NO312893B1 - <beta>-sulfonylhydroksaminsyrer som matriksmetalloproteinaseinhibitorer, og farmasöytisk preparatinneholdende disse - Google Patents
<beta>-sulfonylhydroksaminsyrer som matriksmetalloproteinaseinhibitorer, og farmasöytisk preparatinneholdende disse Download PDFInfo
- Publication number
- NO312893B1 NO312893B1 NO19991494A NO991494A NO312893B1 NO 312893 B1 NO312893 B1 NO 312893B1 NO 19991494 A NO19991494 A NO 19991494A NO 991494 A NO991494 A NO 991494A NO 312893 B1 NO312893 B1 NO 312893B1
- Authority
- NO
- Norway
- Prior art keywords
- methyl
- hydroxy
- propionamide
- methoxybenzenesulfonyl
- butylhydantoin
- Prior art date
Links
- 239000000825 pharmaceutical preparation Substances 0.000 title claims description 9
- 239000002253 acid Substances 0.000 title description 21
- 150000007513 acids Chemical class 0.000 title description 5
- 239000003771 matrix metalloproteinase inhibitor Substances 0.000 title description 4
- 229940121386 matrix metalloproteinase inhibitor Drugs 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims description 94
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 claims description 50
- 229940080818 propionamide Drugs 0.000 claims description 50
- -1 C1-4 - alkoxy Chemical group 0.000 claims description 46
- RHYBFKMFHLPQPH-UHFFFAOYSA-N N-methylhydantoin Natural products CN1CC(=O)NC1=O RHYBFKMFHLPQPH-UHFFFAOYSA-N 0.000 claims description 25
- XIUCDTIXVLEUMG-UHFFFAOYSA-N n-hydroxy-2-[(4-methoxyphenyl)sulfonylmethyl]-3-octylsulfonylpropanamide Chemical compound CCCCCCCCS(=O)(=O)CC(C(=O)NO)CS(=O)(=O)C1=CC=C(OC)C=C1 XIUCDTIXVLEUMG-UHFFFAOYSA-N 0.000 claims description 17
- 102000002274 Matrix Metalloproteinases Human genes 0.000 claims description 16
- 108010000684 Matrix Metalloproteinases Proteins 0.000 claims description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- GZCALQWRAMMVSG-UHFFFAOYSA-N n-hydroxy-3-(4-methoxyphenyl)sulfonyl-2-[(4-methoxyphenyl)sulfonylmethyl]propanamide Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)CC(C(=O)NO)CS(=O)(=O)C1=CC=C(OC)C=C1 GZCALQWRAMMVSG-UHFFFAOYSA-N 0.000 claims description 8
- RSDVBLKBRAZECX-UHFFFAOYSA-N n-hydroxy-5-(4-methoxyphenyl)sulfonyl-2-[(4-methoxyphenyl)sulfonylmethyl]pentanamide Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)CCCC(C(=O)NO)CS(=O)(=O)C1=CC=C(OC)C=C1 RSDVBLKBRAZECX-UHFFFAOYSA-N 0.000 claims description 7
- GGFLARIFGUFMLY-UHFFFAOYSA-N 3-(4-bromophenyl)sulfonyl-2-[(4-bromophenyl)sulfonylmethyl]-n-hydroxypropanamide Chemical compound C=1C=C(Br)C=CC=1S(=O)(=O)CC(C(=O)NO)CS(=O)(=O)C1=CC=C(Br)C=C1 GGFLARIFGUFMLY-UHFFFAOYSA-N 0.000 claims description 6
- IKRTUNFYRQZJTM-UHFFFAOYSA-N 3-(4-chlorophenyl)sulfonyl-2-[(4-chlorophenyl)sulfonylmethyl]-n-hydroxypropanamide Chemical compound C=1C=C(Cl)C=CC=1S(=O)(=O)CC(C(=O)NO)CS(=O)(=O)C1=CC=C(Cl)C=C1 IKRTUNFYRQZJTM-UHFFFAOYSA-N 0.000 claims description 6
- PWUPRWKCMAXCKI-UHFFFAOYSA-N 3-butylsulfonyl-2-(butylsulfonylmethyl)-n-hydroxypropanamide Chemical compound CCCCS(=O)(=O)CC(C(=O)NO)CS(=O)(=O)CCCC PWUPRWKCMAXCKI-UHFFFAOYSA-N 0.000 claims description 6
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 229910052736 halogen Chemical group 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- 230000002401 inhibitory effect Effects 0.000 claims description 6
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 claims description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 5
- NOHNSECEKFOVGT-UHFFFAOYSA-N 1-butylimidazolidine-2,4-dione Chemical compound CCCCN1CC(=O)NC1=O NOHNSECEKFOVGT-UHFFFAOYSA-N 0.000 claims description 5
- BSKDSCGZWSBLGT-UHFFFAOYSA-N 2-benzyl-n-hydroxy-3-(4-methoxyphenyl)sulfonylpropanamide Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)CC(C(=O)NO)CC1=CC=CC=C1 BSKDSCGZWSBLGT-UHFFFAOYSA-N 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- QRIWDFDMDKAYLN-UHFFFAOYSA-N n-hydroxy-3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]propanamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)CC(C(=O)NO)CS(=O)(=O)C1=CC=C(C)C=C1 QRIWDFDMDKAYLN-UHFFFAOYSA-N 0.000 claims description 5
- SNNKEXJKGVOHRP-UHFFFAOYSA-N n-hydroxy-3-octylsulfonyl-2-(octylsulfonylmethyl)propanamide Chemical compound CCCCCCCCS(=O)(=O)CC(C(=O)NO)CS(=O)(=O)CCCCCCCC SNNKEXJKGVOHRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 claims description 4
