NO841656L - Dihydropyridiner og fremgangsmaate for deres fremstilling - Google Patents
Dihydropyridiner og fremgangsmaate for deres fremstillingInfo
- Publication number
- NO841656L NO841656L NO841656A NO841656A NO841656L NO 841656 L NO841656 L NO 841656L NO 841656 A NO841656 A NO 841656A NO 841656 A NO841656 A NO 841656A NO 841656 L NO841656 L NO 841656L
- Authority
- NO
- Norway
- Prior art keywords
- alkyl
- formula
- compound
- methyl
- groups
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 64
- 238000002360 preparation method Methods 0.000 title claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 195
- 125000000217 alkyl group Chemical group 0.000 claims description 62
- 239000000203 mixture Substances 0.000 claims description 51
- -1 2-nitrophenyl Chemical group 0.000 claims description 47
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 44
- 229910052739 hydrogen Inorganic materials 0.000 claims description 35
- 229910052736 halogen Inorganic materials 0.000 claims description 24
- 150000002367 halogens Chemical class 0.000 claims description 23
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 22
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 20
- 239000001257 hydrogen Substances 0.000 claims description 19
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 18
- 229910052757 nitrogen Inorganic materials 0.000 claims description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 15
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 15
- 239000000047 product Substances 0.000 claims description 14
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 125000004076 pyridyl group Chemical group 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 229910021529 ammonia Inorganic materials 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- 125000004429 atom Chemical group 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 125000000623 heterocyclic group Chemical group 0.000 claims description 7
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 7
- 230000003287 optical effect Effects 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000004601 benzofurazanyl group Chemical group N1=C2C(=NO1)C(=CC=C2)* 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000006575 electron-withdrawing group Chemical group 0.000 claims description 6
- 230000007062 hydrolysis Effects 0.000 claims description 6
- 238000006460 hydrolysis reaction Methods 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 230000032050 esterification Effects 0.000 claims description 5
- 238000005886 esterification reaction Methods 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 4
- 230000018044 dehydration Effects 0.000 claims description 4
- 238000006297 dehydration reaction Methods 0.000 claims description 4
- 239000011737 fluorine Chemical group 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 125000001207 fluorophenyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 239000012467 final product Substances 0.000 claims description 3
- 239000012025 fluorinating agent Substances 0.000 claims description 3
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 238000006894 reductive elimination reaction Methods 0.000 claims description 3
- 238000005809 transesterification reaction Methods 0.000 claims description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 2
- RDOAUPPSCNSYPM-UHFFFAOYSA-N 3,4-dihydropyridine Chemical compound C1CC=NC=C1 RDOAUPPSCNSYPM-UHFFFAOYSA-N 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 125000004965 chloroalkyl group Chemical group 0.000 claims description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 125000006299 oxetan-3-yl group Chemical group [H]C1([H])OC([H])([H])C1([H])* 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims description 2
- 238000007254 oxidation reaction Methods 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 2
- OBWJAVIHPMZUHG-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 4-[3-chloro-6-fluoro-2-(trifluoromethyl)phenyl]-2-(fluoromethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=C(F)C=CC(Cl)=C1C(F)(F)F OBWJAVIHPMZUHG-UHFFFAOYSA-N 0.000 claims 1
- 125000004953 trihalomethyl group Chemical group 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 180
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 137
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 111
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 99
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 83
- 239000000243 solution Substances 0.000 description 77
- 239000003208 petroleum Substances 0.000 description 69
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 58
- 239000002904 solvent Substances 0.000 description 56
- 239000000377 silicon dioxide Substances 0.000 description 28
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- 239000007787 solid Substances 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 23
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 22
- 239000003921 oil Substances 0.000 description 22
- 235000019198 oils Nutrition 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 21
- 238000003756 stirring Methods 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 18
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 17
- 239000013078 crystal Substances 0.000 description 17
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- 238000002425 crystallisation Methods 0.000 description 12
- 230000008025 crystallization Effects 0.000 description 12
- 239000007858 starting material Substances 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 11
- 235000019341 magnesium sulphate Nutrition 0.000 description 11
- 229910052938 sodium sulfate Inorganic materials 0.000 description 11
- 235000011152 sodium sulphate Nutrition 0.000 description 11
- 238000004587 chromatography analysis Methods 0.000 description 10
- 239000011780 sodium chloride Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 9
- OJYJRDRXGWCIND-UHFFFAOYSA-N methyl 4-fluoro-3-oxobutanoate Chemical compound COC(=O)CC(=O)CF OJYJRDRXGWCIND-UHFFFAOYSA-N 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000003085 diluting agent Substances 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- 239000012230 colorless oil Substances 0.000 description 7
