NO842684L - Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazol-derivater - Google Patents
Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazol-derivaterInfo
- Publication number
- NO842684L NO842684L NO842684A NO842684A NO842684L NO 842684 L NO842684 L NO 842684L NO 842684 A NO842684 A NO 842684A NO 842684 A NO842684 A NO 842684A NO 842684 L NO842684 L NO 842684L
- Authority
- NO
- Norway
- Prior art keywords
- group
- general formula
- imidazo
- phenyl
- methoxy
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims description 6
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 title claims description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical class C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 title description 6
- 230000001225 therapeutic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 37
- 239000002253 acid Substances 0.000 claims description 24
- 150000003839 salts Chemical class 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000006239 protecting group Chemical group 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 230000007062 hydrolysis Effects 0.000 claims description 6
- 238000006460 hydrolysis reaction Methods 0.000 claims description 6
- UBOOKRVGOBKDMM-UHFFFAOYSA-N 3h-imidazo[4,5-c]pyridine Chemical compound C1=NC=C2NC=NC2=C1 UBOOKRVGOBKDMM-UHFFFAOYSA-N 0.000 claims description 5
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 150000002460 imidazoles Chemical class 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 150000001204 N-oxides Chemical class 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 2
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 150000003461 sulfonyl halides Chemical class 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims 1
- CNMIPBGVODYLIH-UHFFFAOYSA-N [3-methoxy-4-(4-oxo-5,6-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CCNC(=O)C2=N1 CNMIPBGVODYLIH-UHFFFAOYSA-N 0.000 claims 1
- 125000003302 alkenyloxy group Chemical group 0.000 claims 1
- -1 cyanomethoxy- Chemical class 0.000 description 37
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- 238000002844 melting Methods 0.000 description 34
- 230000008018 melting Effects 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 235000011121 sodium hydroxide Nutrition 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 150000003222 pyridines Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 241000282326 Felis catus Species 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- SJJGPLWZUFYWCR-UHFFFAOYSA-N [3-methoxy-4-(4-methylsulfonyloxy-1h-imidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate Chemical group COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=C(OS(C)(=O)=O)N=CC=C2N1 SJJGPLWZUFYWCR-UHFFFAOYSA-N 0.000 description 3
- HKXJXKVCVOTVHV-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC(=O)CC=C2N1 HKXJXKVCVOTVHV-UHFFFAOYSA-N 0.000 description 3
- 125000005336 allyloxy group Chemical group 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 229940093915 gynecological organic acid Drugs 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 230000009090 positive inotropic effect Effects 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- MEXHPWWPNJYKEO-UHFFFAOYSA-N 2-(2-methoxy-4-prop-2-ynoxyphenyl)-5,6-dihydroimidazo[4,5-c]pyridin-4-one Chemical compound COC1=CC(OCC#C)=CC=C1C1=NC2=CCNC(=O)C2=N1 MEXHPWWPNJYKEO-UHFFFAOYSA-N 0.000 description 2
- JRZUKLRCYKYZPQ-UHFFFAOYSA-N 2-(4-hydroxy-2-methoxyphenyl)-5,6-dihydroimidazo[4,5-c]pyridin-4-one Chemical compound COC1=C(C=CC(=C1)O)C1=NC=2C(C(NCC2)=O)=N1 JRZUKLRCYKYZPQ-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- DABCGSNISCRNJM-UHFFFAOYSA-N [2-(4-hydroxy-2-methoxyphenyl)-1H-imidazo[4,5-b]pyridin-5-yl] methanesulfonate Chemical compound COC1=CC(O)=CC=C1C1=NC2=NC(OS(C)(=O)=O)=CC=C2N1 DABCGSNISCRNJM-UHFFFAOYSA-N 0.000 description 2
- HXKMITBUQVIBLB-UHFFFAOYSA-N [3-methoxy-4-(4-oxo-5,6-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate;hydrochloride Chemical compound Cl.COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CCNC(=O)C2=N1 HXKMITBUQVIBLB-UHFFFAOYSA-N 0.000 description 2
- KYEODLZUNTVZBT-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-3,6-dihydroimidazo[4,5-b]pyrazin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NCC(=O)N=C2N1 KYEODLZUNTVZBT-UHFFFAOYSA-N 0.000 description 2
- OVGNDXKPXSXHQQ-UHFFFAOYSA-N [3-methoxy-4-(6-methylsulfonyloxy-7h-purin-8-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC=NC(OS(C)(=O)=O)=C2N1 OVGNDXKPXSXHQQ-UHFFFAOYSA-N 0.000 description 2
- HFEMDDAFRQKFNR-UHFFFAOYSA-N [3-methoxy-4-(6-oxopurin-8-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC=NC(=O)C2=N1 HFEMDDAFRQKFNR-UHFFFAOYSA-N 0.000 description 2
- XWXCBUXGYBVSQR-UHFFFAOYSA-N [4-(2,6-dioxo-3,7-dihydropurin-8-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C(N1)=NC2=C1C(=O)NC(=O)N2 XWXCBUXGYBVSQR-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- UKTFBYCJQQKDDX-UHFFFAOYSA-N imidazo[4,5-b]pyrazin-5-one Chemical class O=C1C=NC2=NC=NC2=N1 UKTFBYCJQQKDDX-UHFFFAOYSA-N 0.000 description 2
- BSMNACCHROZNHW-UHFFFAOYSA-N imidazo[4,5-b]pyridin-5-one Chemical class O=C1C=CC2=NC=NC2=N1 BSMNACCHROZNHW-UHFFFAOYSA-N 0.000 description 2
- PPNFWYUJXHAZIN-UHFFFAOYSA-N imidazo[4,5-c]pyridin-4-one Chemical class O=C1N=CC=C2N=CN=C12 PPNFWYUJXHAZIN-UHFFFAOYSA-N 0.000 description 2
- WEWYWHHXRWFWFC-UHFFFAOYSA-N imidazo[4,5-c]pyridin-6-one Chemical class C1=NC(=O)C=C2N=CN=C21 WEWYWHHXRWFWFC-UHFFFAOYSA-N 0.000 description 2
- KVOVCEPPQJRTOB-UHFFFAOYSA-N imidazo[4,5-d]pyridazin-4-one Chemical class O=C1N=NC=C2N=CN=C12 KVOVCEPPQJRTOB-UHFFFAOYSA-N 0.000 description 2
- YFFVDIZCICRYFW-UHFFFAOYSA-N imidazo[4,5-d]triazin-6-one Chemical class C1=NN=NC2=NC(=O)N=C21 YFFVDIZCICRYFW-UHFFFAOYSA-N 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- FMZPGYCNFUIWBY-UHFFFAOYSA-N n-[3-(dimethylamino)-4-(2,6-dioxo-3,7-dihydropurin-8-yl)phenyl]methanesulfonamide Chemical compound CN(C)C1=CC(NS(C)(=O)=O)=CC=C1C(N1)=NC2=C1C(=O)NC(=O)N2 FMZPGYCNFUIWBY-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- UFZNZKGKBWOSJG-UHFFFAOYSA-N purin-2-one Chemical class O=C1N=CC2=NC=NC2=N1 UFZNZKGKBWOSJG-UHFFFAOYSA-N 0.000 description 2
- UYLWKSJTHLRFBX-UHFFFAOYSA-N purin-6-one Chemical class O=C1N=CN=C2N=CN=C12 UYLWKSJTHLRFBX-UHFFFAOYSA-N 0.000 description 2
- FAIAJSOSTNJZCI-UHFFFAOYSA-N purine-2,6-dione Chemical class O=C1NC(=O)C2=NC=NC2=N1 FAIAJSOSTNJZCI-UHFFFAOYSA-N 0.000 description 2
- 150000003216 pyrazines Chemical class 0.000 description 2
- 150000004892 pyridazines Chemical class 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- XCPBURWDJUJQPS-UHFFFAOYSA-N (5,6-diaminopyridin-3-yl) acetate Chemical compound CC(=O)OC1=CN=C(N)C(N)=C1 XCPBURWDJUJQPS-UHFFFAOYSA-N 0.000 description 1
- JLKCVUZFBPLUQH-UHFFFAOYSA-N 1h-imidazo[4,5-b]pyridin-6-ol Chemical class OC1=CN=C2N=CNC2=C1 JLKCVUZFBPLUQH-UHFFFAOYSA-N 0.000 description 1
- JEQKTDSQNFCOMT-UHFFFAOYSA-N 2-(4-hydroxy-2-methoxyphenyl)-1,6-dihydroimidazo[4,5-b]pyridin-5-one Chemical compound COC1=C(C=CC(=C1)O)C1=NC=2C(NC(CC2)=O)=N1 JEQKTDSQNFCOMT-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- MVVKCHVGSVDVFT-UHFFFAOYSA-N 2-[3-methoxy-4-(4-oxo-5,6-dihydroimidazo[4,5-c]pyridin-2-yl)phenoxy]acetonitrile Chemical compound COC1=CC(OCC#N)=CC=C1C1=NC2=CCNC(=O)C2=N1 MVVKCHVGSVDVFT-UHFFFAOYSA-N 0.000 description 1
- OVBFXTADOCCRBP-UHFFFAOYSA-N 2-chloro-1h-imidazo[4,5-b]pyrazine Chemical class C1=CN=C2NC(Cl)=NC2=N1 OVBFXTADOCCRBP-UHFFFAOYSA-N 0.000 description 1
- XUHHSPBXCSZTCP-UHFFFAOYSA-N 2-chloro-1h-imidazo[4,5-d]pyridazine Chemical class N1=NC=C2NC(Cl)=NC2=C1 XUHHSPBXCSZTCP-UHFFFAOYSA-N 0.000 description 1
- JBMBVWROWJGFMG-UHFFFAOYSA-N 2-chloro-7h-purine Chemical class ClC1=NC=C2NC=NC2=N1 JBMBVWROWJGFMG-UHFFFAOYSA-N 0.000 description 1
- MLSNHDGPZWTQPR-UHFFFAOYSA-N 2-chloro-8-(2-methoxy-4-prop-2-ynoxyphenyl)-7h-purine Chemical compound COC1=CC(OCC#C)=CC=C1C1=NC2=NC(Cl)=NC=C2N1 MLSNHDGPZWTQPR-UHFFFAOYSA-N 0.000 description 1
- SYMQORWZHFIDSO-UHFFFAOYSA-N 2-methoxy-8-(2-methoxy-4-prop-2-ynoxyphenyl)-7h-purine Chemical compound N=1C2=NC(OC)=NC=C2NC=1C1=CC=C(OCC#C)C=C1OC SYMQORWZHFIDSO-UHFFFAOYSA-N 0.000 description 1
- BJMSTOPYTOXAFM-UHFFFAOYSA-N 2-methoxy-n-(3-nitro-6-oxo-1h-pyridin-2-yl)-4-phenylmethoxybenzamide Chemical compound C=1C=C(C(=O)NC2=C(C=CC(=O)N2)[N+]([O-])=O)C(OC)=CC=1OCC1=CC=CC=C1 BJMSTOPYTOXAFM-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- XWNKHKFVVGKLJS-UHFFFAOYSA-N 3-chloro-5h-imidazo[4,5-c]pyridazine Chemical class N1=NC(Cl)=CC2=C1N=CN2 XWNKHKFVVGKLJS-UHFFFAOYSA-N 0.000 description 1
- CQEWZNMGBUSCPC-UHFFFAOYSA-N 3h-imidazo[4,5-c]pyridin-7-ol Chemical class OC1=CN=CC2=C1NC=N2 CQEWZNMGBUSCPC-UHFFFAOYSA-N 0.000 description 1
- AKHVPZOYHZAQQC-UHFFFAOYSA-N 4-(methanesulfonamido)-2-methoxybenzoic acid Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C(O)=O AKHVPZOYHZAQQC-UHFFFAOYSA-N 0.000 description 1
- GLHJQPGLPHZVLC-UHFFFAOYSA-N 8-(2-methoxy-4-phenylmethoxyphenyl)-2-phenylmethoxy-7h-purine Chemical compound C=1C=C(C=2NC3=CN=C(OCC=4C=CC=CC=4)N=C3N=2)C(OC)=CC=1OCC1=CC=CC=C1 GLHJQPGLPHZVLC-UHFFFAOYSA-N 0.000 description 1
- KUTIPOUYUZJYDY-UHFFFAOYSA-N 8-(4-hydroxy-2-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione Chemical compound COC1=CC(O)=CC=C1C(N1)=NC2=C1C(=O)N(C)C(=O)N2C KUTIPOUYUZJYDY-UHFFFAOYSA-N 0.000 description 1
- HFSXYEHZVQIGOX-UHFFFAOYSA-N 8-(4-hydroxy-2-methoxyphenyl)purin-2-one Chemical compound COC1=CC(O)=CC=C1C1=NC2=NC(=O)N=CC2=N1 HFSXYEHZVQIGOX-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- WUIDOCJQTMSLGG-UHFFFAOYSA-N COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=[N+]([O-])C=CC=C2N1 Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=[N+]([O-])C=CC=C2N1 WUIDOCJQTMSLGG-UHFFFAOYSA-N 0.000 description 1
- NIXXRLPNPRHRGY-UHFFFAOYSA-N COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=[N+]([O-])C=CN=C2N1 Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=[N+]([O-])C=CN=C2N1 NIXXRLPNPRHRGY-UHFFFAOYSA-N 0.000 description 1
- 208000020446 Cardiac disease Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- AMUJREGSDAHROB-UHFFFAOYSA-N [3-(dimethylamino)-4-(4-oxo-5,6-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate Chemical compound CN(C)C1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CCNC(=O)C2=N1 AMUJREGSDAHROB-UHFFFAOYSA-N 0.000 description 1
- WWKVAFXQEFXMQX-UHFFFAOYSA-N [3-ethoxy-4-(2-methoxy-7h-purin-8-yl)phenyl] methanesulfonate Chemical compound CCOC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC(OC)=NC=C2N1 WWKVAFXQEFXMQX-UHFFFAOYSA-N 0.000 description 1
- YHSLXXUFOISCIW-UHFFFAOYSA-N [3-methoxy-4-(4-oxoimidazo[4,5-d]pyridazin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CN=NC(=O)C2=N1 YHSLXXUFOISCIW-UHFFFAOYSA-N 0.000 description 1
- OCJZMRCGDZYZHL-UHFFFAOYSA-N [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazol-2-yl)phenyl] methanesulfonate Chemical compound COC1=C(C=CC(=C1)OS(=O)(=O)C)C=1NC(=CN=1)OS(=O)(=O)C OCJZMRCGDZYZHL-UHFFFAOYSA-N 0.000 description 1
- BPCWNIPQFBVRID-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl] butane-1-sulfonate Chemical compound COC1=CC(OS(=O)(=O)CCCC)=CC=C1C1=NC2=CCC(=O)NC2=N1 BPCWNIPQFBVRID-UHFFFAOYSA-N 0.000 description 1
- BSFLSXBSZDZHOS-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl] ethanesulfonate Chemical compound COC1=CC(OS(=O)(=O)CC)=CC=C1C1=NC2=NC(=O)CC=C2N1 BSFLSXBSZDZHOS-UHFFFAOYSA-N 0.000 description 1
- UVRNQOOSPBUAEA-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl] propane-1-sulfonate Chemical compound COC1=CC(OS(=O)(=O)CCC)=CC=C1C1=NC2=NC(=O)CC=C2N1 UVRNQOOSPBUAEA-UHFFFAOYSA-N 0.000 description 1
- HPDAOXRWNIJVLN-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl] propane-2-sulfonate Chemical compound COC1=CC(OS(=O)(=O)C(C)C)=CC=C1C1=NC2=NC(=O)CC=C2N1 HPDAOXRWNIJVLN-UHFFFAOYSA-N 0.000 description 1
- CLIUJTQRPJTGAM-UHFFFAOYSA-N [3-methoxy-4-(6-methoxy-3h-imidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate Chemical compound N=1C=2C=NC(OC)=CC=2NC=1C1=CC=C(OS(C)(=O)=O)C=C1OC CLIUJTQRPJTGAM-UHFFFAOYSA-N 0.000 description 1
- HRFHYARUPZZKNL-UHFFFAOYSA-N [3-methoxy-4-(6-methylsulfonyloxy-1h-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC=C(OS(C)(=O)=O)C=C2N1 HRFHYARUPZZKNL-UHFFFAOYSA-N 0.000 description 1
- GOYSDRVJCFLHKV-UHFFFAOYSA-N [3-methoxy-4-(6-oxo-4,5-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CC(=O)NCC2=N1 GOYSDRVJCFLHKV-UHFFFAOYSA-N 0.000 description 1
- AULJMWNNYDFMKN-UHFFFAOYSA-N [4-(1,3-dimethyl-2,6-dioxo-7h-purin-8-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C(N1)=NC2=C1C(=O)N(C)C(=O)N2C AULJMWNNYDFMKN-UHFFFAOYSA-N 0.000 description 1
- DMKNGXHLCBNJKM-UHFFFAOYSA-N [4-(1h-imidazo[4,5-b]pyridin-2-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC=CC=C2N1 DMKNGXHLCBNJKM-UHFFFAOYSA-N 0.000 description 1
- MPYUXYMLZODTOU-UHFFFAOYSA-N [4-(2-methoxy-7h-purin-8-yl)-3-propoxyphenyl] methanesulfonate Chemical compound CCCOC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC(OC)=NC=C2N1 MPYUXYMLZODTOU-UHFFFAOYSA-N 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 210000000702 aorta abdominal Anatomy 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000004531 blood pressure lowering effect Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 230000002425 cardiocirculatory effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- YLQDNIMRFKQQEO-UHFFFAOYSA-N ethyl 2-[3-methoxy-4-(4-oxo-5,6-dihydroimidazo[4,5-c]pyridin-2-yl)phenoxy]acetate Chemical compound COC1=CC(OCC(=O)OCC)=CC=C1C1=NC2=CCNC(=O)C2=N1 YLQDNIMRFKQQEO-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 210000003191 femoral vein Anatomy 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000010247 heart contraction Effects 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- RZIDZGVHONJKMO-UHFFFAOYSA-N imidazo[4,5-b]pyridin-7-one Chemical class O=C1C=CN=C2N=CN=C12 RZIDZGVHONJKMO-UHFFFAOYSA-N 0.000 description 1
- FIJNUMPUCGUJLV-UHFFFAOYSA-N imidazo[4,5-c]pyridazin-6-one Chemical class C1=CN=NC2=NC(=O)N=C21 FIJNUMPUCGUJLV-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 210000005240 left ventricle Anatomy 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- XMZUQBFADVCNBR-UHFFFAOYSA-N n-(3-amino-6-oxo-1h-pyridin-2-yl)-4-(methanesulfonamido)-2-methoxybenzamide Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C(=O)NC1=C(N)C=CC(=O)N1 XMZUQBFADVCNBR-UHFFFAOYSA-N 0.000 description 1
- CZOVDZHIUWACHV-UHFFFAOYSA-N n-[3-(dimethylamino)-4-(1,3-dimethyl-2,6-dioxo-7h-purin-8-yl)phenyl]methanesulfonamide Chemical compound CN(C)C1=CC(NS(C)(=O)=O)=CC=C1C(N1)=NC2=C1C(=O)N(C)C(=O)N2C CZOVDZHIUWACHV-UHFFFAOYSA-N 0.000 description 1
- XJBIHDXPFGICHB-UHFFFAOYSA-N n-[3-(dimethylamino)-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl]methanesulfonamide Chemical compound CN(C)C1=CC(NS(C)(=O)=O)=CC=C1C1=NC2=NC(=O)CC=C2N1 XJBIHDXPFGICHB-UHFFFAOYSA-N 0.000 description 1
- ZVYFWZYDQJABKV-UHFFFAOYSA-N n-[3-methoxy-4-(4-oxoimidazo[4,5-d]pyridazin-2-yl)phenyl]methanesulfonamide Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C1=NC2=CN=NC(=O)C2=N1 ZVYFWZYDQJABKV-UHFFFAOYSA-N 0.000 description 1
- WHNHGDBDKOZEAD-UHFFFAOYSA-N n-[3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl]methanesulfonamide Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C1=NC2=NC(=O)CC=C2N1 WHNHGDBDKOZEAD-UHFFFAOYSA-N 0.000 description 1
- ZKZWLCWFCICZDG-UHFFFAOYSA-N n-[4-(6-hydroxy-1h-imidazo[4,5-b]pyridin-2-yl)-3-methoxyphenyl]methanesulfonamide Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C1=NC2=NC=C(O)C=C2N1 ZKZWLCWFCICZDG-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000500 noncardiotoxic Toxicity 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229960002275 pentobarbital sodium Drugs 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
- C07D473/08—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3 with methyl radicals in positions 1 and 3, e.g. theophylline
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/28—Oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/28—Oxygen atom
- C07D473/30—Oxygen atom attached in position 6, e.g. hypoxanthine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/40—Heterocyclic compounds containing purine ring systems with halogen atoms or perhalogeno-alkyl radicals directly attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- Heart & Thoracic Surgery (AREA)
- General Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Hospice & Palliative Care (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833324115 DE3324115A1 (de) | 1983-07-05 | 1983-07-05 | Neue imidazole, ihre herstellung und diese verbindungen enthaltende arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO842684L true NO842684L (no) | 1985-01-07 |
Family
ID=6203136
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO842684A NO842684L (no) | 1983-07-05 | 1984-07-03 | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazol-derivater |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US4670438A (lt) |
| EP (1) | EP0130461A3 (lt) |
| JP (1) | JPS6036486A (lt) |
| KR (1) | KR850001208A (lt) |
| AU (1) | AU3032384A (lt) |
| DD (1) | DD224851A5 (lt) |
| DE (1) | DE3324115A1 (lt) |
| DK (1) | DK326484A (lt) |
| ES (4) | ES533995A0 (lt) |
| FI (1) | FI842666A7 (lt) |
| GR (1) | GR82380B (lt) |
| HU (1) | HU194878B (lt) |
| IL (1) | IL72298A0 (lt) |
| NO (1) | NO842684L (lt) |
| NZ (1) | NZ208779A (lt) |
| PH (1) | PH21496A (lt) |
| PT (1) | PT78836B (lt) |
| ZA (1) | ZA845103B (lt) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3346640A1 (de) * | 1983-12-23 | 1985-07-04 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue imidazolderivate, deren herstellung und diese verbindungen enthaltende arzneimittel |
| DE3445299A1 (de) * | 1984-12-12 | 1986-06-19 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue imidazoderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| DE3522230A1 (de) * | 1985-06-21 | 1987-01-02 | Thomae Gmbh Dr K | Neue 2-arylimidazole, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| US4783530A (en) * | 1986-11-13 | 1988-11-08 | Marion Laboratories, Inc. | 8-arylxanthines |
| GB8804016D0 (en) * | 1988-02-22 | 1988-03-23 | Boots Co Plc | Therapeutic agents |
| DE3929864A1 (de) * | 1989-09-08 | 1991-03-14 | Nordmark Arzneimittel Gmbh | Verfahren zur herstellung von theophyllin-pellets |
| EP0434038A1 (en) * | 1989-12-22 | 1991-06-26 | Takeda Chemical Industries, Ltd. | Fused imidazole derivatives, their production and use |
| US5877176A (en) * | 1991-12-26 | 1999-03-02 | Cornell Research Foundation, Inc. | Blocking induction of tetrahydrobiopterin to block induction of nitric oxide synthesis |
| JP2534423B2 (ja) * | 1991-12-26 | 1996-09-18 | コーネル・リサーチ・ファンデーション・インコーポレイテッド | 酸化窒素の過剰生産から生じる血管失調を阻止する阻害剤 |
| EP0577025A3 (de) * | 1992-07-01 | 1998-02-04 | Hoechst Aktiengesellschaft | Angiotensin-II-Rezeptorantagonisten zur Behandlung und Prophylaxe von koronaren Herzerkrankungen |
| EP0686157A1 (en) * | 1993-02-26 | 1995-12-13 | Schering Corporation | 2-benzyl-polycyclic guanine derivatives and process for preparing them |
| CA2131134A1 (en) * | 1993-09-17 | 1995-03-18 | Gerhard Stucky | Process for preparing imidazopyridine derivatives |
| CA2131680C (en) * | 1993-09-17 | 2006-11-07 | Gerhard Stucky | Process for preparing imidazopyridine derivatives |
| US5502050A (en) * | 1993-11-29 | 1996-03-26 | Cornell Research Foundation, Inc. | Blocking utilization of tetrahydrobiopterin to block induction of nitric oxide synthesis |
| US6887690B2 (en) * | 2001-06-22 | 2005-05-03 | Pe Corporation | Dye-labeled ribonucleotide triphosphates |
| JP4127204B2 (ja) * | 2003-12-17 | 2008-07-30 | セイコーエプソン株式会社 | 液晶表示装置の製造方法 |
| CA2642813A1 (en) * | 2006-02-28 | 2007-09-07 | Merck & Co., Inc. | Inhibitors of histone deacetylase |
| EP2170076B1 (en) * | 2007-06-27 | 2016-05-18 | Merck Sharp & Dohme Corp. | 4-carboxybenzylamino derivatives as histone deacetylase inhibitors |
| JP2010531358A (ja) * | 2007-06-27 | 2010-09-24 | メルク・シャープ・エンド・ドーム・コーポレイション | ヒストン脱アセチル化酵素阻害剤としてのピリジル及びピリミジニル誘導体 |
| US20090197880A1 (en) * | 2007-07-13 | 2009-08-06 | Genelabs Technologies, Inc. | Anti-viral compounds, compositions, and methods of use |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3660397A (en) * | 1970-04-17 | 1972-05-02 | Merck & Co Inc | Imidazo(4 5-b)pyrazines |
| US3922345A (en) * | 1971-10-29 | 1975-11-25 | Pfizer | Pyrimidinones and hydroxy pyrimidines |
| DE2305339C3 (de) * | 1973-02-03 | 1980-05-08 | Dr. Karl Thomae Gmbh, 7950 Biberach | Imidazo [4,5-b] pyridine, ihre Herstellung und ihre Verwendung als Cardiötonica |
| US3985891A (en) * | 1973-02-03 | 1976-10-12 | Boehringer Ingelheim Gmbh | 2-Phenyl-imidazo (4,5-b)pyridines and salts thereof |
| EP0011399A1 (en) * | 1978-11-11 | 1980-05-28 | FISONS plc | N-substituted theophyllines, processes for their preparation and pharmaceutical compositions containing them |
| DE2927987A1 (de) * | 1979-07-11 | 1981-02-05 | Thomae Gmbh Dr K | Neue 2-alkoxyphenyl-imidazo eckige klammer auf 4,5-b eckige klammer zu pyridine, deren herstellung und deren verwendung als arzneimittel |
| DE2927988A1 (de) * | 1979-07-11 | 1981-02-05 | Thomae Gmbh Dr K | Neue 8-phenyl-purine, deren herstellung und deren verwendung als arzneimittel |
| DE3037464A1 (de) * | 1980-10-03 | 1982-05-19 | Dr. Karl Thomae Gmbh, 7950 Biberach | 6-hydroxy-2-phenyl-imidazo 4,5-b zu pyridine, ihre herstellung und diese sie enthaltende arzneimittel |
| DE3044497A1 (de) * | 1980-11-26 | 1982-06-24 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neues verfahren zur herstellung von imidazo(4,5-b)pyridinen und -pyrimidinen |
| GB2091249A (en) * | 1980-12-23 | 1982-07-28 | Fordonal Sa | Xanthine derivatives |
| EP0072926B1 (de) * | 1981-08-19 | 1986-09-24 | MERCK PATENT GmbH | 2-Aryl-imidazopyridine |
| ES517193A0 (es) * | 1981-11-10 | 1983-12-01 | Wellcome Found | Un procedimiento para la preparacion de nuevos derivados de imidazo (4,5-c)piridina. |
| US4452788A (en) * | 1982-04-21 | 1984-06-05 | Warner-Lambert Company | Substituted 8-phenylxanthines |
| IL68495A0 (en) * | 1982-05-03 | 1983-07-31 | Lilly Co Eli | 2-phenylimidazo(4,5-c)pyridines |
| DE3217583A1 (de) * | 1982-05-11 | 1983-11-17 | Merck Patent Gmbh, 6100 Darmstadt | 2-aryl-tetraazaindene |
| DE3224512A1 (de) * | 1982-07-01 | 1984-01-05 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue imidazolderivate, ihre herstellung und diese verbindungen enthaltende arzneimittel |
-
1983
- 1983-07-05 DE DE19833324115 patent/DE3324115A1/de not_active Withdrawn
-
1984
- 1984-06-19 EP EP84107002A patent/EP0130461A3/de not_active Withdrawn
- 1984-06-22 US US06/623,718 patent/US4670438A/en not_active Expired - Fee Related
- 1984-06-29 PH PH30905A patent/PH21496A/en unknown
- 1984-07-02 GR GR75159A patent/GR82380B/el unknown
- 1984-07-03 DD DD84264889A patent/DD224851A5/de unknown
- 1984-07-03 FI FI842666A patent/FI842666A7/fi not_active Application Discontinuation
- 1984-07-03 NO NO842684A patent/NO842684L/no unknown
- 1984-07-03 PT PT78836A patent/PT78836B/pt unknown
- 1984-07-03 DK DK326484A patent/DK326484A/da not_active Application Discontinuation
- 1984-07-04 IL IL72298A patent/IL72298A0/xx unknown
- 1984-07-04 KR KR1019840003852A patent/KR850001208A/ko not_active Withdrawn
- 1984-07-04 JP JP59137395A patent/JPS6036486A/ja active Pending
- 1984-07-04 ZA ZA845103A patent/ZA845103B/xx unknown
- 1984-07-04 HU HU842616A patent/HU194878B/hu unknown
- 1984-07-04 NZ NZ208779A patent/NZ208779A/en unknown
- 1984-07-04 ES ES533995A patent/ES533995A0/es active Granted
- 1984-07-05 AU AU30323/84A patent/AU3032384A/en not_active Abandoned
-
1985
- 1985-03-28 ES ES541661A patent/ES541661A0/es active Granted
- 1985-03-28 ES ES541662A patent/ES8603480A1/es not_active Expired
- 1985-03-28 ES ES541660A patent/ES541660A0/es active Granted
