JP2007507428A - 置換ベンズアゾールおよびRafキナーゼのインヒビターとしてのその使用 - Google Patents
置換ベンズアゾールおよびRafキナーゼのインヒビターとしてのその使用 Download PDFInfo
- Publication number
- JP2007507428A JP2007507428A JP2006528331A JP2006528331A JP2007507428A JP 2007507428 A JP2007507428 A JP 2007507428A JP 2006528331 A JP2006528331 A JP 2006528331A JP 2006528331 A JP2006528331 A JP 2006528331A JP 2007507428 A JP2007507428 A JP 2007507428A
- Authority
- JP
- Japan
- Prior art keywords
- methyl
- substituted
- compound according
- amino
- heterocycloalkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 108010077182 raf Kinases Proteins 0.000 title claims abstract description 27
- 102000009929 raf Kinases Human genes 0.000 title claims abstract description 27
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical class C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 title abstract description 14
- 239000003112 inhibitor Substances 0.000 title description 8
- 239000000203 mixture Chemical class 0.000 claims abstract description 179
- 150000001875 compounds Chemical class 0.000 claims abstract description 156
- 238000000034 method Methods 0.000 claims abstract description 63
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 33
- 241001465754 Metazoa Species 0.000 claims abstract description 29
- 238000011282 treatment Methods 0.000 claims abstract description 23
- 201000011510 cancer Diseases 0.000 claims abstract description 19
- 230000000694 effects Effects 0.000 claims abstract description 15
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 14
- 229940088597 hormone Drugs 0.000 claims abstract description 8
- 239000005556 hormone Substances 0.000 claims abstract description 8
- 230000001419 dependent effect Effects 0.000 claims abstract description 6
- 206010006187 Breast cancer Diseases 0.000 claims abstract description 5
- 208000026310 Breast neoplasm Diseases 0.000 claims abstract description 5
- 206010060862 Prostate cancer Diseases 0.000 claims abstract description 3
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims abstract description 3
- -1 amidoalkyl Chemical group 0.000 claims description 372
- 125000000217 alkyl group Chemical group 0.000 claims description 99
- 229910052739 hydrogen Inorganic materials 0.000 claims description 69
- 239000001257 hydrogen Substances 0.000 claims description 66
- 125000001072 heteroaryl group Chemical group 0.000 claims description 56
- 125000003118 aryl group Chemical group 0.000 claims description 53
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 39
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 38
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 36
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 36
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 28
- 150000002431 hydrogen Chemical class 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 28
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 25
- 125000003545 alkoxy group Chemical group 0.000 claims description 24
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 22
- 150000002148 esters Chemical class 0.000 claims description 22
- 229940002612 prodrug Drugs 0.000 claims description 21
- 239000000651 prodrug Substances 0.000 claims description 21
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 16
- 239000003814 drug Substances 0.000 claims description 16
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 14
- 229910052760 oxygen Inorganic materials 0.000 claims description 14
- 125000004076 pyridyl group Chemical group 0.000 claims description 14
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 14
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 13
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 12
- 125000002252 acyl group Chemical group 0.000 claims description 12
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 12
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 12
- 125000003282 alkyl amino group Chemical group 0.000 claims description 11
- 239000012830 cancer therapeutic Substances 0.000 claims description 11
- 229910052717 sulfur Inorganic materials 0.000 claims description 11
- 229940124597 therapeutic agent Drugs 0.000 claims description 11
- 125000002883 imidazolyl group Chemical group 0.000 claims description 10
- 230000002401 inhibitory effect Effects 0.000 claims description 10
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 claims description 9
- 125000001041 indolyl group Chemical group 0.000 claims description 9
- 239000005517 L01XE01 - Imatinib Substances 0.000 claims description 8
- 150000005347 biaryls Chemical group 0.000 claims description 8
- 125000002541 furyl group Chemical group 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 125000001624 naphthyl group Chemical group 0.000 claims description 8
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 8
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 8
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 claims description 7
- 235000010290 biphenyl Nutrition 0.000 claims description 7
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 7
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 7
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 7
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 claims description 7
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 7
- 125000002757 morpholinyl group Chemical group 0.000 claims description 7
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 7
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 7
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 claims description 6
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 6
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 6
- HSMPSHPWCOOUJH-UHFFFAOYSA-N anilinyl Chemical group [NH]C1=CC=CC=C1 HSMPSHPWCOOUJH-UHFFFAOYSA-N 0.000 claims description 6
- 239000012965 benzophenone Substances 0.000 claims description 6
- 239000004305 biphenyl Substances 0.000 claims description 6
- 125000004799 bromophenyl group Chemical group 0.000 claims description 6
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 6
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 claims description 6
- 229960004316 cisplatin Drugs 0.000 claims description 6
- WVIIMZNLDWSIRH-UHFFFAOYSA-N cyclohexylcyclohexane Chemical group C1CCCCC1C1CCCCC1 WVIIMZNLDWSIRH-UHFFFAOYSA-N 0.000 claims description 6
- DLAHAXOYRFRPFQ-UHFFFAOYSA-N dodecyl benzoate Chemical compound CCCCCCCCCCCCOC(=O)C1=CC=CC=C1 DLAHAXOYRFRPFQ-UHFFFAOYSA-N 0.000 claims description 6
- 239000003937 drug carrier Substances 0.000 claims description 6
- 125000001207 fluorophenyl group Chemical group 0.000 claims description 6
- 229960002949 fluorouracil Drugs 0.000 claims description 6
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 6
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 6
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 6
- 125000006303 iodophenyl group Chemical group 0.000 claims description 6
- 229960004768 irinotecan Drugs 0.000 claims description 6
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 6
- NAYYNDKKHOIIOD-UHFFFAOYSA-N phthalamide Chemical compound NC(=O)C1=CC=CC=C1C(N)=O NAYYNDKKHOIIOD-UHFFFAOYSA-N 0.000 claims description 6
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- 229960004641 rituximab Drugs 0.000 claims description 6
- 125000005329 tetralinyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims description 6
- 229930192474 thiophene Natural products 0.000 claims description 6
- QERYCTSHXKAMIS-UHFFFAOYSA-M thiophene-2-carboxylate Chemical compound [O-]C(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-M 0.000 claims description 6
- 125000004360 trifluorophenyl group Chemical group 0.000 claims description 6
- VVIAGPKUTFNRDU-UHFFFAOYSA-N 6S-folinic acid Natural products C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-UHFFFAOYSA-N 0.000 claims description 5
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 claims description 5
- 229940123237 Taxane Drugs 0.000 claims description 5
- 229940122803 Vinca alkaloid Drugs 0.000 claims description 5
- 229940045799 anthracyclines and related substance Drugs 0.000 claims description 5
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 claims description 5
- 229960004562 carboplatin Drugs 0.000 claims description 5
- 229960004397 cyclophosphamide Drugs 0.000 claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- VVIAGPKUTFNRDU-ABLWVSNPSA-N folinic acid Chemical compound C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-ABLWVSNPSA-N 0.000 claims description 5
- 235000008191 folinic acid Nutrition 0.000 claims description 5
- 239000011672 folinic acid Substances 0.000 claims description 5
- 229960005277 gemcitabine Drugs 0.000 claims description 5
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 claims description 5
- 229960002411 imatinib Drugs 0.000 claims description 5
- 229960001691 leucovorin Drugs 0.000 claims description 5
- DKPFODGZWDEEBT-QFIAKTPHSA-N taxane Chemical class C([C@]1(C)CCC[C@@H](C)[C@H]1C1)C[C@H]2[C@H](C)CC[C@@H]1C2(C)C DKPFODGZWDEEBT-QFIAKTPHSA-N 0.000 claims description 5
- 229950006410 tezacitabine Drugs 0.000 claims description 5
- GFFXZLZWLOBBLO-ASKVSEFXSA-N tezacitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(=C/F)/[C@H](O)[C@@H](CO)O1 GFFXZLZWLOBBLO-ASKVSEFXSA-N 0.000 claims description 5
- 229960000303 topotecan Drugs 0.000 claims description 5
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 claims description 5
- 229960000575 trastuzumab Drugs 0.000 claims description 5
- 125000005885 heterocycloalkylalkyl group Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 claims 10
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims 5
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 claims 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 5
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims 5
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 claims 5
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims 5
- 230000002489 hematologic effect Effects 0.000 claims 1
- 201000010099 disease Diseases 0.000 abstract description 10
- 239000003795 chemical substances by application Substances 0.000 abstract description 7
- 230000001404 mediated effect Effects 0.000 abstract description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 419
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 299
- 230000015572 biosynthetic process Effects 0.000 description 206
- 238000006243 chemical reaction Methods 0.000 description 196
- 238000003786 synthesis reaction Methods 0.000 description 175
- 239000000243 solution Substances 0.000 description 171
- 235000019439 ethyl acetate Nutrition 0.000 description 155
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 154
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 127
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 105
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 97
- 239000012044 organic layer Substances 0.000 description 94
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 89
- 239000007787 solid Substances 0.000 description 89
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 80
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 72
- 239000000047 product Substances 0.000 description 65
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 59
- 239000011541 reaction mixture Substances 0.000 description 57
- 239000012267 brine Substances 0.000 description 55
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 55
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 52
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 51
- 238000002360 preparation method Methods 0.000 description 51
- 229910052757 nitrogen Inorganic materials 0.000 description 50
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 48
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 48
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 45
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 45
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 42
- 239000000725 suspension Substances 0.000 description 40
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 39
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 36
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 36
- 238000004237 preparative chromatography Methods 0.000 description 35
- 238000003756 stirring Methods 0.000 description 35
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 34
- 229910052938 sodium sulfate Inorganic materials 0.000 description 33
- 235000011152 sodium sulphate Nutrition 0.000 description 33
- 239000008346 aqueous phase Substances 0.000 description 32
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 32
- 238000000746 purification Methods 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 30
- 239000010410 layer Substances 0.000 description 30
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 30
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 30
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 29
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 29
- 238000004128 high performance liquid chromatography Methods 0.000 description 27
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 27
- 239000012043 crude product Substances 0.000 description 26
- 239000000741 silica gel Substances 0.000 description 25
- 229910002027 silica gel Inorganic materials 0.000 description 25
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 23
- 150000003857 carboxamides Chemical class 0.000 description 22
- 238000004007 reversed phase HPLC Methods 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 20
- 150000004985 diamines Chemical class 0.000 description 20
- 125000005843 halogen group Chemical group 0.000 description 19
- 239000011734 sodium Substances 0.000 description 19
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 18
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- 150000001412 amines Chemical class 0.000 description 17
- 239000012298 atmosphere Substances 0.000 description 17
- 229910000029 sodium carbonate Inorganic materials 0.000 description 17
- 235000017550 sodium carbonate Nutrition 0.000 description 17
- 229910052763 palladium Inorganic materials 0.000 description 16
- 229910000027 potassium carbonate Inorganic materials 0.000 description 16
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 15
- 235000011181 potassium carbonates Nutrition 0.000 description 15
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 14
- 239000002253 acid Substances 0.000 description 14
- 125000000623 heterocyclic group Chemical group 0.000 description 14
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 14
- 102000016914 ras Proteins Human genes 0.000 description 14
- 108010014186 ras Proteins Proteins 0.000 description 14
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 13
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 13
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical compound NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 description 13
- 125000001424 substituent group Chemical group 0.000 description 13
- 235000017557 sodium bicarbonate Nutrition 0.000 description 12
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 12
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 12
- ISGGJJNYMNUZKD-UHFFFAOYSA-N 4-[3-amino-4-(methylamino)phenoxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C(N)C(NC)=CC=2)=C1 ISGGJJNYMNUZKD-UHFFFAOYSA-N 0.000 description 11
- 102000043136 MAP kinase family Human genes 0.000 description 11
- 108091054455 MAP kinase family Proteins 0.000 description 11
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 11
- 229960000583 acetic acid Drugs 0.000 description 11
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 10
