KR102645398B1 - 신규 인공 핵산 분자 - Google Patents
신규 인공 핵산 분자 Download PDFInfo
- Publication number
- KR102645398B1 KR102645398B1 KR1020187008732A KR20187008732A KR102645398B1 KR 102645398 B1 KR102645398 B1 KR 102645398B1 KR 1020187008732 A KR1020187008732 A KR 1020187008732A KR 20187008732 A KR20187008732 A KR 20187008732A KR 102645398 B1 KR102645398 B1 KR 102645398B1
- Authority
- KR
- South Korea
- Prior art keywords
- utr
- nucleic acid
- acid molecule
- artificial nucleic
- delete delete
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000007523 nucleic acids Chemical class 0.000 title claims abstract description 645
- 102000039446 nucleic acids Human genes 0.000 title claims abstract description 544
- 108020004707 nucleic acids Proteins 0.000 title claims abstract description 544
- 108020003589 5' Untranslated Regions Proteins 0.000 claims abstract description 605
- 108020005345 3' Untranslated Regions Proteins 0.000 claims abstract description 452
- 108700026244 Open Reading Frames Proteins 0.000 claims abstract description 195
- 238000013519 translation Methods 0.000 claims abstract description 142
- 238000001415 gene therapy Methods 0.000 claims abstract description 22
- 108091036066 Three prime untranslated region Proteins 0.000 claims abstract description 12
- 108090000623 proteins and genes Proteins 0.000 claims description 325
- 102000004169 proteins and genes Human genes 0.000 claims description 197
- 230000014616 translation Effects 0.000 claims description 196
- 108091028043 Nucleic acid sequence Proteins 0.000 claims description 134
- 210000004027 cell Anatomy 0.000 claims description 131
- 108091032973 (ribonucleotides)n+m Proteins 0.000 claims description 81
- 238000000034 method Methods 0.000 claims description 71
- 108020004705 Codon Proteins 0.000 claims description 58
- 108091034057 RNA (poly(A)) Proteins 0.000 claims description 54
- 238000001890 transfection Methods 0.000 claims description 51
- 239000013598 vector Substances 0.000 claims description 39
- 230000008488 polyadenylation Effects 0.000 claims description 34
- 230000001965 increasing effect Effects 0.000 claims description 33
- 210000004962 mammalian cell Anatomy 0.000 claims description 30
- 108020004999 messenger RNA Proteins 0.000 claims description 24
- 108010033040 Histones Proteins 0.000 claims description 23
- 238000000338 in vitro Methods 0.000 claims description 23
- 229960005486 vaccine Drugs 0.000 claims description 16
- 108010088751 Albumins Proteins 0.000 claims description 12
- 101001089120 Homo sapiens Proteasome subunit beta type-3 Proteins 0.000 claims description 12
- 102100033755 Proteasome subunit beta type-3 Human genes 0.000 claims description 12
- 102100032757 Cysteine-rich protein 2 Human genes 0.000 claims description 10
- 101000942088 Homo sapiens Cysteine-rich protein 2 Proteins 0.000 claims description 10
- 239000008194 pharmaceutical composition Substances 0.000 claims description 9
- 101150003543 GPRC5C gene Proteins 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 4
- 229940079593 drug Drugs 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims 1
- 238000011239 genetic vaccination Methods 0.000 abstract description 19
- 108091026898 Leader sequence (mRNA) Proteins 0.000 abstract description 9
- 125000003729 nucleotide group Chemical group 0.000 description 241
- 239000002773 nucleotide Substances 0.000 description 233
- 235000018102 proteins Nutrition 0.000 description 162
- 230000014509 gene expression Effects 0.000 description 88
- 239000012634 fragment Substances 0.000 description 83
- 108091023045 Untranslated Region Proteins 0.000 description 59
- 238000012986 modification Methods 0.000 description 49
- 230000004048 modification Effects 0.000 description 48
- 108020004414 DNA Proteins 0.000 description 46
- 108091007433 antigens Proteins 0.000 description 44
- 102000036639 antigens Human genes 0.000 description 44
- 239000000427 antigen Substances 0.000 description 42
- -1 RNA or DNA Chemical class 0.000 description 41
- 238000013518 transcription Methods 0.000 description 39
- 230000035897 transcription Effects 0.000 description 39
- 150000001413 amino acids Chemical group 0.000 description 38
- 108090000765 processed proteins & peptides Proteins 0.000 description 38
- 101150114197 TOP gene Proteins 0.000 description 29
- 241000282414 Homo sapiens Species 0.000 description 28
- 210000001519 tissue Anatomy 0.000 description 27
- 102000002278 Ribosomal Proteins Human genes 0.000 description 26
- 108010000605 Ribosomal Proteins Proteins 0.000 description 26
- 229940024606 amino acid Drugs 0.000 description 24
- 235000001014 amino acid Nutrition 0.000 description 24
- 230000006870 function Effects 0.000 description 24
- 244000052769 pathogen Species 0.000 description 22
- NYHBQMYGNKIUIF-UUOKFMHZSA-N Guanosine Chemical class C1=NC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O NYHBQMYGNKIUIF-UUOKFMHZSA-N 0.000 description 21
- 108091008146 restriction endonucleases Proteins 0.000 description 20
- 241000699666 Mus <mouse, genus> Species 0.000 description 18
- 102000004196 processed proteins & peptides Human genes 0.000 description 18
- 235000000346 sugar Nutrition 0.000 description 18
- 108091081024 Start codon Proteins 0.000 description 17
- 241000894007 species Species 0.000 description 17
- 101001127258 Homo sapiens 60S ribosomal protein L36a-like Proteins 0.000 description 16
- 108060001084 Luciferase Proteins 0.000 description 16
- 238000001727 in vivo Methods 0.000 description 16
- 230000008569 process Effects 0.000 description 16
- 230000000694 effects Effects 0.000 description 15
- 230000028993 immune response Effects 0.000 description 15
- 230000002028 premature Effects 0.000 description 15
- OPTASPLRGRRNAP-UHFFFAOYSA-N cytosine Chemical compound NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 description 14
- 108091026890 Coding region Proteins 0.000 description 13
- 102000053602 DNA Human genes 0.000 description 13
- 108091027974 Mature messenger RNA Proteins 0.000 description 13
- 238000010367 cloning Methods 0.000 description 13
- 210000005260 human cell Anatomy 0.000 description 13
- 239000001226 triphosphate Substances 0.000 description 13
- 108010043121 Green Fluorescent Proteins Proteins 0.000 description 12
- 102000004144 Green Fluorescent Proteins Human genes 0.000 description 12
- 102000003861 Ribosomal protein S6 Human genes 0.000 description 12
- 108090000221 Ribosomal protein S6 Proteins 0.000 description 12
- 108020004566 Transfer RNA Proteins 0.000 description 12
- UHDGCWIWMRVCDJ-ZAKLUEHWSA-N cytidine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-ZAKLUEHWSA-N 0.000 description 12
- 230000003308 immunostimulating effect Effects 0.000 description 12
- 230000001717 pathogenic effect Effects 0.000 description 12
- 102100040768 60S ribosomal protein L32 Human genes 0.000 description 11
- 102100031012 60S ribosomal protein L36a-like Human genes 0.000 description 11
- 210000001744 T-lymphocyte Anatomy 0.000 description 11
- 230000004913 activation Effects 0.000 description 11
- 230000015556 catabolic process Effects 0.000 description 11
- 238000003776 cleavage reaction Methods 0.000 description 11
- 230000000295 complement effect Effects 0.000 description 11
- 238000006731 degradation reaction Methods 0.000 description 11
- 210000000987 immune system Anatomy 0.000 description 11
- 230000015788 innate immune response Effects 0.000 description 11
- 239000000178 monomer Substances 0.000 description 11
- 230000007017 scission Effects 0.000 description 11
- 239000000126 substance Substances 0.000 description 11
- 239000005089 Luciferase Substances 0.000 description 10
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical class O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 10
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 10
- 230000033289 adaptive immune response Effects 0.000 description 10
- 210000005006 adaptive immune system Anatomy 0.000 description 10
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 10
- 230000033228 biological regulation Effects 0.000 description 10
- 229940029575 guanosine Drugs 0.000 description 10
- 230000002163 immunogen Effects 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 10
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 10
- 239000002719 pyrimidine nucleotide Substances 0.000 description 10
- 150000003230 pyrimidines Chemical class 0.000 description 10
- 230000001105 regulatory effect Effects 0.000 description 10
- 230000004044 response Effects 0.000 description 10
- 102100031571 40S ribosomal protein S16 Human genes 0.000 description 9
- GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 description 9
- MIKUYHXYGGJMLM-GIMIYPNGSA-N Crotonoside Natural products C1=NC2=C(N)NC(=O)N=C2N1[C@H]1O[C@@H](CO)[C@H](O)[C@@H]1O MIKUYHXYGGJMLM-GIMIYPNGSA-N 0.000 description 9
- NYHBQMYGNKIUIF-UHFFFAOYSA-N D-guanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1OC(CO)C(O)C1O NYHBQMYGNKIUIF-UHFFFAOYSA-N 0.000 description 9
- 230000001939 inductive effect Effects 0.000 description 9
- 230000035800 maturation Effects 0.000 description 9
- 108010092955 ribosomal protein S16 Proteins 0.000 description 9
- 238000006467 substitution reaction Methods 0.000 description 9
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 8
- 206010028980 Neoplasm Diseases 0.000 description 8
- 229910019142 PO4 Inorganic materials 0.000 description 8
- DRTQHJPVMGBUCF-XVFCMESISA-N Uridine Chemical group O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-XVFCMESISA-N 0.000 description 8
- 229960005305 adenosine Drugs 0.000 description 8
- 239000002671 adjuvant Substances 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 230000002068 genetic effect Effects 0.000 description 8
- 238000002372 labelling Methods 0.000 description 8
- 235000021317 phosphate Nutrition 0.000 description 8
- 230000002441 reversible effect Effects 0.000 description 8
- 230000000087 stabilizing effect Effects 0.000 description 8
- 230000032258 transport Effects 0.000 description 8
- UHDGCWIWMRVCDJ-UHFFFAOYSA-N 1-beta-D-Xylofuranosyl-NH-Cytosine Natural products O=C1N=C(N)C=CN1C1C(O)C(O)C(CO)O1 UHDGCWIWMRVCDJ-UHFFFAOYSA-N 0.000 description 7
- FWMNVWWHGCHHJJ-SKKKGAJSSA-N 4-amino-1-[(2r)-6-amino-2-[[(2r)-2-[[(2r)-2-[[(2r)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid Chemical compound C([C@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N1CCC(N)(CC1)C(O)=O)NC(=O)[C@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 FWMNVWWHGCHHJJ-SKKKGAJSSA-N 0.000 description 7
- UHDGCWIWMRVCDJ-PSQAKQOGSA-N Cytidine Natural products O=C1N=C(N)C=CN1[C@@H]1[C@@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-PSQAKQOGSA-N 0.000 description 7
- 238000002965 ELISA Methods 0.000 description 7
- 102100027685 Hemoglobin subunit alpha Human genes 0.000 description 7
- 108091005902 Hemoglobin subunit alpha Proteins 0.000 description 7
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 7
- 125000002091 cationic group Chemical group 0.000 description 7
- 210000005007 innate immune system Anatomy 0.000 description 7
- 238000005259 measurement Methods 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- 238000001262 western blot Methods 0.000 description 7
- 102100025581 ATP synthase subunit delta, mitochondrial Human genes 0.000 description 6
- 102100024948 Aldehyde dehydrogenase family 16 member A1 Human genes 0.000 description 6
- 102100028714 BRCA1-associated ATM activator 1 Human genes 0.000 description 6
- 102100037904 CD9 antigen Human genes 0.000 description 6
- 101000845237 Cereibacter sphaeroides Tryptophan-rich sensory protein Proteins 0.000 description 6
- 102100024457 Cyclin-dependent kinase 9 Human genes 0.000 description 6
- 102100025620 Cytochrome b-245 light chain Human genes 0.000 description 6
- 102100037579 D-3-phosphoglycerate dehydrogenase Human genes 0.000 description 6
- 102100030146 Epithelial membrane protein 3 Human genes 0.000 description 6
- 102100038985 Exosome complex component RRP41 Human genes 0.000 description 6
- 108091005904 Hemoglobin subunit beta Proteins 0.000 description 6
- 101000766510 Homo sapiens ATP synthase subunit delta, mitochondrial Proteins 0.000 description 6
- 101000761405 Homo sapiens Aldehyde dehydrogenase family 16 member A1 Proteins 0.000 description 6
- 101000695387 Homo sapiens BRCA1-associated ATM activator 1 Proteins 0.000 description 6
- 101000980930 Homo sapiens Cyclin-dependent kinase 9 Proteins 0.000 description 6
- 101000856723 Homo sapiens Cytochrome b-245 light chain Proteins 0.000 description 6
- 101000739890 Homo sapiens D-3-phosphoglycerate dehydrogenase Proteins 0.000 description 6
- 101001011788 Homo sapiens Epithelial membrane protein 3 Proteins 0.000 description 6
- 101000882162 Homo sapiens Exosome complex component RRP41 Proteins 0.000 description 6
- 101001054793 Homo sapiens Importin subunit alpha-7 Proteins 0.000 description 6
- 101001057305 Homo sapiens Microtubule-associated protein 1S Proteins 0.000 description 6
- 101000979227 Homo sapiens NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Proteins 0.000 description 6
- 101000612134 Homo sapiens Procollagen C-endopeptidase enhancer 1 Proteins 0.000 description 6
- 101000735893 Homo sapiens Proteasome subunit beta type-6 Proteins 0.000 description 6
- 101000845206 Homo sapiens Putative peripheral benzodiazepine receptor-related protein Proteins 0.000 description 6
- 101000640246 Homo sapiens SCAN domain-containing protein 1 Proteins 0.000 description 6
- 101000705951 Homo sapiens Serine protease 56 Proteins 0.000 description 6
- 101000845233 Homo sapiens Translocator protein Proteins 0.000 description 6
- 101000788548 Homo sapiens Tubulin alpha-4A chain Proteins 0.000 description 6
- 108020004684 Internal Ribosome Entry Sites Proteins 0.000 description 6
- 102100027228 Microtubule-associated protein 1S Human genes 0.000 description 6
- 241000699660 Mus musculus Species 0.000 description 6
- 102100023212 NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Human genes 0.000 description 6
- 102100041026 Procollagen C-endopeptidase enhancer 1 Human genes 0.000 description 6
- 102100036128 Proteasome subunit beta type-6 Human genes 0.000 description 6
- 102100031269 Putative peripheral benzodiazepine receptor-related protein Human genes 0.000 description 6
- 102100033957 SCAN domain-containing protein 1 Human genes 0.000 description 6
- 102100031055 Serine protease 56 Human genes 0.000 description 6
- 102100025239 Tubulin alpha-4A chain Human genes 0.000 description 6
- 102100035140 Vitronectin Human genes 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 238000003556 assay Methods 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 229940104302 cytosine Drugs 0.000 description 6
- 238000001943 fluorescence-activated cell sorting Methods 0.000 description 6
- 102000018146 globin Human genes 0.000 description 6
- 108060003196 globin Proteins 0.000 description 6
- 208000015181 infectious disease Diseases 0.000 description 6
- 239000003446 ligand Substances 0.000 description 6
- 230000035772 mutation Effects 0.000 description 6
- 239000010452 phosphate Substances 0.000 description 6
- 229920001184 polypeptide Polymers 0.000 description 6
- 238000011002 quantification Methods 0.000 description 6
- 102000004346 ribosomal protein L9 Human genes 0.000 description 6
- 108090000907 ribosomal protein L9 Proteins 0.000 description 6
- 238000011144 upstream manufacturing Methods 0.000 description 6
- 102100039882 40S ribosomal protein S17 Human genes 0.000 description 5
- DWRXFEITVBNRMK-UHFFFAOYSA-N Beta-D-1-Arabinofuranosylthymine Natural products O=C1NC(=O)C(C)=CN1C1C(O)C(O)C(CO)O1 DWRXFEITVBNRMK-UHFFFAOYSA-N 0.000 description 5
- 101150022676 CSTB gene Proteins 0.000 description 5
- 101001009007 Homo sapiens Hemoglobin subunit alpha Proteins 0.000 description 5
- 102100027002 Importin subunit alpha-7 Human genes 0.000 description 5
- 101100022170 Mus musculus Ms4a8 gene Proteins 0.000 description 5
- 101150109071 UBC gene Proteins 0.000 description 5
- 150000003838 adenosines Chemical class 0.000 description 5
- 238000013459 approach Methods 0.000 description 5
- 101150071435 atp5f1d gene Proteins 0.000 description 5
- 210000003719 b-lymphocyte Anatomy 0.000 description 5
- 101150029168 cdca8 gene Proteins 0.000 description 5
- 238000007385 chemical modification Methods 0.000 description 5
- 201000010099 disease Diseases 0.000 description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 5
- 238000003780 insertion Methods 0.000 description 5
- 230000037431 insertion Effects 0.000 description 5
- 125000005647 linker group Chemical group 0.000 description 5
- 210000002540 macrophage Anatomy 0.000 description 5
- 125000003835 nucleoside group Chemical group 0.000 description 5
- 230000001575 pathological effect Effects 0.000 description 5
- 108010093121 ribosomal protein S17 Proteins 0.000 description 5
- 238000003860 storage Methods 0.000 description 5
- 238000002255 vaccination Methods 0.000 description 5
- 102100037563 40S ribosomal protein S2 Human genes 0.000 description 4
- 102100040881 60S acidic ribosomal protein P0 Human genes 0.000 description 4
- 102100033416 60S acidic ribosomal protein P1 Human genes 0.000 description 4
