NO136228B - - Google Patents
Download PDFInfo
- Publication number
- NO136228B NO136228B NO3462/73A NO346273A NO136228B NO 136228 B NO136228 B NO 136228B NO 3462/73 A NO3462/73 A NO 3462/73A NO 346273 A NO346273 A NO 346273A NO 136228 B NO136228 B NO 136228B
- Authority
- NO
- Norway
- Prior art keywords
- corrosion
- capric acid
- metal
- vapor
- objects
- Prior art date
Links
- GHVNFZFCNZKVNT-UHFFFAOYSA-N decanoic acid Chemical compound CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 claims description 62
- 238000005260 corrosion Methods 0.000 claims description 38
- 230000007797 corrosion Effects 0.000 claims description 32
- 239000005632 Capric acid (CAS 334-48-5) Substances 0.000 claims description 31
- 229910052751 metal Inorganic materials 0.000 claims description 31
- 239000002184 metal Substances 0.000 claims description 31
- 239000000463 material Substances 0.000 claims description 19
- 239000000126 substance Substances 0.000 claims description 13
- 239000003112 inhibitor Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 7
- 239000002253 acid Substances 0.000 description 11
- -1 amine carboxylates Chemical class 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 10
- 239000000123 paper Substances 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 239000012808 vapor phase Substances 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical class CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229910001369 Brass Inorganic materials 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 3
- 239000010951 brass Substances 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 238000005470 impregnation Methods 0.000 description 3
- 238000004806 packaging method and process Methods 0.000 description 3
- 239000010959 steel Substances 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000005639 Lauric acid Substances 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- 239000002250 absorbent Substances 0.000 description 2
- 230000002745 absorbent Effects 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000002657 fibrous material Substances 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000005022 packaging material Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- 229920002955 Art silk Polymers 0.000 description 1
- 239000005635 Caprylic acid (CAS 124-07-2) Substances 0.000 description 1
- 229920000298 Cellophane Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- HXJOEVTXZQOPIT-UHFFFAOYSA-N decanoate;methylazanium Chemical compound [NH3+]C.CCCCCCCCCC([O-])=O HXJOEVTXZQOPIT-UHFFFAOYSA-N 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 239000002648 laminated material Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000010687 lubricating oil Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910001960 metal nitrate Inorganic materials 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 229960002446 octanoic acid Drugs 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000011101 paper laminate Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B23/00—Record carriers not specific to the method of recording or reproducing; Accessories, e.g. containers, specially adapted for co-operation with the recording or reproducing apparatus ; Intermediate mediums; Apparatus or processes specially adapted for their manufacture
- G11B23/02—Containers; Storing means both adapted to cooperate with the recording or reproducing means
- G11B23/023—Containers for magazines or cassettes
- G11B23/0233—Containers for a single cassette
Landscapes
- Packaging Of Annular Or Rod-Shaped Articles, Wearing Apparel, Cassettes, Or The Like (AREA)
- Packages (AREA)
