JPS5946217B2 - ピペリジン誘導体、その酸付加塩および光学異性体 - Google Patents
ピペリジン誘導体、その酸付加塩および光学異性体Info
- Publication number
- JPS5946217B2 JPS5946217B2 JP51026226A JP2622676A JPS5946217B2 JP S5946217 B2 JPS5946217 B2 JP S5946217B2 JP 51026226 A JP51026226 A JP 51026226A JP 2622676 A JP2622676 A JP 2622676A JP S5946217 B2 JPS5946217 B2 JP S5946217B2
- Authority
- JP
- Japan
- Prior art keywords
- parts
- methyl
- formula
- ethyl
- aryl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000003839 salts Chemical class 0.000 title claims description 110
- 239000002253 acid Substances 0.000 title claims description 78
- 230000003287 optical effect Effects 0.000 title claims description 11
- 150000003053 piperidines Chemical class 0.000 title claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 114
- -1 4-phenylcyclohexyl Chemical group 0.000 claims description 109
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 81
- 125000000217 alkyl group Chemical group 0.000 claims description 64
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 63
- 239000001257 hydrogen Substances 0.000 claims description 43
- 229910052739 hydrogen Inorganic materials 0.000 claims description 43
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 39
- 125000003342 alkenyl group Chemical group 0.000 claims description 27
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 27
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 21
- 125000003118 aryl group Chemical group 0.000 claims description 21
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims description 14
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 14
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000002252 acyl group Chemical group 0.000 claims description 10
- 150000007942 carboxylates Chemical group 0.000 claims description 10
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 5
- 125000005059 halophenyl group Chemical group 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 5
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical group CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 4
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 3
- 239000000730 antalgic agent Substances 0.000 claims description 3
- NFGRCBGXNVMYIM-UHFFFAOYSA-N methyl 4-[n-(cyclopropanecarbonyl)anilino]-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(N(C(=O)C2CC2)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 NFGRCBGXNVMYIM-UHFFFAOYSA-N 0.000 claims description 2
- GARXJOUQUSNOGK-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-(2-phenylethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 GARXJOUQUSNOGK-UHFFFAOYSA-N 0.000 claims description 2
- YDSDEBIZUNNPOB-UHFFFAOYSA-N carfentanil Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 YDSDEBIZUNNPOB-UHFFFAOYSA-N 0.000 claims 1
- JBZRLYJWUZOCQL-UHFFFAOYSA-N methyl 4-(n-propanoylanilino)-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate Chemical compound C1CN(CCC=2SC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 JBZRLYJWUZOCQL-UHFFFAOYSA-N 0.000 claims 1
- QWGNBDHHZUUXTP-UHFFFAOYSA-N n-[4-acetyl-1-(2-phenylethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(C)=O)N(C(=O)CC)C1=CC=CC=C1 QWGNBDHHZUUXTP-UHFFFAOYSA-N 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 67
- 239000000543 intermediate Substances 0.000 abstract description 54
- 230000000202 analgesic effect Effects 0.000 abstract description 4
- LKRMTUUCKBQGFO-UHFFFAOYSA-N n-phenylpiperidin-4-amine Chemical class C1CNCCC1NC1=CC=CC=C1 LKRMTUUCKBQGFO-UHFFFAOYSA-N 0.000 abstract description 3
- 230000003389 potentiating effect Effects 0.000 abstract description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 228
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 207
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 175
- 238000002844 melting Methods 0.000 description 172
- 230000008018 melting Effects 0.000 description 172
- 239000000203 mixture Substances 0.000 description 151
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 120
- 239000000243 solution Substances 0.000 description 116
- 239000003480 eluent Substances 0.000 description 105
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 102
- 239000000047 product Substances 0.000 description 101
- 229960001701 chloroform Drugs 0.000 description 98
- 238000003756 stirring Methods 0.000 description 89
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 87
- 239000011541 reaction mixture Substances 0.000 description 82
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 63
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 60
- 239000000284 extract Substances 0.000 description 55
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 53
- 239000000741 silica gel Substances 0.000 description 53
- 229910002027 silica gel Inorganic materials 0.000 description 53
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 52
- 238000004440 column chromatography Methods 0.000 description 51
- 239000000706 filtrate Substances 0.000 description 51
- 238000006243 chemical reaction Methods 0.000 description 48
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 45
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 43
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 42
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 39
- 238000001816 cooling Methods 0.000 description 39
- 238000010992 reflux Methods 0.000 description 36
- 239000003054 catalyst Substances 0.000 description 35
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 33
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 33
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 28
- 239000000908 ammonium hydroxide Substances 0.000 description 28
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 27
- MUBZPKHOEPUJKR-UHFFFAOYSA-L Oxalate Chemical compound [O-]C(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-L 0.000 description 26
- 239000012074 organic phase Substances 0.000 description 25
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 24
- 239000002904 solvent Substances 0.000 description 23
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 22
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical class OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 22
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 22
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 19
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 18
- 239000002244 precipitate Substances 0.000 description 18
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 17
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 17
- 239000007858 starting material Substances 0.000 description 17
- 229910052799 carbon Inorganic materials 0.000 description 16
- 239000003921 oil Substances 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 15
- 239000012458 free base Substances 0.000 description 15
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 15
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 238000002425 crystallisation Methods 0.000 description 14
- 230000008025 crystallization Effects 0.000 description 14
- 239000005457 ice water Substances 0.000 description 14
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000008346 aqueous phase Substances 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 11