- 102100026112 60S acidic ribosomal protein P2 Human genes 0.000 description 4
- 101150105918 AARSD1 gene Proteins 0.000 description 4
- 101150016676 ACOX2 gene Proteins 0.000 description 4
- 101150021665 CTH gene Proteins 0.000 description 4
- 108700010070 Codon Usage Proteins 0.000 description 4
- 102000004127 Cytokines Human genes 0.000 description 4
- 108090000695 Cytokines Proteins 0.000 description 4
- HMFHBZSHGGEWLO-SOOFDHNKSA-N D-ribofuranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H]1O HMFHBZSHGGEWLO-SOOFDHNKSA-N 0.000 description 4
- 101150074151 Ebp gene Proteins 0.000 description 4
- 108060002716 Exonuclease Proteins 0.000 description 4
- 102100021519 Hemoglobin subunit beta Human genes 0.000 description 4
- 101000673456 Homo sapiens 60S acidic ribosomal protein P0 Proteins 0.000 description 4
- 101000712357 Homo sapiens 60S acidic ribosomal protein P1 Proteins 0.000 description 4
- 101000691878 Homo sapiens 60S acidic ribosomal protein P2 Proteins 0.000 description 4
- 101000729812 Homo sapiens Beta-1,4 N-acetylgalactosaminyltransferase 2 Proteins 0.000 description 4
- 101000738354 Homo sapiens CD9 antigen Proteins 0.000 description 4
- 101000713613 Homo sapiens Tubulin beta-4B chain Proteins 0.000 description 4
- 101000803709 Homo sapiens Vitronectin Proteins 0.000 description 4
- 101150010134 KIF22 gene Proteins 0.000 description 4
- 101150063084 KIF2C gene Proteins 0.000 description 4
- 101150012245 NUDT22 gene Proteins 0.000 description 4
- 108700008625 Reporter Genes Proteins 0.000 description 4
- PYMYPHUHKUWMLA-LMVFSUKVSA-N Ribose Natural products OC[C@@H](O)[C@@H](O)[C@@H](O)C=O PYMYPHUHKUWMLA-LMVFSUKVSA-N 0.000 description 4
- 102000004282 Ribosomal protein S9 Human genes 0.000 description 4
- 108090000878 Ribosomal protein S9 Proteins 0.000 description 4
- 101150045029 SF3B5 gene Proteins 0.000 description 4
- 101150019148 Slc7a3 gene Proteins 0.000 description 4
- 101150109474 TMEM37 gene Proteins 0.000 description 4
- 102000002689 Toll-like receptor Human genes 0.000 description 4
- 108020000411 Toll-like receptor Proteins 0.000 description 4
- 108700009124 Transcription Initiation Site Proteins 0.000 description 4
- 102100036821 Tubulin beta-4B chain Human genes 0.000 description 4
- 102100028462 Ubiquitin-60S ribosomal protein L40 Human genes 0.000 description 4
- 238000007792 addition Methods 0.000 description 4
- HMFHBZSHGGEWLO-UHFFFAOYSA-N alpha-D-Furanose-Ribose Natural products OCC1OC(O)C(O)C1O HMFHBZSHGGEWLO-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 230000000692 anti-sense effect Effects 0.000 description 4
- 230000000890 antigenic effect Effects 0.000 description 4
- IQFYYKKMVGJFEH-UHFFFAOYSA-N beta-L-thymidine Natural products O=C1NC(=O)C(C)=CN1C1OC(CO)C(O)C1 IQFYYKKMVGJFEH-UHFFFAOYSA-N 0.000 description 4
- DRTQHJPVMGBUCF-PSQAKQOGSA-N beta-L-uridine Natural products O[C@H]1[C@@H](O)[C@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-PSQAKQOGSA-N 0.000 description 4
- 239000013592 cell lysate Substances 0.000 description 4
- 210000004443 dendritic cell Anatomy 0.000 description 4
- 230000002500 effect on skin Effects 0.000 description 4
- 230000002708 enhancing effect Effects 0.000 description 4
- 210000003527 eukaryotic cell Anatomy 0.000 description 4
- 102000013165 exonuclease Human genes 0.000 description 4
- 210000002950 fibroblast Anatomy 0.000 description 4
- 239000005090 green fluorescent protein Substances 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 238000004020 luminiscence type Methods 0.000 description 4
- 238000004949 mass spectrometry Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 108010025325 ribosomal protein L32 Proteins 0.000 description 4
- 229940104230 thymidine Drugs 0.000 description 4
- 229940035893 uracil Drugs 0.000 description 4
- DRTQHJPVMGBUCF-UHFFFAOYSA-N uracil arabinoside Natural products OC1C(O)C(CO)OC1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-UHFFFAOYSA-N 0.000 description 4
- 229940045145 uridine Drugs 0.000 description 4
- 230000003612 virological effect Effects 0.000 description 4
- 102000040650 (ribonucleotides)n+m Human genes 0.000 description 3
- 102100023912 40S ribosomal protein S12 Human genes 0.000 description 3
- 102100024113 40S ribosomal protein S15a Human genes 0.000 description 3
- 101710198769 40S ribosomal protein S15a Proteins 0.000 description 3
- 102100039980 40S ribosomal protein S18 Human genes 0.000 description 3
- 102100033051 40S ribosomal protein S19 Human genes 0.000 description 3
- 102100023415 40S ribosomal protein S20 Human genes 0.000 description 3
- 102100037710 40S ribosomal protein S21 Human genes 0.000 description 3
- 102100037513 40S ribosomal protein S23 Human genes 0.000 description 3
- 102100033449 40S ribosomal protein S24 Human genes 0.000 description 3
- 102100022721 40S ribosomal protein S25 Human genes 0.000 description 3
- 102100027337 40S ribosomal protein S26 Human genes 0.000 description 3
- 102100022681 40S ribosomal protein S27 Human genes 0.000 description 3
- 102100023679 40S ribosomal protein S28 Human genes 0.000 description 3
- 102100031928 40S ribosomal protein S29 Human genes 0.000 description 3
- 102100033409 40S ribosomal protein S3 Human genes 0.000 description 3
- 102100022600 40S ribosomal protein S3a Human genes 0.000 description 3
- 102100024088 40S ribosomal protein S7 Human genes 0.000 description 3
- 102100037663 40S ribosomal protein S8 Human genes 0.000 description 3
- 102100027271 40S ribosomal protein SA Human genes 0.000 description 3
- 102100021546 60S ribosomal protein L10 Human genes 0.000 description 3
- 102100035916 60S ribosomal protein L11 Human genes 0.000 description 3
- 102100024406 60S ribosomal protein L15 Human genes 0.000 description 3
- 102100023990 60S ribosomal protein L17 Human genes 0.000 description 3
- 102100021690 60S ribosomal protein L18a Human genes 0.000 description 3
- 102100021206 60S ribosomal protein L19 Human genes 0.000 description 3
- 101710187808 60S ribosomal protein L19 Proteins 0.000 description 3
- 102100037965 60S ribosomal protein L21 Human genes 0.000 description 3
- 102100037685 60S ribosomal protein L22 Human genes 0.000 description 3
- 101710187788 60S ribosomal protein L22 Proteins 0.000 description 3
- 102100021308 60S ribosomal protein L23 Human genes 0.000 description 3
- 102100023247 60S ribosomal protein L23a Human genes 0.000 description 3
- 102100035322 60S ribosomal protein L24 Human genes 0.000 description 3
- 102100028348 60S ribosomal protein L26 Human genes 0.000 description 3
- 102100025601 60S ribosomal protein L27 Human genes 0.000 description 3
- 102100021927 60S ribosomal protein L27a Human genes 0.000 description 3
- 102100021660 60S ribosomal protein L28 Human genes 0.000 description 3
- 102100021671 60S ribosomal protein L29 Human genes 0.000 description 3
- 102100038237 60S ribosomal protein L30 Human genes 0.000 description 3
- 102100023777 60S ribosomal protein L31 Human genes 0.000 description 3
- 102100040637 60S ribosomal protein L34 Human genes 0.000 description 3
- 102100031002 60S ribosomal protein L36a Human genes 0.000 description 3
- 102100030982 60S ribosomal protein L38 Human genes 0.000 description 3
- 102100035988 60S ribosomal protein L39 Human genes 0.000 description 3
- 102100026926 60S ribosomal protein L4 Human genes 0.000 description 3
- 102100040623 60S ribosomal protein L41 Human genes 0.000 description 3
- 102100035841 60S ribosomal protein L7 Human genes 0.000 description 3
- 102100036630 60S ribosomal protein L7a Human genes 0.000 description 3
- 102100035931 60S ribosomal protein L8 Human genes 0.000 description 3
- 102100022089 Acyl-[acyl-carrier-protein] hydrolase Human genes 0.000 description 3
- 229930024421 Adenine Natural products 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 102100026686 Chromobox protein homolog 6 Human genes 0.000 description 3
- 102100024337 Collagen alpha-1(VIII) chain Human genes 0.000 description 3
- 108091035707 Consensus sequence Proteins 0.000 description 3
- 102100032644 Copine-2 Human genes 0.000 description 3
- 102100028005 Cytochrome b-c1 complex subunit 9 Human genes 0.000 description 3
- 102100028472 DNA-directed RNA polymerases I, II, and III subunit RPABC5 Human genes 0.000 description 3
- 102100024426 Dihydropyrimidinase-related protein 2 Human genes 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- 101100200593 Emericella nidulans (strain FGSC A4 / ATCC 38163 / CBS 112.46 / NRRL 194 / M139) rps19 gene Proteins 0.000 description 3
- 108700039887 Essential Genes Proteins 0.000 description 3
- 102100030341 Ethanolaminephosphotransferase 1 Human genes 0.000 description 3
- 102100040669 F-box only protein 32 Human genes 0.000 description 3
- 102100027728 F-box/LRR-repeat protein 18 Human genes 0.000 description 3
- 102100034003 FAU ubiquitin-like and ribosomal protein S30 Human genes 0.000 description 3
- 102100036089 Fascin Human genes 0.000 description 3
- 238000012413 Fluorescence activated cell sorting analysis Methods 0.000 description 3
- 102100021265 Frizzled-2 Human genes 0.000 description 3
- 102000053187 Glucuronidase Human genes 0.000 description 3
- 108010060309 Glucuronidase Proteins 0.000 description 3
- 101001097953 Homo sapiens 40S ribosomal protein S23 Proteins 0.000 description 3
- 101000678929 Homo sapiens 40S ribosomal protein S25 Proteins 0.000 description 3
- 101000862491 Homo sapiens 40S ribosomal protein S26 Proteins 0.000 description 3
- 101000678466 Homo sapiens 40S ribosomal protein S27 Proteins 0.000 description 3
- 101000623076 Homo sapiens 40S ribosomal protein S28 Proteins 0.000 description 3
- 101000679249 Homo sapiens 40S ribosomal protein S3a Proteins 0.000 description 3
- 101000694288 Homo sapiens 40S ribosomal protein SA Proteins 0.000 description 3
- 101001115494 Homo sapiens 60S ribosomal protein L23a Proteins 0.000 description 3
- 101001080179 Homo sapiens 60S ribosomal protein L26 Proteins 0.000 description 3
- 101000753696 Homo sapiens 60S ribosomal protein L27a Proteins 0.000 description 3
- 101001127203 Homo sapiens 60S ribosomal protein L36a Proteins 0.000 description 3
- 101001127039 Homo sapiens 60S ribosomal protein L38 Proteins 0.000 description 3
- 101000674326 Homo sapiens 60S ribosomal protein L41 Proteins 0.000 description 3
- 101000853617 Homo sapiens 60S ribosomal protein L7 Proteins 0.000 description 3
- 101000853243 Homo sapiens 60S ribosomal protein L7a Proteins 0.000 description 3
- 101000824278 Homo sapiens Acyl-[acyl-carrier-protein] hydrolase Proteins 0.000 description 3
- 101000909153 Homo sapiens Carboxypeptidase N subunit 2 Proteins 0.000 description 3
- 101000910833 Homo sapiens Chromobox protein homolog 6 Proteins 0.000 description 3
- 101000909492 Homo sapiens Collagen alpha-1(VIII) chain Proteins 0.000 description 3
- 101000941777 Homo sapiens Copine-2 Proteins 0.000 description 3
- 101000761956 Homo sapiens Cytochrome P450 11B2, mitochondrial Proteins 0.000 description 3
- 101001079630 Homo sapiens Cytochrome b-c1 complex subunit 9 Proteins 0.000 description 3
- 101000723805 Homo sapiens DNA-directed RNA polymerases I, II, and III subunit RPABC5 Proteins 0.000 description 3
- 101001053503 Homo sapiens Dihydropyrimidinase-related protein 2 Proteins 0.000 description 3
- 101000938340 Homo sapiens Ethanolaminephosphotransferase 1 Proteins 0.000 description 3
- 101000892323 Homo sapiens F-box only protein 32 Proteins 0.000 description 3
- 101000862204 Homo sapiens F-box/LRR-repeat protein 18 Proteins 0.000 description 3
- 101000732045 Homo sapiens FAU ubiquitin-like and ribosomal protein S30 Proteins 0.000 description 3
- 101001021925 Homo sapiens Fascin Proteins 0.000 description 3
- 101000819477 Homo sapiens Frizzled-2 Proteins 0.000 description 3
- 101001043809 Homo sapiens Interleukin-7 receptor subunit alpha Proteins 0.000 description 3
- 101001003687 Homo sapiens Lipoma-preferred partner Proteins 0.000 description 3
- 101001047677 Homo sapiens Lysocardiolipin acyltransferase 1 Proteins 0.000 description 3
- 101000601048 Homo sapiens Nidogen-2 Proteins 0.000 description 3
- 101001121166 Homo sapiens ORM1-like protein 2 Proteins 0.000 description 3
- 101001113465 Homo sapiens Partitioning defective 6 homolog beta Proteins 0.000 description 3
- 101001109588 Homo sapiens Polynucleotide 5'-hydroxyl-kinase NOL9 Proteins 0.000 description 3
- 101000605122 Homo sapiens Prostaglandin G/H synthase 1 Proteins 0.000 description 3
- 101000915575 Homo sapiens Protein ZNRD2 Proteins 0.000 description 3
- 101000942729 Homo sapiens Protein lin-7 homolog C Proteins 0.000 description 3
- 101000666171 Homo sapiens Protein-glutamine gamma-glutamyltransferase 2 Proteins 0.000 description 3
- 101001066905 Homo sapiens Pyridoxine-5'-phosphate oxidase Proteins 0.000 description 3
- 101000609349 Homo sapiens Pyrroline-5-carboxylate reductase 3 Proteins 0.000 description 3
- 101000620559 Homo sapiens Ras-related protein Rab-3B Proteins 0.000 description 3
- 101001099888 Homo sapiens Ras-related protein Rab-3D Proteins 0.000 description 3
- 101001132646 Homo sapiens Ribonucleoprotein PTB-binding 1 Proteins 0.000 description 3
- 101000685293 Homo sapiens Seizure 6-like protein 2 Proteins 0.000 description 3
- 101000864990 Homo sapiens Serine incorporator 5 Proteins 0.000 description 3
- 101000729945 Homo sapiens Serine/threonine-protein kinase PLK2 Proteins 0.000 description 3
- 101000836383 Homo sapiens Serpin H1 Proteins 0.000 description 3
- 101000835093 Homo sapiens Transferrin receptor protein 1 Proteins 0.000 description 3
- 101000801088 Homo sapiens Transmembrane protein 201 Proteins 0.000 description 3
- 101000798689 Homo sapiens Transmembrane protein 33 Proteins 0.000 description 3
- 101000840051 Homo sapiens Ubiquitin-60S ribosomal protein L40 Proteins 0.000 description 3
- 101000803527 Homo sapiens Vacuolar ATPase assembly integral membrane protein VMA21 Proteins 0.000 description 3
- 101000782453 Homo sapiens Vacuolar protein sorting-associated protein 18 homolog Proteins 0.000 description 3
- 101000750267 Homo sapiens Vasorin Proteins 0.000 description 3
- 101000864773 Homo sapiens Vesicle transport protein SFT2B Proteins 0.000 description 3
- 101000782485 Homo sapiens Zinc finger protein 460 Proteins 0.000 description 3
- 108091006905 Human Serum Albumin Proteins 0.000 description 3
- 102100021593 Interleukin-7 receptor subunit alpha Human genes 0.000 description 3
- 102100026153 Junction plakoglobin Human genes 0.000 description 3
- 102100026358 Lipoma-preferred partner Human genes 0.000 description 3
- 102100024033 Lysocardiolipin acyltransferase 1 Human genes 0.000 description 3
- 108090001040 Microtubule-associated protein 1B Proteins 0.000 description 3
- 102000004866 Microtubule-associated protein 1B Human genes 0.000 description 3
- 101100108380 Mus musculus Adgre4 gene Proteins 0.000 description 3
- 101100108886 Mus musculus Anln gene Proteins 0.000 description 3
- 101100440246 Mus musculus Ncaph gene Proteins 0.000 description 3
- 101100095906 Mus musculus Slfn9 gene Proteins 0.000 description 3
- 101100483001 Mus musculus Tspan10 gene Proteins 0.000 description 3
- 102100037371 Nidogen-2 Human genes 0.000 description 3
- 102100026498 ORM1-like protein 2 Human genes 0.000 description 3
- 102100023651 Partitioning defective 6 homolog beta Human genes 0.000 description 3
- 108091036407 Polyadenylation Proteins 0.000 description 3
- 102100022739 Polynucleotide 5'-hydroxyl-kinase NOL9 Human genes 0.000 description 3
- 102100038277 Prostaglandin G/H synthase 1 Human genes 0.000 description 3
- 102100028588 Protein ZNRD2 Human genes 0.000 description 3
- 102100032888 Protein lin-7 homolog C Human genes 0.000 description 3
- 102100038095 Protein-glutamine gamma-glutamyltransferase 2 Human genes 0.000 description 3
- 102100034407 Pyridoxine-5'-phosphate oxidase Human genes 0.000 description 3
- 102100039448 Pyrroline-5-carboxylate reductase 3 Human genes 0.000 description 3
- 101150027061 RPS16 gene Proteins 0.000 description 3
- 102100022306 Ras-related protein Rab-3B Human genes 0.000 description 3
- 102100038474 Ras-related protein Rab-3D Human genes 0.000 description 3
- 102100033913 Ribonucleoprotein PTB-binding 1 Human genes 0.000 description 3
- 102000004285 Ribosomal Protein L3 Human genes 0.000 description 3
- 108090000894 Ribosomal Protein L3 Proteins 0.000 description 3
- 108090000986 Ribosomal protein L10 Proteins 0.000 description 3
- 102000013817 Ribosomal protein L13 Human genes 0.000 description 3
- 108050003655 Ribosomal protein L13 Proteins 0.000 description 3
- 108090000983 Ribosomal protein L15 Proteins 0.000 description 3
- 102000003926 Ribosomal protein L18 Human genes 0.000 description 3
- 108090000343 Ribosomal protein L18 Proteins 0.000 description 3
- 108050001924 Ribosomal protein L23 Proteins 0.000 description 3
- 108050009586 Ribosomal protein L28 Proteins 0.000 description 3
- 108090000180 Ribosomal protein L31 Proteins 0.000 description 3
- 102000017528 Ribosomal protein L35 Human genes 0.000 description 3
- 108050005789 Ribosomal protein L35 Proteins 0.000 description 3
- 102000004209 Ribosomal protein L5 Human genes 0.000 description 3
- 108090000776 Ribosomal protein L5 Proteins 0.000 description 3
- 102000004394 Ribosomal protein S10 Human genes 0.000 description 3
