JPH0655729B2 - アルファ−アリ−ル−アルファ−フェニル−エチル−1h−1,2,4−トリアゾ−ル−1−プロパンニトリル化合物 - Google Patents
アルファ−アリ−ル−アルファ−フェニル−エチル−1h−1,2,4−トリアゾ−ル−1−プロパンニトリル化合物Info
- Publication number
- JPH0655729B2 JPH0655729B2 JP62165095A JP16509587A JPH0655729B2 JP H0655729 B2 JPH0655729 B2 JP H0655729B2 JP 62165095 A JP62165095 A JP 62165095A JP 16509587 A JP16509587 A JP 16509587A JP H0655729 B2 JPH0655729 B2 JP H0655729B2
- Authority
- JP
- Japan
- Prior art keywords
- alpha
- halogen
- ethyl
- acid addition
- agriculturally acceptable
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000003839 salts Chemical class 0.000 claims description 103
- 150000001875 compounds Chemical class 0.000 claims description 101
- 238000006243 chemical reaction Methods 0.000 claims description 73
- -1 ethylene, ethenylene, ethynylene Chemical group 0.000 claims description 56
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 54
- 229910052736 halogen Inorganic materials 0.000 claims description 45
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 42
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 41
- 239000002253 acid Substances 0.000 claims description 35
- 230000003287 optical effect Effects 0.000 claims description 34
- 229910052751 metal Chemical class 0.000 claims description 33
- 239000002184 metal Chemical class 0.000 claims description 33
- 239000000203 mixture Substances 0.000 claims description 29
- 238000004519 manufacturing process Methods 0.000 claims description 26
- 239000002904 solvent Substances 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 239000001257 hydrogen Substances 0.000 claims description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims description 21
- 150000002367 halogens Chemical group 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 16
- 229910000104 sodium hydride Chemical group 0.000 claims description 16
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 15
- 238000003756 stirring Methods 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 150000002431 hydrogen Chemical group 0.000 claims description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 10
- 230000000844 anti-bacterial effect Effects 0.000 claims description 9
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 claims description 8
- 150000001450 anions Chemical group 0.000 claims description 8
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 241000233866 Fungi Species 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 125000004434 sulfur atom Chemical group 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 4
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical group [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 3
- 150000001721 carbon Chemical group 0.000 claims description 3
- 230000003032 phytopathogenic effect Effects 0.000 claims description 3
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 claims description 3
- 229910000105 potassium hydride Inorganic materials 0.000 claims description 3
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 claims description 3
- 239000012312 sodium hydride Chemical group 0.000 claims description 3
- HQYJUFZPQLLYCK-UHFFFAOYSA-N 2-(2-chlorophenyl)-4-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Cl)=CC=C1CCC(C=1C(=CC=CC=1)Cl)(C#N)CN1N=CN=C1 HQYJUFZPQLLYCK-UHFFFAOYSA-N 0.000 claims description 2
- YILZKDVXMHFCIA-UHFFFAOYSA-N 2-phenyl-2-(1,2,4-triazol-1-ylmethyl)-4-[4-(trifluoromethyl)phenyl]butanenitrile Chemical compound C1=CC(C(F)(F)F)=CC=C1CCC(C=1C=CC=CC=1)(C#N)CN1N=CN=C1 YILZKDVXMHFCIA-UHFFFAOYSA-N 0.000 claims description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- 125000001624 naphthyl group Chemical group 0.000 claims 4
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims 3
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims 3
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 3
- 150000002739 metals Chemical class 0.000 claims 2
- ZFNHNQUQCOYXJR-UHFFFAOYSA-N 2-(4-bromophenyl)-4-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Cl)=CC=C1CCC(C=1C=CC(Br)=CC=1)(C#N)CN1N=CN=C1 ZFNHNQUQCOYXJR-UHFFFAOYSA-N 0.000 claims 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 claims 1
- NRWBGOUOOZPRFA-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound COC1=CC=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=C(Cl)C=C1 NRWBGOUOOZPRFA-UHFFFAOYSA-N 0.000 claims 1
- GVSNQMFKEPBIOY-UHFFFAOYSA-N 4-methyl-2h-triazole Chemical group CC=1C=NNN=1 GVSNQMFKEPBIOY-UHFFFAOYSA-N 0.000 claims 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 81
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 72
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 63
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 61
- 239000000243 solution Substances 0.000 description 45
- 241000209140 Triticum Species 0.000 description 42
- 235000021307 Triticum Nutrition 0.000 description 41
- 239000000047 product Substances 0.000 description 38
- 241000196324 Embryophyta Species 0.000 description 32
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 28
- 238000012360 testing method Methods 0.000 description 28
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- 150000003852 triazoles Chemical class 0.000 description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 238000002360 preparation method Methods 0.000 description 18
- 241000209219 Hordeum Species 0.000 description 16
- 235000007340 Hordeum vulgare Nutrition 0.000 description 16
- 239000003921 oil Substances 0.000 description 16
- 235000019198 oils Nutrition 0.000 description 16
- 239000007787 solid Substances 0.000 description 16
- 241000221785 Erysiphales Species 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- 230000000052 comparative effect Effects 0.000 description 14
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 14
- 239000000417 fungicide Substances 0.000 description 13
- 238000001030 gas--liquid chromatography Methods 0.000 description 13
- 201000010099 disease Diseases 0.000 description 12
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 12
- 239000007921 spray Substances 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- 244000105624 Arachis hypogaea Species 0.000 description 10
- 239000002585 base Substances 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical class N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 10
- 238000005507 spraying Methods 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 241000209094 Oryza Species 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 235000020232 peanut Nutrition 0.000 description 9
- DSXJKFCLGZTRDG-UHFFFAOYSA-N 4-(2-phenylethyl)-2h-triazole Chemical compound C=1NN=NC=1CCC1=CC=CC=C1 DSXJKFCLGZTRDG-UHFFFAOYSA-N 0.000 description 8
- BJGPDVPEEFEDIA-UHFFFAOYSA-N 4-(chloromethyl)-2h-triazole Chemical compound ClCC1=CNN=N1 BJGPDVPEEFEDIA-UHFFFAOYSA-N 0.000 description 8
- 229920001817 Agar Polymers 0.000 description 8
- 235000017060 Arachis glabrata Nutrition 0.000 description 8
- 235000010777 Arachis hypogaea Nutrition 0.000 description 8
- 235000018262 Arachis monticola Nutrition 0.000 description 8
- 235000007164 Oryza sativa Nutrition 0.000 description 8
- 239000008272 agar Substances 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 8
