KR20060124549A - 폴리 및 코폴리(n-비닐아마이드) 및 모세관 전기영동에서이들의 용도 - Google Patents
폴리 및 코폴리(n-비닐아마이드) 및 모세관 전기영동에서이들의 용도 Download PDFInfo
- Publication number
- KR20060124549A KR20060124549A KR1020057021809A KR20057021809A KR20060124549A KR 20060124549 A KR20060124549 A KR 20060124549A KR 1020057021809 A KR1020057021809 A KR 1020057021809A KR 20057021809 A KR20057021809 A KR 20057021809A KR 20060124549 A KR20060124549 A KR 20060124549A
- Authority
- KR
- South Korea
- Prior art keywords
- acrylamide
- methyl
- methacrylamide
- composition
- propyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 238000005251 capillar electrophoresis Methods 0.000 title abstract description 12
- 239000000203 mixture Substances 0.000 claims abstract description 296
- 229920000642 polymer Polymers 0.000 claims abstract description 228
- 239000000178 monomer Substances 0.000 claims abstract description 145
- -1 their preparation Substances 0.000 claims abstract description 61
- 238000000034 method Methods 0.000 claims abstract description 46
- 229920001577 copolymer Polymers 0.000 claims abstract description 36
- 238000000926 separation method Methods 0.000 claims abstract description 36
- 108091033319 polynucleotide Proteins 0.000 claims abstract description 20
- 102000040430 polynucleotide Human genes 0.000 claims abstract description 20
- 239000002157 polynucleotide Substances 0.000 claims abstract description 20
- 230000002401 inhibitory effect Effects 0.000 claims description 44
- 239000000872 buffer Substances 0.000 claims description 36
- 229920002554 vinyl polymer Polymers 0.000 claims description 29
- 229910052757 nitrogen Inorganic materials 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 25
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 23
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 22
- DNTMQTKDNSEIFO-UHFFFAOYSA-N n-(hydroxymethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCO DNTMQTKDNSEIFO-UHFFFAOYSA-N 0.000 claims description 21
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 20
- 229940088644 n,n-dimethylacrylamide Drugs 0.000 claims description 20
- PNLUGRYDUHRLOF-UHFFFAOYSA-N n-ethenyl-n-methylacetamide Chemical compound C=CN(C)C(C)=O PNLUGRYDUHRLOF-UHFFFAOYSA-N 0.000 claims description 17
- 239000004202 carbamide Substances 0.000 claims description 16
- QALQIBQJEQZNTE-UHFFFAOYSA-N n-(hydroxymethyl)-n,2-dimethylprop-2-enamide Chemical compound OCN(C)C(=O)C(C)=C QALQIBQJEQZNTE-UHFFFAOYSA-N 0.000 claims description 16
- WFKDPJRCBCBQNT-UHFFFAOYSA-N n,2-dimethylprop-2-enamide Chemical compound CNC(=O)C(C)=C WFKDPJRCBCBQNT-UHFFFAOYSA-N 0.000 claims description 15
- ZQXSMRAEXCEDJD-UHFFFAOYSA-N n-ethenylformamide Chemical compound C=CNC=O ZQXSMRAEXCEDJD-UHFFFAOYSA-N 0.000 claims description 15
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 claims description 13
- CCJAYIGMMRQRAO-UHFFFAOYSA-N 2-[4-[(2-hydroxyphenyl)methylideneamino]butyliminomethyl]phenol Chemical compound OC1=CC=CC=C1C=NCCCCN=CC1=CC=CC=C1O CCJAYIGMMRQRAO-UHFFFAOYSA-N 0.000 claims description 12
- QRWZCJXEAOZAAW-UHFFFAOYSA-N n,n,2-trimethylprop-2-enamide Chemical compound CN(C)C(=O)C(C)=C QRWZCJXEAOZAAW-UHFFFAOYSA-N 0.000 claims description 12
- RUSRUYULUAYXIP-UHFFFAOYSA-N n-acetylprop-2-enamide Chemical compound CC(=O)NC(=O)C=C RUSRUYULUAYXIP-UHFFFAOYSA-N 0.000 claims description 12
- HEOJXQORMIVKQQ-UHFFFAOYSA-N n-(2-cyanoethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCCC#N HEOJXQORMIVKQQ-UHFFFAOYSA-N 0.000 claims description 11
- BSCJIBOZTKGXQP-UHFFFAOYSA-N n-(2-hydroxyethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCCO BSCJIBOZTKGXQP-UHFFFAOYSA-N 0.000 claims description 11
- YOZHLACIXDCHPV-UHFFFAOYSA-N n-(methoxymethyl)-2-methylprop-2-enamide Chemical compound COCNC(=O)C(C)=C YOZHLACIXDCHPV-UHFFFAOYSA-N 0.000 claims description 11
- ULYOZOPEFCQZHH-UHFFFAOYSA-N n-(methoxymethyl)prop-2-enamide Chemical compound COCNC(=O)C=C ULYOZOPEFCQZHH-UHFFFAOYSA-N 0.000 claims description 11
- OJBZOTFHZFZOIJ-UHFFFAOYSA-N n-acetyl-2-methylprop-2-enamide Chemical compound CC(=O)NC(=O)C(C)=C OJBZOTFHZFZOIJ-UHFFFAOYSA-N 0.000 claims description 11
- IZKUWTDESDNCCG-UHFFFAOYSA-N n'-acetylprop-2-enehydrazide Chemical compound CC(=O)NNC(=O)C=C IZKUWTDESDNCCG-UHFFFAOYSA-N 0.000 claims description 10
- YLGYACDQVQQZSW-UHFFFAOYSA-N n,n-dimethylprop-2-enamide Chemical compound CN(C)C(=O)C=C YLGYACDQVQQZSW-UHFFFAOYSA-N 0.000 claims description 10
- FTJXXXSSRCHQKC-UHFFFAOYSA-N n-(2-cyanoethyl)prop-2-enamide Chemical compound C=CC(=O)NCCC#N FTJXXXSSRCHQKC-UHFFFAOYSA-N 0.000 claims description 10
- UUORTJUPDJJXST-UHFFFAOYSA-N n-(2-hydroxyethyl)prop-2-enamide Chemical compound OCCNC(=O)C=C UUORTJUPDJJXST-UHFFFAOYSA-N 0.000 claims description 10
- ADGJZVKOKVENDN-UHFFFAOYSA-N n-(butoxymethyl)-2-methylprop-2-enamide Chemical compound CCCCOCNC(=O)C(C)=C ADGJZVKOKVENDN-UHFFFAOYSA-N 0.000 claims description 10
- YPHQUSNPXDGUHL-UHFFFAOYSA-N n-methylprop-2-enamide Chemical compound CNC(=O)C=C YPHQUSNPXDGUHL-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- YQIGLEFUZMIVHU-UHFFFAOYSA-N 2-methyl-n-propan-2-ylprop-2-enamide Chemical compound CC(C)NC(=O)C(C)=C YQIGLEFUZMIVHU-UHFFFAOYSA-N 0.000 claims description 9
- CFZDMXAOSDDDRT-UHFFFAOYSA-N 4-ethenylmorpholine Chemical compound C=CN1CCOCC1 CFZDMXAOSDDDRT-UHFFFAOYSA-N 0.000 claims description 9
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 claims description 9
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 9
- MMOVWHVCSYHEMR-UHFFFAOYSA-N n'-acetyl-2-methylprop-2-enehydrazide Chemical compound CC(=O)NNC(=O)C(C)=C MMOVWHVCSYHEMR-UHFFFAOYSA-N 0.000 claims description 9
- BLYOHBPLFYXHQA-UHFFFAOYSA-N n,n-bis(prop-2-enyl)prop-2-enamide Chemical compound C=CCN(CC=C)C(=O)C=C BLYOHBPLFYXHQA-UHFFFAOYSA-N 0.000 claims description 9
- YHOSNAAUPKDRMI-UHFFFAOYSA-N n,n-di(propan-2-yl)prop-2-enamide Chemical compound CC(C)N(C(C)C)C(=O)C=C YHOSNAAUPKDRMI-UHFFFAOYSA-N 0.000 claims description 9
- RUSMHXACRXXLKQ-UHFFFAOYSA-N n-(2-aminoethyl)-2-methylprop-2-enamide;hydrochloride Chemical compound Cl.CC(=C)C(=O)NCCN RUSMHXACRXXLKQ-UHFFFAOYSA-N 0.000 claims description 9
- BQZIOPPACMCUGU-UHFFFAOYSA-N n-(2-aminoethyl)-n-methylprop-2-enamide;hydrochloride Chemical compound Cl.NCCN(C)C(=O)C=C BQZIOPPACMCUGU-UHFFFAOYSA-N 0.000 claims description 9
