, 31,03 | /3H,s/, 3,,11 3ΗΗ, | Θ/, | 4,99 /2H, | 3/. , | ||
| I | i 50333 | /HH . | brd/, 7, | 10 - 7,60 /H-i , | m/, | 7,58 /1H, | «/. | |||
| 1 1 | ' 7,68 i | /2H, | d/, 7,75 | /1H, s/ ppm. | ||||||
| 156 1 | 270 | ' 1,31 | /6H, | t/, 2,02 | /3H, d/, 3,69 /3H, | s/· | 8,88 | /1H, | 9/, 1 | |
| I | ' 4,12 | /4H, | q7, 5,18 | /2H, 9/, 7,11 | -7,20 | /1H | , a/, | 7.27 | -7,36' | |
| B | , /2H, | m/r | 7,37-7,45 | /1H, m/, 7,56 | /1H, | s/ | ppm. | |||
| 1 157 g | 270 | , 1,24 | /6H, | t/. 3,62 | /3H, 3/, 3,74 | /3H, | 6/. | 4,63-4,l3 | ||
| 1 | l /4H, | m, | 5,20 /2H, | 3/, 7,10-7,17 | /1H, | m , | 7,25 | -7,43 | ||
| 1 | | I | m/, | 7,53 /1H, | s/, 7,56-7,64 | /2H, | ppm. | ||||
| 158 1 | 270 | • 2,38 | /3H, | s/, 3,68 | /3H, s/, 3,82 | /3H, | s/. | 4,00 | /3H, | s/, I |
| 1 | 1 4,09 | /3H, | s/. 5,32 | /^H, s/, 7,10 | -7,50 | /4H | , mm, | 7,40 | ||
| 1 1 | , /1H. | s/, | 7,59 /1H, | S/ ppm. | ||||||
| 159 ’ | 2 70 | 1 , 2,13 | /^H, | 8/ , 3,69 | /3H, s/, 3,51 | /3H, | s/, | 5,03 | /2H, | S/. J |
| 1 | , 6,17 | /lh, | n/, 6,37 | /1- , m/, 5,73 | /1H, | n/ , | 7,15 | , | m/, i | |
| < | , 7,31 | /2H, | m/, 7,47 | /iH, m/, 7,58 | /1H , | S/, | ||||
| 1 1 | i 9,06 1 | /1H, | brs/ ρρη. | |||||||
| 160 1 | 270 | 1 2,19 | /3h, | s/, 3,60 | /3H, s/, 3,74 | /3H, | s/ · | 5,08 | /2H, | s/. 1 |
| 1 | | ‘ 6,20 | 1H, | m, 6>48 | /1H, 6,88 | /1H, | m, | 7,20 | /1H, | m/, 1 | |
| t 7,37 | /2H. | n/, 7,51 | /1H, m/s 7,56 | /1H, | S/· | 10,30 /1H | brs/ | |||
| 1 | , ΡΡ®. |
160 277
Tabele II /c.d./
Związek nr
Częstotliwość
MHz
162
163
164
167
169
171
173
174
270
270
270
270
270
270
270 !70
2,52 /3H, e/, 3,69 /3H, 8j, 3,82 /3H, aj , 5,00 /2H, 8/,
6,95 /iH, d/. 7,08 /1H, t/, 7.18 /1H, m/, 7.24 - 7,40 /5H, mj , 7,54 /1H, «/. 7»59 /1H, ej, 8,65 /2H. d/ ppm.
2.23 /3H. », 2,52 /IH. m/, 3,69 /3H, ej, 3,82 /3H, 9/,
4,71 /2H. d/. 5,15 /2H, s/, 6,98 /1H, /, 7,18 /1H, a/,
7,25 - 7.40 /5H, mj , 7,51 /1H, a/. 7,60 /1H, sj ppm.
1,84 /3H. d/. 3,67 /3h, 8/, 3,80 /3Ht aj. 4,96 /2H. aj, 7,10-7.50 /5H. </, 7,56 /1H. s/ ppm.
1.24 /3H, tj, 1.91 /3H, 9/, 3,66 /3H. 8/, 3,79 /3H. sj,
3,99 /2H, q , 4,82 /2H. aj, 7,10-7,50 j^^, mj, 7,56 /1H, 8/ ppm.
2,35 /3H. aj. 2,51 / 1H, mj, 3,68 /3H, sj, 3,82 /3H, 3/,
5,05 /2H, dj, 5,32 /2H. sj, 6,76 /1H, d/. 7,18 /iH. m/,
7,34 /2H, «/, 7,55 /1H, a/, 7,58 /1H, 9j, 8,58 jlH, d/ ppm.
1.21 /3H, tj, 2,22 /3H, 8/, 2,65 /2H, r/. 3,68 /3H. sj,
3,82 /3H. sj, 5,14 /2H. s/, 7,18 /3H, mj. 7,32 /2H, »/,
7.55 /2H, mj , 7,57 /iH, /j, 7,59 /1H, 8j ppm.
2.12 /3H. s/, 2,33 /3h, sj, 3,67 /3H. 8j, 3,82 /3H, sj,
5,03 /2H, 8/, 7,10-7,14 /1H, mj, 7,24-7,37 /2H, m/. 7,46-7,53 /1H, “/. 7,57 /1H, sj ppm.
2,20 /3H, ej 3,07 /3H, sj, 3,70 /2H, sj, 3,84 /3H, s/, 5,15 /2H, sj, 7,14-7,22 /1H, mj, 7,31-7.40 /2H, m/, 7,43-7,50 /IH, mj, 7,60 /IH, sj ppm.
| 175 | ł , 270 1 | 1 , 3,63 /3H, 1 6,70-7,60 I | sj, /7H | 3,75 , m, | /3h, aj, 7,60 /1H | 3,78 . sj, | /3H, 9/, 5,44 /2H, 8,59 /IH, brs/ ppw | sj, . |
| 176 | 1 270 | 1 1,03 /3H, | t/ | 1,81 /2H. mj, | 2,35 /3H, sj , 3,68 /3H, | s/. | ||
| 1 | 1 3,82 /3H, | 9/. | -4,36 | /2H, tj, | 5,31 | /2H, aj, 6.65 /1H, | d/, | |
| i 1 | J 7,18 /iH, | m/. | 7.315 | /2r, mj , | 77 55 | /1H, d/, 7^6 jiH. | sj , | |
| 1 | , 8,50 /1H, | d/ | ppm. | |||||
| 177 | 1 , 2 70 | 1 , 0,90 /3H, | t/. | 1,32 | j4H, m/, | 11-46 | j2H, mj, ^76 /2H, | mj, |
| 1 | 1 2,22 /3n., | s/. | 3,56 | j3H, s/, | 3.62 | /3H, s/, 3796 /2H, | tZ , | |
| j | ' 5,15 /2H, | s/, | 5,99 | /1H, d/, | 7,15· | -7,35 /6H, m/, 7,52 | ||
| 1 1 | /1H, m/, | 7,59 | /IH. | 8/ ppm. | ||||
| 175 | 1 2 70 i | J 0.59 jjr- , | t/. | i .46 | /2H, m/, | 1176 | /2H , m/ , 2,35 /3H, | sj, |
| i | , 3,-66 /3H, | 9/. | 3 362 | /3H, sj, | 4,41 | /2H. t/, 5,31 /2H, | sj. | |
| 1 | i 6,65 /IH, | 0/ , | 7,15 | /in, m, | 7^2 | /2h, m, 7,55 ji». | dj, | |
| 1 1 | ' 7,58 /IH, 1 | sj. | S ,-4^ | /lH. d/ | ppm. | |||
| 180 | < 270 | 1 1,75 /3H, | sj | 1,60 /3H, sj, | 2,22 /3H, 3j, 3,68 /3h, | s/. | ||
| 1 1 | ΐ 3,82 J3H, | sj , | 4,52 | /2H, d/, | 5,15 | /2H, sj , 5,48 /1H, | t/, | |
| 1 | 1 6,90 /IH. | dj, | 7,15- | 7,35 /6H | , m/, | 7,51 /IH, m, 7,58 |
/IH, sj, ppm.
160 277
Tabela I! /c.d./
| Zwięzek* nr 1 | Częstotliwość MHz | |||
| 184 | 1 1 1 | 270 | ||
| 185 | 1 1 1 | | 270 | ||
| 186 | I 1 1 | 270 | ||
| 187 | 1 1 1 1 | 270 | ||
| 188 | 1 1 1 1 | 270 | ||
| 1S1 | 1 I 1 1 1 | 270 | ||
| 192 | 1 1 1 1 | 270 | ||
| 194 | 1 1 1 1 1 | 270 |
| 2,22 /3H, s/, 2.96 /6H, s/, 3,68 /3H, s/, 3,82 /3H, s/. | |||
| 5,15 /2H. s/. 7,15-7,38 /4H, | 6,72 /1H. dd/, 6,94 /IH, d/, 7,00 /lH.s/, | ||
| m . | 7,52 /IH, ra. | 7,58 /IH, s/ ppm. | |
| 3,69 /3H, s/. | 3,83 /3H, s/, 5,26 /2H, s/, 7,1 - 7,6 | ||
| /6H, m, 7,61 | /1H, | s/, 8,00 /iH, | d/, 8,07 /1H, s/ ppm. |
| 2,05-1,70 /12H, / | , 2,54 /1H, mf | , 3,55 /1H, m, 3,68 | |
| /3H, s/, 3,82 | /3H. | s/, 4,98 /2H, | e/. 7,13 /IH, m/. |
| 7,30 /2H. m. | 7.47 | /IH. m. 7,57 | /IH, s/ ppm. |
| 2,25 /3H, s/. | 3,68 | /3H, 8/, 3,80 | /3H» s/, 5,24 /2H, s/. |
| 6,96 /1H, s/, | 7.47· | -7,15 /5H, m/. | 7,58 /1H, s/, 7,59-7,51 |
| /3H, m/ ppm. | |||
| 2,23 /3H, s/. | 3,30 | /3H, s/, 3,62 | /3H, s/, 3,76 /3rl, s/. |
| 5,18 /2H. s/. | 7.12 | /IH, m. 7,28 | /2h, m, 7,38 /ih, m. |
| 7,53 /IH. s/. | 8,00 | /1H, d/. 8.72 | /1H, d/ ppm. |
| 2,22 /3H, 8/. | 3,38 | /3H, s/ 3,56 /2H, m/, 3,69 /3H, s/. | |
| 3.82 /3H, s/, | 3,83 | /2H, m. 5,14 /2H, 8/. 5,28 /2H, s/. | |
| 7,05 /IH. m. | 7,17 | /1H, o/, 7,25-7,40 /5H, «/, 7,52 | |
| /1H, m. 7,60 | /IH, | a/ ppm. | |
| 2,22 /3*. s/, | 3,68 | /3H, s/, 3,82 | /3H, s/, 4,80 /2H, s/. |
| 5,16 /2H, s/. | 6,98 | /lh, m. 7,16 | /IH, m, 7,32 /5H, m, |
| 7,50 /1K, m. | 7,59 | /1H, 6/ ppm. | |
| 2,22 /3H, 8/. | 3,68 | /3H, s/, 3,82 | /3H, s/, 5,15 /2H, s/. |
| 6,25, 6,52, 6, | 81 /1H, t/, 7.1C /IH, d/, 7,18 /IH, m/, |
7,3-7,4 /3H, m/, 7,41-7,55 /3H, m/, 7,60 /IH, 8/ ppm.
Zwięzki o wzorze 1 aktywność grzybobójczą 1 stanowią substancję czynnę środka według wynalazku. Można Je stosować do zwalczania jednego lub więcej z następujących patogenów: Pyriculana oryzee na ryżu, Puccinia recondita, Puccinia striformis i inne rdze na pszenicy, Puccinia hordei, Puccinia stmfornis i inne rdze na jęczmieniu oraz rdze na innych żywicielach, np. kawie, gruszy, jabłoni, orzechu zinmnyn, warzywach i roślinach ozoobnych, Erysiphe graminis /nączniak właściwy/ na jęczmieniu i pszenicy i inne męczniaki właściwe na różnych żywicielach, takie jak Sphoerotheca maadans na szyszkach chmielowych, Sp^^ero^aca fulignea na dyniowatych /np. ogórku/, Podosphaera leucotucna na jabłoni i Uncinuia iscc^o na winorośli, Helmmt^pornum spp., Rhynonosponum spp., Septcria spp., Pyoensplsoα spo. Pseudocercosporella nerepotncnoides i Gaeumannommces gramr^is na roślinach zbożowych.
Ceousspsra arach.idicoia i Cercossolldlu.n personata na orzechu zimnym oraz inne gatunki z rodzaju Cercospora na innych zywlcielacn, na przykład buraku cukrowym, bananie, soi i ryżu.
Botrytis cinerea /szara pleśń/ na pomidorze, truskawce, warzywach, winorośli i innych żywicielach. Alternana spp. na warzywach /np. ogórku/, rzepaku, jabłoni, pomidorze i innych żywicielach.
ISO 277
Ventune lnaequalis /parch/ na Jabłoni.
Plasmopare yiticola na winorróli,
Inne mączniaM rzekome, takie Jak Bremia lactucae na sałacie, Peronospora spp na soi, tytoniu, cebuli 1 Innych żywicielach oraz Pseudoperonospora hurnuli na szyszkach chmielowych 1 Pseudoperonospora cubensis na dyniowatych, Phytophthora infestans na ziemniaku 1 pomidorze oraz Inne gatunki z rodzaju Phytophthora na warzywach, truskawce, awokado, krzewie pieprzowym, roślinach ozdobnych, tytoniu, drzewie kakaowym 1 innych żywicielach.
Thanatephorus cucurneris na ryżu i inne gatunki z rodzaju Rhozoctonia na różnych żywicielach, takich jak pszenica i jęczmień, warzywa, bawełna i darń.
Niektóre ze zwięzków o wzorze 1 wykazuję szeroki zakres aktywności przeclwgrzyblczej in vitro. Mogę one także wykazywać aktywność przeciw rozmaitym chorobom owoców po zbiorze /np. ^^nicillim digitatui i italcuui oraz Trichoderia viride na pomirańczach, Cloeosporiui lt^arum na bananach i Bot i~,y^is cinerea na wlnogronacc/.
Ponadto pewne zwięzki o wzorze 1 ragę być aktywne jako zaprawy nasienne przeciw Fusar^^m spo., Septona spp·, Tilletia spp. /śnieć cuchnętt pszenicy, choroba przenoszona przez nasiona/, Ustilago spp., Helminthosporlum spp, na zbożach, Rhizoctonia solani na bawebie i Pyriciulari/ oryzae na ryżu.
Przemieszczanie się zwięzków o wzorze 1 w roślinach ma charakter systemiczny. Ponadto zwięzki te mogę być lotne w stopniu wystarczającym do tego, aby wykazywać w fazie pary aktywność przeciwgrzybiczę wobec rośliny.
Sposób zwalczania grzybów polega na tym, że nanosi się na roślinę, na jej nasiona lub na Jej stanowisko, lub też na miejsce, w którym znajduje się roślina lub nasiona, użyte w skutecznej ilości zwięzek o wzorze 1 lub zawierający go środek.
Niektóre ze zwięzków o wzorze 1 wyl^^^uję działanie owadobbócze i w odpowiedniej dawce mogę byc stosowane do zwalczania szeregu owadów i roztoczy.
Sposób zwalczania owadów lub roztoczy polega na tym, ze owady lub roztocze lub miejsce ich występowania traktuje się owadobójczo lub roztoczobójczo efektywnę ilością zwięzku o wzorze 1 lub zawierajęcego go środka.