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 11
- 150000002431 hydrogen Chemical class 0.000 description 11
- 229910000029 sodium carbonate Inorganic materials 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 10
- 239000003610 charcoal Substances 0.000 description 10
- 238000001035 drying Methods 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- 150000001266 acyl halides Chemical class 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- 239000003960 organic solvent Substances 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 9
- 229920006395 saturated elastomer Polymers 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- ULOZGJWEIWAWML-UHFFFAOYSA-N Noralfentanil Chemical compound C1CNCCC1(COC)N(C(=O)CC)C1=CC=CC=C1 ULOZGJWEIWAWML-UHFFFAOYSA-N 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 8
- 238000005917 acylation reaction Methods 0.000 description 8
- 150000008064 anhydrides Chemical class 0.000 description 8
- 238000007796 conventional method Methods 0.000 description 8
- 229910052763 palladium Inorganic materials 0.000 description 8
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 7
- ZTHRQJQJODGZHV-UHFFFAOYSA-N N-phenyl-propionamide Natural products CCC(=O)NC1=CC=CC=C1 ZTHRQJQJODGZHV-UHFFFAOYSA-N 0.000 description 7
- 230000010933 acylation Effects 0.000 description 7
- 229910021529 ammonia Inorganic materials 0.000 description 7
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 7
- 239000006185 dispersion Substances 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 7
- DJVCIHFRPVAFAU-UHFFFAOYSA-N 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 DJVCIHFRPVAFAU-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 150000001335 aliphatic alkanes Chemical class 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 6
- 238000005984 hydrogenation reaction Methods 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 239000003638 chemical reducing agent Substances 0.000 description 5
- 239000003937 drug carrier Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- MWJKXKBVWIHKOB-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenylpiperidin-4-amine Chemical compound C=1C=CC=CC=1NC1(COC)CCNCC1 MWJKXKBVWIHKOB-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- 125000003386 piperidinyl group Chemical group 0.000 description 4
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 4
- WTOYUGZUPNQZHG-UHFFFAOYSA-N (4-anilino-1-benzylpiperidin-4-yl)methanol Chemical compound C1CC(CO)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 WTOYUGZUPNQZHG-UHFFFAOYSA-N 0.000 description 3
- MNNZINNZIQVULG-UHFFFAOYSA-N 2-chloroethylbenzene Chemical class ClCCC1=CC=CC=C1 MNNZINNZIQVULG-UHFFFAOYSA-N 0.000 description 3
- VMJOFTHFJMLIKL-UHFFFAOYSA-N 2-thiophen-2-ylethanol Chemical compound OCCC1=CC=CS1 VMJOFTHFJMLIKL-UHFFFAOYSA-N 0.000 description 3
- AYSXUQVRTPEXOH-UHFFFAOYSA-N 4-anilino-3-methylpiperidine-4-carboxamide Chemical compound CC1CNCCC1(C(N)=O)NC1=CC=CC=C1 AYSXUQVRTPEXOH-UHFFFAOYSA-N 0.000 description 3
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 230000006181 N-acylation Effects 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 150000004645 aluminates Chemical class 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 3
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 235000008504 concentrate Nutrition 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- IZIAEPZQNMQAGS-UHFFFAOYSA-N ethyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 IZIAEPZQNMQAGS-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 125000004970 halomethyl group Chemical group 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 150000002825 nitriles Chemical group 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- BVMUUCRIMILCIA-UHFFFAOYSA-M sodium;4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound [Na+].C1CC(C(=O)[O-])(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 BVMUUCRIMILCIA-UHFFFAOYSA-M 0.000 description 3
- GULNEAPGQHWDMS-UHFFFAOYSA-M sodium;4-anilino-3-methyl-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound [Na+].C1CC(C([O-])=O)(NC=2C=CC=CC=2)C(C)CN1CCC1=CC=CC=C1 GULNEAPGQHWDMS-UHFFFAOYSA-M 0.000 description 3
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 3
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 3
- 238000001665 trituration Methods 0.000 description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- VEDLHCQCGPNHOL-UHFFFAOYSA-N 1-[4-anilino-1-(2-phenylethyl)piperidin-4-yl]ethanone Chemical compound C1CC(C(=O)C)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 VEDLHCQCGPNHOL-UHFFFAOYSA-N 0.000 description 2
- UMPXGSMPVDCSPV-UHFFFAOYSA-N 1-benzyl-4-(4-fluoroanilino)piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(NC=2C=CC(F)=CC=2)CCN1CC1=CC=CC=C1 UMPXGSMPVDCSPV-UHFFFAOYSA-N 0.000 description 2
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 2
- HEBVAMBPYRSREF-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)ethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC1=CC=CN1C HEBVAMBPYRSREF-UHFFFAOYSA-N 0.000 description 2
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 2
- PWPGBBMWCFWLQK-UHFFFAOYSA-N 4-(4-methylanilino)piperidine-4-carboxamide Chemical compound C1=CC(C)=CC=C1NC1(C(N)=O)CCNCC1 PWPGBBMWCFWLQK-UHFFFAOYSA-N 0.000 description 2
- PHLAURNEKNFKNH-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenyl-1-(2-phenylethyl)piperidin-4-amine Chemical compound C1CC(COC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 PHLAURNEKNFKNH-UHFFFAOYSA-N 0.000 description 2
- RTFVPKRWERHIPC-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenyl-1-(2-phenylethyl)piperidin-4-amine;dihydrochloride Chemical compound Cl.Cl.C1CC(COC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 RTFVPKRWERHIPC-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- FOWOXWLATUAFNQ-UHFFFAOYSA-N 4-oxopiperidine-1-carboxylic acid Chemical compound OC(=O)N1CCC(=O)CC1 FOWOXWLATUAFNQ-UHFFFAOYSA-N 0.000 description 2
- YKAYMASDSHFOGI-UHFFFAOYSA-N 4-phenylcyclohexan-1-one Chemical compound C1CC(=O)CCC1C1=CC=CC=C1 YKAYMASDSHFOGI-UHFFFAOYSA-N 0.000 description 2
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 2
- JEXXKCWIDSBELU-UHFFFAOYSA-N C1(=CC=CC=C1)CCOC(=O)C1CCNCC1 Chemical compound C1(=CC=CC=C1)CCOC(=O)C1CCNCC1 JEXXKCWIDSBELU-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 239000012448 Lithium borohydride Substances 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 230000006179 O-acylation Effects 0.000 description 2
- ZLMJMSJWJFRBEC-LZFNBGRKSA-N Potassium-45 Chemical group [45K] ZLMJMSJWJFRBEC-LZFNBGRKSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 2
- OJCZPLDERGDQRJ-UHFFFAOYSA-N Sufentanil citrate Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C1CN(CCC=2SC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 OJCZPLDERGDQRJ-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- VVJWPSNDGLSAMC-UHFFFAOYSA-N [4-anilino-1-(2-phenylethyl)piperidin-4-yl]methanol Chemical compound C1CC(CO)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 VVJWPSNDGLSAMC-UHFFFAOYSA-N 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- WBYWAXJHAXSJNI-UHFFFAOYSA-N cinnamic acid Chemical compound OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- DAQQMJRKGXQPAO-UHFFFAOYSA-N ethyl 4-anilinopiperidine-4-carboxylate Chemical compound C=1C=CC=CC=1NC1(C(=O)OCC)CCNCC1 DAQQMJRKGXQPAO-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 229930195712 glutamate Natural products 0.000 description 2