- 238000004128 high performance liquid chromatography Methods 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- LLMLNAVBOAMOEE-UHFFFAOYSA-N 2,3-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1Cl LLMLNAVBOAMOEE-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 6
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 6
- 238000010828 elution Methods 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 229920002472 Starch Polymers 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 5
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 5
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 5
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 5
- FHKBJKAOJUUUET-UHFFFAOYSA-N methyl 3-amino-4-fluorobut-2-enoate Chemical compound COC(=O)C=C(N)CF FHKBJKAOJUUUET-UHFFFAOYSA-N 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 235000019698 starch Nutrition 0.000 description 5
- VXSSXXLQZFRPHI-UHFFFAOYSA-N 3-chloro-6-fluoro-2-(trifluoromethyl)benzaldehyde Chemical compound FC1=CC=C(Cl)C(C(F)(F)F)=C1C=O VXSSXXLQZFRPHI-UHFFFAOYSA-N 0.000 description 4
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- YCKAGGHNUHZKCL-UHFFFAOYSA-N propan-2-yl 3-aminobut-2-enoate Chemical compound CC(C)OC(=O)C=C(C)N YCKAGGHNUHZKCL-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000008107 starch Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- BDPIHKOPKWGJCU-UHFFFAOYSA-N 2,3-dichloro-6-fluorobenzaldehyde Chemical compound FC1=CC=C(Cl)C(Cl)=C1C=O BDPIHKOPKWGJCU-UHFFFAOYSA-N 0.000 description 3
- XCGFKEPRFAXUPH-UHFFFAOYSA-N 3,5-bis(ethoxycarbonyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-2-carboxylic acid Chemical compound CCOC(=O)C1=C(C)NC(C(O)=O)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 XCGFKEPRFAXUPH-UHFFFAOYSA-N 0.000 description 3
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 3
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 235000010980 cellulose Nutrition 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- YPMPTULBFPFSEQ-SNAWJCMRSA-N ethyl (e)-3-aminobut-2-enoate Chemical compound CCOC(=O)\C=C(/C)N YPMPTULBFPFSEQ-SNAWJCMRSA-N 0.000 description 3
- LGUWBMAEWNZWJY-UHFFFAOYSA-N ethyl 3-amino-4-fluorobut-2-enoate Chemical compound CCOC(=O)C=C(N)CF LGUWBMAEWNZWJY-UHFFFAOYSA-N 0.000 description 3
- KQBYNGJTZNCQCO-UHFFFAOYSA-N ethyl 4-fluoro-3-oxobutanoate Chemical compound CCOC(=O)CC(=O)CF KQBYNGJTZNCQCO-UHFFFAOYSA-N 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229960002003 hydrochlorothiazide Drugs 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- WPHGSKGZRAQSGP-UHFFFAOYSA-N methylenecyclohexane Natural products C1CCCC2CC21 WPHGSKGZRAQSGP-UHFFFAOYSA-N 0.000 description 3
- JIKUXBYRTXDNIY-UHFFFAOYSA-N n-methyl-n-phenylformamide Chemical compound O=CN(C)C1=CC=CC=C1 JIKUXBYRTXDNIY-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 2
- TWBNMYSKRDRHAT-RCWTXCDDSA-N (S)-timolol hemihydrate Chemical compound O.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1 TWBNMYSKRDRHAT-RCWTXCDDSA-N 0.000 description 2
- CBMMVERXHJUMCM-UHFFFAOYSA-N 1-chloro-4-fluoro-2-(trifluoromethyl)benzene Chemical compound FC1=CC=C(Cl)C(C(F)(F)F)=C1 CBMMVERXHJUMCM-UHFFFAOYSA-N 0.000 description 2
- KUNCMOAFNYLOSC-UHFFFAOYSA-N 2-chloro-3-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC(C=O)=C1Cl KUNCMOAFNYLOSC-UHFFFAOYSA-N 0.000 description 2
- KNHJOOROLZMUOK-UHFFFAOYSA-N 2-chloro-5-fluoro-3-(trifluoromethyl)benzaldehyde Chemical compound FC1=CC(C=O)=C(Cl)C(C(F)(F)F)=C1 KNHJOOROLZMUOK-UHFFFAOYSA-N 0.000 description 2
- UMXHIUASUGQBCE-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 4-(2,3-dichlorophenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C=O)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC(Cl)=C1Cl UMXHIUASUGQBCE-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- AWBULVLXYJKXAP-UHFFFAOYSA-N 5-o-cyclopentyl 3-o-methyl 4-(2,3-dichlorophenyl)-2-(fluoromethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC2CCCC2)C1C1=CC=CC(Cl)=C1Cl AWBULVLXYJKXAP-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- HZBMZCARRPZRSZ-KRWDZBQOSA-N [(1s)-2,2,2-trichloro-1-phenylethyl] 2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate Chemical compound O([C@@H](C=1C=CC=CC=1)C(Cl)(Cl)Cl)C(=O)C(C(=O)C)=CC1=CC=CC(Cl)=C1Cl HZBMZCARRPZRSZ-KRWDZBQOSA-N 0.000 description 2
- SCKQSLUKXMGLIF-NSHDSACASA-N [(1s)-2,2,2-trichloro-1-phenylethyl] 3-oxobutanoate Chemical compound CC(=O)CC(=O)O[C@H](C(Cl)(Cl)Cl)C1=CC=CC=C1 SCKQSLUKXMGLIF-NSHDSACASA-N 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- XSDQTOBWRPYKKA-UHFFFAOYSA-N amiloride Chemical compound NC(=N)NC(=O)C1=NC(Cl)=C(N)N=C1N XSDQTOBWRPYKKA-UHFFFAOYSA-N 0.000 description 2
- 229960002576 amiloride Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- LWYBYTBJBOREPW-UHFFFAOYSA-N diethyl 2-(fluoromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(CF)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 LWYBYTBJBOREPW-UHFFFAOYSA-N 0.000 description 2
- MTQXBLJUHXVLGB-UHFFFAOYSA-N diethyl 2-carbamothioyl-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C(N)=S)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 MTQXBLJUHXVLGB-UHFFFAOYSA-N 0.000 description 2
- XYTDWQOKUQKHRY-UHFFFAOYSA-N diethyl 2-cyano-6-(fluoromethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(CF)NC(C#N)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 XYTDWQOKUQKHRY-UHFFFAOYSA-N 0.000 description 2
- JUXIEWFAOQAMER-UHFFFAOYSA-N diethyl 2-hydroxy-6-methyl-4-(3-nitrophenyl)-2-(4-nitrophenyl)-3,4-dihydro-1h-pyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1C(C=2C=C(C=CC=2)[N+]([O-])=O)C(C(=O)OCC)=C(C)NC1(O)C1=CC=C([N+]([O-])=O)C=C1 JUXIEWFAOQAMER-UHFFFAOYSA-N 0.000 description 2
- ZLJLPWPAEMOZAO-UHFFFAOYSA-N diethyl 2-hydroxy-6-methyl-4-(3-nitrophenyl)-2-(trichloromethyl)-3,4-dihydro-1h-pyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C(Cl)(Cl)Cl)(O)C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 ZLJLPWPAEMOZAO-UHFFFAOYSA-N 0.000 description 2