- Automatic Tape Cassette Changers (AREA)
- Preventing Corrosion Or Incrustation Of Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1306572A CH556589A (de) | 1972-09-06 | 1972-09-06 | Behaelter zur aufnahme einer kassette mit einem bandfoermigen aufzeichnungstraeger. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO136228B true NO136228B (is) | 1977-04-25 |
| NO136228C NO136228C (no) | 1977-08-03 |
Family
ID=4388973
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO3462/73A NO136228C (no) | 1972-09-06 | 1973-09-04 | Beholder for en kassett med en b}ndformet registreringsb{rer. |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US3899229A (is) |
| JP (1) | JPS5211578B2 (is) |
| KR (1) | KR790000094Y1 (is) |
| AR (1) | AR201010A1 (is) |
| AT (2) | AT343933B (is) |
| AU (1) | AU477187B2 (is) |
| BE (1) | BE804473A (is) |
| BR (1) | BR7306942D0 (is) |
| CA (1) | CA1001588A (is) |
| CH (1) | CH556589A (is) |
| CS (1) | CS168668B2 (is) |
| DD (1) | DD105919A5 (is) |
| DE (3) | DE2248408C2 (is) |
| DK (1) | DK136922B (is) |
| ES (1) | ES418645A1 (is) |
| FI (1) | FI56593C (is) |
| FR (1) | FR2198210B1 (is) |
| GB (1) | GB1408516A (is) |
| HK (1) | HK32876A (is) |
| IL (1) | IL43132A (is) |
| IT (1) | IT996658B (is) |
| NL (1) | NL171304C (is) |
| NO (1) | NO136228C (is) |
| SE (1) | SE389572B (is) |
| SU (1) | SU505390A3 (is) |
| YU (1) | YU35687B (is) |
| ZA (1) | ZA735860B (is) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1986001930A1 (en) * | 1984-09-21 | 1986-03-27 | Frodelius Jan Erik | Storage means for tape or disc recording media |
Families Citing this family (99)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH556589A (de) * | 1972-09-06 | 1974-11-29 | Idn Invention Dev Novelties | Behaelter zur aufnahme einer kassette mit einem bandfoermigen aufzeichnungstraeger. |
| DE2427105C3 (de) * | 1974-06-05 | 1982-01-14 | IDN Inventions and Development of Novelties AG, Chur | Behälter für Magnetbandkassetten |
| DE2427109C3 (de) | 1974-06-05 | 1988-02-11 | IDN Inventions and Development of Novelties AG, Chur | Behälter für eine Magnetbandkassette |
| DE2427104C2 (de) * | 1974-06-05 | 1982-06-03 | IDN Inventions and Development of Novelties AG, 7002 Chur | Halter für Magnetbandkassette |
| DE2427107C3 (de) * | 1974-06-05 | 1980-11-13 | Idn Inventions And Development Of Novelties Ag, Chur (Schweiz) | Behälter für eine Magnetbandkassette |
| DE2462769C2 (de) * | 1974-06-05 | 1982-01-21 | IDN Inventions and Development of Novelties AG, Chur | Behälter für eine Magnetbandkassette |
| BE823527A (fr) * | 1974-12-18 | 1975-04-16 | Systeme de blocage d'une cassette dans un magasin de stockage | |
| GB1536206A (en) * | 1975-04-01 | 1978-12-20 | Sony Corp | Container for magnetic tape cassette |
| JPS522515A (en) * | 1975-06-24 | 1977-01-10 | Sony Corp | Cassette storage case |
| US4067629A (en) * | 1975-04-03 | 1978-01-10 | Sony Corporation | Storage receptacle for magnetic tape cassette |
| JPS51159103U (is) * | 1975-06-12 | 1976-12-17 | ||
| JPS523519U (is) * | 1975-06-24 | 1977-01-11 | ||
| JPS5211322U (is) * | 1975-07-14 | 1977-01-26 | ||
| DE2545771C2 (de) * | 1975-10-13 | 1982-12-02 | Unibox AG, Chur | Behälter zur Aufbewahrung einer Magnetbandkassette |
| DE2560415C2 (de) * | 1975-10-13 | 1983-12-22 | Unibox AG, Chur | Behälter zur Aufbewahrung von Magnetbandkassetten |
| FR2331120A1 (fr) * | 1975-11-05 | 1977-06-03 | Planchenault Fils | Dispositif pour le rangement des cassettes a bande magnetique et classeur muni de ce dispositif |
| JPS5280635U (is) * | 1975-12-13 | 1977-06-16 | ||
| US4054344A (en) * | 1976-04-05 | 1977-10-18 | Sony Corporation | Storage receptacle for magnetic tape cassette |
