NO120935B - - Google Patents
Download PDFInfo
- Publication number
- NO120935B NO120935B NO152953A NO15295364A NO120935B NO 120935 B NO120935 B NO 120935B NO 152953 A NO152953 A NO 152953A NO 15295364 A NO15295364 A NO 15295364A NO 120935 B NO120935 B NO 120935B
- Authority
- NO
- Norway
- Prior art keywords
- aza
- dibenzo
- dihydro
- cycloheptene
- compound
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 96
- 238000000034 method Methods 0.000 claims description 74
- -1 substituents halogen Chemical class 0.000 claims description 47
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 18
- 229920006395 saturated elastomer Polymers 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 15
- 238000004519 manufacturing process Methods 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000003277 amino group Chemical group 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 229910052744 lithium Inorganic materials 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 150000001340 alkali metals Chemical group 0.000 claims description 5
- 230000018044 dehydration Effects 0.000 claims description 5
- 238000006297 dehydration reaction Methods 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 238000005984 hydrogenation reaction Methods 0.000 claims description 5
- 125000002524 organometallic group Chemical group 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 150000002431 hydrogen Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 150000002440 hydroxy compounds Chemical class 0.000 claims description 4
- 150000002902 organometallic compounds Chemical class 0.000 claims description 4
- 229910052700 potassium Inorganic materials 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 238000003776 cleavage reaction Methods 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- 150000003222 pyridines Chemical class 0.000 claims description 2
- 230000007017 scission Effects 0.000 claims description 2
- 238000006467 substitution reaction Methods 0.000 claims description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 88
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 82
- 239000000243 solution Substances 0.000 description 70
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 49
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 49
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 48
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 238000006243 chemical reaction Methods 0.000 description 33
- 238000010992 reflux Methods 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 30
- 238000002360 preparation method Methods 0.000 description 28
- 238000002844 melting Methods 0.000 description 27
- 230000008018 melting Effects 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 26
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 24
- 238000010438 heat treatment Methods 0.000 description 23
- 150000002576 ketones Chemical class 0.000 description 23
- 239000000047 product Substances 0.000 description 22
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- 229960000583 acetic acid Drugs 0.000 description 18
- 239000000543 intermediate Substances 0.000 description 17
- 229920000137 polyphosphoric acid Polymers 0.000 description 16
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- 125000001424 substituent group Chemical group 0.000 description 15
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 13
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 12
- ZXIJMRYMVAMXQP-UHFFFAOYSA-N cycloheptene Chemical compound C1CCC=CCC1 ZXIJMRYMVAMXQP-UHFFFAOYSA-N 0.000 description 12
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 12
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 12
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 12
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 11
- 239000000706 filtrate Substances 0.000 description 11
- 150000002596 lactones Chemical class 0.000 description 11
- 239000007858 starting material Substances 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- 239000000376 reactant Substances 0.000 description 10