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 108091000080 Phosphotransferase Proteins 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 10
- 238000007792 addition Methods 0.000 description 10
- 229910052786 argon Inorganic materials 0.000 description 10
- 230000003197 catalytic effect Effects 0.000 description 10
- 229940079593 drug Drugs 0.000 description 10
- 125000005842 heteroatom Chemical group 0.000 description 10
- 230000037361 pathway Effects 0.000 description 10
- 102000020233 phosphotransferase Human genes 0.000 description 10
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 description 10
- 229920006395 saturated elastomer Polymers 0.000 description 10
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 9
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 9
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 8
- XQACWEBGSZBLRG-UHFFFAOYSA-N 1-bromo-4-isothiocyanatobenzene Chemical compound BrC1=CC=C(N=C=S)C=C1 XQACWEBGSZBLRG-UHFFFAOYSA-N 0.000 description 8
- 239000002246 antineoplastic agent Substances 0.000 description 8
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 239000012047 saturated solution Substances 0.000 description 8
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 7
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 238000003818 flash chromatography Methods 0.000 description 7
- 229940043355 kinase inhibitor Drugs 0.000 description 7
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 7
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical compound [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 description 7
- WRXNJTBODVGDRY-UHFFFAOYSA-N 2-pyrrolidin-1-ylethanamine Chemical compound NCCN1CCCC1 WRXNJTBODVGDRY-UHFFFAOYSA-N 0.000 description 6
- NGWCQHAOTXTDEK-UHFFFAOYSA-N 4-[2-methoxy-4-(methylamino)-5-nitrophenoxy]-N-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C(=CC(NC)=C(C=2)[N+]([O-])=O)OC)=C1 NGWCQHAOTXTDEK-UHFFFAOYSA-N 0.000 description 6
- IQXUIDYRTHQTET-UHFFFAOYSA-N 4-amino-3-nitrophenol Chemical compound NC1=CC=C(O)C=C1[N+]([O-])=O IQXUIDYRTHQTET-UHFFFAOYSA-N 0.000 description 6
- 208000003200 Adenoma Diseases 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- 239000005711 Benzoic acid Substances 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 108090000744 Mitogen-Activated Protein Kinase Kinases Proteins 0.000 description 6
- 102000004232 Mitogen-Activated Protein Kinase Kinases Human genes 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- 108010029485 Protein Isoforms Proteins 0.000 description 6
- 102000001708 Protein Isoforms Human genes 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 6
- 235000010233 benzoic acid Nutrition 0.000 description 6
- 230000005587 bubbling Effects 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 210000004027 cell Anatomy 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 6
- 230000005764 inhibitory process Effects 0.000 description 6
- 239000002502 liposome Substances 0.000 description 6
- 230000035772 mutation Effects 0.000 description 6
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 5
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 5
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 5
- KKVYYGGCHJGEFJ-UHFFFAOYSA-N 1-n-(4-chlorophenyl)-6-methyl-5-n-[3-(7h-purin-6-yl)pyridin-2-yl]isoquinoline-1,5-diamine Chemical compound N=1C=CC2=C(NC=3C(=CC=CN=3)C=3C=4N=CNC=4N=CN=3)C(C)=CC=C2C=1NC1=CC=C(Cl)C=C1 KKVYYGGCHJGEFJ-UHFFFAOYSA-N 0.000 description 5
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 5
- XLZSBGWFJTXBDS-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 XLZSBGWFJTXBDS-UHFFFAOYSA-N 0.000 description 5
- ZJLSMLDOCGOURY-UHFFFAOYSA-N 4-[[2-[[4-chloro-3-(trifluoromethyl)phenyl]amino]-3h-benzimidazol-5-yl]oxy]-n-methyl-pyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C=C(C(Cl)=CC=4)C(F)(F)F)=NC3=CC=2)=C1 ZJLSMLDOCGOURY-UHFFFAOYSA-N 0.000 description 5
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 5
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 101100381978 Mus musculus Braf gene Proteins 0.000 description 5
- 125000003342 alkenyl group Chemical group 0.000 description 5
- 230000006907 apoptotic process Effects 0.000 description 5
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 5
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000011010 flushing procedure Methods 0.000 description 5
- PVNIIMVLHYAWGP-UHFFFAOYSA-M nicotinate Chemical compound [O-]C(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-M 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 4
- ZVMPEUKZYDFXQN-UHFFFAOYSA-N 1-isothiocyanato-3-(trifluoromethylsulfanyl)benzene Chemical compound FC(F)(F)SC1=CC=CC(N=C=S)=C1 ZVMPEUKZYDFXQN-UHFFFAOYSA-N 0.000 description 4
- PWRIWSXXZAHPKO-UHFFFAOYSA-N 1-isothiocyanato-3-phenoxybenzene Chemical compound S=C=NC1=CC=CC(OC=2C=CC=CC=2)=C1 PWRIWSXXZAHPKO-UHFFFAOYSA-N 0.000 description 4
- HIQNBABZXGQVFC-UHFFFAOYSA-N 1-isothiocyanato-4-(trifluoromethylsulfanyl)benzene Chemical compound FC(F)(F)SC1=CC=C(N=C=S)C=C1 HIQNBABZXGQVFC-UHFFFAOYSA-N 0.000 description 4
- QFFWXJUMBXZQRW-UHFFFAOYSA-N 2-methoxy-4-(methylamino)-5-nitrophenol Chemical compound CNC1=CC(OC)=C(O)C=C1[N+]([O-])=O QFFWXJUMBXZQRW-UHFFFAOYSA-N 0.000 description 4
- FVZWFXJPCRLGFY-UHFFFAOYSA-N 4-(4-amino-3-nitrophenoxy)-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C(C(N)=CC=2)[N+]([O-])=O)=C1 FVZWFXJPCRLGFY-UHFFFAOYSA-N 0.000 description 4
- UVIZFSBFHNHFCO-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxy-n-ethylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NCC)=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 UVIZFSBFHNHFCO-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 108010007457 Extracellular Signal-Regulated MAP Kinases Proteins 0.000 description 4
- 101150100676 Map2k1 gene Proteins 0.000 description 4
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 4
- 102100024193 Mitogen-activated protein kinase 1 Human genes 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 4
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 4
- 239000012455 biphasic mixture Substances 0.000 description 4
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 4
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 4
- 229940080856 gleevec Drugs 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000011981 lindlar catalyst Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 239000010502 orange oil Substances 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 125000004043 oxo group Chemical group O=* 0.000 description 4
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 4
- 239000000546 pharmaceutical excipient Substances 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 230000002441 reversible effect Effects 0.000 description 4
- 125000006413 ring segment Chemical group 0.000 description 4
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 4
- 125000000335 thiazolyl group Chemical group 0.000 description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 4
- 230000004614 tumor growth Effects 0.000 description 4
- 229910052727 yttrium Inorganic materials 0.000 description 4
- FRMFJQIVPNSSPX-UHFFFAOYSA-N 1-ethyl-3-isothiocyanatobenzene Chemical compound CCC1=CC=CC(N=C=S)=C1 FRMFJQIVPNSSPX-UHFFFAOYSA-N 0.000 description 3
- DEJVUVMZSJGRSF-UHFFFAOYSA-N 1-isothiocyanato-3-propan-2-ylbenzene Chemical compound CC(C)C1=CC=CC(N=C=S)=C1 DEJVUVMZSJGRSF-UHFFFAOYSA-N 0.000 description 3
- JSDYQPUPSLXYCV-UHFFFAOYSA-N 1-tert-butyl-3-isothiocyanatobenzene Chemical compound CC(C)(C)C1=CC=CC(N=C=S)=C1 JSDYQPUPSLXYCV-UHFFFAOYSA-N 0.000 description 3
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical compound NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CMVGMXKSCGBXCW-UHFFFAOYSA-N 2-[2-(4-bromo-3-methylanilino)-1-methylbenzimidazol-5-yl]oxy-1H-pyridine-2-carboxylic acid Chemical compound C1=C(Br)C(C)=CC(NC=2N(C3=CC=C(OC4(C=CC=CN4)C(O)=O)C=C3N=2)C)=C1 CMVGMXKSCGBXCW-UHFFFAOYSA-N 0.000 description 3
- TUADYTFWZPZZTP-UHFFFAOYSA-N 2-amino-4-methoxyphenol Chemical compound COC1=CC=C(O)C(N)=C1 TUADYTFWZPZZTP-UHFFFAOYSA-N 0.000 description 3
- BRENVJPPZRBCPU-UHFFFAOYSA-N 2-chloro-5-methoxy-1,3-benzoxazole Chemical compound COC1=CC=C2OC(Cl)=NC2=C1 BRENVJPPZRBCPU-UHFFFAOYSA-N 0.000 description 3
- YELDUWMYYRJMJD-UHFFFAOYSA-N 2-sulfamoylguanidine Chemical compound NC(N)=NS(N)(=O)=O YELDUWMYYRJMJD-UHFFFAOYSA-N 0.000 description 3
- AFPAUXGZVJBVCO-UHFFFAOYSA-N 4-(3,4-diaminophenoxy)-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C(N)C(N)=CC=2)=C1 AFPAUXGZVJBVCO-UHFFFAOYSA-N 0.000 description 3
- RCOVTJVRTZGSBP-UHFFFAOYSA-N 4-(chloromethyl)benzoyl chloride Chemical compound ClCC1=CC=C(C(Cl)=O)C=C1 RCOVTJVRTZGSBP-UHFFFAOYSA-N 0.000 description 3
- HVQNIOPZAVZSAR-UHFFFAOYSA-N 4-[2-(4-chloro-3-nitroanilino)-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C(C(Cl)=CC=4)[N+]([O-])=O)N(C)C3=CC=2)=C1 HVQNIOPZAVZSAR-UHFFFAOYSA-N 0.000 description 3
- GFFZFWAUXAFCSY-UHFFFAOYSA-N 4-[2-(4-nitrophenyl)ethyl]morpholine Chemical compound C1=CC([N+](=O)[O-])=CC=C1CCN1CCOCC1 GFFZFWAUXAFCSY-UHFFFAOYSA-N 0.000 description 3
- WDHFCUQYGLEYJD-UHFFFAOYSA-N 4-[2-(benzylamino)ethyl]aniline Chemical compound C1=CC(N)=CC=C1CCNCC1=CC=CC=C1 WDHFCUQYGLEYJD-UHFFFAOYSA-N 0.000 description 3
- OHCCWFYFBLWJTD-UHFFFAOYSA-N 4-[3-amino-4-(methylamino)phenoxy]-n-(2-hydroxyethyl)pyridine-2-carboxamide Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=NC(C(=O)NCCO)=C1 OHCCWFYFBLWJTD-UHFFFAOYSA-N 0.000 description 3
- RPMGGZCDYWFZCQ-UHFFFAOYSA-N 4-[5-amino-2-methoxy-4-(methylamino)phenoxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C(=CC(NC)=C(N)C=2)OC)=C1 RPMGGZCDYWFZCQ-UHFFFAOYSA-N 0.000 description 3
- ZRRFUDDSSHZCBP-UHFFFAOYSA-N 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)SC3=CC=2)=C1 ZRRFUDDSSHZCBP-UHFFFAOYSA-N 0.000 description 3
- VXHDHMUZXWITDG-UHFFFAOYSA-N 4-bromo-1-isothiocyanato-2-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC(Br)=CC=C1N=C=S VXHDHMUZXWITDG-UHFFFAOYSA-N 0.000 description 3
- BGVBBMZMEKXUTR-UHFFFAOYSA-N 4-chloro-n-methylpyridine-2-carboxamide Chemical compound CNC(=O)C1=CC(Cl)=CC=N1 BGVBBMZMEKXUTR-UHFFFAOYSA-N 0.000 description 3
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 3
- SUFHFYIZWSAJQL-UHFFFAOYSA-N 4-methyl-3-pyrrolidin-1-ylaniline Chemical compound CC1=CC=C(N)C=C1N1CCCC1 SUFHFYIZWSAJQL-UHFFFAOYSA-N 0.000 description 3
- OPGUZRRLMQSMAQ-UHFFFAOYSA-N 5-(4-methoxyphenyl)-1-phenylbenzimidazole Chemical compound C1=CC(OC)=CC=C1C1=CC=C(N(C=N2)C=3C=CC=CC=3)C2=C1 OPGUZRRLMQSMAQ-UHFFFAOYSA-N 0.000 description 3
- NNZZKVDXEJZNDP-UHFFFAOYSA-N 5-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-3-carboxamide Chemical compound CNC(=O)C1=CN=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 NNZZKVDXEJZNDP-UHFFFAOYSA-N 0.000 description 3
- QGTUVLRFJOUWBN-UHFFFAOYSA-N 5-methoxy-3h-1,3-benzoxazole-2-thione Chemical compound COC1=CC=C2OC(=S)NC2=C1 QGTUVLRFJOUWBN-UHFFFAOYSA-N 0.000 description 3
- 206010001233 Adenoma benign Diseases 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- 201000009030 Carcinoma Diseases 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 239000007832 Na2SO4 Substances 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- 102000001253 Protein Kinase Human genes 0.000 description 3
- 102100033479 RAF proto-oncogene serine/threonine-protein kinase Human genes 0.000 description 3
- 101710141955 RAF proto-oncogene serine/threonine-protein kinase Proteins 0.000 description 3
- 102000040945 Transcription factor Human genes 0.000 description 3
- 108091023040 Transcription factor Proteins 0.000 description 3
- 230000003213 activating effect Effects 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 229940046836 anti-estrogen Drugs 0.000 description 3
- 230000001833 anti-estrogenic effect Effects 0.000 description 3
- 230000000692 anti-sense effect Effects 0.000 description 3
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 125000002393 azetidinyl group Chemical group 0.000 description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 3
- 125000005841 biaryl group Chemical group 0.000 description 3
- 208000015322 bone marrow disease Diseases 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 235000011089 carbon dioxide Nutrition 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 210000001072 colon Anatomy 0.000 description 3
- 239000013058 crude material Substances 0.000 description 3
- 125000004966 cyanoalkyl group Chemical group 0.000 description 3
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 3
- 239000012636 effector Substances 0.000 description 3
- 239000000328 estrogen antagonist Substances 0.000 description 3
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 3
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 239000003701 inert diluent Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 150000002632 lipids Chemical class 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- GCVAJYRVBRKKSE-UHFFFAOYSA-N methyl 4-[4-(methylamino)-3-nitrophenoxy]pyridine-3-carboxylate Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC=C1C(=O)OC GCVAJYRVBRKKSE-UHFFFAOYSA-N 0.000 description 3
- SPPJUUNCUKYHSS-UHFFFAOYSA-N methyl 5-(4-aminophenoxy)pyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(OC=2C=CC(N)=CC=2)=C1 SPPJUUNCUKYHSS-UHFFFAOYSA-N 0.000 description 3
- HTGMFZXESCUYDU-UHFFFAOYSA-N methyl 5-(4-nitrophenoxy)pyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(OC=2C=CC(=CC=2)[N+]([O-])=O)=C1 HTGMFZXESCUYDU-UHFFFAOYSA-N 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 208000025113 myeloid leukemia Diseases 0.000 description 3
- UCAOGXRUJFKQAP-UHFFFAOYSA-N n,n-dimethyl-5-nitropyridin-2-amine Chemical compound CN(C)C1=CC=C([N+]([O-])=O)C=N1 UCAOGXRUJFKQAP-UHFFFAOYSA-N 0.000 description 3
- GFKOBLYDSHLGSC-UHFFFAOYSA-N n-(4-bromophenyl)-5-methoxy-1,3-benzoxazol-2-amine Chemical compound N=1C2=CC(OC)=CC=C2OC=1NC1=CC=C(Br)C=C1 GFKOBLYDSHLGSC-UHFFFAOYSA-N 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 229940127084 other anti-cancer agent Drugs 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 210000000496 pancreas Anatomy 0.000 description 3
- 230000026731 phosphorylation Effects 0.000 description 3
- 238000006366 phosphorylation reaction Methods 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 108060006633 protein kinase Proteins 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 230000019491 signal transduction Effects 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000000967 suction filtration Methods 0.000 description 3
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 210000001685 thyroid gland Anatomy 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 125000001425 triazolyl group Chemical group 0.000 description 3
- 210000003932 urinary bladder Anatomy 0.000 description 3
- QRZNDBXLPMZTDZ-UHFFFAOYSA-N (2-fluoro-1h-pyridin-2-yl)boronic acid Chemical compound OB(O)C1(F)NC=CC=C1 QRZNDBXLPMZTDZ-UHFFFAOYSA-N 0.000 description 2
- JVHBZLBJDNVILA-UHFFFAOYSA-N (5-fluoro-2-nitrophenyl)methanamine Chemical compound NCC1=CC(F)=CC=C1[N+]([O-])=O JVHBZLBJDNVILA-UHFFFAOYSA-N 0.000 description 2
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 2
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 2
- AWPAZVLXXSISNV-UHFFFAOYSA-N 1-(2-methyl-5-nitrophenyl)pyrrolidine Chemical compound CC1=CC=C([N+]([O-])=O)C=C1N1CCCC1 AWPAZVLXXSISNV-UHFFFAOYSA-N 0.000 description 2
- RXWYFLRAEYPAIV-UHFFFAOYSA-N 1-bromo-4-isothiocyanato-2-methylbenzene Chemical compound CC1=CC(N=C=S)=CC=C1Br RXWYFLRAEYPAIV-UHFFFAOYSA-N 0.000 description 2
- MZZVFXMTZTVUFO-UHFFFAOYSA-N 1-chloro-4-isothiocyanatobenzene Chemical compound ClC1=CC=C(N=C=S)C=C1 MZZVFXMTZTVUFO-UHFFFAOYSA-N 0.000 description 2
