HU230218B1 - Szubsztituált tién-3-il-szulfonilamino(tio)karbonil-triazolin-(ti)onokon és széfenereken alapuló szelektív herbicidek - Google Patents
Szubsztituált tién-3-il-szulfonilamino(tio)karbonil-triazolin-(ti)onokon és széfenereken alapuló szelektív herbicidek Download PDFInfo
- Publication number
- HU230218B1 HU230218B1 HU0402116A HUP0402116A HU230218B1 HU 230218 B1 HU230218 B1 HU 230218B1 HU 0402116 A HU0402116 A HU 0402116A HU P0402116 A HUP0402116 A HU P0402116A HU 230218 B1 HU230218 B1 HU 230218B1
- Authority
- HU
- Hungary
- Prior art keywords
- alkyl
- optionally
- substituted
- ethyl
- group
- Prior art date
Links
- 239000004009 herbicide Substances 0.000 title description 6
- -1 alboxy Chemical group 0.000 claims description 121
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 64
- 125000004432 carbon atom Chemical group C* 0.000 claims description 57
- 150000001875 compounds Chemical class 0.000 claims description 55
- 125000001153 fluoro group Chemical group F* 0.000 claims description 55
- 125000000217 alkyl group Chemical group 0.000 claims description 48
- 239000000460 chlorine Substances 0.000 claims description 48
- 229910052801 chlorine Inorganic materials 0.000 claims description 47
- 229910052731 fluorine Inorganic materials 0.000 claims description 45
- 239000011737 fluorine Substances 0.000 claims description 45
- 229910052739 hydrogen Inorganic materials 0.000 claims description 43
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 39
- 239000001257 hydrogen Substances 0.000 claims description 37
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 33
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 29
- 125000003545 alkoxy group Chemical group 0.000 claims description 27
- 229910052794 bromium Inorganic materials 0.000 claims description 27
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 26
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 26
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 25
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 24
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 23
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 22
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 22
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 18
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 18
- 229910052799 carbon Inorganic materials 0.000 claims description 17
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 15
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 14
- 229910052736 halogen Inorganic materials 0.000 claims description 14
- 239000000843 powder Substances 0.000 claims description 14
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 13
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 13
- 125000001424 substituent group Chemical group 0.000 claims description 13
- QWWHRELOCZEQNZ-UHFFFAOYSA-N 2,2-dichloro-1-(1-oxa-4-azaspiro[4.5]decan-4-yl)ethanone Chemical compound ClC(Cl)C(=O)N1CCOC11CCCCC1 QWWHRELOCZEQNZ-UHFFFAOYSA-N 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 11
- 125000001246 bromo group Chemical group Br* 0.000 claims description 11
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 238000009472 formulation Methods 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 230000002363 herbicidal effect Effects 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 229910052698 phosphorus Inorganic materials 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 239000011593 sulfur Chemical group 0.000 claims description 5
- 125000004434 sulfur atom Chemical group 0.000 claims description 5
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 claims description 4
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 4
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 4
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 4
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 4
- 150000001721 carbon Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 239000000194 fatty acid Substances 0.000 claims description 4
- 229930195729 fatty acid Natural products 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 3
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 3
- 206010029897 Obsessive thoughts Diseases 0.000 claims description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 claims description 3
