PL112645B1 - Process for preparing novel n-(1,3,4-thiadiazolylo-2)-benzamides - Google Patents
Process for preparing novel n-(1,3,4-thiadiazolylo-2)-benzamides Download PDFInfo
- Publication number
- PL112645B1 PL112645B1 PL1977195892A PL19589277A PL112645B1 PL 112645 B1 PL112645 B1 PL 112645B1 PL 1977195892 A PL1977195892 A PL 1977195892A PL 19589277 A PL19589277 A PL 19589277A PL 112645 B1 PL112645 B1 PL 112645B1
- Authority
- PL
- Poland
- Prior art keywords
- hydrogen
- group
- chlorine
- formula
- bromine
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 5
- 229940054066 benzamide antipsychotics Drugs 0.000 title description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 73
- 239000001257 hydrogen Substances 0.000 description 64
- 229910052801 chlorine Inorganic materials 0.000 description 62
- 239000000460 chlorine Substances 0.000 description 60
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 52
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 52
- 229910052794 bromium Chemical group 0.000 description 52
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 51
- 150000001875 compounds Chemical class 0.000 description 48
- 229910052731 fluorine Chemical group 0.000 description 41
- 239000011737 fluorine Chemical group 0.000 description 41
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 40
- 150000002431 hydrogen Chemical class 0.000 description 34
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 32
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 31
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 31
- 238000000034 method Methods 0.000 description 29
- -1 hydrothesia Chemical group 0.000 description 28
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 17
- 125000004076 pyridyl group Chemical group 0.000 description 17
- 238000000921 elemental analysis Methods 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- 238000002360 preparation method Methods 0.000 description 16
- 125000001424 substituent group Chemical group 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 229910052736 halogen Inorganic materials 0.000 description 13
- 150000002367 halogens Chemical class 0.000 description 13
- 125000000842 isoxazolyl group Chemical group 0.000 description 13
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 12
- 125000000335 thiazolyl group Chemical group 0.000 description 12
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 11
- 125000001624 naphthyl group Chemical group 0.000 description 11
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 10
- 125000001309 chloro group Chemical group Cl* 0.000 description 10
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 9
- 125000002541 furyl group Chemical group 0.000 description 9
- 125000005493 quinolyl group Chemical group 0.000 description 9
- 125000001544 thienyl group Chemical group 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 8
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 125000001246 bromo group Chemical group Br* 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 229910052717 sulfur Chemical group 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- SDYIZAANGZBOSO-UHFFFAOYSA-N 2,3-dimethoxybenzamide Chemical compound COC1=CC=CC(C(N)=O)=C1OC SDYIZAANGZBOSO-UHFFFAOYSA-N 0.000 description 3
- MALIONKMKPITBV-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-n-[2-(4-sulfamoylphenyl)ethyl]acetamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1CCNC(=O)CC1=CC=C(O)C(Cl)=C1 MALIONKMKPITBV-UHFFFAOYSA-N 0.000 description 3
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical group [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 241000534944 Thia Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000011593 sulfur Chemical group 0.000 description 3
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical group FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 2
- 238000007243 oxidative cyclization reaction Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical group C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 1
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 description 1
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 1
- 125000004098 2,6-dichlorobenzoyl group Chemical group O=C([*])C1=C(Cl)C([H])=C([H])C([H])=C1Cl 0.000 description 1
- ZAUCRONGJXRQRD-UHFFFAOYSA-N 2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(N)=O ZAUCRONGJXRQRD-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 1
- GUCPYIYFQVTFSI-UHFFFAOYSA-N 4-methoxybenzamide Chemical compound COC1=CC=C(C(N)=O)C=C1 GUCPYIYFQVTFSI-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 101100457849 Caenorhabditis elegans mon-2 gene Proteins 0.000 description 1
- MUQNGPZZQDCDFT-JNQJZLCISA-N Halcinonide Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H]3OC(C)(C)O[C@@]3(C(=O)CCl)[C@@]1(C)C[C@@H]2O MUQNGPZZQDCDFT-JNQJZLCISA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- LFMFPKKYRXFHHZ-UHFFFAOYSA-N R24 Chemical compound C1=C(Cl)C(C)=CC=C1NC1=NC(N)=C(C=CC=C2)C2=N1 LFMFPKKYRXFHHZ-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 235000009754 Vitis X bourquina Nutrition 0.000 description 1
- 235000012333 Vitis X labruscana Nutrition 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- NFGODEMQGQNUKK-UHFFFAOYSA-M [6-(diethylamino)-9-(2-octadecoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCCOC(=O)C1=CC=CC=C1C1=C2C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C21 NFGODEMQGQNUKK-UHFFFAOYSA-M 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- WARCRYXKINZHGQ-UHFFFAOYSA-N benzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1 WARCRYXKINZHGQ-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 229940032296 ferric chloride Drugs 0.000 description 1
- 229940044631 ferric chloride hexahydrate Drugs 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 229940028332 halog Drugs 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- VOAPTKOANCCNFV-UHFFFAOYSA-N hexahydrate;hydrochloride Chemical compound O.O.O.O.O.O.Cl VOAPTKOANCCNFV-UHFFFAOYSA-N 0.000 description 1
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- IPZOLVGIGPKBJL-UHFFFAOYSA-N hydroxy-imino-dimethoxy-$l^{5}-phosphane Chemical compound COP(N)(=O)OC IPZOLVGIGPKBJL-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- NQXWGWZJXJUMQB-UHFFFAOYSA-K iron trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].Cl[Fe+]Cl NQXWGWZJXJUMQB-UHFFFAOYSA-K 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- HQRPHMAXFVUBJX-UHFFFAOYSA-M lithium;hydrogen carbonate Chemical compound [Li+].OC([O-])=O HQRPHMAXFVUBJX-UHFFFAOYSA-M 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- LRPCLTPZMUIPFK-UHFFFAOYSA-N methane;sulfuric acid Chemical compound C.OS(O)(=O)=O LRPCLTPZMUIPFK-UHFFFAOYSA-N 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 238000004452 microanalysis Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- SFDJOSRHYKHMOK-UHFFFAOYSA-N nitramide Chemical compound N[N+]([O-])=O SFDJOSRHYKHMOK-UHFFFAOYSA-N 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- RPDJEKMSFIRVII-UHFFFAOYSA-N oxomethylidenehydrazine Chemical compound NN=C=O RPDJEKMSFIRVII-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BGUWFUQJCDRPTL-UHFFFAOYSA-N pyridine-4-carbaldehyde Chemical compound O=CC1=CC=NC=C1 BGUWFUQJCDRPTL-UHFFFAOYSA-N 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- CUWHXIJMTMMRTI-UHFFFAOYSA-N thiadiazol-4-amine Chemical class NC1=CSN=N1 CUWHXIJMTMMRTI-UHFFFAOYSA-N 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65655276A | 1976-02-09 | 1976-02-09 | |
| US74016676A | 1976-11-10 | 1976-11-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL195892A1 PL195892A1 (pl) | 1979-05-21 |
| PL112645B1 true PL112645B1 (en) | 1980-10-31 |
Family
ID=27097215
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1977195892A PL112645B1 (en) | 1976-02-09 | 1977-02-09 | Process for preparing novel n-(1,3,4-thiadiazolylo-2)-benzamides |
| PL1977220785A PL113231B1 (en) | 1976-02-09 | 1977-02-09 | Insecticide |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1977220785A PL113231B1 (en) | 1976-02-09 | 1977-02-09 | Insecticide |
Country Status (30)
| Country | Link |
|---|---|
| JP (1) | JPS52105173A (de) |
| AR (1) | AR221204A1 (de) |
| AT (1) | AT362192B (de) |
| AU (1) | AU505649B2 (de) |
| BG (3) | BG28987A4 (de) |
| BR (1) | BR7700471A (de) |
| CA (1) | CA1077041A (de) |
| CH (1) | CH631603A5 (de) |
| CS (1) | CS198217B2 (de) |
| DD (2) | DD130038A5 (de) |
| DE (1) | DE2704288A1 (de) |
| DK (1) | DK50677A (de) |
| ES (2) | ES455409A1 (de) |
| FR (1) | FR2340312A1 (de) |
| GB (1) | GB1571422A (de) |
| GR (1) | GR65893B (de) |
| HK (1) | HK27081A (de) |
| HU (1) | HU179458B (de) |
| IE (1) | IE44573B1 (de) |
| IL (1) | IL51149A (de) |
| IT (1) | IT1078058B (de) |
| KE (1) | KE3131A (de) |
| MY (1) | MY8200038A (de) |
| NL (1) | NL7701059A (de) |
| NZ (1) | NZ182937A (de) |
| PL (2) | PL112645B1 (de) |
| PT (1) | PT66158A (de) |
| RO (2) | RO76588A (de) |
| SE (1) | SE412063B (de) |
| SU (1) | SU706023A3 (de) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2007087427A2 (en) | 2006-01-25 | 2007-08-02 | Synta Pharmaceuticals Corp. | Thiazole and thiadiazole compounds for inflammation and immune-related uses |
| EP2107054A1 (de) * | 2008-04-01 | 2009-10-07 | Università Degli Studi Di Milano - Bicocca | Antiproliferative Verbindungen und therapeutische Verwendungen dafür |
| ES2651002T3 (es) * | 2010-04-16 | 2018-01-23 | Bayer Intellectual Property Gmbh | Nuevos compuestos heterocíclicos como pesticidas |
| UA112761C2 (uk) * | 2010-08-31 | 2016-10-25 | Дау Агросаєнсиз Елелсі | Пестицидні композиції |
| JPWO2012121168A1 (ja) * | 2011-03-04 | 2014-07-17 | 国立大学法人京都大学 | キナーゼ阻害剤 |
| WO2014060381A1 (de) | 2012-10-18 | 2014-04-24 | Bayer Cropscience Ag | Heterocyclische verbindungen als schädlingsbekämpfungsmittel |
| BR112016020067B1 (pt) * | 2014-03-06 | 2021-08-31 | Bayer Cropscience Aktiengesellschaft | Compostos heterocíclicos como pesticidas. |
| JP2020502168A (ja) * | 2016-12-16 | 2020-01-23 | バイエル・クロップサイエンス・アクチェンゲゼルシャフト | 殺有害生物剤としてのチアジアゾール誘導体 |
| BR112019012584A2 (pt) * | 2016-12-22 | 2019-11-19 | Bayer Ag | heteroarilpirrolonas substituídas e sais das mesmas e uso das mesmas como substâncias ativas herbicidas |
| CN109456283B (zh) * | 2018-12-13 | 2023-03-28 | 贵州大学 | 含1,3,4-噻二唑硫醚(砜)的2-(三氟甲基)苯甲酰胺类衍生物、其制备及应用 |
-
1976
- 1976-12-18 GR GR52438A patent/GR65893B/el unknown
- 1976-12-20 IE IE2783/76A patent/IE44573B1/en unknown
- 1976-12-21 NZ NZ182937A patent/NZ182937A/xx unknown
- 1976-12-22 CA CA268,463A patent/CA1077041A/en not_active Expired
- 1976-12-23 IL IL51149A patent/IL51149A/xx unknown
-
1977
- 1977-01-11 AR AR266147A patent/AR221204A1/es active
- 1977-01-25 SE SE7700778A patent/SE412063B/xx unknown
- 1977-01-26 BR BR7700471A patent/BR7700471A/pt unknown
- 1977-01-27 ES ES455409A patent/ES455409A1/es not_active Expired
- 1977-02-01 SU SU772446348A patent/SU706023A3/ru active
- 1977-02-02 NL NL7701059A patent/NL7701059A/xx not_active Application Discontinuation
- 1977-02-02 DE DE19772704288 patent/DE2704288A1/de not_active Ceased
- 1977-02-03 BG BG037894A patent/BG28987A4/xx unknown
- 1977-02-03 GB GB4389/77A patent/GB1571422A/en not_active Expired
- 1977-02-03 BG BG035326A patent/BG28236A3/xx unknown