- XEWICNRVCQLKIG-UHFFFAOYSA-N 1-ethyl-4-(4-nitrophenyl)piperazine Chemical compound C1CN(CC)CCN1C1=CC=C([N+]([O-])=O)C=C1 XEWICNRVCQLKIG-UHFFFAOYSA-N 0.000 description 2
- XXLWCGRHJFEMQH-UHFFFAOYSA-N 1-ethyl-4-isothiocyanatobenzene Chemical compound CCC1=CC=C(N=C=S)C=C1 XXLWCGRHJFEMQH-UHFFFAOYSA-N 0.000 description 2
- NFIUJHJMCQQYDL-UHFFFAOYSA-N 1-fluoro-4-isothiocyanatobenzene Chemical compound FC1=CC=C(N=C=S)C=C1 NFIUJHJMCQQYDL-UHFFFAOYSA-N 0.000 description 2
- HOHSBFCSOARUBF-UHFFFAOYSA-N 1-isothiocyanato-2,4-dimethylbenzene Chemical compound CC1=CC=C(N=C=S)C(C)=C1 HOHSBFCSOARUBF-UHFFFAOYSA-N 0.000 description 2
- SHEUTMKVKORWJF-UHFFFAOYSA-N 1-isothiocyanato-3-propan-2-yloxybenzene Chemical compound CC(C)OC1=CC=CC(N=C=S)=C1 SHEUTMKVKORWJF-UHFFFAOYSA-N 0.000 description 2
- ASKKQCQOXXCVNU-UHFFFAOYSA-N 2-(4-bromoanilino)-1,3-benzoxazol-5-ol Chemical compound N=1C2=CC(O)=CC=C2OC=1NC1=CC=C(Br)C=C1 ASKKQCQOXXCVNU-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- XDYFAYVQPCTFOY-UHFFFAOYSA-N 2-bromo-5-methoxy-1,3-benzothiazole Chemical compound COC1=CC=C2SC(Br)=NC2=C1 XDYFAYVQPCTFOY-UHFFFAOYSA-N 0.000 description 2
- MGQROXOMFRGAOY-UHFFFAOYSA-N 2-chloro-4-pyridin-3-ylpyrimidine Chemical compound ClC1=NC=CC(C=2C=NC=CC=2)=N1 MGQROXOMFRGAOY-UHFFFAOYSA-N 0.000 description 2
- AQRGYIVMIMMJBP-UHFFFAOYSA-N 2-fluoro-3-(4-methylpiperazin-1-yl)-6-nitroaniline Chemical compound C1CN(C)CCN1C1=CC=C([N+]([O-])=O)C(N)=C1F AQRGYIVMIMMJBP-UHFFFAOYSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- OBOSXEWFRARQPU-UHFFFAOYSA-N 2-n,2-n-dimethylpyridine-2,5-diamine Chemical compound CN(C)C1=CC=C(N)C=N1 OBOSXEWFRARQPU-UHFFFAOYSA-N 0.000 description 2
- PNGQEVKCNGURKG-UHFFFAOYSA-N 2-n-(4-bromophenyl)-3h-benzimidazole-2,5-diamine Chemical compound N1C2=CC(N)=CC=C2N=C1NC1=CC=C(Br)C=C1 PNGQEVKCNGURKG-UHFFFAOYSA-N 0.000 description 2
- VQGHOUODWALEFC-UHFFFAOYSA-N 2-phenylpyridine Chemical group C1=CC=CC=C1C1=CC=CC=N1 VQGHOUODWALEFC-UHFFFAOYSA-N 0.000 description 2
- IEVJVQXLBZUEMH-UHFFFAOYSA-N 2-piperidin-2-ylethanamine Chemical compound NCCC1CCCCN1 IEVJVQXLBZUEMH-UHFFFAOYSA-N 0.000 description 2
- DOLQYFPDPKPQSS-UHFFFAOYSA-N 3,4-dimethylaniline Chemical compound CC1=CC=C(N)C=C1C DOLQYFPDPKPQSS-UHFFFAOYSA-N 0.000 description 2
- FPWLQQCGTRLWTG-UHFFFAOYSA-N 3-(3-chloropyridin-4-yl)-4-methylaniline Chemical compound CC1=CC=C(N)C=C1C1=CC=NC=C1Cl FPWLQQCGTRLWTG-UHFFFAOYSA-N 0.000 description 2
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- AESPGPVCKLYYMI-UHFFFAOYSA-N 3-chloro-4-(2-methyl-5-nitrophenyl)pyridine Chemical compound CC1=CC=C([N+]([O-])=O)C=C1C1=CC=NC=C1Cl AESPGPVCKLYYMI-UHFFFAOYSA-N 0.000 description 2
- WJJLGPQRUCWHKZ-UHFFFAOYSA-N 3-chloro-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC(Cl)=C1 WJJLGPQRUCWHKZ-UHFFFAOYSA-N 0.000 description 2
- LLPIMIMXCXEFER-UHFFFAOYSA-N 4-(2-morpholin-4-ylethyl)aniline Chemical compound C1=CC(N)=CC=C1CCN1CCOCC1 LLPIMIMXCXEFER-UHFFFAOYSA-N 0.000 description 2
- WMKSYPPMPLLFOE-UHFFFAOYSA-N 4-(3-bromopropoxy)-2-nitroaniline Chemical compound NC1=CC=C(OCCCBr)C=C1[N+]([O-])=O WMKSYPPMPLLFOE-UHFFFAOYSA-N 0.000 description 2
- XYEZVBVOGISFDY-UHFFFAOYSA-N 4-(4-amino-3-nitrophenoxy)-n,n-dimethylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)N(C)C)=CC(OC=2C=C(C(N)=CC=2)[N+]([O-])=O)=C1 XYEZVBVOGISFDY-UHFFFAOYSA-N 0.000 description 2
- KEPUOYACJXZYTQ-UHFFFAOYSA-N 4-(4-ethylpiperazin-1-yl)aniline Chemical compound C1CN(CC)CCN1C1=CC=C(N)C=C1 KEPUOYACJXZYTQ-UHFFFAOYSA-N 0.000 description 2
- GCEPYWXJPCACOW-UHFFFAOYSA-N 4-(4-pyridin-3-ylpyrimidin-2-yl)oxybenzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1OC1=NC=CC(C=2C=NC=CC=2)=N1 GCEPYWXJPCACOW-UHFFFAOYSA-N 0.000 description 2
- VVTIATCVLPUOPW-UHFFFAOYSA-N 4-[(4-ethylpiperazin-1-yl)methyl]aniline Chemical compound C1CN(CC)CCN1CC1=CC=C(N)C=C1 VVTIATCVLPUOPW-UHFFFAOYSA-N 0.000 description 2
- WPOSDXIOVTVVAH-UHFFFAOYSA-N 4-[1-methyl-2-(3-propan-2-ylanilino)benzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound CC(C)C1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(N=CC=4)C(O)=O)C=C3N=2)C)=C1 WPOSDXIOVTVVAH-UHFFFAOYSA-N 0.000 description 2
- JLLIXKAWWJTDNP-UHFFFAOYSA-N 4-[1-methyl-2-(4-methylanilino)benzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound C1=CC(C)=CC=C1NC1=NC2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N1C JLLIXKAWWJTDNP-UHFFFAOYSA-N 0.000 description 2
- DWGYYXTWFYMMDF-UHFFFAOYSA-N 4-[2-(2-methoxy-5-pyridin-4-ylanilino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C(=CC=C(C=4)C=4C=CN=CC=4)OC)N(C)C3=CC=2)=C1 DWGYYXTWFYMMDF-UHFFFAOYSA-N 0.000 description 2
- XYXYIIYLSGRQEP-UHFFFAOYSA-N 4-[2-(3-amino-4-chloroanilino)-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C(N)C(Cl)=CC=4)N(C)C3=CC=2)=C1 XYXYIIYLSGRQEP-UHFFFAOYSA-N 0.000 description 2
- XXQHKAIVOYWSOC-UHFFFAOYSA-N 4-[2-(3-ethylanilino)-1-methylbenzimidazol-5-yl]oxy-n-[3-(2-oxopyrrolidin-1-yl)propyl]pyridine-2-carboxamide Chemical compound CCC1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(N=CC=4)C(=O)NCCCN4C(CCC4)=O)C=C3N=2)C)=C1 XXQHKAIVOYWSOC-UHFFFAOYSA-N 0.000 description 2
- XQXDKWDWNQFNJA-UHFFFAOYSA-N 4-[2-(4-bromo-3-methylanilino)-6-methoxy-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C=2C=C(OC=3C=C(N=CC=3)C(O)=O)C(OC)=CC=2N(C)C=1NC1=CC=C(Br)C(C)=C1 XQXDKWDWNQFNJA-UHFFFAOYSA-N 0.000 description 2
- BFWPDYZEIUKMJV-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-3-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N(C)C(NC=4C=CC(Br)=CC=4)=NC3=CC=2)=C1 BFWPDYZEIUKMJV-UHFFFAOYSA-N 0.000 description 2
- YPNYOSLFTZRLEW-UHFFFAOYSA-N 4-[2-(4-chloro-3-pyridin-4-ylanilino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C(C(Cl)=CC=4)C=4C=CN=CC=4)N(C)C3=CC=2)=C1 YPNYOSLFTZRLEW-UHFFFAOYSA-N 0.000 description 2
- WTLNZKVACITUMT-UHFFFAOYSA-N 4-[2-(4-chloroanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carbonitrile Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C#N)=CC=C2N(C)C=1NC1=CC=C(Cl)C=C1 WTLNZKVACITUMT-UHFFFAOYSA-N 0.000 description 2
- AHZQRBCQCSFDCG-UHFFFAOYSA-N 4-[2-(4-chloroanilino)-6-methoxy-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C=2C=C(OC=3C=C(N=CC=3)C(O)=O)C(OC)=CC=2N(C)C=1NC1=CC=C(Cl)C=C1 AHZQRBCQCSFDCG-UHFFFAOYSA-N 0.000 description 2
- DOOFLMNKKPHYSI-UHFFFAOYSA-N 4-[2-(4-fluoro-3-pyridin-4-ylanilino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C(C(F)=CC=4)C=4C=CN=CC=4)N(C)C3=CC=2)=C1 DOOFLMNKKPHYSI-UHFFFAOYSA-N 0.000 description 2
- CXNDKOCQUJVQBA-UHFFFAOYSA-N 4-[2-(4-fluoroanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N(C)C=1NC1=CC=C(F)C=C1 CXNDKOCQUJVQBA-UHFFFAOYSA-N 0.000 description 2
- LRPNQBSXXIIABY-UHFFFAOYSA-N 4-[3-amino-4-(methylamino)phenoxy]-n,n-dimethylpyridine-2-carboxamide Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=NC(C(=O)N(C)C)=C1 LRPNQBSXXIIABY-UHFFFAOYSA-N 0.000 description 2
- WTWNAWPQCMHEGE-UHFFFAOYSA-N 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carbaldehyde Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C=O)=C1 WTWNAWPQCMHEGE-UHFFFAOYSA-N 0.000 description 2
- HFQDSIXPMQRTAX-UHFFFAOYSA-N 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carbonitrile Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C#N)=C1 HFQDSIXPMQRTAX-UHFFFAOYSA-N 0.000 description 2
- TZISYNOQFCVJLC-UHFFFAOYSA-N 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxylic acid Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C(O)=O)=C1 TZISYNOQFCVJLC-UHFFFAOYSA-N 0.000 description 2
- UIYJJRGPGYNXNE-UHFFFAOYSA-N 4-chloro-n,n-dimethylpyridine-2-carboxamide Chemical compound CN(C)C(=O)C1=CC(Cl)=CC=N1 UIYJJRGPGYNXNE-UHFFFAOYSA-N 0.000 description 2
- FYBNFLRGZHGUDY-UHFFFAOYSA-N 4-chloropyridine-2-carbonyl chloride Chemical compound ClC(=O)C1=CC(Cl)=CC=N1 FYBNFLRGZHGUDY-UHFFFAOYSA-N 0.000 description 2
- UZHKPPRLUVCFKK-UHFFFAOYSA-N 5-(4-cyclopentylpiperazin-1-yl)-2-nitroaniline Chemical compound C1=C([N+]([O-])=O)C(N)=CC(N2CCN(CC2)C2CCCC2)=C1 UZHKPPRLUVCFKK-UHFFFAOYSA-N 0.000 description 2
- 101150019464 ARAF gene Proteins 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 108060006698 EGF receptor Proteins 0.000 description 2
- 102000001301 EGF receptor Human genes 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 101150040099 MAP2K2 gene Proteins 0.000 description 2
- 101150018665 MAPK3 gene Proteins 0.000 description 2
- 101150024075 Mapk1 gene Proteins 0.000 description 2
- 241001024304 Mino Species 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- JTDIZSGAIYUHPX-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 JTDIZSGAIYUHPX-UHFFFAOYSA-N 0.000 description 2
- MTFFAYYIWDNMSA-UHFFFAOYSA-N N=C=S.C=1C=CC=CC=1CNCCC1=CC=CC=C1 Chemical compound N=C=S.C=1C=CC=CC=1CNCCC1=CC=CC=C1 MTFFAYYIWDNMSA-UHFFFAOYSA-N 0.000 description 2
- QXZIWVRXROLEMZ-UHFFFAOYSA-N N=C=S.CC1=CC=CC=C1Br Chemical compound N=C=S.CC1=CC=CC=C1Br QXZIWVRXROLEMZ-UHFFFAOYSA-N 0.000 description 2
- HHGFEIFUQNJCOF-UHFFFAOYSA-N N=C=S.CC1=CC=CC=C1C1=CC=NC=C1Cl Chemical compound N=C=S.CC1=CC=CC=C1C1=CC=NC=C1Cl HHGFEIFUQNJCOF-UHFFFAOYSA-N 0.000 description 2
- 108700020796 Oncogene Proteins 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- 108091008606 PDGF receptors Proteins 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 102000011653 Platelet-Derived Growth Factor Receptors Human genes 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 102000009516 Protein Serine-Threonine Kinases Human genes 0.000 description 2
- 108010009341 Protein Serine-Threonine Kinases Proteins 0.000 description 2
- 102000001788 Proto-Oncogene Proteins c-raf Human genes 0.000 description 2
- 108010029869 Proto-Oncogene Proteins c-raf Proteins 0.000 description 2
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 2
- 239000004473 Threonine Substances 0.000 description 2
- AVOVJYSYRUEVIA-UHFFFAOYSA-N [4-[2-(4-chloroanilino)-1-methylbenzimidazol-5-yl]oxypyridin-2-yl]methanol Chemical compound N=1C2=CC(OC=3C=C(CO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Cl)C=C1 AVOVJYSYRUEVIA-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
- 229940041181 antineoplastic drug Drugs 0.000 description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- UXHQMSUJQLPRAW-UHFFFAOYSA-N benzene;isothiocyanic acid Chemical compound N=C=S.C1=CC=CC=C1 UXHQMSUJQLPRAW-UHFFFAOYSA-N 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000025084 cell cycle arrest Effects 0.000 description 2
- 230000003915 cell function Effects 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000006165 cyclic alkyl group Chemical group 0.000 description 2
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 230000004069 differentiation Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000009510 drug design Methods 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- 239000003102 growth factor Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 201000005787 hematologic cancer Diseases 0.000 description 2
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 description 2
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- GJRJCCXZJMFAIX-UHFFFAOYSA-N methyl 5-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 GJRJCCXZJMFAIX-UHFFFAOYSA-N 0.000 description 2
- KBFXCDQDPANMIQ-UHFFFAOYSA-N methyl 5-[3-amino-4-(methylamino)phenoxy]pyridine-3-carboxylate Chemical compound C1=C(N)C(NC)=CC=C1OC1=CN=CC(C(=O)OC)=C1 KBFXCDQDPANMIQ-UHFFFAOYSA-N 0.000 description 2
- ADAXEROWSFBHLQ-UHFFFAOYSA-N methyl 5-[3-nitro-4-[(2,2,2-trifluoroacetyl)amino]phenoxy]pyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(OC=2C=C(C(NC(=O)C(F)(F)F)=CC=2)[N+]([O-])=O)=C1 ADAXEROWSFBHLQ-UHFFFAOYSA-N 0.000 description 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 2
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000003226 mitogen Substances 0.000 description 2
- IXXDQTFSZHRHDU-UHFFFAOYSA-N n,n-dimethyl-4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxamide Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C(=O)N(C)C)=C1 IXXDQTFSZHRHDU-UHFFFAOYSA-N 0.000 description 2
- HHXAUUFQZNWJDC-UHFFFAOYSA-N n-(2-hydroxyethyl)-4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxamide Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C(=O)NCCO)=C1 HHXAUUFQZNWJDC-UHFFFAOYSA-N 0.000 description 2
- CDOGWUYGEHKINX-UHFFFAOYSA-N n-(4-bromophenyl)-1-methyl-5-[2-(methylaminomethyl)pyridin-4-yl]oxybenzimidazol-2-amine Chemical compound C1=NC(CNC)=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 CDOGWUYGEHKINX-UHFFFAOYSA-N 0.000 description 2
- HJIQWEBLVQWUMD-UHFFFAOYSA-N n-(4-bromophenyl)-5-methoxy-1,3-benzothiazol-2-amine Chemical compound N=1C2=CC(OC)=CC=C2SC=1NC1=CC=C(Br)C=C1 HJIQWEBLVQWUMD-UHFFFAOYSA-N 0.000 description 2
- YIBHHPKCUYKTTB-UHFFFAOYSA-N n-benzyl-2-(4-nitrophenyl)ethanamine Chemical compound C1=CC([N+](=O)[O-])=CC=C1CCNCC1=CC=CC=C1 YIBHHPKCUYKTTB-UHFFFAOYSA-N 0.000 description 2
- KOIHHWQVQXDNHR-UHFFFAOYSA-N n-methyl-4-[1-methyl-2-[4-(2-morpholin-4-ylethyl)anilino]benzimidazol-5-yl]oxypyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=CC(CCN5CCOCC5)=CC=4)N(C)C3=CC=2)=C1 KOIHHWQVQXDNHR-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 2
- 239000000346 nonvolatile oil Substances 0.000 description 2
- 238000011275 oncology therapy Methods 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 2
- 150000003904 phospholipids Chemical class 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 230000035755 proliferation Effects 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 108700042226 ras Genes Proteins 0.000 description 2
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 2
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 230000011664 signaling Effects 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 229910000162 sodium phosphate Inorganic materials 0.000 description 2
- 239000007909 solid dosage form Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 229960001603 tamoxifen Drugs 0.000 description 2
- BSCMJQUASNXFIA-UHFFFAOYSA-N tert-butyl 4-chloropyridine-2-carboxylate Chemical compound CC(C)(C)OC(=O)C1=CC(Cl)=CC=N1 BSCMJQUASNXFIA-UHFFFAOYSA-N 0.000 description 2
- NWVDKZOUGBMLIH-UHFFFAOYSA-N tert-butyl 6-amino-2,3-dihydroindole-1-carboxylate Chemical compound C1=C(N)C=C2N(C(=O)OC(C)(C)C)CCC2=C1 NWVDKZOUGBMLIH-UHFFFAOYSA-N 0.000 description 2
- KNLKRAUJQBLECR-UHFFFAOYSA-N tert-butyl pyridine-2-carboxylate Chemical compound CC(C)(C)OC(=O)C1=CC=CC=N1 KNLKRAUJQBLECR-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- 230000005740 tumor formation Effects 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- LSPHULWDVZXLIL-UHFFFAOYSA-N (+/-)-Camphoric acid Chemical compound CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- SFUIGUOONHIVLG-UHFFFAOYSA-N (2-nitrophenyl)boronic acid Chemical compound OB(O)C1=CC=CC=C1[N+]([O-])=O SFUIGUOONHIVLG-UHFFFAOYSA-N 0.000 description 1
- XMAYWYJOQHXEEK-OZXSUGGESA-N (2R,4S)-ketoconazole Chemical compound C1CN(C(=O)C)CCN1C(C=C1)=CC=C1OC[C@@H]1O[C@@](CN2C=NC=C2)(C=2C(=CC(Cl)=CC=2)Cl)OC1 XMAYWYJOQHXEEK-OZXSUGGESA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- YUXKOWPNKJSTPQ-AXWWPMSFSA-N (2s,3r)-2-amino-3-hydroxybutanoic acid;(2s)-2-amino-3-hydroxypropanoic acid Chemical compound OC[C@H](N)C(O)=O.C[C@@H](O)[C@H](N)C(O)=O YUXKOWPNKJSTPQ-AXWWPMSFSA-N 0.000 description 1
- XMEGAFICDYBQKG-UHFFFAOYSA-N (3-aminopyrrolidin-1-yl)-[4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridin-2-yl]methanone Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(=O)N3CC(N)CC3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 XMEGAFICDYBQKG-UHFFFAOYSA-N 0.000 description 1
- FRQBKPHRQRPPDJ-UHFFFAOYSA-N (3-chloropyridin-4-yl)boronic acid;hydrate Chemical compound O.OB(O)C1=CC=NC=C1Cl FRQBKPHRQRPPDJ-UHFFFAOYSA-N 0.000 description 1
