NO823294L - Fremgangsmaate ved fremstilling av vincaminsyreestere. - Google Patents
Fremgangsmaate ved fremstilling av vincaminsyreestere.Info
- Publication number
- NO823294L NO823294L NO823294A NO823294A NO823294L NO 823294 L NO823294 L NO 823294L NO 823294 A NO823294 A NO 823294A NO 823294 A NO823294 A NO 823294A NO 823294 L NO823294 L NO 823294L
- Authority
- NO
- Norway
- Prior art keywords
- formula
- acid
- octahydroindolo
- alkali metal
- mixture
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 17
- 150000002148 esters Chemical class 0.000 title claims description 10
- 239000002253 acid Substances 0.000 title claims description 9
- RXPRRQLKFXBCSJ-UHFFFAOYSA-N dl-Vincamin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-UHFFFAOYSA-N 0.000 title description 8
- RXPRRQLKFXBCSJ-GIVPXCGWSA-N vincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-GIVPXCGWSA-N 0.000 title description 6
- WKACQPMBGWZDMR-UHFFFAOYSA-N Vincamin Natural products CC=C1/CN2CCC34CC2C1C(=C3Nc5ccccc45)C=O WKACQPMBGWZDMR-UHFFFAOYSA-N 0.000 title 1
- 239000000203 mixture Substances 0.000 claims description 26
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 229910052783 alkali metal Inorganic materials 0.000 claims description 11
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 10
- -1 quinolizinoxy ester Chemical class 0.000 claims description 9
- 150000001340 alkali metals Chemical class 0.000 claims description 7
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 claims description 6
- 150000007522 mineralic acids Chemical class 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 5
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 239000001632 sodium acetate Substances 0.000 claims description 4
- 235000017281 sodium acetate Nutrition 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 235000010265 sodium sulphite Nutrition 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 23
- 150000001875 compounds Chemical class 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 9
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000908 ammonium hydroxide Substances 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 229960002726 vincamine Drugs 0.000 description 5
- 239000012670 alkaline solution Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 3
- 235000010262 sodium metabisulphite Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- GDRVFDDBLLKWRI-UHFFFAOYSA-N 4H-quinolizine Chemical compound C1=CC=CN2CC=CC=C21 GDRVFDDBLLKWRI-UHFFFAOYSA-N 0.000 description 2
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical group CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- OZDNDGXASTWERN-UHFFFAOYSA-N apovincamine Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)C=C(C(=O)OC)N5C2=C1 OZDNDGXASTWERN-UHFFFAOYSA-N 0.000 description 2
- 229950006936 apovincamine Drugs 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000002027 dichloromethane extract Substances 0.000 description 2
- 238000010931 ester hydrolysis Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- OURDZMSSMGUMKR-UHFFFAOYSA-N 1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine Chemical compound C1=CC=C2C(CCN3CCCCC33)=C3NC2=C1 OURDZMSSMGUMKR-UHFFFAOYSA-N 0.000 description 1
- RXPRRQLKFXBCSJ-HLAWJBBLSA-N 16-epivincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-HLAWJBBLSA-N 0.000 description 1
- OZDNDGXASTWERN-CTNGQTDRSA-N Apovincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C=C(C(=O)OC)N5C2=C1 OZDNDGXASTWERN-CTNGQTDRSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- MCUPLASQAWQHIW-UHFFFAOYSA-N Vinkamin Natural products CCC12C3CCCN1CCc4c2n(c5ccccc45)C(O)(C3)C(=O)OC MCUPLASQAWQHIW-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 238000006345 epimerization reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003250 quinolizines Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D461/00—Heterocyclic compounds containing indolo [3,2,1-d,e] pyrido [3,2,1,j] [1,5]-naphthyridine ring systems, e.g. vincamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU812812A HU182380B (en) | 1981-09-30 | 1981-09-30 | Process for producing esters of vincaminic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO823294L true NO823294L (no) | 1983-04-05 |