- 108090000928 Ribosomal protein S10 Proteins 0.000 description 3
- 102000010983 Ribosomal protein S13 Human genes 0.000 description 3
- 108050001197 Ribosomal protein S13 Proteins 0.000 description 3
- 102000004093 Ribosomal protein S15 Human genes 0.000 description 3
- 108090000530 Ribosomal protein S15 Proteins 0.000 description 3
- 108090000904 Ribosomal protein S2 Proteins 0.000 description 3
- 108091006503 SLC26A1 Proteins 0.000 description 3
- 108091006964 SLC35F6 Proteins 0.000 description 3
- 101100418504 Schizosaccharomyces pombe (strain 972 / ATCC 24843) rps1601 gene Proteins 0.000 description 3
- 102100023161 Seizure 6-like protein 2 Human genes 0.000 description 3
- 102100029726 Serine incorporator 5 Human genes 0.000 description 3
- 102100031462 Serine/threonine-protein kinase PLK2 Human genes 0.000 description 3
- 102100027287 Serpin H1 Human genes 0.000 description 3
- 102100032109 Solute carrier family 35 member F6 Human genes 0.000 description 3
- 102100030100 Sulfate anion transporter 1 Human genes 0.000 description 3
- 230000024932 T cell mediated immunity Effects 0.000 description 3
- 102100034838 Thymidine kinase, cytosolic Human genes 0.000 description 3
- 102100026144 Transferrin receptor protein 1 Human genes 0.000 description 3
- 102100033708 Transmembrane protein 201 Human genes 0.000 description 3
- 102100032461 Transmembrane protein 33 Human genes 0.000 description 3
- 102100023341 Ubiquitin-40S ribosomal protein S27a Human genes 0.000 description 3
- 102100035048 Vacuolar ATPase assembly integral membrane protein VMA21 Human genes 0.000 description 3
- 102100035870 Vacuolar protein sorting-associated protein 18 homolog Human genes 0.000 description 3
- 102100021161 Vasorin Human genes 0.000 description 3
- 102100030062 Vesicle transport protein SFT2B Human genes 0.000 description 3
- 102100035843 Zinc finger protein 460 Human genes 0.000 description 3
- 229960000643 adenine Drugs 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000001580 bacterial effect Effects 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 230000001413 cellular effect Effects 0.000 description 3
- 230000007969 cellular immunity Effects 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 210000001151 cytotoxic T lymphocyte Anatomy 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 239000013604 expression vector Substances 0.000 description 3
- 230000028996 humoral immune response Effects 0.000 description 3
- 230000004727 humoral immunity Effects 0.000 description 3
- 210000002865 immune cell Anatomy 0.000 description 3
- 230000036039 immunity Effects 0.000 description 3
- 230000000977 initiatory effect Effects 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 230000015654 memory Effects 0.000 description 3
- 238000002493 microarray Methods 0.000 description 3
- 210000000822 natural killer cell Anatomy 0.000 description 3
- 239000002777 nucleoside Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000013600 plasmid vector Substances 0.000 description 3
- 108010013519 rat ribosomal protein L8 Proteins 0.000 description 3
- 230000006798 recombination Effects 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 230000009711 regulatory function Effects 0.000 description 3
- 108010025552 ribosomal protein L11 Proteins 0.000 description 3
- 108010025578 ribosomal protein L17 Proteins 0.000 description 3
- 108010019034 ribosomal protein L18a Proteins 0.000 description 3
- 108090000327 ribosomal protein L21 Proteins 0.000 description 3
- 108010025463 ribosomal protein L24 Proteins 0.000 description 3
- 108010025498 ribosomal protein L29 Proteins 0.000 description 3
- 108010025327 ribosomal protein L30 Proteins 0.000 description 3
- 108010025396 ribosomal protein L34 Proteins 0.000 description 3
- 108010025387 ribosomal protein L39 Proteins 0.000 description 3
- 108090000893 ribosomal protein L4 Proteins 0.000 description 3
- 102000004291 ribosomal protein L6 Human genes 0.000 description 3
- 108090000892 ribosomal protein L6 Proteins 0.000 description 3
- 102000004413 ribosomal protein S11 Human genes 0.000 description 3
- 108090000930 ribosomal protein S11 Proteins 0.000 description 3
- 108010092841 ribosomal protein S12 Proteins 0.000 description 3
- 102000004314 ribosomal protein S14 Human genes 0.000 description 3
- 108090000850 ribosomal protein S14 Proteins 0.000 description 3
- 108010088974 ribosomal protein S15a Proteins 0.000 description 3
- 108090000842 ribosomal protein S18 Proteins 0.000 description 3
- 108010093046 ribosomal protein S19 Proteins 0.000 description 3
- 108010092942 ribosomal protein S20 Proteins 0.000 description 3
- 108010092936 ribosomal protein S21 Proteins 0.000 description 3
- 108010093173 ribosomal protein S29 Proteins 0.000 description 3
- 108010033804 ribosomal protein S3 Proteins 0.000 description 3
- 102000004337 ribosomal protein S5 Human genes 0.000 description 3
- 108090000902 ribosomal protein S5 Proteins 0.000 description 3
- 108010033405 ribosomal protein S7 Proteins 0.000 description 3
- 108010033800 ribosomal protein S8 Proteins 0.000 description 3
- 108010067528 ribosomal proteins L27 Proteins 0.000 description 3
- 210000003705 ribosome Anatomy 0.000 description 3
- 101150116648 rpsP gene Proteins 0.000 description 3
- 238000012163 sequencing technique Methods 0.000 description 3
- 238000012289 standard assay Methods 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- 239000003981 vehicle Substances 0.000 description 3
- MZOFCQQQCNRIBI-VMXHOPILSA-N (3s)-4-[[(2s)-1-[[(2s)-1-[[(1s)-1-carboxy-2-hydroxyethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-[[2-[[(2s)-2,6-diaminohexanoyl]amino]acetyl]amino]-4-oxobutanoic acid Chemical compound OC[C@@H](C(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@@H](N)CCCCN MZOFCQQQCNRIBI-VMXHOPILSA-N 0.000 description 2
- GFYLSDSUCHVORB-IOSLPCCCSA-N 1-methyladenosine Chemical compound C1=NC=2C(=N)N(C)C=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O GFYLSDSUCHVORB-IOSLPCCCSA-N 0.000 description 2
- ZLOIGESWDJYCTF-UHFFFAOYSA-N 4-Thiouridine Natural products OC1C(O)C(CO)OC1N1C(=O)NC(=S)C=C1 ZLOIGESWDJYCTF-UHFFFAOYSA-N 0.000 description 2
- ZLOIGESWDJYCTF-XVFCMESISA-N 4-thiouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=S)C=C1 ZLOIGESWDJYCTF-XVFCMESISA-N 0.000 description 2
- 102100032500 40S ribosomal protein S27-like Human genes 0.000 description 2
- 102100028550 40S ribosomal protein S4, Y isoform 1 Human genes 0.000 description 2
- OIVLITBTBDPEFK-UHFFFAOYSA-N 5,6-dihydrouracil Chemical compound O=C1CCNC(=O)N1 OIVLITBTBDPEFK-UHFFFAOYSA-N 0.000 description 2
- AGFIRQJZCNVMCW-UAKXSSHOSA-N 5-bromouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(Br)=C1 AGFIRQJZCNVMCW-UAKXSSHOSA-N 0.000 description 2
- QXDXBKZJFLRLCM-UAKXSSHOSA-N 5-hydroxyuridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(O)=C1 QXDXBKZJFLRLCM-UAKXSSHOSA-N 0.000 description 2
- RYYIULNRIVUMTQ-UHFFFAOYSA-N 6-chloroguanine Chemical compound NC1=NC(Cl)=C2N=CNC2=N1 RYYIULNRIVUMTQ-UHFFFAOYSA-N 0.000 description 2
- 102100040883 60S acidic ribosomal protein P0-like Human genes 0.000 description 2
- 101710134556 60S acidic ribosomal protein P0-like Proteins 0.000 description 2
- 102100027521 60S ribosomal protein L10-like Human genes 0.000 description 2
- 102100022289 60S ribosomal protein L13a Human genes 0.000 description 2
- 102100031854 60S ribosomal protein L14 Human genes 0.000 description 2
- 102100038008 60S ribosomal protein L22-like 1 Human genes 0.000 description 2
- 102100028439 60S ribosomal protein L26-like 1 Human genes 0.000 description 2
- 102100022104 60S ribosomal protein L3-like Human genes 0.000 description 2
- 102100022048 60S ribosomal protein L36 Human genes 0.000 description 2
- 102100036126 60S ribosomal protein L37a Human genes 0.000 description 2
- 102100040587 60S ribosomal protein L39-like Human genes 0.000 description 2
- 102100022575 60S ribosomal protein L7-like 1 Human genes 0.000 description 2
- 101150095491 AACS gene Proteins 0.000 description 2
- 101150034941 AURKB gene Proteins 0.000 description 2
- 208000035657 Abasia Diseases 0.000 description 2
- 108010085238 Actins Proteins 0.000 description 2
- 102000007469 Actins Human genes 0.000 description 2
- 102100033647 Activity-regulated cytoskeleton-associated protein Human genes 0.000 description 2
- 102000009027 Albumins Human genes 0.000 description 2
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 2
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 2
- 108010083359 Antigen Receptors Proteins 0.000 description 2
- 241000219194 Arabidopsis Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 102100030401 Biglycan Human genes 0.000 description 2
- 101150025841 CCND1 gene Proteins 0.000 description 2
- 101150017285 CSPG4 gene Proteins 0.000 description 2
- 101150066398 CXCR4 gene Proteins 0.000 description 2
- 101150079049 Ccnd2 gene Proteins 0.000 description 2
- 108010035532 Collagen Proteins 0.000 description 2
- 102000008186 Collagen Human genes 0.000 description 2
- 108020004635 Complementary DNA Proteins 0.000 description 2
- 101001046554 Dictyostelium discoideum Thymidine kinase 1 Proteins 0.000 description 2
- 101150090723 Dpysl2 gene Proteins 0.000 description 2
- 101100346152 Drosophila melanogaster modSP gene Proteins 0.000 description 2
- 102000004533 Endonucleases Human genes 0.000 description 2
- 108010042407 Endonucleases Proteins 0.000 description 2
- 101150003888 FASN gene Proteins 0.000 description 2
- 101150040219 Fads3 gene Proteins 0.000 description 2
- 108090000652 Flap endonucleases Proteins 0.000 description 2
- 102000004150 Flap endonucleases Human genes 0.000 description 2
- 101150085536 GJA1 gene Proteins 0.000 description 2
- 101150096417 Hmgcs1 gene Proteins 0.000 description 2
- 101000731896 Homo sapiens 40S ribosomal protein S27-like Proteins 0.000 description 2
- 101000696103 Homo sapiens 40S ribosomal protein S4, Y isoform 1 Proteins 0.000 description 2
- 101000656896 Homo sapiens 40S ribosomal protein S6 Proteins 0.000 description 2
- 101000724931 Homo sapiens 60S ribosomal protein L10-like Proteins 0.000 description 2
- 101000681240 Homo sapiens 60S ribosomal protein L13a Proteins 0.000 description 2
- 101000704267 Homo sapiens 60S ribosomal protein L14 Proteins 0.000 description 2
- 101000661567 Homo sapiens 60S ribosomal protein L22-like 1 Proteins 0.000 description 2
- 101001080152 Homo sapiens 60S ribosomal protein L26-like 1 Proteins 0.000 description 2
- 101001110361 Homo sapiens 60S ribosomal protein L3-like Proteins 0.000 description 2
- 101001092424 Homo sapiens 60S ribosomal protein L37a Proteins 0.000 description 2
- 101000674088 Homo sapiens 60S ribosomal protein L39-like Proteins 0.000 description 2
- 101001109962 Homo sapiens 60S ribosomal protein L7-like 1 Proteins 0.000 description 2
- 101001126865 Homo sapiens Biglycan Proteins 0.000 description 2
- 101000899111 Homo sapiens Hemoglobin subunit beta Proteins 0.000 description 2
- 101000691574 Homo sapiens Junction plakoglobin Proteins 0.000 description 2
- 101000598781 Homo sapiens Oxidative stress-responsive serine-rich protein 1 Proteins 0.000 description 2
- 101000645850 Homo sapiens Putative 40S ribosomal protein S10-like Proteins 0.000 description 2
- 101000623058 Homo sapiens Putative 40S ribosomal protein S26-like 1 Proteins 0.000 description 2
- 101001083960 Homo sapiens Putative 60S ribosomal protein L37a-like protein Proteins 0.000 description 2
- 101000743760 Homo sapiens Putative 60S ribosomal protein L39-like 5 Proteins 0.000 description 2
- 101000945477 Homo sapiens Thymidine kinase, cytosolic Proteins 0.000 description 2
- 101000763579 Homo sapiens Toll-like receptor 1 Proteins 0.000 description 2
- 101000763537 Homo sapiens Toll-like receptor 10 Proteins 0.000 description 2
- 101000831567 Homo sapiens Toll-like receptor 2 Proteins 0.000 description 2
- 101000831496 Homo sapiens Toll-like receptor 3 Proteins 0.000 description 2
- 101000669447 Homo sapiens Toll-like receptor 4 Proteins 0.000 description 2
- 101000669460 Homo sapiens Toll-like receptor 5 Proteins 0.000 description 2
- 101000669406 Homo sapiens Toll-like receptor 6 Proteins 0.000 description 2
- 101000669402 Homo sapiens Toll-like receptor 7 Proteins 0.000 description 2
- 101000800483 Homo sapiens Toll-like receptor 8 Proteins 0.000 description 2
- 101150047915 Igf2bp1 gene Proteins 0.000 description 2
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 description 2
- 102100037852 Insulin-like growth factor I Human genes 0.000 description 2
- 102100030703 Interleukin-22 Human genes 0.000 description 2
- 102000015696 Interleukins Human genes 0.000 description 2
- 108010063738 Interleukins Proteins 0.000 description 2
- 108091092195 Intron Proteins 0.000 description 2
- 101150059274 Itga7 gene Proteins 0.000 description 2
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 2
- 101150013552 LDLR gene Proteins 0.000 description 2
- 101150059675 LMNB1 gene Proteins 0.000 description 2
- 108090000128 Lipoxygenases Proteins 0.000 description 2
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 241001529936 Murinae Species 0.000 description 2
- 101100107555 Mus musculus Aarsd1 gene Proteins 0.000 description 2
- 101100268916 Mus musculus Acox2 gene Proteins 0.000 description 2
- 101100490860 Mus musculus Alkbh7 gene Proteins 0.000 description 2
- 101100270477 Mus musculus Armc6 gene Proteins 0.000 description 2
- 101100164615 Mus musculus Atp5f1d gene Proteins 0.000 description 2
- 101100218972 Mus musculus Cdca8 gene Proteins 0.000 description 2
- 101001032338 Mus musculus Cis-aconitate decarboxylase Proteins 0.000 description 2
- 101100274905 Mus musculus Comtd1 gene Proteins 0.000 description 2
- 101100330325 Mus musculus Cstb gene Proteins 0.000 description 2
- 101100113081 Mus musculus Cth gene Proteins 0.000 description 2
- 101000950959 Mus musculus DNA fragmentation factor subunit beta Proteins 0.000 description 2
- 101100388568 Mus musculus Ebp gene Proteins 0.000 description 2
- 101100449408 Mus musculus Gpr84 gene Proteins 0.000 description 2
- 101100453902 Mus musculus Kif22 gene Proteins 0.000 description 2
- 101100181026 Mus musculus Kif2c gene Proteins 0.000 description 2
- 101100472489 Mus musculus Mrpl34 gene Proteins 0.000 description 2
- 101100349562 Mus musculus Nudt22 gene Proteins 0.000 description 2
- 101100519194 Mus musculus Pcyox1l gene Proteins 0.000 description 2
- 101100329712 Mus musculus Slc7a3 gene Proteins 0.000 description 2
- 101000616194 Mus musculus Splicing factor 3B subunit 5 Proteins 0.000 description 2
- 101100481579 Mus musculus Tlr11 gene Proteins 0.000 description 2
- 101100481580 Mus musculus Tlr12 gene Proteins 0.000 description 2
- 101100059392 Mus musculus Tmem37 gene Proteins 0.000 description 2
- 101100370128 Mus musculus Tpgs1 gene Proteins 0.000 description 2
- 101100315769 Mus musculus Ubc gene Proteins 0.000 description 2
- 102100031789 Myeloid-derived growth factor Human genes 0.000 description 2
- 101150074334 NOSIP gene Proteins 0.000 description 2
- 101100102675 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) vma-21 gene Proteins 0.000 description 2
- 102100037780 Oxidative stress-responsive serine-rich protein 1 Human genes 0.000 description 2
- 101150080739 PRPS2 gene Proteins 0.000 description 2
- 102000007079 Peptide Fragments Human genes 0.000 description 2
- 108010033276 Peptide Fragments Proteins 0.000 description 2
- 206010057249 Phagocytosis Diseases 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 241000288906 Primates Species 0.000 description 2
- 102100025572 Putative 40S ribosomal protein S10-like Human genes 0.000 description 2
- 102100023687 Putative 40S ribosomal protein S26-like 1 Human genes 0.000 description 2
- 102100030930 Putative 60S ribosomal protein L37a-like protein Human genes 0.000 description 2
- 102100038391 Putative 60S ribosomal protein L39-like 5 Human genes 0.000 description 2
- 108091081021 Sense strand Proteins 0.000 description 2
- 101150024531 Slc7a1 gene Proteins 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 102100024990 Tetraspanin-10 Human genes 0.000 description 2
- 108010060818 Toll-Like Receptor 9 Proteins 0.000 description 2
- 102100027010 Toll-like receptor 1 Human genes 0.000 description 2
- 102100027009 Toll-like receptor 10 Human genes 0.000 description 2
- 102100024333 Toll-like receptor 2 Human genes 0.000 description 2
- 102100024324 Toll-like receptor 3 Human genes 0.000 description 2
- 102100039360 Toll-like receptor 4 Human genes 0.000 description 2
- 102100039357 Toll-like receptor 5 Human genes 0.000 description 2
- 102100039387 Toll-like receptor 6 Human genes 0.000 description 2
- 102100039390 Toll-like receptor 7 Human genes 0.000 description 2
- 102100033110 Toll-like receptor 8 Human genes 0.000 description 2
- 102100033117 Toll-like receptor 9 Human genes 0.000 description 2
- 108091023040 Transcription factor Proteins 0.000 description 2
- 102000040945 Transcription factor Human genes 0.000 description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 2
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 2
- 108091000117 Tyrosine 3-Monooxygenase Proteins 0.000 description 2
- 101150021191 UHRF1 gene Proteins 0.000 description 2