| JPS52144720U (is) * | 1976-04-28 | 1977-11-02 | ||
| US4087145A (en) * | 1976-07-30 | 1978-05-02 | Minnesota Mining And Manufacturing Company | Magnetic tape cartridge case with biasing means |
| JPS5324617U (is) * | 1976-08-09 | 1978-03-02 | ||
| AT355830B (de) * | 1977-01-17 | 1980-03-25 | Iisi Products Ag | Behaelter fuer tonbandkassetten |
| CH613799A5 (en) * | 1977-03-21 | 1979-10-15 | Macenpat Gmbh | Container with an exchangeable tape cassette located therein |
| US4191292A (en) * | 1977-03-21 | 1980-03-04 | Schweizer Eduard H | Container for interchangeable tape cassette |
| JPS53134914U (is) * | 1977-03-31 | 1978-10-25 | ||
| JPS53134915U (is) * | 1977-03-31 | 1978-10-25 | ||
| JPS5629824Y2 (is) * | 1977-06-15 | 1981-07-15 | ||
| JPS548916U (is) * | 1977-06-22 | 1979-01-20 | ||
| DE2802459A1 (de) * | 1978-01-20 | 1979-07-26 | Licinvest Ag | Archivierungseinrichtung |
| DE2757249A1 (de) * | 1977-12-22 | 1979-07-05 | Idn Invention Dev Novelties | Haltevorrichtung fuer tonbandkassettenbehaelter |
| AU521609B2 (en) * | 1977-12-22 | 1982-04-22 | Idn Inventions And Development Of Novelties A.G. | Magnetic tape cassette container support |
| DE2802460A1 (de) * | 1978-01-20 | 1979-07-26 | Idn Invention Dev Novelties | Stapelvorrichtung |
| USD258026S (en) | 1978-02-07 | 1981-01-27 | Iisi Products Ag | Container for tape cassettes |
| WO1979000804A1 (en) * | 1978-03-21 | 1979-10-18 | Claire Corp Ag | Box for cassette cases |
| USD258024S (en) | 1978-04-07 | 1981-01-27 | Iisi Products Ag | Container for tape cassettes |
| USD258025S (en) | 1978-04-07 | 1981-01-27 | Iisi Products Ag | Container for tape cassettes |
| JPS54172717U (is) * | 1978-05-25 | 1979-12-06 | ||
| JPS54172718U (is) * | 1978-05-25 | 1979-12-06 | ||
| US4326653A (en) * | 1978-06-08 | 1982-04-27 | Stone H Spencer | Visor-connected tape cartridge holder |
| US4307809A (en) | 1978-09-29 | 1981-12-29 | Gilfin International (F.T.) Ltd. | Tape cassette storage container |
| USD258849S (en) | 1978-11-20 | 1981-04-14 | Idn Inventions And Development Of Novelties Ag | Container for tape cassettes |
| US4216857A (en) * | 1979-04-19 | 1980-08-12 | Huang Lung Fei | Box for reserving cassette or cartridge |
| USD259303S (en) | 1979-04-26 | 1981-05-26 | Idn Inventions And Development Of Novelties Ag | Container for tape cassettes |
| USD276574S (en) | 1979-04-26 | 1984-12-04 | Idn Inventions And Development Of Novelties Ag | Container for tape cassettes |
| US4401216A (en) * | 1979-11-01 | 1983-08-30 | Koch Richard C | Media storage device |
| US4557533A (en) * | 1979-11-01 | 1985-12-10 | Koch Richard C | Media storage device |
| US4275943A (en) * | 1980-03-31 | 1981-06-30 | Shape Inc. | Container for a cassette |
| JPS5783503U (is) * | 1980-11-11 | 1982-05-24 | ||
| JPS6323815Y2 (is) * | 1980-11-11 | 1988-06-30 | ||
| US4426056A (en) | 1981-03-31 | 1984-01-17 | Shape Inc. | Plate bracket for mounting a cassette box |
| GB2099793B (en) | 1981-04-09 | 1985-06-05 | Idn Invention Dev Novelties | Containers for magnetic tape cassettes |
| US4399913A (en) * | 1981-05-18 | 1983-08-23 | Shape Inc. | Cassette container with flexible and hinged drawers |
| US4440301A (en) * | 1981-07-16 | 1984-04-03 | American Hospital Supply Corporation | Self-stacking reagent slide |
| JPS6038535Y2 (ja) * | 1981-12-15 | 1985-11-18 | ソニー株式会社 | カセツトケ−ス |
| EP0086275B1 (de) * | 1982-01-20 | 1987-11-19 | idn inventions and development of novelties ag | Behälter zur Aufbewahrung von Magnetbandkassetten oder anderen Aufzeichnungsträgern |
| DE3204336C2 (de) * | 1982-02-09 | 1984-06-14 | Agfa-Gevaert Ag, 5090 Leverkusen | Zusammensteckbare Halterung für mit Magnetbandkassetten belegte Etuis |