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 4
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 claims description 4
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 claims description 4
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- WTRNTDJLWVYXRB-UHFFFAOYSA-N 2-(benzenesulfonylmethyl)-n-hydroxy-3-phenylpropanamide Chemical compound C=1C=CC=CC=1S(=O)(=O)CC(C(=O)NO)CC1=CC=CC=C1 WTRNTDJLWVYXRB-UHFFFAOYSA-N 0.000 claims description 3
- IPLYHDFUXODDGE-UHFFFAOYSA-N 3-(benzenesulfonyl)-2-(benzenesulfonylmethyl)-n-hydroxypropanamide Chemical compound C=1C=CC=CC=1S(=O)(=O)CC(C(=O)NO)CS(=O)(=O)C1=CC=CC=C1 IPLYHDFUXODDGE-UHFFFAOYSA-N 0.000 claims description 3
- PVWKZXONCXNGRR-UHFFFAOYSA-N 3-(benzenesulfonyl)-n-hydroxy-2-methylpropanamide Chemical compound ONC(=O)C(C)CS(=O)(=O)C1=CC=CC=C1 PVWKZXONCXNGRR-UHFFFAOYSA-N 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims description 2
- 125000004847 2-fluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 claims description 2
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000006189 4-phenyl benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical group O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 claims description 2
- 229940091173 hydantoin Drugs 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 228
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 96
- 238000002360 preparation method Methods 0.000 description 67
- 239000000203 mixture Substances 0.000 description 61
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 50
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 48
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 48
- 239000007787 solid Substances 0.000 description 43
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 38
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 36
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 33
- 238000000034 method Methods 0.000 description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 23
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 20
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 19
- 235000017557 sodium bicarbonate Nutrition 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 17
- 239000012074 organic phase Substances 0.000 description 16
- 239000012267 brine Substances 0.000 description 15
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 14
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 13
- 201000010099 disease Diseases 0.000 description 13
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 239000012230 colorless oil Substances 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 10
- 239000012258 stirred mixture Substances 0.000 description 10
- 239000012153 distilled water Substances 0.000 description 9
- 235000019441 ethanol Nutrition 0.000 description 9
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 8
- 239000012141 concentrate Substances 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- NOOYFQLPKUQDNE-UHFFFAOYSA-N 2-(bromomethyl)prop-2-enoic acid Chemical class OC(=O)C(=C)CBr NOOYFQLPKUQDNE-UHFFFAOYSA-N 0.000 description 7
- 102000004190 Enzymes Human genes 0.000 description 7
- 108090000790 Enzymes Proteins 0.000 description 7
- 102000000422 Matrix Metalloproteinase 3 Human genes 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 229940088598 enzyme Drugs 0.000 description 7
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 7
- 235000019260 propionic acid Nutrition 0.000 description 7
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 7
- 108091007196 stromelysin Proteins 0.000 description 7
- NIFAOMSJMGEFTQ-UHFFFAOYSA-N 4-methoxybenzenethiol Chemical compound COC1=CC=C(S)C=C1 NIFAOMSJMGEFTQ-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 108010026132 Gelatinases Proteins 0.000 description 6
- 102000013382 Gelatinases Human genes 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 210000002808 connective tissue Anatomy 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 239000000758 substrate Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 150000003573 thiols Chemical class 0.000 description 6
- 230000008354 tissue degradation Effects 0.000 description 6
