PL80204B1 - - Google Patents
Download PDFInfo
- Publication number
- PL80204B1 PL80204B1 PL1969135558A PL13555869A PL80204B1 PL 80204 B1 PL80204 B1 PL 80204B1 PL 1969135558 A PL1969135558 A PL 1969135558A PL 13555869 A PL13555869 A PL 13555869A PL 80204 B1 PL80204 B1 PL 80204B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- pattern
- ceh5
- active substances
- sample
- Prior art date
Links
- 239000013543 active substance Substances 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 230000000855 fungicidal effect Effects 0.000 claims description 8
- 101100231508 Caenorhabditis elegans ceh-5 gene Proteins 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 239000000417 fungicide Substances 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- HAGYXNVNFOULKK-UHFFFAOYSA-N 1-trityl-1,2,4-triazole Chemical class N1=CN=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 HAGYXNVNFOULKK-UHFFFAOYSA-N 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- -1 xylene and benzene Chemical class 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 241000196324 Embryophyta Species 0.000 description 8
- 208000015181 infectious disease Diseases 0.000 description 8
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 241000233866 Fungi Species 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 241000220225 Malus Species 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 240000008067 Cucumis sativus Species 0.000 description 4
- 235000009849 Cucumis sativus Nutrition 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 125000002877 alkyl aryl group Chemical group 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 150000003852 triazoles Chemical class 0.000 description 3
- 150000000178 1,2,4-triazoles Chemical class 0.000 description 2
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000221787 Erysiphe Species 0.000 description 2
- 241000896218 Golovinomyces orontii Species 0.000 description 2
- 206010061217 Infestation Diseases 0.000 description 2
- 208000031888 Mycoses Diseases 0.000 description 2
- 241000896242 Podosphaera Species 0.000 description 2
- 241001337928 Podosphaera leucotricha Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 102100032306 Aurora kinase B Human genes 0.000 description 1
- 108090000749 Aurora kinase B Proteins 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 241001480059 Erysiphaceae Species 0.000 description 1
- 241000221785 Erysiphales Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000498271 Necator Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000896238 Oidium Species 0.000 description 1
- 241000579741 Sphaerotheca <fungi> Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681795249 DE1795249C3 (de) | 1968-08-28 | 1-Trityl-1,2,4-triazole |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL80204B1 true PL80204B1 (enFirst) | 1975-08-30 |
Family
ID=5708114
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1969135558A PL80204B1 (enFirst) | 1968-08-28 | 1969-08-27 |
Country Status (20)
| Country | Link |
|---|---|
| US (2) | US3682950A (enFirst) |
| JP (1) | JPS4828057B1 (enFirst) |
| AT (2) | AT295923B (enFirst) |
| BE (1) | BE738095A (enFirst) |
| BG (2) | BG16340A3 (enFirst) |
| BR (1) | BR6911924D0 (enFirst) |
| CH (1) | CH488713A (enFirst) |
| CS (1) | CS153050B2 (enFirst) |
| DK (1) | DK120801B (enFirst) |
| ES (1) | ES370939A1 (enFirst) |
| FR (1) | FR2016526A1 (enFirst) |
| GB (1) | GB1237509A (enFirst) |
| IL (1) | IL32758A (enFirst) |
| MY (1) | MY7400100A (enFirst) |
| NL (1) | NL165159C (enFirst) |
| PL (1) | PL80204B1 (enFirst) |
| RO (1) | RO56688A (enFirst) |
| SE (1) | SE349037B (enFirst) |
| TR (1) | TR18610A (enFirst) |
| YU (1) | YU35362B (enFirst) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1964995A1 (de) * | 1969-12-24 | 1971-07-01 | Bayer Ag | N-Benzyltriazole,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums |
| DE2247186A1 (de) * | 1972-09-26 | 1974-03-28 | Bayer Ag | Antimykotisches mittel |
| DE2324424A1 (de) * | 1973-05-15 | 1974-12-05 | Bayer Ag | Antimikrobielle mittel |
| DE2407305C2 (de) * | 1974-02-15 | 1984-06-28 | Bayer Ag, 5090 Leverkusen | Triphenyl-1,2,3-triazol-1-yl-methane, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
| US3922162A (en) * | 1974-03-28 | 1975-11-25 | Velsicol Chemical Corp | 2-Alkyl-4-aryl-1,2,4-triazolidin-3-ones |
| DE2502932C2 (de) * | 1975-01-24 | 1985-04-18 | Bayer Ag, 5090 Leverkusen | Metallkomplexe von N-Trityl-azolen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| DE2652313A1 (de) * | 1976-11-17 | 1978-05-18 | Basf Ag | Triazolderivate |
| WO1988007813A1 (en) * | 1987-04-14 | 1988-10-20 | Greencare Pty. Limited | Soil spreader |