Family
ID=10961206
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO823294A NO823294L (no) | 1981-09-30 | 1982-09-29 | Fremgangsmaate ved fremstilling av vincaminsyreestere. |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4464534A (ja) |
| JP (1) | JPS58135884A (ja) |
| AT (1) | AT381311B (ja) |
| BE (1) | BE894491A (ja) |
| CA (1) | CA1261840A (ja) |
| CH (1) | CH653334A5 (ja) |
| DE (1) | DE3236144A1 (ja) |
| DK (1) | DK158470C (ja) |
| ES (1) | ES8403124A1 (ja) |
| FI (1) | FI70895C (ja) |
| FR (1) | FR2513638B1 (ja) |
| GB (1) | GB2110208B (ja) |
| GR (1) | GR77666B (ja) |
| HU (1) | HU182380B (ja) |
| IL (1) | IL66891A0 (ja) |
| IT (1) | IT1163005B (ja) |
| NL (1) | NL8203768A (ja) |
| NO (1) | NO823294L (ja) |
| PL (1) | PL137648B1 (ja) |
| PT (1) | PT75619B (ja) |
| SE (1) | SE446534B (ja) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU182411B (en) * | 1981-11-03 | 1984-01-30 | Richter Gedeon Vegyeszet | Process for preparing eburnamonine derivatives |
| HU186891B (en) * | 1981-06-12 | 1985-10-28 | Richter Gedeon Vegyeszet | Process for producing esters of apovincaminic acid |
| HU194220B (en) * | 1985-04-19 | 1988-01-28 | Richter Gedeon Vegyeszet | Process for production of derivatives of 1,12 b disubstituated-octahydro-indolo /2,3-a/ quinolisine and medical compounds containing thereof |
| FR2648817B1 (fr) * | 1989-06-21 | 1993-02-05 | Richter Gedeon Vegyeszet | Nouveau derives diester d'octahydro-indolo-(2,3-a)-tetrahydropyranyl (2,3-c) quinolizine racemiques et optiquement actifs et procede pour les preparer |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3770724A (en) * | 1970-03-31 | 1973-11-06 | Roussel Uclaf | Process for preparing pentacyclic alkaloids |
| HU163143B (ja) * | 1971-05-07 | 1973-06-28 | ||
| US4033969A (en) * | 1972-06-19 | 1977-07-05 | Agence Nationale De Valorisation De La Recherche (Anvar) | Vincamine derivatives |
| US4146643A (en) * | 1973-12-18 | 1979-03-27 | Sandoz Ltd. | Increasing vigilance or treating cerebral insufficiency with substituted vincamines |
| CH649295A5 (de) * | 1978-07-12 | 1985-05-15 | Richter Gedeon Vegyeszet | Optisch aktive oder razemische brom-e-homo-eburanderivate. |
| FR2459799A1 (fr) * | 1979-06-22 | 1981-01-16 | Synthelabo | Synthese de la ()-vincamine |
| HU181495B (en) * | 1979-05-31 | 1983-07-28 | Richter Gedeon Vegyeszet | Process for producing hydroxy-imino-eburnane derivatives |
| HU180927B (en) * | 1979-07-13 | 1983-05-30 | Richter Gedeon Vegyeszet | Process for producing 1k-hydroximino-e-homoe-eburane de rivatives |
-
1981
- 1981-09-30 HU HU812812A patent/HU182380B/hu not_active IP Right Cessation
-
1982
- 1982-09-27 BE BE1/10595A patent/BE894491A/fr not_active IP Right Cessation
- 1982-09-28 US US06/425,866 patent/US4464534A/en not_active Expired - Fee Related
- 1982-09-29 IL IL66891A patent/IL66891A0/xx not_active IP Right Cessation
- 1982-09-29 DE DE19823236144 patent/DE3236144A1/de not_active Ceased
- 1982-09-29 SE SE8205563A patent/SE446534B/sv not_active IP Right Cessation
- 1982-09-29 GR GR69398A patent/GR77666B/el unknown
- 1982-09-29 AT AT0360182A patent/AT381311B/de not_active IP Right Cessation
- 1982-09-29 PT PT75619A patent/PT75619B/pt unknown
- 1982-09-29 DK DK431682A patent/DK158470C/da not_active IP Right Cessation
- 1982-09-29 JP JP57168693A patent/JPS58135884A/ja active Granted