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical class Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical group N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 4
- 208000025865 Ulcer Diseases 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 102000003390 tumor necrosis factor Human genes 0.000 description 4
- 230000036269 ulceration Effects 0.000 description 4
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 3
- 108060005980 Collagenase Proteins 0.000 description 3
- 102000029816 Collagenase Human genes 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 206010027476 Metastases Diseases 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 206010028980 Neoplasm Diseases 0.000 description 3
- 208000001132 Osteoporosis Diseases 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 206010064996 Ulcerative keratitis Diseases 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- 150000001253 acrylic acids Chemical class 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229960002424 collagenase Drugs 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 3
- 230000002500 effect on skin Effects 0.000 description 3
- RTFHFJFAAKJBAL-UHFFFAOYSA-N ethyl 3-butylsulfonyl-2-(butylsulfonylmethyl)propanoate Chemical compound CCCCS(=O)(=O)CC(C(=O)OCC)CS(=O)(=O)CCCC RTFHFJFAAKJBAL-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 208000007565 gingivitis Diseases 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 230000009545 invasion Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- 230000009401 metastasis Effects 0.000 description 3
- HYDZPXNVHXJHBG-UHFFFAOYSA-N o-benzylhydroxylamine;hydron;chloride Chemical compound Cl.NOCC1=CC=CC=C1 HYDZPXNVHXJHBG-UHFFFAOYSA-N 0.000 description 3
- 201000001245 periodontitis Diseases 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- FWOIOHFVJKPHCX-UHFFFAOYSA-M sodium;4-butoxybenzenesulfinate Chemical compound [Na+].CCCCOC1=CC=C(S([O-])=O)C=C1 FWOIOHFVJKPHCX-UHFFFAOYSA-M 0.000 description 3
- 239000011343 solid material Substances 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- XVAKMAQOYNDXCC-UHFFFAOYSA-N 2-(octylsulfanylmethyl)prop-2-enoic acid Chemical compound CCCCCCCCSCC(=C)C(O)=O XVAKMAQOYNDXCC-UHFFFAOYSA-N 0.000 description 2
- XJDJOIXMWJFSCK-UHFFFAOYSA-N 2-[(4-butoxyphenyl)sulfonylmethyl]prop-2-enoic acid Chemical compound CCCCOC1=CC=C(S(=O)(=O)CC(=C)C(O)=O)C=C1 XJDJOIXMWJFSCK-UHFFFAOYSA-N 0.000 description 2
- IWMOPLLGCMDGKO-UHFFFAOYSA-N 2-[(4-methoxyphenyl)sulfonylmethyl]-3-octylsulfonylpropanoic acid Chemical compound CCCCCCCCS(=O)(=O)CC(C(O)=O)CS(=O)(=O)C1=CC=C(OC)C=C1 IWMOPLLGCMDGKO-UHFFFAOYSA-N 0.000 description 2
- DTZDCZKDOCTNLI-UHFFFAOYSA-N 2-benzyl-3-(4-methoxyphenyl)sulfonyl-n-phenylmethoxypropanamide Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)CC(C(=O)NOCC=1C=CC=CC=1)CC1=CC=CC=C1 DTZDCZKDOCTNLI-UHFFFAOYSA-N 0.000 description 2
- BQZHEGRXEZTRGH-UHFFFAOYSA-N 2-benzyl-3-(4-methoxyphenyl)sulfonylpropanoic acid Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)CC(C(O)=O)CC1=CC=CC=C1 BQZHEGRXEZTRGH-UHFFFAOYSA-N 0.000 description 2
- KDDBSOXJYRJAGU-UHFFFAOYSA-N 2-benzyl-3-ethoxy-3-oxopropanoic acid Chemical compound CCOC(=O)C(C(O)=O)CC1=CC=CC=C1 KDDBSOXJYRJAGU-UHFFFAOYSA-N 0.000 description 2
- QJPVJXCRHUISOY-UHFFFAOYSA-N 2-ethoxycarbonyl-5-(4-methoxyphenyl)sulfonylpentanoic acid Chemical compound CCOC(=O)C(C(O)=O)CCCS(=O)(=O)C1=CC=C(OC)C=C1 QJPVJXCRHUISOY-UHFFFAOYSA-N 0.000 description 2
- PYCARXNMSIMAAJ-UHFFFAOYSA-N 3-(4-chlorophenyl)sulfonyl-2-[(4-chlorophenyl)sulfonylmethyl]propanoic acid Chemical compound C=1C=C(Cl)C=CC=1S(=O)(=O)CC(C(=O)O)CS(=O)(=O)C1=CC=C(Cl)C=C1 PYCARXNMSIMAAJ-UHFFFAOYSA-N 0.000 description 2
- BNUUCBUVOIFWPT-UHFFFAOYSA-N 3-(4-methoxyphenyl)sulfonyl-2-[(4-methoxyphenyl)sulfonylmethyl]-n-phenylmethoxypropanamide Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)CC(C(=O)NOCC=1C=CC=CC=1)CS(=O)(=O)C1=CC=C(OC)C=C1 BNUUCBUVOIFWPT-UHFFFAOYSA-N 0.000 description 2
- YPHKZGHMWWAPSN-UHFFFAOYSA-N 3-(4-methoxyphenyl)sulfonyl-2-[(4-methoxyphenyl)sulfonylmethyl]propanoic acid Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)CC(C(O)=O)CS(=O)(=O)C1=CC=C(OC)C=C1 YPHKZGHMWWAPSN-UHFFFAOYSA-N 0.000 description 2