- SWFHGTMLYIBPPA-UHFFFAOYSA-N (4-methoxyphenyl)-phenylmethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 SWFHGTMLYIBPPA-UHFFFAOYSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- LKJPYSCBVHEWIU-KRWDZBQOSA-N (R)-bicalutamide Chemical compound C([C@@](O)(C)C(=O)NC=1C=C(C(C#N)=CC=1)C(F)(F)F)S(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-KRWDZBQOSA-N 0.000 description 1
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- OSBIEFWIIINTNJ-UHFFFAOYSA-N 1,2-dichloro-4-isothiocyanatobenzene Chemical compound ClC1=CC=C(N=C=S)C=C1Cl OSBIEFWIIINTNJ-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- DBSXNGIBAKYMSS-UHFFFAOYSA-N 1,3-difluoro-2-isothiocyanatobenzene Chemical compound FC1=CC=CC(F)=C1N=C=S DBSXNGIBAKYMSS-UHFFFAOYSA-N 0.000 description 1
- ABADUMLIAZCWJD-UHFFFAOYSA-N 1,3-dioxole Chemical compound C1OC=CO1 ABADUMLIAZCWJD-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XJKSTNDFUHDPQJ-UHFFFAOYSA-N 1,4-diphenylbenzene Chemical compound C1=CC=CC=C1C1=CC=C(C=2C=CC=CC=2)C=C1 XJKSTNDFUHDPQJ-UHFFFAOYSA-N 0.000 description 1
- VDTMHXBNLSMARZ-UHFFFAOYSA-N 1,5-dibromo-3-fluoro-2-isothiocyanatobenzene Chemical compound FC1=CC(Br)=CC(Br)=C1N=C=S VDTMHXBNLSMARZ-UHFFFAOYSA-N 0.000 description 1
- NTURQZFFJDCTMZ-UHFFFAOYSA-N 1-(2-bromoethyl)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(CCBr)C=C1 NTURQZFFJDCTMZ-UHFFFAOYSA-N 0.000 description 1
- HJORCZCMNWLHMB-UHFFFAOYSA-N 1-(3-aminopropyl)pyrrolidin-2-one Chemical compound NCCCN1CCCC1=O HJORCZCMNWLHMB-UHFFFAOYSA-N 0.000 description 1
- CDQKPLGLAHMDMI-UHFFFAOYSA-N 1-(3-isothiocyanatophenyl)-2,3-dihydro-1H-indene Chemical compound S=C=NC1=CC=CC(C2C3=CC=CC=C3CC2)=C1 CDQKPLGLAHMDMI-UHFFFAOYSA-N 0.000 description 1
- MMEYJNMZRUJHFR-UHFFFAOYSA-N 1-(difluoromethoxy)-2-isothiocyanatobenzene Chemical compound FC(F)OC1=CC=CC=C1N=C=S MMEYJNMZRUJHFR-UHFFFAOYSA-N 0.000 description 1
- MJUFKCAVCYZGCB-UHFFFAOYSA-N 1-(isocyanatosulfanylmethyl)-4-methylbenzene Chemical compound CC1=CC=C(CSN=C=O)C=C1 MJUFKCAVCYZGCB-UHFFFAOYSA-N 0.000 description 1
- CHZFXZDXTFGTCA-UHFFFAOYSA-N 1-[2-(furan-3-yl)phenyl]piperazine Chemical compound C1CNCCN1C1=CC=CC=C1C1=COC=C1 CHZFXZDXTFGTCA-UHFFFAOYSA-N 0.000 description 1
- ZXZYSSSRXLSVBU-UHFFFAOYSA-N 1-[3-(furan-2-yl)pyridin-4-yl]piperazine Chemical group C1CNCCN1C1=CC=NC=C1C1=CC=CO1 ZXZYSSSRXLSVBU-UHFFFAOYSA-N 0.000 description 1
- KKKDZZRICRFGSD-UHFFFAOYSA-N 1-benzylimidazole Chemical compound C1=CN=CN1CC1=CC=CC=C1 KKKDZZRICRFGSD-UHFFFAOYSA-N 0.000 description 1
- NYJNWHXQEZOISL-UHFFFAOYSA-N 1-bromo-2-chloro-4-isothiocyanatobenzene Chemical compound ClC1=CC(N=C=S)=CC=C1Br NYJNWHXQEZOISL-UHFFFAOYSA-N 0.000 description 1
- MKIPLYFZXZBXGO-UHFFFAOYSA-N 1-bromo-2-fluoro-4-isothiocyanatobenzene Chemical compound FC1=CC(N=C=S)=CC=C1Br MKIPLYFZXZBXGO-UHFFFAOYSA-N 0.000 description 1
- PAFORXDSYWMYGP-UHFFFAOYSA-N 1-bromo-2-isothiocyanatobenzene Chemical compound BrC1=CC=CC=C1N=C=S PAFORXDSYWMYGP-UHFFFAOYSA-N 0.000 description 1
- JZDZRFNMDCBTNS-UHFFFAOYSA-N 1-butyl-4-phenylbenzene Chemical compound C1=CC(CCCC)=CC=C1C1=CC=CC=C1 JZDZRFNMDCBTNS-UHFFFAOYSA-N 0.000 description 1
- AHFPRSSHNSGRCU-UHFFFAOYSA-N 1-chloro-4-isothiocyanato-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC(N=C=S)=CC=C1Cl AHFPRSSHNSGRCU-UHFFFAOYSA-N 0.000 description 1
- ZTEHOZMYMCEYRM-UHFFFAOYSA-N 1-chlorodecane Chemical compound CCCCCCCCCCCl ZTEHOZMYMCEYRM-UHFFFAOYSA-N 0.000 description 1
- PVMCQBPJKPMOKM-UHFFFAOYSA-N 1-cyclopentylpiperazine Chemical compound C1CCCC1N1CCNCC1 PVMCQBPJKPMOKM-UHFFFAOYSA-N 0.000 description 1
- YWCJWMWIEHZSOZ-UHFFFAOYSA-N 1-ethoxy-4-(4-methoxyphenyl)benzene Chemical compound C1=CC(OCC)=CC=C1C1=CC=C(OC)C=C1 YWCJWMWIEHZSOZ-UHFFFAOYSA-N 0.000 description 1
- WGCYRFWNGRMRJA-UHFFFAOYSA-N 1-ethylpiperazine Chemical compound CCN1CCNCC1 WGCYRFWNGRMRJA-UHFFFAOYSA-N 0.000 description 1
- BYEKJBKFNWQVLL-UHFFFAOYSA-N 1-ethylpiperazine;1-methylpiperazine Chemical compound CN1CCNCC1.CCN1CCNCC1 BYEKJBKFNWQVLL-UHFFFAOYSA-N 0.000 description 1
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 1
- ODOTYLQYSDVPMA-UHFFFAOYSA-N 1-iodo-2-isothiocyanatobenzene Chemical compound IC1=CC=CC=C1N=C=S ODOTYLQYSDVPMA-UHFFFAOYSA-N 0.000 description 1
- LKCSXVAACHUTGC-UHFFFAOYSA-N 1-iodo-3-isothiocyanatobenzene Chemical compound IC1=CC=CC(N=C=S)=C1 LKCSXVAACHUTGC-UHFFFAOYSA-N 0.000 description 1
- JYKYYPPZLPVIBY-UHFFFAOYSA-N 1-isothiocyanato-2-methylbenzene Chemical compound CC1=CC=CC=C1N=C=S JYKYYPPZLPVIBY-UHFFFAOYSA-N 0.000 description 1
- HERQJOQHRKNLIP-UHFFFAOYSA-N 1-isothiocyanato-2-phenoxybenzene Chemical compound S=C=NC1=CC=CC=C1OC1=CC=CC=C1 HERQJOQHRKNLIP-UHFFFAOYSA-N 0.000 description 1
- LNIPHWGHHXXSOX-UHFFFAOYSA-N 1-isothiocyanato-2-phenylsulfanylbenzene Chemical compound S=C=NC1=CC=CC=C1SC1=CC=CC=C1 LNIPHWGHHXXSOX-UHFFFAOYSA-N 0.000 description 1
- GFEPANUKFYVALF-UHFFFAOYSA-N 1-isothiocyanato-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(N=C=S)=C1 GFEPANUKFYVALF-UHFFFAOYSA-N 0.000 description 1
- WHBYCPUKGYEYFU-UHFFFAOYSA-N 1-isothiocyanato-3-methoxybenzene Chemical compound COC1=CC=CC(N=C=S)=C1 WHBYCPUKGYEYFU-UHFFFAOYSA-N 0.000 description 1
- JKSZUQPHKOPVHF-UHFFFAOYSA-N 1-isothiocyanato-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(N=C=S)C=C1 JKSZUQPHKOPVHF-UHFFFAOYSA-N 0.000 description 1
- DQEVDFQAYLIBRD-UHFFFAOYSA-N 1-isothiocyanato-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(N=C=S)C=C1 DQEVDFQAYLIBRD-UHFFFAOYSA-N 0.000 description 1
- ABQKHKWXTUVKGF-UHFFFAOYSA-N 1-isothiocyanato-4-methylbenzene Chemical compound CC1=CC=C(N=C=S)C=C1 ABQKHKWXTUVKGF-UHFFFAOYSA-N 0.000 description 1
- CEBAJHCAFXYWNT-UHFFFAOYSA-N 1-isothiocyanato-4-methylsulfanylbenzene Chemical compound CSC1=CC=C(N=C=S)C=C1 CEBAJHCAFXYWNT-UHFFFAOYSA-N 0.000 description 1
- OFOKALISZFFLRJ-UHFFFAOYSA-N 1-methyl-4-[(5-phenylthiophen-2-yl)methyl]piperazine Chemical compound C1CN(C)CCN1CC1=CC=C(C=2C=CC=CC=2)S1 OFOKALISZFFLRJ-UHFFFAOYSA-N 0.000 description 1
- RBRWAYCOVWVMHS-UHFFFAOYSA-N 1-methylpiperazine;oxolane Chemical compound C1CCOC1.CN1CCNCC1 RBRWAYCOVWVMHS-UHFFFAOYSA-N 0.000 description 1
- LXINKRZIJMGCDO-UHFFFAOYSA-N 1-methylsulfanyl-4-phenylbenzene Chemical compound C1=CC(SC)=CC=C1C1=CC=CC=C1 LXINKRZIJMGCDO-UHFFFAOYSA-N 0.000 description 1
- KYRIJCZWIILJBZ-UHFFFAOYSA-N 1-n-methyl-4-phenoxybenzene-1,2-diamine Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=CC=C1 KYRIJCZWIILJBZ-UHFFFAOYSA-N 0.000 description 1
- GPOYJVWXGJBMOK-UHFFFAOYSA-N 1-phenoxy-4-phenylbenzene Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1OC1=CC=CC=C1 GPOYJVWXGJBMOK-UHFFFAOYSA-N 0.000 description 1
- OUMKBAHMPRLISR-UHFFFAOYSA-N 1-phenyl-4-(trifluoromethyl)benzene Chemical compound C1=CC(C(F)(F)F)=CC=C1C1=CC=CC=C1 OUMKBAHMPRLISR-UHFFFAOYSA-N 0.000 description 1
- SEULWJSKCVACTH-UHFFFAOYSA-N 1-phenylimidazole Chemical compound C1=NC=CN1C1=CC=CC=C1 SEULWJSKCVACTH-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- VSHIRTNKIXRXMI-UHFFFAOYSA-N 2,2-dimethyl-1,3-oxazolidine Chemical compound CC1(C)NCCO1 VSHIRTNKIXRXMI-UHFFFAOYSA-N 0.000 description 1
- DIPGYZSCGXBTEU-UHFFFAOYSA-N 2,3-difluoro-6-nitroaniline Chemical compound NC1=C(F)C(F)=CC=C1[N+]([O-])=O DIPGYZSCGXBTEU-UHFFFAOYSA-N 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- KBXRNBDAFWDLKI-UHFFFAOYSA-N 2-(1h-imidazol-2-yl)pyrazine Chemical compound C1=CNC(C=2N=CC=NC=2)=N1 KBXRNBDAFWDLKI-UHFFFAOYSA-N 0.000 description 1
- XMFNKZPINKPURY-UHFFFAOYSA-N 2-(2-phenylethynyl)pyrazine Chemical compound C1=CC=CC=C1C#CC1=CN=CC=N1 XMFNKZPINKPURY-UHFFFAOYSA-N 0.000 description 1
- KWDLGYVOZPYSQD-UHFFFAOYSA-N 2-(3-bromoanilino)-1-methylbenzimidazol-5-ol Chemical compound N=1C2=CC(O)=CC=C2N(C)C=1NC1=CC=CC(Br)=C1 KWDLGYVOZPYSQD-UHFFFAOYSA-N 0.000 description 1
- JDMNBMWRIUAWFW-UHFFFAOYSA-N 2-(3-fluoro-4-methoxy-5-prop-2-enylphenyl)furan Chemical compound C1=C(CC=C)C(OC)=C(F)C=C1C1=CC=CO1 JDMNBMWRIUAWFW-UHFFFAOYSA-N 0.000 description 1
- JLSBMXUYHUFHTH-UHFFFAOYSA-N 2-(3-methoxyphenyl)thiophene Chemical compound COC1=CC=CC(C=2SC=CC=2)=C1 JLSBMXUYHUFHTH-UHFFFAOYSA-N 0.000 description 1
- FREKGJOVUQPIKK-UHFFFAOYSA-N 2-(3-nitrophenyl)thiophene Chemical compound [O-][N+](=O)C1=CC=CC(C=2SC=CC=2)=C1 FREKGJOVUQPIKK-UHFFFAOYSA-N 0.000 description 1
- FYKAQDZYDRVKMU-UHFFFAOYSA-N 2-(4-bromoanilino)-1,3-benzothiazol-5-ol Chemical compound N=1C2=CC(O)=CC=C2SC=1NC1=CC=C(Br)C=C1 FYKAQDZYDRVKMU-UHFFFAOYSA-N 0.000 description 1
- DAIRPGULXRTFPX-UHFFFAOYSA-N 2-(4-ethylphenyl)thiophene Chemical compound C1=CC(CC)=CC=C1C1=CC=CS1 DAIRPGULXRTFPX-UHFFFAOYSA-N 0.000 description 1
- TWKDIVDAGCWHES-UHFFFAOYSA-N 2-(4-methoxyphenyl)thiophene Chemical compound C1=CC(OC)=CC=C1C1=CC=CS1 TWKDIVDAGCWHES-UHFFFAOYSA-N 0.000 description 1
- AFLBPIABCXIKBD-UHFFFAOYSA-N 2-(4-methylsulfanylphenyl)thiophene Chemical compound C1=CC(SC)=CC=C1C1=CC=CS1 AFLBPIABCXIKBD-UHFFFAOYSA-N 0.000 description 1
- XEVXGEUMUOAZQN-UHFFFAOYSA-N 2-(5-fluoro-2-nitrophenyl)isoindole-1,3-dione Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1N1C(=O)C2=CC=CC=C2C1=O XEVXGEUMUOAZQN-UHFFFAOYSA-N 0.000 description 1
- KHYJZXSOIPJYSF-UHFFFAOYSA-N 2-(butylamino)-n-[4-(2-phenylethynyl)phenyl]acetamide Chemical compound C1=CC(NC(=O)CNCCCC)=CC=C1C#CC1=CC=CC=C1 KHYJZXSOIPJYSF-UHFFFAOYSA-N 0.000 description 1
- CEWGXMUXHMVAGU-UHFFFAOYSA-N 2-(cyclohexylamino)-n-[4-(2-phenylethynyl)phenyl]acetamide Chemical compound C=1C=C(C#CC=2C=CC=CC=2)C=CC=1NC(=O)CNC1CCCCC1 CEWGXMUXHMVAGU-UHFFFAOYSA-N 0.000 description 1
- FXQOGNXCWYKOEE-UHFFFAOYSA-N 2-(cyclopropylamino)-n-[4-(2-phenylethynyl)phenyl]acetamide Chemical compound C=1C=C(C#CC=2C=CC=CC=2)C=CC=1NC(=O)CNC1CC1 FXQOGNXCWYKOEE-UHFFFAOYSA-N 0.000 description 1
- IWJGTERMSSARLB-UHFFFAOYSA-N 2-(ethylamino)-n-[4-(2-phenylethynyl)phenyl]acetamide Chemical compound C1=CC(NC(=O)CNCC)=CC=C1C#CC1=CC=CC=C1 IWJGTERMSSARLB-UHFFFAOYSA-N 0.000 description 1
- UUNLOEVETHNDQL-UHFFFAOYSA-N 2-(ethylamino)-n-[4-(4-phenylbuta-1,3-diynyl)phenyl]acetamide Chemical compound C1=CC(NC(=O)CNCC)=CC=C1C#CC#CC1=CC=CC=C1 UUNLOEVETHNDQL-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- WEYSSWQDEVEWSR-UHFFFAOYSA-N 2-[2-(4-bromo-3-methylanilino)-6-methoxy-1-methylbenzimidazol-5-yl]oxy-1H-pyridine-2-carboxylic acid Chemical compound N=1C=2C=C(OC3(C=CC=CN3)C(O)=O)C(OC)=CC=2N(C)C=1NC1=CC=C(Br)C(C)=C1 WEYSSWQDEVEWSR-UHFFFAOYSA-N 0.000 description 1
- LMXAPFWFOKHBDS-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenyl]furan Chemical compound FC(F)(F)C1=CC=CC(C=2OC=CC=2)=C1 LMXAPFWFOKHBDS-UHFFFAOYSA-N 0.000 description 1
- PIRSOJCCUACUKP-UHFFFAOYSA-N 2-[4-(2-phenylethynyl)phenyl]-1h-pyrrole Chemical compound C1=CNC(C=2C=CC(=CC=2)C#CC=2C=CC=CC=2)=C1 PIRSOJCCUACUKP-UHFFFAOYSA-N 0.000 description 1
- YNNFGAVVGZRZMT-UHFFFAOYSA-N 2-amino-3-methyl-n-[4-(2-phenylethynyl)phenyl]butanamide Chemical compound C1=CC(NC(=O)C(N)C(C)C)=CC=C1C#CC1=CC=CC=C1 YNNFGAVVGZRZMT-UHFFFAOYSA-N 0.000 description 1
- LQARCTGLACBZBH-UHFFFAOYSA-N 2-amino-n-[4-(2-phenylethynyl)phenyl]acetamide Chemical compound C1=CC(NC(=O)CN)=CC=C1C#CC1=CC=CC=C1 LQARCTGLACBZBH-UHFFFAOYSA-N 0.000 description 1
- MPHNNESXIRIGIB-UHFFFAOYSA-N 2-amino-n-[4-(2-phenylethynyl)phenyl]propanamide Chemical compound C1=CC(NC(=O)C(N)C)=CC=C1C#CC1=CC=CC=C1 MPHNNESXIRIGIB-UHFFFAOYSA-N 0.000 description 1
- SWFLBDIRSHVBOA-UHFFFAOYSA-N 2-benzylsulfanylpyridine Chemical compound C=1C=CC=CC=1CSC1=CC=CC=N1 SWFLBDIRSHVBOA-UHFFFAOYSA-N 0.000 description 1
- XFZFJQHXWJIBQV-UHFFFAOYSA-N 2-bromo-1-methyl-4-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1Br XFZFJQHXWJIBQV-UHFFFAOYSA-N 0.000 description 1
- AZNMQMFLAAJBBT-UHFFFAOYSA-N 2-chloro-1-isothiocyanato-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(N=C=S)C(Cl)=C1 AZNMQMFLAAJBBT-UHFFFAOYSA-N 0.000 description 1
- SLBYCCHSURAIIK-UHFFFAOYSA-N 2-chloro-1-methoxy-4-phenylbenzene Chemical compound C1=C(Cl)C(OC)=CC=C1C1=CC=CC=C1 SLBYCCHSURAIIK-UHFFFAOYSA-N 0.000 description 1
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 1
- HZGOUCYIYIFQHX-UHFFFAOYSA-N 2-isothiocyanato-1,3-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=CC(C(C)C)=C1N=C=S HZGOUCYIYIFQHX-UHFFFAOYSA-N 0.000 description 1
- AKUGVKYPODJPBI-UHFFFAOYSA-N 2-isothiocyanato-1-(2-methoxyphenoxy)-4-(trifluoromethyl)benzene Chemical compound COC1=CC=CC=C1OC1=CC=C(C(F)(F)F)C=C1N=C=S AKUGVKYPODJPBI-UHFFFAOYSA-N 0.000 description 1
- ZRSLJOXAHACGPX-UHFFFAOYSA-N 2-nitro-4-(4-pyridin-3-ylpyrimidin-2-yl)oxyaniline Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1OC1=NC=CC(C=2C=NC=CC=2)=N1 ZRSLJOXAHACGPX-UHFFFAOYSA-N 0.000 description 1
- IRTLROCMFSDSNF-UHFFFAOYSA-N 2-phenyl-1h-pyrrole Chemical compound C1=CNC(C=2C=CC=CC=2)=C1 IRTLROCMFSDSNF-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- PJRGDKFLFAYRBV-UHFFFAOYSA-N 2-phenylthiophene Chemical compound C1=CSC(C=2C=CC=CC=2)=C1 PJRGDKFLFAYRBV-UHFFFAOYSA-N 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- OYXGBWWGGDTMJL-UHFFFAOYSA-N 2-sulfonyl-3h-1,3-benzoxazole Chemical compound C1=CC=C2OC(=S(=O)=O)NC2=C1 OYXGBWWGGDTMJL-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- MWLBMGPQZJDFKZ-UHFFFAOYSA-N 23491-48-7 Chemical compound C1CN(C)CCN1C1=CC=C([N+]([O-])=O)C(N)=C1 MWLBMGPQZJDFKZ-UHFFFAOYSA-N 0.000 description 1
- ZQZJULZPQACTES-UHFFFAOYSA-N 3-(1h-imidazol-2-yl)pyridine Chemical compound C1=CNC(C=2C=NC=CC=2)=N1 ZQZJULZPQACTES-UHFFFAOYSA-N 0.000 description 1
- COYBNLNVTKDNIY-UHFFFAOYSA-N 3-(2,4-dichlorophenyl)-4-methyl-1h-pyrrole Chemical compound CC1=CNC=C1C1=CC=C(Cl)C=C1Cl COYBNLNVTKDNIY-UHFFFAOYSA-N 0.000 description 1
- ZLYFXWKSLUXFMU-UHFFFAOYSA-N 3-(2-phenylethynyl)pyridine Chemical compound C1=CC=CC=C1C#CC1=CC=CN=C1 ZLYFXWKSLUXFMU-UHFFFAOYSA-N 0.000 description 1
- SADHVOSOZBAAGL-UHFFFAOYSA-N 3-(trifluoromethoxy)aniline Chemical compound NC1=CC=CC(OC(F)(F)F)=C1 SADHVOSOZBAAGL-UHFFFAOYSA-N 0.000 description 1
- WEVYNIUIFUYDGI-UHFFFAOYSA-N 3-[6-[4-(trifluoromethoxy)anilino]-4-pyrimidinyl]benzamide Chemical compound NC(=O)C1=CC=CC(C=2N=CN=C(NC=3C=CC(OC(F)(F)F)=CC=3)C=2)=C1 WEVYNIUIFUYDGI-UHFFFAOYSA-N 0.000 description 1
- VKALDPNKZXSWAY-UHFFFAOYSA-N 3-amino-4-(methylamino)phenol Chemical compound CNC1=CC=C(O)C=C1N VKALDPNKZXSWAY-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- ZRPLANDPDWYOMZ-UHFFFAOYSA-N 3-cyclopentylpropionic acid Chemical compound OC(=O)CCC1CCCC1 ZRPLANDPDWYOMZ-UHFFFAOYSA-N 0.000 description 1
- AMKPQMFZCBTTAT-UHFFFAOYSA-N 3-ethylaniline Chemical compound CCC1=CC=CC(N)=C1 AMKPQMFZCBTTAT-UHFFFAOYSA-N 0.000 description 1
- KOZRFVAOQYOQPI-UHFFFAOYSA-N 3-fluoro-4-(4-methylpiperazin-1-yl)benzene-1,2-diamine Chemical compound C1CN(C)CCN1C1=CC=C(N)C(N)=C1F KOZRFVAOQYOQPI-UHFFFAOYSA-N 0.000 description 1
- JJDMDNNJDGIVCG-UHFFFAOYSA-N 3-hydroxy-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC(O)=C1 JJDMDNNJDGIVCG-UHFFFAOYSA-N 0.000 description 1
- FFCSRWGYGMRBGD-UHFFFAOYSA-N 3-iodoaniline Chemical compound NC1=CC=CC(I)=C1 FFCSRWGYGMRBGD-UHFFFAOYSA-N 0.000 description 1
- UCSYVYFGMFODMY-UHFFFAOYSA-N 3-phenoxyaniline Chemical compound NC1=CC=CC(OC=2C=CC=CC=2)=C1 UCSYVYFGMFODMY-UHFFFAOYSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-M 3-phenylpropionate Chemical compound [O-]C(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-M 0.000 description 1
- XCCNRBCNYGWTQX-UHFFFAOYSA-N 3-propan-2-ylaniline Chemical compound CC(C)C1=CC=CC(N)=C1 XCCNRBCNYGWTQX-UHFFFAOYSA-N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- DPKTVUKEPNBABS-UHFFFAOYSA-N 3-tert-butylaniline Chemical compound CC(C)(C)C1=CC=CC(N)=C1 DPKTVUKEPNBABS-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- GHEGMJFASKYZCV-UHFFFAOYSA-N 4-(4-cyclopentylpiperazin-1-yl)benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1N1CCN(C2CCCC2)CC1 GHEGMJFASKYZCV-UHFFFAOYSA-N 0.000 description 1
- RTDKAEOVZXYWJW-UHFFFAOYSA-N 4-(4-methylpiperazin-1-yl)benzene-1,2-diamine Chemical compound C1CN(C)CCN1C1=CC=C(N)C(N)=C1 RTDKAEOVZXYWJW-UHFFFAOYSA-N 0.000 description 1