- 150000004665 fatty acids Chemical class 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000005109 alkynylthio group Chemical group 0.000 claims description 2
- 230000036528 appetite Effects 0.000 claims description 2
- 235000019789 appetite Nutrition 0.000 claims description 2
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 claims description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004783 dichloromethoxy group Chemical group ClC(O*)Cl 0.000 claims description 2
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 2
- 125000006125 ethylsulfonyl group Chemical group 0.000 claims description 2
- 239000000945 filler Substances 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 230000029305 taxis Effects 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 12
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims 3
- 239000001294 propane Substances 0.000 claims 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 claims 2
- 239000004305 biphenyl Substances 0.000 claims 2
- 235000010290 biphenyl Nutrition 0.000 claims 2
- 229910052796 boron Inorganic materials 0.000 claims 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims 2
- 125000006437 ethyl cyclopropyl group Chemical group 0.000 claims 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims 2
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims 2
- CKJSNZAKSPJLJC-MBMOQRBOSA-N (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-nitrohexan-1-one Chemical compound [N+](=O)([O-])C(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO CKJSNZAKSPJLJC-MBMOQRBOSA-N 0.000 claims 1
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims 1
- 125000006728 (C1-C6) alkynyl group Chemical group 0.000 claims 1
- QFMDFTQOJHFVNR-UHFFFAOYSA-N 1-[2,2-dichloro-1-(4-ethylphenyl)ethyl]-4-ethylbenzene Chemical compound C1=CC(CC)=CC=C1C(C(Cl)Cl)C1=CC=C(CC)C=C1 QFMDFTQOJHFVNR-UHFFFAOYSA-N 0.000 claims 1
- 125000001054 5 membered carbocyclic group Chemical group 0.000 claims 1
- 125000004008 6 membered carbocyclic group Chemical group 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims 1
- 102220567177 Ornithine decarboxylase antizyme 1_H73Y_mutation Human genes 0.000 claims 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims 1
- 229910052776 Thorium Inorganic materials 0.000 claims 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- UXXVKDDXBCOQHG-UHFFFAOYSA-M [Cl-].[Cr+] Chemical compound [Cl-].[Cr+] UXXVKDDXBCOQHG-UHFFFAOYSA-M 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 125000003302 alkenyloxy group Chemical group 0.000 claims 1
- 125000005108 alkenylthio group Chemical group 0.000 claims 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims 1
- 125000005037 alkyl phenyl group Chemical group 0.000 claims 1
- 125000005133 alkynyloxy group Chemical group 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 125000006267 biphenyl group Chemical group 0.000 claims 1
- 238000009835 boiling Methods 0.000 claims 1
- 239000012267 brine Substances 0.000 claims 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 1
- 125000000837 carbohydrate group Chemical group 0.000 claims 1
- 125000006310 cycloalkyl amino group Chemical group 0.000 claims 1
- 125000006312 cyclopentyl amino group Chemical group [H]N(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 1
- 230000003111 delayed effect Effects 0.000 claims 1
- 125000004188 dichlorophenyl group Chemical group 0.000 claims 1
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 claims 1
- 239000000428 dust Substances 0.000 claims 1
- 239000003864 humus Substances 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 claims 1
- WPFVBOQKRVRMJB-UHFFFAOYSA-N hydroxycitronellal Chemical compound O=CCC(C)CCCC(C)(C)O WPFVBOQKRVRMJB-UHFFFAOYSA-N 0.000 claims 1
- 150000002500 ions Chemical class 0.000 claims 1
- 235000012054 meals Nutrition 0.000 claims 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 1
- YUUWVCDKDHHAFI-UHFFFAOYSA-N n-sulfanylhydroxylamine Chemical group ONS YUUWVCDKDHHAFI-UHFFFAOYSA-N 0.000 claims 1
- 150000002826 nitrites Chemical class 0.000 claims 1
- 125000005188 oxoalkyl group Chemical group 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 125000004437 phosphorous atom Chemical group 0.000 claims 1