- 1982-09-29 CA CA000412494A patent/CA1261840A/en not_active Expired
- 1982-09-29 IT IT23517/82A patent/IT1163005B/it active
- 1982-09-29 FR FR8216363A patent/FR2513638B1/fr not_active Expired
- 1982-09-29 NL NL8203768A patent/NL8203768A/nl not_active Application Discontinuation
- 1982-09-29 CH CH5729/82A patent/CH653334A5/de not_active IP Right Cessation
- 1982-09-29 FI FI823333A patent/FI70895C/fi not_active IP Right Cessation
- 1982-09-29 GB GB08227830A patent/GB2110208B/en not_active Expired
- 1982-09-29 PL PL1982238418A patent/PL137648B1/pl unknown
- 1982-09-29 ES ES516054A patent/ES8403124A1/es not_active Expired
- 1982-09-29 NO NO823294A patent/NO823294L/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0348194B2 (ja) | 1991-07-23 |
| US4464534A (en) | 1984-08-07 |
| BE894491A (fr) | 1983-03-28 |
| SE8205563D0 (sv) | 1982-09-29 |
| FI823333L (fi) | 1983-03-31 |
| FI70895C (fi) | 1986-10-27 |
| JPS58135884A (ja) | 1983-08-12 |
| SE8205563L (sv) | 1983-03-31 |
| AT381311B (de) | 1986-09-25 |
| DK158470C (da) | 1990-10-15 |
| FI823333A0 (fi) | 1982-09-29 |
| NL8203768A (nl) | 1983-04-18 |
| HU182380B (en) | 1983-12-28 |
| PL238418A1 (en) | 1983-06-06 |
| DK158470B (da) | 1990-05-21 |
| CH653334A5 (de) | 1985-12-31 |
| FR2513638B1 (fr) | 1985-06-28 |
| PL137648B1 (en) | 1986-07-31 |
| ES516054A0 (es) | 1984-03-01 |
| GB2110208B (en) | 1985-02-20 |
| ATA360182A (de) | 1986-02-15 |
| PT75619A (en) | 1982-10-01 |
| IT1163005B (it) | 1987-04-08 |
| FI70895B (fi) | 1986-07-18 |
| GB2110208A (en) | 1983-06-15 |
| DE3236144A1 (de) | 1983-04-07 |
| DK431682A (da) | 1983-03-31 |
| ES8403124A1 (es) | 1984-03-01 |
| PT75619B (en) | 1985-01-08 |
| GR77666B (ja) | 1984-09-25 |
| CA1261840A (en) | 1989-09-26 |
| IT8223517A0 (it) | 1982-09-29 |
| IL66891A0 (en) | 1982-12-31 |
| SE446534B (sv) | 1986-09-22 |
| FR2513638A1 (fr) | 1983-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100386383B1 (ko) | 에난티오머성의순수트로프산에스테르의제조방법 | |
| NO152972B (no) | Analogifremgangsmaate for fremstilling av 2-(1-fenylbenzimidazolyl)-acetohydroksamsyre med terapeutisk aktivitet | |
| US2883384A (en) | Production of reserpine and analogs thereof | |
| NO154116B (no) | Fremgangsm¨te og lamellsepareringsapparat for tilf¯rsel og fordeling av en sammensatt v|ske til et lamellseparerings apparat. | |
| NO140977B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive 2-amino-1,4-dihydropyridiner | |
| US5362891A (en) | Process for the preparation of taurine-conjugated bile acids | |
| NO130398B (ja) | ||
| NO823294L (no) | Fremgangsmaate ved fremstilling av vincaminsyreestere. | |
| NO128608B (ja) | ||
| NO832810L (no) | 1,3-dioksolo(4,5-g)-kinoliner og fremgangsmaate for deres fremstilling. | |
| AU619129B2 (en) | Process for the preparation of methyl-quinoline derivatives | |
| EP0739885B1 (en) | Process for producing 3-isoxazolecarboxylic acid | |
| CZ191398A3 (cs) | Způsob přípravy 9,11ß-epoxisteroidů | |
| US5214199A (en) | Process for preparing malonic monoester | |
| US4656309A (en) | Preparation of alpha-pivaloyl-substituted acetic acid esters | |
| US3947453A (en) | 24-Oxo-14a-aza-D-homo-cholestadiene derivatives | |
| US4094878A (en) | Chemical synthesis of flavipucine | |
| US3049551A (en) | Novobiocin intermediate and process therefor | |
| NO750877L (ja) | ||
| US2701798A (en) | Ch-cha | |
| RU2034842C1 (ru) | Производные хинолина и способ их получения | |
| US6417350B1 (en) | Preparation of (11β,16β)-21-(3-carboxy-1-oxopropoxy)-11-hydroxy-2′-methyl-5′H-pregna-1,4-dieno [17,16-D]oxazole-3,20-dione | |
| US4156728A (en) | 3-Substituted-2(1H)pyridone-6-carboxylic acids | |
| KR950008527B1 (ko) | 피리딘 유도체의 제조방법 | |
| NO145788B (no) | Kinolinderivater for anvendelse som mellomprodukter ved fremstilling av 6,7-dialkoxy-4-oxy-kinolin-3-carboxylsyreestere |