JPS63233744A - パックとその製造方法 - Google Patents
パックとその製造方法Info
- Publication number
- JPS63233744A JPS63233744A JP62316393A JP31639387A JPS63233744A JP S63233744 A JPS63233744 A JP S63233744A JP 62316393 A JP62316393 A JP 62316393A JP 31639387 A JP31639387 A JP 31639387A JP S63233744 A JPS63233744 A JP S63233744A
- Authority
- JP
- Japan
- Prior art keywords
- pack
- pack according
- coating
- topcoat
- coat
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 238000005470 impregnation Methods 0.000 claims abstract description 10
- 238000007789 sealing Methods 0.000 claims abstract description 10
- 238000011049 filling Methods 0.000 claims abstract description 9
- 239000007788 liquid Substances 0.000 claims abstract description 9
- 239000011148 porous material Substances 0.000 claims abstract description 7
- 238000000576 coating method Methods 0.000 claims description 57
- 239000011248 coating agent Substances 0.000 claims description 56
- 235000019197 fats Nutrition 0.000 claims description 32
- 239000000463 material Substances 0.000 claims description 24
- 229920002472 Starch Polymers 0.000 claims description 20
- 235000019698 starch Nutrition 0.000 claims description 20
- 235000019864 coconut oil Nutrition 0.000 claims description 19
- 239000003240 coconut oil Substances 0.000 claims description 19
- 239000008107 starch Substances 0.000 claims description 19
- 239000007787 solid Substances 0.000 claims description 18
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 claims description 16
- 235000021240 caseins Nutrition 0.000 claims description 16
- 239000005018 casein Substances 0.000 claims description 15
- 235000013305 food Nutrition 0.000 claims description 10
- 230000002209 hydrophobic effect Effects 0.000 claims description 10
- 239000008173 hydrogenated soybean oil Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- 235000000346 sugar Nutrition 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 102000014171 Milk Proteins Human genes 0.000 claims description 6
- 108010011756 Milk Proteins Proteins 0.000 claims description 6
- 238000001816 cooling Methods 0.000 claims description 6
- 235000021239 milk protein Nutrition 0.000 claims description 6
- 239000003921 oil Substances 0.000 claims description 6
- 235000019198 oils Nutrition 0.000 claims description 6
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 239000000853 adhesive Substances 0.000 claims description 3
- 230000001070 adhesive effect Effects 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 239000004310 lactic acid Substances 0.000 claims description 2
- 235000014655 lactic acid Nutrition 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims 1
- 235000020183 skimmed milk Nutrition 0.000 claims 1
- 235000008939 whole milk Nutrition 0.000 claims 1
- 229930006000 Sucrose Natural products 0.000 abstract description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 abstract description 2
- 238000007710 freezing Methods 0.000 abstract description 2
- 230000008014 freezing Effects 0.000 abstract description 2
- 235000013681 dietary sucrose Nutrition 0.000 abstract 1
- 229960004793 sucrose Drugs 0.000 abstract 1
- 239000003925 fat Substances 0.000 description 29
- 102000011632 Caseins Human genes 0.000 description 12
- 108010076119 Caseins Proteins 0.000 description 12
- 239000003549 soybean oil Substances 0.000 description 11
- 235000012424 soybean oil Nutrition 0.000 description 11
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 235000013312 flour Nutrition 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- 238000003860 storage Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000007921 spray Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 3