- 238000007363 ring formation reaction Methods 0.000 description 10
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- FIBVUGPJCPOSJB-UHFFFAOYSA-N 2-(2-phenylethyl)pyridine-3-carboxylic acid Chemical class OC(=O)C1=CC=CN=C1CCC1=CC=CC=C1 FIBVUGPJCPOSJB-UHFFFAOYSA-N 0.000 description 9
- HMWBPQZTSAICMS-UHFFFAOYSA-N 3-(2-phenylethyl)pyridine-4-carboxylic acid Chemical class OC(=O)C1=CC=NC=C1CCC1=CC=CC=C1 HMWBPQZTSAICMS-UHFFFAOYSA-N 0.000 description 9
- 241000699670 Mus sp. Species 0.000 description 9
- 150000001204 N-oxides Chemical class 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 8
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 238000006356 dehydrogenation reaction Methods 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- JENIILKCEYGCJV-UHFFFAOYSA-N 3-(2-phenylethyl)pyridine-2-carbonitrile Chemical compound N#CC1=NC=CC=C1CCC1=CC=CC=C1 JENIILKCEYGCJV-UHFFFAOYSA-N 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 230000002804 anti-anaphylactic effect Effects 0.000 description 7
- 230000001387 anti-histamine Effects 0.000 description 7
- 150000003997 cyclic ketones Chemical class 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000005457 ice water Substances 0.000 description 7
- 229910052740 iodine Inorganic materials 0.000 description 7
- 239000011777 magnesium Substances 0.000 description 7
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- 230000009467 reduction Effects 0.000 description 7
- 238000006722 reduction reaction Methods 0.000 description 7
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 6
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000012458 free base Substances 0.000 description 6
- 239000011630 iodine Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- CRFCTXYSRZHZQB-UHFFFAOYSA-N 1h-benzo[1,2]cyclohepta[3,4-b]pyridine Chemical compound C1=CC=C2C=CC=CC2=C2NC=CC=C21 CRFCTXYSRZHZQB-UHFFFAOYSA-N 0.000 description 5
- LDPMSPVUGCVFHB-UHFFFAOYSA-N 2-(2-phenylethenyl)pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC=CN=C1C=CC1=CC=CC=C1 LDPMSPVUGCVFHB-UHFFFAOYSA-N 0.000 description 5
- DXKCYWXEHAMAQW-UHFFFAOYSA-N 3-(2-phenylethyl)pyridine Chemical compound C=1C=CC=CC=1CCC1=CC=CN=C1 DXKCYWXEHAMAQW-UHFFFAOYSA-N 0.000 description 5
- OXIDANFQRMCKEW-UHFFFAOYSA-N 4-(2-phenylethyl)pyridine-3-carboxylic acid Chemical class OC(=O)C1=CN=CC=C1CCC1=CC=CC=C1 OXIDANFQRMCKEW-UHFFFAOYSA-N 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 5
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 5
- 239000000739 antihistaminic agent Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 150000004795 grignard reagents Chemical class 0.000 description 5
- 229910052749 magnesium Inorganic materials 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- DJJPOVQKVDBHFG-UHFFFAOYSA-N 3-(2-phenylethyl)pyridine-2-carboxylic acid Chemical compound OC(=O)C1=NC=CC=C1CCC1=CC=CC=C1 DJJPOVQKVDBHFG-UHFFFAOYSA-N 0.000 description 4
- QSVZFWGNHWNVDJ-UHFFFAOYSA-N 3-(2-phenylethyl)pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC=C1CCC1=CC=CC=C1 QSVZFWGNHWNVDJ-UHFFFAOYSA-N 0.000 description 4
- 239000007818 Grignard reagent Substances 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- ZDXGKCWPISPQIQ-UHFFFAOYSA-N ethyl 4-methylpyridine-3-carboxylate Chemical compound CCOC(=O)C1=CN=CC=C1C ZDXGKCWPISPQIQ-UHFFFAOYSA-N 0.000 description 4
- 229960001340 histamine Drugs 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 4
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- QPDZAAFAAADIRA-UHFFFAOYSA-N 1-oxido-3-(2-phenylethyl)pyridin-1-ium Chemical compound [O-][N+]1=CC=CC(CCC=2C=CC=CC=2)=C1 QPDZAAFAAADIRA-UHFFFAOYSA-N 0.000 description 3
- AWLFVFGRSPUANH-UHFFFAOYSA-N 4-methyl-3-(2-phenylethyl)pyridine Chemical compound CC1=CC=NC=C1CCC1=CC=CC=C1 AWLFVFGRSPUANH-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 241000700198 Cavia Species 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000007962 benzene acetonitriles Chemical class 0.000 description 3
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 3