- WMHXNMLMNIXTTN-UHFFFAOYSA-N diethyl 2-methyl-4-(3-nitrophenyl)-6-(trichloromethyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C(Cl)(Cl)Cl)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 WMHXNMLMNIXTTN-UHFFFAOYSA-N 0.000 description 2
- DXFZNDRJYPKNOO-UHFFFAOYSA-N diethyl 2-methyl-6-methylsulfanyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(SC)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 DXFZNDRJYPKNOO-UHFFFAOYSA-N 0.000 description 2
- MXLBIBBISYOAED-UHFFFAOYSA-N diethyl 4-(2,1,3-benzoxadiazol-4-yl)-2-formyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C=O)NC(C(F)(F)F)=C(C(=O)OCC)C1C1=CC=CC2=NON=C12 MXLBIBBISYOAED-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 238000007907 direct compression Methods 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 239000002934 diuretic Substances 0.000 description 2
- 229940030606 diuretics Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 210000002464 muscle smooth vascular Anatomy 0.000 description 2
- 210000004165 myocardium Anatomy 0.000 description 2
- SWNHAVIOQKLWFI-UHFFFAOYSA-N oxetan-3-yl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1COC1 SWNHAVIOQKLWFI-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229960004605 timolol Drugs 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- SCKQSLUKXMGLIF-UHFFFAOYSA-N (2,2,2-trichloro-1-phenylethyl) 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC(C(Cl)(Cl)Cl)C1=CC=CC=C1 SCKQSLUKXMGLIF-UHFFFAOYSA-N 0.000 description 1
- YKFCISHFRZHKHY-NGQGLHOPSA-N (2s)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;trihydrate Chemical compound O.O.O.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 YKFCISHFRZHKHY-NGQGLHOPSA-N 0.000 description 1
- QSDKXMVGRLVIQV-UHFFFAOYSA-N 1,2-dichloro-4-fluorobenzene Chemical compound FC1=CC=C(Cl)C(Cl)=C1 QSDKXMVGRLVIQV-UHFFFAOYSA-N 0.000 description 1
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical compound C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 1
- DGRVQOKCSKDWIH-UHFFFAOYSA-N 1-chloro-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1Cl DGRVQOKCSKDWIH-UHFFFAOYSA-N 0.000 description 1
- YBBRQAXNTWMMFZ-UHFFFAOYSA-N 2,1,3-benzoxadiazole-4-carbaldehyde Chemical compound O=CC1=CC=CC2=NON=C12 YBBRQAXNTWMMFZ-UHFFFAOYSA-N 0.000 description 1
- HGUFODBRKLSHSI-UHFFFAOYSA-N 2,3,7,8-tetrachloro-dibenzo-p-dioxin Chemical compound O1C2=CC(Cl)=C(Cl)C=C2OC2=C1C=C(Cl)C(Cl)=C2 HGUFODBRKLSHSI-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 1
- WKIVBBWLRIFGHF-UHFFFAOYSA-N 2-chloro-3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1Cl WKIVBBWLRIFGHF-UHFFFAOYSA-N 0.000 description 1
- BDZHKUAKSMWSAJ-UHFFFAOYSA-N 2-chloro-n,n-diethyl-1,1,2-trifluoroethanamine Chemical compound CCN(CC)C(F)(F)C(F)Cl BDZHKUAKSMWSAJ-UHFFFAOYSA-N 0.000 description 1
- FAKUGVHRTLCKHB-UHFFFAOYSA-N 2-fluoro-6-(trifluoromethyl)benzaldehyde Chemical compound FC1=CC=CC(C(F)(F)F)=C1C=O FAKUGVHRTLCKHB-UHFFFAOYSA-N 0.000 description 1
- IWZVIWGVOIAXIJ-UHFFFAOYSA-N 2-methoxyethyl 4-fluoro-3-oxobutanoate Chemical compound COCCOC(=O)CC(=O)CF IWZVIWGVOIAXIJ-UHFFFAOYSA-N 0.000 description 1
- ATLCWADLCUCTLL-UHFFFAOYSA-N 2-methyl-3-nitrobenzaldehyde Chemical compound CC1=C(C=O)C=CC=C1[N+]([O-])=O ATLCWADLCUCTLL-UHFFFAOYSA-N 0.000 description 1
- LLSVFVGOJJLPPS-UHFFFAOYSA-N 2-methyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid Chemical compound CC1=NC=C(C(O)=O)C(C=2C=C(C=CC=2)[N+]([O-])=O)=C1C(O)=O LLSVFVGOJJLPPS-UHFFFAOYSA-N 0.000 description 1
- OVWOYTJKDQEJRO-UHFFFAOYSA-N 2-phenoxyethyl 4-fluoro-3-oxobutanoate Chemical compound FCC(=O)CC(=O)OCCOC1=CC=CC=C1 OVWOYTJKDQEJRO-UHFFFAOYSA-N 0.000 description 1
- OREKKYXHIZUZFU-UHFFFAOYSA-N 2-propoxyethyl 4-fluoro-3-oxobutanoate Chemical compound CCCOCCOC(=O)CC(=O)CF OREKKYXHIZUZFU-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- NGBWHZGIMVVZDQ-UHFFFAOYSA-N 3-O-ethyl 5-O-methyl 4-(2,3-dichlorophenyl)-2-hydroxy-6-methyl-2-(trifluoromethyl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C(F)(F)F)(O)C(C(=O)OCC)C1C1=CC=CC(Cl)=C1Cl NGBWHZGIMVVZDQ-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- CRSQLWPXCKJLIE-UHFFFAOYSA-N 3-o-ethyl 5-o-methyl 2-(fluoromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(CF)NC(C)=C(C(=O)OC)C1C1=CC=CC([N+]([O-])=O)=C1 CRSQLWPXCKJLIE-UHFFFAOYSA-N 0.000 description 1
- LJENZKUXNYKDII-UHFFFAOYSA-N 3-o-ethyl 5-o-methyl 4-(2,3-dichlorophenyl)-2-(fluoromethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(CF)NC(C)=C(C(=O)OC)C1C1=CC=CC(Cl)=C1Cl LJENZKUXNYKDII-UHFFFAOYSA-N 0.000 description 1
- QWHQDPCFOKIBPN-UHFFFAOYSA-N 3-o-ethyl 5-o-methyl 4-(2,3-dichlorophenyl)-2-methyl-6-phenyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C=2C=CC=CC=2)=C(C(=O)OC)C1C1=CC=CC(Cl)=C1Cl QWHQDPCFOKIBPN-UHFFFAOYSA-N 0.000 description 1
- ONFIPAFXQMIIPX-UHFFFAOYSA-N 3-o-methyl 5-o-(2,2,2-trichloro-1-phenylethyl) 2-(fluoromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C=2C=CC=CC=2)C(Cl)(Cl)Cl)C1C1=CC=CC([N+]([O-])=O)=C1 ONFIPAFXQMIIPX-UHFFFAOYSA-N 0.000 description 1
- ZZYNLACFNCUVQG-UHFFFAOYSA-N 3-o-methyl 5-o-(2-methylpropyl) 2-(fluoromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OCC(C)C)C1C1=CC=CC([N+]([O-])=O)=C1 ZZYNLACFNCUVQG-UHFFFAOYSA-N 0.000 description 1
- QHMOHRGQZOPOQM-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 2-(difluoromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C(F)F)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC([N+]([O-])=O)=C1 QHMOHRGQZOPOQM-UHFFFAOYSA-N 0.000 description 1
- VHIMAPQGFJYWON-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 2-(fluoromethyl)-4-(2-methoxy-3-nitrophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC([N+]([O-])=O)=C1OC VHIMAPQGFJYWON-UHFFFAOYSA-N 0.000 description 1
- FKSFAJOXLMOBHX-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 2-(fluoromethyl)-4-[2-fluoro-6-(trifluoromethyl)phenyl]-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=C(F)C=CC=C1C(F)(F)F FKSFAJOXLMOBHX-UHFFFAOYSA-N 0.000 description 1
- GZZIACOMXQHLIR-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 2-(fluoromethyl)-6-methyl-4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC=C1C GZZIACOMXQHLIR-UHFFFAOYSA-N 0.000 description 1