- 235000013351 cheese Nutrition 0.000 description 3
- 235000007983 food acid Nutrition 0.000 description 3
- 235000015243 ice cream Nutrition 0.000 description 3
- 235000013618 yogurt Nutrition 0.000 description 3
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 240000008415 Lactuca sativa Species 0.000 description 2
- 235000015173 baked goods and baking mixes Nutrition 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- -1 ester long chain fatty acids Chemical class 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 235000013372 meat Nutrition 0.000 description 2
- 235000013336 milk Nutrition 0.000 description 2
- 239000008267 milk Substances 0.000 description 2
- 210000004080 milk Anatomy 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 235000012045 salad Nutrition 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 235000019871 vegetable fat Nutrition 0.000 description 2
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 108010046377 Whey Proteins Proteins 0.000 description 1
- 102000007544 Whey Proteins Human genes 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 235000008429 bread Nutrition 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 229940071162 caseinate Drugs 0.000 description 1
- 229940021722 caseins Drugs 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 235000021149 fatty food Nutrition 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000021060 food property Nutrition 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000015122 lemonade Nutrition 0.000 description 1
- 235000021056 liquid food Nutrition 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 235000021119 whey protein Nutrition 0.000 description 1
- 239000012463 white pigment Substances 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A21—BAKING; EDIBLE DOUGHS
- A21D—TREATMENT, e.g. PRESERVATION, OF FLOUR OR DOUGH, e.g. BY ADDITION OF MATERIALS; BAKING; BAKERY PRODUCTS; PRESERVATION THEREOF
- A21D13/00—Finished or partly finished bakery products
- A21D13/30—Filled, to be filled or stuffed products
- A21D13/32—Filled, to be filled or stuffed products filled or to be filled after baking, e.g. sandwiches
- A21D13/33—Edible containers, e.g. cups or cones
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Bakery Products And Manufacturing Methods Therefor (AREA)
- Confectionery (AREA)
- Packging For Living Organisms, Food Or Medicinal Products That Are Sensitive To Environmental Conditiond (AREA)
- Wrappers (AREA)
- General Preparation And Processing Of Foods (AREA)
- Jellies, Jams, And Syrups (AREA)
- Containers And Plastic Fillers For Packaging (AREA)
- Basic Packing Technique (AREA)
- Cereal-Derived Products (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863643199 DE3643199A1 (de) | 1986-12-18 | 1986-12-18 | Verpackung fuer nahrungs- und genussmittel und verfahren zu ihrer herstellung |
| DE3643199.0 | 1986-12-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS63233744A true JPS63233744A (ja) | 1988-09-29 |
Family
ID=6316443
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP62316393A Pending JPS63233744A (ja) | 1986-12-18 | 1987-12-16 | パックとその製造方法 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4957754A (es) |
| EP (1) | EP0271853B2 (es) |
| JP (1) | JPS63233744A (es) |
| AT (1) | ATE67374T1 (es) |
| DE (2) | DE3643199A1 (es) |
| ES (1) | ES2024484T5 (es) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE8915452U1 (de) * | 1989-06-30 | 1990-07-19 | Fa. Wilh. Schmitz-Scholl, 45478 Mülheim | Verpackung für Lebensmittel-Produkte |
| PL167213B1 (pl) * | 1990-02-06 | 1995-08-31 | Biopac Biolog Verpackungssyste | Sposób wytwarzania zdolnych do rozkladu, cienkosciennych ksztaltek na bazie skrobi PL PL PL |