- LJJVUZMCCGMSRG-UHFFFAOYSA-N 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]propanoic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)CC(C(O)=O)CS(=O)(=O)C1=CC=C(C)C=C1 LJJVUZMCCGMSRG-UHFFFAOYSA-N 0.000 description 2
- PEPLRYOEQMVTMM-UHFFFAOYSA-N 3-(benzenesulfonyl)-2-methylpropanoic acid Chemical compound OC(=O)C(C)CS(=O)(=O)C1=CC=CC=C1 PEPLRYOEQMVTMM-UHFFFAOYSA-N 0.000 description 2
- RVNBFPIRLYCIGQ-UHFFFAOYSA-N 3-butylsulfonyl-2-(butylsulfonylmethyl)propanoic acid Chemical compound CCCCS(=O)(=O)CC(C(O)=O)CS(=O)(=O)CCCC RVNBFPIRLYCIGQ-UHFFFAOYSA-N 0.000 description 2
- KLFHRQOZJWCFOI-UHFFFAOYSA-N 3-methyl-1-[(3-methylpiperidin-1-yl)methyl]piperidine Chemical compound C1C(C)CCCN1CN1CC(C)CCC1 KLFHRQOZJWCFOI-UHFFFAOYSA-N 0.000 description 2
- JWXIUQLKYXVXMS-UHFFFAOYSA-N 5-(4-methoxyphenyl)sulfonyl-2-[(4-methoxyphenyl)sulfonylmethyl]-n-phenylmethoxypentanamide Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)CCCC(C(=O)NOCC=1C=CC=CC=1)CS(=O)(=O)C1=CC=C(OC)C=C1 JWXIUQLKYXVXMS-UHFFFAOYSA-N 0.000 description 2
- HEQWLWYUAPKCER-UHFFFAOYSA-N 5-(4-methoxyphenyl)sulfonyl-2-[(4-methoxyphenyl)sulfonylmethyl]pentanoic acid Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)CCCC(C(O)=O)CS(=O)(=O)C1=CC=C(OC)C=C1 HEQWLWYUAPKCER-UHFFFAOYSA-N 0.000 description 2
- 206010053555 Arthritis bacterial Diseases 0.000 description 2
- 108090001008 Avidin Proteins 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ICMAFTSLXCXHRK-UHFFFAOYSA-N Ethyl pentanoate Chemical compound CCCCC(=O)OCC ICMAFTSLXCXHRK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 208000004575 Infectious Arthritis Diseases 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- 229940124761 MMP inhibitor Drugs 0.000 description 2
- 208000029725 Metabolic bone disease Diseases 0.000 description 2
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 206010049088 Osteopenia Diseases 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 239000011616 biotin Chemical group 0.000 description 2
- 229960002685 biotin Drugs 0.000 description 2
- 235000020958 biotin Nutrition 0.000 description 2
- 230000036765 blood level Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229940126214 compound 3 Drugs 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- QHIZVKXJDDTBGY-UHFFFAOYSA-N diethyl 2-[3-(4-methoxyphenyl)sulfonylpropyl]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)CCCS(=O)(=O)C1=CC=C(OC)C=C1 QHIZVKXJDDTBGY-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 150000002118 epoxides Chemical class 0.000 description 2
- SHXICSKHCGDCSK-UHFFFAOYSA-N ethyl 2-benzyl-3-(4-methoxyphenyl)sulfonylpropanoate Chemical compound C=1C=C(OC)C=CC=1S(=O)(=O)CC(C(=O)OCC)CC1=CC=CC=C1 SHXICSKHCGDCSK-UHFFFAOYSA-N 0.000 description 2
- FVLGPYFFONYLRZ-UHFFFAOYSA-N ethyl 2-benzylprop-2-enoate Chemical compound CCOC(=O)C(=C)CC1=CC=CC=C1 FVLGPYFFONYLRZ-UHFFFAOYSA-N 0.000 description 2
- FEMOJJPWPOJSIL-UHFFFAOYSA-N ethyl 3-butylsulfanyl-2-(butylsulfanylmethyl)propanoate Chemical compound CCCCSCC(C(=O)OCC)CSCCCC FEMOJJPWPOJSIL-UHFFFAOYSA-N 0.000 description 2
- VSQCCDWWWVGDQT-UHFFFAOYSA-N ethyl 5-(4-methoxyphenyl)sulfonyl-2-[(4-methoxyphenyl)sulfonylmethyl]pentanoate Chemical compound C=1C=C(OC)C=CC=1S(=O)(=O)CC(C(=O)OCC)CCCS(=O)(=O)C1=CC=C(OC)C=C1 VSQCCDWWWVGDQT-UHFFFAOYSA-N 0.000 description 2
- HSIRMHOAOHCNBH-UHFFFAOYSA-N ethyl 5-(4-methoxyphenyl)sulfonyl-2-methylidenepentanoate Chemical compound CCOC(=O)C(=C)CCCS(=O)(=O)C1=CC=C(OC)C=C1 HSIRMHOAOHCNBH-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical group O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 150000002690 malonic acid derivatives Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- KZCOBXFFBQJQHH-UHFFFAOYSA-N octane-1-thiol Chemical compound CCCCCCCCS KZCOBXFFBQJQHH-UHFFFAOYSA-N 0.000 description 2
- 201000008482 osteoarthritis Diseases 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 206010039073 rheumatoid arthritis Diseases 0.000 description 2
- 201000001223 septic arthritis Diseases 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 1
- ZNYIPTYJBRGSSL-UHFFFAOYSA-N 1,5,5-trimethylimidazolidine-2,4-dione Chemical compound CN1C(=O)NC(=O)C1(C)C ZNYIPTYJBRGSSL-UHFFFAOYSA-N 0.000 description 1
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 1
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 1