Zwięzki o wzorze 1 można stosować do celów rolniczych bezpośrednio, jednak dogodniej Jest sformułować Je w środki stosujęc nośnik lub rozcieńczalnik. Tak więc, wynalazek dotyczy środka grzybobójczego, owadobójczego i roztoczobójczego, zawierajęcego zw.ęzek o wzorze 1 oraz dopuszczalny nośnik lub rozcieńczalnik.
Związki o wzorze 1 można nanosić w rozmaity sposób. I tak np. można Jo nanosić sformułowane lub nie sformułowane, bezpośrednio na listowie rośliny, na nasiona lub inne środowiska, na których rośliny rosnę lub maję być uprawiane. Można tu użyć sposobu polegajęcego na opryskiwaniu, opylaniu albo zastosowaniu ich jako preparatu w postaci kremu lub pasty. Związki te można stosować także jako opary lub granulki do powolnego uwalniania. Nanosie raźna je na kazdę część rośliny, w tym na listowie, łodygi, gałęzie lub korzenie, glebę otaczajęcę korzenie lub tez na nasiona przed ich zasiancm oędź tez ogólnie do gleby, wody zllowaJęcej ryz aloo układów upraw hydroporlozyon. środki według wynalazku można również wstrzykiwać do roślin, względnie opryskiwać nimi roślinność z zastosowaniu techniki opryskiwana o le* tro lynan icznego wzglęme lnnycn mnod niskoobj ętościowych .
Timn roślina” stosowany w niniejsym^! opisie obejmuje sadzonki, krzewy i mewa. Dalej, sposób sw^^czliia grzyoow obejmuje działanie prewencyjne, ochronne, profilaktyczne i wypleniajęce .
Korzytr^ie, zwięziów o wzorze 1 używa się w zastosowaniu rolnicom lub ogrodniczym w postaci środka, przy czym typ użytego środka w każdym przypadku ziIozoc oędzie od konkretnego rozpatrywana zastosowania.
środki według wynalazku mogę występować w postaci proszków do opylania lub granulek zawierajęcych składnik cscniy /zwięzek o wzorze 1/ i stały rozcieńczalnik lub nośnik, np. napełmmaczo, takie jak kaolin, bentonit, ziemia okrzemkowa, dolomit, węglan
160 277 wapniowy, talk, sproszkowany tlenek magnezowy, ziemia fulerska, gips, diatomit, glinka biała. Granulki takie mogę mieć postać gotowych granulek, nadających się do wprowadzania do gleby bez dalszej obróbki. Granulki te można wytworzyć albo przez impregnację grudek napełniacza składnikiem czynnym, albo granulowanie m^szar^^ny składnika czynnego i sproszkowanego napełniacza. środki do zaprawiania nasion mogę zawierać czynnik /np. olej mmnralny/ wspommgający przyleganie środka do nasion. Alternatywnie, składnik czynny można formułować w celu zaprawiania nasion stosujęc rozpuszczalnik organiczny, np, N-mseylopirolidon, glikol propylenowy lub dimetyloformamid, środki mogę istnieć także w postaci proszków zawiesinowych lub granulek zdolnych do dyspeesji w wodzie zawierających środki zwilżajęce lub dyspergujące w celu ułatwienia dyspuas! w płynach. Proszki i granulki mogę także zawierać napełniacze i środki zawieszajęce.
KonlCilraty do emulgowania lub emocję można wytwarzać przez rozpuszczenie składnika czynnego w rozpuszczalniku organicznym, ^wenuslnie zawierającym środek zwilżający lub emu^u^cy, a potem dodanie mieszaniny do wody, która też może zawierać środek zwilżaJęcy lub emuuguuęcy. Stosowanymi rozpuszczalnikami organicznymi sę rozpusscczlniki aromatyczne, takie Jak alkilobenzeny i alkillt^naf^^l^ny, ketony, takie Jak izoforon, cykloheksanom 1 mθiyloClklohekJalon, chlorowane węglowodory, takie jak chlorobinzen i oraz alkohole, takie jak alkohol benzylowy, alkohol furfur^^y, butanol 1 etery glikolowe.
Konncelratl zawiesinowe w wysokim stopniu nierozpuszczalnych ciał stałych można wytwarzać za pomocę zmielenia w młynie kulowym lub perełkowym ze środkiem dyspersyjnym oraz dodania środka zawieszającego w celu zatrzymania osiadania stałych części, środki do użycia w postaci oprysku mogę występować Jako aerozole, w których preparat jest utrzymywany w pojemniku pod w obecności ^opelema, takiego jak f luo rot nchlo r orne tan.
Związki o wzorze 1 można mieszać w stenie suchym z mieszaninę pirotechniczny w celu wytworzenia środka nadajęc^go się do tworzenia w przestrzeniach zamkniętych dymu zawierającego te związki.
Alternatywnie, zwięzki o w^^rze 1 można zastosować w postaci mikrokapsułek. Można je formułować w preparaty z udz^ecm polimerów podatnych na degradację biologicznę, w celu powo^ego, lontroloeanego i^eamia^a subssancci czynny.
Przez dodanie odlowledπlch dodatków, np. dodatków lolepszαjących dystrybucję, siłę przylegania, oporność na deszcz na poddanych działaniu powierzchniach, można lepiej zaadaptować rozmaite środki do różnych zastosowań.
ZwWązki o wzorze 1 nożna stosować w mle8zanlnie z nawozami sztucznymi, takimi jak nawozy sztuczne zawierające azot, potas lub fosfór. Korzystne sę środki zawirajęce tylko granulki nawozu sztucznego z dodatkiem, np. przez ich, znięzku o wzorze i.
Granuli takie korzystnie zawierają do 25% nag. związku o w^i^rze 1.
Proszki zawiesinowe, koncentraty do emulgowania i koncentraty zawiesinowe zawierają zwykle środki powierzchniowo czynne, takie Jak środek zwilżający, środek dyspergujący, środek emulgujący lub środek utrzymujący w zawiesinie, środki te mogą być środkami kationowymi, anionowymi lub niejomowymi.
Oopowieommi 6rcdkami kationowymi są czwartorzędowe zwązki eur^iowi, takie Jak bromek cetylotnmetilaamoniowy. Odpowiednimi środkami anionowymi są mydła, sole alifatycznych uno estrów Kwasu siarkowego /np. laurylosiarczan sodowy/' oraz sole sulfonowanycn związków aromatycznych /np. dodecylobenzenosulfonian sodowy, lignosulfonian sodowy, lignosul foniar, wapniowy lub lignosulfonian amonowy, naftalenosulfonian butylu oraz m^szanina duzopropyloraftalenosu1fomianu sodowego i trizoproopylonaftalenosulfomanu sodowego/.
^ΡΟη^ιιβι środkami niej onowymi są produkty kondemnacji tlenku etylenu z alkoholami tłuszczowymi, takimi jak alkoncl olemowy lub alkohol cetylowy, lub z alkilofenolami, takimi Jak oktylofencl lub nonylofenol i oktylokrazol. Innymi środkami niejonowymi są częściowe etery pochodzące od długołańcuchowycn kwasów tłuszczowych 1 bezwodników heksytolu, produkty kondemnacji wspomnianych cząścoowych eterów z tlenkeem etylenu oraz lecytyny.
160 277
Odpowiednimi środkami utrzymującymi w zawiesinie sę hydrofilową koloidy /np. poliwinylopirolodoc i sól sodowa karboksymmtylooclulozy/ oraz spęczniające gliny, takie jak bentonit lub atapuUgit.
środki do użycia w charakterze wodnych Oyspeessi lub emuliSi eą na ogół dostarczane w postaci koncentratu o wysokim udziale składnika czynnego, przy czym koncentrat rozcieńcza sią wodą przed użyciem. Konccettaty te korzystnie powinny być zdolne do wytrzymania przechowywania w ciągu długotrwałego okresu 1 po tym przechowywaniu nadawać sią Oo rozcieńczenia wodą w celu utworzenia wodnych preparatów, które pozostają homogeniczne, w czasie wystarczającym do użycie ich z zastosowaniem zwykłego wyposażeńia do opryskiwania. Koozyssnie, koncentraty zawierają do 96%, stosownie 10-66%, np. 26-60% wagowych składnika czynnego. Po rozcieńczeniu Ha utworzenia preparatów wodnych, stosowane preparaty mogą zawierać składnik czynny w Hościach zmiennych, zależnie od zamierzonego celu, ale można użyć preparatu wodnego zawierającego 0,00066 lub 0,01 - 10% wagowych składnika czynnego.
środki według wynalazku mogą zawierać inne związki o aktywności biologiczna^ cp. związki wykazujące podobną lub uzuRp^^ającą aktywność grzybobójczą lub wykazuJące zdol -ość regulowania wzrostu roślin, aktywność chwassobójczą lub owadoobóczą.
Związkiem stanowiącym czynnik grzybobóóczy, który może wystąpować w środku według wynnaezku, może być związek zdolny do zwalczania choroby kłosa u rośli- zbożowych /np. pszanncy/, takiej jak w przypadku gatunków z rodzaju Septoria, Oibbeeella 1 Helmictłosporlum, chorób przenoszonych przez nasiona i przez glebą oraz mączniaka rzekomego i mąccniaka właściwego na winogronach, mę(:cniaka właściwego i parcha na jabłoni, itp. □ziąki dodaniu iccego czyndka grzybobójczego, środek może wykazywać szarszy zakres aktywności aniżeli śnlek zawierający sam związek o wzorze 1. Oprócz tego inny czynnik grzybobójczy może wywierać wpływ synergistyczcy na aktywność grzybobójczą związku o wzorze 1, Przyklądowymi związkami 0(0(01^^ czynnikami grzybobójczymi, które można włączyć do środka według wynalazku sąs eter /+/-2-/2,4-dlchlorolelclo/-3-/lH-l,2,4-triazol-ł-ilp/prplylowo-1,1,2,2-tetrafllιlΓletylowl, kwas /RS/-l-omrloplopyloloslonowy, /RS/-4-/4-chllrofenylo/-2-fιπ^1«^-2^-/ΊγΙ1,2t^-l-olomiąy/ho/buty^ronitryl, /RS/-4-chlαfo-N-/lyJnooleloSlyametylo/eeΓ.zamld, /Z/-N-but-2eenylokslmalylo-2-chloro-2<,6*-dletyllacθtanClid, l-22clyJcno22mmetoksyiainoacetlll/-3-θlylaaocznlk, 1-f 2RS.4RS; 2RS, 4RS/-4-bromoo22/2,4-0lchllrofenylo/tetrahydrof u rf uTyło^-m-l ,2,4-t nazol, 3-/2,4-d ich loro feny lo/-2-/lH-l ,2,4-triazol-1-lll/lłlnazollo4/3H/-oc, eter 3-chloro-4-/ 4-aalyl0l22/lHHl;2,4-1Tiazolo-l-metllo/-l,3ddloSsoraπ-2-ylo_7 fe-yio^-chlorofenylowy, 4-broool2-cyjrco--,--dioetylo-S-t rllllalooetylobeczlOldarzll/lsl^ίflnadd, ioio --/2,4-dnhloro leeylo/-22/lHHl,2,4-1 rlezol-l-llo/1 iooctanu 4-chlorobeczllu , kwas 6-e tylo-e .e-lihyln-S-okso/l, 3/-dnksolo/4,6-g/chlclltno-7-ra/boksylowy, Oć/--/
3pchłoro-2,6-ksylloo/O-eeoosiaai^eHmiOo J- -bu tyrolaktoc , a-ilazy-a, BAS 464, /enalaksyl, becomml, /lloksazol, /irapakryl, /ltertrcll, clast lcydyc S, ou^i-rym^r^t, Z^tiobat, Oappafol, kaptan, Οι^ι-Ο^ιο, krr/okslc, chlorobeπzol lazon, chloroce/, chlorotalonrl, cłior/z/looa t, związki zawierające takie jak tlecllcloΓek m^t^zi, siar^czac medzi i oiesza-ica Borleaux, cykloheksiaio, llaalksrtl, lllrlOonarol, lltrl'flrra, 1,1*-dwutlenek <OwJUSarlzOl οι-2-ρirylilu , l ichlo f luamo, lucloc, oiklo/utrazol, lik lomazyca, llkllrac, li^^itamuff, Oimur^mo^, dlOIkocaΣ:cl, llcokrt, Οι^Ιιοί^, imamc, Ο^βπιο^, lodic, edifecfos, ltrOorazci, etirmol, lZ/-^l-Dlczyio-;.l//'oltylll/oetylltlletl 1ideclroOno-lksyl 0rr/lnylo/rolnlJ7-tio/- β -ι13-ιοιθ- etylu, etrldrz/l, fenapearl, ^-αποο^ fe-furam, fe-ppik leni 1, ^-^^111-, fecpr/μlOOlf, octac fentyny, wGOOlotier,lk fe-tyry, fłltlϊrnli, flutriafol, fluzllrzlI, folpet, flsetylo-l 1οο, floerrdrzol, ^η^ΟβγΙ, furolnarzl-llS, Ιοθζθιι-ι, łeksal<on-rol, -ldrokεylzoksazol, ^οβ^^Ι, ltro/erfos, ltrl1llr., izltrotlllr-krsugrorllrr , οοπ-οκ^, οοπθο, maetolti, ο a aa a a lo s y 1, oolflrlksro, mtsu ifowaks, οοΐ!^! tanil, -eoesozyr, lime tiloli t llkrsbrm.m.r- riklu, —,tntal-nopn^^l, muurrmol, ofurace, związki rtęćloorgamczne, oksadiksyl, oksykar/oksi-, penkonnaoi, pensykuron, --furflrlll---loldrzol-ł~llorarlnlyl--DLłhooo-rlr-iOlan pect-4-enylu, tlenek fe-aks-yny, ftalid.
160 277 polioksyn 0, polirao, probenazol, prochloraz, procymldon, propamokarb, proplkanazol, propineb, protiokarb, pirazofos, piryfenoks, plrochilon, piroksyfur, pirolnitrin, chinometunian, chlntozan, sti^ef^n^mycyna, siarka, techloftaaaa, teknozen, tebukonazoo, tiobandazo^ tiofanlan mecylu, tiram, tolklofos-raθiyl, sól trkoclanlwa, 1,1*-ιιηιη^1/^tamerylano/diguanldyny, triadimefon, traadimenol, triazbutyl, trlcyklazol, trldamarf, trlforin, walidamycyna A, winklozolin i zineb.
Związki o w^i^rze 1 można mieszać z glebę, to^am lub innymi podłożami korzeniowymi w celu ochrony roślin przed chorobami przenoszonymi przez nasiona, przez glebę lub chorobami liści powodowanymi przez grzyby.
Odpowiednimi czynnikami ow^c^c^^bjc^^^yi^i, które można łęczyc ze środkiem według wynalazku sę: buprooazin, karbaryl, karbofuran, karbosulfan, ch^^yni^a, cykloprotrin, demθioor--meiyl, dizzynon, dimeeoat, ztofenproas, fenitrotior, fenobukarb, fentUn, formion, izoprokarb, izoksatlln, roonlkokofo8, pentoat, plrlmikarb, propa^s i XMC.
Związki regulujęce wzrost roślin sę to związki, które zwaaczeję chwasty lub formowanie górnej części rośliny z nasionami, względnie wybiórczo zwalczeję wzrost mnej pożędanych roślin /np. traw/.
