IL12811A - interlaced yarns and their preparation - Google Patents
interlaced yarns and their preparationInfo
- Publication number
- IL12811A IL12811A IL1281159A IL1281159A IL12811A IL 12811 A IL12811 A IL 12811A IL 1281159 A IL1281159 A IL 1281159A IL 1281159 A IL1281159 A IL 1281159A IL 12811 A IL12811 A IL 12811A
- Authority
- IL
- Israel
- Prior art keywords
- yarn
- fluid
- interlaced
- filaments
- tension
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 5
- 239000012530 fluid Substances 0.000 claims description 223
- 238000000034 method Methods 0.000 claims description 72
- 230000008569 process Effects 0.000 claims description 59
- 239000000203 mixture Substances 0.000 claims description 10
- 229920002678 cellulose Polymers 0.000 claims description 3
- 239000001913 cellulose Substances 0.000 claims description 2
- 239000004627 regenerated cellulose Substances 0.000 claims 1
- 230000002040 relaxant effect Effects 0.000 description 29
- 238000012360 testing method Methods 0.000 description 23
- 230000000694 effects Effects 0.000 description 20
- -1 poly(hexa-methylene adipamide) Polymers 0.000 description 19
- 230000001965 increasing effect Effects 0.000 description 17
- 238000004804 winding Methods 0.000 description 14
- 238000004806 packaging method and process Methods 0.000 description 11
- 239000000523 sample Substances 0.000 description 10
- 230000008901 benefit Effects 0.000 description 9
- 239000004753 textile Substances 0.000 description 9
- 230000007423 decrease Effects 0.000 description 8
- 230000003247 decreasing effect Effects 0.000 description 8
- 230000009471 action Effects 0.000 description 7
- 238000009987 spinning Methods 0.000 description 7
- 239000004952 Polyamide Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 230000006872 improvement Effects 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 230000002093 peripheral effect Effects 0.000 description 6
- 239000004677 Nylon Substances 0.000 description 5
- 229920002301 cellulose acetate Polymers 0.000 description 5
- 229920001778 nylon Polymers 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- 230000015556 catabolic process Effects 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 230000001976 improved effect Effects 0.000 description 4
- 230000003993 interaction Effects 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- 238000009941 weaving Methods 0.000 description 4
- 241001589086 Bellapiscis medius Species 0.000 description 3
- 229920002302 Nylon 6,6 Polymers 0.000 description 3
- 238000000429 assembly Methods 0.000 description 3
- 230000000712 assembly Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 230000002939 deleterious effect Effects 0.000 description 3
- 238000013461 design Methods 0.000 description 3
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 3
- 238000009940 knitting Methods 0.000 description 3
- 238000012423 maintenance Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- 230000008093 supporting effect Effects 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- 238000011144 upstream manufacturing Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- 238000007664 blowing Methods 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000009954 braiding Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 230000001747 exhibiting effect Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000001788 irregular Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 101150041326 air-2 gene Proteins 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000005553 drilling Methods 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 238000012858 packaging process Methods 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 230000000644 propagated effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000001502 supplementing effect Effects 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- DJZKNOVUNYPPEE-UHFFFAOYSA-N tetradecane-1,4,11,14-tetracarboxamide Chemical compound NC(=O)CCCC(C(N)=O)CCCCCCC(C(N)=O)CCCC(N)=O DJZKNOVUNYPPEE-UHFFFAOYSA-N 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D02—YARNS; MECHANICAL FINISHING OF YARNS OR ROPES; WARPING OR BEAMING