- JFTATDWGOBACPO-UHFFFAOYSA-N 4-(4-phenylbuta-1,3-diynyl)aniline Chemical compound C1=CC(N)=CC=C1C#CC#CC1=CC=CC=C1 JFTATDWGOBACPO-UHFFFAOYSA-N 0.000 description 1
- YYTOEULLPOTNMN-UHFFFAOYSA-N 4-(chloromethyl)-N-[6-(4-pyridin-3-ylpyrimidin-2-yl)oxy-1H-benzimidazol-2-yl]benzamide Chemical compound C1=CC(CCl)=CC=C1C(=O)NC(NC1=C2)=NC1=CC=C2OC1=NC=CC(C=2C=NC=CC=2)=N1 YYTOEULLPOTNMN-UHFFFAOYSA-N 0.000 description 1
- QOWSWEBLNVACCL-UHFFFAOYSA-N 4-Bromophenyl acetate Chemical compound OC(=O)CC1=CC=C(Br)C=C1 QOWSWEBLNVACCL-UHFFFAOYSA-N 0.000 description 1
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 1
- FUWRCUWPFMWXKZ-UHFFFAOYSA-N 4-[(4-methylpiperazin-1-yl)methyl]-n-[6-(4-pyridin-3-ylpyrimidin-2-yl)oxy-1h-benzimidazol-2-yl]benzamide Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2NC3=CC=C(OC=4N=C(C=CN=4)C=4C=NC=CC=4)C=C3N=2)C=C1 FUWRCUWPFMWXKZ-UHFFFAOYSA-N 0.000 description 1
- HNAMAXNIIMZHSW-UHFFFAOYSA-N 4-[1-methyl-2-[4-(trifluoromethylsulfanyl)anilino]benzimidazol-5-yl]oxypyridine-2-carbaldehyde Chemical compound N=1C2=CC(OC=3C=C(C=O)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(SC(F)(F)F)C=C1 HNAMAXNIIMZHSW-UHFFFAOYSA-N 0.000 description 1
- CFDHDHWVAPXQGV-UHFFFAOYSA-N 4-[2-(2,3-dihydro-1h-indol-6-ylamino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C5NCCC5=CC=4)N(C)C3=CC=2)=C1 CFDHDHWVAPXQGV-UHFFFAOYSA-N 0.000 description 1
- UQEUTDUQZTXHOP-UHFFFAOYSA-N 4-[2-(2,6-difluoroanilino)-1-methylbenzimidazol-5-yl]oxy-n,n-dimethylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)N(C)C)=CC(OC=2C=C3N=C(NC=4C(=CC=CC=4F)F)N(C)C3=CC=2)=C1 UQEUTDUQZTXHOP-UHFFFAOYSA-N 0.000 description 1
- VTLQTHDJUGLYOA-UHFFFAOYSA-N 4-[2-(3-fluoro-2-methoxy-5-pyridin-4-ylanilino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C(=C(F)C=C(C=4)C=4C=CN=CC=4)OC)N(C)C3=CC=2)=C1 VTLQTHDJUGLYOA-UHFFFAOYSA-N 0.000 description 1
- HWNPZUOQCGNXAZ-UHFFFAOYSA-N 4-[2-(4-bromo-3-fluoroanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N(C)C=1NC1=CC=C(Br)C(F)=C1 HWNPZUOQCGNXAZ-UHFFFAOYSA-N 0.000 description 1
- HOQWETSYPZRCJB-UHFFFAOYSA-N 4-[2-(4-bromo-3-methylanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound C1=C(Br)C(C)=CC(NC=2N(C3=CC=C(OC=4C=C(N=CC=4)C(O)=O)C=C3N=2)C)=C1 HOQWETSYPZRCJB-UHFFFAOYSA-N 0.000 description 1
- UFVKXUOKVCROGK-UHFFFAOYSA-N 4-[2-(4-bromo-3-methylanilino)-6-methoxy-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C(=CC=3N(C)C(NC=4C=C(C)C(Br)=CC=4)=NC=3C=2)OC)=C1 UFVKXUOKVCROGK-UHFFFAOYSA-N 0.000 description 1
- IZEKXRNALORAHP-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxy-n,n-dimethylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)N(C)C)=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 IZEKXRNALORAHP-UHFFFAOYSA-N 0.000 description 1
- DULLTCJMKLEKCC-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxy-n-(3-pyrrolidin-1-ylpropyl)pyridine-2-carboxamide Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(=O)NCCCN3CCCC3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 DULLTCJMKLEKCC-UHFFFAOYSA-N 0.000 description 1
- IAUYLTHEUUTKBM-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxy-n-piperidin-3-ylpyridine-2-carboxamide Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(=O)NC3CNCCC3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 IAUYLTHEUUTKBM-UHFFFAOYSA-N 0.000 description 1
- ASSXVJBGASXOII-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carbaldehyde Chemical compound N=1C2=CC(OC=3C=C(C=O)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 ASSXVJBGASXOII-UHFFFAOYSA-N 0.000 description 1
- GQMVTZBVAHIADQ-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 GQMVTZBVAHIADQ-UHFFFAOYSA-N 0.000 description 1
- YSZDZOOOGQNAOV-UHFFFAOYSA-N 4-[2-(4-bromophenyl)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(N(C)C3=CC=2)C=2C=CC(Br)=CC=2)=C1 YSZDZOOOGQNAOV-UHFFFAOYSA-N 0.000 description 1
- LGXPXEHAKCAUEV-UHFFFAOYSA-N 4-[2-[(4-bromophenyl)methyl]-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(CC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 LGXPXEHAKCAUEV-UHFFFAOYSA-N 0.000 description 1
- JGCKXGFPYSAZLI-UHFFFAOYSA-N 4-[2-[3-(furan-3-yl)anilino]-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C(C=CC=4)C4=COC=C4)N(C)C3=CC=2)=C1 JGCKXGFPYSAZLI-UHFFFAOYSA-N 0.000 description 1
- YRNVXFRFELSWHD-UHFFFAOYSA-N 4-[2-[4-chloro-3-(2-oxopiperidin-1-yl)anilino]-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C(C(Cl)=CC=4)N4C(CCCC4)=O)N(C)C3=CC=2)=C1 YRNVXFRFELSWHD-UHFFFAOYSA-N 0.000 description 1
- AHYANYXPKUZTCT-UHFFFAOYSA-N 4-[2-[4-chloro-3-(2-oxopyrrolidin-1-yl)anilino]-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C(C(Cl)=CC=4)N4C(CCC4)=O)N(C)C3=CC=2)=C1 AHYANYXPKUZTCT-UHFFFAOYSA-N 0.000 description 1
- MCKKYADDOIQSEO-UHFFFAOYSA-N 4-[2-[4-chloro-3-(trifluoromethyl)anilino]-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C(C(Cl)=CC=4)C(F)(F)F)N(C)C3=CC=2)=C1 MCKKYADDOIQSEO-UHFFFAOYSA-N 0.000 description 1
- NSPZFVGYZORJHP-UHFFFAOYSA-N 4-[2-[[4-(chloromethyl)benzoyl]amino]-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC(=O)C=4C=CC(CCl)=CC=4)N(C)C3=CC=2)=C1 NSPZFVGYZORJHP-UHFFFAOYSA-N 0.000 description 1
- MSYNYJMPLBBZTF-UHFFFAOYSA-N 4-[3-amino-4-(methylamino)phenoxy]-n-[3-(2-oxopyrrolidin-1-yl)propyl]pyridine-2-carboxamide Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=NC(C(=O)NCCCN2C(CCC2)=O)=C1 MSYNYJMPLBBZTF-UHFFFAOYSA-N 0.000 description 1
- UNAURZVBAFVLFW-UHFFFAOYSA-N 4-[3-amino-4-(methylamino)phenoxy]pyridine-2-carbaldehyde Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=NC(C=O)=C1 UNAURZVBAFVLFW-UHFFFAOYSA-N 0.000 description 1
- FTRJXPNQMLDLRO-UHFFFAOYSA-N 4-[4-(methylamino)-3-nitrophenoxy]-n-[3-(2-oxopyrrolidin-1-yl)propyl]pyridine-2-carboxamide Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C(=O)NCCCN2C(CCC2)=O)=C1 FTRJXPNQMLDLRO-UHFFFAOYSA-N 0.000 description 1
- AGBXVBHEXHWIDH-UHFFFAOYSA-N 4-[4-amino-3-(methylamino)phenoxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C(NC)C(N)=CC=2)=C1 AGBXVBHEXHWIDH-UHFFFAOYSA-N 0.000 description 1
- RXFZPPOKHYOTGP-UHFFFAOYSA-N 4-[[2-(2-bromoanilino)-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C(=CC=CC=4)Br)=NC3=CC=2)=C1 RXFZPPOKHYOTGP-UHFFFAOYSA-N 0.000 description 1
- IHRATYMQWKKWJU-UHFFFAOYSA-N 4-[[2-(2-chloroanilino)-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C(=CC=CC=4)Cl)=NC3=CC=2)=C1 IHRATYMQWKKWJU-UHFFFAOYSA-N 0.000 description 1
- ZWMZHDMNANHDOK-UHFFFAOYSA-N 4-[[2-(3-chloro-4-fluoroanilino)-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C=C(Cl)C(F)=CC=4)=NC3=CC=2)=C1 ZWMZHDMNANHDOK-UHFFFAOYSA-N 0.000 description 1
- SDCYAPIECYQCGN-UHFFFAOYSA-N 4-[[2-(3-chloroanilino)-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C=C(Cl)C=CC=4)=NC3=CC=2)=C1 SDCYAPIECYQCGN-UHFFFAOYSA-N 0.000 description 1
- PSTWIOATBDFFPH-UHFFFAOYSA-N 4-[[2-(4-acetylanilino)-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C=CC(=CC=4)C(C)=O)=NC3=CC=2)=C1 PSTWIOATBDFFPH-UHFFFAOYSA-N 0.000 description 1
- MZCRQBOVCGGSLE-UHFFFAOYSA-N 4-[[2-(4-bromoanilino)-1,3-benzoxazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)OC3=CC=2)=C1 MZCRQBOVCGGSLE-UHFFFAOYSA-N 0.000 description 1
- PMAGHRSQJVNSPS-UHFFFAOYSA-N 4-[[2-(4-bromoanilino)-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C=CC(Br)=CC=4)=NC3=CC=2)=C1 PMAGHRSQJVNSPS-UHFFFAOYSA-N 0.000 description 1
- WARUULPSYBJIFJ-UHFFFAOYSA-N 4-[[2-(4-chloroanilino)-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C=CC(Cl)=CC=4)=NC3=CC=2)=C1 WARUULPSYBJIFJ-UHFFFAOYSA-N 0.000 description 1
- SFCAKLIAZFPBEM-UHFFFAOYSA-N 4-[[2-(4-iodoanilino)-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C=CC(I)=CC=4)=NC3=CC=2)=C1 SFCAKLIAZFPBEM-UHFFFAOYSA-N 0.000 description 1
- DHMFGGZSCPEWEE-UHFFFAOYSA-N 4-[[2-(4-tert-butylanilino)-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C=CC(=CC=4)C(C)(C)C)=NC3=CC=2)=C1 DHMFGGZSCPEWEE-UHFFFAOYSA-N 0.000 description 1
- AKDSUNITUDABTD-UHFFFAOYSA-N 4-[[2-(furan-2-ylmethylamino)-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NCC=4OC=CC=4)=NC3=CC=2)=C1 AKDSUNITUDABTD-UHFFFAOYSA-N 0.000 description 1
- HJOQYTSSSWWUDI-UHFFFAOYSA-N 4-[[2-[4-bromo-2-(trifluoromethyl)anilino]-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C(=CC(Br)=CC=4)C(F)(F)F)=NC3=CC=2)=C1 HJOQYTSSSWWUDI-UHFFFAOYSA-N 0.000 description 1
- KFYPUNLEDLXYGS-UHFFFAOYSA-N 4-[[2-[[4-(dimethylamino)naphthalen-1-yl]amino]-3h-benzimidazol-5-yl]oxy]-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3NC(NC=4C5=CC=CC=C5C(N(C)C)=CC=4)=NC3=CC=2)=C1 KFYPUNLEDLXYGS-UHFFFAOYSA-N 0.000 description 1
- GWLIKBAQYRDIID-UHFFFAOYSA-N 4-bromo-1-isothiocyanato-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC(Br)=CC=C1N=C=S GWLIKBAQYRDIID-UHFFFAOYSA-N 0.000 description 1
- PWOPDCSAVIMSPX-UHFFFAOYSA-N 4-bromo-2-fluoro-1-isothiocyanatobenzene Chemical compound FC1=CC(Br)=CC=C1N=C=S PWOPDCSAVIMSPX-UHFFFAOYSA-N 0.000 description 1
- PTPTZLXZHPPVKG-UHFFFAOYSA-N 4-bromo-2-fluoropyridine Chemical compound FC1=CC(Br)=CC=N1 PTPTZLXZHPPVKG-UHFFFAOYSA-N 0.000 description 1
- ZRYZBQLXDKPBDU-UHFFFAOYSA-N 4-bromobenzaldehyde Chemical compound BrC1=CC=C(C=O)C=C1 ZRYZBQLXDKPBDU-UHFFFAOYSA-N 0.000 description 1
- FOHHWGVAOVDVLP-UHFFFAOYSA-N 4-chloro-3-nitroaniline Chemical compound NC1=CC=C(Cl)C([N+]([O-])=O)=C1 FOHHWGVAOVDVLP-UHFFFAOYSA-N 0.000 description 1
- CYPPPVCCVDNLPS-UHFFFAOYSA-N 4-chloro-n-[3-(2-oxopyrrolidin-1-yl)propyl]pyridine-2-carboxamide Chemical compound ClC1=CC=NC(C(=O)NCCCN2C(CCC2)=O)=C1 CYPPPVCCVDNLPS-UHFFFAOYSA-N 0.000 description 1
- DYEZRXLVZMZHQT-UHFFFAOYSA-N 4-chloropyridine-2-carbonitrile Chemical compound ClC1=CC=NC(C#N)=C1 DYEZRXLVZMZHQT-UHFFFAOYSA-N 0.000 description 1
- JGKAUGIWLSHLPX-UHFFFAOYSA-N 4-ethyl-n-phenylpiperazin-1-amine Chemical compound C1CN(CC)CCN1NC1=CC=CC=C1 JGKAUGIWLSHLPX-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- JFSHJWKBNJMGOK-UHFFFAOYSA-N 4-isothiocyanato-1,2-dimethylbenzene Chemical compound CC1=CC=C(N=C=S)C=C1C JFSHJWKBNJMGOK-UHFFFAOYSA-N 0.000 description 1
- YBUGOACXDPDUIR-UHFFFAOYSA-N 4-methoxy-2-nitrophenol Chemical compound COC1=CC=C(O)C([N+]([O-])=O)=C1 YBUGOACXDPDUIR-UHFFFAOYSA-N 0.000 description 1
- RAUWPNXIALNKQM-UHFFFAOYSA-N 4-nitro-1,2-phenylenediamine Chemical compound NC1=CC=C([N+]([O-])=O)C=C1N RAUWPNXIALNKQM-UHFFFAOYSA-N 0.000 description 1
- YQYGPGKTNQNXMH-UHFFFAOYSA-N 4-nitroacetophenone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C=C1 YQYGPGKTNQNXMH-UHFFFAOYSA-N 0.000 description 1
- AWPNFXRMNNPKDW-UHFFFAOYSA-N 4-phenylthiadiazole Chemical compound S1N=NC(C=2C=CC=CC=2)=C1 AWPNFXRMNNPKDW-UHFFFAOYSA-N 0.000 description 1
- PSXJPOTVCKWHGZ-UHFFFAOYSA-N 4-pyridin-3-ylpyrimidine Chemical compound C1=CN=CC(C=2N=CN=CC=2)=C1 PSXJPOTVCKWHGZ-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- YGRGPJVLDRHCIN-UHFFFAOYSA-N 5-(2-phenylethynyl)-1h-pyrimidine-2,4-dione Chemical compound O=C1NC(=O)NC=C1C#CC1=CC=CC=C1 YGRGPJVLDRHCIN-UHFFFAOYSA-N 0.000 description 1
- YOPXKEXWJYKOAZ-UHFFFAOYSA-N 5-(2-phenylethynyl)pyrimidin-2-amine Chemical group C1=NC(N)=NC=C1C#CC1=CC=CC=C1 YOPXKEXWJYKOAZ-UHFFFAOYSA-N 0.000 description 1
- XKTCKCXYGXXAHX-UHFFFAOYSA-N 5-[2-(1h-benzimidazol-2-yl)pyridin-4-yl]oxy-n-(4-fluorophenyl)-1-methylbenzimidazol-2-amine Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C=3NC4=CC=CC=C4N=3)=CC=C2N(C)C=1NC1=CC=C(F)C=C1 XKTCKCXYGXXAHX-UHFFFAOYSA-N 0.000 description 1
- VYJMOWNMDYJYDP-UHFFFAOYSA-N 5-[2-(1h-imidazol-2-yl)pyridin-4-yl]oxy-1-methyl-n-(3-propan-2-ylphenyl)benzimidazol-2-amine Chemical compound CC(C)C1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(N=CC=4)C=4NC=CN=4)C=C3N=2)C)=C1 VYJMOWNMDYJYDP-UHFFFAOYSA-N 0.000 description 1
- VCLPJFZXTRYSCI-UHFFFAOYSA-N 5-[2-(aminomethyl)pyridin-4-yl]oxy-n-(4-bromophenyl)-1-methylbenzimidazol-2-amine Chemical compound N=1C2=CC(OC=3C=C(CN)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 VCLPJFZXTRYSCI-UHFFFAOYSA-N 0.000 description 1
- BJLIMMWQVLEMOL-UHFFFAOYSA-N 5-[2-(methoxyiminomethyl)pyridin-4-yl]oxy-1-methyl-n-(3-phenoxyphenyl)benzimidazol-2-amine Chemical compound C1=NC(C=NOC)=CC(OC=2C=C3N=C(NC=4C=C(OC=5C=CC=CC=5)C=CC=4)N(C)C3=CC=2)=C1 BJLIMMWQVLEMOL-UHFFFAOYSA-N 0.000 description 1
- QFRVADQLBBLZTD-UHFFFAOYSA-N 5-[2-(methoxyiminomethyl)pyridin-4-yl]oxy-1-methyl-n-(3-propan-2-yloxyphenyl)benzimidazol-2-amine Chemical compound C1=NC(C=NOC)=CC(OC=2C=C3N=C(NC=4C=C(OC(C)C)C=CC=4)N(C)C3=CC=2)=C1 QFRVADQLBBLZTD-UHFFFAOYSA-N 0.000 description 1
- AXQPVRDNADPWEZ-UHFFFAOYSA-N 5-[2-(methoxyiminomethyl)pyridin-4-yl]oxy-1-methyl-n-(3-propan-2-ylphenyl)benzimidazol-2-amine Chemical compound C1=NC(C=NOC)=CC(OC=2C=C3N=C(NC=4C=C(C=CC=4)C(C)C)N(C)C3=CC=2)=C1 AXQPVRDNADPWEZ-UHFFFAOYSA-N 0.000 description 1
- RWVGFFJSPITPSG-UHFFFAOYSA-N 5-fluoro-2-(2-nitrophenyl)aniline Chemical compound FC=1C=CC(=C(N)C=1)C1=C(C=CC=C1)[N+](=O)[O-] RWVGFFJSPITPSG-UHFFFAOYSA-N 0.000 description 1
- PEDMFCHWOVJDNW-UHFFFAOYSA-N 5-fluoro-2-nitroaniline Chemical compound NC1=CC(F)=CC=C1[N+]([O-])=O PEDMFCHWOVJDNW-UHFFFAOYSA-N 0.000 description 1
- JDPITNFDYXOKRM-UHFFFAOYSA-N 5-methoxy-3h-1,3-benzothiazole-2-thione Chemical compound COC1=CC=C2SC(=S)NC2=C1 JDPITNFDYXOKRM-UHFFFAOYSA-N 0.000 description 1
- ZYLPQYYLLRBVOK-UHFFFAOYSA-N 5-methyl-2-phenylpyridine Chemical compound N1=CC(C)=CC=C1C1=CC=CC=C1 ZYLPQYYLLRBVOK-UHFFFAOYSA-N 0.000 description 1
- UCGIIOJWRLQBRP-UHFFFAOYSA-N 5-methyl-3-phenyl-1,2-oxazole Chemical compound O1C(C)=CC(C=2C=CC=CC=2)=N1 UCGIIOJWRLQBRP-UHFFFAOYSA-N 0.000 description 1
- DSBIJCMXAIKKKI-UHFFFAOYSA-N 5-nitro-o-toluidine Chemical compound CC1=CC=C([N+]([O-])=O)C=C1N DSBIJCMXAIKKKI-UHFFFAOYSA-N 0.000 description 1
- OEDUIFSDODUDRK-UHFFFAOYSA-N 5-phenyl-1h-pyrazole Chemical compound N1N=CC=C1C1=CC=CC=C1 OEDUIFSDODUDRK-UHFFFAOYSA-N 0.000 description 1
- PSWCIARYGITEOY-UHFFFAOYSA-N 6-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=C2C=CNC2=C1 PSWCIARYGITEOY-UHFFFAOYSA-N 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OWQUVNISDSZQNQ-UHFFFAOYSA-N C1(=CC=CC=C1)C=1C=C(C=CC1)C(C(=O)O)C.C1(=CC=CC=C1)C=1C=C(OCC(=O)NO)C=CC1 Chemical compound C1(=CC=CC=C1)C=1C=C(C=CC1)C(C(=O)O)C.C1(=CC=CC=C1)C=1C=C(OCC(=O)NO)C=CC1 OWQUVNISDSZQNQ-UHFFFAOYSA-N 0.000 description 1
- HOMZPXDDQWYACF-UHFFFAOYSA-N C1=C(Br)C(C)=CC(NC=2N(C3=CC=C(OC=4C=C(C=NO)N=CC=4)C=C3N=2)C)=C1 Chemical compound C1=C(Br)C(C)=CC(NC=2N(C3=CC=C(OC=4C=C(C=NO)N=CC=4)C=C3N=2)C)=C1 HOMZPXDDQWYACF-UHFFFAOYSA-N 0.000 description 1
- FEOLZZVRQKERDR-UHFFFAOYSA-N C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C=NO)=C1 Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C=NO)=C1 FEOLZZVRQKERDR-UHFFFAOYSA-N 0.000 description 1
- GFGDIQGQSHMSOZ-UHFFFAOYSA-N C1=CC(C)=CC=C1NC1=NC2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N1C Chemical compound C1=CC(C)=CC=C1NC1=NC2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N1C GFGDIQGQSHMSOZ-UHFFFAOYSA-N 0.000 description 1
- YRUOAPISPBJDEE-UHFFFAOYSA-N C1=CC(CC)=CC=C1NC1=NC2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N1C Chemical compound C1=CC(CC)=CC=C1NC1=NC2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N1C YRUOAPISPBJDEE-UHFFFAOYSA-N 0.000 description 1
- NOPKUVJNXHNBGI-UHFFFAOYSA-N C=1C=C2N(C)C(NC=3C=C4CCCC4=CC=3)=NC2=CC=1OC1=CC=NC(C=NO)=C1 Chemical compound C=1C=C2N(C)C(NC=3C=C4CCCC4=CC=3)=NC2=CC=1OC1=CC=NC(C=NO)=C1 NOPKUVJNXHNBGI-UHFFFAOYSA-N 0.000 description 1
- FQXPOIISJACSIE-UHFFFAOYSA-N CC(C)C1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(C=NO)N=CC=4)C=C3N=2)C)=C1 Chemical compound CC(C)C1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(C=NO)N=CC=4)C=C3N=2)C)=C1 FQXPOIISJACSIE-UHFFFAOYSA-N 0.000 description 1
- SJJLSGXNAKJCBI-UHFFFAOYSA-N CC(C)OC1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(C=NO)N=CC=4)C=C3N=2)C)=C1 Chemical compound CC(C)OC1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(C=NO)N=CC=4)C=C3N=2)C)=C1 SJJLSGXNAKJCBI-UHFFFAOYSA-N 0.000 description 1