- 125000001475 halogen functional group Chemical group 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- IHLVCKWPAMTVTG-UHFFFAOYSA-N lithium;carbanide Chemical compound [Li+].[CH3-] IHLVCKWPAMTVTG-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- HFNFODVRYCEIQL-UHFFFAOYSA-N methyl 4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CNCCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 HFNFODVRYCEIQL-UHFFFAOYSA-N 0.000 description 2
- IFQWTLUCYHGSSI-UHFFFAOYSA-N methyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 IFQWTLUCYHGSSI-UHFFFAOYSA-N 0.000 description 2
- NPNNCHCGYDKUTA-UHFFFAOYSA-N methyl 4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 NPNNCHCGYDKUTA-UHFFFAOYSA-N 0.000 description 2
- DVMSHHYWRCBCDO-UHFFFAOYSA-N methyl 4-anilinopiperidine-4-carboxylate Chemical compound C=1C=CC=CC=1NC1(C(=O)OC)CCNCC1 DVMSHHYWRCBCDO-UHFFFAOYSA-N 0.000 description 2
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- JSPCTNUQYWIIOT-UHFFFAOYSA-N piperidine-1-carboxamide Chemical compound NC(=O)N1CCCCC1 JSPCTNUQYWIIOT-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000000638 solvent extraction Methods 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- KKOZKXBAPIYWAT-SNVBAGLBSA-N (2r)-2-[(4-methylphenyl)sulfonylamino]pentanedioic acid Chemical class CC1=CC=C(S(=O)(=O)N[C@H](CCC(O)=O)C(O)=O)C=C1 KKOZKXBAPIYWAT-SNVBAGLBSA-N 0.000 description 1
- IWYDHOAUDWTVEP-ZETCQYMHSA-N (S)-mandelic acid Chemical compound OC(=O)[C@@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-ZETCQYMHSA-N 0.000 description 1
- YWRXDGYUFPGSDH-MDZDMXLPSA-N (e)-n-methyl-n-[(1-methylindol-2-yl)methyl]-3-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)prop-2-enamide Chemical group N1CCCC2=CC(/C=C/C(=O)N(CC=3N(C4=CC=CC=C4C=3)C)C)=CN=C21 YWRXDGYUFPGSDH-MDZDMXLPSA-N 0.000 description 1
- CEGRHPCDLKAHJD-UHFFFAOYSA-N 1,1,1-propanetricarboxylic acid Chemical compound CCC(C(O)=O)(C(O)=O)C(O)=O CEGRHPCDLKAHJD-UHFFFAOYSA-N 0.000 description 1
- CFQDMKNXMQTFCH-UHFFFAOYSA-N 1-(4-anilinopiperidin-4-yl)propan-1-one Chemical compound C=1C=CC=CC=1NC1(C(=O)CC)CCNCC1 CFQDMKNXMQTFCH-UHFFFAOYSA-N 0.000 description 1
- QCZZSANNLWPGEA-UHFFFAOYSA-N 1-(4-phenylphenyl)ethanone Chemical compound C1=CC(C(=O)C)=CC=C1C1=CC=CC=C1 QCZZSANNLWPGEA-UHFFFAOYSA-N 0.000 description 1
- NHMCFPHHEGCJDD-UHFFFAOYSA-N 1-[4-(4-methylanilino)-1-(2-phenylethyl)piperidin-4-yl]ethanone Chemical compound C1CC(C(=O)C)(NC=2C=CC(C)=CC=2)CCN1CCC1=CC=CC=C1 NHMCFPHHEGCJDD-UHFFFAOYSA-N 0.000 description 1
- WDDJNDPYGPBYCK-UHFFFAOYSA-N 1-[4-anilino-1-(2-phenylethyl)piperidin-4-yl]pentan-1-one Chemical compound C1CC(C(=O)CCCC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 WDDJNDPYGPBYCK-UHFFFAOYSA-N 0.000 description 1
- YNAHQBZTIRIXLV-UHFFFAOYSA-N 1-[4-anilino-1-(2-phenylethyl)piperidin-4-yl]propan-1-one Chemical compound C1CC(C(=O)CC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 YNAHQBZTIRIXLV-UHFFFAOYSA-N 0.000 description 1
- RNXSAXPSGSHBCG-UHFFFAOYSA-N 1-benzyl-4-(3-methoxyanilino)piperidine-4-carboxylic acid Chemical compound COC1=CC=CC(NC2(CCN(CC=3C=CC=CC=3)CC2)C(O)=O)=C1 RNXSAXPSGSHBCG-UHFFFAOYSA-N 0.000 description 1
- UDRBGVYYKIYOIB-UHFFFAOYSA-N 1-benzyl-4-(4-methoxyanilino)piperidine-4-carboxylic acid Chemical compound C1=CC(OC)=CC=C1NC1(C(O)=O)CCN(CC=2C=CC=CC=2)CC1 UDRBGVYYKIYOIB-UHFFFAOYSA-N 0.000 description 1
- SINMIPRROZGHTC-UHFFFAOYSA-N 1-benzyl-4-(4-methylanilino)piperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1NC1(C(O)=O)CCN(CC=2C=CC=CC=2)CC1 SINMIPRROZGHTC-UHFFFAOYSA-N 0.000 description 1
- LIVHIJCEICYLHB-UHFFFAOYSA-N 1-benzyl-4-(ethoxymethyl)-n-phenylpiperidin-4-amine;dihydrochloride Chemical compound Cl.Cl.C1CC(COCC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 LIVHIJCEICYLHB-UHFFFAOYSA-N 0.000 description 1
- QBUUEBUUMUYSIY-UHFFFAOYSA-N 1-benzyl-4-(methoxymethyl)-n-phenylpiperidin-4-amine Chemical compound C1CC(COC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 QBUUEBUUMUYSIY-UHFFFAOYSA-N 0.000 description 1
- GGFUEGGUUWHRGP-UHFFFAOYSA-N 1-benzyl-4-[3-(trifluoromethyl)anilino]piperidine-4-carbonitrile Chemical compound FC(F)(F)C1=CC=CC(NC2(CCN(CC=3C=CC=CC=3)CC2)C#N)=C1 GGFUEGGUUWHRGP-UHFFFAOYSA-N 0.000 description 1
- YWMJJHSTSFKUJH-UHFFFAOYSA-N 1-benzyl-4-[3-(trifluoromethyl)anilino]piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(NC=2C=C(C=CC=2)C(F)(F)F)CCN1CC1=CC=CC=C1 YWMJJHSTSFKUJH-UHFFFAOYSA-N 0.000 description 1
- NAABYRDMPMGIBL-UHFFFAOYSA-N 1-benzyl-4-methyl-n-phenylpiperidin-4-amine Chemical compound C1CC(C)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 NAABYRDMPMGIBL-UHFFFAOYSA-N 0.000 description 1
- SKQSUPNVAJANKJ-UHFFFAOYSA-N 1-benzyl-n-phenyl-4-(propoxymethyl)piperidin-4-amine;dihydrochloride Chemical compound Cl.Cl.C1CC(COCCC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 SKQSUPNVAJANKJ-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- KMXUKZCMNKLUTF-UHFFFAOYSA-N 1-chloro-4-(2-chloroethyl)benzene Chemical compound ClCCC1=CC=C(Cl)C=C1 KMXUKZCMNKLUTF-UHFFFAOYSA-N 0.000 description 1
- SYYOUHJJSOLSJD-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)acetic acid Chemical compound CN1C=CC=C1CC(O)=O SYYOUHJJSOLSJD-UHFFFAOYSA-N 0.000 description 1
- OWUIUYMLDSTENT-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)ethanol Chemical compound CN1C=CC=C1CCO OWUIUYMLDSTENT-UHFFFAOYSA-N 0.000 description 1
- WPDWOCRJBPXJFM-UHFFFAOYSA-N 2-bromo-1-phenylpropan-1-one Chemical compound CC(Br)C(=O)C1=CC=CC=C1 WPDWOCRJBPXJFM-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- LFWBXHYTNKEQAI-UHFFFAOYSA-N 2-naphthalen-1-ylethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC1=CC=CC2=CC=CC=C12 LFWBXHYTNKEQAI-UHFFFAOYSA-N 0.000 description 1
- DOZZSWAOPDYVLH-UHFFFAOYSA-N 2-phenylpropanamide Chemical compound NC(=O)C(C)C1=CC=CC=C1 DOZZSWAOPDYVLH-UHFFFAOYSA-N 0.000 description 1
- NWVSHHSCDXUYRS-UHFFFAOYSA-N 2-piperidin-4-ylacetamide Chemical compound NC(=O)CC1CCNCC1 NWVSHHSCDXUYRS-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ZSLYVCXNFQPCGT-UHFFFAOYSA-N 3-carboxy-3,5-dihydroxy-5-oxopentanoate;methyl 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidin-1-ium-4-carboxylate Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 ZSLYVCXNFQPCGT-UHFFFAOYSA-N 0.000 description 1
- PFCHFHIRKBAQGU-UHFFFAOYSA-N 3-hexanone Chemical compound CCCC(=O)CC PFCHFHIRKBAQGU-UHFFFAOYSA-N 0.000 description 1
- VQMPTVQCADWACQ-UHFFFAOYSA-N 3-methylpentan-3-amine Chemical compound CCC(C)(N)CC VQMPTVQCADWACQ-UHFFFAOYSA-N 0.000 description 1
- SFKIMFDURHCIKT-UHFFFAOYSA-N 4-(3-methoxyanilino)-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound COC1=CC=CC(NC2(CCN(CCC=3C=CC=CC=3)CC2)C(O)=O)=C1 SFKIMFDURHCIKT-UHFFFAOYSA-N 0.000 description 1
- DZVAELRQMYTGAQ-UHFFFAOYSA-N 4-(4-fluoroanilino)-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(NC=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 DZVAELRQMYTGAQ-UHFFFAOYSA-N 0.000 description 1
- MECVKUYLWNZQTF-UHFFFAOYSA-N 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxamide Chemical compound C1=CC(C)=CC=C1NC1(C(N)=O)CCN(CCC=2C=CC=CC=2)CC1 MECVKUYLWNZQTF-UHFFFAOYSA-N 0.000 description 1
