IL32758A - 1-Tritil-1,2,4-Triazoles, their preparation and use for fungicides - Google Patents
1-Tritil-1,2,4-Triazoles, their preparation and use for fungicidesInfo
- Publication number
- IL32758A IL32758A IL32758A IL3275869A IL32758A IL 32758 A IL32758 A IL 32758A IL 32758 A IL32758 A IL 32758A IL 3275869 A IL3275869 A IL 3275869A IL 32758 A IL32758 A IL 32758A
- Authority
- IL
- Israel
- Prior art keywords
- active
- compound
- weight
- process according
- acid
- Prior art date
Links
- 241000233866 Fungi Species 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 11
- 239000007788 liquid Substances 0.000 claims description 9
- 239000003085 diluting agent Substances 0.000 claims description 7
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 claims description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 239000004310 lactic acid Substances 0.000 claims description 4
- 235000014655 lactic acid Nutrition 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 150000003852 triazoles Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004802 cyanophenyl group Chemical group 0.000 claims description 2
- 230000000855 fungicidal effect Effects 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims 3
- 238000010790 dilution Methods 0.000 claims 1
- 239000012895 dilution Substances 0.000 claims 1
- 239000004615 ingredient Substances 0.000 claims 1
- 125000004971 nitroalkyl group Chemical group 0.000 claims 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 claims 1
- 239000008247 solid mixture Substances 0.000 claims 1
- 150000003512 tertiary amines Chemical class 0.000 claims 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 239000007921 spray Substances 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 3
- 206010061217 Infestation Diseases 0.000 description 3
- 241000220225 Malus Species 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 230000002464 fungitoxic effect Effects 0.000 description 3
- -1 trityl halide Chemical class 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 240000008067 Cucumis sativus Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000221787 Erysiphe Species 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 231100000162 fungitoxic Toxicity 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000896242 Podosphaera Species 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681795249 DE1795249C3 (de) | 1968-08-28 | 1-Trityl-1,2,4-triazole |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL32758A0 IL32758A0 (en) | 1969-11-12 |
| IL32758A true IL32758A (en) | 1973-03-30 |
Family
ID=5708114
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL32758A IL32758A (en) | 1968-08-28 | 1969-08-03 | 1-Tritil-1,2,4-Triazoles, their preparation and use for fungicides |
Country Status (20)
| Country | Link |
|---|---|
| US (2) | US3682950A (enFirst) |
| JP (1) | JPS4828057B1 (enFirst) |
| AT (2) | AT295923B (enFirst) |
| BE (1) | BE738095A (enFirst) |
| BG (2) | BG16340A3 (enFirst) |
| BR (1) | BR6911924D0 (enFirst) |
| CH (1) | CH488713A (enFirst) |
| CS (1) | CS153050B2 (enFirst) |
| DK (1) | DK120801B (enFirst) |
| ES (1) | ES370939A1 (enFirst) |
| FR (1) | FR2016526A1 (enFirst) |
| GB (1) | GB1237509A (enFirst) |
| IL (1) | IL32758A (enFirst) |
| MY (1) | MY7400100A (enFirst) |
| NL (1) | NL165159C (enFirst) |
