NO118917B - - Google Patents
Download PDFInfo
- Publication number
- NO118917B NO118917B NO16430466A NO16430466A NO118917B NO 118917 B NO118917 B NO 118917B NO 16430466 A NO16430466 A NO 16430466A NO 16430466 A NO16430466 A NO 16430466A NO 118917 B NO118917 B NO 118917B
- Authority
- NO
- Norway
- Prior art keywords
- general formula
- pyrimidine
- given above
- ethyl
- denotes
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229940124530 sulfonamide Drugs 0.000 claims description 6
- 150000003456 sulfonamides Chemical class 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 230000003178 anti-diabetic effect Effects 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- BRSRNTJGTDYRFT-UHFFFAOYSA-N 2-(benzenesulfonyl)guanidine Chemical compound NC(N)=NS(=O)(=O)C1=CC=CC=C1 BRSRNTJGTDYRFT-UHFFFAOYSA-N 0.000 claims description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 3
- 239000003472 antidiabetic agent Substances 0.000 claims description 3
- 239000000155 melt Substances 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 150000003230 pyrimidines Chemical class 0.000 claims description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 238000005695 dehalogenation reaction Methods 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- 150000002366 halogen compounds Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 claims description 2
- 230000002829 reductive effect Effects 0.000 claims description 2
- 229930192474 thiophene Natural products 0.000 claims description 2
- 125000004954 trialkylamino group Chemical group 0.000 claims description 2
- 238000002844 melting Methods 0.000 description 15
- 230000008018 melting Effects 0.000 description 15
- 239000000243 solution Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 5
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 3
- VDTNNGKXZGSZIP-UHFFFAOYSA-N carbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VDTNNGKXZGSZIP-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- -1 N-sulfanylyl-N'-(n-butyl)-urea Chemical compound 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- NUQDEHHKOXSIEA-UHFFFAOYSA-N glymidine sodium Chemical compound [Na+].N1=CC(OCCOC)=CN=C1[N-]S(=O)(=O)C1=CC=CC=C1 NUQDEHHKOXSIEA-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- HLBLNLYCFFWMFF-UHFFFAOYSA-N n-pyrimidin-2-ylbenzenesulfonamide Chemical class C=1C=CC=CC=1S(=O)(=O)NC1=NC=CC=N1 HLBLNLYCFFWMFF-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- OIEZCWFCXVSIGQ-UHFFFAOYSA-N 1,1-diethoxy-4-methylpentane Chemical compound CCOC(OCC)CCC(C)C OIEZCWFCXVSIGQ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 150000008319 1H-pyrimidin-2-ones Chemical class 0.000 description 1
- VTSWSQGDJQFXHB-UHFFFAOYSA-N 2,4,6-trichloro-5-methylpyrimidine Chemical compound CC1=C(Cl)N=C(Cl)N=C1Cl VTSWSQGDJQFXHB-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- VQEHSBSZLWUDML-UHFFFAOYSA-N 2-chloro-5-(2-methylpropyl)pyrimidine Chemical compound CC(C)CC1=CN=C(Cl)N=C1 VQEHSBSZLWUDML-UHFFFAOYSA-N 0.000 description 1
- 150000005695 2-halopyrimidines Chemical class 0.000 description 1
- FBAYKPYCNPDYQQ-UHFFFAOYSA-N 3-ethoxythiophene-2-carbonyl chloride Chemical compound CCOC=1C=CSC=1C(Cl)=O FBAYKPYCNPDYQQ-UHFFFAOYSA-N 0.000 description 1
- FKJRKDQMPJJVGC-UHFFFAOYSA-N 3-methoxythiophene-2-carbonyl chloride Chemical compound COC=1C=CSC=1C(Cl)=O FKJRKDQMPJJVGC-UHFFFAOYSA-N 0.000 description 1