Przykaedowymi ldpowiθdnimi zwięzajli regulującymi wzrost roślin do użycia wraz ze zwięzkami o wzorze 1 są: kwas 3,6-dichlororikllrnowy, kwae l-/4-chllrlfenylo/-4,6-dimθiylo-2-oksOl-,2-dlhylΓlplrydynl-3-kaΓblksyllwy, 3,6-dihhlolllmyzar roej^JLu, kwas abscisikowy, zsuIzi, bennzklopropriyl, aarbetzmid, damlnozyd, difenzoguat, diaigulzi, etefon, fenpennezol, fj^uon^^mid, gHi^at, glHozyna, hydroksybbenzlrlryle /np. bΓoιnmlaynll/, mbeniU, iz^my!^ alkohole i kwasy tłuszczowa o długim łańcuchu, hydrazyd ^^leiro^^, lliluldyl, lllfzktyny /np. ihlorfluoroθkol/, ^^^□^οζοί, kwasy feroasylctlwi /np.2,4-0 lub ΜΟΡΑ/, podstawiony kwas benzoesowy /np. kwas trjkllobθnzozslwiy, podstawione czwartorzędowe zwięzki amoniowe i fosfoniowe /np. ihllΓlmequut, ihlorkonlul lub mlirqυllcilolrde/, teknazen, euksyny /np. kwas indolikooctowy, kwas inlollllmzsłowy, kwas naftylooclowy lub kwas naf tlasyoctlwyy, cytokimy /np. bβnzimldazol, bθnzyllalenlna, benzyllamlropuryna, difθπykomlczni< lub Kinetyna/, gibbereliny /np. GA^, GA lub GA? l tniapentenol.
Pcnizsze przykłady ilustruję środki wedłu wynalazku do celów rolniczych i ogrodni czych, 2awlerajęci związki o wzorze ogólnym 1 Jako substancję czynną. Procenty oznaczaję procenty wagowe.
Przykład 1. Sporzędza się alncenrrot do elilgowinla przez mieszanie poniższych skłldnakói do całkowitego ich rozpuszczenia.
Zwięzek nr 16 z tabeli I 10% Alkohol benzylowy 30% Oodecylobenzβnosslfonilr wapniowy 5% Oksyetylowany nozy^ienl /13 roli tlenku etylenu/ 10% Alkllobenzeny 45%
Przykłac 11. Substancję czynnę rozouszcza się w chlorku metylenu i otrzynanę ciecz na t r',s<ui e się na granulki gliny a tapu lg 11 owej . Następnie pozwala się na odparowanie rozpuszczalnika w celu wytworzenia preparatu granulowanego.
Związek nr 15 z tebeli I 5%
Granulki ataoulgitowe S5%
Przykład 111. Sporzędza się srodek ms i zmieszane t niech skiaon<ow:
Zwięzek nr lć z tabbei I 5C%
Olej mineralny 2%
Kaolin 46% oo zaprawiania nasion przez zm^le·
160 277
Przyk ład IV. Sporządza się proszek do opylania przez zmielenie i zmieszanie substancji czynnej z talkeem
| Związek nr 18 z tabeli I | 5% |
| Talk | 95% |
| Przykład | V. Sporządza się koncent |
| składnkków w m^r^i.e kulowym | w celu wytworzenia wodnej |
| Związek nr 18 z tabeli I | 40% |
| Lignosulfonian sodowy | 10% |
| Glina bentonitowa | 1% |
| bodę | 49% |
zmielenie mieszaniny.
środek ten można stosować do oprysków przez bezpośrednio na nasiona.
rozcieńczanie w wodzie lub nanosić
Przykład VI. Sporządza się środek w postaci proszku zawiesinowego przez zmieszanie razem i zmalenie składników az do uzyskania dokładnego wyimaszania.
Związek nr 18 z tabeli I 23% Laurylosiarczan sodowy 2% Lignosulfonian sodowy S% Krzemionka 25% Kaolin 43%
Przykład VII. Związki oada się pod względem ich aktywności w zwalczaniu rozmaitych grzybicznych zakażeń liści. Stosuje się następujące metody:
Prowadzi się hodowlą roślin na John Innes Potting Comppst /nr 1 lub 2/ w doniczka^ o erednicy 4 cm. Związki badane formułuje sią albo za pomocą zmielenia w młynie kulowym wraz z wconym roztworem Oispersol T, albo jako roztwór w acetonie lub mieszaninie eceton/etano! , który rozcieńcza się do żąOanego stążenia bezpośrednio przed użyciem, u przypadku cnoróo liści preparatami /100 ppm składnika czynnego/ opryskuje się listowie oraz stosuje sią je na korzenie rośliny w glebie. Opryski stosuje się do uzyskanie maksymalnej retencji, a korzenie zrasza się do uzyskania końcowego stężenia w przybliżeniu 40 ppm składnika czynnego/sucha gleba. W przypadku stosowania oprysku na rośliny zbozowe. dodaje się Tween 20, do uzyskania końcowego stążenie 0^(^5^%.
.> większości testów, związki stosuje się na glebą /korzeni.e/ oraz na listwie /za pomocą opryskiwania/ dzień luo dwa dni przed zaeπokulowailθm rośliny czynnikiem cnoroootwórczym. wyjątek stanowi tylko test z zas^^wanimii Erysiphe gramnis, w którym to teście rośliny moku^uje się o 24 godziny wcześniej niz nastąpuje poddanie ich działaniu badanego związku. Patogeny liści nanosi się za pomocą opryskiwania li6ci roślin stosowanych w teście zawiesiną zarodników. Po dokonaniu mo^lowenia, rośliny umeszcza się w odpowiednim otoczeniu, aby dopuścić do rozwoju zakazania, a nastąpnie mkubuje się je tak długo, jak długo jest to potrzebne, aby postęp choroby stał sią możliwy do oszacowania. Okres mądzy zainokulowaniem roślin a os^a(^t^wai^^l postępu choroby waha się w zakresie od czterech do czternastu dn, w zależności od rodzaju choroby i środowiska.
Zmlczanie choroby rejestruje sią stosując nastąpującą skalą oceny;
« brkk chocoby b siady - 5% w stosunku do występowania choroby na nietraktowanych roślinach, = 6-25¾ w stosunku do występowania choropy na nietrabowanych roślinach, « 26-55% w stosunku do występowania choroby na n ie t akbicwanych roslrnach, = 6O-1CC% w stosunku do występowania chorooy na nieukb(iwanych roslrnach.
ι/yniki przedstawiono w tabeli III.
160 277
Tabela HI
| Zwięzek nr | Tablica ’ nr 1 t | Puccinia Recor^di- ta pszenica | 1Erysi’ pbe i Grami. nl.s | 1yanturia •Inaequ1 alis , Jabłoń | 1 Pyncu1 laria i Oryzae t ryż | 1 Cerco spora i Arachidi , cola | *Plasmo- ' 1-para < -1 Viticola i 1winorośl , | Phytophtnora1 Infastans · pomidor i | |
| l 1 ι i. .---1----1---- | . Jęczmień, | 1 r ~ “ | orzech _ziemny | 1 1 γ - : “ < | |||||
| . _1_ _ _.-2- - - | _ _3__ | u- ź - - | „ -5--- | > -5— | -7- - - | r - S - - r | |||
| 1 | t 1 | - | ' 3 | | ’ 4 | ' 4 | 1 4 I | 1 4 1 I 1 | 4 1 | |
| 2 | • I | 4 | • 4 | « 4 | * 4 | i 4 | t 4 t | 3 i | |
| 3 | 1 , I | 4 | 1 f 4 | , 4 | ( - | 1 4 | 4 1 t | 3 ' | |
| 4 | ' I | - | 1 4 | 1 4 | ' 3 | » 4 | | 1 4 1 | I | 4 ' | |
| 5 | ι I | 4 | i 4 | 1 4 | 1 - | i 4 | 1 4 , | 3 i | |
| 6 | 1 f I | 4 | 1 4 1 | ' 4 | 1 - | 1 4 1 | 1 4 1 1 1 | 3 ‘ | |
| 7 | 1 1 | 4 | ! 4 | ' 4 | ' - | l 4 | 1 4 1 | 3 i | |
| θ | 1 t 1 | 3 | i 4 | l 4 | , - | , 4 | 1 4 , | 4 , | |
| & | 1 1 | 4 | 1 4 1 | ‘ 4 | 1 - | 1 4 1 | 1 4 1 1 1 | 4 ' | |
| 10 | • I | 4 | • 1 | l 4 | • - | 1 4 | 1 4 t | 1 i | |
| 11 | 1 1 1 | 3 | 1 , 4 | , 4 | , 4 | t 4 | 4 ( | 3 | |
| 12 | ' I | 4 | 1 4 | 1 4 | ' - | 1 4 f | 1 4 1 f t | 4 1 | |
| 13 | • I | 4 | i 4 | i 4 | 1 - | 1 4 | 1 4 i | 0 i | |
| 14 | 1 , 1 | 3 | 1 t C | i 0 | ; - | ' 2 1 | 1 0 1 1 1 | 0 ' | |
| 15 | • 1 | 4 | 1 4 | 1 4 | 1 - | ' 4 | 1 4 ' | 4 > | |
| 16 | i 1 | 3 | 1 4 | , 2 | 1 θ | 1 4 , | 4 , | ||
| 17 | 1 1 1 | 1 | 1 0 1 | 1 4 | ' - | 1 3 I | 1 4 1 1 1 | 3 1 | |
| 18 | ' I | 3 | i 4 | i 4 | 1 0 | 1 - | 1 2 i | 2 i | |
| 19 | 1 , I | 4 | 1 , 4 | ( 4 | ( 4 | 4 1 | 4 | 4 | |
| 20 | ' 1 | 0 | ' 0 | ' 4 | 1 - | • 2 | 1 4 1 1 i | 0 ' | |
| 21 | 1 I | 4a | i 4a | i 4a | i 3a | i 4a | 1 4a i | 4a j | |
| 22 | 1 t I | 4 | 1 4 1 | ’ 4 | * 4 | 1 1 | 1 4 * 1 1 | 4 ’ | |
| 23 | 1 I | 4 | ' 4 | ' 4 | ' 4 | 1 4 | 1 4 · | 4 > | |
| 24 | ι I | 4 | 1 4 | 1 4 | , 3 | , 4 | 1 4 , | 0 , | |
| 25 | 1 ( I | 4 | 1 4 1 | 1 4 | * 3 | ' 4 1 | * 4 * 1 1 | 0 1 | |
| 25 | 1 I | - | l 4 | 1 4 | • C | 2 | 1 4 1 | 4 i | |
| 27 | 1 , I | - | 1 i 3 | 1 0 | , 0 | , 3 | 4 , | 2 | |
| 31 | 1 I | 4 | 1 4 | 1 4 | 1 4 | ł 4 1 | ł 4 1 1 1 | 4 | |
| 32 | • I | 43 | i 43 | i 4a | 1 0a | 4a | i 4a i | 0 a 1 | |
| 33 | 1 | 4 | 1 4 | 4 | ; - | ( 1 | 1 1 4 1 1 | 4 | |
| 34 | * I | 3 | ' 2 | 1 3 | • - | | | 1 4 * 1 1 | 3 ' | |
| 3ó | i 1 | 4 | i 4 | 1 4 | , 3 | , 4 | i 4 , | 3 , | |
| 40 | ' I | 4 | ‘ 4 j | ' 4 | ' - | 1 _ t | 1 4 1 1 1 | 2 1 | |
| 42 | • I 1 1 | 4 | i 4 1 1 | i 3 | ( 3 | t 1 | i 0 t 1 1 1 1 | 0 i |
160 277
| 1 | ( 1 | 2 | 1 P “ | 3 | 4 | J - | 5 | T | 6 | 1 | 7 | 1 | | 6 | 1 | | s | ||
| 43 | 1 | I | 1 | 4 | 4 | 4 | 4 | 1 | - | 1 | 4 | 1 | 4 | ||||
| 46 | 1 1 | I | 1 1 | 4 | 4 | 4 | - | 1 | - | 1 | | 4 | 1 | | 4 | ||||
| 50 | 1 | 1 | 1 | 4 | 4 | 0 | 3 | 1 | - | 1 | 0 | 1 | 0 | ||||
| 53 | 1 | I | 1 | 4 | 4 | 4 | 3 | 1 1 | 4 | 1 1 | 4 | I 1 | 3 | ||||
| 55 | 1 l | I | 1 1 | 4 | 4 | 4 | - | 1 | - | I | 4 | 1 | 4 | ||||
| 57 | 1 | 1 | 1 | 4 | 4 | 4 | - | 1 | - | 1 | 4 | 1 | 2 | ||||
| 60 | 1 1 | 1 | 1 1 | 4 | 3 | 4 | 0 | 1 | | 4 | 1 l | 4 | 1 1 | 0 | ||||
| 61 | 1 | I | 1 | 3 | 3 | 4 | 3 | 1 | - | 1 | 4 | 1 | 3 | ||||
| 62 | 1 | I | 1 | 4 | 4 | 4 | 4 | 1 1 | 4 | 1 1 | 4 | 1 1 | 0 | ||||
| 63 | 1 1 | 1 | 1 1 | 3 | 4 | 4 | 3 | 1 | - | 1 | 4 | 1 | 4 | ||||
| 67 | 1 | I | 1 | 4 | 4 | 4 | 4 | 1 | 2 | 1 | 4 | 1 | 3 | ||||
| 63 | 1 1 | T | 1 | 2 | 0 | 2 | 0 | 1 1 | 2 | 1 1 | 0 | 1 1 | 0 | ||||
| 69 | 1 l | 1 | 1 1 | 4 | 4 | 4 | 4 | - | 1 | 4 | 1 | 3 | |||||
| 70 | 1 | I | 1 | 2 | 4 | 4 | 0 | 3 | 1 | 4 | 1 | 3 | |||||
| 71 | 1 1 | 1 | 1 1 | 3 | 4 | 4 | 2 | 3 | 1 | 4 | 1 ł | 4 | |||||
| 72 | 1 | I | 1 | | 4 | 3 | 4 | 2 | 3 | 1 | 4 | 1 | 4 | |||||
| 73 | i | 1 | 1 | 4 | 4 | 4 | 2 | 3 | 0 | 1 1 | 0 | ||||||
| 75 | 1 1 | 1 | 1 1 | 4 | 4 | 4 | 4 | 4 | 4 | 1 l | 3 | ||||||
| 77 | 1 | 1 | 1 | 0 | 0 | 0 | - | 1 | c | 1 | 0 | ||||||
| 31 | 1 | I | 1 | 4 | 4 | 4 | 0 | 4 | 4 | i 1 | 0 | ||||||
| 62 | 1 1 | I | 1 1 | 4 | - | 4 | 3 | 4 | 4 | 1 | 3 | ||||||
| c3 | 1 | 1 | 1 | 4 | 4 | I | 4 | 4 | 4 | 4 | 1 | 3 | |||||
| 64 | 1 1 | I | I 1 | 4 | 4 | 1 | 4 | 4 | 4 | 4 | 1 1 | 3 | |||||
| 65 | ł | I | 1 | | 4 | 4 | 4 | 4 | - | 4 | 1 | 4 | ||||||
| 66 | 1 | 1 | 1 | 3a | 3a | 1 | 3a | Oa | 4a | 4a | 1 1 | 3a | |||||
| 67 | 1 1 | I | 1 1 | 4 | 4 | 4 | 2 | 4 | 4 | 1 | 4 | ||||||
| 66 | 1 | I | t | 4 | 4 | 1 1 | 4 | - | - | 4 | 1 | 2 | |||||
| 69 | 1 | 1 | 1 | 4a | 4a | 1 | 4a | - | - | 4a | 1 I | Oa | |||||
| S0 | 1 | 1 | 4 | 4 | 1 | 4 | 1 | 4 | - | 4 | 1 | 4 | |||||
| 94 | 1 | I | 1 | 4 | 0 | ł t | 4 | 1 | 4 | -1 - | - | . u - | 4 | 1 . 1 - | 4 |