- 230000003389 potentiating effect Effects 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 claims 1
- 125000005017 substituted alkenyl group Chemical group 0.000 claims 1
- 125000003107 substituted aryl group Chemical group 0.000 claims 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims 1
- 235000013616 tea Nutrition 0.000 claims 1
- 125000000335 thiazolyl group Chemical group 0.000 claims 1
- 125000004001 thioalkyl group Chemical group 0.000 claims 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 16
- 230000012447 hatching Effects 0.000 description 16
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 12
- 240000005979 Hordeum vulgare Species 0.000 description 11
- 235000007340 Hordeum vulgare Nutrition 0.000 description 10
- 241000209140 Triticum Species 0.000 description 10
- 235000021307 Triticum Nutrition 0.000 description 10
- 239000004480 active ingredient Substances 0.000 description 9
- 240000008042 Zea mays Species 0.000 description 8
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 8
- 238000007689 inspection Methods 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 238000005507 spraying Methods 0.000 description 6
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 5
- 235000005822 corn Nutrition 0.000 description 5
- 239000000975 dye Substances 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 239000002585 base Substances 0.000 description 4
- 244000038559 crop plants Species 0.000 description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 239000004088 foaming agent Substances 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 229910002091 carbon monoxide Inorganic materials 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 235000009973 maize Nutrition 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- FYGHSUNMUKGBRK-UHFFFAOYSA-N 1,2,3-trimethylbenzene Chemical compound CC1=CC=CC(C)=C1C FYGHSUNMUKGBRK-UHFFFAOYSA-N 0.000 description 2
- MCNOFYBITGAAGM-UHFFFAOYSA-N 2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone Chemical compound C1N(C(=O)C(Cl)Cl)C(C)(C)OC1C1=CC=CO1 MCNOFYBITGAAGM-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 241001024304 Mino Species 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 241000405217 Viola <butterfly> Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 239000003849 aromatic solvent Substances 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000037213 diet Effects 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 2
- 125000004438 haloalkoxy group Chemical group 0.000 description 2
- 210000003128 head Anatomy 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 235000013336 milk Nutrition 0.000 description 2
- 239000008267 milk Substances 0.000 description 2
- 210000004080 milk Anatomy 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 2
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 210000002435 tendon Anatomy 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- BFTGQIQVUVTBJU-UHFFFAOYSA-N 5,6-dihydroimidazo[2,1-c][1,2,4]dithiazole-3-thione Chemical compound C1CN2C(=S)SSC2=N1 BFTGQIQVUVTBJU-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000272814 Anser sp. Species 0.000 description 1
- 235000005340 Asparagus officinalis Nutrition 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 101150020786 CHGB gene Proteins 0.000 description 1
- 241000132570 Centaurea Species 0.000 description 1
- 240000004385 Centaurea cyanus Species 0.000 description 1
- 235000005940 Centaurea cyanus Nutrition 0.000 description 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 1
- XYZZJOZOPGGIJR-UHFFFAOYSA-N ClBr(=O)=O Chemical compound ClBr(=O)=O XYZZJOZOPGGIJR-UHFFFAOYSA-N 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 235000009414 Elaeocarpus kirtonii Nutrition 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 description 1
- 241000816457 Galeopsis Species 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- LNQCUTNLHUQZLR-VNPYQEQNSA-N Iridin Natural products O(C)c1c(O)c2C(=O)C(c3cc(OC)c(OC)c(O)c3)=COc2cc1O[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@H](CO)O1 LNQCUTNLHUQZLR-VNPYQEQNSA-N 0.000 description 1
- 241001149911 Isopoda Species 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 235000011096 Papaver Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 102100022320 SPRY domain-containing SOCS box protein 1 Human genes 0.000 description 1