- CXDAPRCYUQYNCC-UHFFFAOYSA-N 5-ethylsulfanylpyrimidin-2-amine Chemical compound C(C)SC=1C=NC(=NC1)N CXDAPRCYUQYNCC-UHFFFAOYSA-N 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WSMYVTOQOOLQHP-UHFFFAOYSA-N Malondialdehyde Chemical class O=CCC=O WSMYVTOQOOLQHP-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000005005 aminopyrimidines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940127003 anti-diabetic drug Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000008331 benzenesulfonamides Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- STIAPHVBRDNOAJ-UHFFFAOYSA-N carbamimidoylazanium;carbonate Chemical compound NC(N)=N.NC(N)=N.OC(O)=O STIAPHVBRDNOAJ-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- QFWPJPIVLCBXFJ-UHFFFAOYSA-N glymidine Chemical compound N1=CC(OCCOC)=CN=C1NS(=O)(=O)C1=CC=CC=C1 QFWPJPIVLCBXFJ-UHFFFAOYSA-N 0.000 description 1
- NDEMNVPZDAFUKN-UHFFFAOYSA-N guanidine;nitric acid Chemical compound NC(N)=N.O[N+]([O-])=O.O[N+]([O-])=O NDEMNVPZDAFUKN-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- QAZLUNIWYYOJPC-UHFFFAOYSA-M sulfenamide Chemical compound [Cl-].COC1=C(C)C=[N+]2C3=NC4=CC=C(OC)C=C4N3SCC2=C1C QAZLUNIWYYOJPC-UHFFFAOYSA-M 0.000 description 1
- 125000001010 sulfinic acid amide group Chemical group 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/69—Benzenesulfonamido-pyrimidines
-
- D—TEXTILES; PAPER
- D05—SEWING; EMBROIDERING; TUFTING
- D05B—SEWING
- D05B85/00—Needles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Sewing Machines And Sewing (AREA)
- Registering, Tensioning, Guiding Webs, And Rollers Therefor (AREA)
- Preliminary Treatment Of Fibers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB83296A DE1301817B (de) | 1965-08-17 | 1965-08-17 | Verfahren zur Herstellung von in 5-Stellung substituierten 2-Benzolsulfonamidopyrimidinen |
| CH1895968A CH501088A (de) | 1965-08-17 | 1968-12-19 | Einfädelnadel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO118917B true NO118917B (mo) | 1970-03-02 |
Family
ID=25721809
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO16430466A NO118917B (mo) | 1965-08-17 | 1966-08-15 |
Country Status (12)
| Country | Link |
|---|---|
| BE (1) | BE685537A (mo) |
| BR (1) | BR6682108D0 (mo) |
| CH (2) | CH476011A (mo) |
| DE (2) | DE1301817B (mo) |
| DK (1) | DK118717B (mo) |
| FI (1) | FI45178C (mo) |
| FR (2) | FR1505417A (mo) |
| GB (2) | GB1083250A (mo) |
| IL (1) | IL26338A (mo) |
| NL (1) | NL6611549A (mo) |
| NO (1) | NO118917B (mo) |
| SE (1) | SE344200B (mo) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1803582A1 (de) * | 1968-10-17 | 1970-05-27 | Boehringer Mannheim Gmbh | Neue Sulfonylaminopyrimidine und Verfahren zu ihrer Herstellung |
| DE2048906A1 (de) * | 1970-10-06 | 1972-04-13 | Boehringer Mannheim Gmbh, 6800 Mannheim | Blutzuckersenkende Sulfonylaminopyrimidine und Verfahren zu deren Herstellung |
| FR2474546A1 (fr) * | 1979-12-21 | 1981-07-31 | Vrau Sa Ets | Aiguille pour ouvrages en matiere plastique |
| DE9102151U1 (de) * | 1990-03-06 | 1991-05-16 | Geberit Ag, Jona, St.Gallen | Doppelrohrverbindung an Kunststoffrohren |
| DE19711602C2 (de) * | 1997-03-20 | 2003-12-24 | Dallmer Gmbh & Co Kg | Ablauf mit höhenverstellbarem Einlaufteil |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1101428B (de) * | 1959-07-08 | 1961-03-09 | Schering Ag | Verfahren zur Herstellung langwirkender Aminobenzolsulfonsaeure-amidderivate |
-
1965
- 1965-08-17 DE DEB83296A patent/DE1301817B/de active Pending
-
1966
- 1966-08-15 IL IL2633866A patent/IL26338A/xx unknown
- 1966-08-15 NO NO16430466A patent/NO118917B/no unknown
- 1966-08-15 GB GB3638666A patent/GB1083250A/en not_active Expired
- 1966-08-15 CH CH1171666A patent/CH476011A/de not_active IP Right Cessation
- 1966-08-16 BR BR18210866A patent/BR6682108D0/pt unknown
- 1966-08-16 SE SE1108066A patent/SE344200B/xx unknown
- 1966-08-16 DK DK419566A patent/DK118717B/da unknown
- 1966-08-16 BE BE685537D patent/BE685537A/xx unknown
- 1966-08-16 FR FR73111A patent/FR1505417A/fr not_active Expired
- 1966-08-16 FI FI213966A patent/FI45178C/fi active
- 1966-08-17 NL NL6611549A patent/NL6611549A/xx unknown
-
1968
- 1968-12-19 CH CH1895968A patent/CH501088A/de not_active IP Right Cessation
-
1969
- 1969-12-03 FR FR6941712A patent/FR2026516A1/fr not_active Withdrawn
- 1969-12-04 GB GB1258017D patent/GB1258017A/en not_active Expired
- 1969-12-16 DE DE19691962886 patent/DE1962886A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IL26338A (en) | 1970-05-21 |
| NL6611549A (mo) | 1967-02-20 |
| CH476011A (de) | 1969-07-31 |
| DE1962886A1 (de) | 1970-07-09 |
| GB1258017A (mo) | 1971-12-22 |
| DK118717B (da) | 1970-09-28 |
| CH501088A (de) | 1970-12-31 |
| BE685537A (mo) | 1967-02-16 |
| FR2026516A1 (mo) | 1970-09-18 |
| BR6682108D0 (pt) | 1973-12-04 |
| SE344200B (mo) | 1972-04-04 |
| DE1301817B (de) | 1969-08-28 |
| FI45178B (mo) | 1971-12-31 |
| FI45178C (fi) | 1972-04-10 |
| FR1505417A (fr) | 1967-12-15 |
| GB1083250A (en) | 1967-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU678467B2 (en) | Novel sulfonylamino pyrimidines | |
| US2430439A (en) | Sulfonamido pyrimidines | |
| DE69624010T2 (de) | Sulfonamide Derivate und Verfahren zu deren Herstellung | |
| KR100819668B1 (ko) | 신규한 피리미딘-설퍼아마이드 | |
| NO164304B (no) | Belegningsmiddel paa basis av en hydroksylgruppe-holdig blokk-kopolymer. | |
| US3823135A (en) | Pyrimidone herbicides | |
| AU775194B2 (en) | Bis-sulfonamides | |
| NO300874B1 (no) | Anvendelse av sulfonamider som virkestoffer ved fremstilling av legemidler for behandling av kretslöpssykdommer | |
| NO141163B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive pyrimidiner | |
| KR20010014020A (ko) | 항전이성 및 항종양성 활성을 갖는 바르비투르산 유도체 | |
| RU2329255C2 (ru) | Пиримидинсульфамиды и их использование в качестве антагонистов эндотелиальных рецепторов | |
| NO118917B (mo) | ||
| NO136595B (mo) | ||
| DK165954B (da) | 2,3-dihydrobenzofuran-5-sulfonamidderivater samt antihypertensive og diuretiske midler indeholdende disse | |
| NO160514B (no) | Analogifremgangsm te for fremstilling av farmasoeytisk aktive pyrimid-2-on-derivater. | |
| US4189581A (en) | 2-Acylamino-4-amino-5-(3,4,5-trimethoxybenzyl)-pyrimidines | |
| US3520887A (en) | Certain pyrimidinylbenzenesulfonamides | |
| US2540356A (en) | Sulfonamide derivatives | |
| CA1336516C (en) | Acyl derivatives of 2-amino-4-substituted-5-hydroxy pyrimidines | |
| CA2657062A1 (en) | Substituted sulphoximines as tie2 inhibitors and salts thereof, pharmaceutical compositions comprising same, methods of preparing same and uses of same | |
| US4478839A (en) | Substituted pyrimid-2-ones, the salts thereof, processes for their preparation and pharmaceutical compositions containing them | |
| DE1545944A1 (de) | Verfahren zur Herstellung von neuen Sulfonamiden der Pyrimidinreihe | |
| NO133892B (mo) | ||
| PL185692B1 (pl) | Nowe sulfonamidy, sposób ich wytwarzania oraz zawierające je preparaty farmaceutyczne | |
| US3801588A (en) | Certain perfluoroalkylsulfon-amidothiazoles |