- TUYRBJIOKUKUHG-UHFFFAOYSA-N n-(3-aminopropyl)-n-methylprop-2-enamide;hydrochloride Chemical compound Cl.C=CC(=O)N(C)CCCN TUYRBJIOKUKUHG-UHFFFAOYSA-N 0.000 claims description 9
- UTSYWKJYFPPRAP-UHFFFAOYSA-N n-(butoxymethyl)prop-2-enamide Chemical compound CCCCOCNC(=O)C=C UTSYWKJYFPPRAP-UHFFFAOYSA-N 0.000 claims description 9
- OCXYXUXCRQIICZ-UHFFFAOYSA-N n-(cyanomethyl)prop-2-enamide Chemical compound C=CC(=O)NCC#N OCXYXUXCRQIICZ-UHFFFAOYSA-N 0.000 claims description 9
- ZOTWHNWBICCBPC-UHFFFAOYSA-N n-ethyl-n-methylprop-2-enamide Chemical compound CCN(C)C(=O)C=C ZOTWHNWBICCBPC-UHFFFAOYSA-N 0.000 claims description 9
- CNPHCSFIDKZQAK-UHFFFAOYSA-N n-prop-2-enylprop-2-enamide Chemical compound C=CCNC(=O)C=C CNPHCSFIDKZQAK-UHFFFAOYSA-N 0.000 claims description 9
- VAYTZRYEBVHVLE-UHFFFAOYSA-N 1,3-dioxol-2-one Chemical compound O=C1OC=CO1 VAYTZRYEBVHVLE-UHFFFAOYSA-N 0.000 claims description 8
- UNMSMHCTGCYBJM-UHFFFAOYSA-N 1-ethenylimidazolidin-2-one Chemical compound C=CN1CCNC1=O UNMSMHCTGCYBJM-UHFFFAOYSA-N 0.000 claims description 8
- ZMALNMQOXQXZRO-UHFFFAOYSA-N 4-ethenylmorpholin-3-one Chemical compound C=CN1CCOCC1=O ZMALNMQOXQXZRO-UHFFFAOYSA-N 0.000 claims description 8
- HDYTUPZMASQMOH-UHFFFAOYSA-N 4-ethenylmorpholine-3,5-dione Chemical compound C=CN1C(=O)COCC1=O HDYTUPZMASQMOH-UHFFFAOYSA-N 0.000 claims description 8
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical group COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 claims description 8
- JMCVCHBBHPFWBF-UHFFFAOYSA-N n,n-diethyl-2-methylprop-2-enamide Chemical compound CCN(CC)C(=O)C(C)=C JMCVCHBBHPFWBF-UHFFFAOYSA-N 0.000 claims description 8
- VYHUMZYFJVMWRC-UHFFFAOYSA-N n-(2-hydroxyethyl)-n-methylprop-2-enamide Chemical compound OCCN(C)C(=O)C=C VYHUMZYFJVMWRC-UHFFFAOYSA-N 0.000 claims description 8
- XHIRWEVPYCTARV-UHFFFAOYSA-N n-(3-aminopropyl)-2-methylprop-2-enamide;hydrochloride Chemical compound Cl.CC(=C)C(=O)NCCCN XHIRWEVPYCTARV-UHFFFAOYSA-N 0.000 claims description 8
- VWMLWEYHEYQJLO-UHFFFAOYSA-N n-(cyanomethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCC#N VWMLWEYHEYQJLO-UHFFFAOYSA-N 0.000 claims description 8
- QUYUHNCWKGUJHO-UHFFFAOYSA-N n-(cyanomethyl)-n,2-dimethylprop-2-enamide Chemical compound N#CCN(C)C(=O)C(C)=C QUYUHNCWKGUJHO-UHFFFAOYSA-N 0.000 claims description 8
- DFMIMUDDPBAKFS-UHFFFAOYSA-N n-ethenyl-n-ethylformamide Chemical compound CCN(C=C)C=O DFMIMUDDPBAKFS-UHFFFAOYSA-N 0.000 claims description 8
- OFESGEKAXKKFQT-UHFFFAOYSA-N n-ethenyl-n-methylformamide Chemical compound C=CN(C)C=O OFESGEKAXKKFQT-UHFFFAOYSA-N 0.000 claims description 8
- OTHWJJNYOTXAES-UHFFFAOYSA-N n-ethenyl-n-propan-2-ylacetamide Chemical compound CC(C)N(C=C)C(C)=O OTHWJJNYOTXAES-UHFFFAOYSA-N 0.000 claims description 8
- BMIGLHLHYIWCCD-UHFFFAOYSA-N n-ethenyl-n-propan-2-ylformamide Chemical compound CC(C)N(C=C)C=O BMIGLHLHYIWCCD-UHFFFAOYSA-N 0.000 claims description 8
- RQAKESSLMFZVMC-UHFFFAOYSA-N n-ethenylacetamide Chemical compound CC(=O)NC=C RQAKESSLMFZVMC-UHFFFAOYSA-N 0.000 claims description 8
- VUEZBQJWLDBIDE-UHFFFAOYSA-N 3-ethenyl-1,3-oxazolidin-2-one Chemical compound C=CN1CCOC1=O VUEZBQJWLDBIDE-UHFFFAOYSA-N 0.000 claims description 7
- 150000004702 methyl esters Chemical class 0.000 claims description 7
- OVHHHVAVHBHXAK-UHFFFAOYSA-N n,n-diethylprop-2-enamide Chemical compound CCN(CC)C(=O)C=C OVHHHVAVHBHXAK-UHFFFAOYSA-N 0.000 claims description 7
- YAHBUVWRSTZBAX-UHFFFAOYSA-N n-(2-aminoethyl)prop-2-enamide;hydrochloride Chemical compound Cl.NCCNC(=O)C=C YAHBUVWRSTZBAX-UHFFFAOYSA-N 0.000 claims description 7
- WOSHDWLEPRMIPR-UHFFFAOYSA-N n-(3-aminopropyl)prop-2-enamide;hydrochloride Chemical compound [Cl-].[NH3+]CCCNC(=O)C=C WOSHDWLEPRMIPR-UHFFFAOYSA-N 0.000 claims description 7
- GORGQKRVQGXVEB-UHFFFAOYSA-N n-ethenyl-n-ethylacetamide Chemical compound CCN(C=C)C(C)=O GORGQKRVQGXVEB-UHFFFAOYSA-N 0.000 claims description 7
- QNILTEGFHQSKFF-UHFFFAOYSA-N n-propan-2-ylprop-2-enamide Chemical compound CC(C)NC(=O)C=C QNILTEGFHQSKFF-UHFFFAOYSA-N 0.000 claims description 7
- 229920002401 polyacrylamide Polymers 0.000 claims description 7
- GROXSGRIVDMIEN-UHFFFAOYSA-N 2-methyl-n-prop-2-enylprop-2-enamide Chemical compound CC(=C)C(=O)NCC=C GROXSGRIVDMIEN-UHFFFAOYSA-N 0.000 claims description 6
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 6
- CMMYGCUEJWTBCG-UHFFFAOYSA-N n-(2,2-dimethoxyethyl)prop-2-enamide Chemical compound COC(OC)CNC(=O)C=C CMMYGCUEJWTBCG-UHFFFAOYSA-N 0.000 claims description 6
- KIHJKWNSLAKEPK-UHFFFAOYSA-N n-(2-methoxyethyl)prop-2-enamide Chemical compound COCCNC(=O)C=C KIHJKWNSLAKEPK-UHFFFAOYSA-N 0.000 claims description 6
- AUCNMQYOQYTGPE-UHFFFAOYSA-N n-(hydroxymethyl)-n-methylprop-2-enamide Chemical compound OCN(C)C(=O)C=C AUCNMQYOQYTGPE-UHFFFAOYSA-N 0.000 claims description 6
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims description 6
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 claims description 5
- 239000004354 Hydroxyethyl cellulose Substances 0.000 claims description 5
- 230000005684 electric field Effects 0.000 claims description 5
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 claims description 5
- MGARLISKINLYPI-UHFFFAOYSA-N n-(2,2-dimethoxyethyl)-2-methylprop-2-enamide Chemical compound COC(OC)CNC(=O)C(C)=C MGARLISKINLYPI-UHFFFAOYSA-N 0.000 claims description 5
- YXUAFTLXQLZRJA-UHFFFAOYSA-N n-(cyanomethyl)-n-methylprop-2-enamide Chemical compound N#CCN(C)C(=O)C=C YXUAFTLXQLZRJA-UHFFFAOYSA-N 0.000 claims description 5
- QMQNMBYPQFQQPK-UHFFFAOYSA-N n-methoxyprop-2-enamide Chemical compound CONC(=O)C=C QMQNMBYPQFQQPK-UHFFFAOYSA-N 0.000 claims description 5
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 5
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 claims description 5
- RWFVDIDGJKIBTL-UHFFFAOYSA-N OCC(C)=C(C)C(N)=O Chemical compound OCC(C)=C(C)C(N)=O RWFVDIDGJKIBTL-UHFFFAOYSA-N 0.000 claims description 4
- 229920006187 aquazol Polymers 0.000 claims description 4
- HQVFKSDWNYVAQD-UHFFFAOYSA-N n-hydroxyprop-2-enamide Chemical compound ONC(=O)C=C HQVFKSDWNYVAQD-UHFFFAOYSA-N 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- AJUIEYXPANEMOX-UHFFFAOYSA-N (carbamoylamino) prop-2-enoate Chemical compound NC(=O)NOC(=O)C=C AJUIEYXPANEMOX-UHFFFAOYSA-N 0.000 claims description 3
- PBMWEQHOZPTUQQ-UHFFFAOYSA-N 4-hydroxy-2-methylbut-2-enamide Chemical compound NC(=O)C(C)=CCO PBMWEQHOZPTUQQ-UHFFFAOYSA-N 0.000 claims description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical group CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 3