- 101710178378 SPRY domain-containing SOCS box protein 1 Proteins 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 239000004113 Sepiolite Substances 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 101710141933 Single-stranded DNA-binding protein 1 Proteins 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 244000236151 Tabebuia pallida Species 0.000 description 1
- 235000013584 Tabebuia pallida Nutrition 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- JZRWCGZRTZMZEH-UHFFFAOYSA-N Thiamine Natural products CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N JZRWCGZRTZMZEH-UHFFFAOYSA-N 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- CHVGJBSUVGBIBE-UHFFFAOYSA-N [Br].OS(O)(=O)=O Chemical compound [Br].OS(O)(=O)=O CHVGJBSUVGBIBE-UHFFFAOYSA-N 0.000 description 1
- ZQRRBZZVXPVWRB-UHFFFAOYSA-N [S].[Se] Chemical compound [S].[Se] ZQRRBZZVXPVWRB-UHFFFAOYSA-N 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 244000193174 agave Species 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000006319 alkynyl amino group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 235000019568 aromas Nutrition 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 238000002419 base digestion Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000021028 berry Nutrition 0.000 description 1
- 235000013361 beverage Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004057 biotinyl group Chemical group [H]N1C(=O)N([H])[C@]2([H])[C@@]([H])(SC([H])([H])[C@]12[H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(*)=O 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- ITOJEBDYSWRTML-UHFFFAOYSA-N carbon tetroxide Chemical compound O=C1OOO1 ITOJEBDYSWRTML-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- 125000004490 chloroalkoxy group Chemical group 0.000 description 1
- 229960001701 chloroform Drugs 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 150000001916 cyano esters Chemical class 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- UMNKXPULIDJLSU-UHFFFAOYSA-N dichlorofluoromethane Chemical compound FC(Cl)Cl UMNKXPULIDJLSU-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000005290 ethynyloxy group Chemical group C(#C)O* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 210000003754 fetus Anatomy 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 230000000762 glandular Effects 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 125000004994 halo alkoxy alkyl group Chemical group 0.000 description 1
- OTTZHAVKAVGASB-UHFFFAOYSA-N hept-2-ene Chemical group CCCCC=CC OTTZHAVKAVGASB-UHFFFAOYSA-N 0.000 description 1
- COYBRKAVBMYYSF-UHFFFAOYSA-N heptan-2-yl [(5-chloroquinolin-8-yl)oxy]acetate Chemical group C1=CN=C2C(OCC(=O)OC(C)CCCCC)=CC=C(Cl)C2=C1 COYBRKAVBMYYSF-UHFFFAOYSA-N 0.000 description 1
- 235000008216 herbs Nutrition 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical class [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000000017 hydrogel Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- AQYSYJUIMQTRMV-UHFFFAOYSA-N hypofluorous acid Chemical compound FO AQYSYJUIMQTRMV-UHFFFAOYSA-N 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 108010047623 iridine Proteins 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- MWKVXOJATACCCH-UHFFFAOYSA-N isoxadifen-ethyl Chemical group C1C(C(=O)OCC)=NOC1(C=1C=CC=CC=1)C1=CC=CC=C1 MWKVXOJATACCCH-UHFFFAOYSA-N 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- OFXSXYCSPVKZPF-UHFFFAOYSA-N methoxyperoxymethane Chemical class COOOC OFXSXYCSPVKZPF-UHFFFAOYSA-N 0.000 description 1
- 125000004492 methyl ester group Chemical group 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 210000002850 nasal mucosa Anatomy 0.000 description 1
- 229940042880 natural phospholipid Drugs 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 125000005825 oxyethoxy group Chemical group [H]C([H])(O[*:1])C([H])([H])O[*:2] 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000010690 paraffinic oil Substances 0.000 description 1
- 235000015927 pasta Nutrition 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000006324 propenyl amino group Chemical group 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000006320 propynyl amino group Chemical group 0.000 description 1