| DE3215721A1 (de) * | 1982-04-28 | 1983-11-03 | IDN Inventions and Development of Novelties AG, 7002 Chur | Magnetbandkassettenbehaelter |
| DE3247796A1 (de) * | 1982-12-23 | 1984-07-19 | IDN Inventions and Development of Novelties AG, Chur | Aufbewahrungsvorrichtung fuer scheibenfoermige aufzeichnungstraeger |
| EP0119320B1 (de) * | 1983-01-15 | 1987-03-18 | idn inventions and development of novelties ag | Behälter zur Aufnahme von Datenträgern |
| USD285986S (en) | 1983-05-13 | 1986-10-07 | Lung-Fei Huang | Tape-cassette box |
| GB2144028A (en) * | 1983-07-27 | 1985-02-27 | Tin Yauho | Holder for a magnetic tape cassette |
| US4856653A (en) * | 1983-08-29 | 1989-08-15 | Idn Inventions And Development Of Novelties A.G. | Storage container for compact cassettes |
| DE8423125U1 (de) * | 1984-08-03 | 1985-11-28 | IDN Inventions and Development of Novelties AG, Chur | Vorrichtung zum Aufbewahren von flachen Aufzeichnungsträgern |
| AU3227884A (en) * | 1983-08-29 | 1985-03-07 | Idn Inventions And Development Of Novelties A.G. | Cassette or disc storage |
| EP0134279A1 (de) * | 1983-08-29 | 1985-03-20 | idn inventions and development of novelties ag | Behälter zur Aufbewahrung von Magnetbandkassetten |
| DE3338738A1 (de) * | 1983-10-25 | 1985-05-09 | Geimuplast Peter Mundt Gmbh & Co Kg, 8105 Farchant | Versand- und aufbewahrungsbehaelter, vorzugsweise aus kunststoff, fuer video-kassetten o.dgl. |
| DE8416751U1 (de) * | 1984-06-01 | 1985-09-26 | IDN Inventions and Development of Novelties AG, Chur | Vorrichtung zum Aufbewahren von Aufzeichnungsträgern, insbesondere zum Einbau in Kraftfahrzeuge |
| GB2178403A (en) * | 1984-08-02 | 1987-02-11 | Idn Invention Dev Novelties | Container for recorded-material supports |
| DE8436935U1 (de) * | 1984-12-18 | 1986-04-17 | IDN Inventions and Development of Novelties AG, Chur | Behälter für eine Schall- oder Bildplatte |
| US4632248A (en) * | 1985-07-29 | 1986-12-30 | Hsu Feng Mei | Sound/video-recording tape storing device |
| DE3602695A1 (de) * | 1986-01-30 | 1987-08-06 | Idn Invention Dev Novelties | Behaelter fuer bild- und tonaufzeichnungstraeger |
| US4700840A (en) * | 1986-02-14 | 1987-10-20 | Drexler Technology Corporation | Data card cassette |
| US4884685A (en) * | 1986-04-01 | 1989-12-05 | Idn Inventions And Development Of Novelties Ag | Device for storing flat recording media |
| US4804085A (en) * | 1986-04-01 | 1989-02-14 | Idn Inventions And Development Of Novelties Ag | Device for storing flat recording media |
| USD309976S (en) | 1986-05-30 | 1990-08-21 | Idn Inventions And Development Of Novelties Ag | Container for cassettes |
| DE3620729A1 (de) * | 1986-06-20 | 1987-12-23 | Hans Raasch | Stapelbox fuer kompakttonband-kassetten |
| DE3701598A1 (de) * | 1987-01-21 | 1988-08-04 | Opel Adam Ag | Kassettenaufnahme |
| DE3703601A1 (de) * | 1987-02-06 | 1988-08-18 | Opel Adam Ag | Aufnahmefach sowie zusammenbau solcher aufnahmefaecher |
| DE3708356A1 (de) * | 1987-03-14 | 1988-09-22 | Fischer Artur Werke Gmbh | Behaelter fuer magnetbandkassetten |
| DE3806103A1 (de) * | 1988-02-26 | 1989-09-07 | Fischer Artur Werke Gmbh | Behaelter fuer aufzeichnungstraeger |
| NL8800993A (nl) * | 1988-04-18 | 1989-11-16 | Johannes Willibrordus Anthoniu | Opbergsysteem voor cassettes met daartoe geschikte elementen. |
| DE3906605A1 (de) * | 1989-03-02 | 1990-09-06 | Fischer Artur Werke Gmbh | Behaelter zur aufnahme einer kassette mit einem bandfoermigen aufzeichnungstraeger |
| DE3932584C2 (de) * | 1989-09-29 | 1994-10-27 | Hans Joachim Wolf | Verpackung für Aufzeichnungsträger wie z.B. Magnetbandkassetten |