- RIMCNXPZHSRMSU-UHFFFAOYSA-N 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1NC1(C(O)=O)CCN(CCC=2C=CC=CC=2)CC1 RIMCNXPZHSRMSU-UHFFFAOYSA-N 0.000 description 1
- DPBWFNDFMCCGGJ-UHFFFAOYSA-N 4-Piperidine carboxamide Chemical compound NC(=O)C1CCNCC1 DPBWFNDFMCCGGJ-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- VWCPMNASPOCMNY-UHFFFAOYSA-N 4-anilino-1-(2-phenylethyl)piperidine-4-carbonitrile Chemical compound C1CC(C#N)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 VWCPMNASPOCMNY-UHFFFAOYSA-N 0.000 description 1
- PPQMZAUSWIDYTH-UHFFFAOYSA-N 4-anilino-1-(2-phenylethyl)piperidine-4-carboxamide Chemical compound C1CC(C(=O)N)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 PPQMZAUSWIDYTH-UHFFFAOYSA-N 0.000 description 1
- QNDVTIFLVWHAJR-UHFFFAOYSA-N 4-anilino-1-benzylpiperidine-4-carboxylic acid;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)O)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 QNDVTIFLVWHAJR-UHFFFAOYSA-N 0.000 description 1
- FLEAJPXKUFNEKE-UHFFFAOYSA-N 4-anilino-1-ethoxycarbonylpiperidine-4-carboxylic acid Chemical compound C1CN(C(=O)OCC)CCC1(C(O)=O)NC1=CC=CC=C1 FLEAJPXKUFNEKE-UHFFFAOYSA-N 0.000 description 1
- GUBFHFABUBMECE-UHFFFAOYSA-N 4-anilino-3-methyl-1-(2-phenylethyl)piperidine-4-carboxamide Chemical compound C1CC(C(N)=O)(NC=2C=CC=CC=2)C(C)CN1CCC1=CC=CC=C1 GUBFHFABUBMECE-UHFFFAOYSA-N 0.000 description 1
- WAIIZELGDHTPRX-UHFFFAOYSA-N 4-anilinopiperidine-4-carboxamide Chemical compound C=1C=CC=CC=1NC1(C(=O)N)CCNCC1 WAIIZELGDHTPRX-UHFFFAOYSA-N 0.000 description 1
- QIJFNINHULHMLY-UHFFFAOYSA-N 4-anilinopiperidine-4-carboxylic acid Chemical class C=1C=CC=CC=1NC1(C(=O)O)CCNCC1 QIJFNINHULHMLY-UHFFFAOYSA-N 0.000 description 1
- WRFYIYOXJWKONR-UHFFFAOYSA-N 4-bromo-2-methoxyaniline Chemical compound COC1=CC(Br)=CC=C1N WRFYIYOXJWKONR-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- KBIWNQVZKHSHTI-UHFFFAOYSA-N 4-n,4-n-dimethylbenzene-1,4-diamine;oxalic acid Chemical compound OC(=O)C(O)=O.CN(C)C1=CC=C(N)C=C1 KBIWNQVZKHSHTI-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- FUFZNHHSSMCXCZ-UHFFFAOYSA-N 5-piperidin-4-yl-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole Chemical compound FC(F)(F)C1=CC=CC(C=2N=C(ON=2)C2CCNCC2)=C1 FUFZNHHSSMCXCZ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical class [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- VUQHWKXCERFCII-UHFFFAOYSA-N C(C(=O)O)(=O)O.CC(C)N1CCC(CC1)(C(=O)OC)N(C1=CC=CC=C1)C(CC)=O Chemical compound C(C(=O)O)(=O)O.CC(C)N1CCC(CC1)(C(=O)OC)N(C1=CC=CC=C1)C(CC)=O VUQHWKXCERFCII-UHFFFAOYSA-N 0.000 description 1
- IZTJJKZPDBUODZ-UHFFFAOYSA-N C(C(=O)O)(=O)O.N1(CCCCC1)C(=O)O Chemical compound C(C(=O)O)(=O)O.N1(CCCCC1)C(=O)O IZTJJKZPDBUODZ-UHFFFAOYSA-N 0.000 description 1
- HTWCZSWTNXMLCG-UHFFFAOYSA-N C(C(=O)O)(=O)O.O=C(CC)N(C1=CC=CC=C1)C1(CCN(CC1)CCCC1=CC=CC=C1)C(=O)OC Chemical compound C(C(=O)O)(=O)O.O=C(CC)N(C1=CC=CC=C1)C1(CCN(CC1)CCCC1=CC=CC=C1)C(=O)OC HTWCZSWTNXMLCG-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- LQMPWKIGXLRYLZ-UHFFFAOYSA-N Cl.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 Chemical compound Cl.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 LQMPWKIGXLRYLZ-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical compound [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- KFIABRWWCRCOHZ-UHFFFAOYSA-N N-[1-hexyl-4-(methoxymethyl)piperidin-4-yl]-N-phenylpropanamide oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCCCCC)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 KFIABRWWCRCOHZ-UHFFFAOYSA-N 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- MBWQAAXIGRTPSI-UHFFFAOYSA-N N-[4-(methoxymethyl)-1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC(OC)=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 MBWQAAXIGRTPSI-UHFFFAOYSA-N 0.000 description 1
- LKJPYSCBVHEWIU-UHFFFAOYSA-N N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide Chemical compound C=1C=C(C#N)C(C(F)(F)F)=CC=1NC(=O)C(O)(C)CS(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- BUNNUIAYZRHCFZ-UHFFFAOYSA-N OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(C)=O)N(C(=O)OCC)C1=CC=C(F)C=C1 Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(C)=O)N(C(=O)OCC)C1=CC=C(F)C=C1 BUNNUIAYZRHCFZ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- GWBWGPRZOYDADH-UHFFFAOYSA-N [C].[Na] Chemical compound [C].[Na] GWBWGPRZOYDADH-UHFFFAOYSA-N 0.000 description 1
- WJEIYVAPNMUNIU-UHFFFAOYSA-N [Na].OC(O)=O Chemical compound [Na].OC(O)=O WJEIYVAPNMUNIU-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical class COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000005129 aryl carbonyl group Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- IERVPIYQSPDPFD-UHFFFAOYSA-N benzyl 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OCC=1C=CC=CC=1)N(C(=O)CC)C1=CC=CC=C1 IERVPIYQSPDPFD-UHFFFAOYSA-N 0.000 description 1
- LDECUSDQMXVUMP-UHFFFAOYSA-N benzyl 3-[6-[[2-(butylamino)-1-[3-methoxycarbonyl-4-(2-methoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-hexylamino]-6-oxohexyl]-4-methyl-2-oxo-6-(4-phenylphenyl)-1,6-dihydropyrimidine-5-carboxylate Chemical compound O=C1NC(C=2C=CC(=CC=2)C=2C=CC=CC=2)C(C(=O)OCC=2C=CC=CC=2)=C(C)N1CCCCCC(=O)N(CCCCCC)C(C(=O)NCCCC)C1=CC=C(OCC(=O)OC)C(C(=O)OC)=C1 LDECUSDQMXVUMP-UHFFFAOYSA-N 0.000 description 1
- JKGWRSWTPWMXSY-UHFFFAOYSA-N benzyl 4-(n-ethoxycarbonylanilino)-4-(methoxymethyl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC=2C=CC=CC=2)CCC1(COC)N(C(=O)OCC)C1=CC=CC=C1 JKGWRSWTPWMXSY-UHFFFAOYSA-N 0.000 description 1
- RQQGYKUQYGGDFL-UHFFFAOYSA-N benzyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(NC=1C=CC=CC=1)C(=O)OCC1=CC=CC=C1 RQQGYKUQYGGDFL-UHFFFAOYSA-N 0.000 description 1
- VLRSOCXRUOGIFG-UHFFFAOYSA-N benzyl 4-anilino-4-(methoxymethyl)piperidine-1-carboxylate Chemical compound C1CC(COC)(NC=2C=CC=CC=2)CCN1C(=O)OCC1=CC=CC=C1 VLRSOCXRUOGIFG-UHFFFAOYSA-N 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- FZFYOUJTOSBFPQ-UHFFFAOYSA-M dipotassium;hydroxide Chemical compound [OH-].[K+].[K+] FZFYOUJTOSBFPQ-UHFFFAOYSA-M 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- UZUODNWWWUQRIR-UHFFFAOYSA-L disodium;3-aminonaphthalene-1,5-disulfonate Chemical compound [Na+].[Na+].C1=CC=C(S([O-])(=O)=O)C2=CC(N)=CC(S([O-])(=O)=O)=C21 UZUODNWWWUQRIR-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000011978 dissolution method Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- RVUFXVPTRGVZPZ-UHFFFAOYSA-N ethyl 1-(2-hydroxy-2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CC(O)C1=CC=CC=C1 RVUFXVPTRGVZPZ-UHFFFAOYSA-N 0.000 description 1
- YKVDQHUYKKCVIC-UHFFFAOYSA-N ethyl 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 YKVDQHUYKKCVIC-UHFFFAOYSA-N 0.000 description 1
- XHLZHYYNNKWLGB-UHFFFAOYSA-N ethyl 1-benzyl-4-(4-fluoroanilino)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)OCC)(NC=2C=CC(F)=CC=2)CCN1CC1=CC=CC=C1 XHLZHYYNNKWLGB-UHFFFAOYSA-N 0.000 description 1
- ZLMQQFXTMZXHIB-UHFFFAOYSA-N ethyl 2,4-dioxo-1-phenyl-3-oxa-1,8-diazaspiro[4.5]decane-8-carboxylate Chemical compound C1CN(C(=O)OCC)CCC21C(=O)OC(=O)N2C1=CC=CC=C1 ZLMQQFXTMZXHIB-UHFFFAOYSA-N 0.000 description 1
- HCPOCMMGKBZWSJ-UHFFFAOYSA-N ethyl 3-hydrazinyl-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)NN HCPOCMMGKBZWSJ-UHFFFAOYSA-N 0.000 description 1