- 108020005202 Viral DNA Proteins 0.000 description 2
- 108020000999 Viral RNA Proteins 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- 101100108887 Xenopus laevis anln gene Proteins 0.000 description 2
- 101100440248 Xenopus laevis ncaph gene Proteins 0.000 description 2
- YIJVOACVHQZMKI-JXOAFFINSA-N [[(2r,3s,4r,5r)-5-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O=C1N=C(N)C(C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 YIJVOACVHQZMKI-JXOAFFINSA-N 0.000 description 2
- VEWJOCYCKIZKKV-GBNDHIKLSA-N [[(2r,3s,4r,5s)-5-(2,4-dioxo-1h-pyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1C1=CNC(=O)NC1=O VEWJOCYCKIZKKV-GBNDHIKLSA-N 0.000 description 2
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 108010029483 alpha 1 Chain Collagen Type I Proteins 0.000 description 2
- 101150111716 ankrd1 gene Proteins 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 230000003172 anti-dna Effects 0.000 description 2
- 210000000612 antigen-presenting cell Anatomy 0.000 description 2
- 125000001769 aryl amino group Chemical group 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- 229920001436 collagen Polymers 0.000 description 2
- 230000009089 cytolysis Effects 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 125000004986 diarylamino group Chemical group 0.000 description 2
- 230000029087 digestion Effects 0.000 description 2
- 125000005240 diheteroarylamino group Chemical group 0.000 description 2
- ZPTBLXKRQACLCR-XVFCMESISA-N dihydrouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)CC1 ZPTBLXKRQACLCR-XVFCMESISA-N 0.000 description 2
- NAGJZTKCGNOGPW-UHFFFAOYSA-K dioxido-sulfanylidene-sulfido-$l^{5}-phosphane Chemical compound [O-]P([O-])([S-])=S NAGJZTKCGNOGPW-UHFFFAOYSA-K 0.000 description 2
- 210000003162 effector t lymphocyte Anatomy 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 125000005241 heteroarylamino group Chemical group 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 102000047807 human RPL36AL Human genes 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 230000005847 immunogenicity Effects 0.000 description 2
- 230000016784 immunoglobulin production Effects 0.000 description 2
- 230000001771 impaired effect Effects 0.000 description 2
- 230000001976 improved effect Effects 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 229940047122 interleukins Drugs 0.000 description 2
- 230000003834 intracellular effect Effects 0.000 description 2
- 230000002427 irreversible effect Effects 0.000 description 2
- 210000003563 lymphoid tissue Anatomy 0.000 description 2
- 239000006166 lysate Substances 0.000 description 2
- 210000003470 mitochondria Anatomy 0.000 description 2
- 150000003833 nucleoside derivatives Chemical class 0.000 description 2
- 238000005457 optimization Methods 0.000 description 2
- 230000008520 organization Effects 0.000 description 2
- 230000008782 phagocytosis Effects 0.000 description 2
- PTMHPRAIXMAOOB-UHFFFAOYSA-N phosphoramidic acid Chemical compound NP(O)(O)=O PTMHPRAIXMAOOB-UHFFFAOYSA-N 0.000 description 2
- 230000004962 physiological condition Effects 0.000 description 2
- 108010056274 polo-like kinase 1 Proteins 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 230000001124 posttranscriptional effect Effects 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- 239000003531 protein hydrolysate Substances 0.000 description 2
- RXWNCPJZOCPEPQ-NVWDDTSBSA-N puromycin Chemical compound C1=CC(OC)=CC=C1C[C@H](N)C(=O)N[C@H]1[C@@H](O)[C@H](N2C3=NC=NC(=C3N=C2)N(C)C)O[C@@H]1CO RXWNCPJZOCPEPQ-NVWDDTSBSA-N 0.000 description 2
- 238000004445 quantitative analysis Methods 0.000 description 2
- 238000003753 real-time PCR Methods 0.000 description 2
- 238000005215 recombination Methods 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 108010011179 ribosomal protein S27a Proteins 0.000 description 2
- 238000011895 specific detection Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 2
- RWQNBRDOKXIBIV-UHFFFAOYSA-N thymine Chemical compound CC1=CNC(=O)NC1=O RWQNBRDOKXIBIV-UHFFFAOYSA-N 0.000 description 2
- 108091006107 transcriptional repressors Proteins 0.000 description 2
- 230000001052 transient effect Effects 0.000 description 2
- BIXYYZIIJIXVFW-UUOKFMHZSA-N (2R,3R,4S,5R)-2-(6-amino-2-chloro-9-purinyl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O BIXYYZIIJIXVFW-UUOKFMHZSA-N 0.000 description 1
- JLWUWXCKSOIFPS-KQYNXXCUSA-N (2r,3r,4r,5r)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol Chemical compound CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC(N)=NC(N)=C2N=C1 JLWUWXCKSOIFPS-KQYNXXCUSA-N 0.000 description 1
- ZGYYPTJWJBEXBC-QYYRPYCUSA-N (2r,3r,4r,5r)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1F ZGYYPTJWJBEXBC-QYYRPYCUSA-N 0.000 description 1
- JVOJULURLCZUDE-JXOAFFINSA-N (2r,3r,4s,5r)-2-(2-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C12=NC(N)=NC=C2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O JVOJULURLCZUDE-JXOAFFINSA-N 0.000 description 1
- XHRJGHCQQPETRH-KQYNXXCUSA-N (2r,3r,4s,5r)-2-(6-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(Cl)=C2N=C1 XHRJGHCQQPETRH-KQYNXXCUSA-N 0.000 description 1
- CQKMBZHLOYVGHW-QYYRPYCUSA-N (2r,3s,4r,5r)-4-amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol Chemical compound N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(N)=C2N=C1 CQKMBZHLOYVGHW-QYYRPYCUSA-N 0.000 description 1
- IFVJLCHSLGMHEY-QYYRPYCUSA-N (2r,3s,4r,5r)-5-(6-aminopurin-9-yl)-4-azido-2-(hydroxymethyl)oxolan-3-ol Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1N=[N+]=[N-] IFVJLCHSLGMHEY-QYYRPYCUSA-N 0.000 description 1
- MPCAJMNYNOGXPB-UHFFFAOYSA-N 1,5-anhydrohexitol Chemical class OCC1OCC(O)C(O)C1O MPCAJMNYNOGXPB-UHFFFAOYSA-N 0.000 description 1
- UIYWFOZZIZEEKJ-XVFCMESISA-N 1-[(2r,3r,4r,5r)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound F[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 UIYWFOZZIZEEKJ-XVFCMESISA-N 0.000 description 1
- KYEKLQMDNZPEFU-KVTDHHQDSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)N=C1 KYEKLQMDNZPEFU-KVTDHHQDSA-N 0.000 description 1
- UTQUILVPBZEHTK-ZOQUXTDFSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpyrimidine-2,4-dione Chemical compound O=C1N(C)C(=O)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 UTQUILVPBZEHTK-ZOQUXTDFSA-N 0.000 description 1
- QCWBIPKYTBFWHH-FDDDBJFASA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-ethynylpyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(C#C)=C1 QCWBIPKYTBFWHH-FDDDBJFASA-N 0.000 description 1
- RKSLVDIXBGWPIS-UAKXSSHOSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 RKSLVDIXBGWPIS-UAKXSSHOSA-N 0.000 description 1
- QLOCVMVCRJOTTM-TURQNECASA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-prop-1-ynylpyrimidine-2,4-dione Chemical compound O=C1NC(=O)C(C#CC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 QLOCVMVCRJOTTM-TURQNECASA-N 0.000 description 1
- LLIPTMWIZVIUSX-XVFCMESISA-N 1-[(2r,3r,4s,5r)-3-amino-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 LLIPTMWIZVIUSX-XVFCMESISA-N 0.000 description 1
- MRUKYOQQKHNMFI-XVFCMESISA-N 1-[(2r,3r,4s,5r)-3-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound [N-]=[N+]=N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 MRUKYOQQKHNMFI-XVFCMESISA-N 0.000 description 1
- GRJDAVSXJPWJNJ-RCYBNZJXSA-N 1-[(2r,3r,4s,5s)-5-[bromo(hydroxy)methyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](C(Br)O)O[C@H]1N1C(=O)NC(=O)C=C1 GRJDAVSXJPWJNJ-RCYBNZJXSA-N 0.000 description 1
- GBBJCSTXCAQSSJ-JVZYCSMKSA-N 1-[(2r,3s,4r,5r)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione Chemical compound O=C1NC(=O)C(C)=CN1[C@H]1[C@@H](F)[C@H](O)[C@@H](CO)O1 GBBJCSTXCAQSSJ-JVZYCSMKSA-N 0.000 description 1
- UTAIYTHAJQNQDW-KQYNXXCUSA-N 1-methylguanosine Chemical compound C1=NC=2C(=O)N(C)C(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O UTAIYTHAJQNQDW-KQYNXXCUSA-N 0.000 description 1
- WJNGQIYEQLPJMN-IOSLPCCCSA-N 1-methylinosine Chemical compound C1=NC=2C(=O)N(C)C=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O WJNGQIYEQLPJMN-IOSLPCCCSA-N 0.000 description 1
- UVBYMVOUBXYSFV-XUTVFYLZSA-N 1-methylpseudouridine Chemical compound O=C1NC(=O)N(C)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 UVBYMVOUBXYSFV-XUTVFYLZSA-N 0.000 description 1
- UVBYMVOUBXYSFV-UHFFFAOYSA-N 1-methylpseudouridine Natural products O=C1NC(=O)N(C)C=C1C1C(O)C(O)C(CO)O1 UVBYMVOUBXYSFV-UHFFFAOYSA-N 0.000 description 1
- CQKMBZHLOYVGHW-UHFFFAOYSA-N 10407-64-4 Natural products NC1C(O)C(CO)OC1N1C2=NC=NC(N)=C2N=C1 CQKMBZHLOYVGHW-UHFFFAOYSA-N 0.000 description 1
- YHRRPHCORALGKQ-FDDDBJFASA-N 2'-O-methyl-5-methyluridine Chemical compound CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(C)=C1 YHRRPHCORALGKQ-FDDDBJFASA-N 0.000 description 1
- HPHXOIULGYVAKW-IOSLPCCCSA-N 2'-O-methylinosine Chemical compound CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(N=CNC2=O)=C2N=C1 HPHXOIULGYVAKW-IOSLPCCCSA-N 0.000 description 1
- HPHXOIULGYVAKW-UHFFFAOYSA-N 2'-O-methylinosine Natural products COC1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 HPHXOIULGYVAKW-UHFFFAOYSA-N 0.000 description 1
- WGNUTGFETAXDTJ-OOJXKGFFSA-N 2'-O-methylpseudouridine Chemical compound CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=CNC(=O)NC1=O WGNUTGFETAXDTJ-OOJXKGFFSA-N 0.000 description 1
- ROPTVRLUGSPXNH-UHFFFAOYSA-N 2'-amino-2'-deoxy-guanosine Natural products NC1C(O)C(CO)OC1N1C(NC(N)=NC2=O)=C2N=C1 ROPTVRLUGSPXNH-UHFFFAOYSA-N 0.000 description 1
- KHWCHTKSEGGWEX-RRKCRQDMSA-N 2'-deoxyadenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@H]1C[C@H](O)[C@@H](COP(O)(O)=O)O1 KHWCHTKSEGGWEX-RRKCRQDMSA-N 0.000 description 1
- NCMVOABPESMRCP-SHYZEUOFSA-N 2'-deoxycytosine 5'-monophosphate Chemical compound O=C1N=C(N)C=CN1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)C1 NCMVOABPESMRCP-SHYZEUOFSA-N 0.000 description 1
- YKBGVTZYEHREMT-KVQBGUIXSA-N 2'-deoxyguanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 YKBGVTZYEHREMT-KVQBGUIXSA-N 0.000 description 1
- YKBGVTZYEHREMT-UHFFFAOYSA-N 2'-deoxyguanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1CC(O)C(CO)O1 YKBGVTZYEHREMT-UHFFFAOYSA-N 0.000 description 1
- LTFMZDNNPPEQNG-KVQBGUIXSA-N 2'-deoxyguanosine 5'-monophosphate Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@H]1C[C@H](O)[C@@H](COP(O)(O)=O)O1 LTFMZDNNPPEQNG-KVQBGUIXSA-N 0.000 description 1
- HLYBTPMYFWWNJN-UHFFFAOYSA-N 2-(2,4-dioxo-1h-pyrimidin-5-yl)-2-hydroxyacetic acid Chemical compound OC(=O)C(O)C1=CNC(=O)NC1=O HLYBTPMYFWWNJN-UHFFFAOYSA-N 0.000 description 1
- IQZWKGWOBPJWMX-UHFFFAOYSA-N 2-Methyladenosine Natural products C12=NC(C)=NC(N)=C2N=CN1C1OC(CO)C(O)C1O IQZWKGWOBPJWMX-UHFFFAOYSA-N 0.000 description 1
- BVLGKOVALHRKNM-XUTVFYLZSA-N 2-Thio-1-methylpseudouridine Chemical compound CN1C=C(C(=O)NC1=S)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O BVLGKOVALHRKNM-XUTVFYLZSA-N 0.000 description 1
- CWXIOHYALLRNSZ-JWMKEVCDSA-N 2-Thiodihydropseudouridine Chemical compound C1C(C(=O)NC(=S)N1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O CWXIOHYALLRNSZ-JWMKEVCDSA-N 0.000 description 1
- SVBOROZXXYRWJL-UHFFFAOYSA-N 2-[(4-oxo-2-sulfanylidene-1h-pyrimidin-5-yl)methylamino]acetic acid Chemical compound OC(=O)CNCC1=CNC(=S)NC1=O SVBOROZXXYRWJL-UHFFFAOYSA-N 0.000 description 1
- NUBJGTNGKODGGX-YYNOVJQHSA-N 2-[5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-1-yl]acetic acid Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=CN(CC(O)=O)C(=O)NC1=O NUBJGTNGKODGGX-YYNOVJQHSA-N 0.000 description 1
- VJKJOPUEUOTEBX-TURQNECASA-N 2-[[1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methylamino]ethanesulfonic acid Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(CNCCS(O)(=O)=O)=C1 VJKJOPUEUOTEBX-TURQNECASA-N 0.000 description 1
- LCKIHCRZXREOJU-KYXWUPHJSA-N 2-[[5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-1-yl]methylamino]ethanesulfonic acid Chemical compound C(NCCS(=O)(=O)O)N1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O LCKIHCRZXREOJU-KYXWUPHJSA-N 0.000 description 1
- OTDJAMXESTUWLO-UUOKFMHZSA-N 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-oxolanyl]-3H-purine-6-thione Chemical compound C12=NC(N)=NC(S)=C2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OTDJAMXESTUWLO-UUOKFMHZSA-N 0.000 description 1
- UXUZARPLRQRNNX-DXTOWSMRSA-N 2-amino-9-[(2r,3r,4r,5r)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1F UXUZARPLRQRNNX-DXTOWSMRSA-N 0.000 description 1
- KZELNMSPWPFAEB-UMMCILCDSA-N 2-amino-9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-sulfanylidene-3,7-dihydropurin-6-one Chemical compound C1=2NC(N)=NC(=O)C=2NC(=S)N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O KZELNMSPWPFAEB-UMMCILCDSA-N 0.000 description 1
- ROPTVRLUGSPXNH-DXTOWSMRSA-N 2-amino-9-[(2r,3r,4s,5r)-3-amino-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purin-6-one Chemical compound N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(NC(N)=NC2=O)=C2N=C1 ROPTVRLUGSPXNH-DXTOWSMRSA-N 0.000 description 1
- PHGQZPFEHQOLJM-DXTOWSMRSA-N 2-amino-9-[(2r,3r,4s,5r)-3-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purin-6-one Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1N=[N+]=[N-] PHGQZPFEHQOLJM-DXTOWSMRSA-N 0.000 description 1
- ASJSAQIRZKANQN-CRCLSJGQSA-N 2-deoxy-D-ribose Chemical compound OC[C@@H](O)[C@@H](O)CC=O ASJSAQIRZKANQN-CRCLSJGQSA-N 0.000 description 1
- ASJSAQIRZKANQN-UHFFFAOYSA-N 2-deoxypentose Chemical compound OCC(O)C(O)CC=O ASJSAQIRZKANQN-UHFFFAOYSA-N 0.000 description 1
- IQZWKGWOBPJWMX-IOSLPCCCSA-N 2-methyladenosine Chemical compound C12=NC(C)=NC(N)=C2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O IQZWKGWOBPJWMX-IOSLPCCCSA-N 0.000 description 1
- JUMHLCXWYQVTLL-KVTDHHQDSA-N 2-thio-5-aza-uridine Chemical compound [C@@H]1([C@H](O)[C@H](O)[C@@H](CO)O1)N1C(=S)NC(=O)N=C1 JUMHLCXWYQVTLL-KVTDHHQDSA-N 0.000 description 1
- VRVXMIJPUBNPGH-XVFCMESISA-N 2-thio-dihydrouridine Chemical compound OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1CCC(=O)NC1=S VRVXMIJPUBNPGH-XVFCMESISA-N 0.000 description 1
- GJTBSTBJLVYKAU-XVFCMESISA-N 2-thiouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=S)NC(=O)C=C1 GJTBSTBJLVYKAU-XVFCMESISA-N 0.000 description 1
- UTQUILVPBZEHTK-UHFFFAOYSA-N 3-Methyluridine Natural products O=C1N(C)C(=O)C=CN1C1C(O)C(O)C(CO)O1 UTQUILVPBZEHTK-UHFFFAOYSA-N 0.000 description 1
- KOLPWZCZXAMXKS-UHFFFAOYSA-N 3-methylcytosine Chemical compound CN1C(N)=CC=NC1=O KOLPWZCZXAMXKS-UHFFFAOYSA-N 0.000 description 1
- 101150007523 32 gene Proteins 0.000 description 1
- VTGBLFNEDHVUQA-XUTVFYLZSA-N 4-Thio-1-methyl-pseudouridine Chemical compound S=C1NC(=O)N(C)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 VTGBLFNEDHVUQA-XUTVFYLZSA-N 0.000 description 1
- GJAKJCICANKRFD-UHFFFAOYSA-N 4-acetyl-4-amino-1,3-dihydropyrimidin-2-one Chemical compound CC(=O)C1(N)NC(=O)NC=C1 GJAKJCICANKRFD-UHFFFAOYSA-N 0.000 description 1
- NVZFZMCNALTPBY-XVFCMESISA-N 4-amino-1-[(2r,3r,4r,5r)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](F)[C@H](O)[C@@H](CO)O1 NVZFZMCNALTPBY-XVFCMESISA-N 0.000 description 1
- FECRKKQKJNKYNF-XVFCMESISA-N 4-amino-1-[(2r,3r,4s,5r)-3-amino-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Chemical compound N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)N=C(N)C=C1 FECRKKQKJNKYNF-XVFCMESISA-N 0.000 description 1
- FEOYKPQEERVCAV-XVFCMESISA-N 4-amino-1-[(2r,3r,4s,5r)-3-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](N=[N+]=[N-])[C@H](O)[C@@H](CO)O1 FEOYKPQEERVCAV-XVFCMESISA-N 0.000 description 1
- LZINOQJQXIEBNN-UHFFFAOYSA-N 4-hydroxybutyl dihydrogen phosphate Chemical compound OCCCCOP(O)(O)=O LZINOQJQXIEBNN-UHFFFAOYSA-N 0.000 description 1
- GCNTZFIIOFTKIY-UHFFFAOYSA-N 4-hydroxypyridine Chemical group OC1=CC=NC=C1 GCNTZFIIOFTKIY-UHFFFAOYSA-N 0.000 description 1
- FAWQJBLSWXIJLA-VPCXQMTMSA-N 5-(carboxymethyl)uridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(CC(O)=O)=C1 FAWQJBLSWXIJLA-VPCXQMTMSA-N 0.000 description 1
- DDHOXEOVAJVODV-GBNDHIKLSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidene-1h-pyrimidin-4-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=CNC(=S)NC1=O DDHOXEOVAJVODV-GBNDHIKLSA-N 0.000 description 1
- BNAWMJKJLNJZFU-GBNDHIKLSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidene-1h-pyrimidin-2-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=CNC(=O)NC1=S BNAWMJKJLNJZFU-GBNDHIKLSA-N 0.000 description 1
- OZQDLJNDRVBCST-SHUUEZRQSA-N 5-amino-2-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazin-3-one Chemical compound O=C1N=C(N)C=NN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 OZQDLJNDRVBCST-SHUUEZRQSA-N 0.000 description 1
- IWFHOSULCAJGRM-UAKXSSHOSA-N 5-bromouridine 5'-triphosphate Chemical compound O1[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@@H](O)[C@@H]1N1C(=O)NC(=O)C(Br)=C1 IWFHOSULCAJGRM-UAKXSSHOSA-N 0.000 description 1
- FHIDNBAQOFJWCA-UAKXSSHOSA-N 5-fluorouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(F)=C1 FHIDNBAQOFJWCA-UAKXSSHOSA-N 0.000 description 1
- OOMLBPVHGFQCCL-RRKCRQDMSA-N 5-iododeoxycytidine triphosphate Chemical compound C1=C(I)C(N)=NC(=O)N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)C1 OOMLBPVHGFQCCL-RRKCRQDMSA-N 0.000 description 1
- YIZYCHKPHCPKHZ-PNHWDRBUSA-N 5-methoxycarbonylmethyluridine Chemical compound O=C1NC(=O)C(CC(=O)OC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 YIZYCHKPHCPKHZ-PNHWDRBUSA-N 0.000 description 1