- 239000012861 aquazol Substances 0.000 claims description 3
- 229920003063 hydroxymethyl cellulose Polymers 0.000 claims description 3
- 229940031574 hydroxymethyl cellulose Drugs 0.000 claims description 3
- XWCUDBBUDRNSKP-UHFFFAOYSA-N n-(2-morpholin-4-ylethyl)prop-2-enamide Chemical compound C=CC(=O)NCCN1CCOCC1 XWCUDBBUDRNSKP-UHFFFAOYSA-N 0.000 claims description 3
- IRMNYAOVVDEOKP-UHFFFAOYSA-N n-(3-methoxypropyl)-2-methylprop-2-enamide Chemical compound COCCCNC(=O)C(C)=C IRMNYAOVVDEOKP-UHFFFAOYSA-N 0.000 claims description 3
- RWJGITGQDQSWJG-UHFFFAOYSA-N n-(3-methoxypropyl)prop-2-enamide Chemical compound COCCCNC(=O)C=C RWJGITGQDQSWJG-UHFFFAOYSA-N 0.000 claims description 3
- VOPCZDADAYFWNS-UHFFFAOYSA-N n-(4,4-dimethoxybutyl)prop-2-enamide Chemical compound COC(OC)CCCNC(=O)C=C VOPCZDADAYFWNS-UHFFFAOYSA-N 0.000 claims description 3
- 125000006353 oxyethylene group Chemical group 0.000 claims description 3
- 229920000773 poly(2-methyl-2-oxazoline) polymer Polymers 0.000 claims description 3
- KKBHSBATGOQADJ-UHFFFAOYSA-N 2-ethenyl-1,3-dioxolane Chemical compound C=CC1OCCO1 KKBHSBATGOQADJ-UHFFFAOYSA-N 0.000 claims description 2
- NGMWKRNPNRTXOQ-UHFFFAOYSA-N 2-methyl-n-(2-morpholin-4-ylethyl)prop-2-enamide Chemical compound CC(=C)C(=O)NCCN1CCOCC1 NGMWKRNPNRTXOQ-UHFFFAOYSA-N 0.000 claims 2
- CNIIWDYLLMUOAJ-UHFFFAOYSA-N n-(4,4-dimethoxybutyl)-2-methylprop-2-enamide Chemical compound COC(OC)CCCNC(=O)C(C)=C CNIIWDYLLMUOAJ-UHFFFAOYSA-N 0.000 claims 2
- VASNCYJJLGPGJP-UHFFFAOYSA-N 2-methylhex-2-enamide hydrochloride Chemical compound Cl.C(CC)C=C(C(=O)N)C VASNCYJJLGPGJP-UHFFFAOYSA-N 0.000 claims 1
- 150000003926 acrylamides Chemical class 0.000 claims 1
- QQZXAODFGRZKJT-UHFFFAOYSA-N n-tert-butyl-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NC(C)(C)C QQZXAODFGRZKJT-UHFFFAOYSA-N 0.000 claims 1
- XFHJDMUEHUHAJW-UHFFFAOYSA-N n-tert-butylprop-2-enamide Chemical compound CC(C)(C)NC(=O)C=C XFHJDMUEHUHAJW-UHFFFAOYSA-N 0.000 claims 1
- 238000001962 electrophoresis Methods 0.000 abstract description 10
- 238000002360 preparation method Methods 0.000 abstract description 8
- 238000004458 analytical method Methods 0.000 abstract description 7
- 125000000217 alkyl group Chemical group 0.000 description 99
- 125000004404 heteroalkyl group Chemical group 0.000 description 59
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 50
- 238000005370 electroosmosis Methods 0.000 description 43
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 35
- 125000003118 aryl group Chemical group 0.000 description 30
- 238000007873 sieving Methods 0.000 description 28
- 239000003999 initiator Substances 0.000 description 27
- 239000004094 surface-active agent Substances 0.000 description 24
- 239000004642 Polyimide Substances 0.000 description 23
- 229920001721 polyimide Polymers 0.000 description 23
- 239000003921 oil Substances 0.000 description 19
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 17
- 229940117958 vinyl acetate Drugs 0.000 description 17
- 238000006116 polymerization reaction Methods 0.000 description 16
- UYMKPFRHYYNDTL-UHFFFAOYSA-N ethenamine Chemical compound NC=C UYMKPFRHYYNDTL-UHFFFAOYSA-N 0.000 description 15
- 125000001313 C5-C10 heteroaryl group Chemical group 0.000 description 14
- 239000000523 sample Substances 0.000 description 14
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 12
- 239000003398 denaturant Substances 0.000 description 12
- 125000001072 heteroaryl group Chemical group 0.000 description 12
- 125000002091 cationic group Chemical group 0.000 description 11
- 239000003795 chemical substances by application Substances 0.000 description 11
- 239000012062 aqueous buffer Substances 0.000 description 10
- 125000005842 heteroatom Chemical group 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- FIOAMJSJHNKQHM-UHFFFAOYSA-N N-(hydroxymethyl)-2-methylbut-2-enamide Chemical compound OCNC(C(=CC)C)=O FIOAMJSJHNKQHM-UHFFFAOYSA-N 0.000 description 8
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 8
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 239000007983 Tris buffer Substances 0.000 description 7
- 238000001514 detection method Methods 0.000 description 7
- 150000004676 glycans Chemical class 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 238000000569 multi-angle light scattering Methods 0.000 description 7
- SWSFFBPGDIHBJL-UHFFFAOYSA-N n-(2-methoxyethyl)-2-methylprop-2-enamide Chemical compound COCCNC(=O)C(C)=C SWSFFBPGDIHBJL-UHFFFAOYSA-N 0.000 description 7
- FPKZHPVRIDEUIG-UHFFFAOYSA-N n-ethyl-n-propylprop-2-enamide Chemical compound CCCN(CC)C(=O)C=C FPKZHPVRIDEUIG-UHFFFAOYSA-N 0.000 description 7
- 229920001282 polysaccharide Polymers 0.000 description 7
- 239000005017 polysaccharide Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- VVBLNCFGVYUYGU-UHFFFAOYSA-N 4,4'-Bis(dimethylamino)benzophenone Chemical compound C1=CC(N(C)C)=CC=C1C(=O)C1=CC=C(N(C)C)C=C1 VVBLNCFGVYUYGU-UHFFFAOYSA-N 0.000 description 6
- 108020004414 DNA Proteins 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 208000034953 Twin anemia-polycythemia sequence Diseases 0.000 description 6
- 125000000129 anionic group Chemical group 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000004945 emulsification Methods 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000005227 gel permeation chromatography Methods 0.000 description 6
- 229930195733 hydrocarbon Natural products 0.000 description 6
- 238000002347 injection Methods 0.000 description 6
- 239000007924 injection Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 150000002978 peroxides Chemical class 0.000 description 6
- 230000002441 reversible effect Effects 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 5
- 239000012491 analyte Substances 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 150000001720 carbohydrates Chemical class 0.000 description 5
- 235000014633 carbohydrates Nutrition 0.000 description 5
- 238000007796 conventional method Methods 0.000 description 5
- 239000004530 micro-emulsion Substances 0.000 description 5
- 239000002777 nucleoside Substances 0.000 description 5
- 238000012546 transfer Methods 0.000 description 5
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 4