| CA2059376A1 (en) * | 1991-01-16 | 1992-07-17 | Dale C. Kramer | Compact disc case |
| WO1992022903A1 (en) * | 1991-06-14 | 1992-12-23 | Luckhurst Anthony Henry Willia | Storage container |
| HUT64639A (en) * | 1991-06-19 | 1994-01-28 | Idn Invention Dev Novelties | Cassette holder |
| DE4129392A1 (de) * | 1991-09-04 | 1993-03-11 | Fischer Artur Werke Gmbh | Behaelter fuer flachteile, insbesondere muenzen |
| DE4219232A1 (de) * | 1992-06-12 | 1993-12-16 | Fischer Artur Werke Gmbh | Vorrichtung zur Aufbewahrung von Magnetbandkassetten |
| DE4219233A1 (de) * | 1992-06-12 | 1993-12-16 | Fischer Artur Werke Gmbh | Vorrichtung zur Aufbewahrung von Magnetbandkassetten |
| DE4229470A1 (de) * | 1992-09-03 | 1994-03-10 | Rc System Ges Fuer Entwicklung | Behälter, insbesondere für einen gerollten Negativ-Film, und Behälterteil für einen solchen Behälter |
| US5469961A (en) * | 1994-08-15 | 1995-11-28 | Chang; Chun Y. | Combined minidisc box |
| US5826719A (en) * | 1997-06-09 | 1998-10-27 | Chen; Kuen Jen | Tool box having a drawer |
| US7527170B2 (en) * | 2004-08-03 | 2009-05-05 | Derek Slocum | Weatherproof card holder/dispenser for vehicle exteriors |
| US20060061244A1 (en) * | 2004-09-17 | 2006-03-23 | Century Furniture Llc | Drawer interlock for a furniture element |
| US7477478B2 (en) * | 2006-03-30 | 2009-01-13 | International Business Machines Corporation | Deep storage slot with a constant spring force |
| US20070256681A1 (en) * | 2006-05-03 | 2007-11-08 | Chi-Hsiung Chiang | Smoke exhauster mounting structure |
| TW200938050A (en) * | 2008-02-20 | 2009-09-01 | Inventec Corp | Casing structure of electronic device |
| JP6389798B2 (ja) * | 2015-05-13 | 2018-09-12 | 富士フイルム株式会社 | テープカートリッジ収納ケース |
| US11369034B2 (en) * | 2019-09-18 | 2022-06-21 | Ortronics, Inc. | Ejectable cassette, guide column, and ejectable cassette system |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7215173U (de) * | 1972-07-27 | Kuntze G | Stapelbare Schubfacheinheit, insbesondere zum Aufbewahren einer Tonoder Bildbandkassette | |
| US328015A (en) * | 1885-10-13 | Table | ||
| US1062962A (en) * | 1913-03-03 | 1913-05-27 | Alexander Gaal | Toilet-cabinet. |
| BE489159A (is) * | 1948-05-28 | |||
| DE924363C (de) * | 1953-02-03 | 1955-02-28 | Voigtlaender Ag | An photographische Kameras ansetzbare Sonderkassette fuer die Herstellung von Reihenbildaufnahmen |
| US3552817A (en) * | 1967-08-31 | 1971-01-05 | Terry Plastic Di Guizzardi Cla | Compartmented storage cabinet |
| CA854022A (en) * | 1969-01-22 | 1970-10-20 | U. Gellert Jobst | Storage case tape cartridge |
| US3642337A (en) * | 1970-08-21 | 1972-02-15 | Jay Manheim | Cassette container |
| US3909088A (en) * | 1970-09-14 | 1975-09-30 | Memorex Corp | Cassette receptacle and storage apparatus |
| BE780968A (nl) * | 1972-03-21 | 1972-07-17 | Cogebi | Methode voor het opbergen van cassetten en daartoe geschikte houder. |
| CH556589A (de) * | 1972-09-06 | 1974-11-29 | Idn Invention Dev Novelties | Behaelter zur aufnahme einer kassette mit einem bandfoermigen aufzeichnungstraeger. |
-
1972
- 1972-09-06 CH CH1306572A patent/CH556589A/xx not_active IP Right Cessation
- 1972-10-03 DE DE2248408A patent/DE2248408C2/de not_active Expired
-
1973
- 1973-07-18 AT AT631873A patent/AT343933B/de not_active IP Right Cessation
- 1973-08-24 AT AT736773A patent/AT336300B/de not_active IP Right Cessation
- 1973-08-27 ZA ZA00735860A patent/ZA735860B/xx unknown
- 1973-08-27 US US391962A patent/US3899229A/en not_active Expired - Lifetime
- 1973-08-29 DE DE2343487A patent/DE2343487C2/de not_active Expired
- 1973-08-29 DE DE2366590A patent/DE2366590C2/de not_active Expired