- ZXIATBNUWJBBGT-JXOAFFINSA-N 5-methoxyuridine Chemical compound O=C1NC(=O)C(OC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 ZXIATBNUWJBBGT-JXOAFFINSA-N 0.000 description 1
- SNNBPMAXGYBMHM-JXOAFFINSA-N 5-methyl-2-thiouridine Chemical compound S=C1NC(=O)C(C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 SNNBPMAXGYBMHM-JXOAFFINSA-N 0.000 description 1
- USVMJSALORZVDV-UHFFFAOYSA-N 6-(gamma,gamma-dimethylallylamino)purine riboside Natural products C1=NC=2C(NCC=C(C)C)=NC=NC=2N1C1OC(CO)C(O)C1O USVMJSALORZVDV-UHFFFAOYSA-N 0.000 description 1
- ZKBQDFAWXLTYKS-UHFFFAOYSA-N 6-Chloro-1H-purine Chemical compound ClC1=NC=NC2=C1NC=N2 ZKBQDFAWXLTYKS-UHFFFAOYSA-N 0.000 description 1
- DCPSTSVLRXOYGS-UHFFFAOYSA-N 6-amino-1h-pyrimidine-2-thione Chemical compound NC1=CC=NC(S)=N1 DCPSTSVLRXOYGS-UHFFFAOYSA-N 0.000 description 1
- XYVLZAYJHCECPN-UHFFFAOYSA-L 6-aminohexyl phosphate Chemical compound NCCCCCCOP([O-])([O-])=O XYVLZAYJHCECPN-UHFFFAOYSA-L 0.000 description 1
- WYXSYVWAUAUWLD-SHUUEZRQSA-N 6-azauridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=N1 WYXSYVWAUAUWLD-SHUUEZRQSA-N 0.000 description 1
- ZDRFDHHANOYUTE-IOSLPCCCSA-N 6-methylthioinosine Chemical compound C1=NC=2C(SC)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O ZDRFDHHANOYUTE-IOSLPCCCSA-N 0.000 description 1
- 102100022406 60S ribosomal protein L10a Human genes 0.000 description 1
- 102100022276 60S ribosomal protein L35a Human genes 0.000 description 1
- 101710187872 60S ribosomal protein L36 Proteins 0.000 description 1
- 102100040131 60S ribosomal protein L37 Human genes 0.000 description 1
- OGHAROSJZRTIOK-KQYNXXCUSA-O 7-methylguanosine Chemical compound C1=2N=C(N)NC(=O)C=2[N+](C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OGHAROSJZRTIOK-KQYNXXCUSA-O 0.000 description 1
- SYPRQIWERSQQNL-KQYNXXCUSA-O 7-methylxanthosine Chemical compound C1=2NC(=O)NC(=O)C=2[N+](C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O SYPRQIWERSQQNL-KQYNXXCUSA-O 0.000 description 1
- OAUKGFJQZRGECT-UUOKFMHZSA-N 8-Azaadenosine Chemical compound N1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OAUKGFJQZRGECT-UUOKFMHZSA-N 0.000 description 1
- VJUPMOPLUQHMLE-UUOKFMHZSA-N 8-Bromoadenosine Chemical compound BrC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O VJUPMOPLUQHMLE-UUOKFMHZSA-N 0.000 description 1
- ASUCSHXLTWZYBA-UMMCILCDSA-N 8-Bromoguanosine Chemical compound C1=2NC(N)=NC(=O)C=2N=C(Br)N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O ASUCSHXLTWZYBA-UMMCILCDSA-N 0.000 description 1
- HCAJQHYUCKICQH-VPENINKCSA-N 8-Oxo-7,8-dihydro-2'-deoxyguanosine Chemical compound C1=2NC(N)=NC(=O)C=2NC(=O)N1[C@H]1C[C@H](O)[C@@H](CO)O1 HCAJQHYUCKICQH-VPENINKCSA-N 0.000 description 1
- MSSXOMSJDRHRMC-UHFFFAOYSA-N 9H-purine-2,6-diamine Chemical compound NC1=NC(N)=C2NC=NC2=N1 MSSXOMSJDRHRMC-UHFFFAOYSA-N 0.000 description 1
- 102100023587 ATP synthase F(0) complex subunit C2, mitochondrial Human genes 0.000 description 1
- 206010069754 Acquired gene mutation Diseases 0.000 description 1
- 102000006306 Antigen Receptors Human genes 0.000 description 1
- 102100024003 Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Human genes 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 101150013553 CD40 gene Proteins 0.000 description 1
- 102000019034 Chemokines Human genes 0.000 description 1
- 108010012236 Chemokines Proteins 0.000 description 1
- 241000251556 Chordata Species 0.000 description 1
- 206010008805 Chromosomal abnormalities Diseases 0.000 description 1
- 208000031404 Chromosome Aberrations Diseases 0.000 description 1
- 108010081236 Cleavage Stimulation Factor Proteins 0.000 description 1
- 102000005221 Cleavage Stimulation Factor Human genes 0.000 description 1
- UDMBCSSLTHHNCD-UHFFFAOYSA-N Coenzym Q(11) Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(O)=O)C(O)C1O UDMBCSSLTHHNCD-UHFFFAOYSA-N 0.000 description 1
- 102100035431 Complement factor I Human genes 0.000 description 1
- PCDQPRRSZKQHHS-UHFFFAOYSA-N Cytidine 5'-triphosphate Natural products O=C1N=C(N)C=CN1C1C(O)C(O)C(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 PCDQPRRSZKQHHS-UHFFFAOYSA-N 0.000 description 1
- 102100027896 Cytochrome b-c1 complex subunit 7 Human genes 0.000 description 1
- 102000004163 DNA-directed RNA polymerases Human genes 0.000 description 1
- 108090000626 DNA-directed RNA polymerases Proteins 0.000 description 1
- 108010092160 Dactinomycin Proteins 0.000 description 1
- 101100444936 Danio rerio eif3ha gene Proteins 0.000 description 1
- 101100390736 Danio rerio fign gene Proteins 0.000 description 1
- 241000408659 Darpa Species 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- YKWUPFSEFXSGRT-JWMKEVCDSA-N Dihydropseudouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1C(=O)NC(=O)NC1 YKWUPFSEFXSGRT-JWMKEVCDSA-N 0.000 description 1
- 101150115146 EEF2 gene Proteins 0.000 description 1
- 101150039757 EIF3E gene Proteins 0.000 description 1
- 101150073788 EIF3K gene Proteins 0.000 description 1
- 101150028132 Eif3h gene Proteins 0.000 description 1
- 102100030801 Elongation factor 1-alpha 1 Human genes 0.000 description 1
- 102100040465 Elongation factor 1-beta Human genes 0.000 description 1
- 102100030808 Elongation factor 1-delta Human genes 0.000 description 1
- 102100023362 Elongation factor 1-gamma Human genes 0.000 description 1
- 102100031334 Elongation factor 2 Human genes 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 102100022462 Eukaryotic initiation factor 4A-II Human genes 0.000 description 1
- 102100040015 Eukaryotic translation initiation factor 2 subunit 3 Human genes 0.000 description 1
- 102100035045 Eukaryotic translation initiation factor 3 subunit C Human genes 0.000 description 1
- 102100033132 Eukaryotic translation initiation factor 3 subunit E Human genes 0.000 description 1
- 102100034255 Eukaryotic translation initiation factor 3 subunit F Human genes 0.000 description 1
- 102100037115 Eukaryotic translation initiation factor 3 subunit H Human genes 0.000 description 1
- 102100037110 Eukaryotic translation initiation factor 3 subunit K Human genes 0.000 description 1
- 101150036826 Fignl1 gene Proteins 0.000 description 1
- 108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 description 1
- 102100039619 Granulocyte colony-stimulating factor Human genes 0.000 description 1
- 108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 description 1
- 102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 description 1
- 108010051696 Growth Hormone Proteins 0.000 description 1
- 102100028976 HLA class I histocompatibility antigen, B alpha chain Human genes 0.000 description 1
- 102100035621 Heterogeneous nuclear ribonucleoprotein A1 Human genes 0.000 description 1
- 108010088652 Histocompatibility Antigens Class I Proteins 0.000 description 1
- 108010027412 Histocompatibility Antigens Class II Proteins 0.000 description 1
- 102000018713 Histocompatibility Antigens Class II Human genes 0.000 description 1
- 101000732165 Homo sapiens 40S ribosomal protein S4, X isoform Proteins 0.000 description 1
- 101000755323 Homo sapiens 60S ribosomal protein L10a Proteins 0.000 description 1
- 101001110988 Homo sapiens 60S ribosomal protein L35a Proteins 0.000 description 1
- 101001110263 Homo sapiens 60S ribosomal protein L36 Proteins 0.000 description 1
- 101000671735 Homo sapiens 60S ribosomal protein L37 Proteins 0.000 description 1
- 101000905797 Homo sapiens ATP synthase F(0) complex subunit C2, mitochondrial Proteins 0.000 description 1
- 101001060428 Homo sapiens Cytochrome b-c1 complex subunit 7 Proteins 0.000 description 1
- 101000920078 Homo sapiens Elongation factor 1-alpha 1 Proteins 0.000 description 1
- 101000967447 Homo sapiens Elongation factor 1-beta Proteins 0.000 description 1
- 101000920062 Homo sapiens Elongation factor 1-delta Proteins 0.000 description 1
- 101001050451 Homo sapiens Elongation factor 1-gamma Proteins 0.000 description 1
- 101001044475 Homo sapiens Eukaryotic initiation factor 4A-II Proteins 0.000 description 1
- 101000959829 Homo sapiens Eukaryotic translation initiation factor 2 subunit 3 Proteins 0.000 description 1
- 101000854014 Homo sapiens Heterogeneous nuclear ribonucleoprotein A1 Proteins 0.000 description 1
- 101001002470 Homo sapiens Interferon lambda-1 Proteins 0.000 description 1
- 101000853002 Homo sapiens Interleukin-25 Proteins 0.000 description 1
- 101000853000 Homo sapiens Interleukin-26 Proteins 0.000 description 1
- 101000998139 Homo sapiens Interleukin-32 Proteins 0.000 description 1
- 101001128431 Homo sapiens Myeloid-derived growth factor Proteins 0.000 description 1
- 101001109719 Homo sapiens Nucleophosmin Proteins 0.000 description 1
- 101000979623 Homo sapiens Nucleoside diphosphate kinase B Proteins 0.000 description 1
- 101000609211 Homo sapiens Polyadenylate-binding protein 2 Proteins 0.000 description 1
- 101000653679 Homo sapiens Translationally-controlled tumor protein Proteins 0.000 description 1
- 101000595682 Homo sapiens Tubulin beta-1 chain Proteins 0.000 description 1
- 101001115218 Homo sapiens Ubiquitin-40S ribosomal protein S27a Proteins 0.000 description 1
- 102000003839 Human Proteins Human genes 0.000 description 1
- 108090000144 Human Proteins Proteins 0.000 description 1
- 102000008100 Human Serum Albumin Human genes 0.000 description 1
- UGQMRVRMYYASKQ-KQYNXXCUSA-N Inosine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(O)=C2N=C1 UGQMRVRMYYASKQ-KQYNXXCUSA-N 0.000 description 1
- 229930010555 Inosine Natural products 0.000 description 1
- 102100026720 Interferon beta Human genes 0.000 description 1
- 108010047761 Interferon-alpha Proteins 0.000 description 1
- 102000006992 Interferon-alpha Human genes 0.000 description 1
- 108090000467 Interferon-beta Proteins 0.000 description 1
- 102000000589 Interleukin-1 Human genes 0.000 description 1
- 108010002352 Interleukin-1 Proteins 0.000 description 1
- 102000003814 Interleukin-10 Human genes 0.000 description 1
- 108090000174 Interleukin-10 Proteins 0.000 description 1
- 108010065805 Interleukin-12 Proteins 0.000 description 1
- 102000013462 Interleukin-12 Human genes 0.000 description 1
- 108090000176 Interleukin-13 Proteins 0.000 description 1
- 102000003812 Interleukin-15 Human genes 0.000 description 1
- 108090000172 Interleukin-15 Proteins 0.000 description 1
- 102000049772 Interleukin-16 Human genes 0.000 description 1
- 101800003050 Interleukin-16 Proteins 0.000 description 1
- 102000013691 Interleukin-17 Human genes 0.000 description 1
- 108050003558 Interleukin-17 Proteins 0.000 description 1
- 102000003810 Interleukin-18 Human genes 0.000 description 1
- 108090000171 Interleukin-18 Proteins 0.000 description 1
- 102100039879 Interleukin-19 Human genes 0.000 description 1
- 108050009288 Interleukin-19 Proteins 0.000 description 1
- 102100020873 Interleukin-2 Human genes 0.000 description 1
- 108010002350 Interleukin-2 Proteins 0.000 description 1
- 102000013264 Interleukin-23 Human genes 0.000 description 1
- 108010065637 Interleukin-23 Proteins 0.000 description 1
- 102100036679 Interleukin-26 Human genes 0.000 description 1
- 108010066979 Interleukin-27 Proteins 0.000 description 1
- 108010002386 Interleukin-3 Proteins 0.000 description 1
- 102000000646 Interleukin-3 Human genes 0.000 description 1
- 102100021596 Interleukin-31 Human genes 0.000 description 1
- 101710181613 Interleukin-31 Proteins 0.000 description 1
- 102100033501 Interleukin-32 Human genes 0.000 description 1
- 108010067003 Interleukin-33 Proteins 0.000 description 1
- 102000017761 Interleukin-33 Human genes 0.000 description 1
- 108090000978 Interleukin-4 Proteins 0.000 description 1
- 102000004388 Interleukin-4 Human genes 0.000 description 1
- 108010002616 Interleukin-5 Proteins 0.000 description 1
- 102000000743 Interleukin-5 Human genes 0.000 description 1
- 108090001005 Interleukin-6 Proteins 0.000 description 1
- 102000004889 Interleukin-6 Human genes 0.000 description 1
- 102100021592 Interleukin-7 Human genes 0.000 description 1
- 108010002586 Interleukin-7 Proteins 0.000 description 1
- 108090001007 Interleukin-8 Proteins 0.000 description 1
- 102000004890 Interleukin-8 Human genes 0.000 description 1
- 108010002335 Interleukin-9 Proteins 0.000 description 1
- 102000000585 Interleukin-9 Human genes 0.000 description 1
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- UBORTCNDUKBEOP-UHFFFAOYSA-N L-xanthosine Natural products OC1C(O)C(CO)OC1N1C(NC(=O)NC2=O)=C2N=C1 UBORTCNDUKBEOP-UHFFFAOYSA-N 0.000 description 1
- 108010074338 Lymphokines Proteins 0.000 description 1
- 102000008072 Lymphokines Human genes 0.000 description 1
- 108090000362 Lymphotoxin-beta Proteins 0.000 description 1
- 102100026894 Lymphotoxin-beta Human genes 0.000 description 1
- 108010046938 Macrophage Colony-Stimulating Factor Proteins 0.000 description 1
- 102100028123 Macrophage colony-stimulating factor 1 Human genes 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 208000024556 Mendelian disease Diseases 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical compound OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 1
- 102000013967 Monokines Human genes 0.000 description 1
- 108010050619 Monokines Proteins 0.000 description 1
- 108090000143 Mouse Proteins Proteins 0.000 description 1
- 101100000270 Mus musculus Aacs gene Proteins 0.000 description 1
- 101100491162 Mus musculus Ankrd1 gene Proteins 0.000 description 1
- 101100325648 Mus musculus Aurkb gene Proteins 0.000 description 1
- 101100166337 Mus musculus Cbx6 gene Proteins 0.000 description 1
- 101100382953 Mus musculus Ccnd1 gene Proteins 0.000 description 1
- 101100382960 Mus musculus Ccnd2 gene Proteins 0.000 description 1
- 101000737549 Mus musculus Ceramide synthase 6 Proteins 0.000 description 1
- 101100168723 Mus musculus Csf2ra gene Proteins 0.000 description 1
- 101100168767 Mus musculus Cspg4 gene Proteins 0.000 description 1
- 101100497626 Mus musculus Cxcr4 gene Proteins 0.000 description 1
- 101100443940 Mus musculus Dpysl2 gene Proteins 0.000 description 1
- 101001026869 Mus musculus F-box/LRR-repeat protein 3 Proteins 0.000 description 1
- 101100119743 Mus musculus Fads3 gene Proteins 0.000 description 1
- 101100012564 Mus musculus Fasn gene Proteins 0.000 description 1
- 101100390562 Mus musculus Fen1 gene Proteins 0.000 description 1
- 101100390738 Mus musculus Fign gene Proteins 0.000 description 1
- 101100390729 Mus musculus Fignl1 gene Proteins 0.000 description 1
- 101100329838 Mus musculus Gja1 gene Proteins 0.000 description 1
- 101100337472 Mus musculus Gprc5c gene Proteins 0.000 description 1
- 101100017521 Mus musculus Hmgcs1 gene Proteins 0.000 description 1
- 101100452130 Mus musculus Igf2bp1 gene Proteins 0.000 description 1
- 101100397509 Mus musculus Itga7 gene Proteins 0.000 description 1
- 101100073785 Mus musculus Kif20a gene Proteins 0.000 description 1
- 101100510727 Mus musculus Ldlr gene Proteins 0.000 description 1
- 101100235726 Mus musculus Lmnb1 gene Proteins 0.000 description 1
- 101100240816 Mus musculus Nosip gene Proteins 0.000 description 1
- 101100518479 Mus musculus Osr1 gene Proteins 0.000 description 1
- 101100135261 Mus musculus Oxsr1 gene Proteins 0.000 description 1
- 101100029807 Mus musculus Pimreg gene Proteins 0.000 description 1
- 101100464295 Mus musculus Plk1 gene Proteins 0.000 description 1
- 101100224484 Mus musculus Pole gene Proteins 0.000 description 1
- 101100224497 Mus musculus Pole3 gene Proteins 0.000 description 1
- 101100245190 Mus musculus Prps2 gene Proteins 0.000 description 1
- 101100449066 Mus musculus Shmt2 gene Proteins 0.000 description 1
- 101100042680 Mus musculus Slc7a1 gene Proteins 0.000 description 1
- 101100203373 Mus musculus Slpi gene Proteins 0.000 description 1
- 101100481581 Mus musculus Tlr13 gene Proteins 0.000 description 1
- 101100047780 Mus musculus Tspyl4 gene Proteins 0.000 description 1
- 101100101581 Mus musculus Ubqln2 gene Proteins 0.000 description 1
- 101100483729 Mus musculus Uhrf1 gene Proteins 0.000 description 1
- 101100102673 Mus musculus Vma21 gene Proteins 0.000 description 1
- RSPURTUNRHNVGF-IOSLPCCCSA-N N(2),N(2)-dimethylguanosine Chemical compound C1=NC=2C(=O)NC(N(C)C)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O RSPURTUNRHNVGF-IOSLPCCCSA-N 0.000 description 1
- SLEHROROQDYRAW-KQYNXXCUSA-N N(2)-methylguanosine Chemical compound C1=NC=2C(=O)NC(NC)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O SLEHROROQDYRAW-KQYNXXCUSA-N 0.000 description 1
- USVMJSALORZVDV-SDBHATRESA-N N(6)-(Delta(2)-isopentenyl)adenosine Chemical compound C1=NC=2C(NCC=C(C)C)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O USVMJSALORZVDV-SDBHATRESA-N 0.000 description 1
- VQAYFKKCNSOZKM-IOSLPCCCSA-N N(6)-methyladenosine Chemical compound C1=NC=2C(NC)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O VQAYFKKCNSOZKM-IOSLPCCCSA-N 0.000 description 1
- ZBZXYUYUUDZCNB-UHFFFAOYSA-N N-cyclohexa-1,3-dien-1-yl-N-phenyl-4-[4-(N-[4-[4-(N-[4-[4-(N-phenylanilino)phenyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]aniline Chemical compound C1=CCCC(N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 ZBZXYUYUUDZCNB-UHFFFAOYSA-N 0.000 description 1
- NSTPXGARCQOSAU-VIFPVBQESA-N N-formyl-L-phenylalanine Chemical compound O=CN[C@H](C(=O)O)CC1=CC=CC=C1 NSTPXGARCQOSAU-VIFPVBQESA-N 0.000 description 1