/-/ brak wyniku, /a/ 1C ppn tylko dla oprysku listowia
160 277
Tabele III /c.d./
| Zwięzek nr | 1 · ł· “ ’ Tablica nr | »i Pr | cgh | ' ćgt | 1 L | Sn | 1 Po | a J | Tc | i Vi _l - _ | 1 ca | Pv | 1 X | Pil , | ||||
| 1 | i 2 | i 3 | 4 | J 5 | 1 | 6 | ’ 7 | 1 | 8 | 9 | • 10 | 11 | 12 | |||||
| 28 | 1 f I | t f 4 | 1 | 4 | 1 1 | 1 1 | 4 | 4 | a | 4 | ||||||||
| 29 | ' I | • 4 | 4 | 1 | 4 | , 4 | 1 1 | 4 | ||||||||||
| 30 | | I | i 4 | 4 | 1 | 1 4 | 1 | 4 | 4 | 1 | 4 | ||||||||
| 35 | ' I | | 1 4a t | i Oa | 1 1 | 4a | i 3a | 1 1 | 4a | 4a | 4a | ||||||||
| 37 | ' I | ' 4 | 4 | 1 | 1 | > 4 | 4 | 4 | ||||||||||
| 38 | 1 , I | 1 1 | 4 | 1 | • 4 | 1 | 4 | 4 | 4 | |||||||||
| 39 | ' I | 1 4 | | 1 | 4 | 1 1 | i 4 | 1 1 | 4 | 4 | 4 | ||||||||
| 41 | 1 I | 1 | 1 | 4 | 1 | ' 4 | I | 4 | 4 | 4 | ||||||||
| 44 | 1 ( I | 1 1 | 1 1 | 4 | 1 I | • 4 | 1 1 | 4 | 4 | 4 | ||||||||
| 45 | • I | 1 4 | 4 | 1 | 4 | , 4 | 1 | 4 | 4 | 4 | 4 | |||||||
| 47 | | I | i 4 | 1 | 4 | 1 | 3 | 1 4 | 1 | 4 | 4 | 4 | 4 | ||||||
| 48 | ' I | 1 4 I | t | 4 | 1 | 1 1 | ' 4 | 4 | 4 | |||||||||
| 49 | l I | i 4 | 1 | 4 | 1 | 2 | 4 | 1 | 4 | 4 | 4 | 4 | ||||||
| 51 | I , I | 1 4 | 1 | 4 | 1 1 | 1 1 | 1 4 | 4 | 0 | |||||||||
| 52 | 1 I | 1 4 | 1 | | 1 4 | 1 l | 3 | 1 4 | a I | 4 | 4 | ||||||||
| 56 | i I | i 4 | 1 | 4 | 1 | 4 | ' 4 | a | 4 | 4 | 4 | 3 | ||||||
| 55 | 1 I | 1 4 1 | 1 1 | 4 | 1 1 | a a | 4 | 4 | 4 | |||||||||
| 55 | • I | 1 3 | 4 | 4 | 4 | a | 4 | 4 | 4 | 2 | ||||||||
| 64 | 1 , I | 1 1 4 | 1 1 | 4 | 1 | 1 4 | 1 | a | 4 | 0 | ||||||||
| 65 | 1 I | 1 4 1 | 1 1 | 4 | 3 | i 4 | a 1 | 3 | 1 1 | 4 | 4 | a | 4 | |||||
| 66 | ' I | l 4 | 1 | 4 | 1 | 4 | 4 | a | 4 | a | 4 | 4 | 4 | |||||
| 74 | t ( I | 1 , 3 | 1 | 3 | 1 | • 0 | 1 1 | 1 | 0 | 0 | 0 | |||||||
| 75 | 1 0 | 1 4 | 1 | | 4 | 1 | a a | 1 a | 1 4 | 4 | 1 | 4 | |||||||
| 78 | 1 I | 1 4 | 1 | 4 | 4 | ‘ 3 | a | 4 | a | 4 | 3 | a | 0 | |||||
| 79 | 1 I I | 1 4 1 | 1 | 4 | 1 1 | 4 | a < | 4 | a | 3 | 4 | 1 1 | 2 | |||||
| 80 | ' I | 1 Oa | 3a | 1 | i Oa | 1 | a | Oa | 4a | 1 | | Oa | |||||||
| 51 | 1 , I | 1 1 4a | 1 1 | 1 3a | 4a | 1 4a | 1 | 4a | 4a | 1 | ||||||||
| 92 | ' I | ' 4 l | 1 | 4 | 1 t | i 1 | 1 4 | 4 | 1 1 | 3 | ||||||||
| 1 | 93 | 1 . I | ! 4a 1 | 4ε | 1 1 1 | 1 i 1 | i 4e | 4e | 1 1 1 | 4ε | ||||||||
| 35 | 1 X | i 4 | 4 | 1 | 1 | 1 | 4 | 4 | 1 | 4 | ||||||||
| 95 | 1 ! I | 1 4 1 | 1 | 4 | ( 1 | 1 1 | t | 4 | 4 | 1 | 4 | |||||||
| 97 | ' 1 | 1 4 | 4 | 4 | t 4 | I | | 3 | t l | 4 | 4 | i 1 | 0 | ||||||
| 36 | t I | 1 4 | 1 4 | 4 | 1 3 | 1 | 1 | 4 | 4 | 1 | 3 | |||||||
| 99 | * I | ' 3a 1 | ł 1 | 2a | 1 1 | 1 1 | ' 3a | la | 1 1 | Oa | ||||||||
| 100 | i I | 43 | 4a | 1 | 1 | 1 4a | 4a | a | Ca | |||||||||
| 101 | 1 , I | 1 , 3 | 1 | 4 | a | a | , 4 | 4 | a | 0 | ||||||||
| 102 | 1 I 1 | 1 Oa 1 | Oa | a | a 1 | ' Oa | 3a | a a | Oa |
160 277
| 1 1 i | 2 | - ι 3 | Γ 1 | 4 | T a Ί “ “ ' i 5 | bela | |
| • r 1 | 6 ' | ||||||
| i “ 1 1 104 1 | I | ι ( 4 | t 1 | 4 | 1 1 | 1 1 | 1 |
| ' 105 1 | I | 1 4 | 1 | 4 | 1 | | 1 I | 1 |
| i 108 i | I | t 4 | 1 | 4 | 1 | 1 | 1 1 |
| ' 110 ΐ | I | ' 2 ι | 1 1 | 4 | 1 1 | 1 1 | 1 |
| 1 111 1 | 1 | 2 | 1 | 0 | 1 | 1 | 1 |
| ι 112 ι | I | , 2 | 1 | 3 | 1 | 1 | 1 l |
| ’ 113 ' | | | I | 1 4 I | 1 | 4 | 1 1 | 1 1 | 1 |
| ι 114 | I | I 48 | 1 | 3a | 1 | > | 1 2a e |
| ι 1 ι 115 ι | I | 1 ι 1θ | 1 1 | Oa | 1 1 | 1 1 | Oa 1 |
| 1 116 1 | 1 | 1 4 | 1 | 4 | 1 l | 1 1 | 3 i |
| ι117 ι | I | ι 4 | 1 | 4 | 1 | 1 | 3 ' 1 |
| 'ι 11θ ι | I | ι 4 t | t t | 4 | t i | 1 ł | 4 1 |
| 1 120 ' | 0 | • 3a | 1 | 1 Oa | 1 | Oa , | |
| ι 121 ι | I | I 49 | 1 | i Oa | 1 | Oa 1 1 | |
| 1 122 * ι 1 | I | ' 4 I | 1 | 1 4 1 | 1 1 | 3 i | |
| 1 123 ι | I | ι 4 | 1 | 1 4 | 1 | 1 2 | |
| ι 124 ι | I | ι 4 | 1 1 | , 4 | 1 | 4 · | |
| ' 12ε ' | 1 | 1 4 | ł | 1 4 l | 1 1 | 4 , | |
| ι 126 ι | I | 1 4 | 1 | i 4 | 1 | 4 1 1 | |
| * 127 ’ ι ι | 1 | 1 4 t | 1 1 | I 4 1 | 1 1 | 3 · | |
| ' 128 ' | I | 1 4 | 1 | 1 4 | 1 | 1 4 , | |
| ι 12S , | 1 | ł 4 | 1 | , 4 | 1 | 4 1 | | |
| 1 130 1 | I | 1 4 I | 1 1 | ' 4 ł | 1 1 | 4 « | |
| ι 131 ι | I | ι 4 | 1 | i 4 | 1 | 1 4 1 | |
| 1 1 I 132 , | I | 1 4 | 1 1 | 1 , 4 | 1 1 | 4 ' | |
| ' 133 1 | 1 | ' 4 | 1 | ' 4 | f l | 0 i | |
| ι 134 , | I | 1 4 | 1 | i 4 | 1 | 4 1 1 | |
| 1 1 135 t | 1 | ł 4a I | ł 1 | 1 i &a | 1 1 | Oa i | |
| ' 136 1 | I | * 4 | 1 | 1 4 | 1 | 4 | |
| ι 127 ι | I | , 4 | 1 | , 4 | 1 | 0 1 1 | |
| ' 135 ' : 1 | I | ' 4a ι | 1 t | 1 4a 1 | 1 1 | Ga i | |
| I 13S 1 | I | ι 4 | 1 | i 4 | 1 | 1 | |
| 1 1 I 140 ! | τ X | ι 4 I | ł I | 4 | J | 4 · | |
| ' 141 1 | I | 1 4 | 1 | | 1 4 1 | 1 1 | 4 , | |
| ι 142 ι | I | ι 4 | 1 | i 4 | 1 | 1 | |
| 1 1 143 t ι | 1 | 1 4a 1 | 1 1 | 1 3a 1 | 1 1 | 3a i | |
| • 144 ι | I | 1 | 1 | » 4 | 1 | 4 |
III /c.d./
| 9 , 10 | |||||||
| 7 | 1 6 | i 11 | 1 4 | 12 | |||
| 4 | < | 4 , | , 4 | 1 | 2 | ||
| 4 | 1 | 4 1 | 1 4 | 1 | 4 | ||
| 4 | 1 | 4 i | 1 4 | 1 1 | 4 | ||
| 1 | 1 1 | 1 0 i | 1 ( 3 | 1 | 0 | ||
| 0 | 1 | 0 1 | 1 3 | 1 1 | 0 | ||
| 2 | 1 | 2 , | , 4 | 0 | |||
| 4 | 1 I | 4 1 I | ' 4 1 | I | 3 | ||
| 2a | < la | 3a · | 1 Oa | Oa | |||
| Oa | 1 i | 1 2a , | 1 ( 4a | Oa | |||
| 3 | ' 4 | 4 ' | 1 4 | | 4 | |||
| 4 | i 3 | 4 i | 1 4 | 2 | |||
| 4 | 1 ( 4 | 1 4 ( | 1 4 | 4 | |||
| Oa | 1 Oa | 2a ’ | ' 2a | 3a | |||
| Oa | 1 | 4a i | i Oa | ||||
| 3 | 1 1 | 1 4 1 | ( 4 1 | 1 | |||
| 3 | 1 | 4 l | 1 4 | 4 | |||
| 4 | 1 1 | 1 4 , | 1 1 4 | 4 | |||
| 3 | 1 | 4 ’ | 1 4 I | 3 | |||
| 4 | 1 | 4 i | i 4 | 4 | |||
| 3 | 1 1 | 1 4 1 | 1 4 1 | 3 | |||
| 4 | 1 | 4 ' | ' 4 | 0 | |||
| 4 | 1 | 4 , | l 4 | 4 | |||
| 1 1 | 3 ' 1 | ł 4 1 | 3 | ||||
| 4 | 1 4 | 4 i | 4 | 3 | |||
| 4 | I , 4 | 1 4 , | t 1 4 | 3 | |||
| 3 | * 0 | 4 ' | 1 4 l | 0 | |||
| 4 | l 4 | 4 i | i 4 | 4 | |||
| 4a | 1 1 | I 4a ( | 1 i 4a | Oa | |||
| 4 | I | 4 1 | 1 4 | 4 | |||
| 4 | 1 | 4 i | 1 4 | 4 | |||
| 4a | 1 3a 1 | 1 | 1 4a 1 | 4a r | 2a | ||
| 1 | 4 ' | ' 4 | 4 | ||||
| 4 | 1 4 | > 4 t | , 4 | 3 | |||
| 3 | ' 4 | 1 | 4 1 I | 1 4 | 4 | ||
| 3 | i 2 | 4 1 | 1 4 | 4 | |||
| 4a | 1 Oa 1 | 1 4a 1 | i 3a | Oa | |||
| 4 | ' 4 | 4 1 | ' 4 | 1 | 4 |
160 277
Tabela III /c.d./
| ' 1 | T 1 | 2 | r - 1 | 3 | 1 | 4 i | 5 | ' 6 | r | 7 | · V 1 | c | r | 12 | |||||||
| 1C 1 | 11 | ||||||||||||||||||||
| 1 | Γ | 1 | - 1 | «_ | i | • - 1 | | | a | 1 | ||||||||||||
| 145 | 1 | I | 1 | 4 | 1 | 1 | 4 | 1 | a | 4 | a | 4 ' | 4 | a | a | 4 | 1 | 4 | |||
| 146 | 1 1 | I | 1 1 | 4 | 1 1 | 1 1 | 4 | 1 | a | 4 | I | 4 , | 4 | 1 | | a a | 4 | a a | 4 | |||
| 147 | 1 | I | 1 | 4 | 1 | 1 | 4 | 1 | 4 | a | 4 | a | 4 ' | 4 | a | a | 4 | a | 2 | ||
| 146 | 1 | I | ł | 4 | 1 | 1 | 4 | 1 1 | 4 | a a | 4 | a a | 4 1 | 4 | a a | a a | 4 | a 1 | 3 | ||
| 149 | 1 l | I | 1 1 | 4β | 1 1 | 1 i | 4e | 1 | Oa | a | 4β | a | 4a | a | 1 | 4e | a | ||||
| 150 | 1 | I | 1 | 4 | 1 | I | 0 | 1 1 | 4 | 1 a | 2 | a a | 4 | 1 | a | 1 | a | 0 | |||
| 151 | 1 1 | I | 1 I | 4 | 1 1 | 1 | 0 | a | 4 | a | 4 | 1 a | 4 | a a | a a | 4 | a a | 3 | |||
| 152 | 1 | I | 1 | 4 | 1 | 1 | | 4 | 1 | 4 | a | 4 | a | a | 1 | 4 | a | 3 | ||||
| 153 | 1 | I | 1 | 4 | 1 | 1 | 4 | 1 1 | 0 | 1 a | 4 | a a | 2 < | 4 | a a | a a | 4 | a a | 0 | ||
| 154 | 1 | I | 1 1 | 3e | 1 1 | 1 1 | Oa | 1 | Oa | a | la | a | 2a , | 4a | a | a | Oa | a | | 2e | ||
| 155 | 1 | 1 | 1 | 1 | 1 | 4 | 1 1 | 4 | a | 4 | a | 4 ' | 4 | ł | a | 4 | 1 | 4 | |||
| 156 | I | 1 | 4 | 1 | 1 | 4 | 1 l | - | a a | 4 | 1 a | 0 i | 4 | a 1 | a a | 4 | a 1 | 2 | |||
| 158 | I | 1 | | 0 | 1 1 | 1 1 | Oa | a | la | 1 | Oa | a | Oa ' | 4a | 1 | a | 2e | a | Oa | |||
| 159 | I | 1 | Oa | t | 1 | Oa | 1 | Oa | a 1 | Oa | a a | Oe 1 | 4a | 1 a | 1 | 2e | a | Oa | |||
| 160 | I | 1 1 | 2 | I 1 | 1 | 4 | 1 | 1 | 4 | a | 0 i | 3 | 1 a | 1 a | 4 | a a | 2 | ||||
| 161 | I | 1 | 4 | 1 | 1 | | 4 | 4 | 1 | 4 | a | 4 ' | 4 | a | • | 4 | a | 4 | ||||
| 162 | I | 1 | 4 | 1 | 1 | 4 | 4 | a a | 4 | a 1 | 0 i | 4 | a a | a a | 4 | 1 a | 4 | ||||
| 163 | I | 1 1 | 4 | 1 1 | 1 1 | 4 | 4 | a | 4 | a | 4 , | 4 | 1 1 | a | | 4 | a a | 4 | ||||
| 164 | I | 1 | Oa | 1 | 1 | Oa | Oa | a | Oa | 1 | Oa 1 | 4a | 1 | 1 | Oe | a | Oa | ||||
| 168 | I | 1 | 3e | 1 | 1 | Oa | 3a | 1 a | 2a | a a | 3a | a 1 | 1 1 | Oa | 1 I | Oa | |||||
| 189 | I | 1 1 | 4 | 1 1 | 1 1 | 4 | 4 | a | a | 4 | a | 1 | Oe | a | Oa | ||||||
| 190 | I | 1 | 4 | 1 | 4 | 4 | a a | a | 4 | a | a | 4 | 1 | 4 | |||||||
| 191 | I | 1 1 | 1 1 | 4 | 4 | a | 4 | a | 4 , | 2 | a | 1 | 4 | a | 4 | ||||||
| 192 | I | 1 | 4 | 1 | 4 | 4 | 1 a | 3 | a | 4 ' | 4 | a | I | 4 | a | 2 | |||||
| 193 | I | 1 1 | 4 | 1 | 1 | 0 | 0 | a | | 1 | | 1 | 1 1 | 1 1 | 2 | a 1 | 0 | ||||||
| 194 | I | 1 1 | 4 | 1 1 | 4 | Ł | 4 | a | 4 | I L | 4 ' | 4 | 1 1 | 1 1 | 4 | a a | 4 |
a « tylko dla oprysku listowia
Pr Puccinia recondita
Egh Erysiphe graminis hordei
Egt Erysiphe graminis tritici
Sn Septorna nodorum
Po Pyrmleria oryzae
Tc Thanetophorus cucumeris
Vi V^r^turia lnaegcalis
Ca Cercospora arachidicola
Pv Plasmopara νιιιωοΐβ
Pil Phytopnthora infestans lyccpersici
160 277
Przykłed VIII.' Właściwości owadobójcze związków o wzorze 1 badano następująco i
Aktywność związku określono, stosując różne owady, roztocze i nicienia. Za wyjątkiem przypadku badania działania przeciw Musca domeesica, co Jest opisane poniżej, związki stosuje sią w postaci ciekłych preparatów zawierających 12,5 - 1000 cząści na milion /ppm/ wagowo związku. Preparaty wytworzono przez rozpuszczenie związku w acetonie i rozcieńczenie roztworów zwilżającego sprzedawanego pod nazwą SYNPERONIC NX, aż do uzyskania wymaganego stążenia produktu. SYNPERONIC* jeet zarejttrownnym znakiem towarowym.