- 229960001140 cyproheptadine Drugs 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- 150000001989 diazonium salts Chemical class 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 231100000673 dose–response relationship Toxicity 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- QFWPJPIVLCBXFJ-UHFFFAOYSA-N glymidine Chemical compound N1=CC(OCCOC)=CN=C1NS(=O)(=O)C1=CC=CC=C1 QFWPJPIVLCBXFJ-UHFFFAOYSA-N 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000010561 standard procedure Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- DWQYMLYCTCRYHL-UHFFFAOYSA-N 1-(4-methylpyridin-3-yl)-2-phenylethanone Chemical compound CC1=CC=NC=C1C(=O)CC1=CC=CC=C1 DWQYMLYCTCRYHL-UHFFFAOYSA-N 0.000 description 2
- HUUPVABNAQUEJW-UHFFFAOYSA-N 1-methylpiperidin-4-one Chemical compound CN1CCC(=O)CC1 HUUPVABNAQUEJW-UHFFFAOYSA-N 0.000 description 2
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- GVEQCFMNUYFHOE-UHFFFAOYSA-N 2-phenyl-1-pyridin-3-ylethanone Chemical compound C=1C=CN=CC=1C(=O)CC1=CC=CC=C1 GVEQCFMNUYFHOE-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- OTJNZCAGDNFIMV-UHFFFAOYSA-N 4-(2-phenylethenyl)pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CN=CC=C1C=CC1=CC=CC=C1 OTJNZCAGDNFIMV-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- XBLVHTDFJBKJLG-UHFFFAOYSA-N Ethyl nicotinate Chemical compound CCOC(=O)C1=CC=CN=C1 XBLVHTDFJBKJLG-UHFFFAOYSA-N 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229910052770 Uranium Inorganic materials 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 231100000460 acute oral toxicity Toxicity 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 238000005574 benzylation reaction Methods 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 229930007927 cymene Natural products 0.000 description 2
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- TZORNSWZUZDUCU-UHFFFAOYSA-N ethyl 2-methylpyridine-3-carboxylate Chemical compound CCOC(=O)C1=CC=CN=C1C TZORNSWZUZDUCU-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N 1-Heptene Chemical compound CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- NIJWAAUHTPDGOM-UHFFFAOYSA-N 2-(2-phenylethyl)pyridine Chemical compound C=1C=CC=CC=1CCC1=CC=CC=N1 NIJWAAUHTPDGOM-UHFFFAOYSA-N 0.000 description 1
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- WQDQDLHATTVJSW-UHFFFAOYSA-N 2-ethyl-5-(1-methylpyrrolidin-2-yl)pyridine Chemical compound C1=NC(CC)=CC=C1C1N(C)CCC1 WQDQDLHATTVJSW-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- SWHRHZCHAQSEHY-UHFFFAOYSA-N 3-(2-phenylethenyl)pyridine-2-carboxylic acid Chemical compound OC(=O)C1=NC=CC=C1C=CC1=CC=CC=C1 SWHRHZCHAQSEHY-UHFFFAOYSA-N 0.000 description 1
- ZXBTYOPAKHBOGW-UHFFFAOYSA-N 3-(2-phenylethyl)-1H-pyridin-4-one Chemical compound C1(=CC=CC=C1)CCC=1C=NC=CC1O ZXBTYOPAKHBOGW-UHFFFAOYSA-N 0.000 description 1
- AGIAYOIJHFTOSV-UHFFFAOYSA-N 3-(2-phenylethyl)-1h-pyridin-2-one Chemical compound O=C1NC=CC=C1CCC1=CC=CC=C1 AGIAYOIJHFTOSV-UHFFFAOYSA-N 0.000 description 1
- KERIVOPTFMHQMZ-UHFFFAOYSA-N 3-(2-phenylethyl)pyridin-4-amine hydrochloride Chemical compound Cl.C1(=CC=CC=C1)CCC=1C=NC=CC1N KERIVOPTFMHQMZ-UHFFFAOYSA-N 0.000 description 1
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 1
- MRHMJGLJPOGNFH-UHFFFAOYSA-N 3-oxo-2-phenyl-3-pyridin-3-ylpropanenitrile Chemical compound C=1C=CN=CC=1C(=O)C(C#N)C1=CC=CC=C1 MRHMJGLJPOGNFH-UHFFFAOYSA-N 0.000 description 1
- JRZLFWDVRBHECO-UHFFFAOYSA-N 4-(chloromethyl)-n,n-dimethylcyclohexan-1-amine Chemical compound CN(C)C1CCC(CCl)CC1 JRZLFWDVRBHECO-UHFFFAOYSA-N 0.000 description 1
- BEOBZEOPTQQELP-UHFFFAOYSA-N 4-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=C(C=O)C=C1 BEOBZEOPTQQELP-UHFFFAOYSA-N 0.000 description 1
- CBEDUTMSISIWLK-UHFFFAOYSA-N 4-bromo-1,6-dimethylcyclohexa-2,4-dien-1-amine Chemical compound CC1C=C(Br)C=CC1(C)N CBEDUTMSISIWLK-UHFFFAOYSA-N 0.000 description 1
- MYGXGCCFTPKWIH-UHFFFAOYSA-N 4-chloro-1-methylpiperidine Chemical compound CN1CCC(Cl)CC1 MYGXGCCFTPKWIH-UHFFFAOYSA-N 0.000 description 1
- IVYMIRMKXZAHRV-UHFFFAOYSA-N 4-chlorophenylacetonitrile Chemical compound ClC1=CC=C(CC#N)C=C1 IVYMIRMKXZAHRV-UHFFFAOYSA-N 0.000 description 1