- FGKAUZKTIULETR-UHFFFAOYSA-N ethyl 4-(4-fluoroanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)OCC)(NC=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 FGKAUZKTIULETR-UHFFFAOYSA-N 0.000 description 1
- SPERRCPYPOXSOZ-UHFFFAOYSA-N ethyl 4-(4-fluoroanilino)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C=1C=C(F)C=CC=1NC1(C(=O)OCC)CCNCC1 SPERRCPYPOXSOZ-UHFFFAOYSA-N 0.000 description 1
- KCYIKQLPEKFMRF-UHFFFAOYSA-N ethyl 4-(4-methyl-N-propanoylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC(C)=CC=2)CCN1CCC1=CC=CC=C1 KCYIKQLPEKFMRF-UHFFFAOYSA-N 0.000 description 1
- FCHANJGLLFHTRV-UHFFFAOYSA-N ethyl 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)OCC)(NC=2C=CC(C)=CC=2)CCN1CCC1=CC=CC=C1 FCHANJGLLFHTRV-UHFFFAOYSA-N 0.000 description 1
- RPVMTHSREUIZIT-UHFFFAOYSA-N ethyl 4-(n-butanoylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OCC)N(C(=O)CCC)C1=CC=CC=C1 RPVMTHSREUIZIT-UHFFFAOYSA-N 0.000 description 1
- FGZOTFXLYZDEPL-UHFFFAOYSA-N ethyl 4-(n-propanoylanilino)-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CCC1=CC=CS1 FGZOTFXLYZDEPL-UHFFFAOYSA-N 0.000 description 1
- SHYZHCKFTRVKRT-UHFFFAOYSA-N ethyl 4-(n-propanoylanilino)-1-prop-2-enylpiperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C=1C=CC=CC=1N(C(=O)CC)C1(C(=O)OCC)CCN(CC=C)CC1 SHYZHCKFTRVKRT-UHFFFAOYSA-N 0.000 description 1
- CPDREELMVQAIKC-UHFFFAOYSA-N ethyl 4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 CPDREELMVQAIKC-UHFFFAOYSA-N 0.000 description 1
- YALBVMMSEAQGLO-UHFFFAOYSA-N ethyl 4-anilino-1-propan-2-ylpiperidine-4-carboxylate Chemical compound C=1C=CC=CC=1NC1(C(=O)OCC)CCN(C(C)C)CC1 YALBVMMSEAQGLO-UHFFFAOYSA-N 0.000 description 1
- ZSHUDZNARDEKAX-UHFFFAOYSA-N ethyl 4-anilino-4-propanoylpiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1(C(=O)CC)NC1=CC=CC=C1 ZSHUDZNARDEKAX-UHFFFAOYSA-N 0.000 description 1
- MGTMBYUHMOYLQI-UHFFFAOYSA-N ethyl N-[4-(methoxymethyl)-1-(2-phenylethyl)piperidin-4-yl]-N-phenylcarbamate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(COC)N(C(=O)OCC)C1=CC=CC=C1 MGTMBYUHMOYLQI-UHFFFAOYSA-N 0.000 description 1
- KRXRKXPHJRLXIZ-UHFFFAOYSA-N ethyl n-[4-(methoxymethyl)piperidin-4-yl]-n-phenylcarbamate Chemical compound C1CNCCC1(COC)N(C(=O)OCC)C1=CC=CC=C1 KRXRKXPHJRLXIZ-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 235000013675 iodine Nutrition 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- ODBLHEXUDAPZAU-UHFFFAOYSA-N isocitric acid Chemical compound OC(=O)C(O)C(C(O)=O)CC(O)=O ODBLHEXUDAPZAU-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- SIKUJMOJXPGHSR-UHFFFAOYSA-N methyl 1-(1-phenylpropan-2-yl)-4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CN(C(C)CC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 SIKUJMOJXPGHSR-UHFFFAOYSA-N 0.000 description 1
- AYJPDKSKMSRRSZ-UHFFFAOYSA-N methyl 1-(2-hydroxy-2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate oxalic acid Chemical compound C(C(=O)O)(=O)O.OC(CN1CCC(CC1)(C(=O)OC)N(C1=CC=CC=C1)C(CC)=O)C1=CC=CC=C1 AYJPDKSKMSRRSZ-UHFFFAOYSA-N 0.000 description 1
- UWEAMNXGKIBMKS-UHFFFAOYSA-N methyl 1-(2-phenylethyl)-4-[3-(trifluoromethyl)anilino]piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CC(C(=O)OC)(NC=2C=C(C=CC=2)C(F)(F)F)CCN1CCC1=CC=CC=C1 UWEAMNXGKIBMKS-UHFFFAOYSA-N 0.000 description 1
- CXLSUTOBXXFOEV-UHFFFAOYSA-N methyl 1-[2-(4-methylphenyl)ethyl]-4-(n-propanoylanilino)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC(C)=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 CXLSUTOBXXFOEV-UHFFFAOYSA-N 0.000 description 1
- PZTAXFCWFQYJIT-UHFFFAOYSA-N methyl 1-benzyl-4-(4-fluoroanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=CC(F)=CC=2)CCN1CC1=CC=CC=C1 PZTAXFCWFQYJIT-UHFFFAOYSA-N 0.000 description 1
- BVPKBZOMDAUYBV-UHFFFAOYSA-N methyl 1-benzyl-4-(4-methoxyanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=CC(OC)=CC=2)CCN1CC1=CC=CC=C1 BVPKBZOMDAUYBV-UHFFFAOYSA-N 0.000 description 1
- KOXXLKOHLLPNNF-UHFFFAOYSA-N methyl 1-heptyl-4-(N-propanoylanilino)piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCCCCCC)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 KOXXLKOHLLPNNF-UHFFFAOYSA-N 0.000 description 1
- KBSKNDBMYXNRRE-UHFFFAOYSA-N methyl 1-hexyl-4-(N-propanoylanilino)piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCCCCC)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 KBSKNDBMYXNRRE-UHFFFAOYSA-N 0.000 description 1
- GSFWJSRARHQUNB-UHFFFAOYSA-N methyl 1-octyl-4-(N-propanoylanilino)piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCCCCCCC)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 GSFWJSRARHQUNB-UHFFFAOYSA-N 0.000 description 1
- JWXGBLNGCIGLBH-UHFFFAOYSA-N methyl 3-methyl-4-oxopiperidine-1-carboxylate Chemical compound COC(=O)N1CCC(=O)C(C)C1 JWXGBLNGCIGLBH-UHFFFAOYSA-N 0.000 description 1
- NPOMYZMTQSCHSC-UHFFFAOYSA-N methyl 4-(3-methoxyanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=C(OC)C=CC=2)CCN1CCC1=CC=CC=C1 NPOMYZMTQSCHSC-UHFFFAOYSA-N 0.000 description 1
- SQYQVMHGGUYZAY-UHFFFAOYSA-N methyl 4-(3-methoxyanilino)piperidine-4-carboxylate Chemical compound C=1C=CC(OC)=CC=1NC1(C(=O)OC)CCNCC1 SQYQVMHGGUYZAY-UHFFFAOYSA-N 0.000 description 1
- LQMWMBAVAZHELP-UHFFFAOYSA-N methyl 4-(4-fluoro-N-propanoylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=C(F)C=C1 LQMWMBAVAZHELP-UHFFFAOYSA-N 0.000 description 1
- YEQHKOKSOZNVNF-UHFFFAOYSA-N methyl 4-(4-fluoroanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 YEQHKOKSOZNVNF-UHFFFAOYSA-N 0.000 description 1
- JCWHBAHRXUVHCC-UHFFFAOYSA-N methyl 4-(4-methoxyanilino)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C=1C=C(OC)C=CC=1NC1(C(=O)OC)CCNCC1 JCWHBAHRXUVHCC-UHFFFAOYSA-N 0.000 description 1
- QUXAMUASVHKYOB-UHFFFAOYSA-N methyl 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC(C)=CC=2)CCN1CCC1=CC=CC=C1 QUXAMUASVHKYOB-UHFFFAOYSA-N 0.000 description 1
- PPFMPZCMPFQJCK-UHFFFAOYSA-N methyl 4-(N-propanoylanilino)-1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=C(C=CC=2)C(F)(F)F)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 PPFMPZCMPFQJCK-UHFFFAOYSA-N 0.000 description 1
- QQAHAKMIHJECKP-UHFFFAOYSA-N methyl 4-(n-ethoxycarbonylanilino)piperidine-4-carboxylate Chemical compound C1CNCCC1(C(=O)OC)N(C(=O)OCC)C1=CC=CC=C1 QQAHAKMIHJECKP-UHFFFAOYSA-N 0.000 description 1
- BABZHNGIRGHXSO-UHFFFAOYSA-N methyl 4-(n-propanoylanilino)-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2SC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 BABZHNGIRGHXSO-UHFFFAOYSA-N 0.000 description 1
- KVLGIQMTFXBSLU-UHFFFAOYSA-N methyl 4-[n-(cyclopropanecarbonyl)anilino]-1-(2-phenylethyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CC(C(=O)OC)(N(C(=O)C2CC2)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 KVLGIQMTFXBSLU-UHFFFAOYSA-N 0.000 description 1
- WIYLCEATVIZODY-UHFFFAOYSA-N methyl 4-anilino-1-propan-2-ylpiperidine-4-carboxylate Chemical compound C=1C=CC=CC=1NC1(C(=O)OC)CCN(C(C)C)CC1 WIYLCEATVIZODY-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- RZVWBASHHLFBJF-UHFFFAOYSA-N methyl piperidine-4-carboxylate Chemical compound COC(=O)C1CCNCC1 RZVWBASHHLFBJF-UHFFFAOYSA-N 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- UDGSVBYJWHOHNN-UHFFFAOYSA-N n',n'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- XNKPLHFJLVQKRE-UHFFFAOYSA-N n-[1-(1-hydroxy-1-phenylpropan-2-yl)-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(C(C)C(O)C=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 XNKPLHFJLVQKRE-UHFFFAOYSA-N 0.000 description 1