| DE4025524A1 (de) * | 1990-08-11 | 1992-02-13 | Suedmilch Ag | Behaelter aus einer dauerbackware und verfahren zu seiner herstellung |
| DE4025523A1 (de) * | 1990-08-11 | 1992-02-13 | Werner Georg Munk | Verrottbarer behaelter, verfahren zu seiner herstellung und verwendung |
| DE4126683C1 (en) * | 1990-08-15 | 1993-06-09 | Schmitz-Scholl, Wilh., 4330 Muelheim, De | Soft packaging sheet comprising mixt. of sugar and additive - with release layer on surface, used esp. for foods, including sweets |
| DE4027786A1 (de) * | 1990-09-04 | 1992-04-09 | Marcel Huder | Thermoplastisch verarbeitbare komponentengemische zur herstellung von nutzungs-, gebrauchs- und verpackungsgegenstaenden |
| DE9018139U1 (de) * | 1990-12-31 | 1996-04-18 | Ruhrtaler Waffelfabrik H. Jaspert GmbH & Co. KG, 45479 Mülheim | Waffelteigmischung |
| NL9100590A (nl) * | 1991-04-05 | 1992-11-02 | Limburg Prod Centrale | Werkwijze voor het vervaardigen van een milieuvriendelijke verpakking. |
| DE4119306C2 (de) * | 1991-06-12 | 1996-05-30 | Wheli Inter Ag | Organische Rohstoffe, Zwischen- und Endprodukte für die Ernährung und zur Verwendung für technische Zwecke, die Vitalstoffe enthalten |
| WO1993024024A1 (de) * | 1992-05-25 | 1993-12-09 | Multiforsa Ag | Lebensmittel-kombination |
| US5354621A (en) * | 1992-07-02 | 1994-10-11 | Beltec International | Biodegradable construction material and manufacturing method |
| US5928741A (en) | 1992-08-11 | 1999-07-27 | E. Khashoggi Industries, Llc | Laminated articles of manufacture fashioned from sheets having a highly inorganically filled organic polymer matrix |
| US5545450A (en) | 1992-08-11 | 1996-08-13 | E. Khashoggi Industries | Molded articles having an inorganically filled organic polymer matrix |
| US5830305A (en) | 1992-08-11 | 1998-11-03 | E. Khashoggi Industries, Llc | Methods of molding articles having an inorganically filled organic polymer matrix |
| US5508072A (en) | 1992-08-11 | 1996-04-16 | E. Khashoggi Industries | Sheets having a highly inorganically filled organic polymer matrix |
| US5660903A (en) | 1992-08-11 | 1997-08-26 | E. Khashoggi Industries | Sheets having a highly inorganically filled organic polymer matrix |
| US5783126A (en) * | 1992-08-11 | 1998-07-21 | E. Khashoggi Industries | Method for manufacturing articles having inorganically filled, starch-bound cellular matrix |
| US5830548A (en) | 1992-08-11 | 1998-11-03 | E. Khashoggi Industries, Llc | Articles of manufacture and methods for manufacturing laminate structures including inorganically filled sheets |
| US5618341A (en) * | 1992-08-11 | 1997-04-08 | E. Khashoggi Industries | Methods for uniformly dispersing fibers within starch-based compositions |
| US5582670A (en) | 1992-08-11 | 1996-12-10 | E. Khashoggi Industries | Methods for the manufacture of sheets having a highly inorganically filled organic polymer matrix |
| US5709827A (en) * | 1992-08-11 | 1998-01-20 | E. Khashoggi Industries | Methods for manufacturing articles having a starch-bound cellular matrix |
| US5658603A (en) | 1992-08-11 | 1997-08-19 | E. Khashoggi Industries | Systems for molding articles having an inorganically filled organic polymer matrix |
| US5810961A (en) * | 1993-11-19 | 1998-09-22 | E. Khashoggi Industries, Llc | Methods for manufacturing molded sheets having a high starch content |
| US5580624A (en) | 1992-08-11 | 1996-12-03 | E. Khashoggi Industries | Food and beverage containers made from inorganic aggregates and polysaccharide, protein, or synthetic organic binders, and the methods of manufacturing such containers |
| US5679145A (en) * | 1992-08-11 | 1997-10-21 | E. Khashoggi Industries | Starch-based compositions having uniformly dispersed fibers used to manufacture high strength articles having a fiber-reinforced, starch-bound cellular matrix |