- 1973-09-02 IL IL43132A patent/IL43132A/en unknown
- 1973-09-03 CS CS6141A patent/CS168668B2/cs unknown
- 1973-09-04 DD DD173268A patent/DD105919A5/xx unknown
- 1973-09-04 NO NO3462/73A patent/NO136228C/no unknown
- 1973-09-04 JP JP48098970A patent/JPS5211578B2/ja not_active Expired
- 1973-09-05 GB GB4177973A patent/GB1408516A/en not_active Expired
- 1973-09-05 ES ES418645A patent/ES418645A1/es not_active Expired
- 1973-09-05 SU SU1958187A patent/SU505390A3/ru active
- 1973-09-05 BE BE135327A patent/BE804473A/xx not_active IP Right Cessation
- 1973-09-05 CA CA180,359A patent/CA1001588A/en not_active Expired
- 1973-09-05 FR FR7332057A patent/FR2198210B1/fr not_active Expired
- 1973-09-05 SE SE7312106A patent/SE389572B/xx unknown
- 1973-09-05 YU YU2360/73A patent/YU35687B/xx unknown
- 1973-09-05 AU AU60033/73A patent/AU477187B2/en not_active Expired
- 1973-09-05 DK DK489373AA patent/DK136922B/da not_active IP Right Cessation
- 1973-09-06 NL NLAANVRAGE7312316,A patent/NL171304C/xx not_active IP Right Cessation
- 1973-09-06 IT IT69661/73A patent/IT996658B/it active
- 1973-09-06 AR AR249960A patent/AR201010A1/es active
- 1973-09-06 FI FI2774/73A patent/FI56593C/fi active
- 1973-09-06 BR BR6942/73A patent/BR7306942D0/pt unknown
-
1976
- 1976-06-03 HK HK328/76*UA patent/HK32876A/xx unknown
-
1978
- 1978-11-22 KR KR7805909U patent/KR790000094Y1/ko not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1986001930A1 (en) * | 1984-09-21 | 1986-03-27 | Frodelius Jan Erik | Storage means for tape or disc recording media |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO136228B (is) | ||
| US2986447A (en) | Vapor phase corrosion inhibition | |
| US2629649A (en) | Vapor-phase corrosion inhibitor | |
| US4973448A (en) | Vapor phase corrosion inhibitor product and method containing a desiccant | |
| US2643176A (en) | Compositions for protection of metals against corrosion | |
| CA2100074C (en) | Biocidal self-adhesive and process for producing the same, as well as self-adhesive article and application thereof | |
| Estevao et al. | Modifications in the volatilization rate of volatile corrosion inhibitors by means of host–guest systems | |
| US2512949A (en) | Corrosion inhibitor for metals | |
| US2643177A (en) | Vapor phase corrosion inhibition of metals | |
| US3891470A (en) | Ferrous metals treated with imidazole compounds for corrosion resistance | |
| Andreev et al. | Volatile inhibitors of atmospheric corrosion. IV. Evolution of vapor-phase protection in the light of patent literature | |
| US2923632A (en) | Methods and devices for preventing stalk rot in fruit stalks | |
| US2571739A (en) | Prevention of corrosion of structural metals by hydrogen sulfide, air, and water | |
| US2662808A (en) | Corrosion inhibition with nitrobenzaldehydes | |
| US2549050A (en) | Rust preventive film | |
| US2717196A (en) | Sheet wrapping material containing nitro-phenol compound | |
| SE200889C1 (is) | ||
| JP5152688B2 (ja) | 防錆紙 | |
| US2291460A (en) | Metal coating mixture | |
| Stroud et al. | The prevention of corrosion in packaging. I. The use of sodium benzoate as a corrosion‐inhibitor in wrappings | |
| US2731324A (en) | Corrosion inhibitor containing alkanoyloxyacetic acid and method of using same | |
| US3779818A (en) | Method for preventing the formation of rust on the surface of coiled steel strip and an inhibitor for accomplishing same | |
| CN107119279A (zh) | 自适应、自调节的气相防锈方法 | |
| US20190093236A1 (en) | Compositions of vapor phase corrosion inhibitors and their use as well as methods for their manufacture | |
| RU2334665C1 (ru) | Упаковочный материал с летучим ингибитором коррозии |