- ZWJLRFXTAQXYCQ-UHFFFAOYSA-N 4-nitro-1-oxido-3-(2-phenylethenyl)pyridin-1-ium Chemical compound [O-][N+](=O)C1=CC=[N+]([O-])C=C1C=CC1=CC=CC=C1 ZWJLRFXTAQXYCQ-UHFFFAOYSA-N 0.000 description 1
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical group C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 description 1
- 206010027654 Allergic conditions Diseases 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 101000856746 Bos taurus Cytochrome c oxidase subunit 7A1, mitochondrial Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ZEGVEJNVXNSJES-UHFFFAOYSA-M C(C1=CC=CC=C1)N(CC1=CC=CC=C1)CCC[Mg]Br Chemical compound C(C1=CC=CC=C1)N(CC1=CC=CC=C1)CCC[Mg]Br ZEGVEJNVXNSJES-UHFFFAOYSA-M 0.000 description 1
- SPQZKKAZVNADKZ-UHFFFAOYSA-N CC1=CC=NC=C1C(=O)C(C#N)C1=CC=CC=C1 Chemical compound CC1=CC=NC=C1C(=O)C(C#N)C1=CC=CC=C1 SPQZKKAZVNADKZ-UHFFFAOYSA-N 0.000 description 1
- FFKBFSSMCXLZCX-UHFFFAOYSA-N CN(C)CCC=C(C1=C(CC2)C=CC=C1)C1=C2C=CC=N1 Chemical compound CN(C)CCC=C(C1=C(CC2)C=CC=C1)C1=C2C=CC=N1 FFKBFSSMCXLZCX-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- 238000006898 Intramolecular Friedel-Crafts reaction Methods 0.000 description 1
- 229910021055 KNH2 Inorganic materials 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 201000005702 Pertussis Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 101000650578 Salmonella phage P22 Regulatory protein C3 Proteins 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 101001040920 Triticum aestivum Alpha-amylase inhibitor 0.28 Proteins 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- RMPCPFLMKUEWKH-UHFFFAOYSA-N [3-(2-phenylethyl)pyridin-2-yl] acetate Chemical compound C(C)(=O)OC1=NC=CC=C1CCC1=CC=CC=C1 RMPCPFLMKUEWKH-UHFFFAOYSA-N 0.000 description 1
- AVMOEOFFQPGCQS-UHFFFAOYSA-M [Cl-].C(C1=CC=CC=C1)N1CCC(CC1)[Mg+] Chemical compound [Cl-].C(C1=CC=CC=C1)N1CCC(CC1)[Mg+] AVMOEOFFQPGCQS-UHFFFAOYSA-M 0.000 description 1
- PTSSXLQWBTWOPU-UHFFFAOYSA-M [Cl-].CN1CCC([Mg+])CC1 Chemical compound [Cl-].CN1CCC([Mg+])CC1 PTSSXLQWBTWOPU-UHFFFAOYSA-M 0.000 description 1
- CGXZZFXDSYNSBH-UHFFFAOYSA-N [Li]C1=CC=C(N(C)C)C=C1 Chemical compound [Li]C1=CC=C(N(C)C)C=C1 CGXZZFXDSYNSBH-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000003420 antiserotonin agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 125000000477 aza group Chemical group 0.000 description 1
- PFAPCWGTXQWOGB-UHFFFAOYSA-N benzo[1,2]cyclohepta[3,4-b]pyridin-5-one Chemical class O=C1C=CC2=CC=CC=C2C2=NC=CC=C12 PFAPCWGTXQWOGB-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- SOYKEARSMXGVTM-UHFFFAOYSA-N chlorphenamine Chemical compound C=1C=CC=NC=1C(CCN(C)C)C1=CC=C(Cl)C=C1 SOYKEARSMXGVTM-UHFFFAOYSA-N 0.000 description 1
- 229960003291 chlorphenamine Drugs 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- XHRNQDMNINGCES-UHFFFAOYSA-N cyclohept-4-en-1-one Chemical compound O=C1CCC=CCC1 XHRNQDMNINGCES-UHFFFAOYSA-N 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 238000007269 dehydrobromination reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 150000008508 dibenzocycloheptenes Chemical class 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- SWGLFOANRWDGLW-UHFFFAOYSA-N ethyl 4-(2-phenylethenyl)pyridine-3-carboxylate Chemical compound CCOC(=O)C1=CN=CC=C1C=CC1=CC=CC=C1 SWGLFOANRWDGLW-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229940064982 ethylnicotinate Drugs 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- 229960004931 histamine dihydrochloride Drugs 0.000 description 1
- PPZMYIBUHIPZOS-UHFFFAOYSA-N histamine dihydrochloride Chemical compound Cl.Cl.NCCC1=CN=CN1 PPZMYIBUHIPZOS-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000005191 hydroxyalkylamino group Chemical group 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- NGPAITITALWALP-UHFFFAOYSA-M magnesium;n,n-dimethylpropan-1-amine;chloride Chemical compound [Mg+2].[Cl-].CN(C)CC[CH2-] NGPAITITALWALP-UHFFFAOYSA-M 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 229960001238 methylnicotinate Drugs 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N nicotinic acid Natural products OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen(.) Chemical compound [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 229940066827 pertussis vaccine Drugs 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 206010039083 rhinitis Diseases 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/16—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing only one pyridine ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/50—Ketonic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/53—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/57—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/04—Ortho- or peri-condensed ring systems