- QHOINBKBMJLHPY-UHFFFAOYSA-N 2-chloroethyl formate Chemical compound ClCCOC=O QHOINBKBMJLHPY-UHFFFAOYSA-N 0.000 description 1
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 1
- IVHKZCSZELZKSJ-UHFFFAOYSA-N 2-hydroxyethyl sulfonate Chemical compound OCCOS(=O)=O IVHKZCSZELZKSJ-UHFFFAOYSA-N 0.000 description 1
- FTBCOQFMQSTCQQ-UHFFFAOYSA-N 4-bromobenzenethiol Chemical compound SC1=CC=C(Br)C=C1 FTBCOQFMQSTCQQ-UHFFFAOYSA-N 0.000 description 1
- HGKWMUBXVMFXNC-UHFFFAOYSA-N 4-butoxybenzenesulfonyl chloride Chemical compound CCCCOC1=CC=C(S(Cl)(=O)=O)C=C1 HGKWMUBXVMFXNC-UHFFFAOYSA-N 0.000 description 1
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 1
- DTJVECUKADWGMO-UHFFFAOYSA-N 4-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1 DTJVECUKADWGMO-UHFFFAOYSA-N 0.000 description 1
- YIROYDNZEPTFOL-UHFFFAOYSA-N 5,5-Dimethylhydantoin Chemical compound CC1(C)NC(=O)NC1=O YIROYDNZEPTFOL-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-N L-arginine Chemical compound OC(=O)[C@@H](N)CCCN=C(N)N ODKSFYDXXFIFQN-BYPYZUCNSA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 125000005002 aryl methyl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical class OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 238000003271 compound fluorescence assay Methods 0.000 description 1
- 208000018631 connective tissue disease Diseases 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
- 235000018417 cysteine Nutrition 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- WUOPYKKJFZHTRA-UHFFFAOYSA-N diethyl 2-(3-chloropropyl)propanedioate Chemical compound CCOC(=O)C(CCCCl)C(=O)OCC WUOPYKKJFZHTRA-UHFFFAOYSA-N 0.000 description 1
- ICZLTZWATFXDLP-UHFFFAOYSA-N diethyl 2-benzylpropanedioate Chemical compound CCOC(=O)C(C(=O)OCC)CC1=CC=CC=C1 ICZLTZWATFXDLP-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000005066 dodecenyl group Chemical group C(=CCCCCCCCCCC)* 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000003821 enantio-separation Methods 0.000 description 1
- 239000008393 encapsulating agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- PUSKHXMZPOMNTQ-UHFFFAOYSA-N ethyl 2,1,3-benzoselenadiazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2N=[Se]=NC2=C1 PUSKHXMZPOMNTQ-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 201000005917 gastric ulcer Diseases 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- DOUHZFSGSXMPIE-UHFFFAOYSA-N hydroxidooxidosulfur(.) Chemical compound [O]SO DOUHZFSGSXMPIE-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229960003646 lysine Drugs 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006126 n-butyl sulfonyl group Chemical group 0.000 description 1
- SWTFBLUIBHXOAH-UHFFFAOYSA-N n-butylhydroxylamine Chemical group CCCCNO SWTFBLUIBHXOAH-UHFFFAOYSA-N 0.000 description 1
- 125000005187 nonenyl group Chemical group C(=CCCCCCCC)* 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005071 nonynyl group Chemical group C(#CCCCCCCC)* 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005447 octyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005069 octynyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C#C* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- ALDITMKAAPLVJK-UHFFFAOYSA-N prop-1-ene;hydrate Chemical group O.CC=C ALDITMKAAPLVJK-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Substances CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 235000019833 protease Nutrition 0.000 description 1
- 230000000552 rheumatic effect Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- WUHWAOGAJFMIFU-UHFFFAOYSA-M sodium;4-methylbenzenesulfinate;hydrate Chemical compound O.[Na+].CC1=CC=C(S([O-])=O)C=C1 WUHWAOGAJFMIFU-UHFFFAOYSA-M 0.000 description 1
- CHLCPTJLUJHDBO-UHFFFAOYSA-M sodium;benzenesulfinate Chemical compound [Na+].[O-]S(=O)C1=CC=CC=C1 CHLCPTJLUJHDBO-UHFFFAOYSA-M 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- 230000000451 tissue damage Effects 0.000 description 1
- 231100000827 tissue damage Toxicity 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 230000006433 tumor necrosis factor production Effects 0.000 description 1
- 125000005065 undecenyl group Chemical group C(=CCCCCCCCCC)* 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 230000029663 wound healing Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/44—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/06—Antiasthmatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