- GWICSAZFMNMBOV-UHFFFAOYSA-N CC1=CC(C)=CC=C1NC1=NC2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N1C Chemical compound CC1=CC(C)=CC=C1NC1=NC2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N1C GWICSAZFMNMBOV-UHFFFAOYSA-N 0.000 description 1
- MTZCNGYVMRXGKM-UHFFFAOYSA-N CC1=CC=CC=C1.CO.N=C=S Chemical compound CC1=CC=CC=C1.CO.N=C=S MTZCNGYVMRXGKM-UHFFFAOYSA-N 0.000 description 1
- CGHGNHBQFUUIES-UHFFFAOYSA-N CCC1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(C=NO)N=CC=4)C=C3N=2)C)=C1 Chemical compound CCC1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(C=NO)N=CC=4)C=C3N=2)C)=C1 CGHGNHBQFUUIES-UHFFFAOYSA-N 0.000 description 1
- KSSJBGNOJJETTC-UHFFFAOYSA-N COC1=C(C=CC=C1)N(C1=CC=2C3(C4=CC(=CC=C4C=2C=C1)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)C1=CC(=CC=C1C=1C=CC(=CC=13)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)C1=CC=C(C=C1)OC Chemical compound COC1=C(C=CC=C1)N(C1=CC=2C3(C4=CC(=CC=C4C=2C=C1)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)C1=CC(=CC=C1C=1C=CC(=CC=13)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)C1=CC=C(C=C1)OC KSSJBGNOJJETTC-UHFFFAOYSA-N 0.000 description 1
- DVUQLILLGPEJNX-UHFFFAOYSA-N COC1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(C=NO)N=CC=4)C=C3N=2)C)=C1 Chemical compound COC1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(C=NO)N=CC=4)C=C3N=2)C)=C1 DVUQLILLGPEJNX-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000754798 Calophyllum brasiliense Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 102000053642 Catalytic RNA Human genes 0.000 description 1
- 108090000994 Catalytic RNA Proteins 0.000 description 1
- UWNXGZKSIKQKAH-UHFFFAOYSA-N Cc1cc(CNC(CO)C(O)=O)c(OCc2cccc(c2)C#N)cc1OCc1cccc(c1C)-c1ccc2OCCOc2c1 Chemical compound Cc1cc(CNC(CO)C(O)=O)c(OCc2cccc(c2)C#N)cc1OCc1cccc(c1C)-c1ccc2OCCOc2c1 UWNXGZKSIKQKAH-UHFFFAOYSA-N 0.000 description 1
- 229940123587 Cell cycle inhibitor Drugs 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- 108010037462 Cyclooxygenase 2 Proteins 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- DKMROQRQHGEIOW-UHFFFAOYSA-N Diethyl succinate Chemical compound CCOC(=O)CCC(=O)OCC DKMROQRQHGEIOW-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 101100015729 Drosophila melanogaster drk gene Proteins 0.000 description 1
- 102000040848 ETS family Human genes 0.000 description 1
- 108091071901 ETS family Proteins 0.000 description 1
- 108091008794 FGF receptors Proteins 0.000 description 1
- 102000018233 Fibroblast Growth Factor Human genes 0.000 description 1
- 108050007372 Fibroblast Growth Factor Proteins 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000034951 Genetic Translocation Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102000014150 Interferons Human genes 0.000 description 1
- 108010050904 Interferons Proteins 0.000 description 1
- 108010002350 Interleukin-2 Proteins 0.000 description 1
- 108010063738 Interleukins Proteins 0.000 description 1
- 102000015696 Interleukins Human genes 0.000 description 1
- 238000000023 Kugelrohr distillation Methods 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 206010027145 Melanocytic naevus Diseases 0.000 description 1
- ZRVUJXDFFKFLMG-UHFFFAOYSA-N Meloxicam Chemical compound OC=1C2=CC=CC=C2S(=O)(=O)N(C)C=1C(=O)NC1=NC=C(C)S1 ZRVUJXDFFKFLMG-UHFFFAOYSA-N 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- LKJPYSCBVHEWIU-UHFFFAOYSA-N N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide Chemical compound C=1C=C(C#N)C(C(F)(F)F)=CC=1NC(=O)C(O)(C)CS(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-UHFFFAOYSA-N 0.000 description 1
- DQQLPTSVCKBDCU-UHFFFAOYSA-N N-[[4-[2-(3,4-dimethylanilino)-1-methylbenzimidazol-5-yl]oxypyridin-2-yl]methylidene]hydroxylamine Chemical compound C1=C(C)C(C)=CC=C1NC1=NC2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N1C DQQLPTSVCKBDCU-UHFFFAOYSA-N 0.000 description 1
- GBNGFRCYUWTYBZ-UHFFFAOYSA-N N-[[4-[2-[4-bromo-2-(trifluoromethoxy)anilino]-1-methylbenzimidazol-5-yl]oxypyridin-2-yl]methylidene]hydroxylamine Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1OC(F)(F)F GBNGFRCYUWTYBZ-UHFFFAOYSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 1
- MXMMXNSNWSNTBN-UHFFFAOYSA-N N-methyl-4-[3-(methylamino)-4-nitrophenoxy]pyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C(NC)C(=CC=2)[N+]([O-])=O)=C1 MXMMXNSNWSNTBN-UHFFFAOYSA-N 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- CKRZKMFTZCFYGB-UHFFFAOYSA-N N-phenylhydroxylamine Chemical compound ONC1=CC=CC=C1 CKRZKMFTZCFYGB-UHFFFAOYSA-N 0.000 description 1
- CFCVFJHWQFTEQV-UHFFFAOYSA-N N1(CCCC1)CCN.O1CCCC1 Chemical compound N1(CCCC1)CCN.O1CCCC1 CFCVFJHWQFTEQV-UHFFFAOYSA-N 0.000 description 1
- ZDLVDHIKMMHXHO-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC(C=1)=CC=CC=1OC1=CC=CC=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC(C=1)=CC=CC=1OC1=CC=CC=C1 ZDLVDHIKMMHXHO-UHFFFAOYSA-N 0.000 description 1
- KRMYWSNTFYCNPW-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C(Cl)=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C(Cl)=C1 KRMYWSNTFYCNPW-UHFFFAOYSA-N 0.000 description 1
- HTRAIQQKRKRDNR-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C(F)=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C(F)=C1 HTRAIQQKRKRDNR-UHFFFAOYSA-N 0.000 description 1
- BUAGCEWEJRXYQU-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1F Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1F BUAGCEWEJRXYQU-UHFFFAOYSA-N 0.000 description 1
- YZZQVNCYKMPCPO-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(C(F)(F)F)C=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(C(F)(F)F)C=C1 YZZQVNCYKMPCPO-UHFFFAOYSA-N 0.000 description 1
- KNLMAWYLUHVNLP-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(C(F)(F)F)C=C1Cl Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(C(F)(F)F)C=C1Cl KNLMAWYLUHVNLP-UHFFFAOYSA-N 0.000 description 1
- CNJQPLFXIDSYMQ-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Cl)C(C(F)(F)F)=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Cl)C(C(F)(F)F)=C1 CNJQPLFXIDSYMQ-UHFFFAOYSA-N 0.000 description 1
- AJWLCPMBDWXGPX-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Cl)C(Cl)=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Cl)C(Cl)=C1 AJWLCPMBDWXGPX-UHFFFAOYSA-N 0.000 description 1
- FOJWJIQLGVZMRO-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Cl)C=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Cl)C=C1 FOJWJIQLGVZMRO-UHFFFAOYSA-N 0.000 description 1
- ATJDCGYAAFTUDI-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(OC(F)(F)F)C=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(OC(F)(F)F)C=C1 ATJDCGYAAFTUDI-UHFFFAOYSA-N 0.000 description 1
- HWILJASALIWODG-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(SC(F)(F)F)C=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(SC(F)(F)F)C=C1 HWILJASALIWODG-UHFFFAOYSA-N 0.000 description 1
- XETBMBQSEMJCNY-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=CC(C(C)(C)C)=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=CC(C(C)(C)C)=C1 XETBMBQSEMJCNY-UHFFFAOYSA-N 0.000 description 1
- WNIQOQLTYFJORK-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=CC(C(F)(F)F)=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=CC(C(F)(F)F)=C1 WNIQOQLTYFJORK-UHFFFAOYSA-N 0.000 description 1
- AVMWDUALWZIHDV-UHFFFAOYSA-N N=C=S.C1CN(CC)CCN1C1=CC=CC=C1 Chemical compound N=C=S.C1CN(CC)CCN1C1=CC=CC=C1 AVMWDUALWZIHDV-UHFFFAOYSA-N 0.000 description 1
- SXXGOMGNWVBSGG-UHFFFAOYSA-N N=C=S.C1CN(CC)CCN1CC1=CC=CC=C1 Chemical compound N=C=S.C1CN(CC)CCN1CC1=CC=CC=C1 SXXGOMGNWVBSGG-UHFFFAOYSA-N 0.000 description 1
- KVSDZQGPNWEDGY-UHFFFAOYSA-N N=C=S.C1COCCN1CCC1=CC=CC=C1 Chemical compound N=C=S.C1COCCN1CCC1=CC=CC=C1 KVSDZQGPNWEDGY-UHFFFAOYSA-N 0.000 description 1
- NYHHYBRRMNYBIC-UHFFFAOYSA-N N=C=S.CC(C)(C)C1=CC=CC=C1 Chemical compound N=C=S.CC(C)(C)C1=CC=CC=C1 NYHHYBRRMNYBIC-UHFFFAOYSA-N 0.000 description 1
- OVZNJKYXHBZLLU-UHFFFAOYSA-N N=C=S.CC1=CC=CC=C1N1CCCC1 Chemical compound N=C=S.CC1=CC=CC=C1N1CCCC1 OVZNJKYXHBZLLU-UHFFFAOYSA-N 0.000 description 1
- HOWKHVFVHXZDBS-UHFFFAOYSA-N N=C=S.CN(C)C1=CC=CC=C1 Chemical compound N=C=S.CN(C)C1=CC=CC=C1 HOWKHVFVHXZDBS-UHFFFAOYSA-N 0.000 description 1
- YMHDDXKXHPNWGR-UHFFFAOYSA-N N=C=S.FC(F)(F)C1=CC=CC=C1Cl Chemical compound N=C=S.FC(F)(F)C1=CC=CC=C1Cl YMHDDXKXHPNWGR-UHFFFAOYSA-N 0.000 description 1
- YQDZSJWKIYZYIH-UHFFFAOYSA-N N=C=S.FC1=CC=CC=C1Br Chemical compound N=C=S.FC1=CC=CC=C1Br YQDZSJWKIYZYIH-UHFFFAOYSA-N 0.000 description 1
- RLESEYNYEKLKGT-UHFFFAOYSA-N N=C=S.[O-][N+](=O)C1=CC=CC=C1 Chemical compound N=C=S.[O-][N+](=O)C1=CC=CC=C1 RLESEYNYEKLKGT-UHFFFAOYSA-N 0.000 description 1
- OZMZSWGBBQAQPX-UHFFFAOYSA-N N=C=S.[O-][N+](=O)C1=CC=CC=C1Cl Chemical compound N=C=S.[O-][N+](=O)C1=CC=CC=C1Cl OZMZSWGBBQAQPX-UHFFFAOYSA-N 0.000 description 1
- KTDZCOWXCWUPEO-UHFFFAOYSA-N NS-398 Chemical compound CS(=O)(=O)NC1=CC=C([N+]([O-])=O)C=C1OC1CCCCC1 KTDZCOWXCWUPEO-UHFFFAOYSA-N 0.000 description 1
- 208000007256 Nevus Diseases 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- JDDYCQICAHDSAP-UHFFFAOYSA-N OBO.FC1=CC=CC=N1 Chemical compound OBO.FC1=CC=CC=N1 JDDYCQICAHDSAP-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 208000012868 Overgrowth Diseases 0.000 description 1
- 229930012538 Paclitaxel Natural products 0.000 description 1
- 229920002230 Pectic acid Polymers 0.000 description 1
- 241000276498 Pollachius virens Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 102100038280 Prostaglandin G/H synthase 2 Human genes 0.000 description 1
- 101150062264 Raf gene Proteins 0.000 description 1
- 229940123690 Raf kinase inhibitor Drugs 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- YGPZYYDTPXVBRA-RTDBHSBRSA-N [(2r,3s,4r,5r,6s)-2-[[(2r,3r,4r,5s,6r)-3-[[(3r)-3-dodecanoyloxytetradecanoyl]amino]-6-(hydroxymethyl)-5-phosphonooxy-4-[(3r)-3-tetradecanoyloxytetradecanoyl]oxyoxan-2-yl]oxymethyl]-3,6-dihydroxy-5-[[(3r)-3-hydroxytetradecanoyl]amino]oxan-4-yl] (3r)-3-hydr Chemical compound O1[C@H](CO)[C@@H](OP(O)(O)=O)[C@H](OC(=O)C[C@@H](CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)[C@@H](NC(=O)C[C@@H](CCCCCCCCCCC)OC(=O)CCCCCCCCCCC)[C@@H]1OC[C@@H]1[C@@H](O)[C@H](OC(=O)C[C@H](O)CCCCCCCCCCC)[C@@H](NC(=O)C[C@H](O)CCCCCCCCCCC)[C@@H](O)O1 YGPZYYDTPXVBRA-RTDBHSBRSA-N 0.000 description 1
- KPUGNJHTXJEAML-UHFFFAOYSA-N [4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridin-2-yl]-pyrrolidin-1-ylmethanone Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(=O)N3CCCC3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 KPUGNJHTXJEAML-UHFFFAOYSA-N 0.000 description 1
- XQAZZUSVBUUVDS-UHFFFAOYSA-N [4-[3-amino-4-(methylamino)phenoxy]pyridin-2-yl]methanol Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=NC(CO)=C1 XQAZZUSVBUUVDS-UHFFFAOYSA-N 0.000 description 1
- FQRKHFUJNUYBPI-UHFFFAOYSA-N [4-[4-(methylamino)-3-nitrophenoxy]pyridin-2-yl]methanol Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(CO)=C1 FQRKHFUJNUYBPI-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000004945 acylaminoalkyl group Chemical group 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 125000005094 alkyl carbonyl amino alkyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005277 alkyl imino group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- AEMOLEFTQBMNLQ-BKBMJHBISA-N alpha-D-galacturonic acid Chemical compound O[C@H]1O[C@H](C(O)=O)[C@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-BKBMJHBISA-N 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000004037 angiogenesis inhibitor Substances 0.000 description 1
- 229940121369 angiogenesis inhibitor Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 210000004102 animal cell Anatomy 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000002280 anti-androgenic effect Effects 0.000 description 1
- 230000000340 anti-metabolite Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000000051 antiandrogen Substances 0.000 description 1
- 229940030495 antiandrogen sex hormone and modulator of the genital system Drugs 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940100197 antimetabolite Drugs 0.000 description 1
- 239000002256 antimetabolite Substances 0.000 description 1
- 229940045985 antineoplastic platinum compound Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000005140 aralkylsulfonyl group Chemical group 0.000 description 1
- 125000005125 aryl alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 125000005126 aryl alkyl carbonyl amino group Chemical group 0.000 description 1
- 125000005128 aryl amino alkyl group Chemical group 0.000 description 1
- 125000005100 aryl amino carbonyl group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 1
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 1
- 150000001503 aryl iodides Chemical class 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- UDLLFLQFQMACJB-UHFFFAOYSA-N azidomethylbenzene Chemical compound [N-]=[N+]=NCC1=CC=CC=C1 UDLLFLQFQMACJB-UHFFFAOYSA-N 0.000 description 1
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000003939 benzylamines Chemical class 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N beta-phenylpropanoic acid Natural products OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- 229960000997 bicalutamide Drugs 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- JRXXLCKWQFKACW-UHFFFAOYSA-N biphenylacetylene Chemical compound C1=CC=CC=C1C#CC1=CC=CC=C1 JRXXLCKWQFKACW-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 125000005620 boronic acid group Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 230000005907 cancer growth Effects 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- RZEKVGVHFLEQIL-UHFFFAOYSA-N celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 description 1
- 229960000590 celecoxib Drugs 0.000 description 1
- 230000006369 cell cycle progression Effects 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000005754 cellular signaling Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 1
- 229940106189 ceramide Drugs 0.000 description 1
- 150000001783 ceramides Chemical class 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 229940044683 chemotherapy drug Drugs 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 150000001923 cyclic compounds Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 229940097362 cyclodextrins Drugs 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- SNRCKKQHDUIRIY-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloromethane;dichloropalladium;iron(2+) Chemical compound [Fe+2].ClCCl.Cl[Pd]Cl.C1=C[CH-]C(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.C1=C[CH-]C(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 SNRCKKQHDUIRIY-UHFFFAOYSA-L 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000001086 cytosolic effect Effects 0.000 description 1
- 229960003901 dacarbazine Drugs 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- LMEDOLJKVASKTP-UHFFFAOYSA-N dibutyl sulfate Chemical group CCCCOS(=O)(=O)OCCCC LMEDOLJKVASKTP-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- GAFRWLVTHPVQGK-UHFFFAOYSA-N dipentyl sulfate Chemical compound CCCCCOS(=O)(=O)OCCCCC GAFRWLVTHPVQGK-UHFFFAOYSA-N 0.000 description 1
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 1
- 150000002016 disaccharides Chemical class 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 239000000890 drug combination Substances 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- HKSZLNNOFSGOKW-UHFFFAOYSA-N ent-staurosporine Natural products C12=C3N4C5=CC=CC=C5C3=C3CNC(=O)C3=C2C2=CC=CC=C2N1C1CC(NC)C(OC)C4(C)O1 HKSZLNNOFSGOKW-UHFFFAOYSA-N 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 1
- 229960005420 etoposide Drugs 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 229940126864 fibroblast growth factor Drugs 0.000 description 1