- C07D221/06—Ring systems of three rings
- C07D221/16—Ring systems of three rings containing carbocyclic rings other than six-membered
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pyridine Compounds (AREA)
- Glass Melting And Manufacturing (AREA)
- Hydrogenated Pyridines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO16769367A NO134157C (enExample) | 1963-04-24 | 1967-04-12 |
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US27523763A | 1963-04-24 | 1963-04-24 | |
| US330244A US3366635A (en) | 1963-04-24 | 1963-12-13 | Aza-5h-dibenzo-[a,d]-(cycloheptenes and cycloheptene-5-ones) and the corresponding 10, 11-dihydro derivatives thereof |
| US330263A US3326924A (en) | 1963-04-24 | 1963-12-13 | Novel aza-dibenzo[a, d]-cycloheptene derivatives |
| US42010164A | 1964-12-21 | 1964-12-21 | |
| US580169A US3357986A (en) | 1963-04-24 | 1966-09-19 | 1, 2, 3 or 4, aza,-[5-piperdyl or hydrocarbyl amino]-10, 11 dihydro-5h-dibenzo-[a, d]-cycloheptene |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO120935B true NO120935B (enExample) | 1970-12-28 |
Family
ID=27540590
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO152953A NO120935B (enExample) | 1963-04-24 | 1964-04-23 | |
| NO66164333A NO120938B (enExample) | 1963-04-24 | 1966-08-17 | |
| NO66164332A NO121949B (enExample) | 1963-04-24 | 1966-08-17 |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO66164333A NO120938B (enExample) | 1963-04-24 | 1966-08-17 | |
| NO66164332A NO121949B (enExample) | 1963-04-24 | 1966-08-17 |
Country Status (17)
| Country | Link |
|---|---|
| US (3) | US3326924A (enExample) |
| JP (3) | JPS4840356B1 (enExample) |
| BE (1) | BE647043A (enExample) |
| BR (1) | BR6458580D0 (enExample) |
| CH (2) | CH535769A (enExample) |
| CY (1) | CY543A (enExample) |
| DE (2) | DE1795744A1 (enExample) |
| DK (2) | DK125421B (enExample) |
| FI (1) | FI52220C (enExample) |
| FR (1) | FR4013M (enExample) |
| GB (1) | GB1065191A (enExample) |
| IL (1) | IL21208A (enExample) |
| IT (2) | IT1149233B (enExample) |
| MY (1) | MY7000130A (enExample) |
| NL (2) | NL6404490A (enExample) |
| NO (3) | NO120935B (enExample) |
| SE (4) | SE379765B (enExample) |
Families Citing this family (58)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3378567A (en) * | 1965-12-20 | 1968-04-16 | Schering Corp | 5-diloweralkylaminoalkoxy ethers of 4-aza-10, 11-dihydro-5h-dibenzo[a, d]-cycloheptene derivatives |
| US3409621A (en) * | 1966-04-01 | 1968-11-05 | Schering Corp | Piperazino-aza-dibenzo-[a, d]-cycloheptenes |
| US3458522A (en) * | 1967-05-17 | 1969-07-29 | Sandoz Ag | 4-piperidine substituted benzocycloheptaoxazoles and benzocycloheptathiazoles |
| US3458524A (en) * | 1968-03-27 | 1969-07-29 | Schering Corp | Novel 5-alkylaminoalkoximino-aza-dibenzo-(a,d)-cycloheptenes |
| DK401476A (da) * | 1975-09-15 | 1977-03-16 | Sandoz Ag | Fremgangsmade til fremstilling af benzocycloheptapyridinforbindelser |
| US4092322A (en) * | 1977-02-14 | 1978-05-30 | Warner-Lambert Company | 1-Benzoxepino[4,3-c]pyridines |
| US4355036A (en) * | 1980-06-19 | 1982-10-19 | Schering Corporation | Tricyclic-substituted piperidine antihistamines |
| US4282233B1 (en) * | 1980-06-19 | 2000-09-05 | Schering Corp | Antihistaminic 11-(4-piperidylidene)-5h-benzoÄ5,6Ü-cyclohepta-Ä1,2Ü-pyridines |
| US4454143A (en) * | 1981-03-16 | 1984-06-12 | Schering Corporation | Tricyclic antihistamines |
| JPS61501205A (ja) * | 1984-02-15 | 1986-06-19 | シェリング・コ−ポレ−ション | 8↓−クロル↓−6,11↓−ジヒドロ↓−11↓−(4↓−ピペリジリデン)↓−5H↓−ベンゾ〔5,6〕シクロヘプタ〔1,2−b〕ピリジンおよびその塩、これらの化合物の製造方法、ならびにこれらの化合物を含有する医薬組成物 |