| US5683772A (en) * | 1992-08-11 | 1997-11-04 | E. Khashoggi Industries | Articles having a starch-bound cellular matrix reinforced with uniformly dispersed fibers |
| US5851634A (en) | 1992-08-11 | 1998-12-22 | E. Khashoggi Industries | Hinges for highly inorganically filled composite materials |
| US5662731A (en) * | 1992-08-11 | 1997-09-02 | E. Khashoggi Industries | Compositions for manufacturing fiber-reinforced, starch-bound articles having a foamed cellular matrix |
| US5506046A (en) | 1992-08-11 | 1996-04-09 | E. Khashoggi Industries | Articles of manufacture fashioned from sheets having a highly inorganically filled organic polymer matrix |
| US5800647A (en) | 1992-08-11 | 1998-09-01 | E. Khashoggi Industries, Llc | Methods for manufacturing articles from sheets having a highly inorganically filled organic polymer matrix |
| US5716675A (en) * | 1992-11-25 | 1998-02-10 | E. Khashoggi Industries | Methods for treating the surface of starch-based articles with glycerin |
| DK169728B1 (da) | 1993-02-02 | 1995-01-23 | Stein Gaasland | Fremgangsmåde til frigørelse af cellulosebaserede fibre fra hinanden i vand og støbemasse til plastisk formning af celluloseholdige fiberprodukter |
| DE4309528C2 (de) | 1993-03-24 | 1998-05-20 | Doxa Gmbh | Folie oder Folienschlauch aus Casein, Verfahren zu deren Herstellung und deren Verwendung |
| AT403645B (de) * | 1993-06-04 | 1998-04-27 | Haas Franz Waffelmasch | Verfahren zum wasserabweisenden bzw. wasserdichten beschichten von formkörpern |
| US5738921A (en) | 1993-08-10 | 1998-04-14 | E. Khashoggi Industries, Llc | Compositions and methods for manufacturing sealable, liquid-tight containers comprising an inorganically filled matrix |
| US5736209A (en) * | 1993-11-19 | 1998-04-07 | E. Kashoggi, Industries, Llc | Compositions having a high ungelatinized starch content and sheets molded therefrom |
| US6083586A (en) * | 1993-11-19 | 2000-07-04 | E. Khashoggi Industries, Llc | Sheets having a starch-based binding matrix |
| US5776388A (en) * | 1994-02-07 | 1998-07-07 | E. Khashoggi Industries, Llc | Methods for molding articles which include a hinged starch-bound cellular matrix |
| US5843544A (en) * | 1994-02-07 | 1998-12-01 | E. Khashoggi Industries | Articles which include a hinged starch-bound cellular matrix |
| US5705203A (en) * | 1994-02-07 | 1998-01-06 | E. Khashoggi Industries | Systems for molding articles which include a hinged starch-bound cellular matrix |
| WO1996014750A1 (de) * | 1994-11-16 | 1996-05-23 | Franz Haas Waffelmaschinen Industriegesellschaft Mbh | Vorrichtungen und verfahren für die herstellung von gebackenen, dünnwandigen formkörpern |
| DE29507677U1 (de) * | 1995-05-09 | 1995-07-13 | Zimmermann, Bruno Maria, Dr.med., 66687 Wadern | Schröpfgefäß |
| CN1153518C (zh) * | 1995-06-14 | 2004-06-16 | 弗朗兹哈斯华夫饼干机械工业股份公司 | 制备可降解薄壁模塑物的方法 |
| DE19530463A1 (de) * | 1995-08-18 | 1997-02-20 | Gerhard Liebhold | Essbare Verpackung für Lebensmittel |
| US6168857B1 (en) | 1996-04-09 | 2001-01-02 | E. Khashoggi Industries, Llc | Compositions and methods for manufacturing starch-based compositions |
| US6561787B2 (en) * | 1999-09-29 | 2003-05-13 | Kansas State University Research Foundation | Apparatus for forming biodegradable and edible feed packaging materials |
| US20040005387A1 (en) * | 2002-04-05 | 2004-01-08 | J & B Sausage Company | Method of preparing an improved tortilla sausage wrap |
| US20040175469A1 (en) * | 2002-04-05 | 2004-09-09 | Danny Janecka | Tortilla wrap food product and method for making same |
| DE202004002438U1 (de) * | 2004-02-16 | 2005-08-11 | Systec Pos-Technology Gmbh | Einkaufswagen oder Transportbehälter |