- 239000012901 Milli-Q water Substances 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- NDJKXXJCMXVBJW-UHFFFAOYSA-N heptadecane Chemical compound CCCCCCCCCCCCCCCCC NDJKXXJCMXVBJW-UHFFFAOYSA-N 0.000 description 4
- DCAYPVUWAIABOU-UHFFFAOYSA-N hexadecane Chemical compound CCCCCCCCCCCCCCCC DCAYPVUWAIABOU-UHFFFAOYSA-N 0.000 description 4
- 229920001519 homopolymer Polymers 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 4
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 4
- GJQRYIOSVPEUQJ-UHFFFAOYSA-N n-[3-(prop-2-enoylamino)propyl]prop-2-enamide Chemical compound C=CC(=O)NCCCNC(=O)C=C GJQRYIOSVPEUQJ-UHFFFAOYSA-N 0.000 description 4
- UXGLSABDGQOSET-UHFFFAOYSA-N n-carbamoylprop-2-enamide Chemical compound NC(=O)NC(=O)C=C UXGLSABDGQOSET-UHFFFAOYSA-N 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- YCOZIPAWZNQLMR-UHFFFAOYSA-N pentadecane Chemical compound CCCCCCCCCCCCCCC YCOZIPAWZNQLMR-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 238000012163 sequencing technique Methods 0.000 description 4
- VOCDJQSAMZARGX-UHFFFAOYSA-N 1-ethenylpyrrolidine-2,5-dione Chemical compound C=CN1C(=O)CCC1=O VOCDJQSAMZARGX-UHFFFAOYSA-N 0.000 description 3
- TURITJIWSQEMDB-UHFFFAOYSA-N 2-methyl-n-[(2-methylprop-2-enoylamino)methyl]prop-2-enamide Chemical compound CC(=C)C(=O)NCNC(=O)C(C)=C TURITJIWSQEMDB-UHFFFAOYSA-N 0.000 description 3
- CDIYIEKBGHJSDO-UHFFFAOYSA-N 2-methyl-n-[3-(2-methylprop-2-enoylamino)propyl]prop-2-enamide Chemical compound CC(=C)C(=O)NCCCNC(=O)C(C)=C CDIYIEKBGHJSDO-UHFFFAOYSA-N 0.000 description 3
- PIRPEUWCTMKABH-UHFFFAOYSA-N 4-methoxy-2-methylidenebutanamide Chemical compound COCCC(=C)C(N)=O PIRPEUWCTMKABH-UHFFFAOYSA-N 0.000 description 3
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- 238000001712 DNA sequencing Methods 0.000 description 3
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 3
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 3
- 239000005662 Paraffin oil Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 229920006037 cross link polymer Polymers 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000005350 fused silica glass Substances 0.000 description 3
- 230000002068 genetic effect Effects 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 230000000977 initiatory effect Effects 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- AYGYHGXUJBFUJU-UHFFFAOYSA-N n-[2-(prop-2-enoylamino)ethyl]prop-2-enamide Chemical compound C=CC(=O)NCCNC(=O)C=C AYGYHGXUJBFUJU-UHFFFAOYSA-N 0.000 description 3
- YVEXWBLMSGDWMQ-UHFFFAOYSA-N n-ethenyl-n-propylacetamide Chemical compound CCCN(C=C)C(C)=O YVEXWBLMSGDWMQ-UHFFFAOYSA-N 0.000 description 3
- 239000002736 nonionic surfactant Substances 0.000 description 3
- 102000039446 nucleic acids Human genes 0.000 description 3
- 108020004707 nucleic acids Proteins 0.000 description 3
- 150000007523 nucleic acids Chemical class 0.000 description 3
- 125000003835 nucleoside group Chemical group 0.000 description 3
- 125000003729 nucleotide group Chemical group 0.000 description 3
- 150000001451 organic peroxides Chemical class 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 229920000083 poly(allylamine) Polymers 0.000 description 3
- 239000003505 polymerization initiator Substances 0.000 description 3
- 238000010526 radical polymerization reaction Methods 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 2
- PYEMMMUTGTWTRV-UHFFFAOYSA-N 2-ethenyl-1,3-dioxole Chemical compound C=CC1OC=CO1 PYEMMMUTGTWTRV-UHFFFAOYSA-N 0.000 description 2
- YSBDJJKSMNISEA-UHFFFAOYSA-N 2-methylidenepentanamide;hydrochloride Chemical compound Cl.CCCC(=C)C(N)=O YSBDJJKSMNISEA-UHFFFAOYSA-N 0.000 description 2
- NEGMMKYAVYNLCG-UHFFFAOYSA-N 5-ethyl-1-methyl-5-phenylimidazolidine-2,4-dione Chemical compound C=1C=CC=CC=1C1(CC)N(C)C(=O)NC1=O NEGMMKYAVYNLCG-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229920000209 Hexadimethrine bromide Polymers 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- FSVCELGFZIQNCK-UHFFFAOYSA-N N,N-bis(2-hydroxyethyl)glycine Chemical compound OCCN(CCO)CC(O)=O FSVCELGFZIQNCK-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 241001494479 Pecora Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 2
- LFOXEOLGJPJZAA-UHFFFAOYSA-N [(2,6-dimethoxybenzoyl)-(2,4,4-trimethylpentyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone Chemical compound COC1=CC=CC(OC)=C1C(=O)P(=O)(CC(C)CC(C)(C)C)C(=O)C1=C(OC)C=CC=C1OC LFOXEOLGJPJZAA-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 2
- 239000002280 amphoteric surfactant Substances 0.000 description 2
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 239000012986 chain transfer agent Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- 239000004064 cosurfactant Substances 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 150000008049 diazo compounds Chemical class 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 239000012634 fragment Substances 0.000 description 2
- YMAWOPBAYDPSLA-UHFFFAOYSA-N glycylglycine Chemical compound [NH3+]CC(=O)NCC([O-])=O YMAWOPBAYDPSLA-UHFFFAOYSA-N 0.000 description 2
- 150000002432 hydroperoxides Chemical class 0.000 description 2
- 238000012688 inverse emulsion polymerization Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 238000012703 microemulsion polymerization Methods 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- ZTHQOLRLBINPRS-UHFFFAOYSA-N n-ethenyl-n-propylformamide Chemical compound CCCN(C=C)C=O ZTHQOLRLBINPRS-UHFFFAOYSA-N 0.000 description 2
- 150000003833 nucleoside derivatives Chemical class 0.000 description 2
- 239000002773 nucleotide Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000010702 perfluoropolyether Substances 0.000 description 2
- RVZRBWKZFJCCIB-UHFFFAOYSA-N perfluorotributylamine Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F RVZRBWKZFJCCIB-UHFFFAOYSA-N 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 229920000191 poly(N-vinyl pyrrolidone) Polymers 0.000 description 2
- 229920000744 poly(arginines) Polymers 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000012966 redox initiator Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 239000005968 1-Decanol Substances 0.000 description 1
- UEKSZTNDVRLVAZ-UHFFFAOYSA-N 1-amino-3-hydroxy-2,2-bis(hydroxymethyl)propane-1-sulfonic acid Chemical compound OCC(CO)(CO)C(S(=O)(=O)O)N UEKSZTNDVRLVAZ-UHFFFAOYSA-N 0.000 description 1
- OSSNTDFYBPYIEC-UHFFFAOYSA-N 1-ethenylimidazole Chemical compound C=CN1C=CN=C1 OSSNTDFYBPYIEC-UHFFFAOYSA-N 0.000 description 1