- 235000009566 rice Nutrition 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 230000000855 fungicidal effect Effects 0.000 description 7
- 125000001475 halogen functional group Chemical group 0.000 description 7
- 238000011081 inoculation Methods 0.000 description 7
- 239000002689 soil Substances 0.000 description 7
- YNOFIMCHDGSWSS-UHFFFAOYSA-N 2,4-diphenylbutanenitrile Chemical compound C=1C=CC=CC=1C(C#N)CCC1=CC=CC=C1 YNOFIMCHDGSWSS-UHFFFAOYSA-N 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000008367 deionised water Substances 0.000 description 6
- 229910021641 deionized water Inorganic materials 0.000 description 6
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 6
- 229920000053 polysorbate 80 Polymers 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- MQXUINLVWYNNJE-UHFFFAOYSA-N potassium;2h-triazole Chemical group [K].C=1C=NNN=1 MQXUINLVWYNNJE-UHFFFAOYSA-N 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- 235000019502 Orange oil Nutrition 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229940125773 compound 10 Drugs 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- YPHMISFOHDHNIV-FSZOTQKASA-N cycloheximide Chemical compound C1[C@@H](C)C[C@H](C)C(=O)[C@@H]1[C@H](O)CC1CC(=O)NC(=O)C1 YPHMISFOHDHNIV-FSZOTQKASA-N 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229920001971 elastomer Polymers 0.000 description 4
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 4
- 239000010502 orange oil Substances 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- QSGMJOKYKJVWEX-UHFFFAOYSA-N 2-(2-chlorophenyl)-4-(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(F)=CC=C1CCC(C=1C(=CC=CC=1)Cl)(C#N)CN1N=CN=C1 QSGMJOKYKJVWEX-UHFFFAOYSA-N 0.000 description 3
- MZNBGEKFZCWVES-UHFFFAOYSA-N 2-(3-fluorophenyl)ethanol Chemical compound OCCC1=CC=CC(F)=C1 MZNBGEKFZCWVES-UHFFFAOYSA-N 0.000 description 3
- ASDTXCMWARADMX-UHFFFAOYSA-N 2-(bromomethyl)-2,4-diphenylbutanenitrile Chemical compound C=1C=CC=CC=1C(CBr)(C#N)CCC1=CC=CC=C1 ASDTXCMWARADMX-UHFFFAOYSA-N 0.000 description 3
- BLQVTFVDPQLPRC-UHFFFAOYSA-N 2-phenyl-2-(1,2,4-triazol-1-ylmethyl)-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=CC=CC=2)=C1 BLQVTFVDPQLPRC-UHFFFAOYSA-N 0.000 description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 239000005842 Thiophanate-methyl Substances 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 150000004703 alkoxides Chemical class 0.000 description 3
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 239000010779 crude oil Substances 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 239000004495 emulsifiable concentrate Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 239000002054 inoculum Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical group COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 3
- 238000005292 vacuum distillation Methods 0.000 description 3
- 239000004563 wettable powder Substances 0.000 description 3
- WRCSFUANACAWCW-UHFFFAOYSA-N 1-(2-chloroethyl)-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(CCCl)=C1 WRCSFUANACAWCW-UHFFFAOYSA-N 0.000 description 2
- GYPFVSLTAQBJHV-UHFFFAOYSA-N 1-(2-chloroethyl)-3-fluorobenzene Chemical compound FC1=CC=CC(CCCl)=C1 GYPFVSLTAQBJHV-UHFFFAOYSA-N 0.000 description 2
- YIKWKLYQRFRGPM-UHFFFAOYSA-N 1-dodecylguanidine acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN=C(N)N YIKWKLYQRFRGPM-UHFFFAOYSA-N 0.000 description 2
- SVPKNMBRVBMTLB-UHFFFAOYSA-N 2,3-dichloronaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(Cl)=C(Cl)C(=O)C2=C1 SVPKNMBRVBMTLB-UHFFFAOYSA-N 0.000 description 2
- JPNUVXSIDDEFGI-UHFFFAOYSA-N 2,4-diphenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=NC=NN1CC(C=1C=CC=CC=1)(C#N)CCC1=CC=CC=C1 JPNUVXSIDDEFGI-UHFFFAOYSA-N 0.000 description 2
- NNEQFNOYQVZCOY-UHFFFAOYSA-N 2-(2-chloro-6-fluorophenyl)-4-(4-chlorophenyl)butanenitrile Chemical compound FC1=CC=CC(Cl)=C1C(C#N)CCC1=CC=C(Cl)C=C1 NNEQFNOYQVZCOY-UHFFFAOYSA-N 0.000 description 2
- SEKHECNGGZLMEM-UHFFFAOYSA-N 2-(2-chlorophenyl)-4-(4-fluorophenyl)butanenitrile Chemical compound C1=CC(F)=CC=C1CCC(C#N)C1=CC=CC=C1Cl SEKHECNGGZLMEM-UHFFFAOYSA-N 0.000 description 2
- XXLCVIZGVFWXFL-UHFFFAOYSA-N 2-(2-ethoxyphenyl)acetonitrile Chemical compound CCOC1=CC=CC=C1CC#N XXLCVIZGVFWXFL-UHFFFAOYSA-N 0.000 description 2
- KYNNBXCGXUOREX-UHFFFAOYSA-N 2-(3-bromophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1 KYNNBXCGXUOREX-UHFFFAOYSA-N 0.000 description 2
- PTTFLKHCSZSFOL-UHFFFAOYSA-N 2-(3-bromophenyl)ethanol Chemical compound OCCC1=CC=CC(Br)=C1 PTTFLKHCSZSFOL-UHFFFAOYSA-N 0.000 description 2
- YEAUYVGUXSZCFI-UHFFFAOYSA-N 2-(3-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(F)=C1 YEAUYVGUXSZCFI-UHFFFAOYSA-N 0.000 description 2
- DLEPZLMLRSQCNN-UHFFFAOYSA-N 2-(bromomethyl)-2-(4-chlorophenyl)-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(CCC(CBr)(C#N)C=2C=CC(Cl)=CC=2)=C1 DLEPZLMLRSQCNN-UHFFFAOYSA-N 0.000 description 2
- QUTXFNUOYHMBRA-UHFFFAOYSA-N 2-(bromomethyl)-2-phenyl-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(CCC(CBr)(C#N)C=2C=CC=CC=2)=C1 QUTXFNUOYHMBRA-UHFFFAOYSA-N 0.000 description 2
- PFCQZOWDWGKRMR-UHFFFAOYSA-N 2-(bromomethyl)-4-(4-methoxyphenyl)-2-phenylbutanenitrile Chemical compound C1=CC(OC)=CC=C1CCC(CBr)(C#N)C1=CC=CC=C1 PFCQZOWDWGKRMR-UHFFFAOYSA-N 0.000 description 2
- XYWMPKXXBBGXRP-UHFFFAOYSA-N 4-(3-bromophenyl)-2-(2-ethoxyphenyl)butanenitrile Chemical compound CCOC1=CC=CC=C1C(C#N)CCC1=CC=CC(Br)=C1 XYWMPKXXBBGXRP-UHFFFAOYSA-N 0.000 description 2
- FZNBRXWANXTHJF-UHFFFAOYSA-N 4-(3-fluorophenyl)-2-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound FC1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=CC=CC=2)=C1 FZNBRXWANXTHJF-UHFFFAOYSA-N 0.000 description 2
- OKRCOQJQHUNIKT-UHFFFAOYSA-N 4-(3-fluorophenyl)-2-phenylbutanenitrile Chemical compound FC1=CC=CC(CCC(C#N)C=2C=CC=CC=2)=C1 OKRCOQJQHUNIKT-UHFFFAOYSA-N 0.000 description 2
- NCOJVZXOPPOMQK-UHFFFAOYSA-N 4-(4-methoxyphenyl)-2-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(OC)=CC=C1CCC(C=1C=CC=CC=1)(C#N)CN1N=CN=C1 NCOJVZXOPPOMQK-UHFFFAOYSA-N 0.000 description 2
- KUFNEMCYFOJAGR-UHFFFAOYSA-N 4-benzyl-2h-triazole Chemical compound C=1C=CC=CC=1CC1=CNN=N1 KUFNEMCYFOJAGR-UHFFFAOYSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- 241000190150 Bipolaris sorokiniana Species 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 241001157813 Cercospora Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- 241000371644 Curvularia ravenelii Species 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000682843 Pseudocercosporella Species 0.000 description 2
- 241001123569 Puccinia recondita Species 0.000 description 2
- 241001533598 Septoria Species 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 239000011717 all-trans-retinol Substances 0.000 description 2
- 235000019169 all-trans-retinol Nutrition 0.000 description 2
- 125000005336 allyloxy group Chemical group 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 239000003899 bactericide agent Substances 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 150000007962 benzene acetonitriles Chemical class 0.000 description 2
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 description 2
- 125000004799 bromophenyl group Chemical group 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000013043 chemical agent Substances 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- PGRHXDWITVMQBC-UHFFFAOYSA-N dehydroacetic acid Chemical compound CC(=O)C1C(=O)OC(C)=CC1=O PGRHXDWITVMQBC-UHFFFAOYSA-N 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- FJBFPHVGVWTDIP-UHFFFAOYSA-N dibromomethane Chemical compound BrCBr FJBFPHVGVWTDIP-UHFFFAOYSA-N 0.000 description 2
- 235000021186 dishes Nutrition 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- PYZSVQVRHDXQSL-UHFFFAOYSA-N dithianon Chemical compound S1C(C#N)=C(C#N)SC2=C1C(=O)C1=CC=CC=C1C2=O PYZSVQVRHDXQSL-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- BBXXLROWFHWFQY-UHFFFAOYSA-N ethirimol Chemical compound CCCCC1=C(C)NC(NCC)=NC1=O BBXXLROWFHWFQY-UHFFFAOYSA-N 0.000 description 2
- WHDGWKAJBYRJJL-UHFFFAOYSA-K ferbam Chemical compound [Fe+3].CN(C)C([S-])=S.CN(C)C([S-])=S.CN(C)C([S-])=S WHDGWKAJBYRJJL-UHFFFAOYSA-K 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 230000009969 flowable effect Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 238000003328 mesylation reaction Methods 0.000 description 2
- AFCCDDWKHLHPDF-UHFFFAOYSA-M metam-sodium Chemical compound [Na+].CNC([S-])=S AFCCDDWKHLHPDF-UHFFFAOYSA-M 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- KKMLIVYBGSAJPM-UHFFFAOYSA-L propineb Chemical compound [Zn+2].[S-]C(=S)NC(C)CNC([S-])=S KKMLIVYBGSAJPM-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- FBQQHUGEACOBDN-UHFFFAOYSA-N quinomethionate Chemical compound N1=C2SC(=O)SC2=NC2=CC(C)=CC=C21 FBQQHUGEACOBDN-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 230000007480 spreading Effects 0.000 description 2
- 238000003892 spreading Methods 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 229960001367 tartaric acid Drugs 0.000 description 2
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000004308 thiabendazole Substances 0.000 description 2
- 235000010296 thiabendazole Nutrition 0.000 description 2
- WJCNZQLZVWNLKY-UHFFFAOYSA-N thiabendazole Chemical compound S1C=NC(C=2NC3=CC=CC=C3N=2)=C1 WJCNZQLZVWNLKY-UHFFFAOYSA-N 0.000 description 2
- 229960004546 thiabendazole Drugs 0.000 description 2
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 2
- 229960002447 thiram Drugs 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 239000011135 tin Substances 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- WCLDITPGPXSPGV-UHFFFAOYSA-N tricamba Chemical compound COC1=C(Cl)C=C(Cl)C(Cl)=C1C(O)=O WCLDITPGPXSPGV-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical compound C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 description 1
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- STPKWKPURVSAJF-LJEWAXOPSA-N (4r,5r)-5-[4-[[4-(1-aza-4-azoniabicyclo[2.2.2]octan-4-ylmethyl)phenyl]methoxy]phenyl]-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-4,5-dihydro-2h-1$l^{6}-benzothiepin-4-ol Chemical compound O[C@H]1C(CCCC)(CCCC)CS(=O)(=O)C2=CC=C(N(C)C)C=C2[C@H]1C(C=C1)=CC=C1OCC(C=C1)=CC=C1C[N+]1(CC2)CCN2CC1 STPKWKPURVSAJF-LJEWAXOPSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- DEVSOMFAQLZNKR-RJRFIUFISA-N (z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-n'-pyrazin-2-ylprop-2-enehydrazide Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(C2=NN(\C=C/C(=O)NNC=3N=CC=NC=3)C=N2)=C1 DEVSOMFAQLZNKR-RJRFIUFISA-N 0.000 description 1
- JCIIKRHCWVHVFF-UHFFFAOYSA-N 1,2,4-thiadiazol-5-amine;hydrochloride Chemical compound Cl.NC1=NC=NS1 JCIIKRHCWVHVFF-UHFFFAOYSA-N 0.000 description 1
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 description 1
- WCRAKJMHCWUABB-UHFFFAOYSA-N 1,2,4-triazol-1-ylmethanol Chemical compound OCN1C=NC=N1 WCRAKJMHCWUABB-UHFFFAOYSA-N 0.000 description 1
- YUIOPHXTILULQC-UHFFFAOYSA-N 1,4-Dithiane-2,5-diol Chemical compound OC1CSC(O)CS1 YUIOPHXTILULQC-UHFFFAOYSA-N 0.000 description 1
- ULMJQMDYAOJNCC-UHFFFAOYSA-N 1-(3-bromophenyl)ethanol Chemical compound CC(O)C1=CC=CC(Br)=C1 ULMJQMDYAOJNCC-UHFFFAOYSA-N 0.000 description 1
- PSDSORRYQPTKSV-UHFFFAOYSA-N 1-(4-fluorophenyl)ethanol Chemical compound CC(O)C1=CC=C(F)C=C1 PSDSORRYQPTKSV-UHFFFAOYSA-N 0.000 description 1
- WGJAYACACWILMG-UHFFFAOYSA-N 1-bromo-3-(2-chloroethyl)benzene Chemical compound ClCCC1=CC=CC(Br)=C1 WGJAYACACWILMG-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- INQXGZFDGDSRIF-UHFFFAOYSA-N 1h-quinoxaline-2-thione Chemical compound C1=CC=CC2=NC(S)=CN=C21 INQXGZFDGDSRIF-UHFFFAOYSA-N 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- IUWQJWIKCTXFIT-PJQLUOCWSA-N 2,3-dinitrooctan-2-yl (e)-2-phenylbut-2-enoate Chemical compound CCCCCC([N+]([O-])=O)C(C)([N+]([O-])=O)OC(=O)C(=C\C)\C1=CC=CC=C1 IUWQJWIKCTXFIT-PJQLUOCWSA-N 0.000 description 1
- OTPYTPUCJXKLDT-UHFFFAOYSA-N 2,4-bis(3-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound ClC1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=C(Cl)C=CC=2)=C1 OTPYTPUCJXKLDT-UHFFFAOYSA-N 0.000 description 1
- VTGGKZYHXNWFJX-UHFFFAOYSA-N 2,4-bis(3-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound FC1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=C(F)C=CC=2)=C1 VTGGKZYHXNWFJX-UHFFFAOYSA-N 0.000 description 1
- SUSDWFAETZTOCN-UHFFFAOYSA-N 2,4-bis(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Cl)=CC=C1CCC(C=1C=CC(Cl)=CC=1)(C#N)CN1N=CN=C1 SUSDWFAETZTOCN-UHFFFAOYSA-N 0.000 description 1
- UZYYVYZBXHBYPC-UHFFFAOYSA-N 2,4-bis(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(F)=CC=C1CCC(C=1C=CC(F)=CC=1)(C#N)CN1N=CN=C1 UZYYVYZBXHBYPC-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- VLKOBPGUNWZHMG-UHFFFAOYSA-N 2-(1,2,4-triazol-1-ylmethyl)-2,4-bis[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=C(C=CC=2)C(F)(F)F)=C1 VLKOBPGUNWZHMG-UHFFFAOYSA-N 0.000 description 1
- XUALUTPAEZHWPW-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-4-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound ClC1=CC(Cl)=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC=C1 XUALUTPAEZHWPW-UHFFFAOYSA-N 0.000 description 1
- MTGHBSZGDGCILE-UHFFFAOYSA-N 2-(2-bromophenyl)-2-(1,2,4-triazol-1-ylmethyl)-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C(=CC=CC=2)Br)=C1 MTGHBSZGDGCILE-UHFFFAOYSA-N 0.000 description 1
- YWDXBAMCIMVILZ-UHFFFAOYSA-N 2-(2-bromophenyl)-4-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound BrC1=CC=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC=C1 YWDXBAMCIMVILZ-UHFFFAOYSA-N 0.000 description 1
- OMUGOYQFEKGEOZ-UHFFFAOYSA-N 2-(2-chloro-6-fluorophenyl)-4-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound FC1=CC=CC(Cl)=C1C(C#N)(CN1N=CN=C1)CCC1=CC=C(Cl)C=C1 OMUGOYQFEKGEOZ-UHFFFAOYSA-N 0.000 description 1
- SRWJPHLJZWZZED-UHFFFAOYSA-N 2-(2-chloro-6-fluorophenyl)-4-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound FC1=CC=CC(Cl)=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC=C1 SRWJPHLJZWZZED-UHFFFAOYSA-N 0.000 description 1
- ZGSAFMIRVLOISC-UHFFFAOYSA-N 2-(2-chloro-6-fluorophenyl)acetonitrile Chemical compound FC1=CC=CC(Cl)=C1CC#N ZGSAFMIRVLOISC-UHFFFAOYSA-N 0.000 description 1
- HANAXPRHRZMAAL-UHFFFAOYSA-N 2-(2-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C(=CC=CC=2)Cl)=C1 HANAXPRHRZMAAL-UHFFFAOYSA-N 0.000 description 1
- BNDXAMUTHJGZTG-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound CCOC1=CC=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC(C(F)(F)F)=C1 BNDXAMUTHJGZTG-UHFFFAOYSA-N 0.000 description 1
- IHDYRFPZQYRLAJ-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-4-(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound CCOC1=CC=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=C(F)C=C1 IHDYRFPZQYRLAJ-UHFFFAOYSA-N 0.000 description 1
- XEBWFCLLVMPIOB-UHFFFAOYSA-N 2-(2-fluorophenyl)-4-(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(F)=CC=C1CCC(C=1C(=CC=CC=1)F)(C#N)CN1N=CN=C1 XEBWFCLLVMPIOB-UHFFFAOYSA-N 0.000 description 1
- LYGUPXRZWGVGEP-UHFFFAOYSA-N 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)-4-[4-(trifluoromethyl)phenyl]butanenitrile Chemical compound COC1=CC=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=C(C(F)(F)F)C=C1 LYGUPXRZWGVGEP-UHFFFAOYSA-N 0.000 description 1
- CAULDFSAMREODF-UHFFFAOYSA-N 2-(2-methoxyphenyl)-4-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound COC1=CC=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC=C1 CAULDFSAMREODF-UHFFFAOYSA-N 0.000 description 1
- JJALWHPHMQCDRT-UHFFFAOYSA-N 2-(3-bromophenyl)-4-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound BrC1=CC=CC(C(CCC=2C=CC=CC=2)(CN2N=CN=C2)C#N)=C1 JJALWHPHMQCDRT-UHFFFAOYSA-N 0.000 description 1
- ITLRVBOOBBXJKG-UHFFFAOYSA-N 2-(3-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=C(Cl)C=CC=2)=C1 ITLRVBOOBBXJKG-UHFFFAOYSA-N 0.000 description 1
- XOSIREFUFGXZKF-UHFFFAOYSA-N 2-(3-chlorophenyl)-4-(3-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound FC1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=C(Cl)C=CC=2)=C1 XOSIREFUFGXZKF-UHFFFAOYSA-N 0.000 description 1
- SJVKAZMVHUEHJJ-UHFFFAOYSA-N 2-(3-chlorophenyl)-4-(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(F)=CC=C1CCC(C=1C=C(Cl)C=CC=1)(C#N)CN1N=CN=C1 SJVKAZMVHUEHJJ-UHFFFAOYSA-N 0.000 description 1
- ONMYBVOBOYTOGH-UHFFFAOYSA-N 2-(3-chlorophenyl)-4-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound ClC1=CC=CC(C(CCC=2C=CC=CC=2)(CN2N=CN=C2)C#N)=C1 ONMYBVOBOYTOGH-UHFFFAOYSA-N 0.000 description 1
- HRRSYBKCJDXDBU-UHFFFAOYSA-N 2-(3-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC1=CC=CC(C(CCC=2C=C(C=CC=2)C(F)(F)F)(CN2N=CN=C2)C#N)=C1 HRRSYBKCJDXDBU-UHFFFAOYSA-N 0.000 description 1
- BBUNDDDMBHDWRO-UHFFFAOYSA-N 2-(3-fluorophenyl)-4-(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(F)=CC=C1CCC(C=1C=C(F)C=CC=1)(C#N)CN1N=CN=C1 BBUNDDDMBHDWRO-UHFFFAOYSA-N 0.000 description 1
- IJNNHNGWSCGHBE-UHFFFAOYSA-N 2-(3-fluorophenyl)-4-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound FC1=CC=CC(C(CCC=2C=CC=CC=2)(CN2N=CN=C2)C#N)=C1 IJNNHNGWSCGHBE-UHFFFAOYSA-N 0.000 description 1
- NVPQYKAYWLBBQM-UHFFFAOYSA-N 2-(4-bromophenyl)-4-(3-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound ClC1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=CC(Br)=CC=2)=C1 NVPQYKAYWLBBQM-UHFFFAOYSA-N 0.000 description 1
- RXBMVGSWIZQOAJ-UHFFFAOYSA-N 2-(4-bromophenyl)-4-(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(F)=CC=C1CCC(C=1C=CC(Br)=CC=1)(C#N)CN1N=CN=C1 RXBMVGSWIZQOAJ-UHFFFAOYSA-N 0.000 description 1
- BSRFRFRXLDFBRB-UHFFFAOYSA-N 2-(4-bromophenyl)-4-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Br)=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC=C1 BSRFRFRXLDFBRB-UHFFFAOYSA-N 0.000 description 1
- LLYNKHIQZYPMTJ-UHFFFAOYSA-N 2-(4-bromophenyl)ethyl methanesulfonate Chemical compound CS(=O)(=O)OCCC1=CC=C(Br)C=C1 LLYNKHIQZYPMTJ-UHFFFAOYSA-N 0.000 description 1
- BLGOJDTVMGMGET-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=CC(Cl)=CC=2)=C1 BLGOJDTVMGMGET-UHFFFAOYSA-N 0.000 description 1
- JWPVHCDGFLMBIX-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-4-[4-(trifluoromethyl)phenyl]butanenitrile Chemical compound C1=CC(C(F)(F)F)=CC=C1CCC(C=1C=CC(Cl)=CC=1)(C#N)CN1N=CN=C1 JWPVHCDGFLMBIX-UHFFFAOYSA-N 0.000 description 1
- HZJKXKUJVSEEFU-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile Chemical compound C=1C=C(Cl)C=CC=1C(CCCC)(C#N)CN1C=NC=N1 HZJKXKUJVSEEFU-UHFFFAOYSA-N 0.000 description 1
- BTIPRIFTUGFWED-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-(3-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound FC1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=CC(Cl)=CC=2)=C1 BTIPRIFTUGFWED-UHFFFAOYSA-N 0.000 description 1
- DRVIJLHZEUIHNN-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(F)=CC=C1CCC(C=1C=CC(Cl)=CC=1)(C#N)CN1N=CN=C1 DRVIJLHZEUIHNN-UHFFFAOYSA-N 0.000 description 1
- HXYRZLJYPSNIQG-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-(4-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(OC)=CC=C1CCC(C=1C=CC(Cl)=CC=1)(C#N)CN1N=CN=C1 HXYRZLJYPSNIQG-UHFFFAOYSA-N 0.000 description 1
- HAZIFEZZJSEDHL-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-(4-methylphenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(C)=CC=C1CCC(C=1C=CC(Cl)=CC=1)(C#N)CN1N=CN=C1 HAZIFEZZJSEDHL-UHFFFAOYSA-N 0.000 description 1
- SQDOBPKBKIGBGG-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(CCC(C#N)C=2C=CC(Cl)=CC=2)=C1 SQDOBPKBKIGBGG-UHFFFAOYSA-N 0.000 description 1
- STSXDNBXEPNZST-UHFFFAOYSA-N 2-(4-chlorophenyl)ethyl methanesulfonate Chemical compound CS(=O)(=O)OCCC1=CC=C(Cl)C=C1 STSXDNBXEPNZST-UHFFFAOYSA-N 0.000 description 1
- HAWXTMUSBPAXSH-UHFFFAOYSA-N 2-(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound C1=CC(F)=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC(C(F)(F)F)=C1 HAWXTMUSBPAXSH-UHFFFAOYSA-N 0.000 description 1
- RSBGWXCGBSPFPC-UHFFFAOYSA-N 2-(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-4-[4-(trifluoromethyl)phenyl]butanenitrile Chemical compound C1=CC(F)=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=C(C(F)(F)F)C=C1 RSBGWXCGBSPFPC-UHFFFAOYSA-N 0.000 description 1
- ZKOXMMMQJXZPLO-UHFFFAOYSA-N 2-(4-fluorophenyl)-4-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(F)=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC=C1 ZKOXMMMQJXZPLO-UHFFFAOYSA-N 0.000 description 1
- BVHCCXBFHAXYPT-UHFFFAOYSA-N 2-(4-fluorophenyl)ethyl methanesulfonate Chemical compound CS(=O)(=O)OCCC1=CC=C(F)C=C1 BVHCCXBFHAXYPT-UHFFFAOYSA-N 0.000 description 1
- ORTPEEDBOZIXNC-UHFFFAOYSA-N 2-(4-methoxyphenyl)ethyl methanesulfonate Chemical compound COC1=CC=C(CCOS(C)(=O)=O)C=C1 ORTPEEDBOZIXNC-UHFFFAOYSA-N 0.000 description 1
- QDUJBTYRJBSOAO-UHFFFAOYSA-N 2-(bromomethyl)-2-(2-chloro-6-fluorophenyl)-4-(4-chlorophenyl)butanenitrile Chemical compound FC1=CC=CC(Cl)=C1C(CBr)(C#N)CCC1=CC=C(Cl)C=C1 QDUJBTYRJBSOAO-UHFFFAOYSA-N 0.000 description 1
- UPTVJAJPBGIRLZ-UHFFFAOYSA-N 2-(trichloromethylsulfanyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical compound C1CC=CC2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C21 UPTVJAJPBGIRLZ-UHFFFAOYSA-N 0.000 description 1
- PYRKKGOKRMZEIT-UHFFFAOYSA-N 2-[6-(2-cyclopropylethoxy)-9-(2-hydroxy-2-methylpropyl)-1h-phenanthro[9,10-d]imidazol-2-yl]-5-fluorobenzene-1,3-dicarbonitrile Chemical compound C1=C2C3=CC(CC(C)(O)C)=CC=C3C=3NC(C=4C(=CC(F)=CC=4C#N)C#N)=NC=3C2=CC=C1OCCC1CC1 PYRKKGOKRMZEIT-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- HRYRVCUBGVCXKL-UHFFFAOYSA-N 2-chloro-1-nitropropane Chemical compound CC(Cl)C[N+]([O-])=O HRYRVCUBGVCXKL-UHFFFAOYSA-N 0.000 description 1
- WZSOEUAQKKEHFE-UHFFFAOYSA-N 2-chloro-2-phenylacetonitrile Chemical compound N#CC(Cl)C1=CC=CC=C1 WZSOEUAQKKEHFE-UHFFFAOYSA-N 0.000 description 1
- FZWMAVNEGPGQKL-UHFFFAOYSA-N 2-diethoxyphosphinothioyloxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(OP(=S)(OCC)OCC)C(=O)C2=C1 FZWMAVNEGPGQKL-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical class OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- XMLQRKPSFZSXFX-UHFFFAOYSA-N 2-phenyl-4-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(CCC(C#N)C=2C=CC=CC=2)=C1 XMLQRKPSFZSXFX-UHFFFAOYSA-N 0.000 description 1
- IHHLCZCTQBNZMV-UHFFFAOYSA-N 2-phenylacetonitrile;hydrobromide Chemical class Br.N#CCC1=CC=CC=C1 IHHLCZCTQBNZMV-UHFFFAOYSA-N 0.000 description 1
- ZRDUSMYWDRPZRM-UHFFFAOYSA-N 2-sec-butyl-4,6-dinitrophenyl 3-methylbut-2-enoate Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)C=C(C)C ZRDUSMYWDRPZRM-UHFFFAOYSA-N 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- FSRNFKKSRMNQDG-UHFFFAOYSA-N 3-(1,2,4-triazol-1-yl)propanenitrile Chemical compound N#CCCN1C=NC=N1 FSRNFKKSRMNQDG-UHFFFAOYSA-N 0.000 description 1
- FSCWZHGZWWDELK-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl-2,4-oxazolidinedione Chemical compound O=C1C(C)(C=C)OC(=O)N1C1=CC(Cl)=CC(Cl)=C1 FSCWZHGZWWDELK-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- SGIFQMGFUAXLCX-UHFFFAOYSA-N 4-(2,4-dichlorophenyl)-2-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound ClC1=CC(Cl)=CC=C1CCC(C=1C=CC=CC=1)(C#N)CN1N=CN=C1 SGIFQMGFUAXLCX-UHFFFAOYSA-N 0.000 description 1
- SEYKBBOJIPYCPR-UHFFFAOYSA-N 4-(2-fluorophenyl)-2-(4-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(F)=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC=C1F SEYKBBOJIPYCPR-UHFFFAOYSA-N 0.000 description 1
- JEXQGQNHHMKEQJ-UHFFFAOYSA-N 4-(2-methoxyphenyl)-2-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound COC1=CC=CC=C1CCC(C=1C=CC=CC=1)(C#N)CN1N=CN=C1 JEXQGQNHHMKEQJ-UHFFFAOYSA-N 0.000 description 1
- NJHOBZYKUGQNRI-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-2-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=C(Cl)C(Cl)=CC=C1CCC(C=1C=CC=CC=1)(C#N)CN1N=CN=C1 NJHOBZYKUGQNRI-UHFFFAOYSA-N 0.000 description 1
- LBGFXWAVMVFWHK-UHFFFAOYSA-N 4-(3-bromophenyl)-2-(2-ethoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound CCOC1=CC=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC(Br)=C1 LBGFXWAVMVFWHK-UHFFFAOYSA-N 0.000 description 1
- ZFJRHNMFYRBSEI-UHFFFAOYSA-N 4-(3-bromophenyl)-2-(3-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound ClC1=CC=CC(C(CCC=2C=C(Br)C=CC=2)(CN2N=CN=C2)C#N)=C1 ZFJRHNMFYRBSEI-UHFFFAOYSA-N 0.000 description 1
- JIIZPXLXPOQOJN-UHFFFAOYSA-N 4-(3-bromophenyl)-2-(4-bromophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Br)=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC(Br)=C1 JIIZPXLXPOQOJN-UHFFFAOYSA-N 0.000 description 1
- GEMXDHMEJPGEGA-UHFFFAOYSA-N 4-(3-bromophenyl)-2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Cl)=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC(Br)=C1 GEMXDHMEJPGEGA-UHFFFAOYSA-N 0.000 description 1
- GLVCNGIPFYIOMK-UHFFFAOYSA-N 4-(3-chlorophenyl)-2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound COC1=CC=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=CC(Cl)=C1 GLVCNGIPFYIOMK-UHFFFAOYSA-N 0.000 description 1
- YLWSKFLVBBFQCU-UHFFFAOYSA-N 4-(3-methoxyphenyl)-2-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound COC1=CC=CC(CCC(CN2N=CN=C2)(C#N)C=2C=CC=CC=2)=C1 YLWSKFLVBBFQCU-UHFFFAOYSA-N 0.000 description 1
- DCHBYSZGJJTMKE-UHFFFAOYSA-N 4-(4-bromophenyl)-2-(2-ethoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound CCOC1=CC=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=C(Br)C=C1 DCHBYSZGJJTMKE-UHFFFAOYSA-N 0.000 description 1
- SBLTUXLKAVGRLP-UHFFFAOYSA-N 4-(4-bromophenyl)-2-(2-ethoxyphenyl)butanenitrile Chemical compound CCOC1=CC=CC=C1C(C#N)CCC1=CC=C(Br)C=C1 SBLTUXLKAVGRLP-UHFFFAOYSA-N 0.000 description 1
- HCWHHVFIRRIUKH-UHFFFAOYSA-N 4-(4-bromophenyl)-2-(3-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound ClC1=CC=CC(C(CCC=2C=CC(Br)=CC=2)(CN2N=CN=C2)C#N)=C1 HCWHHVFIRRIUKH-UHFFFAOYSA-N 0.000 description 1
- XIKXUBZDNCFWAB-UHFFFAOYSA-N 4-(4-bromophenyl)-2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Cl)=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=C(Br)C=C1 XIKXUBZDNCFWAB-UHFFFAOYSA-N 0.000 description 1
- ODNMDTXSOORIMP-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-(2-ethoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound CCOC1=CC=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=C(Cl)C=C1 ODNMDTXSOORIMP-UHFFFAOYSA-N 0.000 description 1
- ZSIJNGZWSFPYEB-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-(3-fluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound FC1=CC=CC(C(CCC=2C=CC(Cl)=CC=2)(CN2N=CN=C2)C#N)=C1 ZSIJNGZWSFPYEB-UHFFFAOYSA-N 0.000 description 1
- GIARWWHDXBYJQM-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-(4-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(OC)=CC=C1C(C#N)(CN1N=CN=C1)CCC1=CC=C(Cl)C=C1 GIARWWHDXBYJQM-UHFFFAOYSA-N 0.000 description 1
- RQDJADAKIFFEKQ-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Cl)=CC=C1CCC(C=1C=CC=CC=1)(C#N)CN1N=CN=C1 RQDJADAKIFFEKQ-UHFFFAOYSA-N 0.000 description 1
- LOJJQFDDCDFPKR-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-pyridin-2-yl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Cl)=CC=C1CCC(C=1N=CC=CC=1)(C#N)CN1N=CN=C1 LOJJQFDDCDFPKR-UHFFFAOYSA-N 0.000 description 1
- JGLRIFFLQQADBO-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-thiophen-2-yl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Cl)=CC=C1CCC(C=1SC=CC=1)(C#N)CN1N=CN=C1 JGLRIFFLQQADBO-UHFFFAOYSA-N 0.000 description 1
- DAXLVDLSLSEMTC-UHFFFAOYSA-N 4-(4-methoxyphenyl)-2-phenylbutanenitrile Chemical compound C1=CC(OC)=CC=C1CCC(C#N)C1=CC=CC=C1 DAXLVDLSLSEMTC-UHFFFAOYSA-N 0.000 description 1
- MOXBCYIWIODTKI-UHFFFAOYSA-N 4-(dimethylamino)benzenediazonium Chemical compound CN(C)C1=CC=C([N+]#N)C=C1 MOXBCYIWIODTKI-UHFFFAOYSA-N 0.000 description 1
- CDIJOYCNNFLOAX-UHFFFAOYSA-N 4-(trichloromethylsulfanyl)isoindole-1,3-dione Chemical compound ClC(Cl)(Cl)SC1=CC=CC2=C1C(=O)NC2=O CDIJOYCNNFLOAX-UHFFFAOYSA-N 0.000 description 1
- OOTHTARUZHONSW-UHFFFAOYSA-N 4-[(2-chlorophenyl)hydrazinylidene]-3-methyl-1,2-oxazol-5-one Chemical class CC1=NOC(=O)C1=NNC1=CC=CC=C1Cl OOTHTARUZHONSW-UHFFFAOYSA-N 0.000 description 1
- MZWDAEVXPZRJTQ-WUXMJOGZSA-N 4-[(e)-(4-fluorophenyl)methylideneamino]-3-methyl-1h-1,2,4-triazole-5-thione Chemical compound CC1=NNC(=S)N1\N=C\C1=CC=C(F)C=C1 MZWDAEVXPZRJTQ-WUXMJOGZSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- ZOMKCDYJHAQMCU-UHFFFAOYSA-N 4-butyl-1,2,4-triazole Chemical compound CCCCN1C=NN=C1 ZOMKCDYJHAQMCU-UHFFFAOYSA-N 0.000 description 1
- IVYMIRMKXZAHRV-UHFFFAOYSA-N 4-chlorophenylacetonitrile Chemical compound ClC1=CC=C(CC#N)C=C1 IVYMIRMKXZAHRV-UHFFFAOYSA-N 0.000 description 1
- MWUVGXCUHWKQJE-UHFFFAOYSA-N 4-fluorophenethyl alcohol Chemical compound OCCC1=CC=C(F)C=C1 MWUVGXCUHWKQJE-UHFFFAOYSA-N 0.000 description 1
- MVXMNHYVCLMLDD-UHFFFAOYSA-N 4-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(OC)=CC=C(C=O)C2=C1 MVXMNHYVCLMLDD-UHFFFAOYSA-N 0.000 description 1
- PYVYJCRCDFCZMB-UHFFFAOYSA-N 4-phenyl-2-(4-phenylphenyl)-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=NC=NN1CC(C=1C=CC(=CC=1)C=1C=CC=CC=1)(C#N)CCC1=CC=CC=C1 PYVYJCRCDFCZMB-UHFFFAOYSA-N 0.000 description 1
- LUEYUHCBBXWTQT-UHFFFAOYSA-N 4-phenyl-2h-triazole Chemical compound C1=NNN=C1C1=CC=CC=C1 LUEYUHCBBXWTQT-UHFFFAOYSA-N 0.000 description 1
- GDUANFXPOZTYKS-UHFFFAOYSA-N 6-bromo-8-[(2,6-difluoro-4-methoxybenzoyl)amino]-4-oxochromene-2-carboxylic acid Chemical compound FC1=CC(OC)=CC(F)=C1C(=O)NC1=CC(Br)=CC2=C1OC(C(O)=O)=CC2=O GDUANFXPOZTYKS-UHFFFAOYSA-N 0.000 description 1
- XASOHFCUIQARJT-UHFFFAOYSA-N 8-methoxy-6-[7-(2-morpholin-4-ylethoxy)imidazo[1,2-a]pyridin-3-yl]-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-1-one Chemical compound C(N1C(=O)C2=C(OC)C=C(C=3N4C(=NC=3)C=C(C=C4)OCCN3CCOCC3)C=C2CC1)C(F)(F)F XASOHFCUIQARJT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 241001480061 Blumeria graminis Species 0.000 description 1
- 239000005739 Bordeaux mixture Substances 0.000 description 1
- JQUCWIWWWKZNCS-LESHARBVSA-N C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F Chemical compound C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F JQUCWIWWWKZNCS-LESHARBVSA-N 0.000 description 1
- PWBNTWVHBHFBTH-UHFFFAOYSA-N CPN1C=NC=N1 Chemical class CPN1C=NC=N1 PWBNTWVHBHFBTH-UHFFFAOYSA-N 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- RQVPIPIPYHKCSH-UHFFFAOYSA-N ClC1=CC=C(CCC(CN2C=NC=N2)C#N)C=C1 Chemical compound ClC1=CC=C(CCC(CN2C=NC=N2)C#N)C=C1 RQVPIPIPYHKCSH-UHFFFAOYSA-N 0.000 description 1
- 239000004287 Dehydroacetic acid Substances 0.000 description 1
- IIUZTXTZRGLYTI-UHFFFAOYSA-N Dihydrogriseofulvin Natural products COC1CC(=O)CC(C)C11C(=O)C(C(OC)=CC(OC)=C2Cl)=C2O1 IIUZTXTZRGLYTI-UHFFFAOYSA-N 0.000 description 1
- HDWLUGYOLUHEMN-UHFFFAOYSA-N Dinobuton Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)OC(C)C HDWLUGYOLUHEMN-UHFFFAOYSA-N 0.000 description 1
- 239000005765 Dodemorph Substances 0.000 description 1
- 239000005766 Dodine Substances 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- PLUBXMRUUVWRLT-UHFFFAOYSA-N Ethyl methanesulfonate Chemical compound CCOS(C)(=O)=O PLUBXMRUUVWRLT-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000005789 Folpet Substances 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- UXWOXTQWVMFRSE-UHFFFAOYSA-N Griseoviridin Natural products O=C1OC(C)CC=C(C(NCC=CC=CC(O)CC(O)C2)=O)SCC1NC(=O)C1=COC2=N1 UXWOXTQWVMFRSE-UHFFFAOYSA-N 0.000 description 1
- 241000370541 Idia Species 0.000 description 1
- 239000005867 Iprodione Substances 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 239000005802 Mancozeb Substances 0.000 description 1
- 101100515472 Mus musculus Mycl gene Proteins 0.000 description 1
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 1
- DDUHZTYCFQRHIY-UHFFFAOYSA-N Negwer: 6874 Natural products COC1=CC(=O)CC(C)C11C(=O)C(C(OC)=CC(OC)=C2Cl)=C2O1 DDUHZTYCFQRHIY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- YYVFXSYQSOZCOQ-UHFFFAOYSA-N Oxyquinoline sulfate Chemical class [O-]S([O-])(=O)=O.C1=C[NH+]=C2C(O)=CC=CC2=C1.C1=C[NH+]=C2C(O)=CC=CC2=C1 YYVFXSYQSOZCOQ-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 241000736122 Parastagonospora nodorum Species 0.000 description 1
- 241000315044 Passalora arachidicola Species 0.000 description 1
- 241000776989 Phaeosphaeria herpotrichoides Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000004820 Pressure-sensitive adhesive Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000005822 Propiconazole Substances 0.000 description 1
- 239000005823 Propineb Substances 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- BCKXLBQYZLBQEK-KVVVOXFISA-M Sodium oleate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC([O-])=O BCKXLBQYZLBQEK-KVVVOXFISA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 239000005843 Thiram Substances 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- BABJTMNVJXLAEX-UHFFFAOYSA-N Triamiphos Chemical compound N1=C(N)N(P(=O)(N(C)C)N(C)C)N=C1C1=CC=CC=C1 BABJTMNVJXLAEX-UHFFFAOYSA-N 0.000 description 1
- 229930195482 Validamycin Natural products 0.000 description 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 1
- 239000005870 Ziram Substances 0.000 description 1
- SAHIZENKTPRYSN-UHFFFAOYSA-N [2-[3-(phenoxymethyl)phenoxy]-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound O(C1=CC=CC=C1)CC=1C=C(OC2=NC(=CC(=C2)CN)C(F)(F)F)C=CC=1 SAHIZENKTPRYSN-UHFFFAOYSA-N 0.000 description 1
- JNVCSEDACVAATK-UHFFFAOYSA-L [Ca+2].[S-]SSS[S-] Chemical compound [Ca+2].[S-]SSS[S-] JNVCSEDACVAATK-UHFFFAOYSA-L 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- YISWLIADKXFJBR-UHFFFAOYSA-N acetic acid;4-cyclodecyl-2,6-dimethylmorpholine Chemical compound CC(O)=O.C1C(C)OC(C)CN1C1CCCCCCCCC1 YISWLIADKXFJBR-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- IMHBYKMAHXWHRP-UHFFFAOYSA-N anilazine Chemical compound ClC1=CC=CC=C1NC1=NC(Cl)=NC(Cl)=N1 IMHBYKMAHXWHRP-UHFFFAOYSA-N 0.000 description 1
- JDXKTOBMLZLCSB-UHFFFAOYSA-N anilinothiourea Chemical compound NC(=S)NNC1=CC=CC=C1 JDXKTOBMLZLCSB-UHFFFAOYSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 description 1
- 229940117949 captan Drugs 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- CSNJTIWCTNEOSW-UHFFFAOYSA-N carbamothioylsulfanyl carbamodithioate Chemical compound NC(=S)SSC(N)=S CSNJTIWCTNEOSW-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- PFIADAMVCJPXSF-UHFFFAOYSA-N chloroneb Chemical compound COC1=CC(Cl)=C(OC)C=C1Cl PFIADAMVCJPXSF-UHFFFAOYSA-N 0.000 description 1
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 229940116318 copper carbonate Drugs 0.000 description 1
- 229940120693 copper naphthenate Drugs 0.000 description 1
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(I) oxide Inorganic materials [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 1
- SEVNKWFHTNVOLD-UHFFFAOYSA-L copper;3-(4-ethylcyclohexyl)propanoate;3-(3-ethylcyclopentyl)propanoate Chemical compound [Cu+2].CCC1CCC(CCC([O-])=O)C1.CCC1CCC(CCC([O-])=O)CC1 SEVNKWFHTNVOLD-UHFFFAOYSA-L 0.000 description 1
- GEZOTWYUIKXWOA-UHFFFAOYSA-L copper;carbonate Chemical compound [Cu+2].[O-]C([O-])=O GEZOTWYUIKXWOA-UHFFFAOYSA-L 0.000 description 1
- 229960003280 cupric chloride Drugs 0.000 description 1
- 229940112669 cuprous oxide Drugs 0.000 description 1
- KRFJLUBVMFXRPN-UHFFFAOYSA-N cuprous oxide Chemical compound [O-2].[Cu+].[Cu+] KRFJLUBVMFXRPN-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 229960001270 d- tartaric acid Drugs 0.000 description 1
- QAYICIQNSGETAS-UHFFFAOYSA-N dazomet Chemical compound CN1CSC(=S)N(C)C1 QAYICIQNSGETAS-UHFFFAOYSA-N 0.000 description 1
- 229940061632 dehydroacetic acid Drugs 0.000 description 1
- 235000019258 dehydroacetic acid Nutrition 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- JYIMWRSJCRRYNK-UHFFFAOYSA-N dialuminum;disodium;oxygen(2-);silicon(4+);hydrate Chemical compound O.[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Na+].[Na+].[Al+3].[Al+3].[Si+4] JYIMWRSJCRRYNK-UHFFFAOYSA-N 0.000 description 1
- BIXZHMJUSMUDOQ-UHFFFAOYSA-N dichloran Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1Cl BIXZHMJUSMUDOQ-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 208000032625 disorder of ear Diseases 0.000 description 1
- LOZWAPSEEHRYPG-UHFFFAOYSA-N dithiane Natural products C1CSCCS1 LOZWAPSEEHRYPG-UHFFFAOYSA-N 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- JMXKCYUTURMERF-UHFFFAOYSA-N dodemorph Chemical compound C1C(C)OC(C)CN1C1CCCCCCCCCCC1 JMXKCYUTURMERF-UHFFFAOYSA-N 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- AWZOLILCOUMRDG-UHFFFAOYSA-N edifenphos Chemical compound C=1C=CC=CC=1SP(=O)(OCC)SC1=CC=CC=C1 AWZOLILCOUMRDG-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- KQTVWCSONPJJPE-UHFFFAOYSA-N etridiazole Chemical compound CCOC1=NC(C(Cl)(Cl)Cl)=NS1 KQTVWCSONPJJPE-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical compound C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 description 1
- 208000010801 foot rot Diseases 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- DDUHZTYCFQRHIY-RBHXEPJQSA-N griseofulvin Chemical compound COC1=CC(=O)C[C@@H](C)[C@@]11C(=O)C(C(OC)=CC(OC)=C2Cl)=C2O1 DDUHZTYCFQRHIY-RBHXEPJQSA-N 0.000 description 1
- 229960002867 griseofulvin Drugs 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000012678 infectious agent Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- ONUFESLQCSAYKA-UHFFFAOYSA-N iprodione Chemical compound O=C1N(C(=O)NC(C)C)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 ONUFESLQCSAYKA-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- UFHLMYOGRXOCSL-UHFFFAOYSA-N isoprothiolane Chemical compound CC(C)OC(=O)C(C(=O)OC(C)C)=C1SCCS1 UFHLMYOGRXOCSL-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- PVTHJAPFENJVNC-MHRBZPPQSA-N kasugamycin Chemical compound N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 description 1
- 230000007775 late Effects 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229940099690 malic acid Drugs 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 229920000940 maneb Polymers 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- BCTQJXQXJVLSIG-UHFFFAOYSA-N mepronil Chemical compound CC(C)OC1=CC=CC(NC(=O)C=2C(=CC=CC=2)C)=C1 BCTQJXQXJVLSIG-UHFFFAOYSA-N 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- ACUBUDUYSFODKZ-UHFFFAOYSA-N methyl n-(phenylcarbamothioyl)carbamate Chemical compound COC(=O)NC(=S)NC1=CC=CC=C1 ACUBUDUYSFODKZ-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000006877 oatmeal agar Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229940039748 oxalate Drugs 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- LKPLKUMXSAEKID-UHFFFAOYSA-N pentachloronitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LKPLKUMXSAEKID-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000002071 phenylalkoxy group Chemical group 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229940096826 phenylmercuric acetate Drugs 0.000 description 1
- 229940096825 phenylmercury Drugs 0.000 description 1
- DCNLOVYDMCVNRZ-UHFFFAOYSA-N phenylmercury(.) Chemical compound [Hg]C1=CC=CC=C1 DCNLOVYDMCVNRZ-UHFFFAOYSA-N 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000001965 potato dextrose agar Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- WHHIPMZEDGBUCC-UHFFFAOYSA-N probenazole Chemical compound C1=CC=C2C(OCC=C)=NS(=O)(=O)C2=C1 WHHIPMZEDGBUCC-UHFFFAOYSA-N 0.000 description 1
- STJLVHWMYQXCPB-UHFFFAOYSA-N propiconazole Chemical compound O1C(CCC)COC1(C=1C(=CC(Cl)=CC=1)Cl)CN1N=CN=C1 STJLVHWMYQXCPB-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- FGVVTMRZYROCTH-UHFFFAOYSA-N pyridine-2-thiol N-oxide Chemical class [O-][N+]1=CC=CC=C1S FGVVTMRZYROCTH-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 230000028070 sporulation Effects 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229960005322 streptomycin Drugs 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- LPSWFOCTMJQJIS-UHFFFAOYSA-N sulfanium;hydroxide Chemical class [OH-].[SH3+] LPSWFOCTMJQJIS-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- ILERPRJWJPJZDN-UHFFFAOYSA-N thioquinox Chemical compound C1=CC=C2N=C(SC(=S)S3)C3=NC2=C1 ILERPRJWJPJZDN-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- JARYYMUOCXVXNK-IMTORBKUSA-N validamycin Chemical compound N([C@H]1C[C@@H]([C@H]([C@H](O)[C@H]1O)O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)CO)[C@H]1C=C(CO)[C@H](O)[C@H](O)[C@H]1O JARYYMUOCXVXNK-IMTORBKUSA-N 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- MBBWTVUFIXOUBE-UHFFFAOYSA-L zinc;dicarbamodithioate Chemical compound [Zn+2].NC([S-])=S.NC([S-])=S MBBWTVUFIXOUBE-UHFFFAOYSA-L 0.000 description 1
- AMHNZOICSMBGDH-UHFFFAOYSA-L zineb Chemical compound [Zn+2].[S-]C(=S)NCCNC([S-])=S AMHNZOICSMBGDH-UHFFFAOYSA-L 0.000 description 1
- DUBNHZYBDBBJHD-UHFFFAOYSA-L ziram Chemical compound [Zn+2].CN(C)C([S-])=S.CN(C)C([S-])=S DUBNHZYBDBBJHD-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/647—Triazoles; Hydrogenated triazoles
- A01N43/653—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US88099086A | 1986-07-02 | 1986-07-02 | |
| US880990 | 1986-07-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6322569A JPS6322569A (ja) | 1988-01-30 |
| JPH0655729B2 true JPH0655729B2 (ja) | 1994-07-27 |
Family
ID=25377550
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP62165095A Expired - Lifetime JPH0655729B2 (ja) | 1986-07-02 | 1987-07-01 | アルファ−アリ−ル−アルファ−フェニル−エチル−1h−1,2,4−トリアゾ−ル−1−プロパンニトリル化合物 |
Country Status (24)
| Country | Link |
|---|---|
| EP (1) | EP0251775B1 (enExample) |
| JP (1) | JPH0655729B2 (enExample) |
| KR (1) | KR950003999B1 (enExample) |
| AR (1) | AR245448A1 (enExample) |
| AT (1) | ATE84789T1 (enExample) |
| AU (1) | AU607425B2 (enExample) |
| BE (1) | BE1001485A4 (enExample) |
| BR (1) | BR8703376A (enExample) |
| CA (1) | CA1321588C (enExample) |
| DE (2) | DE3783669T2 (enExample) |
| DK (2) | DK336587D0 (enExample) |
| EG (1) | EG18875A (enExample) |
| ES (1) | ES2053542T3 (enExample) |
| FR (1) | FR2612741A1 (enExample) |
| GB (2) | GB2192184B (enExample) |
| GR (1) | GR3006830T3 (enExample) |
| HU (1) | HU203452B (enExample) |
| IE (1) | IE60314B1 (enExample) |
| IL (1) | IL83034A (enExample) |
| IT (1) | IT1211468B (enExample) |
| NZ (1) | NZ220916A (enExample) |
| PT (1) | PT85239B (enExample) |
| TR (1) | TR23322A (enExample) |
| ZA (1) | ZA874751B (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3825841A1 (de) * | 1988-07-29 | 1990-02-01 | Basf Ag | 1-halogen-1-azolypropene und -methyloxirane und diese enthaltende fungizide |
| DE3835742A1 (de) * | 1988-10-20 | 1990-05-10 | Lentia Gmbh | Neue nitroalkylazole |
| CA2037162A1 (en) * | 1990-03-12 | 1991-09-13 | Steven Howard Shaber | Heterocyclicacetonitriles and fungicidal use |
| ZA914221B (en) | 1990-06-05 | 1992-03-25 | Ciba Geigy | Aromatic compounds |
| CH680895A5 (enExample) | 1990-11-02 | 1992-12-15 | Ciba Geigy Ag | |
| US5330984A (en) * | 1990-11-02 | 1994-07-19 | Ciba-Geigy Corporation | Fungicidal compositions |
| US5223178A (en) * | 1990-12-10 | 1993-06-29 | Rohm And Haas Company | Use of certain triazoles to protect materials from fungal attack, articles and compositions |
| CA2076203A1 (en) * | 1991-08-26 | 1993-02-27 | Steven Howard Shaber | Fungicidal 2-aryl-2-cyano-2-(aryloxyalkyl) ethyl-1,2,4-triazoles |
| US5240925A (en) * | 1991-08-26 | 1993-08-31 | Rohm And Haas Company | Fungicidal 2-aryl-2-cyano-2-(heterocyclylalkyl)ethyl-1,2,4-triazoles |
| GB9125791D0 (en) * | 1991-12-04 | 1992-02-05 | Schering Agrochemicals Ltd | Herbicides |
| SG47444A1 (en) * | 1991-12-19 | 1998-04-17 | Ciba Geigy Ag | Microbicides |
| DK0556157T3 (da) * | 1992-02-13 | 1998-08-10 | Novartis Ag | Fungicide blandinger på basis af triazol-fungicider og et 4,6-dimethyl-N-phenyl-2-pyrimidinamin. |