| US20110018249A1 (en) * | 2004-02-16 | 2011-01-27 | Horst Sonnendorfer | Shopping cart or transport container, and production method |
| GB2436513A (en) * | 2006-03-21 | 2007-10-03 | Mark Anthony Watson | An edible coated with a layer of modified cellulose |
| DE102008028394A1 (de) | 2008-06-13 | 2009-12-31 | Amphenol-Tuchel Electronics Gmbh | Kompostierbare Verpackung für elektronische Bauelemente |
| US9410059B2 (en) * | 2014-01-21 | 2016-08-09 | Alltech, Inc. | Wax treated article and method of making |
| DE102017127988B4 (de) | 2017-11-27 | 2020-10-22 | Emre Yildiz | Lebensmittelverpackung mit integriertem Abfallbehälter und Verwendung einer Lebensmittelverpackung mit integriertem Abfallbehälter |
| EP3841882A1 (de) * | 2019-12-23 | 2021-06-30 | Josef Zehnder | Formkörper auf basis von polysaccharid-haltigen substanzen |
| ES2946668T3 (es) * | 2020-07-23 | 2023-07-24 | Zhen Yi Xuan Food Entpr Co | Tapa comestible |
Family Cites Families (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1221585B (de) * | 1962-09-20 | 1966-07-28 | Big Drum Inc | Verfahren zum Schutze der Oberflaeche einer zu fuellenden Dauerbackware gegen ein Durchfeuchten |
| US1810453A (en) * | 1929-07-01 | 1931-06-16 | Raymond B Webster | Chewing gum confection |
| US2167353A (en) * | 1938-08-18 | 1939-07-25 | Frediani Nello | Confection |
| GB846440A (en) * | 1958-11-25 | 1960-08-31 | Maryland Baking Company | Improvements in or relating to edible cups for ice-cream and like confectionery |
| US3186852A (en) * | 1961-12-26 | 1965-06-01 | Big Drum Inc | Process for maintaining the crispness in a pastry product filled with a frozen confection |
| US3290154A (en) * | 1964-05-13 | 1966-12-06 | Turner Wesley | Edible baked cup-shaped product and method for making same |
| US3366486A (en) * | 1965-08-24 | 1968-01-30 | Maryland Baking Co Inc | Edible containers for foods |
| US3471303A (en) * | 1966-03-07 | 1969-10-07 | Archer Daniels Midland Co | Edible coating compositions and method for coating food |
| US3526515A (en) * | 1966-12-21 | 1970-09-01 | Maryland Cup Corp | Method of waterproofing baked goods |
| CA1061163A (en) * | 1974-11-22 | 1979-08-28 | Ryuzo Nakatsuka | Protein-starch binary molding composition and shaped articles obtained therefrom |
| DE2701765A1 (de) * | 1977-01-18 | 1978-07-20 | Matthias Schmidt | Honigwaffel |
| DE2835700A1 (de) * | 1978-08-16 | 1980-02-28 | Karl Wissner | Fertigimbiss |
| US4219579A (en) * | 1979-01-25 | 1980-08-26 | Carl Piampiano | Means and method improving taste of saccharine sweetened food products |
| DE2929496C2 (de) * | 1979-07-20 | 1983-09-08 | Ferrero Ohg, 3570 Stadtallendorf | Waffel mit glatter dichter Oberfläche und einer zellenartigen Innenstruktur zur Verwendung als gefüllte Waffel aus zwei oder mehreren Waffelblättern |
| EP0023151B1 (en) * | 1979-07-20 | 1984-02-01 | Unilever Plc | Composite ice confections and processes for preparing them |
| GB2045050B (en) * | 1980-03-03 | 1983-12-21 | Unilever Ltd | Composite ice confections and processes for preparing them |
| US4390553A (en) * | 1980-08-05 | 1983-06-28 | Maryland Cup Corporation | Edible food containers and the method of coating said containers |
| AT379293B (de) * | 1980-10-03 | 1985-12-10 | Unilever Nv | Verfahren zur herstellung von zusammengesetzten eiskonfekterzeugnissen |
| FR2516353A1 (fr) * | 1981-11-19 | 1983-05-20 | Locolas Claude | Recipient alimentaire consommable pour restauration rapide et moyens pour sa fabrication |
| US4603051A (en) * | 1982-01-04 | 1986-07-29 | Maryland Cup Corporation | Edible food containers and the method of coating said containers |
| US4472440A (en) * | 1982-02-09 | 1984-09-18 | Maryland Cup Corporation | Package containing a moisture resistant edible baked container |