Procedura testu, dostosowana do każdego rodzaju szkodnika była zasedniczo taka sama 1 obejmowała nanoszenie szeregu szkodników nw podłoże, którym zazwyczaj była roślina żywicielskw lub karma -którą żywi sią szkodnik 1 traktowanie szkodników i/lub środowiska preparatami. Następnie określano śmiertelność szkodników w okresach zazwyczaj od Jednego do siedmiu dni po traktowaniu.
badań zestawiono w tablicy IV dla każdego związku w pierwszej kolumnie, w podanym w drugiej kolumnie stążeniu w cząściach na milion. Stopień śmiertelności oznaczano Jako 9,5 lub O, gdzie 9 oznacza 80-10(% śmiertelności /70-100%/ redukcji mmtwlka korzeniowego w porównaniu z rośl^ami nietwakrowβnymi w teście in vitro dla Melrldogyne incoj^nni^^, 5 oznacza 50-7!% śmiertelności 50-6!% reduk^! mmtwika krtzenrooego w teście in vitro dla MelridogJne incognita w O oznacza mnej niż 50% śmiertelności.
W tabeli IV zastosowany organizm szkodnika oznaczono kodem l^e^wym. Znaczenia tego kodu, środowisko podłoża lub pokarm oraz rodzaj i czas trwanie testu podano w tabeli V.
Właściwości działania przeciw Musca dornaetica określano nastąpująco.
Próbką związku rozcieńczono w 0,1% mieszaninie etanol/aceton 50:50 i doprowadzono do roztworu 1000 ppm za pomocą 0,1% wodnego roztworu Synperonic NX. Nastąpnie 1 ml roztworu opryskiwano bezpośrednio 10 much mieszanej płci trzymanych w kubiku, zawierającym kawałek cukru, który również został opryskany. Natychmiast po oprysku kubki odwrócono i pozostawiono do wyJtCnięcJa. Oszacowania działania dokonano gdy kubiki ponownie odwrócono w 15 minut póżnnej. Muchy zaopatrzono w wilgotny tampon z waty i przJtrJymJmwno przez 48 godzin w klimaJyrow8nym pomieszczeniu o tempθJatutze 25°0 i wilgotności rnzglądnej 65% przed oceną śmiertelnrści.
Tabela IV
| k - - | ||||||||||||||||||||||||||
| i Zmią | - Stążenie | 1 TU | 1 | TU | 'tu | 1 | MP | 1 | NC | ' NC | 1 | MD | 1 | MD | 1 BG | 1 | 5G | 1 | HV | 'hv , | SP | 1 | SP, | OB | 1 MI | |
| zek | J /PPM/ | AC | 1 | EO | NG | 1 | MC | 1 | NC | ' NG | 1 | AK | 1 | AC | ' NK | 1 | NC | 1 | LR | 'lg i | LR | 1 | LG i | LR | 1 oc | |
| L _n£ i 1 | r - 2 - | 3 | T | 4 | *5 | 1 | 6 | r | 7 | 1 8 | 1 1 | 9 | 1 1 | 10 | 1 11 | 1 1 | 12 | 1 I | 13 | ΤιΣ? | 15 | l T | - J 16j | 17 | r18 | |
| r · - - “ | T | • 1 | T | Ί | Γ “ | T | r - - | T | Γ ~ | |||||||||||||||||
| i 1000 | 9 | 1 | 0 | IC | 1 | 0 | 0 | I 0 | 9 | 1 | 9 | 1 0 | 1 | 0 | 0 | i 0 ' | 5 | 5 ' | 0 | 1 | ||||||
| , 7 | ' 25 | 1 | 1 | 1 | 1 | 1 | 1 | 1 | 1 1 | 1 0 | ||||||||||||||||
| 1- - · - - | 4 | - 1 - « | O 1 | X | -1 - - | |||||||||||||||||||||
| 1 1000 | 0 | 1 | 0 | '0 | 0 | 5 | 1 9 | 0 | 1 | 0 | ' 0 | 1 | 0 | 0 | ' 0 1 | 0 | 0 1 | 0 | 1 | |||||||
| i 6 | ' 25 | 1 | t | 1 | 1 | 1 | 1 | 1 1 | 1 | ' 0 | ||||||||||||||||
| Γ “ “ | i | . 1 - | i | .1 _ - | .1 | 1 | l_ | J | X - - | X | Ł - | |||||||||||||||
| 1 1000 | 9 | 1 | 0 | '0 | 0 | 0 | ' 0 | 0 | 1 | C | ' 0 | 1 | c | 0 | 1 0 1 | 0 | 0 , | 9 | f | |||||||
| i 10 | 1 25 | 1 | 1 | 1 | 1 | 1 | 1 | 1 1 | 1 | ' 0 | ||||||||||||||||
| t- · « - - | J | . 1 - - | 1 | J - . | .1 | u - | J | X - - | X | X - | ||||||||||||||||
| ' 500 | 0 | 0 | 'c | 0 | 0 | ' 0 | C | f | 0 | - | 5 | 0 | ' o , | 0 | o , | 0 ' | 1 | |||||||||
| ' 11 | i 25 | 1 | 1 | . 0 | ||||||||||||||||||||||
| Γ | * l“ | - Ί | ||||||||||||||||||||||||
| ' 1000 | 0 | 0 | *0 | 0 | 0 | 1 9 | 1 | 0 | i | 0 | ' 0 | 0 | i | 0 | ' 0 i | - | - , | 9 | 1 | |||||||
| i 12 | ' 25 | 1 | 1 | 1 | 1 1 | 1 | 1 | ' 0 | ||||||||||||||||||
| Γ “ - | i | • - . | X | • - - | 1 . | 1- _ | J | 1 | X - . i | X | 1 | X . | ||||||||||||||
| 1 1000 | 5 | 0 | 'o | 0 | 1 | 0 | 1 0 | t | 0 | 1 | 0 | 1 0 | 0 | 1 | 0 | ' 0 1 | - | 1 | 0 | 1 | ||||||
| ' 13 | 25 | I | f | f | 1 | ( 0 | ||||||||||||||||||||
| U - . | 1. | i - 1. | - X |
160 277
Tabele IV /c.d./
| 1 | 1 | 2 | 1 | 3 | l | 4 | , 5 | l | 6 l | 7 , | 6 | 1 | 9 | 10 | 1 | 11, | 12; | 13 | • 14 | 9 | 1^ 16, | 17 | 9 | |||
| 1 1 | 1000 | 1 1 | 0 | l l | 0 | l , 0 | l l | l S , | 9 , | - | 1 1 | 9 | 9 | l 9 | 0 | 9 9 | 9 0 , | 0 | 9 ( 9 | 9 ł | 0 | 1 l 9 0 9 | 5 | 9 9 | ||
| 15 | 1 | 25 | 1 | l | l | l | l | l | 9 | l | 9 | l | 9 9 | 9 | ||||||||||||
| - - - | ł | - - - | - | 4 | - - | 4 | • 4 | - -l | - - | - | -l - | - | - | U | - 4 | - - | U | - | U - 4 | • · | 4 | |||||
| 1 | 1000 | 1 | 9 | l | 0 | 1 5 | l | 0 1 | 0 1 | 0 | l | 0 | 0 | 9 | 0 | 9 | 0 1 | 0 | • 0 | 1 | 0 | 1 0 1 | 0 | 9 9 | ||
| 17 | 1 1 | 25 | 1 1 | l 1 | l 1 | l | 1 | 1 | l | 9 | 9 | l | 9 | 9 9 | 9 | |||||||||||
| 19 | 1 | 500 | 1 1 | - | l | | - | l t | l l | l 0 f | 5 J | 9 | l t | 0 | l | 0 | 9 l | 0 | 9 t | 1 0 | | 0 | 1 0 | 9 t | 0 | 9 9 e 0 i | 0 | 9 l |
| 1 | 1 | l | l | l | T | Γ | Γ | Γ | - · | 9 * | l | |||||||||||||||
| 1 | 1000 | 1 | 0 | l | 0 | l 0 | l | 0 i | 9 i | • | l | 0 | 0 | l | 0 | 9 | 0 9 | 0 | i 0 | 9 | 0 | 9 0 9 | 0 | l | ||
| 20 | 1 | 25 | 1 | l | l | l | l | 1 | l | 9 | 9 | 9 | l | 9 9 | l | |||||||||||
| l_ | u | - | J | - - | .1 | . J | - -1 | - - | L | - | -i - | - | u | - | U | _ J | - - | u | - | U - J | “ · | X | ||||
| 22 | 1 | 500 | 1 | l | l | l | 0 ' | 0 ' | 0 | l | 0 | 5 | l | 0 | 9 | 0 ' | 0 | 1 0 | 1 | 0 | 1 0 1 | 0 | 9 | |||
| J | L | 1 | L | L | _l | 9 _ | l | _ J | 1 | |||||||||||||||||
| 1 | 500 | 1 | | 0 | l f | 0 | 1 0 l | l l | 5 ’ l | 0 ' | 9 | l l | 9 | l | 9 | l l | 0 | 9 9 | 0 ' 9 | 0 | 1 0 9 | 9 | 0 | 4 0 1 9 9 | 5 | 1 9 | |
| 23 | u | _12.5 | L | 4 | J | - 4 | _ «9 | • » | L | • | _l · | - | u | • | L | . 4 | - - | L | - | u - 4 | - - | 4 | ||||
| 1 | 500 | 1 | 5 | l | 0 | • 0 | l | 5 · | 0 · | 0 | 1 | 9 | 9 | 9 | 0 | 9 | 0 ' | 0 | ' 0 | 1 | 0 | ' 0 ‘ | 5 | 9 | ||
| 24 | 1 | 12,5 | 1 | l J | I i. - | l J | l - J | l L | l | 1 L | l L | 1 | l 9 | l 9 | 9 9 1 _ J | 9 9 | ||||||||||
| 1 | 500 | 1 | 0 | l | c | ' 0 | l | o 1 | 5 | 9 | 1 | 5 | 9 | l 9 | 0 | l 9 | 0 ' | 0 | 1 0 | J 1 | 0 | 9 0 1 | 9 | 9 1 | ||
| 31 | 1 | 12,5 | 1 | l | 1 | l | l | t | l | 9 | l | 9 | 9 | 9 9 | 9 | |||||||||||
| - - - | Γ | - - - | Γ | - | “> | “ - | Ί | “ Ί | “ “| | • - | Γ | • | • | Γ | • | Γ | - Ί | • · | r “ | Γ | Γ “ Π | 1 | ||||
| 34 | 1 | 500 | 1 | - | l | - | | - | l | 0 l | 0 | 0 | l | 0 | 0 | l | 0 | l | 0 I | 9 | 1 - | 1 | 0 | 1 0 1 | 0 | 9 | |
| _ _ _ | r | _ _ - | Γ | - | -» | - - | Ί | i | - *9 | - - | r | - | •| · | - | Γ | • | r | - ~l | - · | r · | r | - | r - ί | • · | T | |
| 1 | 500 | 1 | - | l | - | | - | 9 | 0 i | 0 1 | 0 | 1 | 0 | l | 5 | l | 0 | l | 0 1 | 0 | i 5 | 9 | - | 1 - 9 | 0 | 9 | |
| 36 | 1 | 12,5 | 1 | l | l | l | t | 1 | l | 9 | l | 1 | l | 9 9 | l | |||||||||||
| - - - | u | - - - | w | - | 4 | - - | l* - | 4 | - 4 | - -· | - “ | V | - | - | K | - | V | - 4 | - · | 9- - | u | - | U - 4 | • · | 4 | |
| 1 | 500 | 1 | l | - | 1 | l | 9 · | 5 ' | 5 | l | 0 | 0 | l | 0 | 9 | 0 ' | 0 | 1 0 | 1 | - | 5 | 9 | ||||
| 42 | 1 | 12,5 | 1 | l j | I u - | l J | l _ J | l L | 1 | I L | 9 L | 9 9 | 1 1 | 9 9 | 1 ι 9 _ J | 1 1 | ||||||||||
| ( | 500 | l | - | l | - | l | l 0 ( | 0 , | 0 | l | 5 | l | 9 | t | 0 | 9 | 0 e | 0 | ( 0 | 9 | - | 0 | 9 | |||
| 53 | 1 | |||||||||||||||||||||||||
| 12,5 | 1 | 1 | 1 | 1 | 1 | l | l | 9 | 9 | 9 | 1 | 1 | l 9 | 1 | ||||||||||||
| 61 | 1 1 | 500 | 1 t | - | l ł | - | l t | i l | l l | S ' | - | l l | 0 | 9 | 0 | 9 1 | 0 | 9 9 | 0 ' 9 | 0 | 1 0 1 | 1 l | 0 | ' 0 9 9 1 | 0 | 1 l |
| 63 | 1 1 | 500 | 1 1 | l ł | 1 l * | l 9 | l 0 l | 0 i | 0 | l l | 0 | l | 0 | l 9 | 0 | 9 1 | 9 0 9 | 0 | 1 , 9 | l i | 0 | 9 1 1 0 9 | s | ł l | ||
| Γ | Γ | n | n “ - | - r | ||||||||||||||||||||||
| 1 | 500 | 1 | 0 | l | 0 | 1 0 | l | 0 i | 5 i | 0 | l | 0 | 9 | 0 | l | 0 | l | 0 9 | 0 | 1 0 | i | 0 | 1 0 9 | 0 | 9 | |
| 67 | 1 | l | l | l | l | l | 1 | l | 9 | 1 | 1 | 1 | 1 1 | l | ||||||||||||
| 1 | 12,5 | ł | 1 | 1 | l | l | l | l | 1 | l | 1 | 1 | l 1 | 1 | ||||||||||||
| 1 | 500 | l | • | l | - | ł | l | l 0 ( | 5; | 1 l | 0 | 1 9 | 0 | l 1 | 0 | l 9 | 9 0 f | 9 | 1 9 * | l 9 | - | i 1 9 * 9 | 0 | 1 9 | ||
| 66 | 1 | 12,5 | l | l | 1 | I | l | I | 9 | 1 | l | l | 1 | 1 | l 9 | l | ||||||||||
| r | Γ | •| | 1 | Γ | * 1 | r | • “I | |||||||||||||||||||
| 71 | 1 1 | 500 | l 1 | - | l 1 | - | 1 | 5 1 1 | 0 ' | 9 | l l | 0 | l l | 0 | 1 1 | 0 | l 1 | 0 1 l | C | 1 0 1 | 1 1 | 0 | 1 0 1 1 1 | s | 1 1 | |
| 72 | ł 1 | 500 | l 1 | - | ł l | - | » I | l | 1 0 1 | 01 | 5 | 1 l | 0 | l l | 0 | ( l | c | 9 l | o 1 1 | C | * S i | 1 l | 0 | t 1 0 1 1 | 0 | l ł |
| 73 | 1 1 | 500 | l l | - | l l | - | 1 | l ł | 1 9 , | 9 , | - | 1 1 | 0 | 1 1 | 0 | 1 i | c | 9 9 | l 0 | | 0 | ł i 5 | 1 i | c | 1 1 i £ 1 | c | 1 1 |