- D02G—CRIMPING OR CURLING FIBRES, FILAMENTS, THREADS, OR YARNS; YARNS OR THREADS
- D02G1/00—Producing crimped or curled fibres, filaments, yarns, or threads, giving them latent characteristics
- D02G1/16—Producing crimped or curled fibres, filaments, yarns, or threads, giving them latent characteristics using jets or streams of turbulent gases, e.g. air, steam
-
- D—TEXTILES; PAPER
- D02—YARNS; MECHANICAL FINISHING OF YARNS OR ROPES; WARPING OR BEAMING
- D02G—CRIMPING OR CURLING FIBRES, FILAMENTS, THREADS, OR YARNS; YARNS OR THREADS
- D02G1/00—Producing crimped or curled fibres, filaments, yarns, or threads, giving them latent characteristics
- D02G1/02—Producing crimped or curled fibres, filaments, yarns, or threads, giving them latent characteristics by twisting, fixing the twist and backtwisting, i.e. by imparting false twist
- D02G1/0206—Producing crimped or curled fibres, filaments, yarns, or threads, giving them latent characteristics by twisting, fixing the twist and backtwisting, i.e. by imparting false twist by false-twisting
- D02G1/024—Producing crimped or curled fibres, filaments, yarns, or threads, giving them latent characteristics by twisting, fixing the twist and backtwisting, i.e. by imparting false twist by false-twisting with provision for imparting irregular effects to the yarn
-
- D—TEXTILES; PAPER
- D02—YARNS; MECHANICAL FINISHING OF YARNS OR ROPES; WARPING OR BEAMING
- D02G—CRIMPING OR CURLING FIBRES, FILAMENTS, THREADS, OR YARNS; YARNS OR THREADS
- D02G1/00—Producing crimped or curled fibres, filaments, yarns, or threads, giving them latent characteristics
- D02G1/02—Producing crimped or curled fibres, filaments, yarns, or threads, giving them latent characteristics by twisting, fixing the twist and backtwisting, i.e. by imparting false twist
- D02G1/04—Devices for imparting false twist
-
- D—TEXTILES; PAPER
- D02—YARNS; MECHANICAL FINISHING OF YARNS OR ROPES; WARPING OR BEAMING
- D02G—CRIMPING OR CURLING FIBRES, FILAMENTS, THREADS, OR YARNS; YARNS OR THREADS
- D02G3/00—Yarns or threads, e.g. fancy yarns; Processes or apparatus for the production thereof, not otherwise provided for
- D02G3/22—Yarns or threads characterised by constructional features, e.g. blending, filament/fibre
- D02G3/26—Yarns or threads characterised by constructional features, e.g. blending, filament/fibre with characteristics dependent on the amount or direction of twist
- D02G3/28—Doubled, plied, or cabled threads
- D02G3/286—Doubled, plied, or cabled threads with alternatively "S" and "Z" direction of twist, e.g. Self-twist process
-
- D—TEXTILES; PAPER
- D02—YARNS; MECHANICAL FINISHING OF YARNS OR ROPES; WARPING OR BEAMING
- D02J—FINISHING OR DRESSING OF FILAMENTS, YARNS, THREADS, CORDS, ROPES OR THE LIKE
- D02J1/00—Modifying the structure or properties resulting from a particular structure; Modifying, retaining, or restoring the physical form or cross-sectional shape, e.g. by use of dies or squeeze rollers
- D02J1/08—Interlacing constituent filaments without breakage thereof, e.g. by use of turbulent air streams
-
- D—TEXTILES; PAPER
- D02—YARNS; MECHANICAL FINISHING OF YARNS OR ROPES; WARPING OR BEAMING
- D02J—FINISHING OR DRESSING OF FILAMENTS, YARNS, THREADS, CORDS, ROPES OR THE LIKE