- 102000012064 NLR Proteins Human genes 0.000 description 1
- 108091005686 NOD-like receptors Proteins 0.000 description 1
- VQAYFKKCNSOZKM-UHFFFAOYSA-N NSC 29409 Natural products C1=NC=2C(NC)=NC=NC=2N1C1OC(CO)C(O)C1O VQAYFKKCNSOZKM-UHFFFAOYSA-N 0.000 description 1
- 102100022678 Nucleophosmin Human genes 0.000 description 1
- 102100023258 Nucleoside diphosphate kinase B Human genes 0.000 description 1
- XMIFBEZRFMTGRL-TURQNECASA-N OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cc(CNCCS(O)(=O)=O)c(=O)[nH]c1=S Chemical compound OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cc(CNCCS(O)(=O)=O)c(=O)[nH]c1=S XMIFBEZRFMTGRL-TURQNECASA-N 0.000 description 1
- 108010068204 Peptide Elongation Factors Proteins 0.000 description 1
- 102000002508 Peptide Elongation Factors Human genes 0.000 description 1
- 108010012887 Poly(A)-Binding Protein I Proteins 0.000 description 1
- 102100026090 Polyadenylate-binding protein 1 Human genes 0.000 description 1
- 102100039427 Polyadenylate-binding protein 2 Human genes 0.000 description 1
- 229920002873 Polyethylenimine Polymers 0.000 description 1
- 108010071563 Proto-Oncogene Proteins c-fos Proteins 0.000 description 1
- 102000007568 Proto-Oncogene Proteins c-fos Human genes 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 108091005685 RIG-I-like receptors Proteins 0.000 description 1
- 230000021839 RNA stabilization Effects 0.000 description 1
- 238000003559 RNA-seq method Methods 0.000 description 1
- 102100025234 Receptor of activated protein C kinase 1 Human genes 0.000 description 1
- 108010044157 Receptors for Activated C Kinase Proteins 0.000 description 1
- 108010008281 Recombinant Fusion Proteins Proteins 0.000 description 1
- 102000007056 Recombinant Fusion Proteins Human genes 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 101100279491 Schizosaccharomyces pombe (strain 972 / ATCC 24843) int6 gene Proteins 0.000 description 1
- 101100225588 Schizosaccharomyces pombe (strain 972 / ATCC 24843) nip1 gene Proteins 0.000 description 1
- 102100038803 Somatotropin Human genes 0.000 description 1
- 101710172711 Structural protein Proteins 0.000 description 1
- 108091008874 T cell receptors Proteins 0.000 description 1
- 102000016266 T-Cell Antigen Receptors Human genes 0.000 description 1
- RZCIEJXAILMSQK-JXOAFFINSA-N TTP Chemical compound O=C1NC(=O)C(C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 RZCIEJXAILMSQK-JXOAFFINSA-N 0.000 description 1
- 210000000447 Th1 cell Anatomy 0.000 description 1
- 102100029887 Translationally-controlled tumor protein Human genes 0.000 description 1
- 102100036084 Tubulin beta-1 chain Human genes 0.000 description 1
- 102100040245 Tumor necrosis factor receptor superfamily member 5 Human genes 0.000 description 1
- 101710200656 Ubiquitin-60S ribosomal protein L40 Proteins 0.000 description 1
- DJJCXFVJDGTHFX-UHFFFAOYSA-N Uridinemonophosphate Natural products OC1C(O)C(COP(O)(O)=O)OC1N1C(=O)NC(=O)C=C1 DJJCXFVJDGTHFX-UHFFFAOYSA-N 0.000 description 1
- 108700005077 Viral Genes Proteins 0.000 description 1
- CAEFEWVYEZABLA-UUOKFMHZSA-N XTP Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C(NC(=O)NC2=O)=C2N=C1 CAEFEWVYEZABLA-UUOKFMHZSA-N 0.000 description 1
- UBORTCNDUKBEOP-HAVMAKPUSA-N Xanthosine Natural products O[C@@H]1[C@H](O)[C@H](CO)O[C@H]1N1C(NC(=O)NC2=O)=C2N=C1 UBORTCNDUKBEOP-HAVMAKPUSA-N 0.000 description 1
- JCAQMQLAHNGVPY-UUOKFMHZSA-N [(2r,3s,4r,5r)-3,4-dihydroxy-5-(2,2,4-trioxo-1h-imidazo[4,5-c][1,2,6]thiadiazin-7-yl)oxolan-2-yl]methyl dihydrogen phosphate Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(O)=O)O[C@H]1N1C(NS(=O)(=O)NC2=O)=C2N=C1 JCAQMQLAHNGVPY-UUOKFMHZSA-N 0.000 description 1
- RUKRVHYQIIURNV-RLKNHCSUSA-N [[(2R,3R,5R)-4-fluoro-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound Cc1cn([C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)C2F)c(=O)[nH]c1=O RUKRVHYQIIURNV-RLKNHCSUSA-N 0.000 description 1
- GKVHYBAWZAYQDO-XVFCMESISA-N [[(2r,3s,4r,5r)-3,4-dihydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O1[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@@H](O)[C@@H]1N1C(=O)NC(=S)C=C1 GKVHYBAWZAYQDO-XVFCMESISA-N 0.000 description 1
- KHYOUGAATNYCAZ-XVFCMESISA-N [[(2r,3s,4r,5r)-3,4-dihydroxy-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O1[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@@H](O)[C@@H]1N1C(=S)NC(=O)C=C1 KHYOUGAATNYCAZ-XVFCMESISA-N 0.000 description 1
- ABOQIBZHFFLOGM-UAKXSSHOSA-N [[(2r,3s,4r,5r)-3,4-dihydroxy-5-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O1[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@@H](O)[C@@H]1N1C(=O)NC(=O)C(I)=C1 ABOQIBZHFFLOGM-UAKXSSHOSA-N 0.000 description 1
- QTWNSBVFPSAMPO-IOSLPCCCSA-N [[(2r,3s,4r,5r)-3,4-dihydroxy-5-(6-imino-1-methylpurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound C1=NC=2C(=N)N(C)C=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O QTWNSBVFPSAMPO-IOSLPCCCSA-N 0.000 description 1
- LCQWKKZWHQFOAH-IOSLPCCCSA-N [[(2r,3s,4r,5r)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound C1=NC=2C(NC)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O LCQWKKZWHQFOAH-IOSLPCCCSA-N 0.000 description 1
- WNVZQYHBHSLUHJ-XVFCMESISA-N [[(2r,3s,4r,5r)-4-amino-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound N[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C(=O)N=C(N)C=C1 WNVZQYHBHSLUHJ-XVFCMESISA-N 0.000 description 1
- CABDYDUZLRXGTB-UUOKFMHZSA-N [[(2r,3s,4r,5r)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound C12=NC(N)=NC(N)=C2N=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O CABDYDUZLRXGTB-UUOKFMHZSA-N 0.000 description 1
- YWHNPOKVSACYOQ-KQYNXXCUSA-N [[(2r,3s,4r,5r)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound C1=NC=2C(=O)N(C)C(N)=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O YWHNPOKVSACYOQ-KQYNXXCUSA-N 0.000 description 1
- NCKFQXVRKKNRBB-SHUUEZRQSA-N [[(2r,3s,4r,5r)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C(=O)NC(=O)C=N1 NCKFQXVRKKNRBB-SHUUEZRQSA-N 0.000 description 1
- ZPZGYYNOHSQDQC-UAKXSSHOSA-N [[(2r,3s,4r,5r)-5-(4-amino-5-iodo-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound C1=C(I)C(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 ZPZGYYNOHSQDQC-UAKXSSHOSA-N 0.000 description 1
- UOVXAGVICVPZQP-SHUUEZRQSA-N [[(2r,3s,4r,5r)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O=C1N=C(N)C=NN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 UOVXAGVICVPZQP-SHUUEZRQSA-N 0.000 description 1
- PQISXOFEOCLOCT-UUOKFMHZSA-N [[(2r,3s,4r,5r)-5-(6-amino-8-azidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound [N-]=[N+]=NC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O PQISXOFEOCLOCT-UUOKFMHZSA-N 0.000 description 1
- WDPOFPOWJQWIPX-UUOKFMHZSA-N [[(2r,3s,4r,5r)-5-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound N1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O WDPOFPOWJQWIPX-UUOKFMHZSA-N 0.000 description 1
- GIYJFUYCSKNMOE-IVZWLZJFSA-N [[(2r,3s,5r)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O=C1NC(=O)C(C#CC)=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)C1 GIYJFUYCSKNMOE-IVZWLZJFSA-N 0.000 description 1
- QCUUXXCLJLZGLD-IVZWLZJFSA-N [[(2r,3s,5r)-5-(4-amino-2-oxo-5-prop-1-ynylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O=C1N=C(N)C(C#CC)=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)C1 QCUUXXCLJLZGLD-IVZWLZJFSA-N 0.000 description 1
- UYPHYZSNRPGPAN-RRKCRQDMSA-N [[(2r,3s,5r)-5-(4-amino-5-bromo-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound C1=C(Br)C(N)=NC(=O)N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)C1 UYPHYZSNRPGPAN-RRKCRQDMSA-N 0.000 description 1
- BLQCQNFLEGAHPA-RRKCRQDMSA-N [[(2r,3s,5r)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O1[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)C[C@@H]1N1C(=O)NC(=O)C(Br)=C1 BLQCQNFLEGAHPA-RRKCRQDMSA-N 0.000 description 1
- ODAFAEFSKRENSW-IOSLPCCCSA-N [hydroxy-[[(2r,3r,4r,5r)-3-hydroxy-4-methoxy-5-(6-oxo-3h-purin-9-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate Chemical compound CO[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C2=NC=NC(O)=C2N=C1 ODAFAEFSKRENSW-IOSLPCCCSA-N 0.000 description 1
- ZWDWDTXYXXJLJB-RRKCRQDMSA-N [hydroxy-[[(2r,3s,5r)-3-hydroxy-5-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate Chemical compound O1[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)C[C@@H]1N1C(=O)NC(=O)C(I)=C1 ZWDWDTXYXXJLJB-RRKCRQDMSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000003044 adaptive effect Effects 0.000 description 1
- UDMBCSSLTHHNCD-KQYNXXCUSA-N adenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O UDMBCSSLTHHNCD-KQYNXXCUSA-N 0.000 description 1
- 229960003190 adenosine monophosphate Drugs 0.000 description 1
- LNQVTSROQXJCDD-UHFFFAOYSA-N adenosine monophosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(CO)C(OP(O)(O)=O)C1O LNQVTSROQXJCDD-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000009824 affinity maturation Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 101150087698 alpha gene Proteins 0.000 description 1
- 125000000539 amino acid group Chemical group 0.000 description 1
- 125000002431 aminoalkoxy group Chemical group 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 229940121357 antivirals Drugs 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- PYMYPHUHKUWMLA-WDCZJNDASA-N arabinose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C=O PYMYPHUHKUWMLA-WDCZJNDASA-N 0.000 description 1
- PYMYPHUHKUWMLA-UHFFFAOYSA-N arabinose Natural products OCC(O)C(O)C(O)C=O PYMYPHUHKUWMLA-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229940031567 attenuated vaccine Drugs 0.000 description 1
- 230000006472 autoimmune response Effects 0.000 description 1
- 239000013602 bacteriophage vector Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- SRBFZHDQGSBBOR-UHFFFAOYSA-N beta-D-Pyranose-Lyxose Natural products OC1COC(O)C(O)C1O SRBFZHDQGSBBOR-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000008827 biological function Effects 0.000 description 1
- 238000010170 biological method Methods 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229920006317 cationic polymer Polymers 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000020411 cell activation Effects 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000011712 cell development Effects 0.000 description 1
- 150000001793 charged compounds Chemical class 0.000 description 1
- 108010059385 chemotactic factor inactivator Proteins 0.000 description 1
- 230000024203 complement activation Effects 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- IERHLVCPSMICTF-XVFCMESISA-N cytidine 5'-monophosphate Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(O)=O)O1 IERHLVCPSMICTF-XVFCMESISA-N 0.000 description 1
- IERHLVCPSMICTF-UHFFFAOYSA-N cytidine monophosphate Natural products O=C1N=C(N)C=CN1C1C(O)C(O)C(COP(O)(O)=O)O1 IERHLVCPSMICTF-UHFFFAOYSA-N 0.000 description 1
- PCDQPRRSZKQHHS-ZAKLUEHWSA-N cytidine-5'-triphosphate Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@@H](O)[C@H](CO[P@](O)(=O)O[P@@](O)(=O)OP(O)(O)=O)O1 PCDQPRRSZKQHHS-ZAKLUEHWSA-N 0.000 description 1
- 230000016396 cytokine production Effects 0.000 description 1
- 230000001086 cytosolic effect Effects 0.000 description 1
- GYOZYWVXFNDGLU-XLPZGREQSA-N dTMP Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)C1 GYOZYWVXFNDGLU-XLPZGREQSA-N 0.000 description 1
- 229960000640 dactinomycin Drugs 0.000 description 1
- 235000013365 dairy product Nutrition 0.000 description 1
- 230000007123 defense Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 238000012217 deletion Methods 0.000 description 1
- 230000037430 deletion Effects 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- VGONTNSXDCQUGY-UHFFFAOYSA-N desoxyinosine Natural products C1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 VGONTNSXDCQUGY-UHFFFAOYSA-N 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000003828 downregulation Effects 0.000 description 1
- 101150093313 eIF3c gene Proteins 0.000 description 1
- 230000000463 effect on translation Effects 0.000 description 1
- 101150081549 eif3f gene Proteins 0.000 description 1
- 238000004520 electroporation Methods 0.000 description 1
- 239000002158 endotoxin Substances 0.000 description 1
- 108010048367 enhanced green fluorescent protein Proteins 0.000 description 1
- 230000006862 enzymatic digestion Effects 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 210000001808 exosome Anatomy 0.000 description 1
- 235000021050 feed intake Nutrition 0.000 description 1
- 230000037433 frameshift Effects 0.000 description 1
- 102000034356 gene-regulatory proteins Human genes 0.000 description 1
- 108091006104 gene-regulatory proteins Proteins 0.000 description 1
- 230000009395 genetic defect Effects 0.000 description 1
- 238000010353 genetic engineering Methods 0.000 description 1
- 230000012178 germinal center formation Effects 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 239000000122 growth hormone Substances 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- RQFCJASXJCIDSX-UUOKFMHZSA-N guanosine 5'-monophosphate Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O RQFCJASXJCIDSX-UUOKFMHZSA-N 0.000 description 1
- 235000013928 guanylic acid Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 210000003494 hepatocyte Anatomy 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- PHNWGDTYCJFUGZ-UHFFFAOYSA-L hexyl phosphate Chemical compound CCCCCCOP([O-])([O-])=O PHNWGDTYCJFUGZ-UHFFFAOYSA-L 0.000 description 1
- 230000003054 hormonal effect Effects 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 230000033444 hydroxylation Effects 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 239000000677 immunologic agent Substances 0.000 description 1
- 229940124541 immunological agent Drugs 0.000 description 1
- 230000006054 immunological memory Effects 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000012678 infectious agent Substances 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229960003786 inosine Drugs 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 102000004114 interleukin 20 Human genes 0.000 description 1
- 108090000681 interleukin 20 Proteins 0.000 description 1
- 108010074108 interleukin-21 Proteins 0.000 description 1
- 108010074109 interleukin-22 Proteins 0.000 description 1
- 102000003898 interleukin-24 Human genes 0.000 description 1
- 108090000237 interleukin-24 Proteins 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 238000001638 lipofection Methods 0.000 description 1
- 229920006008 lipopolysaccharide Polymers 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 238000003670 luciferase enzyme activity assay Methods 0.000 description 1
- 210000002751 lymph Anatomy 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 210000005210 lymphoid organ Anatomy 0.000 description 1
- 230000012976 mRNA stabilization Effects 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000012067 mathematical method Methods 0.000 description 1
- 210000001806 memory b lymphocyte Anatomy 0.000 description 1
- 210000003071 memory t lymphocyte Anatomy 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- IZAGSTRIDUNNOY-UHFFFAOYSA-N methyl 2-[(2,4-dioxo-1h-pyrimidin-5-yl)oxy]acetate Chemical compound COC(=O)COC1=CNC(=O)NC1=O IZAGSTRIDUNNOY-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- YACKEPLHDIMKIO-UHFFFAOYSA-N methylphosphonic acid Chemical class CP(O)(O)=O YACKEPLHDIMKIO-UHFFFAOYSA-N 0.000 description 1
- 230000034778 micropinocytosis Effects 0.000 description 1
- OHDXDNUPVVYWOV-UHFFFAOYSA-N n-methyl-1-(2-naphthalen-1-ylsulfanylphenyl)methanamine Chemical compound CNCC1=CC=CC=C1SC1=CC=CC2=CC=CC=C12 OHDXDNUPVVYWOV-UHFFFAOYSA-N 0.000 description 1
- 239000002105 nanoparticle Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 230000001662 opsonic effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 238000012261 overproduction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 230000004526 pharmaceutical effect Effects 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 239000013612 plasmid Substances 0.000 description 1
- 108091023021 poly(A) binding Proteins 0.000 description 1
- 102000028499 poly(A) binding Human genes 0.000 description 1
- 102000040430 polynucleotide Human genes 0.000 description 1
- 108091033319 polynucleotide Proteins 0.000 description 1
- 239000002157 polynucleotide Substances 0.000 description 1
- 108040000983 polyphosphate:AMP phosphotransferase activity proteins Proteins 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- REQCZEXYDRLIBE-UHFFFAOYSA-N procainamide Chemical compound CCN(CC)CCNC(=O)C1=CC=C(N)C=C1 REQCZEXYDRLIBE-UHFFFAOYSA-N 0.000 description 1
- 210000001236 prokaryotic cell Anatomy 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000004952 protein activity Effects 0.000 description 1
- 235000004252 protein component Nutrition 0.000 description 1
- 239000002213 purine nucleotide Substances 0.000 description 1
- 150000003212 purines Chemical class 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 229950010131 puromycin Drugs 0.000 description 1
- XKMLYUALXHKNFT-UHFFFAOYSA-N rGTP Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1OC(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)C(O)C1O XKMLYUALXHKNFT-UHFFFAOYSA-N 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000037425 regulation of transcription Effects 0.000 description 1
- 230000022532 regulation of transcription, DNA-dependent Effects 0.000 description 1
- 230000009712 regulation of translation Effects 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 239000002342 ribonucleoside Substances 0.000 description 1
- 108010033786 ribosomal protein S4 Proteins 0.000 description 1
- DWRXFEITVBNRMK-JXOAFFINSA-N ribothymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 DWRXFEITVBNRMK-JXOAFFINSA-N 0.000 description 1
- 229920002477 rna polymer Polymers 0.000 description 1
- JRPHGDYSKGJTKZ-UHFFFAOYSA-N selenophosphoric acid Chemical compound OP(O)([SeH])=O JRPHGDYSKGJTKZ-UHFFFAOYSA-N 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 210000001082 somatic cell Anatomy 0.000 description 1
- 230000000392 somatic effect Effects 0.000 description 1
- 230000037439 somatic mutation Effects 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229940031626 subunit vaccine Drugs 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 239000005451 thionucleotide Substances 0.000 description 1
- 229940113082 thymine Drugs 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 238000003151 transfection method Methods 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 230000003827 upregulation Effects 0.000 description 1
- DJJCXFVJDGTHFX-XVFCMESISA-N uridine 5'-monophosphate Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(O)=O)O[C@H]1N1C(=O)NC(=O)C=C1 DJJCXFVJDGTHFX-XVFCMESISA-N 0.000 description 1
- YIZYCHKPHCPKHZ-UHFFFAOYSA-N uridine-5-acetic acid methyl ester Natural products COC(=O)Cc1cn(C2OC(CO)C(O)C2O)c(=O)[nH]c1=O YIZYCHKPHCPKHZ-UHFFFAOYSA-N 0.000 description 1
- 229960003636 vidarabine Drugs 0.000 description 1
- 239000013603 viral vector Substances 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
- WCNMEQDMUYVWMJ-JPZHCBQBSA-N wybutoxosine Chemical compound C1=NC=2C(=O)N3C(CC([C@H](NC(=O)OC)C(=O)OC)OO)=C(C)N=C3N(C)C=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O WCNMEQDMUYVWMJ-JPZHCBQBSA-N 0.000 description 1
- UBORTCNDUKBEOP-UUOKFMHZSA-N xanthosine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(NC(=O)NC2=O)=C2N=C1 UBORTCNDUKBEOP-UUOKFMHZSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N15/00—Mutation or genetic engineering; DNA or RNA concerning genetic engineering, vectors, e.g. plasmids, or their isolation, preparation or purification; Use of hosts therefor
- C12N15/09—Recombinant DNA-technology
- C12N15/63—Introduction of foreign genetic material using vectors; Vectors; Use of hosts therefor; Regulation of expression
- C12N15/67—General methods for enhancing the expression
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K35/00—Medicinal preparations containing materials or reaction products thereof with undetermined constitution
- A61K35/12—Materials from mammals; Compositions comprising non-specified tissues or cells; Compositions comprising non-embryonic stem cells; Genetically modified cells
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K48/00—Medicinal preparations containing genetic material which is inserted into cells of the living body to treat genetic diseases; Gene therapy
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/04—Immunostimulants
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N15/00—Mutation or genetic engineering; DNA or RNA concerning genetic engineering, vectors, e.g. plasmids, or their isolation, preparation or purification; Use of hosts therefor
- C12N15/09—Recombinant DNA-technology
- C12N15/63—Introduction of foreign genetic material using vectors; Vectors; Use of hosts therefor; Regulation of expression
- C12N15/79—Vectors or expression systems specially adapted for eukaryotic hosts
- C12N15/85—Vectors or expression systems specially adapted for eukaryotic hosts for animal cells
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2800/00—Nucleic acids vectors
- C12N2800/10—Plasmid DNA
- C12N2800/106—Plasmid DNA for vertebrates
- C12N2800/107—Plasmid DNA for vertebrates for mammalian
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Genetics & Genomics (AREA)
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Biotechnology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Zoology (AREA)
- General Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Immunology (AREA)
- Molecular Biology (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Biophysics (AREA)
- Physics & Mathematics (AREA)
- Plant Pathology (AREA)
- Microbiology (AREA)
- Biochemistry (AREA)
- Epidemiology (AREA)
- Rheumatology (AREA)
- Pain & Pain Management (AREA)
- Virology (AREA)
- Developmental Biology & Embryology (AREA)
- Cell Biology (AREA)
- Micro-Organisms Or Cultivation Processes Thereof (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Measuring Or Testing Involving Enzymes Or Micro-Organisms (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EPPCT/EP2015/001755 | 2015-08-28 | ||
| EP2015001755 | 2015-08-28 | ||
| PCT/EP2016/001417 WO2017036580A1 (en) | 2015-08-28 | 2016-08-22 | Artificial nucleic acid molecules |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| KR20180038564A KR20180038564A (ko) | 2018-04-16 |
| KR102645398B1 true KR102645398B1 (ko) | 2024-03-07 |
Family
ID=54064264
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020187008732A Active KR102645398B1 (ko) | 2015-08-28 | 2016-08-22 | 신규 인공 핵산 분자 |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US12258567B2 (enExample) |
| EP (2) | EP4108774A1 (enExample) |
| JP (2) | JP7304155B2 (enExample) |
| KR (1) | KR102645398B1 (enExample) |
| CN (2) | CN114381470A (enExample) |
| AU (1) | AU2016316439B2 (enExample) |
| CA (1) | CA2992801A1 (enExample) |
| DK (1) | DK3341482T3 (enExample) |
| ES (1) | ES2924739T3 (enExample) |
| MX (1) | MX395421B (enExample) |
| SG (1) | SG10201913629VA (enExample) |
| WO (1) | WO2017036580A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR20240111764A (ko) * | 2021-12-13 | 2024-07-17 | 주식회사 에스엠엘바이오팜 | 발현 효율을 증가시킨 핵산 발현 플랫폼 |
Families Citing this family (115)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2012019630A1 (en) | 2010-08-13 | 2012-02-16 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly(a) sequence or a polyadenylation signal for increasing the expression of an encoded protein |
| WO2012116714A1 (en) | 2011-03-02 | 2012-09-07 | Curevac Gmbh | Vaccination in elderly patients |
| WO2013120499A1 (en) | 2012-02-15 | 2013-08-22 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly (a) sequence or a polyadenylation signal for increasing the expression of an encoded pathogenic antigen |
| WO2013120497A1 (en) | 2012-02-15 | 2013-08-22 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly(a) sequence or a polyadenylation signal for increasing the expression of an encoded therapeutic protein |
| RU2658490C2 (ru) | 2012-03-27 | 2018-06-21 | Кьюрвак Аг | Искусственные молекулы нуклеиновых кислот для улучшенной экспрессии белков или пептидов |
| JP6456305B2 (ja) | 2013-02-22 | 2019-01-23 | キュアバック アーゲー | ワクチン接種とpd−1経路の阻害との組み合わせ |
| RU2712743C2 (ru) | 2013-08-21 | 2020-01-30 | Куревак Аг | Вакцина против бешенства |
| AU2014310935B2 (en) | 2013-08-21 | 2019-11-21 | CureVac SE | Combination vaccine |
| SG11201510746WA (en) | 2013-08-21 | 2016-03-30 | Curevac Ag | Respiratory syncytial virus (rsv) vaccine |
| EP3116535B1 (en) | 2014-03-12 | 2019-08-07 | CureVac AG | Combination of vaccination and ox40 agonists |
| HUE060907T2 (hu) | 2014-06-25 | 2023-04-28 | Acuitas Therapeutics Inc | Új lipidek és lipid nanorészecske formulációk nukleinsavak bevitelére |
| US11149278B2 (en) | 2014-12-12 | 2021-10-19 | Curevac Ag | Artificial nucleic acid molecules for improved protein expression |
| WO2016165825A1 (en) | 2015-04-13 | 2016-10-20 | Curevac Ag | Method for producing rna compositions |
| SG11201707663SA (en) | 2015-04-17 | 2017-11-29 | Curevac Ag | Lyophilization of rna |
| CA2984125A1 (en) | 2015-04-27 | 2016-11-03 | The Trustees Of The University Of Pennsylvania | Nucleoside-modified rna for inducing an adaptive immune response |
| EP3289101B1 (en) | 2015-04-30 | 2021-06-23 | CureVac AG | Immobilized poly(n)polymerase |
| WO2016180430A1 (en) | 2015-05-08 | 2016-11-17 | Curevac Ag | Method for producing rna |
| ES2875589T3 (es) | 2015-05-15 | 2021-11-10 | Curevac Ag | Regímenes de sensibilización-refuerzo que implican la administración de al menos un constructo de ARNm |
| SG11201708541QA (en) | 2015-05-20 | 2017-12-28 | Curevac Ag | Dry powder composition comprising long-chain rna |
| SG11201708540VA (en) | 2015-05-20 | 2017-12-28 | Curevac Ag | Dry powder composition comprising long-chain rna |
| US11608513B2 (en) | 2015-05-29 | 2023-03-21 | CureVac SE | Method for adding cap structures to RNA using immobilized enzymes |
| WO2016193206A1 (en) | 2015-05-29 | 2016-12-08 | Curevac Ag | A method for producing and purifying rna, comprising at least one step of tangential flow filtration |
| US10221127B2 (en) | 2015-06-29 | 2019-03-05 | Acuitas Therapeutics, Inc. | Lipids and lipid nanoparticle formulations for delivery of nucleic acids |
| WO2017009376A1 (en) | 2015-07-13 | 2017-01-19 | Curevac Ag | Method of producing rna from circular dna and corresponding template dna |
| EP3362576A1 (en) | 2015-10-12 | 2018-08-22 | CureVac AG | Automated method for isolation, selection and/or detection of microorganisms or cells comprised in a solution |
| IL307179A (en) | 2015-10-28 | 2023-11-01 | Acuitas Therapeutics Inc | Novel lipids and lipid nanoparticle formulations for delivery of nucleic acids |
| US11413346B2 (en) | 2015-11-09 | 2022-08-16 | Curevac Ag | Rotavirus vaccines |
| EP3701963A1 (en) | 2015-12-22 | 2020-09-02 | CureVac AG | Method for producing rna molecule compositions |
| US11248223B2 (en) | 2015-12-23 | 2022-02-15 | Curevac Ag | Method of RNA in vitro transcription using a buffer containing a dicarboxylic acid or tricarboxylic acid or a salt thereof |
| MX2018009917A (es) | 2016-02-17 | 2019-08-14 | Curevac Ag | Vacuna contra el virus del zika. |
| EP3423595A1 (en) | 2016-03-03 | 2019-01-09 | CureVac AG | Rna analysis by total hydrolysis |
| US11596699B2 (en) | 2016-04-29 | 2023-03-07 | CureVac SE | RNA encoding an antibody |
| US11078247B2 (en) | 2016-05-04 | 2021-08-03 | Curevac Ag | RNA encoding a therapeutic protein |
| EP3452493B1 (en) | 2016-05-04 | 2025-01-15 | CureVac SE | Nucleic acid molecules and uses thereof |
| WO2017212009A1 (en) | 2016-06-09 | 2017-12-14 | Curevac Ag | Hybrid carriers for nucleic acid cargo |
| AU2017314067A1 (en) | 2016-08-19 | 2018-12-20 | CureVac SE | RNA for cancer therapy |
| US12491261B2 (en) | 2016-10-26 | 2025-12-09 | Acuitas Therapeutics, Inc. | Lipid nanoparticle formulations |
| WO2018096179A1 (en) | 2016-11-28 | 2018-05-31 | Curevac Ag | Method for purifying rna |
| JP2020501545A (ja) | 2016-12-08 | 2020-01-23 | キュアバック アーゲー | 肝疾患の処置または予防のためのrna |
| US11542490B2 (en) | 2016-12-08 | 2023-01-03 | CureVac SE | RNAs for wound healing |
| US11464847B2 (en) | 2016-12-23 | 2022-10-11 | Curevac Ag | Lassa virus vaccine |
| EP3558355A2 (en) | 2016-12-23 | 2019-10-30 | CureVac AG | Henipavirus vaccine |
| WO2018115527A2 (en) | 2016-12-23 | 2018-06-28 | Curevac Ag | Mers coronavirus vaccine |
| JP7317715B2 (ja) | 2017-01-11 | 2023-07-31 | ザ・トラステイーズ・オブ・ザ・ユニバーシテイ・オブ・ペンシルベニア | ジカウイルスに対する免疫応答を誘導するためのヌクレオシド改変rna |
| JP2020514370A (ja) | 2017-03-17 | 2020-05-21 | キュアバック アーゲー | 組合せ抗癌療法のためのrnaワクチン及び免疫チェックポイント阻害剤 |
| EP3601576A1 (en) * | 2017-03-24 | 2020-02-05 | CureVac AG | Nucleic acids encoding crispr-associated proteins and uses thereof |
| US11357856B2 (en) | 2017-04-13 | 2022-06-14 | Acuitas Therapeutics, Inc. | Lipids for delivery of active agents |
| WO2018200892A1 (en) | 2017-04-27 | 2018-11-01 | The Trustees Of The University Of Pennsylvania | NUCLEOSIDE-MODIFIED mRNA-LIPID NANOPARTICLE LINEAGE VACCINE FOR HEPATITIS C VIRUS |
| CN116693411A (zh) | 2017-04-28 | 2023-09-05 | 爱康泰生治疗公司 | 用于递送核酸的新型羰基脂质和脂质纳米颗粒制剂 |
| EP3625363A1 (en) | 2017-05-17 | 2020-03-25 | CureVac Real Estate GmbH | Method for determining at least one quality parameter of an rna sample |
| US11639329B2 (en) | 2017-08-16 | 2023-05-02 | Acuitas Therapeutics, Inc. | Lipids for use in lipid nanoparticle formulations |
| US12065396B2 (en) | 2017-08-17 | 2024-08-20 | Acuitas Therapeutics, Inc. | Lipids for use in lipid nanoparticle formulations |
| US11524932B2 (en) | 2017-08-17 | 2022-12-13 | Acuitas Therapeutics, Inc. | Lipids for use in lipid nanoparticle formulations |
| WO2019036028A1 (en) | 2017-08-17 | 2019-02-21 | Acuitas Therapeutics, Inc. | LIPIDS FOR USE IN LIPID NANOPARTICULAR FORMULATIONS |
| EP3673069A1 (en) | 2017-08-22 | 2020-07-01 | CureVac AG | Bunyavirales vaccine |
| JP2021501572A (ja) * | 2017-10-19 | 2021-01-21 | キュアバック アーゲー | 新規な人工核酸分子 |
| CN111511924A (zh) | 2017-11-08 | 2020-08-07 | 库瑞瓦格股份公司 | Rna序列调整 |
| WO2019115635A1 (en) | 2017-12-13 | 2019-06-20 | Curevac Ag | Flavivirus vaccine |
| US11525158B2 (en) | 2017-12-21 | 2022-12-13 | CureVac SE | Linear double stranded DNA coupled to a single support or a tag and methods for producing said linear double stranded DNA |
| EP3773702A2 (en) | 2018-04-05 | 2021-02-17 | CureVac AG | Novel yellow fever nucleic acid molecules for vaccination |
| JP7613685B2 (ja) | 2018-04-17 | 2025-01-15 | キュアバック エスイー | 新規rsv rna分子及びワクチン接種用組成物 |
| EP3813874A1 (en) | 2018-06-27 | 2021-05-05 | CureVac AG | Novel lassa virus rna molecules and compositions for vaccination |
| SG11202011097YA (en) | 2018-06-28 | 2020-12-30 | Curevac Ag | Bioreactor for rna in vitro transcription |
| CN112567053A (zh) * | 2018-08-10 | 2021-03-26 | 潘泽尔纳疗法有限公司 | 重组核酸构建体 |
| US12329857B2 (en) | 2018-09-21 | 2025-06-17 | Acuitas Therapeutics, Inc. | Systems and methods for manufacturing lipid nanoparticles and liposomes |
| AU2019410737A1 (en) | 2018-12-21 | 2021-06-10 | CureVac SE | RNA for malaria vaccines |
| CA3122645A1 (en) | 2018-12-21 | 2020-06-25 | Curevac Ag | Methods for rna analysis |
| US20220133908A1 (en) | 2019-02-08 | 2022-05-05 | Curevac Ag | Coding rna administered into the suprachoroidal space in the treatment of ophthalmic diseases |
| WO2020254535A1 (en) | 2019-06-18 | 2020-12-24 | Curevac Ag | Rotavirus mrna vaccine |
| EP4013880A1 (en) | 2019-08-14 | 2022-06-22 | CureVac AG | Rna combinations and compositions with decreased immunostimulatory properties |
| CN110812366B (zh) * | 2019-11-18 | 2023-11-17 | 珠海丽凡达生物技术有限公司 | 一种可用于激素补充的mRNA药物及其制备方法 |
| DE202021003575U1 (de) | 2020-02-04 | 2022-01-17 | Curevac Ag | Coronavirus-Vakzine |
| US12194089B2 (en) | 2020-02-04 | 2025-01-14 | CureVac SE | Coronavirus vaccine |
| US11241493B2 (en) | 2020-02-04 | 2022-02-08 | Curevac Ag | Coronavirus vaccine |
| CN111494631B (zh) * | 2020-04-27 | 2022-10-18 | 北京大学人民医院 | 一种原发性免疫性血小板减少症miRNA标记物及其应用 |
| WO2021239880A1 (en) | 2020-05-29 | 2021-12-02 | Curevac Ag | Nucleic acid based combination vaccines |
| AU2021308681A1 (en) | 2020-07-16 | 2023-03-09 | Acuitas Therapeutics, Inc. | Cationic lipids for use in lipid nanoparticles |
| US20230272052A1 (en) | 2020-07-31 | 2023-08-31 | CureVac SE | Nucleic acid encoded antibody mixtures |
| EP4157344A2 (en) | 2020-08-31 | 2023-04-05 | CureVac SE | Multivalent nucleic acid based coronavirus vaccines |
| AU2021405281A1 (en) | 2020-12-22 | 2023-07-06 | Glaxosmithkline Biologicals Sa | Rna vaccine against sars-cov-2 variants |
| CA3171051A1 (en) | 2020-12-22 | 2022-06-30 | Curevac Ag | Pharmaceutical composition comprising lipid-based carriers encapsulating rna for multidose administration |
| WO2022137133A1 (en) | 2020-12-22 | 2022-06-30 | Curevac Ag | Rna vaccine against sars-cov-2 variants |
| WO2022162027A2 (en) | 2021-01-27 | 2022-08-04 | Curevac Ag | Method of reducing the immunostimulatory properties of in vitro transcribed rna |
| US20240181037A1 (en) | 2021-03-26 | 2024-06-06 | Glaxosmithkline Biologicals Sa | Immunogenic compositions |
| CA3171429A1 (en) | 2021-03-31 | 2022-09-30 | Alexander SCHWENGER | Syringes containing pharmaceutical compositions comprising rna |
| EP4334446A1 (en) | 2021-05-03 | 2024-03-13 | CureVac SE | Improved nucleic acid sequence for cell type specific expression |
| US20240263217A1 (en) | 2021-06-04 | 2024-08-08 | Translate Bio, Inc. | Assay for quantitative assessment of mrna capping efficiency |
| KR20230000471A (ko) * | 2021-06-24 | 2023-01-02 | 한미약품 주식회사 | 비천연 5'-비번역 영역 및 3'-비번역 영역 및 그의 용도 |
| JP7689238B2 (ja) * | 2021-07-27 | 2025-06-05 | エスケー バイオサイエンス カンパニー リミテッド | タンパク質発現のためのmRNA、及びそのためのテンプレート |
| JP2024534120A (ja) | 2021-08-24 | 2024-09-18 | ビオンテック・ソシエタス・エウロパエア | インビトロ転写技術 |
| KR20240123832A (ko) | 2021-12-16 | 2024-08-14 | 아퀴타스 테라퓨틱스 인크. | 지질 나노입자 제형에 사용하기 위한 지질 |
| CN115404238A (zh) * | 2021-12-22 | 2022-11-29 | 江苏拓弘康恒医药有限公司 | 高翻译稳定性BDNF mRNA的设计和制备方法 |
| US20250099614A1 (en) | 2022-01-28 | 2025-03-27 | CureVac SE | Nucleic acid encoded transcription factor inhibitors |
| CN114540307A (zh) * | 2022-02-16 | 2022-05-27 | 多莱泌生物科技(武汉)有限公司 | 一种靶向肝脏的工程化外泌体制备方法 |
| CN119212720A (zh) | 2022-05-25 | 2024-12-27 | 库瑞瓦格欧洲股份公司 | 编码大肠杆菌FimH抗原性多肽的基于核酸的疫苗 |
| AU2023310896A1 (en) * | 2022-07-19 | 2025-01-30 | Shenzhen Shenxin Biotechnology Co., Ltd. | Mrna for sars-cov-2 s protein and use thereof |
| CN115845043B (zh) * | 2022-07-20 | 2025-07-29 | 安徽智飞龙科马生物制药有限公司 | 一种模板DNA分子及其在制备mRNA和疫苗中的应用 |