| US4834980A (en) * | 1984-07-23 | 1989-05-30 | Schering Corporation | Transdermal delivery of azatidine |
| DE3677842D1 (de) * | 1985-05-13 | 1991-04-11 | Schering Corp | Verfahren zur herstellung von piperidyliden-dihydrodibenzo(a,d)zykloheptenen und deren azoderivate, so hergestellte verbindungen und ihre anwendung zur vorbereitung von heilmitteln. |
| US4731447A (en) * | 1985-05-13 | 1988-03-15 | Schering Corporation | Process for preparing piperidylidene dihydro-dibenzo(a,d)-cycloheptenes or aza-derivatives thereof |
| US4804666A (en) | 1985-08-14 | 1989-02-14 | Schering Corporation | Antiallergic 6,11-dihydro-11-(4-piperidylidene)-5H-benzo(5,6)cyclohepta(1,2-B)pyridines |
| US4639457A (en) * | 1985-08-19 | 1987-01-27 | Merck & Co., Inc. | Benzocycloheptapyridone compounds for treating congestive heart failure |
| US4873335A (en) * | 1986-03-12 | 1989-10-10 | Schering Corporation | 3-phenethyl-2-benzene-amides or aza-derivatives thereof |
| US5011860A (en) * | 1986-04-11 | 1991-04-30 | Schering Corporation | Aryl-substituted naphthyridine and pyridopyrazine derivatives and their use in treating hyperproliferative skin diseases |
| US4826853A (en) | 1986-10-31 | 1989-05-02 | Schering Corporation | 6,11-Dihydro-11-(N-substituted-4-piperidylidene)-5H-benzo(5,6)cyclohepta(1,2-B)pyridines and compositions and methods of use |
| US5438062A (en) * | 1986-10-31 | 1995-08-01 | Schering Corporation | Benzo(5,6)cycloheptapyridines, compositions and methods of use |
| US5089496A (en) | 1986-10-31 | 1992-02-18 | Schering Corporation | Benzo[5,6]cycloheptapyridine compounds, compositions and method of treating allergies |
| US5665726A (en) * | 1986-10-31 | 1997-09-09 | Schering Corporation | Benzo[5,6]cycloheptapyridines, compositions and methods of use |
| US4843163A (en) * | 1987-12-02 | 1989-06-27 | Smithkline Beckman Corporation | Certain 3-(2-phenethyl)-1-carbamoyloxypyridinium halide intermediates |
| JP2766266B2 (ja) * | 1988-06-20 | 1998-06-18 | 協和醗酵工業株式会社 | ピリジン誘導体およびその中間体 |
| US4863931A (en) * | 1988-09-15 | 1989-09-05 | Schering Corporation | Antihistaminic fluoro substituted benzocycloheptapyridines |
| US4996321A (en) * | 1990-02-26 | 1991-02-26 | Merck & Co., Inc. | Dibenzo[a,d]cycloheptenylidene compounds |
| NZ238629A (en) * | 1990-06-22 | 1993-09-27 | Schering Corp | Bis-benzo- or benzopyrido-cyclohepta (where z is c, o, s or n) piperidine, piperidylidene or piperazine compounds, medicaments and methods of preparation |
| AU8854091A (en) * | 1990-10-10 | 1992-05-20 | Schering Corporation | Bis-benzo cyclohepta piperidylidene, piperidine and piperazine compounds, compositions and methods of use |
| GB9102997D0 (en) * | 1991-02-13 | 1991-03-27 | Pfizer Ltd | Therapeutic agents |
| CA2109702A1 (en) * | 1991-05-23 | 1992-11-26 | Jesse K. Wong | Novel benzopyrido piperidylidene compounds, compositions, methods of manufacture and methods of use |
| EP0595989A1 (en) * | 1991-07-23 | 1994-05-11 | Schering Corporation | Benzopyrido piperylidene compounds, compositions, methods of manufacture and methods of use |
| ES2040177B1 (es) * | 1992-03-06 | 1994-05-16 | S A Tamarang | Procedimiento para la sintesis de la 8-cloro-6, 11-dihidro-11, (1-etoxicarbonil-4-piperidiliden) -5h-benzo (5,6) ciclohepta-(1,2-b) piridina. |
| JPH07505393A (ja) * | 1992-03-27 | 1995-06-15 | シェリング・コーポレーション | 非橋渡しビスアリールカルビノール誘導体,組成物および使用法 |
| CA2132849A1 (en) * | 1992-03-27 | 1993-10-14 | Jesse K. Wong | Bridged bis-aryl carbinol derivatives, compositions and methods of use |
| AU4244593A (en) * | 1992-05-19 | 1993-12-13 | Schering Corporation | Pentacyclic antihistamines |
| US5464840A (en) * | 1993-12-06 | 1995-11-07 | Schering Corporation | Tricyclic derivatives, compositions and methods of use |
| US7211582B1 (en) * | 1994-12-30 | 2007-05-01 | Sepracor Inc. | Methods for treating urticaria using descarboethoxyloratadine |
| US5801175A (en) | 1995-04-07 | 1998-09-01 | Schering Corporation | Tricyclic compounds useful for inhibition of G-protein function and for treatment of proliferative diseases |