- YKBGVTZYEHREMT-KVQBGUIXSA-N 2'-deoxyguanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 YKBGVTZYEHREMT-KVQBGUIXSA-N 0.000 description 1
- CKTSBUTUHBMZGZ-SHYZEUOFSA-N 2'‐deoxycytidine Chemical compound O=C1N=C(N)C=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 CKTSBUTUHBMZGZ-SHYZEUOFSA-N 0.000 description 1
- 125000000579 2,2-diphenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(C1=C([H])C([H])=C([H])C([H])=C1[H])C([H])([H])* 0.000 description 1
- WZIMSXIXZTUBSO-UHFFFAOYSA-N 2-[[bis(carboxymethyl)amino]methyl-(carboxymethyl)amino]acetic acid Chemical compound OC(=O)CN(CC(O)=O)CN(CC(O)=O)CC(O)=O WZIMSXIXZTUBSO-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- XMLYCEVDHLAQEL-UHFFFAOYSA-N 2-hydroxy-2-methyl-1-phenylpropan-1-one Chemical compound CC(C)(O)C(=O)C1=CC=CC=C1 XMLYCEVDHLAQEL-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- LPDYFZFHFZNYQL-UHFFFAOYSA-N 2-methyl-5-morpholin-4-ylpent-2-enamide Chemical compound NC(=O)C(C)=CCCN1CCOCC1 LPDYFZFHFZNYQL-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- WCCVMVPVUAVUFI-UHFFFAOYSA-N 2-methylprop-2-enamide;hydrochloride Chemical compound Cl.CC(=C)C(N)=O WCCVMVPVUAVUFI-UHFFFAOYSA-N 0.000 description 1
- FKOZPUORKCHONH-UHFFFAOYSA-N 2-methylpropane-1-sulfonic acid Chemical compound CC(C)CS(O)(=O)=O FKOZPUORKCHONH-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- PAWGAIPTLBIYRS-UHFFFAOYSA-N 3-ethenylpyrrolidin-2-one Chemical compound C=CC1CCNC1=O PAWGAIPTLBIYRS-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- HOULWGIEDRBPKO-UHFFFAOYSA-N 4-amino-2-methylidenebutanamide;hydrochloride Chemical compound Cl.NCCC(=C)C(N)=O HOULWGIEDRBPKO-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- IQAGXMNEUYBTLG-UHFFFAOYSA-N 5-hydroxy-2-methylpent-2-enamide Chemical compound NC(=O)C(C)=CCCO IQAGXMNEUYBTLG-UHFFFAOYSA-N 0.000 description 1
- 239000007991 ACES buffer Substances 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Chemical class C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- 229920000936 Agarose Polymers 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- DWRXFEITVBNRMK-UHFFFAOYSA-N Beta-D-1-Arabinofuranosylthymine Natural products O=C1NC(=O)C(C)=CN1C1C(O)C(O)C(CO)O1 DWRXFEITVBNRMK-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- UPIYXCQZCKSJJX-UHFFFAOYSA-N CCCCOCC=C(C)C(N)=O Chemical compound CCCCOCC=C(C)C(N)=O UPIYXCQZCKSJJX-UHFFFAOYSA-N 0.000 description 1
- OLVRNENKICWIHR-UHFFFAOYSA-N COCCC=C(C)C(N)=O Chemical compound COCCC=C(C)C(N)=O OLVRNENKICWIHR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- 102000053602 DNA Human genes 0.000 description 1
- 230000004543 DNA replication Effects 0.000 description 1
- CKTSBUTUHBMZGZ-UHFFFAOYSA-N Deoxycytidine Natural products O=C1N=C(N)C=CN1C1OC(CO)C(O)C1 CKTSBUTUHBMZGZ-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- 102000003886 Glycoproteins Human genes 0.000 description 1
- 108090000288 Glycoproteins Proteins 0.000 description 1
- 108010008488 Glycylglycine Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- NZHROCUWIUVWCT-UHFFFAOYSA-N NCCC=C(C(=O)Cl)C Chemical compound NCCC=C(C(=O)Cl)C NZHROCUWIUVWCT-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Chemical class O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- NWGKJDSIEKMTRX-AAZCQSIUSA-N Sorbitan monooleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-AAZCQSIUSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 229920002359 Tetronic® Polymers 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005211 alkyl trimethyl ammonium group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- XKRFYHLGVUSROY-UHFFFAOYSA-N argon Substances [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- IQFYYKKMVGJFEH-UHFFFAOYSA-N beta-L-thymidine Natural products O=C1NC(=O)C(C)=CN1C1OC(CO)C(O)C1 IQFYYKKMVGJFEH-UHFFFAOYSA-N 0.000 description 1
- 239000007998 bicine buffer Substances 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 238000012661 block copolymerization Methods 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- 229920005605 branched copolymer Polymers 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000005549 deoxyribonucleoside Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- NAGJZTKCGNOGPW-UHFFFAOYSA-K dioxido-sulfanylidene-sulfido-$l^{5}-phosphane Chemical compound [O-]P([O-])([S-])=S NAGJZTKCGNOGPW-UHFFFAOYSA-K 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002314 glycerols Chemical class 0.000 description 1
- 229940043257 glycylglycine Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229940097789 heavy mineral oil Drugs 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 229920001477 hydrophilic polymer Polymers 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229920013821 hydroxy alkyl cellulose Polymers 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical class C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 229910001869 inorganic persulfate Inorganic materials 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 230000005865 ionizing radiation Effects 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 238000001499 laser induced fluorescence spectroscopy Methods 0.000 description 1
- 229940059904 light mineral oil Drugs 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000010369 molecular cloning Methods 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- XUQIDBSIIKXTTI-UHFFFAOYSA-N n,n-bis(2-hydroxyethyl)prop-2-enamide Chemical compound OCCN(CCO)C(=O)C=C XUQIDBSIIKXTTI-UHFFFAOYSA-N 0.000 description 1
- AADPGYDUTSGSMI-UHFFFAOYSA-N n-(1-hydroxypropyl)prop-2-enamide Chemical compound CCC(O)NC(=O)C=C AADPGYDUTSGSMI-UHFFFAOYSA-N 0.000 description 1
- HXJGFDIZSMWOGY-UHFFFAOYSA-N n-(2-azaniumylethyl)prop-2-enimidate Chemical compound NCCNC(=O)C=C HXJGFDIZSMWOGY-UHFFFAOYSA-N 0.000 description 1
- AMLJWLYRONUCKO-UHFFFAOYSA-N n-(6-amino-5-iodopyridin-2-yl)acetamide Chemical compound CC(=O)NC1=CC=C(I)C(N)=N1 AMLJWLYRONUCKO-UHFFFAOYSA-N 0.000 description 1
- JAOBQCFEUPZDQN-UHFFFAOYSA-N n-[2-(1-hydroxyethoxy)ethyl]prop-2-enamide Chemical compound CC(O)OCCNC(=O)C=C JAOBQCFEUPZDQN-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- URXNVXOMQQCBHS-UHFFFAOYSA-N naphthalene;sodium Chemical compound [Na].C1=CC=CC2=CC=CC=C21 URXNVXOMQQCBHS-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- ZJIJAJXFLBMLCK-UHFFFAOYSA-N perfluorohexane Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F ZJIJAJXFLBMLCK-UHFFFAOYSA-N 0.000 description 1