- NIFIFKQPDTWWGU-UHFFFAOYSA-N pyrite Chemical compound [Fe+2].[S-][S-] NIFIFKQPDTWWGU-UHFFFAOYSA-N 0.000 description 1
- 229910052683 pyrite Inorganic materials 0.000 description 1
- 239000011028 pyrite Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000003507 refrigerant Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 235000002020 sage Nutrition 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229910052624 sepiolite Inorganic materials 0.000 description 1
- 235000019355 sepiolite Nutrition 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 125000004646 sulfenyl group Chemical group S(*)* 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- KYMBYSLLVAOCFI-UHFFFAOYSA-N thiamine Chemical compound CC1=C(CCO)SCN1CC1=CN=C(C)N=C1N KYMBYSLLVAOCFI-UHFFFAOYSA-N 0.000 description 1
- 235000019157 thiamine Nutrition 0.000 description 1
- 229960003495 thiamine Drugs 0.000 description 1
- 239000011721 thiamine Substances 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 125000003652 trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 229960005486 vaccine Drugs 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/38—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the group >N—CO—N< where at least one nitrogen atom is part of a heterocyclic ring; Thio analogues thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N25/00—Biocides, pest repellants or attractants, or plant growth regulators, characterised by their forms, or by their non-active ingredients or by their methods of application, e.g. seed treatment or sequential application; Substances for reducing the noxious effect of the active ingredients to organisms other than pests
- A01N25/32—Ingredients for reducing the noxious effect of the active substances to organisms other than pests, e.g. toxicity reducing compositions, self-destructing compositions
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/647—Triazoles; Hydrogenated triazoles
- A01N43/653—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- Agronomy & Crop Science (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Toxicology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUS1600007C HUS1600007I1 (hu) | 2001-09-21 | 2016-01-21 | Szubsztituált tién-3-il-szulfonilamino(tio)karbonil-triazolin-(ti)onokon és széfenereken alapuló szelektív herbicidek |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10146590.4 | 2001-09-21 | ||
| DE10146590A DE10146590A1 (de) | 2001-09-21 | 2001-09-21 | Selektive Herbizide auf Basis von substituierten Thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)onen und Safenern |
| PCT/EP2002/010104 WO2003026427A1 (de) | 2001-09-21 | 2002-09-10 | Selektive herbizide auf basis von substituierten thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)onen und safenern |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HUP0402116A2 HUP0402116A2 (hu) | 2005-01-28 |
| HUP0402116A3 HUP0402116A3 (en) | 2005-10-28 |
| HU230218B1 true HU230218B1 (hu) | 2015-10-28 |
Family
ID=7699812
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU0402116A HU230218B1 (hu) | 2001-09-21 | 2002-09-10 | Szubsztituált tién-3-il-szulfonilamino(tio)karbonil-triazolin-(ti)onokon és széfenereken alapuló szelektív herbicidek |
| HUS1600007C HUS1600007I1 (hu) | 2001-09-21 | 2016-01-21 | Szubsztituált tién-3-il-szulfonilamino(tio)karbonil-triazolin-(ti)onokon és széfenereken alapuló szelektív herbicidek |
| HUS2000029C HUS2000029I1 (hu) | 2001-09-21 | 2020-07-27 | Szubsztituált tién-3-il-szulfonilamino(tio)karbonil-triazolin-(ti)onokon és széfenereken alapuló szelektív herbicidek |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HUS1600007C HUS1600007I1 (hu) | 2001-09-21 | 2016-01-21 | Szubsztituált tién-3-il-szulfonilamino(tio)karbonil-triazolin-(ti)onokon és széfenereken alapuló szelektív herbicidek |
| HUS2000029C HUS2000029I1 (hu) | 2001-09-21 | 2020-07-27 | Szubsztituált tién-3-il-szulfonilamino(tio)karbonil-triazolin-(ti)onokon és széfenereken alapuló szelektív herbicidek |
Country Status (24)
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10146591A1 (de) * | 2001-09-21 | 2003-04-10 | Bayer Cropscience Ag | Herbizide auf Basis von substituierten Thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)onen |