| PL (1) | PL80204B1 (enFirst) |
| RO (1) | RO56688A (enFirst) |
| SE (1) | SE349037B (enFirst) |
| TR (1) | TR18610A (enFirst) |
| YU (1) | YU35362B (enFirst) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1964995A1 (de) * | 1969-12-24 | 1971-07-01 | Bayer Ag | N-Benzyltriazole,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums |
| DE2247186A1 (de) * | 1972-09-26 | 1974-03-28 | Bayer Ag | Antimykotisches mittel |
| DE2324424A1 (de) * | 1973-05-15 | 1974-12-05 | Bayer Ag | Antimikrobielle mittel |
| DE2407305C2 (de) * | 1974-02-15 | 1984-06-28 | Bayer Ag, 5090 Leverkusen | Triphenyl-1,2,3-triazol-1-yl-methane, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
| US3922162A (en) * | 1974-03-28 | 1975-11-25 | Velsicol Chemical Corp | 2-Alkyl-4-aryl-1,2,4-triazolidin-3-ones |
| DE2502932C2 (de) * | 1975-01-24 | 1985-04-18 | Bayer Ag, 5090 Leverkusen | Metallkomplexe von N-Trityl-azolen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| DE2652313A1 (de) * | 1976-11-17 | 1978-05-18 | Basf Ag | Triazolderivate |
| WO1988007813A1 (en) * | 1987-04-14 | 1988-10-20 | Greencare Pty. Limited | Soil spreader |
| DE3931303A1 (de) * | 1989-09-20 | 1991-03-28 | Desowag Materialschutz Gmbh | Verfahren zum vorbeugenden materialschutz gegenueber staendig und/oder temporaer im boden lebenden schaedlingen, insbesondere termiten |
| GB9202779D0 (en) * | 1992-02-10 | 1992-03-25 | Ici Plc | Novel compounds |
| DE10248335A1 (de) * | 2002-10-17 | 2004-05-06 | Bayer Ag | Fungizide Wirkstoffkombinationen |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1215164B (de) * | 1964-01-25 | 1966-04-28 | Bayer Ag | Verfahren zur Herstellung von 1, 2, 4-Triazolen |
| US3321366A (en) * | 1965-11-15 | 1967-05-23 | Dow Chemical Co | Fungicidal methods and compositions |
-
1969
- 1969-07-24 CH CH1132969A patent/CH488713A/de not_active IP Right Cessation
- 1969-08-03 IL IL32758A patent/IL32758A/en unknown
- 1969-08-06 TR TR18610A patent/TR18610A/xx unknown
- 1969-08-08 US US848738A patent/US3682950A/en not_active Expired - Lifetime
- 1969-08-09 RO RO60763A patent/RO56688A/ro unknown
- 1969-08-18 BG BG012889A patent/BG16340A3/bg unknown
- 1969-08-25 GB GB42265/69A patent/GB1237509A/en not_active Expired
- 1969-08-25 SE SE11783/69A patent/SE349037B/xx unknown
- 1969-08-26 NL NL6913028.A patent/NL165159C/xx not_active IP Right Cessation
- 1969-08-27 PL PL1969135558A patent/PL80204B1/pl unknown
- 1969-08-27 YU YU2202/69A patent/YU35362B/xx unknown
- 1969-08-27 DK DK459369AA patent/DK120801B/da not_active IP Right Cessation
- 1969-08-28 BR BR211924/69A patent/BR6911924D0/pt unknown
- 1969-08-28 CS CS590169A patent/CS153050B2/cs unknown
- 1969-08-28 JP JP44067634A patent/JPS4828057B1/ja active Pending
- 1969-08-28 BE BE738095A patent/BE738095A/fr not_active IP Right Cessation
- 1969-08-28 AT AT760970A patent/AT295923B/de not_active IP Right Cessation
- 1969-08-28 FR FR6929493A patent/FR2016526A1/fr not_active Withdrawn
- 1969-08-28 ES ES370939A patent/ES370939A1/es not_active Expired
- 1969-08-28 AT AT823069A patent/AT291257B/de not_active IP Right Cessation
-
1970
- 1970-01-21 BG BG013789A patent/BG16166A3/bg unknown
-
1972
- 1972-04-19 US US00245603A patent/US3723622A/en not_active Expired - Lifetime
-
1974
- 1974-12-30 MY MY100/74A patent/MY7400100A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT295923B (de) | 1972-01-25 |