- D02J1/00—Modifying the structure or properties resulting from a particular structure; Modifying, retaining, or restoring the physical form or cross-sectional shape, e.g. by use of dies or squeeze rollers
- D02J1/22—Stretching or tensioning, shrinking or relaxing, e.g. by use of overfeed and underfeed apparatus, or preventing stretch
- D02J1/222—Stretching in a gaseous atmosphere or in a fluid bed
-
- D—TEXTILES; PAPER
- D02—YARNS; MECHANICAL FINISHING OF YARNS OR ROPES; WARPING OR BEAMING
- D02J—FINISHING OR DRESSING OF FILAMENTS, YARNS, THREADS, CORDS, ROPES OR THE LIKE
- D02J1/00—Modifying the structure or properties resulting from a particular structure; Modifying, retaining, or restoring the physical form or cross-sectional shape, e.g. by use of dies or squeeze rollers
- D02J1/22—Stretching or tensioning, shrinking or relaxing, e.g. by use of overfeed and underfeed apparatus, or preventing stretch
- D02J1/229—Relaxing
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S57/00—Textiles: spinning, twisting, and twining
- Y10S57/908—Jet interlaced or intermingled
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Mechanical Engineering (AREA)
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- Yarns And Mechanical Finishing Of Yarns Or Ropes (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75245158A | 1958-08-01 | 1958-08-01 | |
| US75491258A | 1958-08-12 | 1958-08-12 | |
| US800040A US2990671A (en) | 1958-08-01 | 1959-03-17 | Multiple vortex pneumatic twister and method of producing alternate twist yarn |
| US803731A US3069836A (en) | 1958-08-01 | 1959-04-02 | Yarn relaxation process using fluid jets |
| US97408A US3116588A (en) | 1958-08-01 | 1961-03-14 | Process for preparing stable alternating twist yarn |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL12811A true IL12811A (en) | 1960-07-20 |
Family
ID=27536832
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL1281159A IL12811A (en) | 1958-08-01 | 1959-07-27 | interlaced yarns and their preparation |
Country Status (13)
| Country | Link |
|---|---|
| US (3) | US2990671A (h) |
| AT (1) | AT251454B (h) |
| BE (2) | BE581303A (h) |
| CA (5) | CA642783A (h) |
| CH (2) | CH402686A (h) |
| DE (2) | DE1214825B (h) |
| DK (1) | DK110250C (h) |
| FI (1) | FI42600B (h) |
| FR (2) | FR1242895A (h) |
| GB (2) | GB924089A (h) |
| IL (1) | IL12811A (h) |
| MX (1) | MX70102A (h) |
| NL (3) | NL123772C (h) |
Families Citing this family (110)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3125793A (en) * | 1964-03-24 | Interlaced yarn by multiple utilization of pressurized gas | ||
| US3306023A (en) * | 1967-02-28 | Process for forming twisted fibre assemblies | ||
| US3279164A (en) * | 1959-05-04 | 1966-10-18 | Du Pont | Fluid jet process for twisting yarn |
| US3225534A (en) * | 1961-03-31 | 1965-12-28 | Du Pont | Differential shrinkage yarn |
| US3225533A (en) * | 1961-10-19 | 1965-12-28 | Commw Scient Ind Res Org | Apparatus and process for forming yarns and other twisted assemblies |
| US3079746A (en) * | 1961-10-23 | 1963-03-05 | Du Pont | Fasciated yarn, process and apparatus for producing the same |
| BE625194A (h) * | 1961-11-23 | |||
| DE1282840B (de) * | 1961-11-24 | 1968-11-14 | Eastman Kodak Co | Verfahren zur Herstellung von Schlingengarn |
| BE628584A (h) * | 1962-02-19 | |||
| US3220082A (en) * | 1962-03-29 | 1965-11-30 | Eastman Kodak Co | Jet apparatus for treatment of textile fibers |
| US3120733A (en) * | 1962-07-06 | 1964-02-11 | Du Pont | Process of uniting a plurality of yarns into a network structure and the resulting unitary yarn structures |
| BE638757A (h) * | 1962-10-16 | |||
| US3184820A (en) * | 1963-04-29 | 1965-05-25 | Maurice S Kanbar | Apparatus for orienting the structure of synthetic yarn |