-
1987
- 1987-01-28 US US07/007,530 patent/US4766130A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0130461A3 (de) | 1987-05-06 |
| ES8506017A1 (es) | 1985-06-16 |
| IL72298A0 (en) | 1984-11-30 |
| JPS6036486A (ja) | 1985-02-25 |
| GR82380B (lt) | 1984-12-13 |
| DK326484A (da) | 1985-01-06 |
| ES8603478A1 (es) | 1985-12-16 |
| ES541662A0 (es) | 1985-12-16 |
| ES8603480A1 (es) | 1985-12-16 |
| PH21496A (en) | 1987-11-10 |
| KR850001208A (ko) | 1985-03-16 |
| FI842666A0 (fi) | 1984-07-03 |
| AU3032384A (en) | 1985-01-10 |
| US4670438A (en) | 1987-06-02 |
| FI842666A7 (fi) | 1985-01-06 |
| ES541660A0 (es) | 1985-12-16 |
| ES8603479A1 (es) | 1985-12-16 |
| DK326484D0 (da) | 1984-07-03 |
| ES541661A0 (es) | 1985-12-16 |
| ZA845103B (en) | 1986-03-26 |
| HU194878B (en) | 1988-03-28 |
| DE3324115A1 (de) | 1985-01-17 |
| PT78836A (de) | 1984-08-01 |
| DD224851A5 (de) | 1985-07-17 |
| HUT34475A (en) | 1985-03-28 |
| US4766130A (en) | 1988-08-23 |
| NZ208779A (en) | 1988-02-29 |
| PT78836B (de) | 1986-10-21 |
| ES533995A0 (es) | 1985-06-16 |
| EP0130461A2 (de) | 1985-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO842684L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazol-derivater | |
| US4582837A (en) | Imidazo[4,5-b] and [4,5-c]pyridine derivatives having cardiotonic activity | |
| FI92697C (fi) | Menetelmä lääkeaineina käyttökelpoisten imidatso/4,5-b/kinolinyylioksialkaanihappoamidien valmistamiseksi | |
| AU592983B2 (en) | Imidazoquinoline antithrombogenic cardiotonicagents | |
| KR900008567B1 (ko) | 이미다조키놀리닐에테르 유도체의 제조방법 | |
| AU628913B2 (en) | Pyrazolopyridine compound and processes for preparation thereof | |
| EP0370381B1 (en) | 2(1H)-quinolinone compounds, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| US4722929A (en) | Novel 2-phenyl-imidazoles and pharmaceutical compositions containing same | |
| NO862477L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-arylimidazol-derivater. | |
| US5354759A (en) | Angiotenin II antagonizing heterocyclic compounds | |
| IE861104L (en) | Xanthines | |
| WO2006026760A2 (en) | 1-amino imidazo-containing compounds and methods | |
| NO316564B1 (no) | Fremgangsmåte til fremstilling av imidazokinolinaminer | |
| PL171766B1 (pl) | Sposób wytwarzania imidazo-skondensowanych zwiazków izo-i heterocyklicznych PL PL | |
| IE63502B1 (en) | Aminopyrimidine derivatives useful for treating cardiovascular disorders | |
| DE69713255T2 (de) | Pharmazeutische Pyridin-Derivate, ihre Herstellungsverfahren und Zwischenprodukte dafür | |
| NZ233047A (en) | Heterocyclic derivatives of diazepine and pharmaceutical compositions | |
| NO855196L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazoderivater. | |
| US4284768A (en) | 1,2-Dihydro-4-amino-2-oxo-3-quinoline-carboxylic acid derivatives | |
| NO152373B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive 8-fenyl-purin-derivater | |
| NO854964L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazoderivater. | |
| EP0594883B1 (en) | Imidazo(1,2-c) quinazoline derivatives as antihypertensives and anti dysurics | |
| NO845169L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive benzimidazol-derivater | |
| CS220343B2 (en) | Method of producing new imidazoquinazoline derivatives | |
| CZ22697A3 (en) | Imidazopyridine-azolidinone derivatives, process of their preparation and pharmaceutical composition containing thereof |