| WO1997040009A1 (en) * | 1996-04-25 | 1997-10-30 | Nissan Chemical Industries, Ltd. | Ethylene derivatives and pest controlling agents |
| US6509346B2 (en) * | 1998-01-21 | 2003-01-21 | Millennium Pharmaceuticals, Inc. | Chemokine receptor antagonists and methods of use therefor |
| EP1098882B1 (en) * | 1998-07-24 | 2004-08-25 | Russinsky Limited | A process for preparing benzocycloheptapyridin-11-ones |
| US6267986B1 (en) | 1999-09-24 | 2001-07-31 | Ranbaxy Laboratories Limited | Process for the preparation of a controlled drug delivery system containing pseudoephedrine and a long acting antihistamine |
| US7541365B2 (en) * | 2001-11-21 | 2009-06-02 | Millennium Pharmaceuticals, Inc. | Chemokine receptor antagonists and methods of use therefor |
| AU2003230758A1 (en) * | 2002-04-02 | 2003-10-20 | Merck And Co., Inc. | 5h-benzo(4,5)cyclohepta(1,2-b)pyridine nmda/nr2b antagonists |
| WO2004019955A1 (en) * | 2002-08-30 | 2004-03-11 | Altana Pharma Ag | The use of the combination of ciclesonide and antihistamines for the treatment of allergic rhinitis |
| TWI291467B (en) * | 2002-11-13 | 2007-12-21 | Millennium Pharm Inc | CCR1 antagonists and methods of use therefor |
| PT1507531E (pt) * | 2003-03-12 | 2007-03-30 | Teva Pharma | Composições farmacêuticas estáveis de desloratadina |
| NL1026634C2 (nl) * | 2004-07-12 | 2006-01-16 | Willem Jacob Van Der Burg | Psychofarmaceutisch preparaat en werkzame stof daarin. |
| EP1896421B1 (en) * | 2005-06-23 | 2011-09-14 | Merck Sharp & Dohme Corp. | Benzocycloheptapyridines as inhibitors of the receptor tyrosine kinase met |
| US20070036859A1 (en) * | 2005-08-11 | 2007-02-15 | Perry Ronald L | Sustained release antihistamine and decongestant composition |
| WO2007050383A2 (en) * | 2005-10-21 | 2007-05-03 | Merck & Co., Inc. | Tyrosine kinase inhibitors |
| NZ573174A (en) | 2006-06-01 | 2012-01-12 | Msd Consumer Care Inc | Sustained release pharmaceutical dosage form containing phenylephrine |
| CA2653953C (en) | 2006-06-01 | 2015-12-08 | Schering-Plough Healthcare Products, Inc. | Phenylephrine pharmaceutical formulations and compositions for colonic absorption |
| TW200813021A (en) * | 2006-07-10 | 2008-03-16 | Merck & Co Inc | Tyrosine kinase inhibitors |
| US20090082385A1 (en) * | 2007-09-26 | 2009-03-26 | Protia, Llc | Deuterium-enriched desloratidine |
| US20090281156A1 (en) * | 2007-12-21 | 2009-11-12 | Schering-Plough Healthcare Products, Inc, | Enhancing photostabilization of oxymetazoline |
| CN102993172B (zh) * | 2012-12-19 | 2014-04-02 | 天津大学 | 具有抗组胺活性的三环类化合物、制备方法及用途 |
| GB202103803D0 (en) | 2021-03-18 | 2021-05-05 | Queens Univ Of Belfast | Anti-viral therapy |
| CN112898268A (zh) * | 2021-04-07 | 2021-06-04 | 深圳振强生物技术有限公司 | 一种地氯雷他定杂质的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB858187A (en) * | 1958-04-03 | 1961-01-11 | Hoffmann La Roche | Novel dibenzocycloheptaenes and salts thereof and a process for the manufacture of same |
| GB858186A (en) * | 1958-04-03 | 1961-01-11 | Hoffmann La Roche | Novel dibenzoheptaenes and salts thereof and a process for the manufacture of same |
| US3014911A (en) * | 1958-09-29 | 1961-12-26 | Merck & Co Inc | Derivatives of dibenzo[a, e]cycloheptatriene |
| US3073847A (en) * | 1959-02-12 | 1963-01-15 | Hoffmann La Roche | 9-(3-amino-1-propynyl) derivatives of 9-xanthenols and 9-thioxanthenols and a process for their preparation |
| DE1160442B (de) * | 1959-03-18 | 1964-01-02 | Degussa | Verfahren zur Herstellung von 3-Trifluormethylphenthiazinen |
| US3086972A (en) * | 1960-03-24 | 1963-04-23 | Sandoz Ag | Aza-thiaxanthene derivatives |
| US3127409A (en) * | 1962-08-08 | 1964-03-31 | Olin Mathieson | Novel dihydropyridobenzoxazepines and dihydropyridobenzthiazepines |
-
0
- NL NL132137D patent/NL132137C/xx active
-
1963
- 1963-12-13 US US330263A patent/US3326924A/en not_active Expired - Lifetime
- 1963-12-13 US US330244A patent/US3366635A/en not_active Expired - Lifetime
-
1964
- 1964-04-20 CH CH509564A patent/CH535769A/de not_active IP Right Cessation