| DE3931303A1 (de) * | 1989-09-20 | 1991-03-28 | Desowag Materialschutz Gmbh | Verfahren zum vorbeugenden materialschutz gegenueber staendig und/oder temporaer im boden lebenden schaedlingen, insbesondere termiten |
| GB9202779D0 (en) * | 1992-02-10 | 1992-03-25 | Ici Plc | Novel compounds |
| DE10248335A1 (de) * | 2002-10-17 | 2004-05-06 | Bayer Ag | Fungizide Wirkstoffkombinationen |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1215164B (de) * | 1964-01-25 | 1966-04-28 | Bayer Ag | Verfahren zur Herstellung von 1, 2, 4-Triazolen |
| US3321366A (en) * | 1965-11-15 | 1967-05-23 | Dow Chemical Co | Fungicidal methods and compositions |
-
1969
- 1969-07-24 CH CH1132969A patent/CH488713A/de not_active IP Right Cessation
- 1969-08-03 IL IL32758A patent/IL32758A/en unknown
- 1969-08-06 TR TR18610A patent/TR18610A/xx unknown
- 1969-08-08 US US848738A patent/US3682950A/en not_active Expired - Lifetime
- 1969-08-09 RO RO60763A patent/RO56688A/ro unknown
- 1969-08-18 BG BG012889A patent/BG16340A3/bg unknown
- 1969-08-25 GB GB42265/69A patent/GB1237509A/en not_active Expired
- 1969-08-25 SE SE11783/69A patent/SE349037B/xx unknown
- 1969-08-26 NL NL6913028.A patent/NL165159C/xx not_active IP Right Cessation
- 1969-08-27 PL PL1969135558A patent/PL80204B1/pl unknown
- 1969-08-27 YU YU2202/69A patent/YU35362B/xx unknown
- 1969-08-27 DK DK459369AA patent/DK120801B/da not_active IP Right Cessation
- 1969-08-28 BR BR211924/69A patent/BR6911924D0/pt unknown
- 1969-08-28 CS CS590169A patent/CS153050B2/cs unknown
- 1969-08-28 JP JP44067634A patent/JPS4828057B1/ja active Pending
- 1969-08-28 BE BE738095A patent/BE738095A/fr not_active IP Right Cessation
- 1969-08-28 AT AT760970A patent/AT295923B/de not_active IP Right Cessation
- 1969-08-28 FR FR6929493A patent/FR2016526A1/fr not_active Withdrawn
- 1969-08-28 ES ES370939A patent/ES370939A1/es not_active Expired
- 1969-08-28 AT AT823069A patent/AT291257B/de not_active IP Right Cessation
-
1970
- 1970-01-21 BG BG013789A patent/BG16166A3/bg unknown
-
1972
- 1972-04-19 US US00245603A patent/US3723622A/en not_active Expired - Lifetime
-
1974
- 1974-12-30 MY MY100/74A patent/MY7400100A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT295923B (de) | 1972-01-25 |
| BG16340A3 (bg) | 1972-08-20 |
| GB1237509A (en) | 1971-06-30 |
| CS153050B2 (enFirst) | 1974-02-22 |
| DK120801B (da) | 1971-07-19 |
| TR18610A (tr) | 1977-05-13 |
| AT291257B (de) | 1971-07-12 |
| JPS4828057B1 (enFirst) | 1973-08-29 |
| BR6911924D0 (pt) | 1973-04-17 |
| YU35362B (en) | 1980-12-31 |
| DE1795249B2 (de) | 1975-11-06 |
| DE1795249A1 (de) | 1971-12-30 |
| MY7400100A (en) | 1974-12-31 |
| NL6913028A (enFirst) | 1970-03-03 |
| YU220269A (en) | 1980-06-30 |
| NL165159B (nl) | 1980-10-15 |
| BE738095A (enFirst) | 1970-03-02 |
| CH488713A (de) | 1970-04-15 |
| SE349037B (enFirst) | 1972-09-18 |
| IL32758A (en) | 1973-03-30 |
| FR2016526A1 (enFirst) | 1970-05-08 |
| IL32758A0 (en) | 1969-11-12 |
| US3723622A (en) | 1973-03-27 |
| BG16166A3 (bg) | 1972-07-20 |
| NL165159C (nl) | 1981-03-16 |
| RO56688A (enFirst) | 1974-09-01 |
| ES370939A1 (es) | 1971-11-01 |
| US3682950A (en) | 1972-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5063241A (en) | Fungicidal agents | |
| HU188833B (en) | Fungicidal and plant growth regulating compositions comprising ether derivatives of substituted 1-(hydroxy-alkyl)-azoles as active substance and process for preparing the active substances | |
| CS200238B2 (en) | Fungicide | |
| EP0192055B1 (de) | Hydroxyalkinyl-azolyl-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| PL80204B1 (enFirst) | ||
| US4495191A (en) | Fungicidal 3-1,2,4-triazol-1-yl-1,2-diaryl-1-halogeno-prop-1-ene derivatives, compositions, and method of use | |
| CS221276B2 (en) | Fungicide means | |
| DD219100A5 (de) | Fungizide mittel | |
| CS196433B2 (en) | Fungicide | |
| DE3124580A1 (de) | Fungizide mittel | |
| PL109268B1 (en) | Fungicide | |
| DD147041A5 (de) | Fungizide mittel | |
| CS219299B2 (en) | Fungicide means and method of making the active substance | |
| EP0108995B1 (de) | Hydroxyalkinyl-azolyl-Derivate | |
| PL120444B1 (en) | Fungicide | |
| DE2944223A1 (de) | Fungizide entriazole, ihre herstellung und verwendung | |
| US4021482A (en) | Sulfinyl or sulfonyl-1-chloroacrylic acid amides | |
| CS219858B2 (en) | Fungicide means and method of making the active substances | |
| EP0173918A2 (de) | Substituierte Phenylsulfonylazole | |
| PL96760B1 (pl) | Srodek grzybobojczy | |
| US5240952A (en) | Fungicidal agents | |
| PL106362B1 (pl) | Srodek grzybobojczy | |
| DE3314738A1 (de) | Azolylethyl-benzyl-ether-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| DE2931665A1 (de) | Imidazolyl-enolether, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| EP0123179B1 (de) | Phosphorylierte Azolyl-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |