PL108983B1 - Insecticidal agent - Google Patents
Insecticidal agent Download PDFInfo
- Publication number
- PL108983B1 PL108983B1 PL1975193676A PL19367675A PL108983B1 PL 108983 B1 PL108983 B1 PL 108983B1 PL 1975193676 A PL1975193676 A PL 1975193676A PL 19367675 A PL19367675 A PL 19367675A PL 108983 B1 PL108983 B1 PL 108983B1
- Authority
- PL
- Poland
- Prior art keywords
- pyrazoline
- chlorophenyl
- phenyl
- group
- carbon atoms
- Prior art date
Links
- 239000002917 insecticide Substances 0.000 title claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 40
- 150000001875 compounds Chemical class 0.000 claims description 40
- 239000000203 mixture Substances 0.000 claims description 36
- 125000000217 alkyl group Chemical group 0.000 claims description 32
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 27
- 239000004480 active ingredient Substances 0.000 claims description 24
- 125000005843 halogen group Chemical group 0.000 claims description 24
- 239000013543 active substance Substances 0.000 claims description 17
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 17
- -1 C1-4 Chemical group 0.000 claims description 14
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 12
- 150000003219 pyrazolines Chemical class 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 150000002367 halogens Chemical group 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 125000004001 thioalkyl group Chemical group 0.000 claims description 10
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052740 iodine Chemical group 0.000 claims description 5
- 229910052717 sulfur Chemical group 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Chemical group 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 239000011593 sulfur Chemical group 0.000 claims description 4
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- MCGBIXXDQFWVDW-UHFFFAOYSA-N 4,5-dihydro-1h-pyrazole Chemical compound C1CC=NN1 MCGBIXXDQFWVDW-UHFFFAOYSA-N 0.000 description 169
- 230000000694 effects Effects 0.000 description 19
- 239000003921 oil Substances 0.000 description 16
- 241000238631 Hexapoda Species 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 241000256118 Aedes aegypti Species 0.000 description 6
- 241000254173 Coleoptera Species 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 230000000749 insecticidal effect Effects 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 244000061456 Solanum tuberosum Species 0.000 description 5
- 235000002595 Solanum tuberosum Nutrition 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 240000007124 Brassica oleracea Species 0.000 description 3
- 241000258916 Leptinotarsa decemlineata Species 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- 241000255969 Pieris brassicae Species 0.000 description 2
- 229920001214 Polysorbate 60 Polymers 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 229960000892 attapulgite Drugs 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052625 palygorskite Inorganic materials 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 125000002755 pyrazolinyl group Chemical group 0.000 description 2
- 239000000779 smoke Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000008399 tap water Substances 0.000 description 2
- 235000020679 tap water Nutrition 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- IYLGZMTXKJYONK-ACLXAEORSA-N (12s,15r)-15-hydroxy-11,16-dioxo-15,20-dihydrosenecionan-12-yl acetate Chemical compound O1C(=O)[C@](CC)(O)C[C@@H](C)[C@](C)(OC(C)=O)C(=O)OCC2=CCN3[C@H]2[C@H]1CC3 IYLGZMTXKJYONK-ACLXAEORSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- WWLYVPZNCXCPCE-UHFFFAOYSA-N 2,2,2-trichloro-1-(4,4-dichlorocyclohexa-1,5-dien-1-yl)-1-phenylethanol Chemical compound C=1C=CC=CC=1C(C(Cl)(Cl)Cl)(O)C1=CCC(Cl)(Cl)C=C1 WWLYVPZNCXCPCE-UHFFFAOYSA-N 0.000 description 1
- MHKBMNACOMRIAW-UHFFFAOYSA-N 2,3-dinitrophenol Chemical class OC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O MHKBMNACOMRIAW-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- NIOPZPCMRQGZCE-WEVVVXLNSA-N 2,4-dinitro-6-(octan-2-yl)phenyl (E)-but-2-enoate Chemical compound CCCCCCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)\C=C\C NIOPZPCMRQGZCE-WEVVVXLNSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- RCLHACRHIDBJQD-UHFFFAOYSA-N 2-cyanoguanidine;methylmercury Chemical compound [Hg]C.NC(=N)NC#N RCLHACRHIDBJQD-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- CDIJOYCNNFLOAX-UHFFFAOYSA-N 4-(trichloromethylsulfanyl)isoindole-1,3-dione Chemical compound ClC(Cl)(Cl)SC1=CC=CC2=C1C(=O)NC2=O CDIJOYCNNFLOAX-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- 241000107983 Aleyrodes proletella Species 0.000 description 1
- 241000238421 Arthropoda Species 0.000 description 1
- 241000256113 Culicidae Species 0.000 description 1
- ZAKOWWREFLAJOT-CEFNRUSXSA-N D-alpha-tocopherylacetate Chemical compound CC(=O)OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C ZAKOWWREFLAJOT-CEFNRUSXSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical class CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 241000257162 Lucilia <blowfly> Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000010170 biological method Methods 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 1
- QXHGFJKIGCSCBA-UHFFFAOYSA-N carbonodithioic S,S-acid quinoxaline Chemical compound C(S)(O)=S.N1=CC=NC2=CC=CC=C12 QXHGFJKIGCSCBA-UHFFFAOYSA-N 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- WDQNIWFZKXZFAY-UHFFFAOYSA-M fentin acetate Chemical compound CC([O-])=O.C1=CC=CC=C1[Sn+](C=1C=CC=CC=1)C1=CC=CC=C1 WDQNIWFZKXZFAY-UHFFFAOYSA-M 0.000 description 1
- BFWMWWXRWVJXSE-UHFFFAOYSA-M fentin hydroxide Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(O)C1=CC=CC=C1 BFWMWWXRWVJXSE-UHFFFAOYSA-M 0.000 description 1
- OMRRUNXAWXNVFW-UHFFFAOYSA-N fluoridochlorine Chemical class ClF OMRRUNXAWXNVFW-UHFFFAOYSA-N 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 230000000974 larvacidal effect Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003252 quinoxalines Chemical class 0.000 description 1
- IYLGZMTXKJYONK-UHFFFAOYSA-N ruwenine Natural products O1C(=O)C(CC)(O)CC(C)C(C)(OC(C)=O)C(=O)OCC2=CCN3C2C1CC3 IYLGZMTXKJYONK-UHFFFAOYSA-N 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000002641 tar oil Substances 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/06—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/72—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups
- C07C45/75—Reactions with formaldehyde
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/813—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen polycyclic
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7409433.A NL158178B (nl) | 1974-07-12 | 1974-07-12 | Werkwijze ter bereiding van insekticide preparaten die een pyrazolinederivaat bevatten, aldus verkregen gevormde preparaten, en werkwijze ter bereiding van pyrazolinederivaten met insekticide werking. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL193676A1 PL193676A1 (pl) | 1978-07-17 |
| PL108983B1 true PL108983B1 (en) | 1980-05-31 |
Family
ID=19821740
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1975193676A PL108983B1 (en) | 1974-07-12 | 1975-07-12 | Insecticidal agent |
| PL1975182044A PL105891B1 (pl) | 1974-07-12 | 1975-07-12 | Sposob wytwarzania nowych pochodnych pirazoliny |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1975182044A PL105891B1 (pl) | 1974-07-12 | 1975-07-12 | Sposob wytwarzania nowych pochodnych pirazoliny |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4070365A (enExample) |
| JP (1) | JPS6123162B2 (enExample) |
| AR (1) | AR223449A1 (enExample) |
| AT (1) | AT342585B (enExample) |
| AU (1) | AU501280B2 (enExample) |
| BE (1) | BE831232A (enExample) |
| BR (1) | BR7504413A (enExample) |
| CA (1) | CA1075242A (enExample) |
| CH (1) | CH624675A5 (enExample) |
| CS (1) | CS188962B2 (enExample) |
| DD (1) | DD122775A5 (enExample) |
| DE (1) | DE2529689C2 (enExample) |
| DK (1) | DK142028B (enExample) |
| EG (1) | EG11880A (enExample) |
| ES (1) | ES439292A1 (enExample) |
| FR (1) | FR2277827A1 (enExample) |
| GB (1) | GB1514285A (enExample) |
| HU (1) | HU178320B (enExample) |
| IE (1) | IE41836B1 (enExample) |
| IL (1) | IL47676A (enExample) |
| IT (1) | IT1044358B (enExample) |
| NL (1) | NL158178B (enExample) |
| OA (1) | OA05057A (enExample) |
| PL (2) | PL108983B1 (enExample) |
| SE (1) | SE419644B (enExample) |
| YU (1) | YU39003B (enExample) |
| ZA (1) | ZA754203B (enExample) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4156007A (en) * | 1974-07-12 | 1979-05-22 | U.S. Philips Corporation | Pyrazoline compounds |
| NL183400C (nl) * | 1976-01-09 | 1988-10-17 | Duphar Int Res | Werkwijze ter bereiding van een insecticide preparaat dat een pyrazoline-verbinding bevat en werkwijze ter bereiding van een pyrazoline-verbinding met insecticide werking. |
| US4174393A (en) * | 1975-07-09 | 1979-11-13 | Duphar International Research B.V. | 1,3,4-Substituted pyrazoline derivatives |
| DE2700288A1 (de) * | 1977-01-05 | 1978-07-13 | Bayer Ag | Phenylcarbamoyl-pyrazoline, verfahren zu ihrer herstellung und ihre verwendung als insektizide |
| DE2700289A1 (de) * | 1977-01-05 | 1978-07-06 | Bayer Ag | Substituierte phenylcarbamoyl-2- pyrazoline, verfahren zu ihrer herstellung und ihre verwendung als insektizide |
| EP0004733A3 (en) * | 1978-03-31 | 1979-10-31 | Imperial Chemical Industries Plc | Diaryl substituted pyrazoline carboxanilides, processes for preparing them, insecticidal compositions and uses thereof, and intermediates therefor |
| EP0014810A3 (en) | 1979-01-18 | 1980-11-26 | Fbc Limited | Pesticidal pyrazoles, their production, compositions and uses, as well as intermediates and their preparation |
| DE3064749D1 (en) * | 1979-07-03 | 1983-10-13 | Duphar Int Res | New pyrazoline derivatives, method of preparing the new compounds, as well as insecticidal composition on the basis of these new compounds |
| US4540706A (en) * | 1981-02-17 | 1985-09-10 | Nissan Chemical Industries Ltd. | Insecticidal 1-N-phenylcarbamoyl-3-(4-difluoromethoxyphenyl)-4-phenyl-2-pyrazoline derivatives |
| US4407813A (en) * | 1981-02-17 | 1983-10-04 | Nissan Chemical Industries Ltd. | Insecticidal pyrazoline derivatives and composition |
| JPS57209275A (en) * | 1981-06-19 | 1982-12-22 | Nissan Chem Ind Ltd | Novel pyrazoline derivative, its preparation, and vermin-controlling agent containing said derivative as active component |
| GB2093836B (en) * | 1981-02-17 | 1984-09-05 | Nissan Chemical Ind Ltd | Insecticidal pyrazoline derivatives |
| EP0065334B1 (en) * | 1981-05-12 | 1985-07-17 | Duphar International Research B.V | New pyrazoline derivatives, method of preparing the new compounds, as well as insecticidal compositions on the basis of these compounds |
| US4663341A (en) * | 1984-02-16 | 1987-05-05 | Rohm And Haas Company | Insecticidal n-aryl-3-aryl-4,5-dihydro-1h-pyrazole-1-carboxamides |
| ZA851044B (en) * | 1984-02-16 | 1986-03-26 | Rohm & Haas | N-aryl-3-aryl-4,5-dihydro-1h-pyrazole-1-carboxamides processes for their production,insecticidal compositions containing them and methods for combatting insects |
| AU556949B2 (en) * | 1984-10-25 | 1986-11-27 | Fmc Corporation | Pyrozoline insecticides |
| EP0182746A3 (de) * | 1984-11-16 | 1988-10-12 | Ciba-Geigy Ag | Pyrazolinderivate |
| US4863947A (en) * | 1985-01-11 | 1989-09-05 | Rohm And Haas | N-aryl-3-aryl-4,5-dihydro-1H-pyrazole-1-carboxamides and methods of their production |
| DE3545786A1 (de) * | 1985-12-21 | 1987-06-25 | Schering Ag | Pyrazolinderivate, ihre herstellung und ihre verwendung als mittel mit insektizider wirkung |
| US5091405A (en) * | 1987-01-05 | 1992-02-25 | E. I. Du Pont De Nemours And Company | Insecticidal pyrazolines |
| US4960784A (en) * | 1987-04-09 | 1990-10-02 | E. I. Du Pont De Nemours And Company | Insecticidal substituted indazoles |
| EP0367796A1 (en) * | 1987-07-17 | 1990-05-16 | E.I. Du Pont De Nemours And Company | Insecticidal pyrazolines |
| EP0300692A1 (en) * | 1987-07-17 | 1989-01-25 | E.I. Du Pont De Nemours And Company | Insecticidal pyrazolines |
| US5116850A (en) * | 1987-11-30 | 1992-05-26 | E. I. Du Pont De Nemours And Co. | Heterocyclic pyrazoline carboxanilides |
| EP0322126A1 (en) * | 1987-11-30 | 1989-06-28 | E.I. Du Pont De Nemours And Company | Heterocyclic pyrazoline carboxanilides |
| AU4316189A (en) * | 1988-09-22 | 1990-04-18 | E.I. Du Pont De Nemours And Company | Substituted indazole arthropodicides |
| ES2072304T3 (es) * | 1988-09-27 | 1995-07-16 | Du Pont | Pirazolinas n-sulfeniladas y n-aciladas. |
| US5591764A (en) * | 1988-09-27 | 1997-01-07 | E. I. Du Pont De Nemours And Company | N-acylated pyrazolines |
| US5491162A (en) * | 1988-09-27 | 1996-02-13 | E. I. Du Pont De Nemours And Company | N-acylated pyrazolines, compositions and use |
| AU4400389A (en) * | 1988-10-11 | 1990-05-01 | E.I. Du Pont De Nemours And Company | Substituted indazoles as arthropodicides |
| DE4032089A1 (de) * | 1990-01-24 | 1991-07-25 | Bayer Ag | Substituierte pyrazolinderivate |
| ES2103794T3 (es) * | 1990-01-31 | 1997-10-01 | Du Pont | Pirazolinas, pirazolidinas e hidrazinas artropodicidas. |
| AU7884691A (en) * | 1990-05-15 | 1991-12-10 | E.I. Du Pont De Nemours And Company | Arthropodicidal tetrahydropyridazines |
| US5798311A (en) * | 1990-07-13 | 1998-08-25 | Rohm And Haas Company | N-aryl-3-aryl-4-substituted-4,5-dihydro-1H-pyrazole-1-carboxamides and methods of their production |
| US5462938A (en) * | 1990-12-21 | 1995-10-31 | Annus; Gary D. | Arthropodicidal oxadiazinyl, thiadiazinyl and triazinyl carboxanilides |
| US5493024A (en) * | 1991-04-11 | 1996-02-20 | Dowelanco | 3,4,N-trisubstituted-4,5-dihydro-1H-pyrazole-1-carboxamides and their use as insectioides |
| US5250532A (en) * | 1991-04-11 | 1993-10-05 | Dowelanco | 3,4,N-trisubstituted-4,5-dihydro-1H-pyrazole-1-carboxamides and their use as insecticides |
| DE4117076A1 (de) * | 1991-05-25 | 1992-11-26 | Bayer Ag | Substituierte 4-hetaryl-pyrazoline |
| DE4217863A1 (de) * | 1991-08-28 | 1993-03-04 | Bayer Ag | Substituierte pyrazoline |
| DE4217862A1 (de) * | 1991-08-28 | 1993-03-04 | Bayer Ag | Substituierte pyrazoline |
| JPH05112556A (ja) * | 1991-10-18 | 1993-05-07 | Nippon Bayeragrochem Kk | 殺虫性ピラゾリン類 |
| US5514678A (en) * | 1992-03-26 | 1996-05-07 | E. I. Du Pont De Nemours And Company | Arthropodicidal 1,2,4-triazinyl amides |
| DE4218745A1 (de) * | 1992-06-04 | 1993-12-09 | Schering Ag | 1-(4-Cyanophenyl-carbamoyl)-pyrazoline |
| US5338856A (en) * | 1992-08-17 | 1994-08-16 | Dowelanco | 3,4-N,trisubstituted-4,5-dihydro-1H-pyrazole-1-carboxamides and their use as insecticides |
| DE4233717A1 (de) * | 1992-10-07 | 1994-04-14 | Bayer Ag | Substituierte 3,4-Hetaryl-pyrazoline |
| DE4410828A1 (de) * | 1994-03-23 | 1995-09-28 | Hoechst Schering Agrevo Gmbh | 1-(4-Isopropoxyphenyl-carbamoyl)-pyrazoline |
| BR0207412A (pt) * | 2001-02-20 | 2004-02-25 | Sagami Chem Res | Derivado de pirazol, seu intermediário, processos para a preparação destes, e herbicida contendo o mesmo como ingrediente ativo |
| ES2229132T3 (es) * | 2001-03-22 | 2005-04-16 | Solvay Pharmaceuticals B.V. | Derivados de 4,5-dihidro-1h-pirazol que tienen actividad como antagonistas de cb1. |
| BR0208253A (pt) * | 2001-09-21 | 2004-04-13 | Solvay Pharm Bv | Compostos, composições farmacêuticas, método de preparação de composições farmacêuticas, processo para preparação de compostos, e, uso de um composto |
| ES2272809T3 (es) * | 2001-09-21 | 2007-05-01 | Solvay Pharm Bv | Nuevos derivados de 4,5-dihidro-1h-pirazol con actividad antagonista de cb1. |
| ES2301717T3 (es) * | 2001-12-18 | 2008-07-01 | F. Hoffmann-La Roche Ag | Cis-2,4,5-trifenil-imidazolinas y su utilizacion para el tratamiento de tumores. |
| US20050239859A2 (en) * | 2003-09-03 | 2005-10-27 | Solvay Pharmaceuticals Gmbh | Novel medical uses of 4,5-dihydro-1h-pyrazole derivatives having cb1- antagonistic activity |
| US20050124660A1 (en) * | 2003-10-27 | 2005-06-09 | Jochen Antel | Novel medical uses of compounds showing CB1-antagonistic activity and combination treatment involving said compounds |
| US20050143441A1 (en) * | 2003-10-27 | 2005-06-30 | Jochen Antel | Novel medical combination treatment of obesity involving 4,5-dihydro-1H-pyrazole derivatives having CB1-antagonistic activity |
| BRPI0517434A (pt) | 2004-10-25 | 2008-10-07 | Solvay Pharm Gmbh | composições farmacêuticas compreendendo antagonistas do receptor canabinóide cb1 e abridores de canal de potássio para o tratamento de diabetes mellitus do tipo i, obesidade e estados relacionados |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795264A (fr) * | 1972-02-09 | 1973-08-09 | Philips Nv | Nouveaux composes de pyrazoline a activite insecticide |
-
1974
- 1974-07-12 NL NL7409433.A patent/NL158178B/xx not_active IP Right Cessation
-
1975
- 1975-07-01 ZA ZA754203A patent/ZA754203B/xx unknown
- 1975-07-03 DE DE2529689A patent/DE2529689C2/de not_active Expired
- 1975-07-08 HU HU75PI478A patent/HU178320B/hu not_active IP Right Cessation
- 1975-07-09 CH CH897775A patent/CH624675A5/de not_active IP Right Cessation
- 1975-07-09 DD DD187199A patent/DD122775A5/xx unknown
- 1975-07-09 AU AU82850/75A patent/AU501280B2/en not_active Expired
- 1975-07-09 GB GB28895/75A patent/GB1514285A/en not_active Expired
- 1975-07-09 DK DK310975AA patent/DK142028B/da not_active IP Right Cessation
- 1975-07-09 IE IE1531/75A patent/IE41836B1/en unknown