| US3286321A (en) * | 1963-11-22 | 1966-11-22 | Eastman Kodak Co | Method of treating multifilament yarn |
| US3325987A (en) * | 1964-12-24 | 1967-06-20 | Stevens & Co Inc J P | Textured textile material |
| US3353344A (en) * | 1964-10-13 | 1967-11-21 | Du Pont | Fluid jet twister |
| US3261071A (en) * | 1965-05-25 | 1966-07-19 | Du Pont | Yarn treating jet |
| US3303639A (en) * | 1965-06-23 | 1967-02-14 | Monsanto Co | Pneumtic false twister |
| US3367100A (en) * | 1965-06-23 | 1968-02-06 | Monsanto Co | Multifilament yarn having individually twisted filaments |
| DE1660252A1 (de) * | 1965-07-20 | 1971-04-15 | Ts Lab Przemyslu Dziewiarskieg | Verfahren und Vorrichtung zum Kraeuseln von Garn aus synthetischen Fasern |
| GB1121871A (en) * | 1965-08-23 | 1968-07-31 | Ici Ltd | Treatment of oriented crystalline polyester filaments |
| DE1435749A1 (de) * | 1965-08-26 | 1969-03-20 | Zinser Textilmaschinen Gmbh | Heizrohr zum Waermebehandein von Garnen |
| GB1141509A (en) * | 1965-10-27 | 1969-01-29 | Wool Ind Res Association | A method and device for handling an end of yarn or roving |
| US3333313A (en) * | 1965-12-06 | 1967-08-01 | Fmc Corp | Filament interlacing apparatus |
| US3403501A (en) * | 1966-07-15 | 1968-10-01 | Nuval Co | Yarn-treatment, method and apparatus |
| US3412546A (en) * | 1966-09-30 | 1968-11-26 | Celanese Corp | Interleaved moulinee yarn |
| CH471917A (fr) * | 1966-11-17 | 1969-04-30 | Torsellini Renato | Procedimento e dispositivo per la produzione di fili artificiali e sintetici a bave intrecciate, e prodotto relativo |
| FR1526082A (fr) * | 1967-03-29 | 1968-05-24 | Csf | Ligne à retard dispersive à section tubulaire |
| US3434275A (en) * | 1967-04-26 | 1969-03-25 | Stanley Backer | Alternate twist yarns and method of forming same |
| DE1760520A1 (de) * | 1967-06-06 | 1972-04-20 | Unitika Ltd | Verfahren zur Herstellung von Garnen auf pneumatischem Wege und Vorrichtung zu seiner Durchfuehrung |
| DE1660346C2 (de) * | 1967-06-19 | 1984-04-05 | Enka Ag, 5600 Wuppertal | Vorrichtung zur Behandlung eines laufenden Fadens mit einem strömendem Medium |
| GB1223260A (en) * | 1967-07-13 | 1971-02-24 | Nelson Silk Ltd | Method of and apparatus for making a yarn of interlaced filaments |
| GB1223259A (en) * | 1967-07-13 | 1971-02-24 | Nelson Silk Ltd | A method of and apparatus for making and interlaced yarn |
| US3488939A (en) * | 1967-08-09 | 1970-01-13 | Commw Scient Ind Res Org | Twisted thread assemblies |
| US3478398A (en) * | 1967-09-25 | 1969-11-18 | Monsanto Co | Yarn jet apparatus |
| US3422516A (en) * | 1967-09-25 | 1969-01-21 | Monsanto Co | Yarn-treating process |
| US3455096A (en) * | 1968-03-27 | 1969-07-15 | Allied Chem | Method and apparatus for uniform entanglement of multifilament yarn |
| US4005566A (en) * | 1968-07-16 | 1977-02-01 | E. I. Du Pont De Nemours And Company | Process and apparatus for imparting coherence to tow |
| US3468120A (en) * | 1968-07-30 | 1969-09-23 | Du Pont | Method of producing alternate twist yarn |
| US3589120A (en) * | 1968-11-29 | 1971-06-29 | Ici Ltd | Process for winding polyamide yarn packages with tapered end-portions |
| US3525134A (en) * | 1969-02-17 | 1970-08-25 | Du Pont | Yarn fluid treating apparatus |
| US3636601A (en) * | 1969-06-23 | 1972-01-25 | Monsanto Co | Regularly tangled compact yarn process |
| US3762142A (en) * | 1970-03-03 | 1973-10-02 | O Rasmussen | Yarnlike product kept together by circumjacent polymer material, and a method and an apparatus for producing said product |
| US3857230A (en) * | 1970-04-02 | 1974-12-31 | O Rasmussen | Yarnlike product with spaced polymer rings |
| US3683608A (en) * | 1970-04-30 | 1972-08-15 | Michel Buzano | Fluid texturizing apparatus and method of use |
| GB1344491A (en) * | 1970-06-10 | 1974-01-23 | Snam Progetti | Process for the production of yarns apparatus suitable for releasing the same and yarns obtainable thereby |
| US3707837A (en) * | 1970-07-30 | 1973-01-02 | J Gibbon | Fibrillation process |
| US3727392A (en) * | 1970-07-30 | 1973-04-17 | Fiber Industries Inc | Fibrillation jet |
| US3775955A (en) * | 1971-07-30 | 1973-12-04 | Bigelow Sanford Inc | Composite false-twist yarns, methods and apparatus |
| US3748844A (en) * | 1971-08-04 | 1973-07-31 | Du Pont | Polyester yarn |
| GB1381937A (en) * | 1972-06-27 | 1975-01-29 | Ici Ltd | Composite yarns and methods for their manufacture |
| US3824778A (en) * | 1972-09-25 | 1974-07-23 | Burlington Industries Inc | Heating procedure in a false twist texturizing process |
| JPS4987861A (h) * | 1972-12-29 | 1974-08-22 | ||
| USRE31376E (en) * | 1973-06-11 | 1983-09-13 | Bigelow-Sanford, Inc. | Yarn structure and method for producing same |
| US3846968A (en) * | 1973-06-11 | 1974-11-12 | Bigelow Sanford Inc | Yarn structure and method for producing same |
| CH563303A5 (h) * | 1973-09-26 | 1975-06-30 | Zellweger Uster Ag | |
| US4051660A (en) * | 1974-07-15 | 1977-10-04 | Akzona Incorported | Yarns and their method of manufacture |
| US3944071A (en) * | 1974-09-12 | 1976-03-16 | E. I. Du Pont De Nemours & Co. | Filamentary tow package and method for making |
| US4003195A (en) * | 1974-09-12 | 1977-01-18 | E. I. Du Pont De Nemours And Company | Filamentary tow packaging method |
| US4003974A (en) * | 1975-04-04 | 1977-01-18 | E. I. Du Pont De Nemours And Company | Continuous spin-drawing process for preparing polyethylene terephthalate yarns |
| JPS51130334A (en) * | 1975-05-06 | 1976-11-12 | Murata Machinery Ltd | Apparatus for making spun yarns |
| GB1554763A (en) * | 1975-06-11 | 1979-10-31 | Toray Industries | Texured polyester yarns and process for the production thereof |
| JPS5212362A (en) * | 1975-07-18 | 1977-01-29 | Toray Industries | Fluid treatment apparatus |
| SU562595A1 (ru) * | 1975-07-29 | 1977-06-25 | Всесоюзный Научно-Исследовательский Институт Легкого И Текстильного Машиностроения | Устройство дл получени самокрученой пр жи |
| CA1056146A (en) * | 1975-08-29 | 1979-06-12 | E.I. Du Pont De Nemours And Company | Fluid process for making continuous filament heather yarn |
| US4096685A (en) * | 1975-12-11 | 1978-06-27 | Ppg Industries, Inc. | Method and apparatus for producing slubby yarn |
| US4096687A (en) * | 1977-05-04 | 1978-06-27 | Ppg Industries, Inc. | Method for producing slubbed yarns |
| US4100723A (en) * | 1976-12-09 | 1978-07-18 | Ppg Industries, Inc. | Apparatus for producing slubby yarn |
| US4307497A (en) * | 1977-05-04 | 1981-12-29 | Ppg Industries, Inc. | Method of treating textile yarns |
| US4196574A (en) * | 1978-05-05 | 1980-04-08 | Akzona Incorporated | Composite yarn and method of manufacture |
| JPS5557035A (en) * | 1978-10-20 | 1980-04-26 | Teijin Ltd | False twisted spun yarn and production |
| US4408445A (en) * | 1979-08-31 | 1983-10-11 | Monsanto Company | Twisted singles apparel yarn |
| US4290378A (en) * | 1979-08-31 | 1981-09-22 | Monsanto Company | Twisted singles carpet yarn |
| US4408446A (en) * | 1979-08-31 | 1983-10-11 | Monsanto Company | Singles carpet yarn |
| DE3019302A1 (de) * | 1980-05-21 | 1981-11-26 | Hoechst Ag, 6000 Frankfurt | Verwirbelungsduese |
| US4554121A (en) * | 1980-08-18 | 1985-11-19 | Akzona Incorporated | Method of forming latent-contractable elastomeric composite yarns |
| FR2533235A1 (fr) * | 1982-09-17 | 1984-03-23 | Asa Sa | Procede et installation pour la texturation d'un fil, notamment par fausse torsion |
| DE3341474A1 (de) * | 1982-11-19 | 1984-05-24 | Barmag Barmer Maschinenfabrik Ag, 5630 Remscheid | Vorrichtung zum umspinnen eines spinnfaserstrangs mit spinnfasern |
| JPS5994637A (ja) * | 1982-11-22 | 1984-05-31 | 帝人株式会社 | 仮撚捲縮糸 |
| DE3328477A1 (de) * | 1983-08-06 | 1985-02-21 | Neumünstersche Maschinen- und Apparatebau GmbH (Neumag), 2350 Neumünster | Verfahren und anordnung zur herstellung eines ungezwirnten kraeuselgarns aus mindestens zwei fadenbuendeln unterschiedlicher farbe oder faerbbarkeit |
| EP0137088A1 (fr) * | 1983-10-13 | 1985-04-17 | Société dite: ASA S.A. (société anonyme) | Procédé et installation pour la texturation d'un fil, notamment par fausse torsion |
| US4546043A (en) * | 1984-01-18 | 1985-10-08 | Teijin Limited | Hollow irregular multifilament yarn and process and spinneret for producing the same |
| US4529655A (en) * | 1984-05-23 | 1985-07-16 | E. I. Du Pont De Nemours And Company | Interlaced polyester industrial yarns |
| US4622187A (en) * | 1984-05-23 | 1986-11-11 | E. I. Du Pont De Nemours And Company | Continuous process for making interlaced polyester yarns |
| EP0216951B1 (de) * | 1985-10-04 | 1989-07-26 | Karl Mayer Textilmaschinenfabrik GmbH | Vorrichtung zum Verwirbeln von multifilen Fäden |
| DE3616196A1 (de) * | 1986-05-14 | 1987-11-19 | Seydel Spinnereimasch | Verfahren und vorrichtung zum verflechten von faserbaendern |
| JPS63175135A (ja) * | 1987-01-08 | 1988-07-19 | 曙ブレーキ工業株式会社 | 非アスベスト系摩擦材用基材の製造方法 |
| US5179827A (en) * | 1988-04-15 | 1993-01-19 | E. I. Du Pont De Nemours And Company | Alternate twist plied yarn |
| US5054174A (en) * | 1988-12-13 | 1991-10-08 | Barmag Ag | Method of producing an air textured yarn |
| DE4004721C2 (de) * | 1988-12-13 | 2002-09-26 | Staehle Gmbh H | Verfahren zur Herstellung eines lufttexturierten Fadens |
| US4977739A (en) * | 1989-06-26 | 1990-12-18 | Du Pont Canada Inc. | Method and apparatus for making composite yarn |
| US5147721A (en) * | 1989-07-07 | 1992-09-15 | Hexcel Corporation | Ceramic reinforced glass matrix |
| DE59101250D1 (de) * | 1990-02-15 | 1994-05-05 | Barmag Barmer Maschf | Verfahren zur Herstellung eines lufttexturierten Fadens. |
| DE4013946A1 (de) * | 1990-04-30 | 1991-10-31 | Hoechst Ag | Verwirbeltes multifilamentgarn aus hochmodul-einzelfilamenten und verfahren zum herstellen eines solchen garnes |
| US5275618A (en) * | 1991-11-13 | 1994-01-04 | United States Surgical Corporation | Jet entangled suture yarn and method for making same |
| CH687086A5 (de) * | 1993-05-11 | 1996-09-13 | Heberlein & Co Ag | Vorrichtung zum Behandeln wenigstens eines laufenden Multifilamentgarns. |
| TW317578B (h) * | 1994-03-01 | 1997-10-11 | Heberlein & Co Ag | |
| DE19605675C5 (de) * | 1996-02-15 | 2010-06-17 | Oerlikon Heberlein Temco Wattwil Ag | Verfahren zum aerodynamischen Texturieren sowie Texturierdüse |
| US5746046A (en) * | 1996-08-05 | 1998-05-05 | Guilford Mills, Inc. | Method for forming comingled composite yarn |
| US6089009A (en) | 1997-08-28 | 2000-07-18 | Belmont Textile Machinery Co., Inc. | Fluid-jet false-twisting method and product |
| US6052878A (en) * | 1999-05-28 | 2000-04-25 | E. I. Du Pont De Nemours And Company | Methods and apparatus for interlacing filaments and methods of making the apparatus |
| US7083853B2 (en) | 1999-06-14 | 2006-08-01 | E. I. Du Pont De Nemours And Company | Stretch break method and product |
| US7100246B1 (en) | 1999-06-14 | 2006-09-05 | E. I. Du Pont De Nemours And Company | Stretch break method and product |
| WO2005085504A1 (en) | 2004-02-27 | 2005-09-15 | E.I. Dupont De Nemours And Company | Spun yarn, and method and apparatus for the manufacture thereof |
| WO2013124177A1 (en) * | 2012-02-20 | 2013-08-29 | Teijin Aramid B.V. | Method and apparatus for entangling yarns |
| CN103849966A (zh) * | 2012-11-29 | 2014-06-11 | 宁波双盾纺织帆布实业有限公司 | 一种棉、羊绒纤维工艺 |
| JP2016079540A (ja) * | 2014-10-21 | 2016-05-16 | 村田機械株式会社 | 芯糸供給装置及び紡績機 |
| CN105200599A (zh) * | 2015-10-30 | 2015-12-30 | 太仓市璜泾镇佳梦化纤厂 | 一种吸湿透气耐用舒适混纺纤维 |
| CN109056133A (zh) * | 2018-08-03 | 2018-12-21 | 上海纺织(集团)大丰纺织有限公司 | 一种柞蚕丝纱线及其纺纱工艺 |
| FI20236404A1 (en) * | 2023-12-20 | 2025-06-21 | Spinnova Oyj | Apparatus and method for providing a compressed filament bundle |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA554149A (en) * | 1958-03-11 | Courtaulds Limited | Treatment of threads | |
| CA554150A (en) * | 1958-03-11 | A. Hartley Kenneth | Treatment of threads | |
| BE547297A (h) * | ||||
| US984195A (en) * | 1910-02-04 | 1911-02-14 | Joseph Cooper | Sliver-funnel for textile machinery. |
| GB355447A (en) * | 1930-07-10 | 1931-08-27 | Kurt Prosswimmer | Improvements in or relating to patterned, doubled thread |
| FR739071A (fr) * | 1932-06-25 | 1933-01-05 | Textiles Synthetiques Sa Des | Produits textiles ainsi que les procédés et appareils pour leur fabrication |
| NL42341C (h) * | 1935-01-30 | |||
| US2399258A (en) * | 1943-03-20 | 1946-04-30 | American Viscose Corp | Novel filamentous product and method of making it |
| US2463620A (en) * | 1946-01-21 | 1949-03-08 | Heberlein Patent Corp | Apparatus and process for crimping |
| FR946205A (fr) * | 1947-04-25 | 1949-05-27 | Louis Antoine Billion | Procédé de traitement de fils à base de superpolyamides, nouveaux fils et nouveaux produits obtenus avec ces fils |
| BE485558A (h) * | 1947-11-12 | 1900-01-01 | ||
| US2515299A (en) * | 1948-10-19 | 1950-07-18 | Us Rubber Co | Apparatus for imparting false twist to strands |
| US2783609A (en) * | 1951-12-14 | 1957-03-05 | Du Pont | Bulky continuous filament yarn |
| CH321465A (de) * | 1951-12-14 | 1957-05-15 | Du Pont | Voluminöses Garn sowie Verfahren zu seiner Herstellung und Einrichtung zur Durchführung des Verfahrens |
| US2846839A (en) * | 1953-05-18 | 1958-08-12 | Billion & Cie Soc | Snag resistant bulky multi-ply superpolymidic yarn |
| US2761272A (en) * | 1953-06-19 | 1956-09-04 | Chavanoz Moulinage Retorderie | Apparatus for producing curled yarn |
| US2815559A (en) * | 1953-08-03 | 1957-12-10 | Robinson Thread Company | Cellular synthetic fibre thread and a method of making the same |
| US2823514A (en) * | 1954-06-11 | 1958-02-18 | Chavanoz Moulinage Retorderie | Apparatus for producing curled yarn |
| FR1154315A (fr) * | 1955-08-03 | 1958-04-04 | Onderzoekings Inst Res | Appareil et procédé pour fabriquer des filaments bouclés et produits obtenus par ces moyens |
| CH325048A (de) * | 1956-02-08 | 1957-10-31 | Patentex Inc | Garn aus thermoplastischem Material, Verfahren zu seiner Herstellung und Verwendung dieses Garnes |
| US2751747A (en) * | 1956-02-08 | 1956-06-26 | Patentex Inc | Process of producing dual twist yarn |
| US2807863A (en) * | 1956-06-22 | 1957-10-01 | Du Pont | Multi-step stretching of nylon cords |
| FR1178980A (fr) * | 1956-07-16 | 1959-05-19 | Du Pont | Procédé de tordage à jet de fluide, appareil destiné à cet effet, et produits obtenus |
| US2869967A (en) * | 1957-08-23 | 1959-01-20 | Du Pont | Bulky yarn |
-
0
- CA CA661606A patent/CA661606A/en not_active Expired
- CA CA655087A patent/CA655087A/en not_active Expired
- CA CA644282A patent/CA644282A/en not_active Expired
- MX MX70102D patent/MX70102A/es unknown
- CA CA646726A patent/CA646726A/en not_active Expired
- CA CA642783A patent/CA642783A/en not_active Expired
-
1955
- 1955-08-01 BE BE581303A patent/BE581303A/fr unknown
-
1959