| 1 | 500 | l | l | - | l | 1 5 , | 0 , | 0 | 1 l | 9 | l ł | 0 | 1 1 | 0 | 1 1 | l 0 | | 0 | , 0 | 1 1 | - | 0 | 1 | ||||
| 74 | ||||||||||||||||||||||||||
| 1 | 12,5 | 1 | l | 1 | l | 1 | ||||||||||||||||||||
| Γ | Γ | l | 1 | 1 | ||||||||||||||||||||||
| 1 | 500 | l | - | l | 1 . | 0 1 | C ' | 0 | 1 | 9 | l | 9 | 1 | 0 | 9 | 5 1 | 0 | ' 9 | 1 | - | l - t | 9 | 9 | |||
| 62 | I | 1 | l | ł | l | l | l | 9 | l | 9 | 9 l | l | ||||||||||||||
| 12,5 | ||||||||||||||||||||||||||
| J | 1 | 1 |
O
O
O
O o
o o
o o
o o
o
160 277
I
I
I
I
I
I
I ł
I,
Tabela IV /c.d./
| r | r - τ | - Ί | Γ * | r - | 1 | - - r | |||||||||||||||||||
| 1 | 2 | 3 | i 4 1 | 5 | 1 θ | 1 7 , | 8 1 | 9 | 10 | 11 | 12 | i 13 | 14 | l 15 | | | 16 , | 17 , | 18 | 1 | ||||||
| 5 | |||||||||||||||||||||||||
| 1 | 50C | - | - | - | ' 0 | ' 0 1 | 0 ' | 0 | 5 | 0 | 0 | ' 0 | 0 | 1 | 1 | 5 ' | 1 | ||||||||
| L | Θ3 | • | 12.5 | 1 | 1 1 1 1 | 1 | | 1 1 1 | | 1 l | 1 | 1 | | 1 | | 0 | 1 | ||||||||||||
| Ί | |||||||||||||||||||||||||
| 1 | 500 | 1 | - | - | 1 0 | ' 0 ' | o 1 | 9 | 1 | 0 | 0 | 0 | ' 0 | 1 | 0 | 1 | 1 | 0 1 | 1 | ||||||
| 64 | 1 | 12,5 | 1 | 1 1 1 I | 1 | 1 1 | 1 | 1 | | 1 | 1 | 1 | 1 | 0 | 1 | |||||||||||
| “1 | T | ||||||||||||||||||||||||
| 1 | 500 | 1 | - | 1 t | - | ' 0 | ' 0 ' | 0 1 | 5 | 1 | 0 | 0 | 0 | 1 0 | 1 | 0 | 1 | t | 5 ' | 1 | |||||
| 85 | 1 1 | 1 | | 1 | 1 | 1 | 1 | 1 | 1 | |||||||||||||||||
| 12.5 | 1 1 | 1 | 1 1 | ł | 1 | 1 | l | 1 | 0 | ||||||||||||||||
| 4 |
Tabele V
| ś rodooisko podłoża/pokarm | Rodzaj testu 1 | 1 1 t rioania 1 /dni 1 | ||
| Kod litrrowy /Tabela U/ | , Badane gatunki 1 1 | |||
| 1 | l 2 | 3 | 4 | _ 5 . |
| TU AC | 1 Tetranychus urticae | 1 | 1 1 | |
| 1 ------------ /pająkroare roztocze- | liść fasoli | ) kontakt | • 3 ' | |
| dorosły/ | 1 | 1 I | ||
| TU EO | 1 Tetranychus urticae | 1 | 1 1 | |
| /pajękooate roztocze- | lxść fasoli | 1 kontakt | ||
| ' jajo/ | 1 | < i | ||
| TU NG | * Tetranychus urticae | ł | 1 I | |
| i /pajękooate roztocze- | liść fasoli | 1 kontakt | 1 1 6 ( | |
| nimfa/ | /ozrost/ .1. | _ 1 _ _< | ||
| MP MC | 1 , Mzus persicae | I I | 1 I 1 1 | |
| /mszyca/ | liść kapusty | 1 kontakt | 1 3 1 | |
| u-----.-.--- | chińskie; | 1 | 1 1 | |
| NC NC | 1 1 NepPhtettix cincticeps | 1 1 | 1 1 | |
| I — — — — — — — — - i /skoczkooate-nimfa/ | rozsada ryżu | kontakt 1 | 1 1 2 1 1 | |
| NC TG | i Nephooetix cincticeps | 1 1 | 1 1 1 1 | |
| , /skoczkooate - nimfa/ | rozsada ryżu | Kontakt | ' 6 ' | |
| 1 /oil^t^^^,/ | ||||
| KO AK | Musca oorestics | 1 | 1 1 | |
| 1 .. . . - mucha domooa--ccosła | naczynie pląs- | 1 kontakt | 1 15 min 1 | |
| tikooe | 1 | 1 1 | ||
| KO AC | i Musca domen ica | 1 | l I | |
| 1 nucha doraooa-dotosła | naczynie | i kontakt | i 3 1 | |
| ł | piast toowe | t | 1 1 | |
| 3G -« | i Ba tel la cermaica | 1 1 | 1 1 1 1 | |
| 1 rimfa karaima | raczyrie | i kontakt | i 15 nin i | |
| I | siać tikc -z | 1 | 1 1 | |
| bg :.c | ' Blattella ce — a n ica | 1 1 | 1 t | |
| n i- fa karalucha | naczynie | 1 | 1 t | |
| 1 | pias t koMe | l kontakt | i 2 1 | |
| KV LR | 1 Mnotl·^ uirescens | 1 | 1 > | |
| 1 ---.... | płate< | 1 | 1 1 | |
| i larwa motyla | baoGłny | pozostały | 1 2 1 |
160 277
Tabela V /c.d./
| 1 riV | LG | 1 - r 1 | 2 neliothis vireacens | • 1- I I | 3 ' | 4 | I . J - I l | 5 I | ||
| 1 1 I | larwa | I I I | płatek bawełny i | pozos tały /wzrost/ | I I Ί - | 5 | ||||
| SP | LR | 1 I I l | Spodootera exiqua - łarwa/ | I I I I | płatek bawełny | pozostały | I I I 1 - | 2 | ||
| SP | LG | I I I I | Spodoptera exigua - larwa | I I I I | płatek bawełny | pozostały /wzrost/ | I I I I | 5 | . - U | |
| OB | LR | I I I I T | Oiabrotica balteata - larwa/ | I I ł I “ r · | bibuła filtracyjne /nasiona 1 kukurydzy/ · | pozostały | I I | 2 | ||
| MI | OC | I I I I | Mι6ltldtgyne incognita /mątwik korzeniowy - larwa/ | I I I I | in vitro | kontak t | I I I I | I | • « u |
Test kontakt* ozn^i^^a, ze traktowane były zarówno szkodniki jak i środowisko, a oozostały oznacza, ze środowisko było trasowane przed zakażeniem szKodnikami.
WZÓR 7
160 277
WZÓR 6
160 277
OCH3
WZÓR 1
OCH
WZÓR 3
Zakład Wydawnictw UP RP. Nakład 90 egz. Cena 10 000 zł
Claims (3)
1? o 2 ze jeden z po^35tαool^óo R1 i R oznacza grupę CJ_2lllolsklooą, chlorooco/Ci_4/alklbową, feny lo/C_ ./ak kantową, ^korowco/C, ./akkoksklooę, hetsrocy^ilo/C, ./alltioOT^ę inoę niz 2”4 3 4 3 3 1—4 3 heteroarylo/Ci 4/aH^lowi=, -nr R , -S/O^R ionę niż -SOgR albo -PO/OR /2, każda z wytnieο^ο·^ wyżej grup fenylowych albo hetirockliioowych lub hitirolrklowkch, óędąckco 5- lub 6-cztooowkil pierścieniami, zawierającymi l, 2 lub 3 atomy tleou, azotu lub siarki, ewentualnie sprzężonymi z piersclenem benzenowym może być eweetualnie podstawiona chlorowcem, grupę Ci_4llllOooą , Ci_4lllolsklowę, Cj^alkilotio , chlorowcu/C1_4/alkloowę, chloΓowco/Ci_4/
160 277
-alkoksylową, Cg-galkenylckeylową, C2_talkmyloksylową, heteroaryloksylową, fenylową, foncksylową, nitrową, cyjanową, N-oksy, fenylo/C, ./alkloową, fenylo/C ./oHoksylową, •a > *> o s o o •J4’ 1*“**
-NRJR , -COjR » -CONR R lub -SOgR , gdzie R i R mają wyżej podane znaczenie, a grupy fenylowe są ewaetuulnle podstawione chlooawcem lub grupą cyjanową oraz jego ttereonomery, w połączeniu z grzybobójczo, owadobójczo lub roztoczobójczo dopuszczalnym nośnikiem lub rozcieńczalnikiem.
ą. Srcdek grzybobójczy, owadobójczy lub roztoczobójczy, znamienny tym, że Jako substancję czynną zawiera związek o wzorze 1, w którym R IR mogą byc takie sama lub różne 1 oznaczają wodór, chlorowiec, grupę Ci_galkilowę, C__ggckloolkilową,
C^galkoksylową, chlorlwco/C^_4/alkilową, fenylową, fonoksylową, fenylo/Cj^/akki'ową, fenylo/C, ./alkenylową, chlorowco/C, ./akkoksylową, fenylo/C, ./Hkoksylową, hetorocykklIo/C1_./lakkilową, hβtorolrylloę, cyjanową, -NR R , -COgR ,-COR , -S/O^R . -PO/OR /2, gdzie
R3 i R4 mogą byc takie samo lub różne i oznaczają wodór, grupę C,,.alkilową lub fenylową, 12 i n Jest równe 0, 1 lub 2, albo R IR razem tworzą pierścień Cg^gkarbocykliczny lub heterocykliczny, ioeituulnie zawierający sprzężony pierścień benzenowy, przy czym pierścień heterocykliczny zawiera 1 lub 2 atomy tlenu lub azotu, każda z wymienionych wyżej grup fenylowych albo heterocyklicznych lub heteroarylcwych, będących 5- lub 6-czlnnooymi pierścieniami, zawierającymi 1, 2 lub 3 atomy tlenu, azotu lub sierki, iweetuulnίe sprzężonymi z piorścoenoem benzenowym, może być o/wenuslnie podstawiona chl^on^wcem, grupą Ci_4likllooę, C,_4aiklksylową, lk i lot 10, yhilrowyo/Ci_4/alkllooą, ehloroocolC133/elkoksylooę, Cg_g aikenyloksylooę, C-^alk inyloksyJ^ową, cykllalkoksylooą , Ci_4oiklksy-/C, _4/akkoksy/C1_4/ alkoksylową, cyJonoalkoksylową, heteroaryloksylową, fenylową, fonoksylową, nitową, cy,jlnlwę, N-oksy, fenylo/C. ./siklawą, fenylo/C. ,/elkoksylow^ -NR R4, -CO^R, -conrJR4, a 2 A fU
-CCNR~R lub -6/0/nR . gdzio R , R i n mmją wyżej podano znaczenie a grupy fenylowe są owen^e^ie podstawiono chlu-owcem lub grupą cyjanową pod warunkiem, żo Jeden z podstawników R i R* oznacza grupę fonylo/Cj_4/akloksylową albo jeden z podstawników R i R zawiera część fenylową, hetorocyklllowę lub hetoroarylowę podstawioną grupą cykloalkoksylową,
1 2 jako substancję czynnę zawiera związek o wzorze 1, w którym R i R mogą być takie same lub różne i ozoaczaję chlorowiec, grupę C1_6alHoowę, C3_gCykloβlkilowę, fenylową, fenoksylowę, fenylo/Cł_4/alkiOooę, hetaroarylo-ZCj^/elkioowę, hβteroerylooę, cyjanową,
-C0_R3, -C0R3, -SO,r3, gdzie R3 oznacza wodó^ grupę C _allit.ową luls fenylow.ę, pod warun2 2 12 kiem, że Jeden z podstawników R i R oznacza grupę heteroarylowę/C.,/βkklOową lub Jeden 1 2 i—— z podstawników R i R oznacza grupę fenylowę, fenolsylooą, fenklo/C,_4/alkiOową, heteroarylo/Cj 4/αlklOową albo hθteroerkOową,o której części fenylowa i heteroaryoowa sę sprzężone z pierścienemai benzenowym, każda z ^^t^m^i^^ooych wyżej grup fenylowych albo heteroerylowych, będęcych 5- lub 6-cztooowkmi pierścieniami, zawierającymi 1, 2 lub 3 atomy tlenu, azotu lub siarki może być eweetuβlnle podstawiona chlorowcem, grupę C1_4alkioowę, Cl_4αlkoksylooą, Cj^aHilotio , chlorowco/C1o4/alkitową , chloΓOwco/Cl_4/elkoksytooą .C^galkenyloksylowę ,
C_ 4alkinyloksylową, hθteroarklolsylową, fenylowę, fenolsylooę, nitrowę, cyjanową, N-oksy, fenylo/C- _4/elkloooą, fenylo/Cj^/dkoksylow^-nr r , -c°2r , -c°Nr r lub -so2r , gdzie R i
4 3
R mogę byc tekie same lub różne i mm ję znaczenie w^żej podane dla R , a grupy fenylowe są eweeouuloie podstawione chlooowcem lub grupę cyjanowę oraz jego stereoizomery, w połęczeniu z grzybobójczo, ondobóóczo lub rozroczobójczo dopuszczalnym nocnikiem lub rozcieńczaloikeem.