- 1975-07-09 IL IL47676A patent/IL47676A/xx unknown
- 1975-07-09 SE SE7507868A patent/SE419644B/xx not_active Application Discontinuation
- 1975-07-09 CS CS754892A patent/CS188962B2/cs unknown
- 1975-07-09 US US05/594,205 patent/US4070365A/en not_active Expired - Lifetime
- 1975-07-09 AT AT529175A patent/AT342585B/de not_active IP Right Cessation
- 1975-07-09 IT IT25233/75A patent/IT1044358B/it active
- 1975-07-09 CA CA231,100A patent/CA1075242A/en not_active Expired
- 1975-07-10 FR FR7521726A patent/FR2277827A1/fr active Granted
- 1975-07-10 BE BE158182A patent/BE831232A/xx not_active IP Right Cessation
- 1975-07-10 YU YU01764/75A patent/YU39003B/xx unknown
- 1975-07-10 ES ES439292A patent/ES439292A1/es not_active Expired
- 1975-07-11 JP JP50085187A patent/JPS6123162B2/ja not_active Expired
- 1975-07-11 BR BR7504413*A patent/BR7504413A/pt unknown
- 1975-07-11 AR AR259546A patent/AR223449A1/es active
- 1975-07-12 PL PL1975193676A patent/PL108983B1/pl not_active IP Right Cessation
- 1975-07-12 EG EG410/75A patent/EG11880A/xx active
- 1975-07-12 PL PL1975182044A patent/PL105891B1/pl unknown
- 1975-07-22 OA OA55557A patent/OA05057A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL108983B1 (en) | Insecticidal agent | |
| RU2058983C1 (ru) | Триазиновое производное, способ его получения и гербицидная композиция на его основе | |
| US4607044A (en) | Insecticidal use of ureas and thioureas | |
| US3933908A (en) | Substituted benzoyl ureas | |
| DK155597B (da) | Urinstofderivater samt insekticidt middel indeholdende disse derivater | |
| US4572914A (en) | Insecticidal 4-substituted-3-chlorophenyl-1-(fluoroalkoxyphenylcarbamoyl)pyrazolines | |
| JPH01502028A (ja) | 殺菌剤組成物 | |
| JP2576865B2 (ja) | 殺虫性n−置換−n′−置換−n,n′−ジアシルヒドラジン | |
| US4396617A (en) | 2-Arylamino-hexahydropyrimidines, compositions containing same, and method of use thereof | |
| DK142985B (da) | Pyrazolinforbindelser til anvendelse som insekticider | |
| IE56589B1 (en) | Benzoylurea compounds,and pesticidal and pharmaceutical compositions comprising same | |
| PT84965B (pt) | Processo para a preparacao de composicoes insecticidas contendo hidrazinas n,n'-dissubstituidas-n'-substituidas-n-(opcionalmente substituidas) insecticidas | |
| NZ229536A (en) | N'-substituted-n'-substituted carbonyl-n-substituted carbonyl-hydrazines and pesticidal compositions | |
| PL136891B1 (en) | Insecticide and method of obtaining new derivatives of benzoyl urea | |
| US3885042A (en) | Benzylidenesemicarbazide compounds having insecticidal activity | |
| US4439440A (en) | 1-Alkoxycarbonylphenylcarbamoyl-3-phenyl-4-cyanoalkyl-2-pyrazolines and use as insecticides | |
| CA1283662C (en) | Benzoyl-ureas exerting an insecticide activity | |
| US4110469A (en) | Insecticidal N-(2,6-dichlorobenzoyl)-N'-(4-cyanophenyl) urea | |
| JP2010527362A (ja) | 殺有害生物用ジアゼンオキシドカルボキシレート | |
| US3266982A (en) | Process for controlling pests | |
| JPH05112405A (ja) | 殺虫組成物 | |
| US3972707A (en) | N-(phenylcarbamoyl)-4-methylpiperidine herbicides compositions and herbicidal method | |
| US5155136A (en) | Fungicidal, 2-acylacetanilide derivatives | |
| IL44426A (en) | 3 - Pyridylmethyl oryl ureas, their preparation and use as rodenticides | |
| IL37390A (en) | Imidazolyl-alkyl-thiophosphates and thiophosphonates,their manufacture and their use as pesticides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Decisions on the lapse of the protection rights |
Effective date: 20030303 |