| BG16340A3 (bg) | 1972-08-20 |
| GB1237509A (en) | 1971-06-30 |
| CS153050B2 (enFirst) | 1974-02-22 |
| DK120801B (da) | 1971-07-19 |
| TR18610A (tr) | 1977-05-13 |
| AT291257B (de) | 1971-07-12 |
| JPS4828057B1 (enFirst) | 1973-08-29 |
| BR6911924D0 (pt) | 1973-04-17 |
| YU35362B (en) | 1980-12-31 |
| DE1795249B2 (de) | 1975-11-06 |
| DE1795249A1 (de) | 1971-12-30 |
| MY7400100A (en) | 1974-12-31 |
| NL6913028A (enFirst) | 1970-03-03 |
| YU220269A (en) | 1980-06-30 |
| NL165159B (nl) | 1980-10-15 |
| BE738095A (enFirst) | 1970-03-02 |
| CH488713A (de) | 1970-04-15 |
| PL80204B1 (enFirst) | 1975-08-30 |
| SE349037B (enFirst) | 1972-09-18 |
| FR2016526A1 (enFirst) | 1970-05-08 |
| IL32758A0 (en) | 1969-11-12 |
| US3723622A (en) | 1973-03-27 |
| BG16166A3 (bg) | 1972-07-20 |
| NL165159C (nl) | 1981-03-16 |
| RO56688A (enFirst) | 1974-09-01 |
| ES370939A1 (es) | 1971-11-01 |
| US3682950A (en) | 1972-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2429523C2 (enFirst) | ||
| EP0085333B1 (de) | Ether-Derivate von substituierten 1-Hydroxyalkyl-azolen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide und Pflanzenwachstumsregulatoren | |
| EP0055833B1 (de) | Substituierte 1-Azolyl-butan-2-ole, Verfahren zu ihrer Herstellung und ihre Verwendung als Pflanzenschutzmittel sowie als Zwischenprodukte | |
| IL45133A (en) | 1-phenoxy-1-imidazolyl-alkanol derivatives and their salts process for their preparation and their use as fungicide | |
| DE2635663C2 (enFirst) | ||
| IL31302A (en) | N-tritylimidazoles,their preparation and use for combatting fungi | |
| IL32758A (en) | 1-Tritil-1,2,4-Triazoles, their preparation and use for fungicides | |
| HU181644B (en) | Fungicide compositions containing oximino-triazolyl-ethane derivatives as active substances and process for preparing the active substances | |
| EP0007506A1 (de) | Alpha-Azolyl-keto-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| DE2325156A1 (de) | Fungizide und mikrobizide mittel | |
| EP0019189A1 (de) | Fungizide Mittel, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| CS195322B2 (en) | Fungicide and method of preparing active substances therefor | |
| JPS5835190B2 (ja) | シンキ 1− エチル − トリアゾ−ルノ セイホウ | |
| JPS58967A (ja) | 菌・カビ防除組成物 | |
| NL192319C (nl) | Fungicide, preparaat dat dit fungicide bevat en gebruik van dit fungicide of preparaat voor het bestrijden van fytopathogene fungi. | |
| EP0009707B1 (de) | Halogenierte 1-Azolyl-1-fluorphenoxy-butan-Derivate, Verfahren zu ihrer Herstellung, sie enthaltende Fungizide Mittel sowie ihre Verwendung als Fungizide | |
| JPS599553B2 (ja) | 新規ハロゲントリアゾ−ル誘導体の製法 | |
| EP0006538B1 (de) | Sulfenylierte Carbamoyl-triazolyl-O,N-acetale, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| HU176918B (hu) | Fungicidnye i nematocidnye kompozicii dlja zahhity rastenijj | |
| DE3518916A1 (de) | Dichlorcyclopropylalkyl-hydroxyalkyl-azol- derivate | |
| IE42407B1 (en) | Metal complexes of n-trityl-azoles, processes for their preparation and their use as fungicides | |
| DD201842A5 (de) | Fungizide mittel | |
| EP0123179B1 (de) | Phosphorylierte Azolyl-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| EP0197322A2 (de) | Triazol-Derivate | |
| IL44155A (en) | Fungicidal compositions containing certain 1-ethylimidazole derivatives |