| DE10146590A1 (de) * | 2001-09-21 | 2003-04-10 | Bayer Cropscience Ag | Selektive Herbizide auf Basis von substituierten Thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)onen und Safenern |
| DE10154074A1 (de) * | 2001-11-02 | 2003-05-15 | Bayer Cropscience Ag | Substituierte Thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)one |
| DE102004025220A1 (de) * | 2004-05-22 | 2005-12-08 | Bayer Cropscience Gmbh | Ölsuspensionskonzentrat |
| DE102004010813A1 (de) | 2004-03-05 | 2005-11-10 | Bayer Cropscience Ag | Neue Herbizide auf Basis von substituierten Thien-3-yl-sulfonylamino(thio)carbonyltriazolin(thi)onen und 4-HPPD-Hemmstoffen |
| DE102004010812A1 (de) * | 2004-03-05 | 2005-09-22 | Bayer Cropscience Ag | Unkrautbekämpfungsverfahren |
| DE102004035137A1 (de) * | 2004-07-20 | 2006-02-16 | Bayer Cropscience Gmbh | Wirkstoffe zur Steigerung der Pathogenabwehr in Pflanzen und Methoden zu ihrer Auffindung |
| CN101262772A (zh) * | 2005-09-08 | 2008-09-10 | 拜尔作物科学股份公司 | 新型的含磺酰胺的固体配制剂 |
| WO2007057107A1 (de) | 2005-11-17 | 2007-05-24 | Bayer Cropscience Ag | Wässriges herbizides mittel auf basis eines suspensionskonzentrats enthaltend herbizide und safener |
| EP2071950A1 (de) | 2007-12-20 | 2009-06-24 | Bayer CropScience AG | Verfahren zur Authentizitätsprüfung von Pflanzenschutzmitteln mittels Isotopen |
| CN103980098B (zh) * | 2014-05-16 | 2016-07-13 | 上海康鹏化学有限公司 | 含二氟甲氧醚桥键(cf2o)的单体液晶化合物的制备方法 |
| TW201822637A (zh) * | 2016-11-07 | 2018-07-01 | 德商拜耳廠股份有限公司 | 用於控制動物害蟲的經取代磺醯胺類 |
| AR111838A1 (es) | 2017-05-30 | 2019-08-21 | Arysta Lifescience Inc | Dispersión oleosa herbicida que contiene un fitoprotector |
| MX2022007820A (es) * | 2019-12-27 | 2022-07-19 | Ishihara Sangyo Kaisha | Metodo que aporta beneficios a la salud y/o al crecimiento de plantas utiles. |
| BR102020019868A2 (pt) * | 2020-09-28 | 2022-04-12 | Upl Do Brasil Industria E Comercio De Insumos Agropecuarios S.A. | Combinações de herbicidas triazolonas com fitoprotetores |
| CN118475238A (zh) | 2021-11-11 | 2024-08-09 | 拜耳公司 | 具有高盐含量和低浓度磺酰脲类除草剂的水性农业化学品(作物保护)悬浮液制剂的表面活性剂组合 |
| WO2024200431A1 (en) | 2023-03-31 | 2024-10-03 | Bayer Aktiengesellschaft | Emulsifiable concentrate (ec) formulation with thiencarbazone-methyl |
Family Cites Families (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4415353A (en) * | 1971-04-16 | 1983-11-15 | Stauffer Chemical Company | Herbicide compositions |
| US4137070A (en) * | 1971-04-16 | 1979-01-30 | Stauffer Chemical Company | Herbicide compositions |
| US4708735A (en) * | 1971-04-16 | 1987-11-24 | Stauffer Chemical Co. | Herbicide compositions |
| US4415352A (en) * | 1971-04-16 | 1983-11-15 | Stauffer Chemical Company | Herbicide compositions |
| US4971618A (en) * | 1971-04-16 | 1990-11-20 | Ici Americas Inc. | Herbicide compositions |
| US4269618A (en) * | 1971-12-09 | 1981-05-26 | Stauffer Chemical Company | Herbicide compositions |
| US4021224A (en) * | 1971-12-09 | 1977-05-03 | Stauffer Chemical Company | Herbicide compositions |
| US4186130A (en) * | 1973-05-02 | 1980-01-29 | Stauffer Chemical Company | N-(haloalkanoyl) oxazolidines |
| US4243811A (en) * | 1972-10-13 | 1981-01-06 | Stauffer Chemical Company | 2,2,4-Trimethyl-4-hydroxymethyl-3-dichloroacetyl oxazolidine |
| MA19709A1 (fr) * | 1982-02-17 | 1983-10-01 | Ciba Geigy Ag | Application de derives de quinoleine a la protection des plantes cultivees . |
| DE3382743D1 (de) * | 1982-05-07 | 1994-05-11 | Ciba Geigy | Verwendung von Chinolinderivaten zum Schützen von Kulturpflanzen. |
| DE3525205A1 (de) * | 1984-09-11 | 1986-03-20 | Hoechst Ag, 6230 Frankfurt | Pflanzenschuetzende mittel auf basis von 1,2,4-triazolderivaten sowie neue derivate des 1,2,4-triazols |
| DE3680212D1 (de) * | 1985-02-14 | 1991-08-22 | Ciba Geigy Ag | Verwendung von chinolinderivaten zum schuetzen von kulturpflanzen. |
| US4964893A (en) * | 1986-04-17 | 1990-10-23 | Monsanto Company | Benzhydryl compounds as herbicide antidotes |
| DE3633840A1 (de) * | 1986-10-04 | 1988-04-14 | Hoechst Ag | Phenylpyrazolcarbonsaeurederivate, ihre herstellung und verwendung als pflanzenwachstumsregulatoren und safener |
| US5276162A (en) * | 1988-05-09 | 1994-01-04 | Bayer Aktiengesellschaft | Herbicidal sulphonylaminocarbonyltriazolinones having substituents which are bonded via sulphur |