| US5342980A (en) | 1992-12-30 | 1994-08-30 | American Cyanamid Company | Fungicidal agents |
| EP0645091B1 (de) * | 1993-09-24 | 1996-04-17 | BASF Aktiengesellschaft | Fungizide Mischungen |
| TW286264B (enExample) | 1994-05-20 | 1996-09-21 | Ciba Geigy Ag | |
| US5510493A (en) * | 1994-11-14 | 1996-04-23 | Rohm And Haas Company | Process for alkylation with triazoles |
| IT1296926B1 (it) * | 1997-12-05 | 1999-08-03 | Zambon Spa | Procedimento per la preparazione di composti ad attivita' antimicotica |
| MXPA02005835A (es) * | 1999-12-13 | 2003-01-28 | Bayer Ag | Combinaciones de productos activos fungicidas. |
| KR100417082B1 (ko) * | 1999-12-22 | 2004-02-05 | 주식회사 포스코 | 연속 계량 장치의 이상 검출 장치 및 방법 |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| BRPI0612022B1 (pt) | 2005-06-09 | 2016-12-06 | Bayer Cropscience Ag | combinações de substâncias ativas, seus usos, processos para combater fungos fitopatogênicos indesejáveis, processo para preparar composições fungicidas, revestimento de semente, e processos para revestir semente e semente transgênica |
| DE102005035300A1 (de) | 2005-07-28 | 2007-02-01 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| EP2000028A1 (de) | 2007-06-06 | 2008-12-10 | Bayer CropScience Aktiengesellschaft | Fungizide Wirkstoffkombinationen |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| WO2010149758A1 (en) | 2009-06-25 | 2010-12-29 | Basf Se | Antifungal 1, 2, 4-triazolyl derivatives |
| EP2453750A2 (de) | 2009-07-16 | 2012-05-23 | Bayer CropScience AG | Synergistische wirkstoffkombinationen mit phenyltriazolen |
| CN102057930B (zh) * | 2011-01-24 | 2014-03-19 | 陕西美邦农药有限公司 | 一种含有腈苯唑与硫代氨基甲酸酯类化合物的杀菌组合物 |
| EP2746264A1 (en) | 2012-12-19 | 2014-06-25 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| EP2746255A1 (en) | 2012-12-19 | 2014-06-25 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
| CN114467960A (zh) * | 2022-02-09 | 2022-05-13 | 陕西上格之路生物科学有限公司 | 一种含有腈苯唑和硫酸铜钙的杀菌组合物 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2181580A1 (en) * | 1972-04-28 | 1973-12-07 | Stampfli Jackie | Disposable syringe - with device for preventing its re-use |
| US3951146A (en) * | 1972-11-01 | 1976-04-20 | Arias Marcelo Chiquiar | Disposable self-destructible syringes which render themselves unreusable |
| US4073921A (en) * | 1975-03-12 | 1978-02-14 | Rohm And Haas Company | Substituted arylcyanoalkyl and diarylcyanoalkylimidazoles and fungical compositions and methods utilizing them |
| US4366165A (en) * | 1977-05-19 | 1982-12-28 | Rohm And Haas Company | 1 and 4-Arylcyanoalkyl-1,2,4-triazoles and fungicidal use |
| CH620126A5 (enExample) * | 1978-03-10 | 1980-11-14 | Tulcea Sa | |
| DE3175673D1 (en) * | 1980-11-19 | 1987-01-15 | Ici Plc | Triazole compounds, a process for preparing them, their use as plant fungicides and fungicidal compositions containing them |
| EP0063099B1 (de) * | 1981-03-10 | 1985-11-27 | Ciba-Geigy Ag | Verfahren zur Herstellung von Phenyläthyltriazolen |
| EP0061840A3 (en) * | 1981-03-30 | 1983-08-24 | Imperial Chemical Industries Plc | Triazole compounds, a process for preparing them, their use as plant fungicides and fungicidal compositions containing them |
| DE3216301A1 (de) * | 1982-04-26 | 1983-10-27 | Schering AG, 1000 Berlin und 4709 Bergkamen | 1,2,4-triazol-1-yl-propionitrile, verfahren zur herstellung dieser verbindungen sowie diese enthaltende biozide mittel |
| FR2571261B1 (fr) * | 1984-10-09 | 1987-01-30 | Avare Georges | Seringue du type jetable pour injection ou prelevement humain ou animal et corps de seringue afferent |
| DE8529315U1 (de) * | 1985-10-11 | 1986-04-17 | PHYSIONIC Gesellschaft für Medizin- und Systemtechnik mbH, 1000 Berlin | Medizinische und/oder technische Injektionsspritze mit Einzugsmechanismus der Injektionskanüle in den Spritzenzylinder |
-
1987
- 1987-06-23 CA CA000540296A patent/CA1321588C/en not_active Expired - Fee Related
- 1987-06-25 IE IE169987A patent/IE60314B1/en not_active IP Right Cessation
- 1987-06-25 AR AR87307982A patent/AR245448A1/es active
- 1987-06-30 DK DK336587D patent/DK336587D0/da unknown
- 1987-06-30 DK DK336587A patent/DK171399B1/da active
- 1987-06-30 IL IL83034A patent/IL83034A/xx not_active IP Right Cessation
- 1987-07-01 DE DE8787305808T patent/DE3783669T2/de not_active Expired - Fee Related
- 1987-07-01 EP EP87305808A patent/EP0251775B1/en not_active Expired - Lifetime
- 1987-07-01 AT AT87305808T patent/ATE84789T1/de not_active IP Right Cessation
- 1987-07-01 JP JP62165095A patent/JPH0655729B2/ja not_active Expired - Lifetime
- 1987-07-01 DE DE19873721786 patent/DE3721786A1/de not_active Withdrawn
- 1987-07-01 ES ES87305808T patent/ES2053542T3/es not_active Expired - Lifetime
- 1987-07-01 ZA ZA874751A patent/ZA874751B/xx unknown
- 1987-07-01 GB GB8715388A patent/GB2192184B/en not_active Revoked
- 1987-07-01 BE BE8700737A patent/BE1001485A4/fr not_active IP Right Cessation
- 1987-07-01 FR FR8709321A patent/FR2612741A1/fr not_active Withdrawn
- 1987-07-01 IT IT8767565A patent/IT1211468B/it active
- 1987-07-01 NZ NZ220916A patent/NZ220916A/en unknown
- 1987-07-02 KR KR1019870007028A patent/KR950003999B1/ko not_active Expired - Fee Related
- 1987-07-02 EG EG38887A patent/EG18875A/xx active
- 1987-07-02 TR TR469/87A patent/TR23322A/xx unknown
- 1987-07-02 AU AU75048/87A patent/AU607425B2/en not_active Ceased
- 1987-07-02 BR BR8703376A patent/BR8703376A/pt not_active IP Right Cessation
- 1987-07-02 HU HU873001A patent/HU203452B/hu not_active IP Right Cessation
- 1987-07-02 PT PT85239A patent/PT85239B/pt not_active IP Right Cessation
- 1987-10-06 GB GB8723388A patent/GB2197311B/en not_active Revoked
-
1993
- 1993-01-21 GR GR920403178T patent/GR3006830T3/el unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0655729B2 (ja) | アルファ−アリ−ル−アルファ−フェニル−エチル−1h−1,2,4−トリアゾ−ル−1−プロパンニトリル化合物 | |
| US5087635A (en) | Alpha-aryl-alpha-phenylethyl-1H-1,2,4-triazole-1-propanenitriles | |
| KR890000378B1 (ko) | 알파-알킬-알파-(4-할로페닐)-1h-1, 2, 4-트리아졸-1-프로판니트릴유도체 | |
| US4366165A (en) | 1 and 4-Arylcyanoalkyl-1,2,4-triazoles and fungicidal use | |
| JPH0133467B2 (enExample) | ||
| US4413003A (en) | β-Hydroxyarylethylimidazoles | |
| US5527816A (en) | Fungicidal 2-aryl-2-cyano-2-(aryloxyalkyl)ethyl-1,2-4-triazoles | |
| US4920139A (en) | Alpha-alkyl-alpha-(4-halophenyl)-1H-1,2,4-triazole-1-propanenitrile | |
| US4351839A (en) | Fungicidal 2-aryl-2-1-H-azoyl-(alkyl)-gamma-butyrolactones | |
| KR900001161B1 (ko) | 알파-(2-알콕시페닐)-알파-알킬-1h-1,2,4- 트리아졸-1-프로판니트릴 및 그의 유도체 | |
| EP0575122A2 (en) | Fungicidal (2-aryl-2-substituted) ethyl-1,2,4-triazoles | |
| JP2921862B2 (ja) | 2,2―ジフルオロシクロプロピル誘導体 | |
| JPH0152390B2 (enExample) | ||
| US5397768A (en) | Fungicidal and herbicidal triazoles | |
| US5216007A (en) | Substituted ethylene imidazole and triazoles | |
| HU199437B (en) | Fungicides comprising hydroxyalkyl triazolyl derivatives as active ingredient and process for producing the active ingredients | |
| HU194702B (en) | Fungicide compositions containing hydroxy-ethyl-azol derivatives as active components and process for producing hydroxy-ethyl-azol derivatives | |
| JPH06256321A (ja) | シアノスルホニルエチルトリアゾールおよびそれを含有する殺菌組成物 | |
| JPS62215576A (ja) | アルフア−(2−アルコキシフエニル)−アルフア−アルキル−1h−1,2,4−トリアゾ−ル−1−プロパンニトリル,およびそれを含有する殺菌剤 |