- MEINHZKCLKJTOV-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 2-(fluoromethyl)-6-methyl-4-(2-methylsulfanylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC=C1SC MEINHZKCLKJTOV-UHFFFAOYSA-N 0.000 description 1
- UGOCFMRGGDNHPO-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 2-(fluoromethyl)-6-methyl-4-(2-methylsulfonylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC=C1S(C)(=O)=O UGOCFMRGGDNHPO-UHFFFAOYSA-N 0.000 description 1
- TXWNSOBVWMDPAY-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 2-(fluoromethyl)-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC=C1[N+]([O-])=O TXWNSOBVWMDPAY-UHFFFAOYSA-N 0.000 description 1
- RBQFRDYEZWMKGI-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 2-(fluoromethyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC=C1C(F)(F)F RBQFRDYEZWMKGI-UHFFFAOYSA-N 0.000 description 1
- ACMRHUWLTCVUKE-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 2-hydroxy-6-methyl-4-(3-nitrophenyl)-2-phenyl-3,4-dihydro-1h-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1C(C=2C=C(C=CC=2)[N+]([O-])=O)C(C(=O)OC(C)C)=C(C)NC1(O)C1=CC=CC=C1 ACMRHUWLTCVUKE-UHFFFAOYSA-N 0.000 description 1
- HNRXDUQAGWJZGH-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2-hydroxy-6-methyl-2-phenyl-3,4-dihydro-1h-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1C(C=2C3=NON=C3C=CC=2)C(C(=O)OC(C)C)=C(C)NC1(O)C1=CC=CC=C1 HNRXDUQAGWJZGH-UHFFFAOYSA-N 0.000 description 1
- CIIZZJJJKGOMLL-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 4-(2,3-dichlorophenyl)-2-(fluoromethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC(Cl)=C1Cl CIIZZJJJKGOMLL-UHFFFAOYSA-N 0.000 description 1
- YEWREPQOFMPDTH-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 4-(2-chloro-5-nitrophenyl)-2-(fluoromethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=CC([N+]([O-])=O)=CC=C1Cl YEWREPQOFMPDTH-UHFFFAOYSA-N 0.000 description 1
- SMVWSQIQACOKGM-UHFFFAOYSA-N 3-o-methyl 5-o-propan-2-yl 4-(3-chlorophenyl)-2-(fluoromethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC(Cl)=C1 SMVWSQIQACOKGM-UHFFFAOYSA-N 0.000 description 1
- KWOXRJYOWWHLCM-UHFFFAOYSA-N 4-(2,3-dichlorophenyl)-6-(fluoromethyl)-5-methoxycarbonyl-2-methyl-1,4-dihydropyridine-3-carboxylic acid Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(O)=O)C1C1=CC=CC(Cl)=C1Cl KWOXRJYOWWHLCM-UHFFFAOYSA-N 0.000 description 1
- JIEMFOWRWIAOQZ-UHFFFAOYSA-N 4-fluoro-3-oxobutanoic acid Chemical compound OC(=O)CC(=O)CF JIEMFOWRWIAOQZ-UHFFFAOYSA-N 0.000 description 1
- BTJDMDJIAAHSRG-UHFFFAOYSA-N 5-acetyl-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound CC(=O)C1C(=O)OC(C)(C)OC1=O BTJDMDJIAAHSRG-UHFFFAOYSA-N 0.000 description 1
- ASPDJZINBYYZRU-UHFFFAOYSA-N 5-amino-2-chlorobenzotrifluoride Chemical compound NC1=CC=C(Cl)C(C(F)(F)F)=C1 ASPDJZINBYYZRU-UHFFFAOYSA-N 0.000 description 1
- CKLNDYFJWPDHRA-UHFFFAOYSA-N 5-o-(1-benzhydrylazetidin-3-yl) 3-o-methyl 4-(2,3-dichlorophenyl)-2-(fluoromethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC2CN(C2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)C1C1=CC=CC(Cl)=C1Cl CKLNDYFJWPDHRA-UHFFFAOYSA-N 0.000 description 1
- WNHRODGVXYHKAY-UHFFFAOYSA-N 5-o-(2-cyanoethyl) 3-o-propan-2-yl 2-(fluoromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(CF)NC(C)=C(C(=O)OCCC#N)C1C1=CC=CC([N+]([O-])=O)=C1 WNHRODGVXYHKAY-UHFFFAOYSA-N 0.000 description 1
- IOPLTWYTOJAWQS-UHFFFAOYSA-N 5-o-(2-methylsulfanylethyl) 3-o-propan-2-yl 2-(fluoromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CSCCOC(=O)C1=C(C)NC(CF)=C(C(=O)OC(C)C)C1C1=CC=CC([N+]([O-])=O)=C1 IOPLTWYTOJAWQS-UHFFFAOYSA-N 0.000 description 1
- NSYVTXVCDQWXLS-UHFFFAOYSA-N 5-o-[2-[benzyl(methyl)amino]ethyl] 3-o-methyl 2-(fluoromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.COC(=O)C1=C(CF)NC(C)=C(C(=O)OCCN(C)CC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 NSYVTXVCDQWXLS-UHFFFAOYSA-N 0.000 description 1
- SMYNNVPRYSEZSZ-UHFFFAOYSA-N 5-o-cyclopentyl 3-o-methyl 2-(fluoromethyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CF)NC(C)=C(C(=O)OC2CCCC2)C1C1=CC=CC=C1C(F)(F)F SMYNNVPRYSEZSZ-UHFFFAOYSA-N 0.000 description 1
- IHNWGJYAPMEPSV-UHFFFAOYSA-N 5-o-ethyl 3-o-methyl 2-(fluoromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(CF)=C(C(=O)OC)C1C1=CC=CC([N+]([O-])=O)=C1 IHNWGJYAPMEPSV-UHFFFAOYSA-N 0.000 description 1
- MONGMOINROSLLO-UHFFFAOYSA-N 5-o-ethyl 3-o-methyl 4-(2,3-dichlorophenyl)-2-(fluoromethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(CF)=C(C(=O)OC)C1C1=CC=CC(Cl)=C1Cl MONGMOINROSLLO-UHFFFAOYSA-N 0.000 description 1
- JBKSZZRREVLMHU-UHFFFAOYSA-N 5-o-methyl 3-o-propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2-methyl-6-phenyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound N1C(C)=C(C(=O)OC(C)C)C(C=2C3=NON=C3C=CC=2)C(C(=O)OC)=C1C1=CC=CC=C1 JBKSZZRREVLMHU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- WXRZZQJURWSKTN-UHFFFAOYSA-N CCOC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OC)C1C1=CC=CC(Cl)=C1Cl Chemical compound CCOC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OC)C1C1=CC=CC(Cl)=C1Cl WXRZZQJURWSKTN-UHFFFAOYSA-N 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- 241000252095 Congridae Species 0.000 description 1
- 229920002785 Croscarmellose sodium Chemical class 0.000 description 1
- 206010011878 Deafness Diseases 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 208000010412 Glaucoma Diseases 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010020571 Hyperaldosteronism Diseases 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- 208000007101 Muscle Cramp Diseases 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- RKOTXQYWCBGZLP-UHFFFAOYSA-N N-[(2,4-difluorophenyl)methyl]-2-ethyl-9-hydroxy-3-methoxy-1,8-dioxospiro[3H-pyrido[1,2-a]pyrazine-4,3'-oxolane]-7-carboxamide Chemical compound CCN1C(OC)C2(CCOC2)N2C=C(C(=O)NCC3=C(F)C=C(F)C=C3)C(=O)C(O)=C2C1=O RKOTXQYWCBGZLP-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 201000001068 Prinzmetal angina Diseases 0.000 description 1
- 208000003782 Raynaud disease Diseases 0.000 description 1