3. środek grzybobóóczy, o^^t^t^t^o óczy lub roztoczobóóczy, znamienny tym, że jako substancję czynnę zawiera zwęzek o wzorze 1, w którym R i rz mogę być takie same lub rozns i oznaczaję wodór, chlorow-ec, grupę C ^gaUilow^, Cgggc^oolkllową, C^_gllkoksklooę, cblorooco/Ci_4/al^clbowę , fiOklooą, feoolsklooą, fenylo/C 1.4/^ ioowę, finylo/C2_4/alkenklową, chlorowco/C. 4/llkolsklooę, he t θγοουΧι lo/^ 4/llkltową, hetiroerklooę, cyjanowę, λ Q Q O Ω A — 2 Ą
-NR3R, -C0jR, -COR3 -8/0/^3 -PO/OR3/2, dzie R i R mogę byc talde same lub rózne 1 ozoaczaję wodóó, grupę C „llklOowę lub fenylowę, a o jest równe °, 1 lub 2. pod warunkiem,
1. środek grzybobójczy, owadobójczy lub roztoczobójczy, znamienny tym, ze Jako substancję czynnę zawiera zwięzek o ^^(orze 1, w którym R i R mocgę byc takie same lub różne i ozoaczaję wodór, chlorowiec, grupę Cj^gglkilowę, g-cykloalkioowę, feoylowę, fenołcsylowę, fenylo/C, ./αlklt.owę, heteroarylową, cyjanową, -CO„R3, -C0r3,
3 3 £
-SOjR , gdzie R oznacza grupę C^gaakioowę lub fenylowę, albo R i R razem tworzę pierścień Cg^gkarbocykliczny lub heterocykliczny, ewentua!nie zawierajęcy sprzężony pierścień benzenowy, przy czym pierścień heterocykliczny zawiera 1 lub 2 atomy tlenu lub azotu, każda z wymienionych wyżej grup fenylowych albo heteroerylowych, będęcych 5- lub
6-czoonowymi pierścieniami, zawierającymi 1, 2 lub 3 atomy tlenu, azotu lub eiarki, może być ewθntualoie podstawiona chlorowcem, grupę C.j_4llli0ową, Cg-alkoksylowę, Cj^alkllotlo, chlorowco/Cl_4/alkltowę, chlorowco/C1_4/ekkoksylowę, C2_6allenyloksylowę, C2_4alki^ny]^olsklową, heteroarylolsylowę, fenylową, fenoksylowę, nitrowę, cyjanową, N-oksy, feoylo-^C, 4 ^Idow^ ^nylo/Cj^/e^oksylow^ -nr3r , -co2r, -CONR r lub -So2r, gdzie r3 i Rj mogę być takie same lub różne i ma,Ję znaczenie wyżej podane dla r3 a grupy fenylowe sę enenoualnie podstawione chlooowcem lub grupę cyjanowę oraz Jego stereoizomery, w połęczeniu z grzybobójczo, owadoOójczi lub rozroczobójczo dopuszczalnym nośnikiem lub rozcieńczalnikiem.
2. środek grzybobójczy, owadobójczy lub roztoczobójczy, znamienny tym, że
3 4 3
Cl_4aikoksy/Cl_4/alkoksy/Cl_4/alkoksylową, cyjanlaikoksylloą, -CSNR R lub -S/O^R inną niz -SOgR3 oraz jego sterooizomery w poJtączoniu z grzybobójczo, owadobóóczo lub roztoczobójczo dopuszczalnym nośnikiem lub rozcieńczalnikiem.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB888827149A GB8827149D0 (en) | 1988-11-21 | 1988-11-21 | Fungicides |
| GB898905383A GB8905383D0 (en) | 1989-03-09 | 1989-03-09 | Fungicides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL160277B1 true PL160277B1 (pl) | 1993-02-26 |
Family
ID=26294646
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1989282378A PL160277B1 (pl) | 1988-11-21 | 1989-11-20 | S rodek grzybobójczy, owadobójczy lub roztoczobójczy PL PL PL PL PL PL |
| PL89285050A PL162219B1 (pl) | 1988-11-21 | 1989-11-20 | Sposób wytwarzania nowych pochodnych kwasu propenowego PL PL PL PL PL PL |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL89285050A PL162219B1 (pl) | 1988-11-21 | 1989-11-20 | Sposób wytwarzania nowych pochodnych kwasu propenowego PL PL PL PL PL PL |
Country Status (27)
| Country | Link |
|---|---|
| US (5) | US5055471A (pl) |
| EP (2) | EP0370629B2 (pl) |
| JP (1) | JP2740306B2 (pl) |
| KR (1) | KR0133666B1 (pl) |
| CN (1) | CN1024005C (pl) |
| AP (1) | AP127A (pl) |
| AR (1) | AR247741A1 (pl) |
| AT (1) | ATE169616T1 (pl) |
| AU (1) | AU627239B2 (pl) |
| CA (1) | CA2003480C (pl) |
| CZ (1) | CZ282034B6 (pl) |
| DE (2) | DE68928783T2 (pl) |
| DK (1) | DK174963B1 (pl) |
| ES (2) | ES2054025T5 (pl) |
| GB (1) | GB8924122D0 (pl) |
| GR (2) | GR3007535T3 (pl) |
| HU (1) | HU204491B (pl) |
| ID (1) | ID1026B (pl) |
| IE (1) | IE64709B1 (pl) |
| IL (1) | IL92200A (pl) |
| LV (1) | LV10082B (pl) |
| NZ (1) | NZ231242A (pl) |
| PL (2) | PL160277B1 (pl) |
| PT (1) | PT92359B (pl) |
| RU (1) | RU2024496C1 (pl) |
| SK (1) | SK659089A3 (pl) |
| UA (1) | UA41244C2 (pl) |
Families Citing this family (94)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE68928783T2 (de) * | 1988-11-21 | 1998-12-24 | Zeneca Ltd., London | Zwischenverbindungen zur Herstellung von Fungiziden |
| US5104872A (en) * | 1989-08-22 | 1992-04-14 | Nihon Hohyaku Co., Ltd. | N-(substituted benzyloxy) imine derivatives and method of use thereof |
| CA2029040A1 (en) * | 1989-11-02 | 1991-05-03 | Masanori Watanabe | Oxime ether derivative, preparation thereof and germicide containing the same |
| GB9000301D0 (en) * | 1990-01-06 | 1990-03-07 | Pfizer Ltd | Piperidine & pyrrolidine derivatives |
| DE4001618A1 (de) * | 1990-01-20 | 1991-07-25 | Basf Ag | Ungesaettigte cyclohexylessigsaeurederivate und diese enthaltende pflanzenschutzmittel |
| PH11991042549B1 (pl) * | 1990-06-05 | 2000-12-04 | ||
| ATE161007T1 (de) * | 1990-06-27 | 1997-12-15 | Basf Ag | O-benzyl-oximether und diese verbindungen enthaltende pflanzenschutzmittel |
| GB9018408D0 (en) * | 1990-08-22 | 1990-10-03 | Ici Plc | Fungicides |
| JPH06504538A (ja) * | 1991-01-30 | 1994-05-26 | ゼネカ・リミテッド | 殺菌剤 |
| MX9200203A (es) * | 1991-01-30 | 1994-06-30 | Ici Plc | Fungicidas. |
| DE4105160A1 (de) * | 1991-02-20 | 1992-08-27 | Basf Ag | Imino-substiuierte phenylderivate, ihre herstellung und diese enthaltende fungizide |
| NZ242290A (en) * | 1991-04-15 | 1994-12-22 | Zeneca Ltd | Pyridyl and pyrimidinyl substituted oxime-o-benzyl ether derivatives; preparatory processes, fungicidal compositions and an intermediate |
| IT1251474B (it) * | 1991-09-13 | 1995-05-15 | Mini Ricerca Scient Tecnolog | Derivati ossimici ad attivita' fungicida |
| US5760250A (en) * | 1991-11-05 | 1998-06-02 | Zeneca Limited | Process for the preparation of 3-(α-methoxy)methylenebenzofuranones and intermediates therefor |
| DE4140558A1 (de) * | 1991-12-09 | 1993-06-17 | Bayer Ag | Substituierte oximetheramide |
| TW221965B (pl) * | 1992-02-28 | 1994-04-01 | Ciba Geigy | |
| DE4206353A1 (de) * | 1992-02-29 | 1993-09-02 | Basf Ag | Cyanooximether, verfahren zu ihrer herstellung, sie enthaltende mittel und deren verwendung |
| IL105191A (en) * | 1992-04-04 | 1998-08-16 | Basf Ag | Acids and aminooxymethylbenzoic acids and their preparation |
| DE4213149A1 (de) * | 1992-04-22 | 1993-10-28 | Hoechst Ag | Akarizide, insektizide und nematizide substituierte (Hetero)-Aryl-Alkyl-ketonoxim-O-ether, Verfahren zu ihrer Herstellung, sie enthaltende Mittel und ihre Verwendung als Schädlingsbekämpfungsmittel |
| GB9218242D0 (en) * | 1992-08-27 | 1992-10-14 | Ici Plc | Chemical process |
| GB9221526D0 (en) * | 1992-10-14 | 1992-11-25 | Ici Plc | Fungicides |
| TW279845B (pl) * | 1992-12-01 | 1996-07-01 | Ciba Geigy Ag | |
| GB9226734D0 (en) * | 1992-12-22 | 1993-02-17 | Ici Plc | Fungicides |
| GB9226865D0 (en) * | 1992-12-23 | 1993-02-17 | Ici Plc | Fungicides |
| US5494888A (en) * | 1993-01-27 | 1996-02-27 | Lucky Ltd. | 6-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoic acid imino ester derivatives, processes for their production and a method for their application as herbicides |
| GB9307247D0 (en) * | 1993-04-07 | 1993-06-02 | Zeneca Ltd | Fungicidal compounds |
| TW299310B (pl) * | 1993-05-18 | 1997-03-01 | Ciba Geigy Ag | |
| AU690190B2 (en) * | 1994-01-05 | 1998-04-23 | Bayer Aktiengesellschaft | Pesticides |
| NZ278587A (en) | 1994-02-04 | 1998-08-26 | Basf Ag | Oxime-substituted phenylacetic acid derivatives; biocides |
| GB9405492D0 (en) * | 1994-03-21 | 1994-05-04 | Zeneca Ltd | Chemical compounds |
| MX9606276A (es) * | 1994-06-10 | 1998-11-30 | Basf Ag | Metodo para preparar metilamidas de acido alfa-metoxiiminocarboxilico, asi como productos intermedios empleados en el metodo. |
| US5583249A (en) * | 1994-08-19 | 1996-12-10 | Ciba-Geigy Corporation | Pesticides |
| JPH093031A (ja) * | 1995-04-17 | 1997-01-07 | Mitsubishi Chem Corp | ヒドロキサム酸誘導体並びにそれを含有する農園芸用殺菌剤 |
| US5635494A (en) * | 1995-04-21 | 1997-06-03 | Rohm And Haas Company | Dihydropyridazinones and pyridazinones and their use as fungicides and insecticides |
| MY115814A (en) * | 1995-06-16 | 2003-09-30 | Bayer Ip Gmbh | Crop protection compositions |
| UA54395C2 (uk) | 1995-06-16 | 2003-03-17 | Баєр Акціенгезельшафт | Фітобактерициднa композиція, спосіб контролю та запобігання хворобам рослин, матеріал для розмноження рослин |
| DE19523288A1 (de) * | 1995-06-27 | 1997-01-02 | Basf Ag | Iminooxybenzylverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung |
| ES2294789T3 (es) * | 1995-08-15 | 2008-04-01 | Bayer Cropscience Ag | Derivados de indazol pesticidas. |
| GB9516788D0 (en) * | 1995-08-16 | 1995-10-18 | Agrevo Uk Ltd | Fungicides |
| AU7286496A (en) * | 1995-10-18 | 1997-05-07 | Bayer Aktiengesellschaft | Iminoacetic acid amides and their use as pest control agents |
| ATE224361T1 (de) * | 1995-12-07 | 2002-10-15 | Bayer Ag | Pestizide |
| CN1111155C (zh) | 1995-12-07 | 2003-06-11 | 拜尔公开股份有限公司 | 农药的制备方法 |
| DE59608892D1 (de) * | 1995-12-27 | 2002-04-18 | Basf Ag | Iminooxyphenylessigsäurederivate, verfahren und zwischenprodukte zu ihrer herstellung und ihre verwendung |
| DE69709112T2 (de) * | 1996-06-12 | 2002-04-25 | Bayer Ag | Pestizide |
| FR2754254B1 (fr) * | 1996-10-09 | 1998-10-30 | Rhone Poulenc Agrochimie | Fongicides a groupes hydroximiques et hydrazoniques |
| US6084120A (en) * | 1997-07-09 | 2000-07-04 | Hoffmann-La Roche Inc. | β-Alkoxyacrylates against malaria |
| IT1295351B1 (it) * | 1997-10-17 | 1999-05-12 | Isagro Ricerca Srl | Analoghi della strobilurina aventi attivita' fungicida e loro utilizzo per il controllo di funghi fitopatogeni |
| CN1062711C (zh) * | 1998-02-10 | 2001-03-07 | 化工部沈阳化工研究院 | 不饱和肟醚类杀虫、杀真菌剂 |
| EP0936213B1 (en) * | 1998-02-10 | 2003-03-26 | Dow AgroSciences LLC | Unsaturated oxime ethers and their use as fungicides and insecticides |
| FR2777003A1 (fr) * | 1998-04-07 | 1999-10-01 | Rhone Poulenc Agrochimie | Nouveaux composes fongicides |
| FR2777002A1 (fr) * | 1998-04-07 | 1999-10-08 | Rhone Poulenc Agrochimie | Nouveaux composes fongicides |
| EP1077957B1 (en) | 1998-05-11 | 2004-08-04 | Takeda Chemical Industries, Ltd. | Oxyiminoalkanoic acid derivatives with hypoglycemic and hypolipidemic activity |
| HUP0102874A3 (en) | 1998-05-14 | 2003-04-28 | Basf Ag | Pesticidal and fungicidal bisoximether derivatives production and intermediates and use thereof |
| US6313344B1 (en) | 1998-05-27 | 2001-11-06 | Bayer Aktiengesellschaft | Organic compounds |
| JP2000044491A (ja) * | 1998-07-28 | 2000-02-15 | Nihon Medi Physics Co Ltd | スカラー結合により磁気共鳴診断が可能な医療用薬剤 |
| US6063956A (en) * | 1999-01-27 | 2000-05-16 | Rohm And Haas Company | Aryl and heteroarylcyclopropyl oxime ethers and their use as fungicides and insecticides |
| AU1007400A (en) * | 1999-01-27 | 2000-08-03 | Dow Agrosciences Llc | Aryl and heteroarylcyclopropyl oxime ethers and their use as fungicides and insecticides |
| KR100311195B1 (ko) * | 1999-08-16 | 2001-10-18 | 김충섭 | 옥심기를 가교로 하는, 불소화 비닐기가 치환된 프로페노익 에스테르 및 아미드 화합물, 이의 제조방법 및 이를 포함하는 살균제 조성물 |
| TR200201223T2 (tr) | 1999-11-05 | 2002-09-23 | Nippon Soda Company Limited | Tarım ve bahçe kullanımı için oksim O-eter bileşikleri ve mantar öldürücüler |
| EP1125931A1 (en) * | 2000-02-17 | 2001-08-22 | Hunan Research Institute of Chemical Industry | Biocidal alkyl-substituted-(hetero)aryl-ketoxime-O-ethers and the production method thereof |
| US6428654B1 (en) | 2000-04-05 | 2002-08-06 | Hercules Incorporated | Fungicidal method |
| KR100379761B1 (ko) * | 2000-11-23 | 2003-04-11 | 한국화학연구원 | 옥심기를 측쇄로 하는 신규의 프로페노익 에스테르 및아미드 유도체, 이의 제조방법 그리고 이를 함유하는살균제 조성물 |
| KR100415622B1 (ko) * | 2002-02-21 | 2004-01-24 | 이회선 | 살비성 화합물 및 해충 표시자 |
| CN1179942C (zh) * | 2002-09-13 | 2004-12-15 | 湖南化工研究院 | 具有杀菌活性的含硫不饱和肟醚类化合物及其制备方法 |