- ORGBRUMLZQRHAY-UHFFFAOYSA-N n-[1-(2-anilinoethyl)-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCNC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 ORGBRUMLZQRHAY-UHFFFAOYSA-N 0.000 description 1
- VSWUICYVPZNQCU-UHFFFAOYSA-N n-[1-(2-anilinoethyl)-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide;dihydrochloride Chemical compound Cl.Cl.C1CN(CCNC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 VSWUICYVPZNQCU-UHFFFAOYSA-N 0.000 description 1
- FYAGIJMJHIDNBX-UHFFFAOYSA-N n-[1-[2-(4-aminophenyl)ethyl]-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCC=2C=CC(N)=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 FYAGIJMJHIDNBX-UHFFFAOYSA-N 0.000 description 1
- UEHITAZETWNUOP-UHFFFAOYSA-N n-[1-benzyl-4-(ethoxymethyl)piperidin-4-yl]-n-phenylpropanamide;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(COCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CC1=CC=CC=C1 UEHITAZETWNUOP-UHFFFAOYSA-N 0.000 description 1
- RIGNIZMZYKGGHY-UHFFFAOYSA-N n-[1-benzyl-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 RIGNIZMZYKGGHY-UHFFFAOYSA-N 0.000 description 1
- AFLKBESYVTWUMU-UHFFFAOYSA-N n-[1-benzyl-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 AFLKBESYVTWUMU-UHFFFAOYSA-N 0.000 description 1
- IUFFNKZCZVDKAA-UHFFFAOYSA-N n-[1-butyl-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide;hydrochloride Chemical compound Cl.C1CN(CCCC)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 IUFFNKZCZVDKAA-UHFFFAOYSA-N 0.000 description 1
- KTBOXWNWIXXKSW-UHFFFAOYSA-N n-[4-(ethoxymethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C=1C=CC=CC=1N(C(=O)CC)C1(COCC)CCNCC1 KTBOXWNWIXXKSW-UHFFFAOYSA-N 0.000 description 1
- SMJQGAOLVOHPAQ-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-(1-oxo-1-phenylpropan-2-yl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(C(C)C(=O)C=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 SMJQGAOLVOHPAQ-UHFFFAOYSA-N 0.000 description 1
- PKCVQFDFGMSBMV-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCC=2C=CC(=CC=2)[N+]([O-])=O)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 PKCVQFDFGMSBMV-UHFFFAOYSA-N 0.000 description 1
- KYZHCRUJJKQLIZ-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-prop-2-enylpiperidin-4-yl]-n-phenylpropanamide;hydrochloride Chemical compound Cl.C1CN(CC=C)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 KYZHCRUJJKQLIZ-UHFFFAOYSA-N 0.000 description 1
- ICCKRZDLWUZYPR-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-propylpiperidin-4-yl]-n-phenylpropanamide;hydrochloride Chemical compound Cl.C1CN(CCC)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 ICCKRZDLWUZYPR-UHFFFAOYSA-N 0.000 description 1
- PVIIZOBCFXGBQE-UHFFFAOYSA-N n-[4-acetyl-1-(2-phenylethyl)piperidin-4-yl]-n-(4-methylphenyl)propanamide Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(C)=O)N(C(=O)CC)C1=CC=C(C)C=C1 PVIIZOBCFXGBQE-UHFFFAOYSA-N 0.000 description 1
- DPIKFBCGUGZJES-UHFFFAOYSA-N n-[4-acetyl-1-(2-phenylethyl)piperidin-4-yl]-n-phenylpropanamide;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(C)=O)N(C(=O)CC)C1=CC=CC=C1 DPIKFBCGUGZJES-UHFFFAOYSA-N 0.000 description 1
- YDJXNYNKKXZBMP-UHFFFAOYSA-N n-phenethyl-4-piperidinone Chemical compound C1CC(=O)CCN1CCC1=CC=CC=C1 YDJXNYNKKXZBMP-UHFFFAOYSA-N 0.000 description 1
- PJTTUONVSVGXRW-UHFFFAOYSA-N n-phenyl-1-(2-phenylethyl)-4-(phenylmethoxymethyl)piperidin-4-amine Chemical compound C1CC(COCC=2C=CC=CC=2)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 PJTTUONVSVGXRW-UHFFFAOYSA-N 0.000 description 1
- VZZQQOHWILSVFT-UHFFFAOYSA-N n-phenyl-n-[1-(2-phenylethyl)-4-(phenylmethoxymethyl)piperidin-4-yl]propanamide;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC=CC=2)CCC1(COCC=1C=CC=CC=1)N(C(=O)CC)C1=CC=CC=C1 VZZQQOHWILSVFT-UHFFFAOYSA-N 0.000 description 1
- JOMKVIZDKRYFCT-UHFFFAOYSA-N n-phenyl-n-[1-(2-phenylethyl)-4-(propoxymethyl)piperidin-4-yl]propanamide;hydrochloride Chemical compound Cl.C1CC(COCCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 JOMKVIZDKRYFCT-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FATBGEAMYMYZAF-KTKRTIGZSA-N oleamide Chemical compound CCCCCCCC\C=C/CCCCCCCC(N)=O FATBGEAMYMYZAF-KTKRTIGZSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- HWOCNWRPIUYVDF-UHFFFAOYSA-N oxalic acid N-phenyl-1-(2-phenylethyl)-4-(phenylmethoxymethyl)piperidin-4-amine Chemical compound OC(=O)C(O)=O.C1CC(COCC=2C=CC=CC=2)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 HWOCNWRPIUYVDF-UHFFFAOYSA-N 0.000 description 1
- GEVPUGOOGXGPIO-UHFFFAOYSA-N oxalic acid;dihydrate Chemical compound O.O.OC(=O)C(O)=O GEVPUGOOGXGPIO-UHFFFAOYSA-N 0.000 description 1
- ROCHZUNCIZLTRQ-UHFFFAOYSA-N oxalic acid;propan-2-ol Chemical compound CC(C)O.OC(=O)C(O)=O ROCHZUNCIZLTRQ-UHFFFAOYSA-N 0.000 description 1
- OZHOHTGAQOJLCS-UHFFFAOYSA-N oxalic acid;propanoic acid Chemical compound CCC(O)=O.OC(=O)C(O)=O OZHOHTGAQOJLCS-UHFFFAOYSA-N 0.000 description 1
- CQVJYXJCWBFYSJ-UHFFFAOYSA-N oxalic acid;propyl 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OCCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 CQVJYXJCWBFYSJ-UHFFFAOYSA-N 0.000 description 1
- PIPVCOVQLQUMQY-UHFFFAOYSA-N oxalic acid;propyl 4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OCCC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 PIPVCOVQLQUMQY-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- 125000004351 phenylcyclohexyl group Chemical group C1(=CC=CC=C1)C1(CCCCC1)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical compound NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 description 1
- RJUAEBLXGFKZMS-UHFFFAOYSA-N piperidin-1-ylmethanol Chemical compound OCN1CCCCC1 RJUAEBLXGFKZMS-UHFFFAOYSA-N 0.000 description 1
- ABABQFDOYCEIRS-UHFFFAOYSA-N piperidin-2-ylidenemethanone Chemical compound O=C=C1CCCCN1 ABABQFDOYCEIRS-UHFFFAOYSA-N 0.000 description 1
- IIKFXOLJMNWWCH-UHFFFAOYSA-N piperidine-1,4-dicarboxylic acid Chemical compound OC(=O)C1CCN(C(O)=O)CC1 IIKFXOLJMNWWCH-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- NOTVAPJNGZMVSD-UHFFFAOYSA-N potassium monoxide Inorganic materials [K]O[K] NOTVAPJNGZMVSD-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- UQPGCLOZEWKMBO-UHFFFAOYSA-N prop-2-enyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC=C)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 UQPGCLOZEWKMBO-UHFFFAOYSA-N 0.000 description 1
- RMIGTEGRHJUHHM-UHFFFAOYSA-N propan-1-ol;hydrochloride Chemical compound Cl.CCCO RMIGTEGRHJUHHM-UHFFFAOYSA-N 0.000 description 1
- YKCXSUSMKWMAGB-UHFFFAOYSA-N propan-2-yl 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC(C)C)N(C(=O)CC)C1=CC=CC=C1 YKCXSUSMKWMAGB-UHFFFAOYSA-N 0.000 description 1
- VTOVDQCZYVGCIR-UHFFFAOYSA-N propan-2-yl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC(C)C)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 VTOVDQCZYVGCIR-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- BQCWHLMBFROKFM-UHFFFAOYSA-N propyl 1-(2-hydroxy-2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate hydrochloride Chemical compound Cl.C1CC(C(=O)OCCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CC(O)C1=CC=CC=C1 BQCWHLMBFROKFM-UHFFFAOYSA-N 0.000 description 1