- AQZYBQIAUSKCCS-UHFFFAOYSA-N perfluorotripentylamine Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F AQZYBQIAUSKCCS-UHFFFAOYSA-N 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000005365 phosphate glass Substances 0.000 description 1
- 125000005496 phosphonium group Chemical group 0.000 description 1
- PTMHPRAIXMAOOB-UHFFFAOYSA-L phosphoramidate Chemical compound NP([O-])([O-])=O PTMHPRAIXMAOOB-UHFFFAOYSA-L 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 229920002939 poly(N,N-dimethylacrylamides) Polymers 0.000 description 1
- 229920003213 poly(N-isopropyl acrylamide) Polymers 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- 229920001921 poly-methyl-phenyl-siloxane Polymers 0.000 description 1
- 229920006122 polyamide resin Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 238000003752 polymerase chain reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920000056 polyoxyethylene ether Polymers 0.000 description 1
- 229940051841 polyoxyethylene ether Drugs 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- ZYBHSWXEWOPHBJ-UHFFFAOYSA-N potassium;propan-2-ylbenzene Chemical compound [K+].C[C-](C)C1=CC=CC=C1 ZYBHSWXEWOPHBJ-UHFFFAOYSA-N 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 238000003847 radiation curing Methods 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 239000002342 ribonucleoside Substances 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 239000012488 sample solution Substances 0.000 description 1
- JRPHGDYSKGJTKZ-UHFFFAOYSA-K selenophosphate Chemical compound [O-]P([O-])([O-])=[Se] JRPHGDYSKGJTKZ-UHFFFAOYSA-K 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 238000001542 size-exclusion chromatography Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000007655 standard test method Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical compound FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 1
- 229940104230 thymidine Drugs 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Chemical class OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 150000005691 triesters Chemical class 0.000 description 1
- 229940086542 triethylamine Drugs 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 239000013638 trimer Substances 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 229920001959 vinylidene polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F26/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a single or double bond to nitrogen or by a heterocyclic ring containing nitrogen
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N27/00—Investigating or analysing materials by the use of electric, electrochemical, or magnetic means
- G01N27/26—Investigating or analysing materials by the use of electric, electrochemical, or magnetic means by investigating electrochemical variables; by using electrolysis or electrophoresis
- G01N27/416—Systems
- G01N27/447—Systems using electrophoresis
- G01N27/44704—Details; Accessories
- G01N27/44747—Composition of gel or of carrier mixture
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/74—Synthetic polymeric materials
- A61K31/785—Polymers containing nitrogen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F126/00—Homopolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a single or double bond to nitrogen or by a heterocyclic ring containing nitrogen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F226/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a single or double bond to nitrogen or by a heterocyclic ring containing nitrogen
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N27/00—Investigating or analysing materials by the use of electric, electrochemical, or magnetic means
- G01N27/26—Investigating or analysing materials by the use of electric, electrochemical, or magnetic means by investigating electrochemical variables; by using electrolysis or electrophoresis
- G01N27/416—Systems
- G01N27/447—Systems using electrophoresis
- G01N27/44704—Details; Accessories
- G01N27/44752—Controlling the zeta potential, e.g. by wall coatings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F20/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical or a salt, anhydride, ester, amide, imide or nitrile thereof
- C08F20/02—Monocarboxylic acids having less than ten carbon atoms, Derivatives thereof
- C08F20/52—Amides or imides
- C08F20/54—Amides, e.g. N,N-dimethylacrylamide or N-isopropylacrylamide
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Molecular Biology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Immunology (AREA)
- Analytical Chemistry (AREA)
- Biochemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Electrochemistry (AREA)
- Pathology (AREA)
- Organic Chemistry (AREA)
- Polymers & Plastics (AREA)
- Dispersion Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyamides (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US47151903P | 2003-05-15 | 2003-05-15 | |
| US60/471,519 | 2003-05-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20060124549A true KR20060124549A (ko) | 2006-12-05 |
Family
ID=33476854
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020057021809A Abandoned KR20060124549A (ko) | 2003-05-15 | 2004-05-12 | 폴리 및 코폴리(n-비닐아마이드) 및 모세관 전기영동에서이들의 용도 |
Country Status (8)
| Country | Link |
|---|---|
| US (4) | US20050025741A1 (https=) |
| EP (2) | EP1636279B1 (https=) |
| JP (1) | JP2007513209A (https=) |
| KR (1) | KR20060124549A (https=) |
| CN (2) | CN101724216A (https=) |
| AT (2) | ATE423147T1 (https=) |
| DE (1) | DE602004019525D1 (https=) |
| WO (1) | WO2004104054A1 (https=) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20050025741A1 (en) * | 2003-05-15 | 2005-02-03 | Lau Aldrich N.K. | Poly and copoly(N-vinylamide)s and their use in capillary electrophoresis |
| KR20080075129A (ko) * | 2005-11-01 | 2008-08-14 | 노오쓰웨스턴 유니버시티 | 마이크로채널 분리용 매트릭스 및 동적 중합체 시스템 및조성물 |
| KR20100058499A (ko) * | 2007-08-17 | 2010-06-03 | 하이모 가부시키가이샤 | 전기영동용 프리캐스트 겔, 그 제조방법 및 그 사용방법 |
| KR101475697B1 (ko) | 2009-09-29 | 2015-01-02 | (주) 더바이오 | 모세관 전기영동 기반의 단일쇄 형태변환 다형성 분석용 충진재 및 이를 이용한 모세관 전기영동 기반의 단일쇄 형태변환 다형성 분석법 |
| US9550168B2 (en) | 2012-04-25 | 2017-01-24 | Sandia Corporation | Programmable pH buffers |
| EP3398201A4 (en) | 2015-12-31 | 2019-11-06 | University of Notre Dame du Lac | ESI-MS VIA AN ELECTRO-KINETICALLY PUMPED INTERFACE |