| WO2004043150A1 (de) | 2002-11-12 | 2004-05-27 | Basf Aktiengesellschaft | Verfahren zur ertragssteigerung bei glyphosate resistenten leguminosen |
| CA2590364A1 (en) * | 2004-12-23 | 2006-07-06 | Basf Aktiengesellschaft | Fungicidal mixtures |
| JP2010505811A (ja) | 2006-10-04 | 2010-02-25 | ファイザー・プロダクツ・インク | カルシウム受容体アンタゴニストとしてのピリド[4,3−d]ピリミジン−4(3H)−オン誘導体 |
| CN101372470B (zh) * | 2008-10-16 | 2013-05-15 | 国家农药创制工程技术研究中心 | 具有杀虫、杀菌活性的肟醚甲氧丙烯酸酯类化合物 |
| RU2617430C1 (ru) * | 2015-12-10 | 2017-04-25 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Российский химико-технологический университет имени Д.И. Менделеева (РХТУ им. Д.И. Менделеева)" | Замещенные n-окси-1-(3-пиридил)проп-2-ен-3-фенил-1-имины, обладающие фунгицидной активностью |
| RU2617413C1 (ru) * | 2015-12-10 | 2017-04-25 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Российский химико-технологический университет имени Д.И. Менделеева (РХТУ им. Д.И. Менделеева)" | О-замещенные 3-пиридилкетоксимы, обладающие фунгицидной активностью |
| US10544092B2 (en) | 2015-12-25 | 2020-01-28 | Shenyang Sinochem Agrochemicals R&D Co., Ltd. | Malononitrile oxime ether compound and use thereof |
| WO2017129121A1 (zh) * | 2016-01-26 | 2017-08-03 | 南开大学 | 一类噻二唑肟醚甲氧基丙烯酸酯衍生物及其制备方法和用途 |
| WO2017129122A1 (zh) * | 2016-01-26 | 2017-08-03 | 南开大学 | 一类异噻唑肟醚甲氧基丙烯酸酯衍生物及其制备方法和用途 |
| CN106995417B (zh) | 2016-01-26 | 2019-05-31 | 南开大学 | 一类异噻唑肟醚甲氧基丙烯酸酯衍生物及其制备方法和用途 |
| US10435411B2 (en) | 2016-11-01 | 2019-10-08 | Nihon Nohyaku Co., Ltd. | Oxime group-containing quinoline compound, N-oxide thereof or salt thereof, agricultural and horticultural insecticide comprising the compound, and method for using the insecticide |
| JP2021176818A (ja) * | 2018-07-31 | 2021-11-11 | 住友化学株式会社 | Qo阻害剤に対して耐性を有するダイズさび病菌の防除方法 |
| CN110220898A (zh) * | 2019-07-12 | 2019-09-10 | 五邑大学 | 代森锰锌的快速检测方法 |
| EP3903583A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors iii |
| EP3903584A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors iv |
| CA3171545A1 (en) | 2020-04-28 | 2021-11-04 | Andreas Koch | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors ii |
| PL4142497T3 (pl) * | 2020-04-28 | 2025-11-03 | Basf Se | Zastosowanie związków typu strobiluryny do zwalczania grzybów fitopatogennych zawierających podstawienie aminokwasowe f129l w mitochondrialnym białku cytochromu b nadające odporność na inhibitory qo (i) |
| IL297584A (en) * | 2020-04-28 | 2022-12-01 | Basf Se | Use of strobilurin type compounds to control phytopathogenic fungi containing amino acid conversion f129l in mitochondrial cytochrome b protein conferring resistance to iii qo inhibitors |
| EP3903581A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors i |
| WO2021219390A1 (en) | 2020-04-28 | 2021-11-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors iv |
| EP3903582A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors ii |
| WO2022008303A1 (en) | 2020-07-08 | 2022-01-13 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors vi |
| EP3960727A1 (en) | 2020-08-28 | 2022-03-02 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors vi |
| EP3939961A1 (en) | 2020-07-16 | 2022-01-19 | Basf Se | Strobilurin type compounds and their use for combating phytopathogenic fungi |
| WO2023072670A1 (en) | 2021-10-28 | 2023-05-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors x |
| WO2023072672A1 (en) | 2021-10-28 | 2023-05-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors xi |
| WO2023072671A1 (en) | 2021-10-28 | 2023-05-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors ix |
| EP4361126A1 (en) | 2022-10-24 | 2024-05-01 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors xv |
| EP4702006A1 (en) | 2023-04-26 | 2026-03-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors xvi |
| CN121135814A (zh) * | 2025-06-30 | 2025-12-16 | 浙江肽昇生物医药有限公司 | 一种合成二肽Fmoc-Leu-Aib-OH的方法 |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1318681A (en) * | 1971-01-01 | 1973-05-31 | Shell Int Research | Phenyl ketoxime derivatives |
| FR2430416A1 (fr) * | 1978-07-03 | 1980-02-01 | Shell Int Research | Ethers de benzyloxime et leur utilisation comme pesticides |
| AU6159680A (en) * | 1979-08-24 | 1981-04-09 | Rhone-Poulenc, Inc. | Ketoximinoether insecticides |
| DE3208330A1 (de) * | 1982-03-09 | 1983-09-15 | Basf Ag, 6700 Ludwigshafen | Alpha-oximinoessigsaeurederivate, ihre herstellung und ihre verwendung zur herstellung von fungizid wirksamen verbindungen |
| US4434182A (en) * | 1982-11-01 | 1984-02-28 | Fmc Corporation | Insecticidal substituted-biphenylmethyl oxime ethers |
| NZ213630A (en) * | 1984-10-19 | 1990-02-26 | Ici Plc | Acrylic acid derivatives and fungicidal compositions |
| US4773034A (en) * | 1985-05-09 | 1988-09-20 | American Telephone And Telegraph Company | Adaptive equalizer utilizing a plurality of multiplier-accumulator devices |
| DE3519280A1 (de) * | 1985-05-30 | 1986-12-04 | Basf Ag, 6700 Ludwigshafen | Stilbenderivate und fungizide, die diese verbindungen enthalten |
| DE3545319A1 (de) * | 1985-12-20 | 1987-06-25 | Basf Ag | Acrylsaeureester und fungizide, die diese verbindungen enthalten |
| JPH0749379B2 (ja) * | 1985-12-27 | 1995-05-31 | 住友化学工業株式会社 | 置換ベンゼン誘導体およびそれを有効成分とする農園芸用殺菌剤 |
| CA1300137C (en) * | 1985-12-27 | 1992-05-05 | Hiroshi Hamaguchi | Pyrazole oxime derivative and its production and use |
| US5225406A (en) * | 1986-04-14 | 1993-07-06 | Banyu Pharmaceutical Co., Ltd. | 1-carboxy-1-vinyloxyimino aminothiazole cephalosporin derivatives |
| DE3750411T2 (de) * | 1986-04-14 | 1995-03-16 | Banyu Pharma Co Ltd | Cephalosporinderivate, Verfahren zu ihrer Herstellung und antibakterielle Präparate. |
| DE3620860A1 (de) * | 1986-06-21 | 1987-12-23 | Basf Ag | Substituierte acrylsaeureester und fungizide, die diese verbindungen enthalten |
| CA1310267C (en) * | 1986-07-09 | 1992-11-17 | Yutaka Hirao | Process for heat treating chemically unmodified _-globulin |
| DE3623921A1 (de) * | 1986-07-16 | 1988-01-21 | Basf Ag | Oximether und diese enthaltende fungizide |
| EP0273572B1 (en) * | 1986-12-16 | 1996-01-24 | Zeneca Limited | Pyrrole derivatives and their use in agriculture |
| ATE111468T1 (de) * | 1987-02-27 | 1994-09-15 | Banyu Pharma Co Ltd | Cephalosporinderivate, verfahren zu ihrer herstellung und antibakterielle mittel. |
| DE68928783T2 (de) * | 1988-11-21 | 1998-12-24 | Zeneca Ltd., London | Zwischenverbindungen zur Herstellung von Fungiziden |
| AU4639089A (en) * | 1988-12-29 | 1990-08-01 | Ciba-Geigy Ag | Methyl esters of aldimino- or ketimino-oxy-ortho-tolylacrylic acid, manufacturing process and fungicides containing them |
| US5026794A (en) * | 1989-05-23 | 1991-06-25 | Polysar Limited | Adducts of an hydroxy-free acrylate resin and an epoxy resin |
| US5104872A (en) * | 1989-08-22 | 1992-04-14 | Nihon Hohyaku Co., Ltd. | N-(substituted benzyloxy) imine derivatives and method of use thereof |
| JPH03160071A (ja) * | 1989-11-18 | 1991-07-10 | Somar Corp | 光硬化性無電解メッキレジストインキ組成物 |
| ATE161007T1 (de) * | 1990-06-27 | 1997-12-15 | Basf Ag | O-benzyl-oximether und diese verbindungen enthaltende pflanzenschutzmittel |
| GB9018408D0 (en) * | 1990-08-22 | 1990-10-03 | Ici Plc | Fungicides |
| DE4116090A1 (de) * | 1991-05-17 | 1992-11-19 | Basf Ag | (alpha)-phenylacrylsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen und schadpilzen |
| DE4117371A1 (de) * | 1991-05-28 | 1992-12-03 | Basf Ag | Antimykotische mittel, die phenylessigsaeurederivate enthalten |
-
1989
- 1989-10-25 DE DE68928783T patent/DE68928783T2/de not_active Expired - Lifetime
- 1989-10-25 ES ES89310996T patent/ES2054025T5/es not_active Expired - Lifetime
- 1989-10-25 AT AT92111192T patent/ATE169616T1/de not_active IP Right Cessation
- 1989-10-25 DE DE68905765T patent/DE68905765T3/de not_active Expired - Lifetime
- 1989-10-25 ES ES92111192T patent/ES2118769T3/es not_active Expired - Lifetime
- 1989-10-25 EP EP89310996A patent/EP0370629B2/en not_active Expired - Lifetime
- 1989-10-25 EP EP92111192A patent/EP0506149B1/en not_active Expired - Lifetime
- 1989-10-26 GB GB898924122A patent/GB8924122D0/en active Pending
- 1989-10-31 IE IE350889A patent/IE64709B1/en not_active IP Right Cessation
- 1989-11-01 AU AU44308/89A patent/AU627239B2/en not_active Expired
- 1989-11-02 NZ NZ231242A patent/NZ231242A/xx unknown
- 1989-11-03 IL IL9220089A patent/IL92200A/en unknown
- 1989-11-06 AP APAP/P/1989/000147A patent/AP127A/en active
- 1989-11-06 HU HU895673A patent/HU204491B/hu unknown
- 1989-11-15 US US07/436,752 patent/US5055471A/en not_active Expired - Lifetime
- 1989-11-20 PT PT92359A patent/PT92359B/pt not_active IP Right Cessation
- 1989-11-20 UA UA4742511A patent/UA41244C2/uk unknown
- 1989-11-20 RU SU894742511A patent/RU2024496C1/ru active
- 1989-11-20 PL PL1989282378A patent/PL160277B1/pl unknown
- 1989-11-20 AR AR89315486A patent/AR247741A1/es active
- 1989-11-20 PL PL89285050A patent/PL162219B1/pl unknown
- 1989-11-21 JP JP1300944A patent/JP2740306B2/ja not_active Expired - Lifetime
- 1989-11-21 KR KR1019890016920A patent/KR0133666B1/ko not_active Expired - Lifetime
- 1989-11-21 CA CA002003480A patent/CA2003480C/en not_active Expired - Lifetime
- 1989-11-21 CZ CS896590A patent/CZ282034B6/cs not_active IP Right Cessation
- 1989-11-21 DK DK198905847A patent/DK174963B1/da not_active IP Right Cessation
- 1989-11-21 CN CN89108648A patent/CN1024005C/zh not_active Expired - Lifetime
- 1989-11-21 SK SK6590-89A patent/SK659089A3/sk unknown
-
1991
- 1991-08-12 ID IDP5591A patent/ID1026B/id unknown
-
1992
- 1992-12-24 LV LVP-92-492A patent/LV10082B/en unknown
-
1993
- 1993-04-01 GR GR920402973T patent/GR3007535T3/el unknown
- 1993-10-28 US US08/142,109 patent/US5371084A/en not_active Expired - Lifetime
-
1994
- 1994-08-25 US US08/295,424 patent/US5432197A/en not_active Expired - Lifetime
- 1994-12-02 US US08/352,764 patent/US5631253A/en not_active Expired - Lifetime
-
1996
- 1996-12-30 US US08/774,798 patent/US5763640A/en not_active Expired - Fee Related
-
1998
- 1998-01-15 GR GR980400080T patent/GR3025912T3/el unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL160277B1 (pl) | S rodek grzybobójczy, owadobójczy lub roztoczobójczy PL PL PL PL PL PL | |
| JPS6254096B2 (pl) | ||
| JPH04288005A (ja) | 複素環置換スルホン類を基材とした殺菌殺カビ剤 | |
| CS254984B2 (en) | Agent for selective weed killing | |
| EA011163B1 (ru) | Способ защиты полезных растений или материала для размножения растений | |
| HU182942B (en) | Antidote and herbicide compositions containing oxyme derivatives and process for preparing the antidote | |
| WO2015135422A1 (zh) | 一种保护植物免于植物病害的方法 | |
| CN106922703A (zh) | 一种杀菌组合物 | |
| CN114223665A (zh) | 一种杀菌组合物用于防治植物致病真菌的用途 | |
| JP2000510437A (ja) | 殺菌剤混合物 | |
| RU2042327C1 (ru) | Фунгицидное средство и способ борьбы с грибками | |
| JPS61200968A (ja) | 複素環式化合物、その製造方法およびこれを含有する、殺菌または植物生長調整剤組成物 | |
| JPS6368505A (ja) | 農業用殺虫殺菌組成物 | |
| JPS63284162A (ja) | ヒドラジン誘導体、その組成物及び微生物に対する植物保護方法 | |
| JPH02264770A (ja) | 植物を病気から保護するための組成物 | |
| RU2150833C1 (ru) | Гербицидный препарат избирательного действия и способ селективной борьбы с сорняками и травами | |
| US5055125A (en) | Antidoted herbicide compositions and antidote compositions | |
| JPH01186849A (ja) | ジフェニルアミン誘導体、その製造法およびそれを有効成分とする有害生物防除剤 | |
| US3996039A (en) | Synergistic herbicidal compositions | |
| KR100231518B1 (ko) | 농원예용살진균조성물 | |
| NO811258L (no) | Fungicide, heterocyklisk substituerte tioglykolsyreanilider, fremgangsmaate til deres fremstilling og skadedyrs-bekjempelsesmidler inneholdende disse | |
| KR20020065905A (ko) | 작물 수확량 향상을 위한 세미카르바존 식물 성장조절제의 용도 | |
| JPH03115205A (ja) | 除草剤組成物 | |
| JPH04230271A (ja) | 殺微生物剤 | |
| CN112056316A (zh) | 一种杀菌组合物 |