- 102000052178 fibroblast growth factor receptor activity proteins Human genes 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- DBEPLOCGEIEOCV-WSBQPABSSA-N finasteride Chemical compound N([C@@H]1CC2)C(=O)C=C[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](C(=O)NC(C)(C)C)[C@@]2(C)CC1 DBEPLOCGEIEOCV-WSBQPABSSA-N 0.000 description 1
- 229960004039 finasteride Drugs 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- 229960005304 fludarabine phosphate Drugs 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- MKXKFYHWDHIYRV-UHFFFAOYSA-N flutamide Chemical compound CC(C)C(=O)NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 MKXKFYHWDHIYRV-UHFFFAOYSA-N 0.000 description 1
- 229960002074 flutamide Drugs 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- CYEFKCRAAGLNHW-UHFFFAOYSA-N furan-3-ylboronic acid Chemical compound OB(O)C=1C=COC=1 CYEFKCRAAGLNHW-UHFFFAOYSA-N 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229960003297 gemtuzumab ozogamicin Drugs 0.000 description 1
- 238000001415 gene therapy Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 229940015043 glyoxal Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 101150098203 grb2 gene Proteins 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000003394 haemopoietic effect Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 150000005748 halopyridines Chemical class 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940022353 herceptin Drugs 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 208000018819 hormone-resistant breast carcinoma Diseases 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- USZLCYNVCCDPLQ-UHFFFAOYSA-N hydron;n-methoxymethanamine;chloride Chemical compound Cl.CNOC USZLCYNVCCDPLQ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- YLMAHDNUQAMNNX-UHFFFAOYSA-N imatinib methanesulfonate Chemical compound CS(O)(=O)=O.C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 YLMAHDNUQAMNNX-UHFFFAOYSA-N 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 239000000367 immunologic factor Substances 0.000 description 1
- 238000009169 immunotherapy Methods 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000005462 in vivo assay Methods 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical compound C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 229940102213 injectable suspension Drugs 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229940047124 interferons Drugs 0.000 description 1
- 229940047122 interleukins Drugs 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 229960004125 ketoconazole Drugs 0.000 description 1
- 238000003674 kinase activity assay Methods 0.000 description 1
- 238000000021 kinase assay Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000004973 liquid crystal related substance Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 201000007270 liver cancer Diseases 0.000 description 1
- 208000014018 liver neoplasm Diseases 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 210000002752 melanocyte Anatomy 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 229960001929 meloxicam Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- KJJSHOHQQHACLE-UHFFFAOYSA-N methyl 5-hydroxypyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(O)=C1 KJJSHOHQQHACLE-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 239000002829 mitogen activated protein kinase inhibitor Substances 0.000 description 1
- 229960001156 mitoxantrone Drugs 0.000 description 1
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 150000002772 monosaccharides Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KOTXCAOSNRHIMI-UHFFFAOYSA-N n-(2-aminoethyl)-1-phenylmethanesulfonamide Chemical compound NCCNS(=O)(=O)CC1=CC=CC=C1 KOTXCAOSNRHIMI-UHFFFAOYSA-N 0.000 description 1
- VFKNPSJIOFHNER-UHFFFAOYSA-N n-(2-aminoethyl)-4-(2-phenylethynyl)benzamide Chemical compound C1=CC(C(=O)NCCN)=CC=C1C#CC1=CC=CC=C1 VFKNPSJIOFHNER-UHFFFAOYSA-N 0.000 description 1
- FONPXFPNZGBDSP-UHFFFAOYSA-N n-(2-hydroxyethyl)-4-[1-methyl-2-[3-(trifluoromethylsulfanyl)anilino]benzimidazol-5-yl]oxypyridine-2-carboxamide Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(=O)NCCO)=CC=C2N(C)C=1NC1=CC=CC(SC(F)(F)F)=C1 FONPXFPNZGBDSP-UHFFFAOYSA-N 0.000 description 1
- RZJLNDYEVIOCTM-UHFFFAOYSA-N n-(3-chloro-4-methylphenyl)pyridin-4-amine Chemical compound C1=C(Cl)C(C)=CC=C1NC1=CC=NC=C1 RZJLNDYEVIOCTM-UHFFFAOYSA-N 0.000 description 1
- CIIFBEQDPLXKQE-UHFFFAOYSA-N n-(3-ethylphenyl)-5-[2-(methoxyiminomethyl)pyridin-4-yl]oxy-1-methylbenzimidazol-2-amine Chemical compound CCC1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(C=NOC)N=CC=4)C=C3N=2)C)=C1 CIIFBEQDPLXKQE-UHFFFAOYSA-N 0.000 description 1
- LDACHLNBCOVNBL-UHFFFAOYSA-N n-(3-tert-butylphenyl)-5-[2-(1h-imidazol-2-yl)pyridin-4-yl]oxy-1-methylbenzimidazol-2-amine Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C=3NC=CN=3)=CC=C2N(C)C=1NC1=CC=CC(C(C)(C)C)=C1 LDACHLNBCOVNBL-UHFFFAOYSA-N 0.000 description 1
- SUOMBGQDIFHTQA-UHFFFAOYSA-N n-(3-tert-butylphenyl)-5-[2-(methoxyiminomethyl)pyridin-4-yl]oxy-1-methylbenzimidazol-2-amine Chemical compound C1=NC(C=NOC)=CC(OC=2C=C3N=C(NC=4C=C(C=CC=4)C(C)(C)C)N(C)C3=CC=2)=C1 SUOMBGQDIFHTQA-UHFFFAOYSA-N 0.000 description 1
- YBPCPVUDFQYSEK-UHFFFAOYSA-N n-(4-bromophenyl)-1-methyl-5-phenoxybenzimidazol-2-amine Chemical compound N=1C2=CC(OC=3C=CC=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 YBPCPVUDFQYSEK-UHFFFAOYSA-N 0.000 description 1
- VXWJPWDCUPQDRO-UHFFFAOYSA-N n-(4-bromophenyl)-1-methyl-5-pyridin-4-yloxybenzimidazol-2-amine Chemical compound N=1C2=CC(OC=3C=CN=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 VXWJPWDCUPQDRO-UHFFFAOYSA-N 0.000 description 1
- CFBLOAVHBSHFFU-UHFFFAOYSA-N n-(4-bromophenyl)-6-nitro-1h-benzimidazol-2-amine Chemical compound N1C2=CC([N+](=O)[O-])=CC=C2N=C1NC1=CC=C(Br)C=C1 CFBLOAVHBSHFFU-UHFFFAOYSA-N 0.000 description 1
- SNQJDSNBSOBUOP-UHFFFAOYSA-N n-(nitromethyl)aniline Chemical compound [O-][N+](=O)CNC1=CC=CC=C1 SNQJDSNBSOBUOP-UHFFFAOYSA-N 0.000 description 1
- LKUFUQKKOINRJA-UHFFFAOYSA-N n-[(5-phenylthiophen-2-yl)methylidene]hydroxylamine Chemical compound S1C(C=NO)=CC=C1C1=CC=CC=C1 LKUFUQKKOINRJA-UHFFFAOYSA-N 0.000 description 1
- UEPXBTCUIIGYCY-UHFFFAOYSA-N n-[3-[2-(2-hydroxyethoxy)-6-morpholin-4-ylpyridin-4-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide Chemical compound C1=C(C=2C=C(N=C(OCCO)C=2)N2CCOCC2)C(C)=CC=C1NC(=O)C1=CC=NC(C(F)(F)F)=C1 UEPXBTCUIIGYCY-UHFFFAOYSA-N 0.000 description 1
- CJDJJOWEZGXYKJ-UHFFFAOYSA-N n-[4-(2-cyanopyridin-4-yl)oxy-2-nitrophenyl]-2,2,2-trifluoro-n-methylacetamide Chemical compound C1=C([N+]([O-])=O)C(N(C(=O)C(F)(F)F)C)=CC=C1OC1=CC=NC(C#N)=C1 CJDJJOWEZGXYKJ-UHFFFAOYSA-N 0.000 description 1
- RREQMZIVNMMKDB-UHFFFAOYSA-N n-[4-(2-phenylethynyl)phenyl]pyrrolidine-2-carboxamide Chemical compound C1CCNC1C(=O)NC(C=C1)=CC=C1C#CC1=CC=CC=C1 RREQMZIVNMMKDB-UHFFFAOYSA-N 0.000 description 1
- USKWAMRRZYMWDB-UHFFFAOYSA-N n-[[4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridin-2-yl]methyl]acetamide Chemical compound C1=NC(CNC(=O)C)=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 USKWAMRRZYMWDB-UHFFFAOYSA-N 0.000 description 1
- GTWJETSWSUWSEJ-UHFFFAOYSA-N n-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- RQADQLTVYXPJEE-UHFFFAOYSA-N n-methyl-4-[1-methyl-2-[(4-methylphenyl)methylamino]benzimidazol-5-yl]oxypyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NCC=4C=CC(C)=CC=4)N(C)C3=CC=2)=C1 RQADQLTVYXPJEE-UHFFFAOYSA-N 0.000 description 1
- AKZMDZIBBIKLHD-UHFFFAOYSA-N n-methyl-4-[1-methyl-2-[[4-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]benzimidazol-5-yl]oxypyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC(=O)C=4C=CC(CN5CCN(C)CC5)=CC=4)N(C)C3=CC=2)=C1 AKZMDZIBBIKLHD-UHFFFAOYSA-N 0.000 description 1
- NOEZAIFFTNSSLL-UHFFFAOYSA-N n-methyl-4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C(C(NC)=CC=2)[N+]([O-])=O)=C1 NOEZAIFFTNSSLL-UHFFFAOYSA-N 0.000 description 1
- GVBHRBMWXDCRHZ-UHFFFAOYSA-N n-phenylpyridine-2-carboxamide Chemical compound C=1C=CC=NC=1C(=O)NC1=CC=CC=C1 GVBHRBMWXDCRHZ-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000006548 oncogenic transformation Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000002916 oxazoles Chemical class 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- KGCNHWXDPDPSBV-UHFFFAOYSA-N p-nitrobenzyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CCl)C=C1 KGCNHWXDPDPSBV-UHFFFAOYSA-N 0.000 description 1
- 229960001592 paclitaxel Drugs 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- BOTNYLSAWDQNEX-UHFFFAOYSA-N phenoxymethylbenzene Chemical compound C=1C=CC=CC=1COC1=CC=CC=C1 BOTNYLSAWDQNEX-UHFFFAOYSA-N 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- 229940117953 phenylisothiocyanate Drugs 0.000 description 1
- OAHKWDDSKCRNFE-UHFFFAOYSA-N phenylmethanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=CC=CC=C1 OAHKWDDSKCRNFE-UHFFFAOYSA-N 0.000 description 1
- 150000008105 phosphatidylcholines Chemical class 0.000 description 1
- 102000051624 phosphatidylethanolamine binding protein Human genes 0.000 description 1
- 108700021017 phosphatidylethanolamine binding protein Proteins 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- INAAIJLSXJJHOZ-UHFFFAOYSA-N pibenzimol Chemical compound C1CN(C)CCN1C1=CC=C(N=C(N2)C=3C=C4NC(=NC4=CC=3)C=3C=CC(O)=CC=3)C2=C1 INAAIJLSXJJHOZ-UHFFFAOYSA-N 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 150000003058 platinum compounds Chemical class 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 108091033319 polynucleotide Proteins 0.000 description 1
- 102000040430 polynucleotide Human genes 0.000 description 1
- 239000002157 polynucleotide Substances 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000001725 pyrenyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- ABMYEXAYWZJVOV-UHFFFAOYSA-N pyridin-3-ylboronic acid Chemical compound OB(O)C1=CC=CN=C1 ABMYEXAYWZJVOV-UHFFFAOYSA-N 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 description 1
- 229960004622 raloxifene Drugs 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 229930002330 retinoic acid Natural products 0.000 description 1
- 108091092562 ribozyme Proteins 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 150000003334 secondary amides Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000008054 signal transmission Effects 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- PPASLZSBLFJQEF-RKJRWTFHSA-M sodium ascorbate Substances [Na+].OC[C@@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RKJRWTFHSA-M 0.000 description 1
- 235000010378 sodium ascorbate Nutrition 0.000 description 1
- 229960005055 sodium ascorbate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 1
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical compound [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000000527 sonication Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- HKSZLNNOFSGOKW-FYTWVXJKSA-N staurosporine Chemical compound C12=C3N4C5=CC=CC=C5C3=C3CNC(=O)C3=C2C2=CC=CC=C2N1[C@H]1C[C@@H](NC)[C@@H](OC)[C@]4(C)O1 HKSZLNNOFSGOKW-FYTWVXJKSA-N 0.000 description 1
- CGPUWJWCVCFERF-UHFFFAOYSA-N staurosporine Natural products C12=C3N4C5=CC=CC=C5C3=C3CNC(=O)C3=C2C2=CC=CC=C2N1C1CC(NC)C(OC)C4(OC)O1 CGPUWJWCVCFERF-UHFFFAOYSA-N 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 230000004960 subcellular localization Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 1
- 229940063683 taxotere Drugs 0.000 description 1
- GSISGLUKVBMUJB-UHFFFAOYSA-N tert-butyl 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxylate Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C(=O)OC(C)(C)C)=C1 GSISGLUKVBMUJB-UHFFFAOYSA-N 0.000 description 1
- BCCIQUYKSACFJY-UHFFFAOYSA-N tert-butyl n-[(4-phenylphenyl)methyl]carbamate Chemical compound C1=CC(CNC(=O)OC(C)(C)C)=CC=C1C1=CC=CC=C1 BCCIQUYKSACFJY-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000004797 therapeutic response Effects 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000005309 thioalkoxy group Chemical group 0.000 description 1
- NONOKGVFTBWRLD-UHFFFAOYSA-N thioisocyanate group Chemical group S(N=C=O)N=C=O NONOKGVFTBWRLD-UHFFFAOYSA-N 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- ODLHGICHYURWBS-LKONHMLTSA-N trappsol cyclo Chemical compound CC(O)COC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](COCC(C)O)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](COCC(C)O)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](COCC(C)O)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](COCC(C)O)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)COCC(O)C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1COCC(C)O ODLHGICHYURWBS-LKONHMLTSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000004565 tumor cell growth Effects 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 239000005483 tyrosine kinase inhibitor Substances 0.000 description 1
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 1
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 229960005486 vaccine Drugs 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000006444 vascular growth Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B35/00—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/622—Forming processes; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/626—Preparing or treating the powders individually or as batches ; preparing or treating macroscopic reinforcing agents for ceramic products, e.g. fibres; mechanical aspects section B
- C04B35/63—Preparing or treating the powders individually or as batches ; preparing or treating macroscopic reinforcing agents for ceramic products, e.g. fibres; mechanical aspects section B using additives specially adapted for forming the products, e.g.. binder binders
- C04B35/632—Organic additives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Health & Medical Sciences (AREA)
- Ceramic Engineering (AREA)
- Manufacturing & Machinery (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Chemical & Material Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Materials Engineering (AREA)
- Structural Engineering (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Hematology (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10/675,927 US8299108B2 (en) | 2002-03-29 | 2003-09-29 | Substituted benzazoles and methods of their use as inhibitors of raf kinase |
| PCT/US2004/032161 WO2005032548A1 (en) | 2003-09-29 | 2004-09-29 | Substituted benzazoles and use thereof as inhibitors of raf kinase |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2007507428A true JP2007507428A (ja) | 2007-03-29 |
| JP2007507428A5 JP2007507428A5 (enExample) | 2007-08-30 |
Family
ID=34422104
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2006528331A Withdrawn JP2007507428A (ja) | 2003-09-29 | 2004-09-29 | 置換ベンズアゾールおよびRafキナーゼのインヒビターとしてのその使用 |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US8299108B2 (enExample) |
| EP (1) | EP1675584A1 (enExample) |
| JP (1) | JP2007507428A (enExample) |
| KR (1) | KR20060089232A (enExample) |
| CN (1) | CN1913884A (enExample) |
| AU (1) | AU2004277405A1 (enExample) |
| BR (1) | BRPI0414908A (enExample) |
| CA (1) | CA2539748A1 (enExample) |
| EA (1) | EA011890B1 (enExample) |
| IL (1) | IL174431A0 (enExample) |
| MX (1) | MXPA06003435A (enExample) |
| WO (1) | WO2005032548A1 (enExample) |
| ZA (1) | ZA200603418B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2010064611A1 (ja) * | 2008-12-01 | 2010-06-10 | 武田薬品工業株式会社 | 複素環化合物およびその用途 |
| JP2020526547A (ja) * | 2017-07-12 | 2020-08-31 | ブリストル−マイヤーズ スクイブ カンパニーBristol−Myers Squibb Company | 心不全の治療のためのrockの5員アミノヘテロ環および5,6−または6,6員二環式アミノヘテロ環の阻害剤 |