- TWZDKOGMJAXTAL-UHFFFAOYSA-N propyl 4-(n-propanoylanilino)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C=CC=CC=1N(C(=O)CC)C1(C(=O)OCCC)CCNCC1 TWZDKOGMJAXTAL-UHFFFAOYSA-N 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000010956 selective crystallization Methods 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229960005137 succinic acid Drugs 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000007910 systemic administration Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- NRTLTGGGUQIRRT-UHFFFAOYSA-N triethylazanium;bromide Chemical compound [Br-].CC[NH+](CC)CC NRTLTGGGUQIRRT-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/333—Radicals substituted by oxygen or sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
- C07D211/66—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4 having a hetero atom as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Pain & Pain Management (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Pyrrole Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US55851175A | 1975-03-14 | 1975-03-14 | |
US05/648,685 US3998834A (en) | 1975-03-14 | 1976-01-13 | N-(4-piperidinyl)-n-phenylamides and -carbamates |
Publications (2)
Publication Number | Publication Date |
---|---|
JPS51115478A JPS51115478A (en) | 1976-10-12 |
JPS5946217B2 true JPS5946217B2 (ja) | 1984-11-10 |
Family
ID=27071767
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP51026226A Expired JPS5946217B2 (ja) | 1975-03-14 | 1976-03-12 | ピペリジン誘導体、その酸付加塩および光学異性体 |
Country Status (28)
Country | Link |
---|---|
US (1) | US3998834A (en, 2012) |
JP (1) | JPS5946217B2 (en, 2012) |
AT (1) | AT359493B (en, 2012) |
AU (1) | AU503632B2 (en, 2012) |
BG (1) | BG28259A3 (en, 2012) |
CA (1) | CA1080232A (en, 2012) |
CH (1) | CH629486A5 (en, 2012) |
CZ (1) | CZ278060B6 (en, 2012) |
DE (1) | DE2610228A1 (en, 2012) |
DK (1) | DK148960C (en, 2012) |
ES (1) | ES446034A1 (en, 2012) |
FI (1) | FI61481C (en, 2012) |
FR (1) | FR2303546A1 (en, 2012) |
GB (1) | GB1538938A (en, 2012) |
HU (1) | HU172963B (en, 2012) |
IE (1) | IE42512B1 (en, 2012) |
IL (1) | IL49204A (en, 2012) |
IT (1) | IT1057988B (en, 2012) |
LU (1) | LU74511A1 (en, 2012) |
NL (1) | NL185279C (en, 2012) |
NO (1) | NO146162C (en, 2012) |
NZ (1) | NZ180096A (en, 2012) |
PH (1) | PH12746A (en, 2012) |
PL (1) | PL102474B1 (en, 2012) |
PT (1) | PT64898B (en, 2012) |
SE (1) | SE426486B (en, 2012) |
SU (1) | SU1227109A3 (en, 2012) |
YU (1) | YU39960B (en, 2012) |
Families Citing this family (61)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4179569A (en) * | 1975-03-14 | 1979-12-18 | Janssen Pharmaceutica N.V. | N-(4-piperidinyl)-N-phenylamides |
US4208418A (en) * | 1975-09-23 | 1980-06-17 | Janssen Pharmaceutica N.V. | N-Aryl-N-(1-alkyl-4-piperidinyl)arylacetamides |
US4225606A (en) * | 1975-09-23 | 1980-09-30 | Janssen Pharmaceutica N.V. | N-Aryl-N-(1-L-4-piperidinyl)arylacetamides |
FR2389622B1 (en, 2012) * | 1977-05-05 | 1982-05-21 | Janssen Pharmaceutica Nv | |
US4167574A (en) * | 1978-03-13 | 1979-09-11 | Janssen Pharmaceutica, N.V. | N-phenyl-N-(4-piperidinyl)amides |
US4584303A (en) * | 1984-04-09 | 1986-04-22 | The Boc Group, Inc. | N-aryl-N-(4-piperidinyl)amides and pharmaceutical compositions and method employing such compounds |
FR2608602A1 (fr) * | 1986-12-23 | 1988-06-24 | Cerm Cent Europ Rech Mauvernay | Nouvelles 3-piperidineamines ou 3-azepineamines substituees, leur preparation et leurs applications en therapeutique |
US5013742A (en) * | 1987-11-02 | 1991-05-07 | Boc, Inc. | 4-phenyl-4-N-(phenyl) amido piperidine derivatives and pharmaceutical compositions and method employing such compounds |
US4957929A (en) * | 1987-11-02 | 1990-09-18 | Boc, Inc. | 4-phenyl-4-[N-(phenyl)amido]piperidine compounds and pharmaceutical compositions employing such compounds |
US4791121A (en) * | 1987-11-02 | 1988-12-13 | The Boc Group, Inc. | 4-phenyl-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
US4921864A (en) * | 1987-11-02 | 1990-05-01 | Boc, Inc. | 4-Phenyl-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
US4849521A (en) * | 1987-11-02 | 1989-07-18 | Boc, Inc. | Stereoselective preparation of 3-substituted-4-piperidine compounds and derivatives |
USRE33495E (en) * | 1987-11-02 | 1990-12-18 | Boc, Inc. | Stereoselective preparation of 3-substituted-4-anilino-piperidine compounds and derivatives |
US4791120A (en) * | 1987-12-31 | 1988-12-13 | The Boc Group, Inc. | 4-heteropentacyclic-4-[N-(phenyl)amino] piperidine derivatives and pharmaceutical compositions and method employing such compounds |
US4801615A (en) * | 1987-12-31 | 1989-01-31 | The Boc Group, Inc. | 4-heterohexacyclic-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
US5019583A (en) * | 1989-02-15 | 1991-05-28 | Glaxo Inc. | N-phenyl-N-(4-piperidinyl)amides useful as analgesics |
USRE34201E (en) * | 1989-04-20 | 1993-03-23 | Anaquest, Inc. | N-aryl-N-[4-(1-heterocyclicalkyl)piperidinyl]amides and pharmaceutical compositions and methods employing such compounds |
US5053411A (en) * | 1989-04-20 | 1991-10-01 | Anaquest, Inc. | N-aryl-N-[4-(1-heterocyclicalkyl)piperidinyl]amides and pharmaceutical compositions and methods employing such compounds |
US5145967A (en) * | 1989-04-20 | 1992-09-08 | Anaquest, Inc. | Method for preparing 4-alkoxyalkyl-4-phenylaminopiperdines and derivatives thereof |
US4939161A (en) * | 1989-05-12 | 1990-07-03 | Boc, Inc. | Analgesic N-aryl-N-[1-substituted-3,5-dimethyl-4-piperidinyl]amides |
US4994471A (en) * | 1989-05-12 | 1991-02-19 | Boc, Inc. | N-aryl-N-(1-substituted-3-alkoxy-4-piperidinyl)amides and pharmaceutical compositions and methods employing such compounds |
US5100903A (en) * | 1989-05-12 | 1992-03-31 | Anaquest, Inc. | N-aryl-n-(1-substituted-3-alkoxy-4-piperidinyl)amides and pharmaceutical compositions and methods employing such compounds |
US5039804A (en) * | 1989-12-13 | 1991-08-13 | Glaxo Inc. | Preparation of substituted alkali metal piperidine-4-carboxylates |
US5126455A (en) * | 1989-12-13 | 1992-06-30 | Glaxo Inc. | Preparation of substituted alkali metal piperidine-4-carboxylates |
US5130321A (en) * | 1990-12-18 | 1992-07-14 | Glaxo Inc. | Analgesic n-phenyl-n-(3-or 1-3-me-4-piperidinyl)amides |
US5214148A (en) * | 1990-12-18 | 1993-05-25 | Glaxo Inc. | Analgesic N-phenyl-N-(3-OR1 -3-ME-4-piperidinyl)amides |
FR2676054B1 (fr) * | 1991-05-03 | 1993-09-03 | Sanofi Elf | Nouveaux composes n-alkylenepiperidino et leurs enantiomeres, procede pour leur preparation et compositions pharmaceutiques les contenant. |
GB9316863D0 (en) * | 1993-08-13 | 1993-09-29 | Glaxo Group Ltd | Chemical process |
US5489689A (en) * | 1993-09-30 | 1996-02-06 | Mallinckrodt Chemical, Inc. | Preparation of piperidine derivatives |
US6541021B1 (en) | 1999-03-18 | 2003-04-01 | Durect Corporation | Devices and methods for pain management |
US6835194B2 (en) * | 1999-03-18 | 2004-12-28 | Durect Corporation | Implantable devices and methods for treatment of pain by delivery of fentanyl and fentanyl congeners |
EP1182192A4 (en) * | 1999-04-09 | 2002-06-05 | Mochida Pharm Co Ltd | 4-HYDROXYPIPERIDINE DERIVATIVES WITH ANTI-ARRHYTHMIC EFFECT |
US6635661B2 (en) | 2000-05-25 | 2003-10-21 | Sepracor Inc. | Heterocyclic analgesic compounds and methods of use thereof |