- 1959-03-17 US US800040A patent/US2990671A/en not_active Expired - Lifetime
- 1959-04-02 US US803731A patent/US3069836A/en not_active Expired - Lifetime
- 1959-07-27 IL IL1281159A patent/IL12811A/en unknown
- 1959-07-30 GB GB26230/59A patent/GB924089A/en not_active Expired
- 1959-07-30 CH CH7639159A patent/CH402686A/de unknown
- 1959-07-30 GB GB26229/59A patent/GB924088A/en not_active Expired
- 1959-07-31 NL NL241891A patent/NL123772C/nl active
- 1959-07-31 DK DK275659AA patent/DK110250C/da active
- 1959-08-01 AT AT567059A patent/AT251454B/de active
- 1959-08-01 DE DEP23297A patent/DE1214825B/de active Pending
- 1959-08-01 NL NL241927A patent/NL126927C/nl active
- 1959-08-01 FR FR801805A patent/FR1242895A/fr not_active Expired
- 1959-08-01 BE BE581302A patent/BE581302A/fr unknown
- 1959-08-01 CH CH7648359A patent/CH386615A/de unknown
- 1959-08-01 FR FR801804A patent/FR1235718A/fr not_active Expired
- 1959-08-01 DE DE19591410636 patent/DE1410636A1/de active Pending
-
1961
- 1961-03-14 US US97408A patent/US3116588A/en not_active Expired - Lifetime
-
1967
- 1967-03-21 NL NL6704202A patent/NL6704202A/nl unknown
- 1967-09-05 FI FI2387/67A patent/FI42600B/fi active
Also Published As
| Publication number | Publication date |
|---|---|
| CH402686A (de) | 1965-11-15 |
| CA655087A (en) | 1963-01-01 |
| AT251454B (de) | 1967-01-10 |
| US2990671A (en) | 1961-07-04 |
| FR1242895A (fr) | 1960-10-07 |
| GB924089A (en) | 1963-04-24 |
| CA642783A (en) | 1962-06-12 |
| BE581303A (fr) | 1960-02-01 |
| NL123772C (nl) | 1967-11-15 |
| DE1410636A1 (de) | 1968-10-10 |
| BE581302A (fr) | 1960-02-01 |
| NL126927C (nl) | 1969-08-15 |
| CA661606A (en) | 1963-04-16 |
| US3069836A (en) | 1962-12-25 |
| DE1214825B (de) | 1966-04-21 |
| NL6704202A (nl) | 1967-07-25 |
| CH386615A (de) | 1965-01-15 |
| FR1235718A (fr) | 1960-07-08 |
| US3116588A (en) | 1964-01-07 |
| MX70102A (h) | |
| CA644282A (en) | 1962-07-03 |
| FI42600B (fi) | 1970-06-01 |
| DK110250C (da) | 1975-08-04 |
| CA646726A (en) | 1962-08-14 |
| NL241891A (nl) | 1967-10-16 |
| GB924088A (en) | 1963-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL12811A (en) | interlaced yarns and their preparation | |
| US2985995A (en) | Compact interlaced yarn | |
| US3110151A (en) | Process for producing compact interlaced yarn | |
| US3279164A (en) | Fluid jet process for twisting yarn | |
| US3309855A (en) | Process and apparatus for producing bulked plied yarn | |
| US3009309A (en) | Fluid jet twist crimping process | |
| US3079745A (en) | Fluid twiste apparatus for twisting yarn | |
| US3364537A (en) | Apparatus for interlacing multifilament yarn | |
| US3022566A (en) | False twisted yarn beam | |
| US3973386A (en) | Process for texturing polyester yarn | |
| US3091913A (en) | Variable denier composite yarn | |
| US3365874A (en) | Treatment of synthetic filaments | |
| US3083523A (en) | Twistless, heat relaxed interlaced yarn | |
| US3427647A (en) | Wrapped yarn product and process for preparing wrapped yarns | |
| US6076345A (en) | Method and apparatus for generating a yarn composed of at least two yarn components | |
| US3453709A (en) | Apparatus for treating filamentary material | |
| US4170867A (en) | Spun-like continuous multifilament yarn | |
| US3433007A (en) | Slub yarn process and product | |
| US4464894A (en) | Spun-like continuous multifilament yarn | |
| USRE27717E (en) | Fluid jet process for twisting yarn | |
| US3271943A (en) | Process for stabilizing bulked yarns and product thereof | |
| US4035883A (en) | Multipurpose intermingling jet and process | |
| US4247505A (en) | Melt spinning of polymers | |
| US3529413A (en) | Drawn intermingled yarn | |
| US3462813A (en) | Method of producing volumized yarn |