| US4503080A (en) * | 1982-07-08 | 1985-03-05 | The Procter & Gamble Company | Doughs and cookies providing storage-stable texture variability |
| US4491681A (en) * | 1983-12-08 | 1985-01-01 | The United States Of America As Represented By The United States Department Of Energy | Liquid cooled, linear focus solar cell receiver |
| US4710391A (en) * | 1985-06-11 | 1987-12-01 | Conagra, Inc. | Flavoring method for fried food products |
| US4764386A (en) * | 1985-09-24 | 1988-08-16 | Griffith Laboratories U.S.A., Inc. | Process for preparing storage stable, readily reconstituted frozen comestibles |
| US4781932A (en) * | 1985-10-25 | 1988-11-01 | The Pillsbury Company | Food shell and method of manufacture |
| JPS63501921A (ja) * | 1985-12-16 | 1988-08-04 | ウイスコンシン アラムナイ リサ−チ フオンデ−シヨン | 水蒸気移動抵抗性可食フイルムバリヤ− |
| DE3639185A1 (de) * | 1986-10-25 | 1988-04-28 | Manfred Koerner | Verfahren zur herstellung einer verpackung aus organischen stoffen in beliebiger formgebung fuer die einbringung von lebensmitteln |
-
1986
- 1986-12-18 DE DE19863643199 patent/DE3643199A1/de not_active Withdrawn
-
1987
- 1987-12-12 DE DE8787118447T patent/DE3773150D1/de not_active Expired - Lifetime
- 1987-12-12 EP EP87118447A patent/EP0271853B2/de not_active Expired - Lifetime
- 1987-12-12 ES ES87118447T patent/ES2024484T5/es not_active Expired - Lifetime
- 1987-12-12 AT AT87118447T patent/ATE67374T1/de not_active IP Right Cessation
- 1987-12-16 JP JP62316393A patent/JPS63233744A/ja active Pending
- 1987-12-17 US US07/134,175 patent/US4957754A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| DE3643199A1 (de) | 1988-06-30 |
| EP0271853A2 (de) | 1988-06-22 |
| EP0271853B1 (de) | 1991-09-18 |
| ES2024484B3 (es) | 1992-03-01 |
| EP0271853A3 (en) | 1989-08-09 |
| ATE67374T1 (de) | 1991-10-15 |
| DE3773150D1 (de) | 1991-10-24 |
| EP0271853B2 (de) | 1994-07-20 |
| ES2024484T5 (es) | 1995-08-16 |
| US4957754A (en) | 1990-09-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS63233744A (ja) | パックとその製造方法 | |
| US5130151A (en) | Natural and synthetic edible moisture barrier | |
| US4874618A (en) | Package containing a moisture resistant edible internal barrier | |
| US4915971A (en) | Method for making an edible film and for retarding water transfer among multi-component food products | |
| US4020188A (en) | Cooked dough having a frozen dessert filling and method therefor | |
| US4409249A (en) | Egg product and process of manufacture | |
| CA2616723C (en) | Multilayer food product and method for preparing same | |
| JPS58125452A (ja) | 食品用食用容器とその塗装方法 | |
| US5130150A (en) | Edible moisture barrier | |
| NO990647D0 (no) | Toast med belegg | |
| EP0188553A1 (en) | Edible pre-formed film barrier materials | |
| US6472006B1 (en) | Oven-stable edible moisture barrier | |
| US5069921A (en) | Method of preparing an encrusted food product | |
| US3676151A (en) | Toaster product and process | |
| RU2191514C2 (ru) | Способ изготовления пищевого продукта в виде взбитой смеси и пищевой продукт в виде взбитой смеси | |
| US4415601A (en) | Quick hardening icing composition | |
| US5194272A (en) | Pack for foods and process for the production thereof | |
| EP0451491A2 (en) | Barrier coating for food products | |
| WO1987003453A1 (en) | Edible film barrier resistant to water vapor transfer | |
| US2870022A (en) | Dough mix package | |
| JP6346705B1 (ja) | 卵加工品 | |
| US6071617A (en) | Packaging having a food-grade barrier coating and preparation thereof | |
| SG194528A1 (en) | Impregnation type composite fatty confectionery | |
| US3544335A (en) | Coated frozen batter pieces and process for making same | |
| MXPA02009212A (es) | Bizcocho cubierto. |