| CN115896141B (zh) * | 2022-08-08 | 2025-09-16 | 复旦大学附属妇产科医院 | Prss56蛋白表达和酶活调控在近视治疗中的应用 |
| WO2024068545A1 (en) | 2022-09-26 | 2024-04-04 | Glaxosmithkline Biologicals Sa | Influenza virus vaccines |
| WO2024083345A1 (en) | 2022-10-21 | 2024-04-25 | BioNTech SE | Methods and uses associated with liquid compositions |
| WO2024089638A1 (en) | 2022-10-28 | 2024-05-02 | Glaxosmithkline Biologicals Sa | Nucleic acid based vaccine |
| CN120092088A (zh) * | 2022-11-11 | 2025-06-03 | 斯微(上海)生物科技股份有限公司 | 人工核酸分子 |
| CN120112637A (zh) * | 2022-11-11 | 2025-06-06 | 斯微(上海)生物科技股份有限公司 | 人工核酸分子 |
| EP4658239A1 (en) | 2023-02-03 | 2025-12-10 | GlaxoSmithKline Biologicals S.A. | Rna formulation |
| GB202302092D0 (en) | 2023-02-14 | 2023-03-29 | Glaxosmithkline Biologicals Sa | Analytical method |
| WO2024223728A1 (en) | 2023-04-27 | 2024-10-31 | Glaxosmithkline Biologicals Sa | Influenza virus vaccines |
| WO2024223724A1 (en) | 2023-04-27 | 2024-10-31 | Glaxosmithkline Biologicals Sa | Influenza virus vaccines |
| WO2024230934A1 (en) | 2023-05-11 | 2024-11-14 | CureVac SE | Therapeutic nucleic acid for the treatment of ophthalmic diseases |
| WO2024260570A1 (en) | 2023-06-23 | 2024-12-26 | CureVac SE | Nucleic acid encoded antibodies |
| WO2025096878A1 (en) * | 2023-11-02 | 2025-05-08 | Capstan Therapeutics, Inc. | Rna for in vivo transfection with increased expression |
| CN120530193A (zh) * | 2023-11-30 | 2025-08-22 | 传信生物医药(苏州)有限公司 | 用于提高rna分子的翻译性能的3’utr |
| WO2025132839A1 (en) | 2023-12-21 | 2025-06-26 | Glaxosmithkline Biologicals Sa | Influenza virus vaccines |
| CN117487809B (zh) * | 2023-12-29 | 2024-03-19 | 艾斯拓康医药科技(北京)有限公司 | 一种优化的5`utr序列及其应用 |
| CN117535295B (zh) * | 2024-01-09 | 2024-04-26 | 艾斯拓康医药科技(北京)有限公司 | 一种优化的3`utr序列及其应用 |
| GB202404607D0 (en) | 2024-03-29 | 2024-05-15 | Glaxosmithkline Biologicals Sa | RNA formulation |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2014164253A1 (en) | 2013-03-09 | 2014-10-09 | Moderna Therapeutics, Inc. | Heterologous untranslated regions for mrna |
Family Cites Families (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5132418A (en) | 1980-02-29 | 1992-07-21 | University Patents, Inc. | Process for preparing polynucleotides |
| US4458066A (en) | 1980-02-29 | 1984-07-03 | University Patents, Inc. | Process for preparing polynucleotides |
| US4500707A (en) | 1980-02-29 | 1985-02-19 | University Patents, Inc. | Nucleosides useful in the preparation of polynucleotides |
| US4668777A (en) | 1981-03-27 | 1987-05-26 | University Patents, Inc. | Phosphoramidite nucleoside compounds |
| US4973679A (en) | 1981-03-27 | 1990-11-27 | University Patents, Inc. | Process for oligonucleo tide synthesis using phosphormidite intermediates |
| US4415732A (en) | 1981-03-27 | 1983-11-15 | University Patents, Inc. | Phosphoramidite compounds and processes |
| US4401796A (en) | 1981-04-30 | 1983-08-30 | City Of Hope Research Institute | Solid-phase synthesis of polynucleotides |
| US4373071A (en) | 1981-04-30 | 1983-02-08 | City Of Hope Research Institute | Solid-phase synthesis of polynucleotides |
| US5153319A (en) | 1986-03-31 | 1992-10-06 | University Patents, Inc. | Process for preparing polynucleotides |
| US5047524A (en) | 1988-12-21 | 1991-09-10 | Applied Biosystems, Inc. | Automated system for polynucleotide synthesis and purification |
| US5262530A (en) | 1988-12-21 | 1993-11-16 | Applied Biosystems, Inc. | Automated system for polynucleotide synthesis and purification |
| US5700642A (en) | 1995-05-22 | 1997-12-23 | Sri International | Oligonucleotide sizing using immobilized cleavable primers |
| US6436703B1 (en) * | 2000-03-31 | 2002-08-20 | Hyseq, Inc. | Nucleic acids and polypeptides |
| DE50214379D1 (de) | 2001-06-05 | 2010-05-27 | Curevac Gmbh | Stabilisierte mRNA mit erhöhtem G/C-Gehalt für die Gentherapie |
| DE10162480A1 (de) | 2001-12-19 | 2003-08-07 | Ingmar Hoerr | Die Applikation von mRNA für den Einsatz als Therapeutikum gegen Tumorerkrankungen |
| DE10229872A1 (de) | 2002-07-03 | 2004-01-29 | Curevac Gmbh | Immunstimulation durch chemisch modifizierte RNA |
| DE10335833A1 (de) | 2003-08-05 | 2005-03-03 | Curevac Gmbh | Transfektion von Blutzellen mit mRNA zur Immunstimulation und Gentherapie |
| DE102004042546A1 (de) | 2004-09-02 | 2006-03-09 | Curevac Gmbh | Kombinationstherapie zur Immunstimulation |
| DE102005023170A1 (de) | 2005-05-19 | 2006-11-23 | Curevac Gmbh | Optimierte Formulierung für mRNA |
| DE102006035618A1 (de) | 2006-07-31 | 2008-02-07 | Curevac Gmbh | Nukleinsäure der Formel (I): GlXmGn, insbesondere als immunstimulierendes Adjuvanz |
| DE102006061015A1 (de) | 2006-12-22 | 2008-06-26 | Curevac Gmbh | Verfahren zur Reinigung von RNA im präparativen Maßstab mittels HPLC |
| DE102007001370A1 (de) | 2007-01-09 | 2008-07-10 | Curevac Gmbh | RNA-kodierte Antikörper |
| US20080220983A1 (en) | 2007-03-08 | 2008-09-11 | Switchgear Genomics A California Corporation | Functional arrays for high throughput characterization of regulatory elements in untranslated regions of genes |
| WO2009030254A1 (en) | 2007-09-04 | 2009-03-12 | Curevac Gmbh | Complexes of rna and cationic peptides for transfection and for immunostimulation |
| WO2009046739A1 (en) | 2007-10-09 | 2009-04-16 | Curevac Gmbh | Composition for treating prostate cancer (pca) |
| WO2009046738A1 (en) | 2007-10-09 | 2009-04-16 | Curevac Gmbh | Composition for treating lung cancer, particularly of non-small lung cancers (nsclc) |
| KR101483715B1 (ko) | 2008-01-31 | 2015-01-19 | 큐어백 게엠바하 | 면역증강제/애주번트인 화학식(NuGlXmGnNv)a를 포함하는 핵산 및 이의 유도체 |
| WO2010037408A1 (en) | 2008-09-30 | 2010-04-08 | Curevac Gmbh | Composition comprising a complexed (m)rna and a naked mrna for providing or enhancing an immunostimulatory response in a mammal and uses thereof |
| US20110053829A1 (en) | 2009-09-03 | 2011-03-03 | Curevac Gmbh | Disulfide-linked polyethyleneglycol/peptide conjugates for the transfection of nucleic acids |
| WO2011069529A1 (en) | 2009-12-09 | 2011-06-16 | Curevac Gmbh | Mannose-containing solution for lyophilization, transfection and/or injection of nucleic acids |
| BR112013002298A2 (pt) | 2010-07-30 | 2016-05-24 | Curevac Gmbh | complexação de ácidos nucleicos com componentes catiônicos reticulados com dissulfeto para transfecção e estimulação imunológica. |
| WO2012019630A1 (en) | 2010-08-13 | 2012-02-16 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly(a) sequence or a polyadenylation signal for increasing the expression of an encoded protein |
| WO2012089225A1 (en) | 2010-12-29 | 2012-07-05 | Curevac Gmbh | Combination of vaccination and inhibition of mhc class i restricted antigen presentation |
| WO2012116715A1 (en) | 2011-03-02 | 2012-09-07 | Curevac Gmbh | Vaccination in newborns and infants |
| WO2012113413A1 (en) | 2011-02-21 | 2012-08-30 | Curevac Gmbh | Vaccine composition comprising complexed immunostimulatory nucleic acids and antigens packaged with disulfide-linked polyethyleneglycol/peptide conjugates |
| WO2012116714A1 (en) | 2011-03-02 | 2012-09-07 | Curevac Gmbh | Vaccination in elderly patients |
| WO2013113325A1 (en) | 2012-01-31 | 2013-08-08 | Curevac Gmbh | Negatively charged nucleic acid comprising complexes for immunostimulation |
| EP2623121A1 (en) | 2012-01-31 | 2013-08-07 | Bayer Innovation GmbH | Pharmaceutical composition comprising a polymeric carrier cargo complex and an antigen |
| WO2013113326A1 (en) | 2012-01-31 | 2013-08-08 | Curevac Gmbh | Pharmaceutical composition comprising a polymeric carrier cargo complex and at least one protein or peptide antigen |
| WO2013120497A1 (en) | 2012-02-15 | 2013-08-22 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly(a) sequence or a polyadenylation signal for increasing the expression of an encoded therapeutic protein |
| WO2013120499A1 (en) | 2012-02-15 | 2013-08-22 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly (a) sequence or a polyadenylation signal for increasing the expression of an encoded pathogenic antigen |
| WO2013120500A1 (en) | 2012-02-15 | 2013-08-22 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly(a) sequence or a polyadenylation signal for increasing the expression of an encoded tumour antigen |
| WO2013120498A1 (en) | 2012-02-15 | 2013-08-22 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly(a) sequence or a polyadenylation signal for increasing the expression of an encoded allergenic antigen or an autoimmune self-antigen |
| RU2658490C2 (ru) * | 2012-03-27 | 2018-06-21 | Кьюрвак Аг | Искусственные молекулы нуклеиновых кислот для улучшенной экспрессии белков или пептидов |
| MX357803B (es) | 2012-03-27 | 2018-07-24 | Curevac Ag | Moléculas de ácido nucleico artificiales. |
| RU2660565C2 (ru) * | 2012-03-27 | 2018-07-06 | Кьюрвак Аг | Молекулы искусственной нуклеиновой кислоты, содержащие 5'utr гена top |
| AU2013243954A1 (en) * | 2012-04-02 | 2014-10-30 | Moderna Therapeutics, Inc. | Modified polynucleotides for the production of cosmetic proteins and peptides |
| US20150306249A1 (en) | 2012-05-25 | 2015-10-29 | Curevac Gmbh | Reversible immobilization and/or controlled release of nucleic acid containing nanoparticles by (biodegradable) polymer coatings |
| JP6456305B2 (ja) | 2013-02-22 | 2019-01-23 | キュアバック アーゲー | ワクチン接種とpd−1経路の阻害との組み合わせ |
| SG10201801428RA (en) | 2013-08-21 | 2018-03-28 | Curevac Ag | Method for increasing expression of rna-encoded proteins |
| AU2014310935B2 (en) | 2013-08-21 | 2019-11-21 | CureVac SE | Combination vaccine |
| EA037217B1 (ru) | 2013-08-21 | 2021-02-20 | Куревак Аг | Композиция и вакцина для лечения рака легких |
| RU2712743C2 (ru) | 2013-08-21 | 2020-01-30 | Куревак Аг | Вакцина против бешенства |
| KR20160043103A (ko) | 2013-08-21 | 2016-04-20 | 큐어백 아게 | 전립선암 치료를 위한 조성물 및 백신 |
| SG11201510746WA (en) | 2013-08-21 | 2016-03-30 | Curevac Ag | Respiratory syncytial virus (rsv) vaccine |
| CA2925021C (en) | 2013-11-01 | 2025-05-06 | Curevac Ag | MODIFIED MESSENGER RIBONUCLE ACID (MRNA) WITH REDUCED IMMUNOSTIMULATING PROPERTIES |
| CA2927254C (en) | 2013-12-30 | 2023-10-24 | Curevac Ag | Artificial nucleic acid molecules |
| SG10201903381TA (en) | 2013-12-30 | 2019-05-30 | Curevac Ag | Artificial nucleic acid molecules |
| AU2014375404C1 (en) | 2013-12-30 | 2020-11-19 | CureVac Manufacturing GmbH | Methods for RNA analysis |
| EP3116535B1 (en) | 2014-03-12 | 2019-08-07 | CureVac AG | Combination of vaccination and ox40 agonists |
| EP3129050A2 (en) | 2014-04-01 | 2017-02-15 | CureVac AG | Polymeric carrier cargo complex for use as an immunostimulating agent or as an adjuvant |
| RU2738753C2 (ru) | 2014-06-10 | 2020-12-16 | Куревак Риэл Эстейт Гмбх | Способы и средства повышения продуктивности рнк |
| US11149278B2 (en) | 2014-12-12 | 2021-10-19 | Curevac Ag | Artificial nucleic acid molecules for improved protein expression |
| CA2962849A1 (en) | 2014-12-16 | 2016-06-23 | Curevac Ag | Ebolavirus and marburgvirus vaccines |
| EP3240558A1 (en) | 2014-12-30 | 2017-11-08 | CureVac AG | Artificial nucleic acid molecules |
| WO2016165825A1 (en) | 2015-04-13 | 2016-10-20 | Curevac Ag | Method for producing rna compositions |
| SG11201707663SA (en) | 2015-04-17 | 2017-11-29 | Curevac Ag | Lyophilization of rna |
| RU2749113C2 (ru) | 2015-04-22 | 2021-06-04 | Куревак Аг | Содержащая рнк композиция для лечения опухолевых заболеваний |
| EP3289101B1 (en) | 2015-04-30 | 2021-06-23 | CureVac AG | Immobilized poly(n)polymerase |
| CN108064307A (zh) | 2015-04-30 | 2018-05-22 | 库瑞瓦格股份公司 | 使用固定化的限制酶进行体外转录的方法 |
| WO2016180430A1 (en) | 2015-05-08 | 2016-11-17 | Curevac Ag | Method for producing rna |
| ES2875589T3 (es) | 2015-05-15 | 2021-11-10 | Curevac Ag | Regímenes de sensibilización-refuerzo que implican la administración de al menos un constructo de ARNm |
| SG11201708541QA (en) | 2015-05-20 | 2017-12-28 | Curevac Ag | Dry powder composition comprising long-chain rna |
| SG11201708540VA (en) | 2015-05-20 | 2017-12-28 | Curevac Ag | Dry powder composition comprising long-chain rna |
| WO2016193206A1 (en) | 2015-05-29 | 2016-12-08 | Curevac Ag | A method for producing and purifying rna, comprising at least one step of tangential flow filtration |
| US11608513B2 (en) | 2015-05-29 | 2023-03-21 | CureVac SE | Method for adding cap structures to RNA using immobilized enzymes |
| EP3310384A1 (en) | 2015-06-17 | 2018-04-25 | CureVac AG | Vaccine composition |
| US20190017100A1 (en) | 2015-07-01 | 2019-01-17 | Curevac Ag | Method for analysis of an rna molecule |
| WO2017009376A1 (en) | 2015-07-13 | 2017-01-19 | Curevac Ag | Method of producing rna from circular dna and corresponding template dna |
| WO2017021546A1 (en) | 2015-08-05 | 2017-02-09 | Curevac Ag | Epidermal mrna vaccine |
| WO2017025120A1 (en) | 2015-08-07 | 2017-02-16 | Curevac Ag | Process for the in vivo production of rna in a host cell |
| CN108138187B (zh) | 2015-08-10 | 2022-07-19 | 库瑞瓦格房地产有限公司 | 增加环状dna分子复制的方法 |
| EP3362576A1 (en) | 2015-10-12 | 2018-08-22 | CureVac AG | Automated method for isolation, selection and/or detection of microorganisms or cells comprised in a solution |
| US11413346B2 (en) | 2015-11-09 | 2022-08-16 | Curevac Ag | Rotavirus vaccines |
| US20180126003A1 (en) | 2016-05-04 | 2018-05-10 | Curevac Ag | New targets for rna therapeutics |
-
2016
- 2016-08-22 CA CA2992801A patent/CA2992801A1/en active Pending
- 2016-08-22 JP JP2018511127A patent/JP7304155B2/ja active Active
- 2016-08-22 EP EP22176444.2A patent/EP4108774A1/en active Pending
- 2016-08-22 ES ES16759979T patent/ES2924739T3/es active Active
- 2016-08-22 DK DK16759979.4T patent/DK3341482T3/da active
- 2016-08-22 KR KR1020187008732A patent/KR102645398B1/ko active Active
- 2016-08-22 EP EP16759979.4A patent/EP3341482B1/en active Active
- 2016-08-22 CN CN202210036661.4A patent/CN114381470A/zh active Pending
- 2016-08-22 CN CN201680049973.1A patent/CN108026537B/zh active Active
- 2016-08-22 WO PCT/EP2016/001417 patent/WO2017036580A1/en not_active Ceased
- 2016-08-22 AU AU2016316439A patent/AU2016316439B2/en active Active
- 2016-08-22 MX MX2018001040A patent/MX395421B/es unknown
- 2016-08-22 US US15/755,739 patent/US12258567B2/en active Active
- 2016-08-22 SG SG10201913629VA patent/SG10201913629VA/en unknown
-
2021
- 2021-08-16 JP JP2021132110A patent/JP7245878B2/ja active Active
-
2025
- 2025-01-16 US US19/026,182 patent/US20250171789A1/en active Pending
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2014164253A1 (en) | 2013-03-09 | 2014-10-09 | Moderna Therapeutics, Inc. | Heterologous untranslated regions for mrna |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR20240111764A (ko) * | 2021-12-13 | 2024-07-17 | 주식회사 에스엠엘바이오팜 | 발현 효율을 증가시킨 핵산 발현 플랫폼 |
| KR102818855B1 (ko) | 2021-12-13 | 2025-06-16 | 주식회사 에스엠엘바이오팜 | 발현 효율을 증가시킨 핵산 발현 플랫폼 |
Also Published As
| Publication number | Publication date |
|---|---|
| AU2016316439A1 (en) | 2018-02-08 |
| EP3341482B1 (en) | 2022-07-06 |
| WO2017036580A1 (en) | 2017-03-09 |
| US20250171789A1 (en) | 2025-05-29 |
| JP7245878B2 (ja) | 2023-03-24 |
| US12258567B2 (en) | 2025-03-25 |
| US20180237786A1 (en) | 2018-08-23 |
| JP2021192613A (ja) | 2021-12-23 |
| KR20180038564A (ko) | 2018-04-16 |
| AU2016316439B2 (en) | 2022-02-24 |
| MX2018001040A (es) | 2018-06-15 |
| EP3341482A1 (en) | 2018-07-04 |
| CA2992801A1 (en) | 2017-03-09 |
| BR112018001995A2 (pt) | 2018-09-18 |
| JP7304155B2 (ja) | 2023-07-06 |
| JP2018529329A (ja) | 2018-10-11 |
| MX395421B (es) | 2025-03-25 |
| CN114381470A (zh) | 2022-04-22 |
| EP4108774A1 (en) | 2022-12-28 |
| ES2924739T3 (es) | 2022-10-10 |
| RU2018110872A3 (enExample) | 2020-07-24 |
| DK3341482T3 (da) | 2022-08-15 |
| CN108026537B (zh) | 2022-02-08 |
| SG10201913629VA (en) | 2020-03-30 |
| CN108026537A (zh) | 2018-05-11 |
| RU2018110872A (ru) | 2019-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR102645398B1 (ko) | 신규 인공 핵산 분자 | |
| US20240294928A1 (en) | Artificial nucleic acid molecules | |
| JP6997251B2 (ja) | 人工核酸分子 | |
| JP6584414B2 (ja) | 人工核酸分子 | |
| AU2014375402A1 (en) | Artificial nucleic acid molecules | |
| EP3090053A2 (en) | Artificial nucleic acid molecules | |
| RU2772349C2 (ru) | Искусственные молекулы нуклеиновой кислоты | |
| RU2774415C1 (ru) | Искусственные молекулы нуклеиновой кислоты | |
| HK40068167A (en) | Artificial nucleic acid molecules | |
| EP3090052B1 (en) | Artificial nucleic acid molecules |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20180327 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| PA0201 | Request for examination |
Patent event code: PA02012R01D Patent event date: 20210820 Comment text: Request for Examination of Application |
|
| E902 | Notification of reason for refusal | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20230721 Patent event code: PE09021S01D |
|
| E701 | Decision to grant or registration of patent right | ||
| PE0701 | Decision of registration |
Patent event code: PE07011S01D Comment text: Decision to Grant Registration Patent event date: 20240122 |
|
| GRNT | Written decision to grant | ||
| PR0701 | Registration of establishment |
Comment text: Registration of Establishment Patent event date: 20240305 Patent event code: PR07011E01D |
|
| PR1002 | Payment of registration fee |
Payment date: 20240305 End annual number: 3 Start annual number: 1 |
|
| PG1601 | Publication of registration |