| US10416115B2 (en) * | 2016-06-20 | 2019-09-17 | University of Nortre Dame du Lac | System for capillary electrophoresis for peptide and protein analysis |
| US11619608B2 (en) | 2017-05-22 | 2023-04-04 | Life Technologies Corporation | Compositions, methods, kits and devices for molecular analysis |
| CN109580756A (zh) * | 2018-12-03 | 2019-04-05 | 杨翠芳 | 应用于毛细管电泳的组合物 |
| JP7187041B2 (ja) * | 2020-02-06 | 2022-12-12 | 一丸ファルコス株式会社 | プロテオグリカンの含有量の測定法 |
| US12092606B2 (en) | 2020-12-17 | 2024-09-17 | Hongene Biotech Corporation | Compositions and kits comprising interpenetrating polymer network for capillary electrophoresis |
| CN120025625B (zh) * | 2023-11-17 | 2026-02-17 | 中国石油化工股份有限公司 | 发泡组合物及其应用、发泡材料及其制备方法与应用 |
Family Cites Families (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4831842B1 (https=) | 1968-07-04 | 1973-10-02 | ||
| DE2047248A1 (de) * | 1970-09-25 | 1972-03-30 | Farbenfabriken Bayer Ag, 5090 Leverkusen | Von Vakuolen freie Fäden und Filme aus Acrylnitrilcopolymerisaten |
| DE3003778A1 (de) * | 1980-02-02 | 1981-08-13 | Hoechst Ag, 6000 Frankfurt | Verfahren zur polymerisation von vinylchlorid in waessiger phase |
| DE3027829A1 (de) | 1980-07-23 | 1982-03-04 | Cassella Ag, 6000 Frankfurt | Dispersionen optischer aufheller enthaltend pfropfpolymere des pva und die neuen pfropfpolymeren |
| SE8102772L (sv) * | 1981-05-04 | 1982-11-05 | Sven Staffan Folestad | Forfarande for laserinducerad fluoriscensdetektering och anordning for genomforande av forfarandet |
| JPS5939399A (ja) | 1982-08-31 | 1984-03-03 | Mitsubishi Chem Ind Ltd | 有機汚泥脱水剤 |
| US4675300A (en) * | 1985-09-18 | 1987-06-23 | The Board Of Trustees Of The Leland Stanford Junior University | Laser-excitation fluorescence detection electrokinetic separation |
| JPS62199872A (ja) * | 1986-02-21 | 1987-09-03 | 上野 桂助 | 難燃性パルプの製造方法 |
| DE3620065A1 (de) * | 1986-06-14 | 1987-12-17 | Basf Ag | Verfahren zur herstellung von papier, pappe und karton |
| DE3720194C2 (de) * | 1986-06-19 | 1997-07-10 | Mitsubishi Chem Corp | Vinylamincopolymere, Verwendung als Ausflockungsmittel und Verfahren zu ihrer Herstellung |
| US4865707A (en) * | 1986-10-21 | 1989-09-12 | Northeastern University | Capillary gel electrophoresis columns |
| US4997537A (en) * | 1986-10-21 | 1991-03-05 | Northeastern University | High performance microcapillary gel electrophoresis |
| JP2537827B2 (ja) | 1986-12-26 | 1996-09-25 | 株式会社クラレ | インクジエツト記録用のシ−ト |
| US4871251A (en) | 1987-04-27 | 1989-10-03 | Preikschat F K | Apparatus and method for particle analysis |
| JPH0676458B2 (ja) * | 1987-12-29 | 1994-09-28 | 三菱化成株式会社 | ポリn−ビニルホルムアミドの製造方法 |
| US4837446A (en) * | 1988-03-31 | 1989-06-06 | International Paper Company | Apparatus and process for testing uniformity of pulp |
| US4908112A (en) * | 1988-06-16 | 1990-03-13 | E. I. Du Pont De Nemours & Co. | Silicon semiconductor wafer for analyzing micronic biological samples |
| EP0364399A3 (de) * | 1988-10-03 | 1992-04-29 | Ciba-Geigy Ag | Wasserlösliche oder in Wasser dispergierbare Mischpolymerisate, deren Herstellung und Verwendung |
| US5100952A (en) * | 1989-05-11 | 1992-03-31 | Mobil Oil Corporation | Organically crosslinked polyvinyl alcohol copolymeric gels for use under harsh reservoir conditions |
| JP2688843B2 (ja) | 1989-05-16 | 1997-12-10 | 株式会社興人 | 新規なジビニル化合物 |
| US5264101A (en) * | 1989-11-06 | 1993-11-23 | Applied Biosystems, Inc. | Capillary electrophoresis molecular weight separation of biomolecules using a polymer-containing solution |
| US5015350A (en) * | 1989-11-06 | 1991-05-14 | Applied Biosystems, Inc. | Flow-rate-controlled surface-charge coating for capillary electrophoresis |
| US5181999A (en) * | 1989-11-06 | 1993-01-26 | Applied Biosystems, Inc. | Capillary electrophoresis method with polymer tube coating |
| US5126395A (en) * | 1990-03-08 | 1992-06-30 | Basf Aktiengesellschaft | Preparation of stable water-in-oil emulsions of hydrolyzed polymers of n-vinylamides |
| DE4139211C2 (de) * | 1990-11-30 | 1994-03-24 | Hitachi Ltd | Elektrophoresegerät |
| JPH04264182A (ja) | 1991-02-19 | 1992-09-18 | Kuraray Co Ltd | 接着剤組成物 |
| US5126021A (en) * | 1991-07-17 | 1992-06-30 | Applied Biosystems Inc. | Low-viscosity polymer solution for capillary electrophoresis |
| US5384024A (en) * | 1992-03-13 | 1995-01-24 | Applied Biosystems, Inc. | Capillary electrophoresis |
| US5290418A (en) * | 1992-09-24 | 1994-03-01 | Applied Biosystems, Inc. | Viscous electrophoresis polymer medium and method |
| JP2989722B2 (ja) | 1992-12-02 | 1999-12-13 | 花王株式会社 | 糊料組成物 |
| JPH06184386A (ja) | 1992-12-16 | 1994-07-05 | Showa Denko Kk | 水溶性熱可塑性フィルムおよびその用途 |
| JPH06184251A (ja) | 1992-12-16 | 1994-07-05 | Showa Denko Kk | 水溶性熱可塑性フィルムおよびその用途 |
| US5286806C1 (en) * | 1993-05-14 | 2001-01-30 | Cytec Tech Corp | Methods of making and using high molecular weight acrylamide polymers |
| US5512645A (en) * | 1993-11-25 | 1996-04-30 | Mitsubishi Chemical Corporation | Lactam ring containing polymer |
| WO1995016910A1 (en) * | 1993-12-17 | 1995-06-22 | Perkin-Elmer Corporation | Uncharged polymers for separation of biomolecules by capillary electrophoresis |
| EP0665326A3 (de) * | 1994-01-26 | 1996-09-25 | Ciba Geigy Ag | Verfahren zum Bedrucken von Fasermaterial im Direktdruck. |
| US5503722A (en) * | 1994-02-28 | 1996-04-02 | Beckman Instruments, Inc. | Rehydratable gels for capillary electrophoresis |
| US5501770A (en) * | 1994-08-12 | 1996-03-26 | Nalco Chemical Company | Enzymes in combination with polyelectrolytes for enhancing the freeness of clarified sludge in papermaking |
| US6273998B1 (en) * | 1994-08-16 | 2001-08-14 | Betzdearborn Inc. | Production of paper and paperboard |
| US5629184A (en) * | 1995-01-25 | 1997-05-13 | Amgen Inc. | Cationic copolymers of vinylamine and vinyl alcohol for the delivery of oligonucleotides |
| US5591799A (en) * | 1995-03-03 | 1997-01-07 | Air Products And Chemicals, Inc. | Aqueous emulsion materials containing copolymerized vinyl amide monomers and hydrolysis products thereof |
| US5744665A (en) * | 1995-06-08 | 1998-04-28 | Exxon Production Research Company | Maleimide copolymers and method for inhibiting hydrate formation |
| US6028233A (en) * | 1995-06-08 | 2000-02-22 | Exxon Production Research Company | Method for inhibiting hydrate formation |