- 208000012322 Raynaud phenomenon Diseases 0.000 description 1
- 208000001647 Renal Insufficiency Diseases 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- 208000007718 Stable Angina Diseases 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 102100031083 Uteroglobin Human genes 0.000 description 1
- 108090000203 Uteroglobin Proteins 0.000 description 1
- 206010047163 Vasospasm Diseases 0.000 description 1
- 210000000683 abdominal cavity Anatomy 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical class [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 208000008445 altitude sickness Diseases 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- RRLONFSFFMSMBT-UHFFFAOYSA-N bis(2-propoxyethyl) 2-(fluoromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCOCCOC(=O)C1=C(C)NC(CF)=C(C(=O)OCCOCCC)C1C1=CC=CC([N+]([O-])=O)=C1 RRLONFSFFMSMBT-UHFFFAOYSA-N 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 1
- 229960000830 captopril Drugs 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical class [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000000372 cardioplegic agent Substances 0.000 description 1
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229960002155 chlorothiazide Drugs 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000001767 crosslinked sodium carboxy methyl cellulose Chemical class 0.000 description 1
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- KNLQBRGRIQAPAY-UHFFFAOYSA-N cyclobutyl 2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate Chemical compound C1CCC1OC(=O)C(C(=O)C)=CC1=CC=CC(Cl)=C1Cl KNLQBRGRIQAPAY-UHFFFAOYSA-N 0.000 description 1
- GCPXGAQMXOZLKH-UHFFFAOYSA-N cyclobutyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCC1 GCPXGAQMXOZLKH-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- XRAVYESZTUBEBU-UHFFFAOYSA-N cyclohexane;propan-2-ol Chemical compound CC(C)O.C1CCCCC1 XRAVYESZTUBEBU-UHFFFAOYSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- LYTTXGZNYGUTOH-UHFFFAOYSA-N cyclopentyl 2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate Chemical compound C1CCCC1OC(=O)C(C(=O)C)=CC1=CC=CC(Cl)=C1Cl LYTTXGZNYGUTOH-UHFFFAOYSA-N 0.000 description 1
- SCFWSXWPGYNVRS-UHFFFAOYSA-N cyclopentyl 3-aminobut-2-enoate Chemical compound CC(N)=CC(=O)OC1CCCC1 SCFWSXWPGYNVRS-UHFFFAOYSA-N 0.000 description 1
- UGZNCYLVFNJCGV-UHFFFAOYSA-N cyclopentyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCCC1 UGZNCYLVFNJCGV-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- VZWRXSSEBRCAAK-UHFFFAOYSA-N diethyl 2,6-bis(fluoromethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(CF)NC(CF)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 VZWRXSSEBRCAAK-UHFFFAOYSA-N 0.000 description 1
- GYNTWLPOLMGOJA-UHFFFAOYSA-N diethyl 2-(3,4-dichlorophenyl)-2-hydroxy-6-methyl-4-(3-nitrophenyl)-3,4-dihydro-1h-pyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1C(C=2C=C(C=CC=2)[N+]([O-])=O)C(C(=O)OCC)=C(C)NC1(O)C1=CC=C(Cl)C(Cl)=C1 GYNTWLPOLMGOJA-UHFFFAOYSA-N 0.000 description 1
- YGYCSRIRMNYPAN-UHFFFAOYSA-N diethyl 2-(3-chlorophenyl)-2-hydroxy-6-methyl-4-(3-nitrophenyl)-3,4-dihydro-1h-pyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1C(C=2C=C(C=CC=2)[N+]([O-])=O)C(C(=O)OCC)=C(C)NC1(O)C1=CC=CC(Cl)=C1 YGYCSRIRMNYPAN-UHFFFAOYSA-N 0.000 description 1
- UXPHPLMNBSSLNJ-UHFFFAOYSA-N diethyl 2-(3-chlorophenyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C=2C=C(Cl)C=CC=2)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 UXPHPLMNBSSLNJ-UHFFFAOYSA-N 0.000 description 1
- PTLVLSNVCATDJU-UHFFFAOYSA-N diethyl 2-(4-chlorophenyl)-2-hydroxy-6-methyl-4-(3-nitrophenyl)-3,4-dihydro-1h-pyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1C(C=2C=C(C=CC=2)[N+]([O-])=O)C(C(=O)OCC)=C(C)NC1(O)C1=CC=C(Cl)C=C1 PTLVLSNVCATDJU-UHFFFAOYSA-N 0.000 description 1
- VHTKGNDZWUUWQY-UHFFFAOYSA-N diethyl 2-(4-chlorophenyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C=2C=CC(Cl)=CC=2)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 VHTKGNDZWUUWQY-UHFFFAOYSA-N 0.000 description 1
- KEPISNYAHMLRJW-UHFFFAOYSA-N diethyl 2-(4-methoxyphenyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C=2C=CC(OC)=CC=2)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 KEPISNYAHMLRJW-UHFFFAOYSA-N 0.000 description 1
- LPLMKCWXNCMZAN-UHFFFAOYSA-N diethyl 2-(dichloromethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C(Cl)Cl)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 LPLMKCWXNCMZAN-UHFFFAOYSA-N 0.000 description 1
- NCFOKQIOVQUXNU-UHFFFAOYSA-N diethyl 2-(fluoromethyl)-4-(3-nitrophenyl)-6-phenyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(CF)NC(C=2C=CC=CC=2)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 NCFOKQIOVQUXNU-UHFFFAOYSA-N 0.000 description 1
- CRHZJSCFKYYVJK-UHFFFAOYSA-N diethyl 2-(fluoromethyl)-6-(hydroxymethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(CO)NC(CF)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 CRHZJSCFKYYVJK-UHFFFAOYSA-N 0.000 description 1
- YHHYSUITTUHTOD-UHFFFAOYSA-N diethyl 2-(fluoromethyl)-6-formyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(CF)NC(C=O)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 YHHYSUITTUHTOD-UHFFFAOYSA-N 0.000 description 1
- HQVYMKNCKLQFPZ-UHFFFAOYSA-N diethyl 2-(fluoromethyl)-6-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(CF)=C(C(=O)OCC)C1C1=CC=CC=C1C(F)(F)F HQVYMKNCKLQFPZ-UHFFFAOYSA-N 0.000 description 1
- VBXFTOOYZAHLFA-UHFFFAOYSA-N diethyl 2-(furan-2-yl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C=1C(C=2C=C(C=CC=2)[N+]([O-])=O)C(C(=O)OCC)=C(C)NC=1C1=CC=CO1 VBXFTOOYZAHLFA-UHFFFAOYSA-N 0.000 description 1
- LWTWJBUKUVHABE-UHFFFAOYSA-N diethyl 2-(hydroxymethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(CO)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 LWTWJBUKUVHABE-UHFFFAOYSA-N 0.000 description 1
- ADPJJCBHAQHQRB-UHFFFAOYSA-N diethyl 2-[(2,4-dinitrophenoxy)iminomethyl]-6-(fluoromethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C=1C(C=2C=C(C=CC=2)[N+]([O-])=O)C(C(=O)OCC)=C(CF)NC=1C=NOC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O ADPJJCBHAQHQRB-UHFFFAOYSA-N 0.000 description 1