US6677332B1 (en) | 1999-05-25 | 2004-01-13 | Sepracor, Inc. | Heterocyclic analgesic compounds and methods of use thereof |
US7361666B2 (en) * | 1999-05-25 | 2008-04-22 | Sepracor, Inc. | Heterocyclic analgesic compounds and methods of use thereof |
CA2393559C (en) * | 1999-12-06 | 2009-05-26 | Mallinckrodt Inc. | Methods for the syntheses of alfentanil, sufentanil and remifentanil |
US7074803B2 (en) * | 2001-03-02 | 2006-07-11 | Durect Corporation | Opioid formulations |
US20040102476A1 (en) * | 2002-11-25 | 2004-05-27 | Chan Tai Wah | High concentration formulations of opioids and opioid derivatives |
US20090030041A1 (en) * | 2004-09-14 | 2009-01-29 | Toshihiro Takahashi | N-substituted N-(4-piperidinyl) Amide Derivative |
JP2008088057A (ja) * | 2005-03-23 | 2008-04-17 | Nippon Chemiphar Co Ltd | N−置換−n−(4−ピペリジニル)アミド誘導体 |
EP1966140A1 (en) * | 2005-11-17 | 2008-09-10 | Mallinckrodt, Inc. | Process for synthesizing remifentanil |
CN101374812A (zh) * | 2006-01-24 | 2009-02-25 | 马林克罗特公司 | 合成瑞芬太尼的方法 |
EP1867635A1 (en) * | 2006-06-15 | 2007-12-19 | Kern Pharma, S.L. | Process for preparing remifentanil, intermediates thereof, use of said intermediates and processes for their preparation |
US20080009782A1 (en) * | 2006-06-28 | 2008-01-10 | Alza Corporation | Methods and Devices for Transdermal Electrotransport Delivery of Lofentanil and Carfentanil |
WO2008005423A1 (en) * | 2006-07-03 | 2008-01-10 | Cambrex Charles City, Inc. | Improved method of making sufentanil |
EP2125730A2 (en) * | 2006-11-29 | 2009-12-02 | Mallinckrodt Inc. | New process for remifentanil synthesis |
US20100056574A1 (en) * | 2008-09-04 | 2010-03-04 | Mallinckrodt Inc. | Crystalline Forms of Sufentanil |
US8299258B2 (en) * | 2008-11-04 | 2012-10-30 | Cambrex Charles City | Method of making piperidine derivatives |
ES2664801T3 (es) | 2010-09-17 | 2018-04-23 | Mallinckrodt Llc | Proceso mejorado para la preparación de un precursor de sufentanilo base |
EP2455377B1 (de) | 2010-11-11 | 2014-07-09 | hameln rds gmbh | Synthese von Fentanyl Analoga |
CN103328038A (zh) | 2010-12-01 | 2013-09-25 | 史拜诺莫度雷森公司 | 向神经解剖结构直接递送药剂 |
SG10201700952XA (en) * | 2013-03-13 | 2017-04-27 | Harvard College | Stapled and stitched polypeptides and uses thereof |
EP3233077A4 (en) | 2014-12-19 | 2018-08-08 | The Broad Institute Inc. | Dopamine d2 receptor ligands |
US10752588B2 (en) | 2014-12-19 | 2020-08-25 | The Broad Institute, Inc. | Dopamine D2 receptor ligands |
ES2806631T3 (es) | 2015-05-27 | 2021-02-18 | SpecGx LLC | Preparación de citrato de sufentanilo y base de sufentanilo |
CN106854203B (zh) * | 2015-12-08 | 2020-12-01 | 江苏恩华药业股份有限公司 | 枸橼酸舒芬太尼的新晶型及其制备方法 |
EP3199523B1 (en) | 2016-01-29 | 2018-08-15 | Bioka s. r.o. | The new process for producing n-phenyl-n-(4-piperidinyl) amide derivatives such as remifentanil and carfentanil |
CN108503579B (zh) * | 2018-03-28 | 2021-03-26 | 南京医科大学 | 芬太尼类似物及其应用 |
CN113214139B (zh) * | 2020-02-03 | 2022-03-04 | 江苏谛奇医药科技有限公司 | 哌啶酰胺类衍生物及其制备方法、其药物组合物、其单晶培养方法及其应用 |
IL299091A (en) | 2020-08-14 | 2023-02-01 | Novartis Ag | Heteroaryl substituted spiropiperidinyl derivatives and pharmaceutical uses thereof |
CN114262320A (zh) * | 2021-12-28 | 2022-04-01 | 宜昌人福药业有限责任公司 | 一种利用连续流微通道反应器制备苯胺基哌啶类药物的合成方法 |
Family Cites Families (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
BE623427A (en, 2012) * | 1961-10-10 | |||
US3171838A (en) * | 1961-10-10 | 1965-03-02 | Res Lab Dr C Janssen N V | Aroylalkyl and hydroxyaralkyl derivatives of 4-(n-arylalkanamido)-piperidines and related compounds |
-
1976
- 1976-01-13 US US05/648,685 patent/US3998834A/en not_active Expired - Lifetime
- 1976-02-23 NO NO760591A patent/NO146162C/no unknown
- 1976-02-24 NZ NZ180096A patent/NZ180096A/xx unknown
- 1976-02-27 SE SE7602740A patent/SE426486B/xx active Protection Beyond IP Right Term
- 1976-02-27 CA CA246,697A patent/CA1080232A/en not_active Expired
- 1976-03-09 LU LU74511A patent/LU74511A1/xx unknown
- 1976-03-10 FR FR7606870A patent/FR2303546A1/fr active Granted
- 1976-03-10 GB GB9593/76A patent/GB1538938A/en not_active Expired
- 1976-03-11 HU HU76JA00000751A patent/HU172963B/hu unknown
- 1976-03-11 DE DE19762610228 patent/DE2610228A1/de active Granted
- 1976-03-12 JP JP51026226A patent/JPS5946217B2/ja not_active Expired
- 1976-03-12 PL PL1976187910A patent/PL102474B1/pl unknown
- 1976-03-12 AT AT184676A patent/AT359493B/de not_active IP Right Cessation
- 1976-03-12 NL NLAANVRAGE7602612,A patent/NL185279C/xx not_active IP Right Cessation
- 1976-03-12 ES ES446034A patent/ES446034A1/es not_active Expired
- 1976-03-12 SU SU762332950A patent/SU1227109A3/ru active
- 1976-03-12 DK DK110376A patent/DK148960C/da not_active IP Right Cessation
- 1976-03-12 IT IT48556/76A patent/IT1057988B/it active
- 1976-03-12 CH CH310476A patent/CH629486A5/de not_active IP Right Cessation
- 1976-03-12 PT PT64898A patent/PT64898B/pt unknown
- 1976-03-12 IL IL49204A patent/IL49204A/xx unknown
- 1976-03-12 IE IE527/76A patent/IE42512B1/en not_active IP Right Cessation
- 1976-03-12 CZ CS761632A patent/CZ278060B6/cs unknown
- 1976-03-12 BG BG032601A patent/BG28259A3/xx unknown
- 1976-03-12 PH PH18204A patent/PH12746A/en unknown
- 1976-03-12 YU YU652/76A patent/YU39960B/xx unknown
- 1976-03-12 FI FI760646A patent/FI61481C/fi not_active IP Right Cessation
- 1976-03-15 AU AU12006/76A patent/AU503632B2/en not_active Expired
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
JPS5946217B2 (ja) | ピペリジン誘導体、その酸付加塩および光学異性体 | |
US4126689A (en) | N-aryl-n-(1-alkyl-4-piperidinyl)-arylacetamides | |
JP3073238B2 (ja) | 1−(1,2−ジ置換ピペリジニル)−4−置換ピペラジン誘導体 | |
US4369184A (en) | 1-(Cyclohexyl)-4-aryl-4-piperidinecarboxylic acid derivatives | |
JP2000502690A (ja) | タキキニンレセプターアンタゴニストとしての1−(1,2−ジ置換ピペリジニル)−4−置換ピペリジン誘導体 | |
JPH0759578B2 (ja) | ベンズオキサゾール‐及びベンゾチアゾールアミン誘導体 | |
HU203724B (en) | Process for producing new, substituted n-(1-alkyl-hydroxy-4-piperidinyl)-benzamide derivatives and pharmaceutical compositions containing them | |
CA2468529C (en) | 4-(2-furoyl) aminopiperidines, intermediates in synthesizing the same, process for producing the same and medicinal use of the same | |
US4292321A (en) | 1,3,8-Triazaspirodecane-4-ones, pharmaceutical compositions thereof and method of use thereof | |
JP5379000B2 (ja) | ウロテンシンii受容体アンタゴニスト | |
SU747424A3 (ru) | Способ получени -арил- (1- -4-пиперидинил) ацетамидов или их солей | |
EP1256575B1 (en) | Phenoxyalkylamine derivatives useful as opioid delta receptor agonists | |
US4197304A (en) | N-Aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
KR840002022B1 (ko) | 1-(시클로헥실)-4-아릴-4-피페리딘카르본산 유도체의 제조방법 | |
US4411904A (en) | Diphenylpropanamines, compositions thereof and use thereof | |
KR19980702304A (ko) | 장운동 촉진성 옥사디아졸 | |
US4157393A (en) | N-aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
US4225606A (en) | N-Aryl-N-(1-L-4-piperidinyl)arylacetamides | |
US4364954A (en) | Diphenylpropanamines, compositions thereof and use thereof | |
US4197303A (en) | N-Aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
US4208418A (en) | N-Aryl-N-(1-alkyl-4-piperidinyl)arylacetamides | |
US4198411A (en) | N-aryl-N-(1-L-4-piperidinyl)-arylaceytamides | |
CN1068881C (zh) | 苯基-氧代-烷基-(4-哌啶基)苯甲酸酯衍生物 | |
JP2008088057A (ja) | N−置換−n−(4−ピペリジニル)アミド誘導体 | |
WO2006041635A2 (en) | Arylthiobenzylpiperidine derivatives |