- A61P19/10—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease for osteoporosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/04—Antineoplastic agents specific for metastasis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
Landscapes
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Physical Education & Sports Medicine (AREA)
- Rheumatology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Pulmonology (AREA)
- Immunology (AREA)
- Ophthalmology & Optometry (AREA)
- Oncology (AREA)
- Pain & Pain Management (AREA)
- Dermatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Lubricants (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2684896P | 1996-09-27 | 1996-09-27 | |
| PCT/US1997/016348 WO1998013340A1 (en) | 1996-09-27 | 1997-09-19 | β-SULFONYL HYDROXAMIC ACIDS AS MATRIX METALLOPROTEINASES INHIBITORS |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NO991494D0 NO991494D0 (no) | 1999-03-26 |
| NO991494L NO991494L (no) | 1999-05-26 |
| NO312893B1 true NO312893B1 (no) | 2002-07-15 |
Family
ID=21834136
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO19991494A NO312893B1 (no) | 1996-09-27 | 1999-03-26 | <beta>-sulfonylhydroksaminsyrer som matriksmetalloproteinaseinhibitorer, og farmasöytisk preparatinneholdende disse |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US5847153A (enExample) |
| EP (1) | EP0929519B1 (enExample) |
| JP (1) | JP2001516338A (enExample) |
| KR (1) | KR20000048639A (enExample) |
| CN (1) | CN1158254C (enExample) |
| AT (1) | ATE289590T1 (enExample) |
| AU (1) | AU726799B2 (enExample) |
| BR (1) | BR9712134A (enExample) |
| CA (1) | CA2266368A1 (enExample) |
| CZ (1) | CZ92399A3 (enExample) |
| DE (1) | DE69732571T2 (enExample) |
| EA (1) | EA001460B1 (enExample) |
| ES (1) | ES2236829T3 (enExample) |
| HU (1) | HUP0000145A3 (enExample) |
| ID (1) | ID21897A (enExample) |
| IL (1) | IL128900A0 (enExample) |
| NO (1) | NO312893B1 (enExample) |
| NZ (1) | NZ334729A (enExample) |
| PL (1) | PL332509A1 (enExample) |
| UA (1) | UA48262C2 (enExample) |
| WO (1) | WO1998013340A1 (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0968182B1 (en) * | 1996-08-07 | 2004-05-06 | Darwin Discovery Limited | Hydroxamic and carboxylic acid derivatives having mmp and tnf inhibitory activity |
| US6566384B1 (en) | 1996-08-07 | 2003-05-20 | Darwin Discovery Ltd. | Hydroxamic and carboxylic acid derivatives having MMP and TNF inhibitory activity |
| KR20000048639A (ko) * | 1996-09-27 | 2000-07-25 | 로렌스 티. 마이젠헬더 | 매트릭스 메탈로프로테이나제 억제제인 베타-술포닐 히드록삼산 |
| DE69829648T2 (de) | 1997-01-22 | 2009-12-10 | Aventis Pharmaceuticals Inc. | Substituierte β-Thiocarbonsäure |
| GB9702088D0 (en) | 1997-01-31 | 1997-03-19 | Pharmacia & Upjohn Spa | Matrix metalloproteinase inhibitors |
| US6172057B1 (en) | 1997-02-27 | 2001-01-09 | American Cyanamid Company | N-Hydroxy-2-(alkyl, aryl, or heteroaryl sulfanyl, sulfinyl or sulfonyl)-3-substituted alkyl, aryl or heteroarylamides as matrix metalloproteinase inhibitors |
| ES2209122T3 (es) * | 1997-03-04 | 2004-06-16 | Pharmacia Corporation | Compuestos de acido sulfonil alfa-hidroxi hidroxamico aromatico. |
| WO1998039326A1 (en) | 1997-03-04 | 1998-09-11 | Monsanto Company | Aromatic sulfonyl alpha-hydroxy hydroxamic acid compounds |
| US6063786A (en) * | 1997-11-12 | 2000-05-16 | Darwin Discovery, Ltd. | Heterocyclic compounds having MMP and TNF inhibitory activity |
| US6187924B1 (en) * | 1997-11-12 | 2001-02-13 | Darwin Discovery, Ltd. | Hydroxamic and carboxylic acid derivatives having MMP and TNF inhibitory activity |
| HUP0100812A3 (en) * | 1997-11-21 | 2002-11-28 | Upjohn Co | Alpha-hydroxy, -amino and -fluoro derivatives of betha-sulphonyl hydroxamic acids as matrix metalloproteinases inhibitors |
| IL137146A0 (en) * | 1998-01-30 | 2001-07-24 | Darwin Discovery Ltd | Hydroxamic and carboxylic acid derivatives |
| ATE402142T1 (de) | 1998-06-18 | 2008-08-15 | Hoffmann La Roche | Verfahren für arylalkylsulfid |
| GB9916562D0 (en) * | 1999-07-14 | 1999-09-15 | Pharmacia & Upjohn Spa | 3-Arylsulfonyl-2-(substituted-methyl) propanoic acid derivatives as matrix metalloproteinase inhibitora |