- RJUMRTLKDAVUAZ-UHFFFAOYSA-N diethyl 2-amino-6-(fluoromethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(N)NC(CF)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 RJUMRTLKDAVUAZ-UHFFFAOYSA-N 0.000 description 1
- DHUGTPALLLGSPO-UHFFFAOYSA-N diethyl 2-carbamoyl-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C(N)=O)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 DHUGTPALLLGSPO-UHFFFAOYSA-N 0.000 description 1
- SASQRUKEXFCJRG-UHFFFAOYSA-N diethyl 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C#N)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 SASQRUKEXFCJRG-UHFFFAOYSA-N 0.000 description 1
- FVVDVMJADTZKFT-UHFFFAOYSA-N diethyl 2-hydroxy-6-methyl-4-(3-nitrophenyl)-2-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydro-1h-pyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C(F)(F)C(F)(F)F)(O)C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 FVVDVMJADTZKFT-UHFFFAOYSA-N 0.000 description 1
- HTDMEQVCMXRDBL-UHFFFAOYSA-N diethyl 2-hydroxy-6-methyl-4-(3-nitrophenyl)-2-(trifluoromethyl)-3,4-dihydro-1h-pyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C(F)(F)F)(O)C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 HTDMEQVCMXRDBL-UHFFFAOYSA-N 0.000 description 1
- CXXXNLLKVOTJCL-UHFFFAOYSA-N diethyl 2-methyl-4-(3-nitrophenyl)-6-(1,1,2,2,2-pentafluoroethyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C(F)(F)C(F)(F)F)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 CXXXNLLKVOTJCL-UHFFFAOYSA-N 0.000 description 1
- VUVWTUBLLMMEOJ-UHFFFAOYSA-N diethyl 2-methyl-4-(3-nitrophenyl)-6-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C=2C=CC(=CC=2)[N+]([O-])=O)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 VUVWTUBLLMMEOJ-UHFFFAOYSA-N 0.000 description 1
- ONJNYCCICAPTNY-UHFFFAOYSA-N diethyl 2-methyl-4-(3-nitrophenyl)-6-(trichloromethyl)-3,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C(Cl)(Cl)Cl)N=C(C)C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 ONJNYCCICAPTNY-UHFFFAOYSA-N 0.000 description 1
- ZAULKMCTNNVKAM-UHFFFAOYSA-N diethyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C(F)(F)F)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 ZAULKMCTNNVKAM-UHFFFAOYSA-N 0.000 description 1
- ZOOXITMXSDTGQW-UHFFFAOYSA-N diethyl 2-methyl-6-(4-methylphenyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C=2C=CC(C)=CC=2)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 ZOOXITMXSDTGQW-UHFFFAOYSA-N 0.000 description 1
- GZXVCBQKBFUZNE-UHFFFAOYSA-N diethyl 2-methyl-6-(morpholine-4-carbonyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C=1C(C=2C=C(C=CC=2)[N+]([O-])=O)C(C(=O)OCC)=C(C)NC=1C(=O)N1CCOCC1 GZXVCBQKBFUZNE-UHFFFAOYSA-N 0.000 description 1
- LPJRTWXATBWGTR-UHFFFAOYSA-N diethyl 2-methyl-6-methylsulfinyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical class CCOC(=O)C1=C(C)NC(S(C)=O)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 LPJRTWXATBWGTR-UHFFFAOYSA-N 0.000 description 1
- CIPHZSUBHHWEKS-UHFFFAOYSA-N diethyl 2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C=2C=CC=CC=2)=C(C(=O)OCC)C1C1=CC=CC=C1C(F)(F)F CIPHZSUBHHWEKS-UHFFFAOYSA-N 0.000 description 1
- OAEIHEZHHUYMLX-UHFFFAOYSA-N diethyl 4-(2,1,3-benzoxadiazol-4-yl)-2-(diethoxymethyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C(F)(F)F)NC(C(OCC)OCC)=C(C(=O)OCC)C1C1=CC=CC2=NON=C12 OAEIHEZHHUYMLX-UHFFFAOYSA-N 0.000 description 1
- FXHFXYBYAZLWHB-UHFFFAOYSA-N diethyl 4-(2,1,3-benzoxadiazol-4-yl)-2-(fluoromethyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(CF)=C(C(=O)OCC)C1C1=CC=CC2=NON=C12 FXHFXYBYAZLWHB-UHFFFAOYSA-N 0.000 description 1
- DENPVYWGEJATNU-UHFFFAOYSA-N diethyl 4-(2,1,3-benzoxadiazol-4-yl)-2-(hydroxymethyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(CO)NC(C(F)(F)F)=C(C(=O)OCC)C1C1=CC=CC2=NON=C12 DENPVYWGEJATNU-UHFFFAOYSA-N 0.000 description 1
- BMBGPUXGNIQXCH-UHFFFAOYSA-N diethyl 6-(fluoromethyl)-2-hydroxy-4-(3-nitrophenyl)-2-phenyl-3,4-dihydro-1h-pyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1C(C=2C=C(C=CC=2)[N+]([O-])=O)C(C(=O)OCC)=C(CF)NC1(O)C1=CC=CC=C1 BMBGPUXGNIQXCH-UHFFFAOYSA-N 0.000 description 1
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 208000037765 diseases and disorders Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- AVOLMBLBETYQHX-UHFFFAOYSA-N etacrynic acid Chemical compound CCC(=C)C(=O)C1=CC=C(OCC(O)=O)C(Cl)=C1Cl AVOLMBLBETYQHX-UHFFFAOYSA-N 0.000 description 1
- 229960003199 etacrynic acid Drugs 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- YOPMSDPIOQUWFE-UHFFFAOYSA-N ethyl 2-[(3-nitrophenyl)methylidene]-3-oxobutanoate Chemical compound CCOC(=O)C(C(C)=O)=CC1=CC=CC([N+]([O-])=O)=C1 YOPMSDPIOQUWFE-UHFFFAOYSA-N 0.000 description 1
- PMIMZTYTHPVEBG-UHFFFAOYSA-N ethyl 4,4,4-trichloro-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate Chemical compound CCOC(=O)C(C(=O)C(Cl)(Cl)Cl)=CC1=CC=CC([N+]([O-])=O)=C1 PMIMZTYTHPVEBG-UHFFFAOYSA-N 0.000 description 1
- XGIRWPYENXRJMZ-UHFFFAOYSA-N ethyl 4,4,4-trichloro-3-oxobutanoate Chemical compound CCOC(=O)CC(=O)C(Cl)(Cl)Cl XGIRWPYENXRJMZ-UHFFFAOYSA-N 0.000 description 1
- OCJKUQIPRNZDTK-UHFFFAOYSA-N ethyl 4,4,4-trifluoro-3-oxobutanoate Chemical compound CCOC(=O)CC(=O)C(F)(F)F OCJKUQIPRNZDTK-UHFFFAOYSA-N 0.000 description 1
- KKUGTCHIXZWRFL-UHFFFAOYSA-N ethyl 4,4-diethoxy-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate Chemical compound CCOC(OCC)C(=O)C(C(=O)OCC)=CC1=CC=CC([N+]([O-])=O)=C1 KKUGTCHIXZWRFL-UHFFFAOYSA-N 0.000 description 1
- RYEQVXYFBKFQQK-UHFFFAOYSA-N ethyl 4-fluoro-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate Chemical compound CCOC(=O)C(C(=O)CF)=CC1=CC=CC([N+]([O-])=O)=C1 RYEQVXYFBKFQQK-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- ZBHDTYQJAQDBIH-UHFFFAOYSA-N fluoroacetyl chloride Chemical compound FCC(Cl)=O ZBHDTYQJAQDBIH-UHFFFAOYSA-N 0.000 description 1
- VUWZPRWSIVNGKG-UHFFFAOYSA-N fluoromethane Chemical compound F[CH2] VUWZPRWSIVNGKG-UHFFFAOYSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000010370 hearing loss Effects 0.000 description 1
- 231100000888 hearing loss Toxicity 0.000 description 1
- 208000016354 hearing loss disease Diseases 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 230000035873 hypermotility Effects 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 206010020871 hypertrophic cardiomyopathy Diseases 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000004041 inotropic agent Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 208000028867 ischemia Diseases 0.000 description 1
- 201000006370 kidney failure Diseases 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- GXHFUVWIGNLZSC-UHFFFAOYSA-N meldrum's acid Chemical compound CC1(C)OC(=O)CC(=O)O1 GXHFUVWIGNLZSC-UHFFFAOYSA-N 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- WRGLZAJBHUOPFO-UHFFFAOYSA-N methyl 3-oxo-3-phenylpropanoate Chemical compound COC(=O)CC(=O)C1=CC=CC=C1 WRGLZAJBHUOPFO-UHFFFAOYSA-N 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- HYIMSNHJOBLJNT-UHFFFAOYSA-N nifedipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O HYIMSNHJOBLJNT-UHFFFAOYSA-N 0.000 description 1
- 229960001597 nifedipine Drugs 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- LMYJGUNNJIDROI-UHFFFAOYSA-N oxan-4-ol Chemical compound OC1CCOCC1 LMYJGUNNJIDROI-UHFFFAOYSA-N 0.000 description 1
- MCUGCGNLCJKXJT-UHFFFAOYSA-N oxan-4-yl 3-aminobut-2-enoate Chemical compound CC(N)=CC(=O)OC1CCOCC1 MCUGCGNLCJKXJT-UHFFFAOYSA-N 0.000 description 1
- UXERQARFCGHZNW-UHFFFAOYSA-N oxan-4-yl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCOCC1 UXERQARFCGHZNW-UHFFFAOYSA-N 0.000 description 1
- VQFKDILUAVXVOV-UHFFFAOYSA-N oxetan-3-yl 2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate Chemical compound C1OCC1OC(=O)C(C(=O)C)=CC1=CC=CC(Cl)=C1Cl VQFKDILUAVXVOV-UHFFFAOYSA-N 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- SRLTVGTYILXKDV-UHFFFAOYSA-N pentan-3-yl 3-aminobut-2-enoate Chemical compound CCC(CC)OC(=O)C=C(C)N SRLTVGTYILXKDV-UHFFFAOYSA-N 0.000 description 1
- PFTIWTQFHWICDR-UHFFFAOYSA-N pentan-3-yl 3-oxobutanoate Chemical compound CCC(CC)OC(=O)CC(C)=O PFTIWTQFHWICDR-UHFFFAOYSA-N 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- KFVAZJUCJAOBDS-UHFFFAOYSA-N propan-2-yl 4-fluoro-3-oxobutanoate Chemical compound CC(C)OC(=O)CC(=O)CF KFVAZJUCJAOBDS-UHFFFAOYSA-N 0.000 description 1
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 230000012191 relaxation of muscle Effects 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- 238000010956 selective crystallization Methods 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 210000002027 skeletal muscle Anatomy 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- HJHVQCXHVMGZNC-JCJNLNMISA-M sodium;(2z)-2-[(3r,4s,5s,8s,9s,10s,11r,13r,14s,16s)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1h-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoate Chemical compound [Na+].O[C@@H]([C@@H]12)C[C@H]3\C(=C(/CCC=C(C)C)C([O-])=O)[C@@H](OC(C)=O)C[C@]3(C)[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](O)[C@H]2C HJHVQCXHVMGZNC-JCJNLNMISA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 208000024535 susceptibility to myocardial infarction Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012976 tarts Nutrition 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 230000036269 ulceration Effects 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/55—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/78—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D305/00—Heterocyclic compounds containing four-membered rings having one oxygen atom as the only ring hetero atoms
- C07D305/02—Heterocyclic compounds containing four-membered rings having one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D305/04—Heterocyclic compounds containing four-membered rings having one oxygen atom as the only ring hetero atoms not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D305/08—Heterocyclic compounds containing four-membered rings having one oxygen atom as the only ring hetero atoms not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (10)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB838311519A GB8311519D0 (en) | 1983-04-27 | 1983-04-27 | Nitrogen heterocycles |
GB838311521A GB8311521D0 (en) | 1983-04-27 | 1983-04-27 | Nitrogen heterocycles |
GB838311520A GB8311520D0 (en) | 1983-04-27 | 1983-04-27 | Nitrogen heterocycles |
GB838326362A GB8326362D0 (en) | 1983-10-01 | 1983-10-01 | Nitrogen heterocyclic compounds |
GB838327660A GB8327660D0 (en) | 1983-10-15 | 1983-10-15 | Nitrogen heterocyclic compounds |
GB838327661A GB8327661D0 (en) | 1983-10-15 | 1983-10-15 | Nitrogen heterocyclic compounds |
GB838330852A GB8330852D0 (en) | 1983-11-18 | 1983-11-18 | Nitrogen heterocycles |
GB838334287A GB8334287D0 (en) | 1983-12-22 | 1983-12-22 | Nitrogen heterocycles |
GB838334285A GB8334285D0 (en) | 1983-12-22 | 1983-12-22 | Nitrogen compounds |
GB838334286A GB8334286D0 (en) | 1983-12-22 | 1983-12-22 | Nitrogen heterocycles |
Publications (1)
Publication Number | Publication Date |
---|---|
NO841656L true NO841656L (no) | 1984-10-29 |
Family
ID=27579364
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO841656A NO841656L (no) | 1983-04-27 | 1984-04-26 | Dihydropyridiner og fremgangsmaate for deres fremstilling |
Country Status (6)
Country | Link |
---|---|
EP (1) | EP0125803A3 (de) |
AU (1) | AU2744584A (de) |
FI (1) | FI841597A (de) |
IL (1) | IL71631A0 (de) |
NO (1) | NO841656L (de) |
PT (1) | PT78507B (de) |
Families Citing this family (17)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
IE57810B1 (en) * | 1984-03-27 | 1993-04-21 | Delagrange Lab | 1,4-dihydropyridine derivatives,their preparation and their use |
DE3414801A1 (de) * | 1984-04-19 | 1985-10-24 | Bayer Ag, 5090 Leverkusen | 4-(nitrophenyl)-tetrahydropyridine, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
GB8421039D0 (en) * | 1984-08-17 | 1984-09-19 | Wyeth John & Brother Ltd | Heterocyclic compounds |
GR851819B (de) * | 1984-08-17 | 1985-11-26 | Wyeth John & Brother Ltd | |
EP0174131A3 (de) * | 1984-09-01 | 1989-06-07 | FISONS plc | Dihydropyridine, Verfahren und Zwischenprodukte zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen |
GB8428552D0 (en) * | 1984-11-12 | 1984-12-19 | Sandoz Ltd | Organic compounds |
GB8431119D0 (en) * | 1984-12-10 | 1985-01-16 | Fujisawa Pharmaceutical Co | Anti-arteriosclerotic composition |
JPS6289662A (ja) * | 1985-06-14 | 1987-04-24 | Sankyo Co Ltd | 1,4−ジヒドロピリジン誘導体 |
FI862343A (fi) * | 1985-06-17 | 1986-12-18 | Warner Lambert Co | Foerfarande foer framstaellning av terapeutiskt verkande 1,4-dihydropyridinfoereningar. |
EP0225175A3 (de) * | 1985-11-28 | 1988-12-28 | FISONS plc | Dihydropyridin-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen |
DE3544211A1 (de) * | 1985-12-13 | 1987-06-19 | Bayer Ag | Neue, fluorhaltige 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
US4983740A (en) * | 1986-08-04 | 1991-01-08 | Adir Et Compagnie | Process for 1,4-dihydropyridine compounds |
DE3629545A1 (de) * | 1986-08-30 | 1988-03-10 | Bayer Ag | Dihydropyridinverbindungen, verfahren zu ihrer herstellung und ihre verwendung |
US4772596A (en) * | 1986-10-09 | 1988-09-20 | Sankyo Company Limited | Dihydropyridine derivatives, their preparation and their use |
MY104933A (en) * | 1987-09-30 | 1994-07-30 | Pfizer Ltd | Platelet activating factor antagonists |
GB8822170D0 (en) * | 1988-09-21 | 1988-10-26 | Pfizer Ltd | Therapeutic agents |
DE3915495A1 (de) * | 1989-05-12 | 1990-11-15 | Bayer Ag | Kernfluorierte trifluormethylbenzaldehyde |
Family Cites Families (15)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2180772A (en) * | 1935-10-25 | 1939-11-21 | Gen Aniline Works Inc | Trifluoromethyl benzaldehydes |
DE1768419A1 (de) * | 1968-05-11 | 1971-12-30 | Bayer Ag | Verfahren zur selektiven Decarbonylierung von kernchlorierten Di- und Tri-formylbenzolen |
DE2210674C3 (de) * | 1972-03-06 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | 2-Amino-6-methyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
DE2248150A1 (de) * | 1972-09-30 | 1974-04-04 | Bayer Ag | Dihydropyridinpolyester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
GB1552911A (en) * | 1975-07-02 | 1979-09-19 | Fujisawa Pharmaceutical Co | 1,4 dihydropyridine derivatives and the preparation thereof |
US3984098A (en) * | 1975-11-28 | 1976-10-05 | Xerox Corporation | Pneumatic registration and clamping apparatus |
JPS57175164A (en) * | 1981-04-18 | 1982-10-28 | Banyu Pharmaceut Co Ltd | 1,4-dihydropyridine derivative and its preparation |
NZ201395A (en) * | 1981-07-30 | 1987-02-20 | Bayer Ag | Pharmaceutical compositions containing 1,4-dihydropyridines and certain of these dihydropyridines |
DE3142856A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoylchlorid |
US4497808A (en) * | 1981-12-30 | 1985-02-05 | Ciba-Geigy Corporation | N-Oxide compounds useful in the treatment of cardiovascular ailments |
DK161312C (da) * | 1982-03-11 | 1991-12-09 | Pfizer | Analogifremgangsmaade til fremstilling af 2-aminoalkoxymethyl-4-phenyl-6-methyl-1,4-dihydropyridin-3,5-dicarboxylsyreestere eller syreadditionssalte deraf samt phthalimidoderivater til anvendelse som udgangsmateriale ved fremgangsmaaden |
JPS58222045A (ja) * | 1982-06-18 | 1983-12-23 | Asahi Glass Co Ltd | 含フツ素芳香族アルデヒドの製造方法 |
PT77842B (en) * | 1982-12-21 | 1986-05-05 | Pfizer | Process for preparing dihydropyridines |
GB8331120D0 (en) * | 1983-11-22 | 1983-12-29 | Pfizer Ltd | Benzaldehyde derivatives |
EP0168841B1 (de) * | 1983-12-19 | 1988-09-28 | Pfizer Limited | Dihydropyridin-Zwischenprodukt |
-
1984
- 1984-04-16 EP EP84302566A patent/EP0125803A3/de not_active Withdrawn
- 1984-04-24 FI FI841597A patent/FI841597A/fi not_active Application Discontinuation
- 1984-04-25 IL IL71631A patent/IL71631A0/xx unknown
- 1984-04-26 NO NO841656A patent/NO841656L/no unknown
- 1984-04-27 AU AU27445/84A patent/AU2744584A/en not_active Abandoned
- 1984-04-27 PT PT78507A patent/PT78507B/pt unknown
Also Published As
Publication number | Publication date |
---|---|
FI841597A (fi) | 1984-10-28 |
EP0125803A3 (de) | 1987-01-21 |
AU2744584A (en) | 1984-11-01 |
PT78507B (en) | 1986-07-22 |
IL71631A0 (en) | 1984-07-31 |
EP0125803A2 (de) | 1984-11-21 |
FI841597A0 (fi) | 1984-04-24 |
PT78507A (en) | 1984-05-01 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO841656L (no) | Dihydropyridiner og fremgangsmaate for deres fremstilling | |
US4772596A (en) | Dihydropyridine derivatives, their preparation and their use | |
US4707486A (en) | Diaryl piperidine containing esters of 1,4-dihydropyridines and coronary therapeutic use | |
JP3421323B2 (ja) | ピペリジンccr−3受容体拮抗薬 | |
DK164158B (da) | 1,4-dihydropyridincarboxylsyreestere | |
FR2569402A1 (fr) | Derives d'acide 3,5-pyridine-dicarboxylique, procede pour leur preparation et composition pharmaceutique les contenant | |
JP5014342B2 (ja) | 4−クロメノニル−1,4−ジヒドロピリジン類およびそれらの使用 | |
ES2372306T3 (es) | 4-cromenonil-1,4-dihidropiridincarbonitrilos y su uso. | |
FI83773B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,4-dihydropyridinderivat. | |
NO179974B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive piperidinforbindelser | |
US4607041A (en) | Antihypertensive 2-phenyl Hantzsch dihydropyridines | |
JPH0141628B2 (de) | ||
JPS61257983A (ja) | 1,4−ジヒドロピリジン及びこれを有効成分とする医薬組成物 | |
US4686217A (en) | Calcium antagonist 2-fluoroalkyl-1,4-dihydropyridines | |
EP0215250B1 (de) | 2-Substituierte-1,4-dihydropyridine, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Zusammensetzungen | |
NO177186B (no) | Fremgangsmåte ved fremstilling av enantiomert rene polysubstituerte 1,4-dihydropyridiner | |
US4876255A (en) | Substituted 1,4-dihydropyridines for control of circulation and thromboses | |
EP0245918B1 (de) | 1,4-Dihydropyridinderivate | |
JPS59205360A (ja) | ジヒドロピリジン化合物 | |
HUT52055A (en) | Process for producing basic 4-aryl-dihydropyridin-amides and pharmaceutical compositions containing them | |
US4898865A (en) | [4-(6-Oxo-1,4,5,6-tetrahydro-3-pyridazinyl) anilino hexyl 1,4-dihydro-2,6 Di methyl 5 nitro 4 aryl pyridine 3-carboxylates | |
JP2664941B2 (ja) | 1,4―ジヒドロピリジン化合物 | |
KR20050018947A (ko) | 퀴나졸린 유도체 | |
NZ207958A (en) | Dihydropyridine derivatives and pharmaceutical compositions | |
HU197304B (en) | Process for producing fluor-containing 1,4-dihydro-pyridines and pharmaceutical compositions containing them |