- 1964-04-20 CH CH584573A patent/CH544091A/de not_active IP Right Cessation
- 1964-04-20 IL IL21208A patent/IL21208A/xx unknown
- 1964-04-21 GB GB16484/64A patent/GB1065191A/en not_active Expired
- 1964-04-22 BR BR158580/64A patent/BR6458580D0/pt unknown
- 1964-04-23 FI FI640863A patent/FI52220C/fi active
- 1964-04-23 DK DK205164AA patent/DK125421B/da unknown
- 1964-04-23 FR FR972072A patent/FR4013M/fr not_active Expired
- 1964-04-23 SE SE6912617*3A patent/SE379765B/xx unknown
- 1964-04-23 DE DE19641795744 patent/DE1795744A1/de active Pending
- 1964-04-23 NO NO152953A patent/NO120935B/no unknown
- 1964-04-23 NL NL6404490A patent/NL6404490A/xx unknown
- 1964-04-23 IT IT08873/64A patent/IT1149233B/it active
- 1964-04-23 DE DE1964SC041153 patent/DE1695853B2/de active Granted
- 1964-04-24 JP JP39022868A patent/JPS4840356B1/ja active Pending
- 1964-04-24 BE BE647043D patent/BE647043A/xx unknown
-
1966
- 1966-08-17 NO NO66164333A patent/NO120938B/no unknown
- 1966-08-17 NO NO66164332A patent/NO121949B/no unknown
- 1966-09-19 US US580169A patent/US3357986A/en not_active Expired - Lifetime
-
1968
- 1968-06-25 SE SE08609/68A patent/SE338317B/xx unknown
- 1968-06-25 SE SE08610/68A patent/SE349030B/xx unknown
- 1968-06-25 SE SE08607/68A patent/SE347745B/xx unknown
-
1969
- 1969-09-09 DK DK482469AA patent/DK125133B/da unknown
-
1970
- 1970-06-26 CY CY54370A patent/CY543A/xx unknown
- 1970-12-31 MY MY1970130A patent/MY7000130A/xx unknown
-
1972
- 1972-02-28 IT IT21129/72A patent/IT1123902B/it active
-
1973
- 1973-05-25 JP JP48058500A patent/JPS5030078B1/ja active Pending
- 1973-05-25 JP JP7358499A patent/JPS5030077B1/ja active Pending
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO120935B (enExample) | ||
| US3014911A (en) | Derivatives of dibenzo[a, e]cycloheptatriene | |
| US3682930A (en) | 4(1-alkyl-4-piperidylidine)-4h-benzo {84,5{9 {0 cyclohepta {8 1,2{14 6{9 | |
| NO167693B (no) | System for syklisk avbrytelse av driften av en anordning mellom en foerste tilstand og en andre tilstand. | |
| Buckle et al. | Studies on 1, 2, 3-triazoles. 13.(Piperazinylalkoxy)-[1] benzopyrano [2, 3-d]-1, 2, 3-triazol-9 (1H)-ones with combined H1-antihistamine and mast cell stabilizing properties | |
| US3717647A (en) | Alpha-nicotinoyl phenylacetonitriles | |
| EP0386839B1 (en) | Tetrahydroquinoline derivatives useful for neurodegenerative disorders | |
| Villani et al. | Benzopyranopyridine derivatives. 1. Aminoalkyl derivatives of the azaxanthenes as bronchodilating agents | |
| NO136150B (no) | Analogifremgangsm}te til fremstilling av terapeutisk aktive pyridyl- eller piperidinsubstituerte 1,4-dihydro-4-okso-3-kinolinkarboksylsyre-estere. | |
| JPS6134426B2 (enExample) | ||
| HU205900B (en) | Process for producing alpha, alpha-disubstituted aromatic and heteroaromatic compounds and pharmaceutical compositions containing them | |
| NO178149B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive 7-tetrahydro-naftyridin-6-fluor-1,4-dihydro-4-okso-kinolin-3-karboksylsyrer | |
| NO300809B1 (no) | Tricykliske kondenserte heterocykliske forbindelser og deres anvendelse | |
| FI61899B (fi) | Foerfarande foer framstaellning av antiflogistiska och antitrombotiska 6-substituerad-3-amino-4-fenyl-1h-pyrazolo/3,4-b/pyridiner | |
| US5416087A (en) | Bis-benzo, cyclohepta piperidylidene, piperidine and piperazine compounds, compositions and methods of use | |
| US3419565A (en) | Aza-dibenzocycloheptenes | |
| US4243666A (en) | 4-Amino-2-piperidino-quinazolines | |
| US4698345A (en) | Quinoline derivatives and their use as anti-asthmatic agents | |
| US4515944A (en) | 1,5-Diphenyl-2-haloalkylpyrazolin-3-one intermediates | |
| US4387098A (en) | Imidazo[1,2-a]quinoline derivatives useful as anxiolytics | |
| US3301863A (en) | Amino derivatives of phenethylpyridines | |
| US6043371A (en) | Organic compound synthesis | |
| US3382250A (en) | Aroylalkyl derivatives of 1, 2, 3, 4-tetrahydro-5h-pyrido[4, 3b]indoles | |
| NO144110B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 5:6-benzo-4-pyron-derivater | |
| US4167638A (en) | Process for production of 8-NHR quinolines |