Families Citing this family (72)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE538794T1 (de) | 1999-01-13 | 2012-01-15 | Bayer Healthcare Llc | Gamma carboxyarylsubstituierte diphenylharnstoffverbindungen als p38 kinasehemmer |
| US8124630B2 (en) | 1999-01-13 | 2012-02-28 | Bayer Healthcare Llc | ω-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| US7351834B1 (en) | 1999-01-13 | 2008-04-01 | Bayer Pharmaceuticals Corporation | ω-Carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| WO2003068229A1 (en) | 2002-02-11 | 2003-08-21 | Bayer Pharmaceuticals Corporation | Pyridine, quinoline, and isoquinoline n-oxides as kinase inhibitors |
| MXPA04007832A (es) | 2002-02-11 | 2005-09-08 | Bayer Pharmaceuticals Corp | Aril-ureas con actividad inhibitoria de angiogenesis. |
| JP4628678B2 (ja) * | 2002-03-29 | 2011-02-09 | ノバルティス バクシンズ アンド ダイアグノスティックス,インコーポレーテッド | 置換ベンズアゾールおよびRafキナーゼ阻害剤としてのそれらの使用 |
| UY28213A1 (es) | 2003-02-28 | 2004-09-30 | Bayer Pharmaceuticals Corp | Nuevos derivados de cianopiridina útiles en el tratamiento de cáncer y otros trastornos. |
| CA2526285A1 (en) | 2003-05-15 | 2004-12-23 | Arqule, Inc. | Inhibitors of p38 and methods of using the same |
| EP1636585B2 (en) | 2003-05-20 | 2012-06-13 | Bayer HealthCare LLC | Diaryl ureas with kinase inhibiting activity |
| HRP20060073B1 (hr) | 2003-07-23 | 2014-03-14 | Bayer Healthcare Llc | Fluoro supstituirana omega-karboksiaril difenil urea za lijeäśenje i prevenciju bolesti i stanja |
| CA2542653A1 (en) * | 2003-10-16 | 2005-04-28 | Chiron Corporation | Substituted benzazoles and use thereof as inhibitors of raf kinase |
| US7829560B2 (en) * | 2004-07-08 | 2010-11-09 | Arqule, Inc. | 1,4-disubstituted naphthalenes as inhibitors of P38 MAP kinase |
| US8178672B2 (en) * | 2004-10-19 | 2012-05-15 | Arqule, Inc. | Synthesis of imidazooxazole and imidazothiazole inhibitors of p38 MAP kinase |
| US7429608B2 (en) * | 2005-01-20 | 2008-09-30 | Amgen Inc. | Benzo[d]imidazol analogs as vanilloid receptor ligands and their use in treatments |
| TWI370820B (en) * | 2005-04-27 | 2012-08-21 | Takeda Pharmaceutical | Fused heterocyclic compounds |
| PE20070427A1 (es) * | 2005-08-30 | 2007-04-21 | Novartis Ag | Compuestos derivados de benzimidazoles sustituidos como inhibidores de tirosina quinasas |
| WO2007047397A2 (en) * | 2005-10-13 | 2007-04-26 | Smithkline Beecham Corporation | Phenol ethers as modulators of the opioid receptors |
| EP2295432A1 (en) | 2006-02-10 | 2011-03-16 | TransTech Pharma Inc. | Process for the preparation of aminobenzimidazole derivatives |
| PE20080359A1 (es) | 2006-04-19 | 2008-06-06 | Novartis Ag | Compuestos de benzoxazol y benzotiazol 6-0-sustituidos y metodos de inhibicion de la senalizacion de csf-1r |
| DK2046292T3 (da) | 2006-07-21 | 2010-06-07 | Novartis Ag | Formuleringer for benzimidazolylpyridylethere |
| PE20080766A1 (es) * | 2006-08-30 | 2008-06-15 | Novartis Ag | Sales de benzimidazolil piridil eteres y formulaciones que las contienen |
| AU2008239179B2 (en) * | 2007-04-05 | 2011-02-24 | Daiichi Sankyo Company, Limited | Fused bicyclic heteroaryl derivatives |
| AR066845A1 (es) | 2007-06-05 | 2009-09-16 | Takeda Pharmaceutical | Derivados de triazolopiridina e imidazopiridina una composicion farmaceutica que los comprende y su uso en la preparacion de un medicamento para el tratamiento del cancer |
| EP2181987B9 (en) | 2007-08-23 | 2014-09-03 | Takeda Pharmaceutical Company Limited | 2-Carbonylaminobenzothiazoles and their use for the prophylaxis and treatment of cancer |
| EP2184285B1 (en) * | 2007-08-29 | 2015-11-04 | Takeda Pharmaceutical Company Limited | Heterocyclic compound and use thereof |
| BRPI0816881A2 (pt) * | 2007-09-21 | 2015-03-17 | Array Biopharma Inc | Composto, composição farmacêutica, uso de um composto, e, métodos para tratar doenças ou distúrbios e para preparar um composto. |
| WO2009050228A2 (en) * | 2007-10-18 | 2009-04-23 | Novartis Ag | Csf-1r inhibitors for treatment of cancer and bone diseases |
| JO3101B1 (ar) | 2008-12-02 | 2017-09-20 | Takeda Pharmaceuticals Co | مشتقات بنزوثيازول كعوامل مضادة للسرطان |
| KR20110100241A (ko) * | 2008-12-05 | 2011-09-09 | 아르퀼 인코포레이티드 | Raf 억제제 및 이들의 용도 |
| CN102341386A (zh) | 2009-03-05 | 2012-02-01 | 第一三共株式会社 | 吡啶衍生物 |
| AU2011265254B2 (en) | 2010-06-11 | 2016-05-19 | Smith & Nephew, Inc. | Patient-matched instruments |
| EP2593434A1 (en) | 2010-07-16 | 2013-05-22 | Purdue Pharma LP | Pyridine compounds as sodium channel blockers |
| AU2011303597A1 (en) | 2010-09-17 | 2013-04-11 | Purdue Pharma L.P. | Pyridine compounds and the uses thereof |
| CN102276482A (zh) * | 2011-04-11 | 2011-12-14 | 常州大学 | 2-甲氧基-5-溴苯胺的制备方法 |
| US9408885B2 (en) | 2011-12-01 | 2016-08-09 | Vib Vzw | Combinations of therapeutic agents for treating melanoma |
| AU2013203824A1 (en) | 2012-03-16 | 2013-10-03 | Purdue Pharma L.P. | Substituted pyridines and pryimidines as sodium channel blockers |
| US9714252B2 (en) | 2012-12-20 | 2017-07-25 | Purdue Pharma L.P. | Cyclic sulfonamides as sodium channel blockers |
| US9242969B2 (en) | 2013-03-14 | 2016-01-26 | Novartis Ag | Biaryl amide compounds as kinase inhibitors |
| CN103435554A (zh) * | 2013-09-06 | 2013-12-11 | 中国药科大学 | 2-苯氨基苯并咪唑类化合物及其用途 |
| WO2015041534A1 (en) | 2013-09-20 | 2015-03-26 | Stichting Het Nederlands Kanker Instituut | P90rsk in combination with raf/erk/mek |
| EP3046557A1 (en) | 2013-09-20 | 2016-07-27 | Stichting Het Nederlands Kanker Instituut | Rock in combination with mapk-pathway |
| US10730866B2 (en) | 2014-04-07 | 2020-08-04 | Purdue Pharma L.P. | Indole derivatives and use thereof |
| US20170027940A1 (en) | 2014-04-10 | 2017-02-02 | Stichting Het Nederlands Kanker Instituut | Method for treating cancer |
| WO2015178770A1 (en) | 2014-05-19 | 2015-11-26 | Stichting Het Nederlands Kanker Instituut | Compositions for cancer treatment |
| UY36294A (es) | 2014-09-12 | 2016-04-29 | Novartis Ag | Compuestos y composiciones como inhibidores de quinasa |
| WO2016100184A1 (en) | 2014-12-16 | 2016-06-23 | Forum Pharmaceuticals, Inc. | Geminal substituted quinuclidine amide compounds as agonists of alpha-7 nicotinic acetylcholine receptors |
| CN105949178B (zh) * | 2015-03-09 | 2020-05-26 | 西格莱(苏州)生物医药有限公司 | 一种苯并咪唑类化合物、其制备方法、中间体及应用 |
| JP2018516973A (ja) | 2015-06-10 | 2018-06-28 | フォーラム・ファーマシューティカルズ・インコーポレイテッドForum Pharmaceuticals Inc. | α7−ニコチン性アセチルコリン受容体のアゴニストとしてのアミノベンゾイソオキサゾール化合物 |
| EP3334740A4 (en) | 2015-08-12 | 2019-02-06 | Axovant Sciences GmbH | GEMINAL SUBSTITUTED AMINOBENZISOXAZOLE COMPOUNDS AS AGONISTS OF ALPHA 7-NICOTINIC ACETYLCHOLINE RECEPTORS |
| KR101770310B1 (ko) | 2015-08-24 | 2017-08-24 | 이화여자대학교 산학협력단 | 2-(페닐아미노)벤조[d]옥사졸-5-올 유도체, 이의 제조방법 및 이를 유효성분으로 함유하는 염증성 질환의 예방 또는 치료용 약학적 조성물 |
| US11028055B2 (en) * | 2015-11-30 | 2021-06-08 | Children's Medical Center Corporation | Compounds for treating proliferative diseases |
| CA3037456A1 (en) | 2016-09-19 | 2018-03-22 | Novartis Ag | Therapeutic combinations comprising a raf inhibitor and a erk inhibitor |
| CN106674264A (zh) * | 2016-12-20 | 2017-05-17 | 苏州汉德创宏生化科技有限公司 | (2,2,2‑三氟乙氧基)苯硼酸类化合物的合成方法 |
| US11471538B2 (en) | 2017-02-10 | 2022-10-18 | INSERM (Institut National de la Santéet de la Recherche Medicale) | Methods and pharmaceutical compositions for the treatment of cancers associated with activation of the MAPK pathway |
| WO2018168899A1 (ja) | 2017-03-15 | 2018-09-20 | 大日本住友製薬株式会社 | ベンズイミダゾール誘導体の製造方法 |
| IL270224B1 (en) | 2017-05-02 | 2024-04-01 | Novartis Ag | Combination therapy employing trametinib and a defined raf inhibitor |
| US11339157B1 (en) | 2017-10-24 | 2022-05-24 | Bayer Aktiengesellschaft | 4H-pyrrolo[3,2-c]pyridin-4-one derivatives |
| EP3732285A1 (en) | 2017-12-28 | 2020-11-04 | Tract Pharmaceuticals, Inc. | Stem cell culture systems for columnar epithelial stem cells, and uses related thereto |
| WO2019156438A1 (en) * | 2018-02-07 | 2019-08-15 | Korea Research Institute Of Chemical Technology | Hetero ring-fused phenyl compounds for inhibiting tnik and medical uses thereof |
| JP2022500385A (ja) | 2018-09-10 | 2022-01-04 | ミラティ セラピューティクス, インコーポレイテッド | 組み合わせ療法 |
| WO2020097398A1 (en) | 2018-11-07 | 2020-05-14 | Dana-Farber Cancer Institute, Inc. | Benzothiazole derivatives and 7-aza-benzothiazole derivatives as janus kinase 2 inhibitors and uses thereof |
| WO2020216774A1 (en) | 2019-04-24 | 2020-10-29 | Bayer Aktiengesellschaft | 4h-pyrrolo[3,2-c]pyridin-4-one derivatives |
| BR112021019998B1 (pt) | 2019-04-24 | 2024-01-16 | The Broad Institute, Inc. | 4h-pirrolo[3,2-c]piridin-4-ona, seus usos, composição farmacêutica, e kit de partes |
| WO2020216773A1 (en) | 2019-04-24 | 2020-10-29 | Bayer Aktiengesellschaft | 4h-pyrrolo[3,2-c]pyridin-4-one compounds |
| EP4563150A3 (en) | 2019-05-13 | 2025-07-23 | Novartis AG | New crystalline forms of n-(3-(2-(2-hydroxyethoxy)-6-morpholinopyridin-4-yl)-4-methvlphenyl)-2(trifluoromethyl) isonicotinamide as raf inhibitors for the treatment of cancer |
| CA3177214A1 (en) | 2020-03-31 | 2021-10-07 | Bayer Aktiengesellschaft | 3-(anilino)-2-[3-(3-alkoxy-pyridin-4-yl]-1,5,6,7-tetrahydro-4h-pyrrolo[3,2-c]pyridin-4-one derivatives as egfr inhibitors for the treatment of cancer |
| CA3181537A1 (en) | 2020-05-06 | 2021-11-11 | Ajax Therapeutics, Inc. | 6-heteroaryloxy benzimidazoles and azabenzimidazoles as jak2 inhibitors |
| EP4263531A2 (en) * | 2020-12-16 | 2023-10-25 | IFM Due, Inc. | Compounds and compositions for treating conditions associated with sting activity |
| WO2022140527A1 (en) | 2020-12-23 | 2022-06-30 | Ajax Therapeutics, Inc. | 6-heteroaryloxy benzimidazoles and azabenzimidazoles as jak2 inhibitors |
| WO2023009708A1 (en) * | 2021-07-29 | 2023-02-02 | Ajax Therapeutics, Inc. | Heteroaryloxy triazolo- and imidazo-azines as jak2 inhibitors |
| TW202325289A (zh) | 2021-11-09 | 2023-07-01 | 美商雅捷可斯治療公司 | Jak2抑制劑之形式及組合物 |
| CA3234638A1 (en) | 2021-11-09 | 2023-05-19 | Ajax Therapeutics, Inc. | 6-heteroaryloxy benzimidazoles and azabenzimidazoles as jak2 inhibitors |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2005529089A (ja) * | 2002-03-29 | 2005-09-29 | カイロン コーポレイション | 置換ベンズアゾールおよびRafキナーゼ阻害剤としてのそれらの使用 |
| JP2006520805A (ja) * | 2003-03-21 | 2006-09-14 | アムジエン・インコーポレーテツド | 複素環式化合物ならびにその使用方法 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ510991A (en) * | 1997-03-05 | 2002-11-26 | Sugen Inc | Use of formulations for hydrophobic pharmaceutical agents in treatment or prevention of cell proliferative disorders |
| GB9711650D0 (en) * | 1997-06-05 | 1997-07-30 | Pfizer Ltd | Compounds useful in therapy |
| US6211177B1 (en) * | 1998-11-24 | 2001-04-03 | Cell Pathways, Inc. | Method for treating neoplasia by exposure to substituted 2-aryl-benzimidazole derivatives |
| WO2000042012A1 (en) | 1999-01-13 | 2000-07-20 | Bayer Corporation | φ-CARBOXYARYL SUBSTITUTED DIPHENYL UREAS AS RAF KINASE INHIBITORS |
| EP2308833A3 (en) | 1999-04-15 | 2011-09-28 | Bristol-Myers Squibb Company | Cyclic protein tyrosine kinase inhibitors |
| ATE339406T1 (de) * | 1999-09-23 | 2006-10-15 | Astrazeneca Ab | Chinazoline verbindungen als heilmittel |
| JP2003525936A (ja) | 2000-03-06 | 2003-09-02 | スミスクライン ビーチャム パブリック リミテッド カンパニー | Rafキナーゼ阻害物質としてのイミダゾール誘導体 |
| HUP0400651A2 (hu) | 2000-11-07 | 2004-06-28 | Bristol-Myers Squibb Company | Szerin proteáz inhibitorokként alkalmazható savszármazékok és ezeket tartalmazó gyógyszerkészítmények |
| EP1341771A2 (en) | 2000-11-29 | 2003-09-10 | Glaxo Group Limited | Benzimidazole derivatives useful as tie-2 and/or vegfr-2 inhibitors |
| US20030009034A1 (en) | 2001-03-22 | 2003-01-09 | Neil Wishart | Transition metal mediated process |
| GB0112348D0 (en) | 2001-05-19 | 2001-07-11 | Smithkline Beecham Plc | Compounds |
| US7893096B2 (en) * | 2003-03-28 | 2011-02-22 | Novartis Vaccines And Diagnostics, Inc. | Use of small molecule compounds for immunopotentiation |
-
2003
- 2003-09-29 US US10/675,927 patent/US8299108B2/en not_active Expired - Fee Related
-
2004
- 2004-09-29 MX MXPA06003435A patent/MXPA06003435A/es not_active Application Discontinuation
- 2004-09-29 JP JP2006528331A patent/JP2007507428A/ja not_active Withdrawn
- 2004-09-29 EA EA200600689A patent/EA011890B1/ru not_active IP Right Cessation
- 2004-09-29 KR KR1020067006470A patent/KR20060089232A/ko not_active Ceased
- 2004-09-29 BR BRPI0414908-4A patent/BRPI0414908A/pt not_active IP Right Cessation
- 2004-09-29 EP EP04789345A patent/EP1675584A1/en not_active Withdrawn
- 2004-09-29 CN CNA2004800326778A patent/CN1913884A/zh active Pending
- 2004-09-29 CA CA002539748A patent/CA2539748A1/en not_active Abandoned
- 2004-09-29 WO PCT/US2004/032161 patent/WO2005032548A1/en not_active Ceased
- 2004-09-29 AU AU2004277405A patent/AU2004277405A1/en not_active Abandoned
-
2006
- 2006-03-21 IL IL174431A patent/IL174431A0/en unknown
- 2006-04-28 ZA ZA200603418A patent/ZA200603418B/en unknown
-
2012
- 2012-07-24 US US13/556,907 patent/US20120288501A1/en not_active Abandoned
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2005529089A (ja) * | 2002-03-29 | 2005-09-29 | カイロン コーポレイション | 置換ベンズアゾールおよびRafキナーゼ阻害剤としてのそれらの使用 |
| JP2006520805A (ja) * | 2003-03-21 | 2006-09-14 | アムジエン・インコーポレーテツド | 複素環式化合物ならびにその使用方法 |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2010064611A1 (ja) * | 2008-12-01 | 2010-06-10 | 武田薬品工業株式会社 | 複素環化合物およびその用途 |
| US8697874B2 (en) | 2008-12-01 | 2014-04-15 | Takeda Pharmaceutical Company Limited | Heterocyclic compound and use thereof |
| JP5579619B2 (ja) * | 2008-12-01 | 2014-08-27 | 武田薬品工業株式会社 | 複素環化合物およびその用途 |
| JP2020526547A (ja) * | 2017-07-12 | 2020-08-31 | ブリストル−マイヤーズ スクイブ カンパニーBristol−Myers Squibb Company | 心不全の治療のためのrockの5員アミノヘテロ環および5,6−または6,6員二環式アミノヘテロ環の阻害剤 |
| JP7234201B2 (ja) | 2017-07-12 | 2023-03-07 | ブリストル-マイヤーズ スクイブ カンパニー | 心不全の治療のためのrockの5員アミノヘテロ環および5,6-または6,6員二環式アミノヘテロ環の阻害剤 |
Also Published As
| Publication number | Publication date |
|---|---|
| CA2539748A1 (en) | 2005-04-14 |
| US20040122237A1 (en) | 2004-06-24 |
| US20120288501A1 (en) | 2012-11-15 |
| IL174431A0 (en) | 2006-08-01 |
| MXPA06003435A (es) | 2006-06-20 |
| AU2004277405A1 (en) | 2005-04-14 |
| KR20060089232A (ko) | 2006-08-08 |
| BRPI0414908A (pt) | 2006-11-07 |
| EP1675584A1 (en) | 2006-07-05 |
| ZA200603418B (en) | 2007-07-25 |
| WO2005032548A1 (en) | 2005-04-14 |
| EA200600689A1 (ru) | 2006-08-25 |
| CN1913884A (zh) | 2007-02-14 |
| US8299108B2 (en) | 2012-10-30 |
| EA011890B1 (ru) | 2009-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP5265629B2 (ja) | 置換ベンズアゾールおよびRafキナーゼ阻害剤としてのそれらの使用 | |
| JP2007507428A (ja) | 置換ベンズアゾールおよびRafキナーゼのインヒビターとしてのその使用 | |
| ES2327418T3 (es) | Benzazoles sustituidos y uso de los mismos como inhibidores de la quinasa raf. | |
| JP2007509059A (ja) | 癌の処置のためのRafキナーゼのインヒビターとしての、2,6−二置換キナゾリン、キノキサリン、キノリンおよびイソキノリン | |
| HK1078779B (en) | Substituted benzazoles and use thereof as raf kinase inhibitors | |
| HK1067945B (en) | Substituted benzazoles and use thereof as raf kinase inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20070709 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20070709 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20100826 |
|
| A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20101125 |
|
| A602 | Written permission of extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A602 Effective date: 20101202 |
|
| A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20101214 |
|
| A602 | Written permission of extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A602 Effective date: 20101221 |
|
| A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20110125 |
|
| A602 | Written permission of extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A602 Effective date: 20110201 |
|
| A761 | Written withdrawal of application |
Free format text: JAPANESE INTERMEDIATE CODE: A761 Effective date: 20110218 |