| RU2160409C2 (ru) | 1995-06-08 | 2000-12-10 | Эксонмобил Апстрим Рисерч Компани | Способ ингибирования образования гидратов |
| WO1997003098A1 (de) * | 1995-07-07 | 1997-01-30 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verzweigte, wasserlösliche acrylamid-copolymere mit hohem molekulargewicht und verfahren zu ihrer herstellung |
| DE19526626A1 (de) * | 1995-07-21 | 1997-01-23 | Basf Ag | Pfropfpolymerisate aus Vinylester- und/oder Vinylalkohol-Einheiten enthaltenden Polymerisaten und ethylenisch ungesättigten Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung |
| JPH09236580A (ja) * | 1996-02-29 | 1997-09-09 | Mitsuru Akashi | キャピラリー電気泳動用媒体 |
| NO972355D0 (no) * | 1997-05-22 | 1997-05-22 | Rf Procom As | Blanding for regulering av clathrathydrater og en fremgangsmåte for regulering av clathrathydrat-dannelse |
| JPH11129609A (ja) | 1997-10-31 | 1999-05-18 | Mitsubishi Paper Mills Ltd | インクジェット用受像体 |
| US6057106A (en) * | 1998-01-23 | 2000-05-02 | Novex | Sample buffer and methods for high resolution gel electrophoresis of denatured nucleic acids |
| US6013165A (en) * | 1998-05-22 | 2000-01-11 | Lynx Therapeutics, Inc. | Electrophoresis apparatus and method |
| CN1236892A (zh) * | 1998-05-28 | 1999-12-01 | 中国人民解放军军事医学科学院放射医学研究所 | 交联聚丙烯酰胺类涂层毛细管柱辐照制备方法 |
| JP2000136351A (ja) | 1998-11-02 | 2000-05-16 | Kuraray Co Ltd | 水性艶出し組成物 |
| US6228487B1 (en) * | 1998-12-31 | 2001-05-08 | National Starch And Chemical Investment Holding Corporation | Poly(vinyl acetamide) adhesive for skin cleaning tape |
| WO2000042423A1 (en) * | 1999-01-12 | 2000-07-20 | Spectrumedix Corporation | Copolymers for capillary gel electrophoresis |
| JP4549485B2 (ja) | 1999-04-20 | 2010-09-22 | ダイヤニトリックス株式会社 | 水溶性高分子水溶液の粘度低下抑制方法 |
| JP2001081670A (ja) | 1999-09-10 | 2001-03-27 | Nicca Chemical Co Ltd | ポリアミド繊維用湿潤堅牢度向上剤及びポリアミド繊維の湿潤堅牢度向上方法 |
| SE9903748D0 (sv) | 1999-10-19 | 1999-10-19 | Amersham Pharm Biotech Ab | Method and kit for the manufacture of separation gels |
| CA2407124C (en) * | 2000-04-25 | 2010-09-28 | Spectrumedix Corporation | Denaturant-free electrophoresis of biological molecules under high temperature conditions |
| US6787016B2 (en) * | 2000-05-01 | 2004-09-07 | Aclara Biosciences, Inc. | Dynamic coating with linear polymer mixture for electrophoresis |
| JP4476451B2 (ja) | 2000-07-06 | 2010-06-09 | 株式会社クラレ | 塩素含有物質包装用水溶性フィルム |
| JP2002019274A (ja) | 2000-07-11 | 2002-01-23 | Kuraray Co Ltd | インクジェット記録材 |
| US6939451B2 (en) * | 2000-09-19 | 2005-09-06 | Aclara Biosciences, Inc. | Microfluidic chip having integrated electrodes |
| US6706162B1 (en) | 2000-09-25 | 2004-03-16 | Applera Corporation | High speed, high resolution compositions, methods, and kits for capillary electrophoresis |
| US6794458B2 (en) * | 2001-05-18 | 2004-09-21 | 3M Innovative Properties Company | Azlactone-functional hydrophilic coatings and hydrogels |
| DE10138631A1 (de) * | 2001-08-13 | 2003-02-27 | Basf Ag | Verfahren zur Herstellung von beschichtetem Papier mit hoher Weiße |
| US20050025741A1 (en) * | 2003-05-15 | 2005-02-03 | Lau Aldrich N.K. | Poly and copoly(N-vinylamide)s and their use in capillary electrophoresis |
-
2004
- 2004-05-11 US US10/843,114 patent/US20050025741A1/en not_active Abandoned
- 2004-05-12 EP EP04751975A patent/EP1636279B1/en not_active Expired - Lifetime
- 2004-05-12 CN CN200910207714A patent/CN101724216A/zh active Pending
- 2004-05-12 CN CNB2004800193475A patent/CN100567339C/zh not_active Expired - Fee Related
- 2004-05-12 AT AT04751975T patent/ATE423147T1/de not_active IP Right Cessation
- 2004-05-12 KR KR1020057021809A patent/KR20060124549A/ko not_active Abandoned
- 2004-05-12 WO PCT/US2004/014831 patent/WO2004104054A1/en not_active Ceased
- 2004-05-12 AT AT09000227T patent/ATE524502T1/de not_active IP Right Cessation
- 2004-05-12 EP EP09000227A patent/EP2053067B1/en not_active Expired - Lifetime
- 2004-05-12 JP JP2006532979A patent/JP2007513209A/ja active Pending
- 2004-05-12 DE DE602004019525T patent/DE602004019525D1/de not_active Expired - Lifetime
-
2009
- 2009-11-11 US US12/616,748 patent/US20100051461A1/en not_active Abandoned
-
2014
- 2014-01-06 US US14/148,401 patent/US9671367B2/en not_active Expired - Lifetime
-
2017
- 2017-05-15 US US15/595,439 patent/US10551345B2/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| WO2004104054A1 (en) | 2004-12-02 |
| US20050025741A1 (en) | 2005-02-03 |
| ATE423147T1 (de) | 2009-03-15 |
| DE602004019525D1 (de) | 2009-04-02 |
| CN1816573A (zh) | 2006-08-09 |
| US20100051461A1 (en) | 2010-03-04 |
| US20140209461A1 (en) | 2014-07-31 |
| EP2053067A1 (en) | 2009-04-29 |
| EP1636279A1 (en) | 2006-03-22 |
| US10551345B2 (en) | 2020-02-04 |
| CN100567339C (zh) | 2009-12-09 |
| EP1636279B1 (en) | 2009-02-18 |
| US9671367B2 (en) | 2017-06-06 |
| CN101724216A (zh) | 2010-06-09 |
| ATE524502T1 (de) | 2011-09-15 |
| EP2053067B1 (en) | 2011-09-14 |
| JP2007513209A (ja) | 2007-05-24 |
| US20170356877A1 (en) | 2017-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US10551345B2 (en) | Poly and copoly(N-vinylamide)s and their use in capillary electrophoresis | |
| US8784627B2 (en) | Graft copolymers, their preparation and use in capillary electrophoresis | |
| US8734630B2 (en) | High speed, high resolution compositions, methods, and kits for capillary electrophoresis | |
| Albarghouthi et al. | Poly‐N‐hydroxyethylacrylamide (polyDuramide™): A novel, hydrophilic, self‐coating polymer matrix for DNA sequencing by capillary electrophoresis | |
| JP2003523499A (ja) | キャピラリーゲル電気泳動のためのコポリマー | |
| US20060108225A1 (en) | High conductivity sieving matrices for high resolution biomolecule separations |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20051115 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| A201 | Request for examination | ||
| PA0201 | Request for examination |
Patent event code: PA02012R01D Patent event date: 20090512 Comment text: Request for Examination of Application |
|
| E902 | Notification of reason for refusal | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20110304 Patent event code: PE09021S01D |
|
| E701 | Decision to grant or registration of patent right | ||
| PE0701 | Decision of registration |
Patent event code: PE07011S01D Comment text: Decision to Grant Registration Patent event date: 20111130 |
|
| NORF | Unpaid initial registration fee | ||
| PC1904 | Unpaid initial registration fee |