| US6620823B2 (en) | 2000-07-11 | 2003-09-16 | Bristol-Myers Squibb Pharme Company | Lactam metalloprotease inhibitors |
| GB0017435D0 (en) * | 2000-07-14 | 2000-08-30 | Pharmacia & Upjohn Spa | 3-arylsulfonyl-2-hydroxy-2-methylpropanoic acid derivatives |
| PE20030701A1 (es) | 2001-12-20 | 2003-08-21 | Schering Corp | Compuestos para el tratamiento de trastornos inflamatorios |
| JP2006516548A (ja) | 2002-12-30 | 2006-07-06 | アンジオテック インターナショナル アクツィエン ゲゼルシャフト | 迅速ゲル化ポリマー組成物からの薬物送達法 |
| JP2009519349A (ja) | 2005-12-15 | 2009-05-14 | ベーリンガー インゲルハイム インターナショナル ゲゼルシャフト ミット ベシュレンクテル ハフツング | Cb2受容体を変調する化合物 |
| JP5448164B2 (ja) | 2006-07-28 | 2014-03-19 | ベーリンガー インゲルハイム インターナショナル ゲゼルシャフト ミット ベシュレンクテル ハフツング | Cb2受容体を変調する化合物 |
| US7928123B2 (en) * | 2006-09-25 | 2011-04-19 | Boehringer Ingelheim International Gmbh | Compounds which modulate the CB2 receptor |
| WO2009061652A1 (en) | 2007-11-07 | 2009-05-14 | Boehringer Ingelheim International Gmbh | Compounds which modulate the cb2 receptor |
| WO2010005782A1 (en) | 2008-07-10 | 2010-01-14 | Boehringer Ingelheim International Gmbh | Sulfone compounds which modulate the cb2 receptor |
| AP2011005674A0 (en) | 2008-09-25 | 2011-04-30 | Boehringer Ingelheim Int | Sulfonyl compounds which selectively modulate the CB2 receptor. |
| US8299103B2 (en) | 2009-06-15 | 2012-10-30 | Boehringer Ingelheim International Gmbh | Compounds which selectively modulate the CB2 receptor |
| US8383615B2 (en) | 2009-06-16 | 2013-02-26 | Boehringer Ingelheim International Gmbh | Azetidine 2-carboxamide derivatives which modulate the CB2 receptor |
| US8383651B2 (en) | 2009-09-22 | 2013-02-26 | Boehringer Ingelheim International Gmbh | Compounds which selectively modulate the CB2 receptor |
| EP2523936A1 (en) | 2010-01-15 | 2012-11-21 | Boehringer Ingelheim International GmbH | Compounds which modulate the cb2 receptor |
| US8329735B2 (en) | 2010-03-05 | 2012-12-11 | Boehringer Ingelheim International Gmbh | Tetrazole compounds which selectively modulate the CB2 receptor |
| EP2595959B1 (en) | 2010-07-22 | 2015-11-04 | Boehringer Ingelheim International GmbH | Sulfonyl compounds which modulate the cb2 receptor |
| EP2803668A1 (en) | 2013-05-17 | 2014-11-19 | Boehringer Ingelheim International Gmbh | Novel (cyano-dimethyl-methyl)-isoxazoles and -[1,3,4]thiadiazoles |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB689608A (en) * | 1950-04-13 | 1953-04-01 | Basf Ag | Improvements in the production of gamma-sulphonyl carboxylic acids |
| US2659752A (en) * | 1951-08-09 | 1953-11-17 | Goodrich Co B F | Method for preparing beta-(arylsulfonyl) carboxylic acids and salts thereof |
| GB8827305D0 (en) * | 1988-11-23 | 1988-12-29 | British Bio Technology | Compounds |
| JP3348725B2 (ja) * | 1992-04-07 | 2002-11-20 | ブリティッシュ バイオテック ファーマシューティカルズ リミテッド | ヒドロキサム酸ベースのコラゲナーゼとサイトカイン阻害剤 |
| DE4233100A1 (de) * | 1992-10-01 | 1994-04-07 | Hoechst Ag | Verfahren zur stereoselektiven Synthese von 3-substituierten 2-Sulfonylmethylpropionsäuren sowie Zwischenprodukte |
| DE4233099A1 (de) * | 1992-10-01 | 1994-04-07 | Hoechst Ag | Verfahren zur stereoselektiven Synthese von 3-substituierten 2-Thiomethylpropionsäuren |
| GB9223904D0 (en) * | 1992-11-13 | 1993-01-06 | British Bio Technology | Inhibition of cytokine production |
| EP0640594A1 (en) * | 1993-08-23 | 1995-03-01 | Fujirebio Inc. | Hydantoin derivative as metalloprotease inhibitor |
| GB9320660D0 (en) * | 1993-10-07 | 1993-11-24 | British Bio Technology | Inhibition of cytokine production |
| ATE225343T1 (de) * | 1995-12-20 | 2002-10-15 | Hoffmann La Roche | Matrix-metalloprotease inhibitoren |
| AU1529897A (en) * | 1996-01-02 | 1997-07-28 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted (aryl, heteroaryl, arylmethyl or heteroarylmethyl) hydroxamic acid compounds |
| TW448172B (en) * | 1996-03-08 | 2001-08-01 | Pharmacia & Upjohn Co Llc | Novel hydroxamic acid derivatives useful for the treatment of diseases related to connective tissue degradation |
| KR20000048639A (ko) * | 1996-09-27 | 2000-07-25 | 로렌스 티. 마이젠헬더 | 매트릭스 메탈로프로테이나제 억제제인 베타-술포닐 히드록삼산 |
| WO1998039326A1 (en) | 1997-03-04 | 1998-09-11 | Monsanto Company | Aromatic sulfonyl alpha-hydroxy hydroxamic acid compounds |
-
1997