- 1977-02-03 BG BG037893A patent/BG28986A4/xx unknown
- 1977-02-04 PT PT66158A patent/PT66158A/pt unknown
- 1977-02-07 AU AU22026/77A patent/AU505649B2/en not_active Expired
- 1977-02-07 DK DK50677A patent/DK50677A/da not_active Application Discontinuation
- 1977-02-07 CH CH146977A patent/CH631603A5/de not_active IP Right Cessation
- 1977-02-07 HU HU77EI725A patent/HU179458B/hu unknown
- 1977-02-08 IT IT20057/77A patent/IT1078058B/it active
- 1977-02-08 AT AT81877A patent/AT362192B/de not_active IP Right Cessation
- 1977-02-08 CS CS77822A patent/CS198217B2/cs unknown
- 1977-02-09 PL PL1977195892A patent/PL112645B1/pl unknown
- 1977-02-09 JP JP1404977A patent/JPS52105173A/ja active Pending
- 1977-02-09 DD DD7700197305A patent/DD130038A5/de unknown
- 1977-02-09 PL PL1977220785A patent/PL113231B1/pl unknown
- 1977-02-09 DD DD77204378A patent/DD135032A5/de unknown
- 1977-02-09 FR FR7703603A patent/FR2340312A1/fr active Granted
- 1977-02-13 RO RO7796600A patent/RO76588A/ro unknown
-
1978
- 1978-02-16 ES ES467061A patent/ES467061A1/es not_active Expired
-
1979
- 1979-02-17 RO RO7996599A patent/RO76587A/ro unknown
-
1981
- 1981-06-02 KE KE3131A patent/KE3131A/xx unknown
- 1981-06-18 HK HK270/81A patent/HK27081A/xx unknown
-
1982
- 1982-12-30 MY MY38/82A patent/MY8200038A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1254213A (en) | Aminomethyl oxooxazolidinyl benzene derivatives useful as antibacterial agents | |
| CA1263114A (en) | Derivatives of 1,2,5-thiadiazole-1-oxides and 1,1- dioxides as histamine h2-antagonists | |
| CA1170264A (en) | Azolyloxy-carboxylic acid n-oxy-amide compounds and herbicidal compositions | |
| AU654084B2 (en) | N-isopropylheteroaryloxyacetanilides | |
| RU2329043C2 (ru) | Соединения, воздействующие на глюкокиназу | |
| PL112645B1 (en) | Process for preparing novel n-(1,3,4-thiadiazolylo-2)-benzamides | |
| JP2009528983A5 (de) | ||
| HU185881B (en) | Herbicide composition and process for preparing azolyloxy-carboxylic acid amide derivatives applied as active substances | |
| NO177301C (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive N-(aryloksyalkyl)heteroarylpiperidiner og -heteroarylpiperaziner | |
| CA1118426A (en) | Herbicidally active 1,2,4-oxadiazole derivatives, a process for their manufacture and their use | |
| CZ80096A3 (en) | Sulfonamide derivative, process of its preparation and pharmaceutical composition containing thereof | |
| CA2486090A1 (en) | Pyridine carboxamide derivatives and their use as pesticides | |
| CN112409293B (zh) | 苯并噻嗪酮化合物及其制备方法与作为抗结核药物的应用 | |
| KR100345045B1 (ko) | 1,4-이치환된-5(4h)-테트라졸리논의제조방법 | |
| WO1987007602A3 (en) | N-(5-substituted methylene) phenyl herbicides | |
| CA2423156A1 (en) | Substituted azole derivatives as inhibitors of corticotropin releasing factor | |
| CA1046516A (en) | 1-thiadiazolylimidazolidinones | |
| PL96263B1 (pl) | Sposob wytwarzania nowych pochodnych oksadiazolinonu | |
| FI63394B (fi) | Analogifoerfarande foer framstaellning av kemoterapeutiskt anvaendbara heteroarylfoereningar | |
| HUP9700955A2 (hu) | Szubsztituált 2-naftoil-guanidin-származékok, előállításuk, valamint az e vegyületeket tartalmazó gyógyszerkészítmények | |
| CA1188698A (en) | N-(2,2,2-trifluoroethyl)-n-alkyl-azolyloxyacetic acid amides, a process for their preparation and their use as herbicides | |
| EP0003539B1 (de) | N-Azolylalkyl-halogenacetanilide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| CN105503727A (zh) | 一种吡唑酰胺类化合物及其应用 | |
| Shelke et al. | Synthesis of 2-((5-benzylidene-4-oxo-4, 5-dihydrothiazol-2-yl)-substituted amino acids as anticancer and antimicrobial agents | |
| CA1234567A (en) | Substituted 3-trihalogenomethyl-1,2,4-thiadiazol-5- yl-oxyacetamides, a process for their preparation and their use as herbicides |