- 1997-09-19 KR KR1019990702581A patent/KR20000048639A/ko not_active Ceased
- 1997-09-19 NZ NZ334729A patent/NZ334729A/xx unknown
- 1997-09-19 IL IL12890097A patent/IL128900A0/xx unknown
- 1997-09-19 JP JP51570298A patent/JP2001516338A/ja not_active Withdrawn
- 1997-09-19 HU HU0000145A patent/HUP0000145A3/hu unknown
- 1997-09-19 CN CNB971979227A patent/CN1158254C/zh not_active Expired - Fee Related
- 1997-09-19 US US08/934,408 patent/US5847153A/en not_active Expired - Fee Related
- 1997-09-19 PL PL97332509A patent/PL332509A1/xx unknown
- 1997-09-19 UA UA99042348A patent/UA48262C2/uk unknown
- 1997-09-19 ID IDW990118A patent/ID21897A/id unknown
- 1997-09-19 EA EA199900332A patent/EA001460B1/ru not_active IP Right Cessation
- 1997-09-19 CZ CZ99923A patent/CZ92399A3/cs unknown
- 1997-09-19 BR BR9712134-7A patent/BR9712134A/pt active Search and Examination
- 1997-09-19 EP EP97945207A patent/EP0929519B1/en not_active Expired - Lifetime
- 1997-09-19 CA CA002266368A patent/CA2266368A1/en not_active Abandoned
- 1997-09-19 WO PCT/US1997/016348 patent/WO1998013340A1/en not_active Ceased
- 1997-09-19 ES ES97945207T patent/ES2236829T3/es not_active Expired - Lifetime
- 1997-09-19 AT AT97945207T patent/ATE289590T1/de not_active IP Right Cessation
- 1997-09-19 US US09/269,185 patent/US6235928B1/en not_active Expired - Fee Related
- 1997-09-19 AU AU46459/97A patent/AU726799B2/en not_active Ceased
- 1997-09-19 DE DE69732571T patent/DE69732571T2/de not_active Expired - Fee Related
-
1999
- 1999-03-26 NO NO19991494A patent/NO312893B1/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ID21897A (id) | 1999-08-05 |
| AU4645997A (en) | 1998-04-17 |
| EP0929519A1 (en) | 1999-07-21 |
| HK1022468A1 (en) | 2000-08-11 |
| NO991494L (no) | 1999-05-26 |
| HUP0000145A3 (en) | 2001-12-28 |
| EA001460B1 (ru) | 2001-04-23 |
| US5847153A (en) | 1998-12-08 |
| ATE289590T1 (de) | 2005-03-15 |
| NZ334729A (en) | 2001-01-26 |
| PL332509A1 (en) | 1999-09-13 |
| CZ92399A3 (cs) | 1999-07-14 |
| EA199900332A1 (ru) | 1999-12-29 |
| AU726799B2 (en) | 2000-11-23 |
| WO1998013340A1 (en) | 1998-04-02 |
| CA2266368A1 (en) | 1998-04-02 |
| KR20000048639A (ko) | 2000-07-25 |
| IL128900A0 (en) | 2000-01-31 |
| JP2001516338A (ja) | 2001-09-25 |
| CN1230177A (zh) | 1999-09-29 |
| HUP0000145A2 (en) | 2000-07-28 |
| DE69732571T2 (de) | 2006-01-12 |
| UA48262C2 (uk) | 2002-08-15 |
| EP0929519B1 (en) | 2005-02-23 |
| ES2236829T3 (es) | 2005-07-16 |
| BR9712134A (pt) | 1999-08-31 |
| US6235928B1 (en) | 2001-05-22 |
| CN1158254C (zh) | 2004-07-21 |
| DE69732571D1 (de) | 2005-03-31 |
| NO991494D0 (no) | 1999-03-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO312893B1 (no) | <beta>-sulfonylhydroksaminsyrer som matriksmetalloproteinaseinhibitorer, og farmasöytisk preparatinneholdende disse | |
| AU748998B2 (en) | N-hydroxy-2-(alkyl, aryl, or heteroaryl sulfanyl, sulfinyl or sulfonyl)-3-substituted alkyl, aryl or heteroarylamides as matrix metalloproteinase inhibitors | |
| US5859061A (en) | Bis-sulfonamides hydroxamic acids as MMP inhibitors | |
| AU763113B2 (en) | Alpha-hydroxy, -amino, and halo derivatives of beta-sulfonyl hydroxamic acids as matrix metalloproteinases inhibitors | |
| EA003283B1 (ru) | N-гидрокси-2-(алкил-, арил- или гетероарилсульфанил-, сульфинил- или сульфонил)-3-замещенный алкил-, арил- или гетероариламиды в качестве ингибиторов матричных металлопротеиназ | |
| EP2059500A2 (en) | Inhibitors of zinc proteases thioaryl substituted and their use | |
| US6765003B1 (en) | 3-Arylsulfonyl-2 (substituted methyl) propanoic acid derivatives as matrix metalloproteinase inhibitors | |
| AU776171C (en) | Alpha-amino-beta-sulfonyl hydroxamic acid compounds | |
| JP2003519100A (ja) | ベータ二置換メタロプロテアーゼ阻害剤 | |
| US5409939A (en) | Phenyl amidine thio derivatives useful as platelet aggregation inhibitors | |
| CZ20003036A3 (cs) | Inhibitory metaloproteinázy matrice | |
| MXPA99002807A (en) | &bgr;-SULFONYL HYDROXAMIC ACIDS AS MATRIX METALLOPROTEINASES INHIBITORS | |
| CZ20001886A3 (cs) | Alfa-hydroxy, alfa-amino a alfa-haloderiváty Bsulfonylhydroxamových kyselin jako inhibitory matricových metaloproteináz | |
| CA2274889A1 (en) | Bis-sulfonomides hydroxamic acids as mmp inhibitors | |
| CZ306099A3 (cs) | Inhibitory metalloproteinázy |