| US5262389A (en) * | 1987-03-24 | 1993-11-16 | Bayer Aktiengesellschaft | Substituted triazolinone herbicides and plant growth regulators |
| US5149356A (en) * | 1988-05-09 | 1992-09-22 | Bayer Aktiengesellschaft | Herbicidal sulphonylaminocarbonyltriazolinones having substituents which are bonded via sulphur |
| US5166356A (en) * | 1987-03-24 | 1992-11-24 | Bayer Aktiengesellschaft | Substituted triazolinone herbicides and plant growth regulators |
| US5599944A (en) * | 1987-03-24 | 1997-02-04 | Bayer Aktiengesellschaft | Intermediates for herbicidal sulphonylaminocarbonyltriazolinones having substituents which are bonded via sulphur |
| DE3709574A1 (de) * | 1987-03-24 | 1988-10-06 | Bayer Ag | Substituierte triazolinone |
| US5380863A (en) * | 1989-10-12 | 1995-01-10 | Bayer Aktiengesellschaft | Herbicidal sulphonylaminocarbonyltriazolinones having substituents which are bonded via sulphur |
| DE3808896A1 (de) * | 1988-03-17 | 1989-09-28 | Hoechst Ag | Pflanzenschuetzende mittel auf basis von pyrazolcarbonsaeurederivaten |
| DE3817192A1 (de) | 1988-05-20 | 1989-11-30 | Hoechst Ag | 1,2,4-triazolderivate enthaltende pflanzenschuetzende mittel sowie neue derivate des 1,2,4-triazols |
| DE3939010A1 (de) * | 1989-11-25 | 1991-05-29 | Hoechst Ag | Isoxazoline, verfahren zu ihrer herstellung und ihre verwendung als pflanzenschuetzende mittel |
| DE3939503A1 (de) * | 1989-11-30 | 1991-06-06 | Hoechst Ag | Neue pyrazoline zum schutz von kulturpflanzen gegenueber herbiziden |
| US5700758A (en) * | 1989-11-30 | 1997-12-23 | Hoechst Aktiengesellschaft | Pyrazolines for protecting crop plants against herbicides |
| EP0492366B1 (de) * | 1990-12-21 | 1997-03-26 | Hoechst Schering AgrEvo GmbH | Neue 5-Chlorchinolin-8-oxyalkancarbonsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Antidots von Herbiziden |
| US5739076A (en) * | 1992-07-24 | 1998-04-14 | Exxon Chemical Patents Inc. | Catalysts and their use in oxidation of saturated hydrocarbons |
| TW259690B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1992-08-01 | 1995-10-11 | Hoechst Ag | |
| DE4234801A1 (de) * | 1992-10-15 | 1994-04-21 | Bayer Ag | Sulfonylaminocarbonyltriazolinone |
| US5407897A (en) * | 1993-03-03 | 1995-04-18 | American Cyanamid Company | Method for safening herbicides in crops using substituted benzopyran and tetrahydronaphthalene compounds |
| DE4331448A1 (de) * | 1993-09-16 | 1995-03-23 | Hoechst Schering Agrevo Gmbh | Substituierte Isoxazoline, Verfahren zu deren Herstellung, diese enthaltende Mittel und deren Verwendung als Safener |
| DE19508118A1 (de) * | 1995-03-08 | 1996-09-12 | Bayer Ag | Sulfonylaminocarbonyltriazoline mit Halogenalkoxy-Substituenten |
| DE19621522A1 (de) * | 1996-05-29 | 1997-12-04 | Hoechst Schering Agrevo Gmbh | Neue N-Acylsulfonamide, neue Mischungen aus Herbiziden und Antidots und deren Verwendung |
| DE19742951A1 (de) * | 1997-09-29 | 1999-04-15 | Hoechst Schering Agrevo Gmbh | Acylsulfamoylbenzoesäureamide, diese enthaltende nutzpflanzenschützende Mittel und Verfahren zu ihrer Herstellung |
| AU719657B2 (en) * | 1998-01-21 | 2000-05-11 | Syngenta Participations Ag | Herbicidal composition |
| DE19827855A1 (de) * | 1998-06-23 | 1999-12-30 | Hoechst Schering Agrevo Gmbh | Kombinationen aus Herbiziden und Safenern |
| DE19933260A1 (de) * | 1999-07-15 | 2001-01-18 | Bayer Ag | Substituierte Thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)one |
| DE19940860A1 (de) * | 1999-08-27 | 2001-03-01 | Bayer Ag | Selektive Herbizide auf Basis eines substituierten Phenylsulfonyl aminocarbonyltriazolinons und Safenern II |
| DE10031825A1 (de) * | 2000-06-30 | 2002-01-10 | Bayer Ag | Selektive Herbizide auf Basis von Arylsulfonylaminocarbonyltriazolinonen |
| DE10146590A1 (de) * | 2001-09-21 | 2003-04-10 | Bayer Cropscience Ag | Selektive Herbizide auf Basis von substituierten Thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)onen und Safenern |
| DE10146591A1 (de) * | 2001-09-21 | 2003-04-10 | Bayer Cropscience Ag | Herbizide auf Basis von substituierten Thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)onen |
-
2001
- 2001-09-21 DE DE10146590A patent/DE10146590A1/de not_active Withdrawn
-
2002
- 2002-08-30 AR ARP020103292A patent/AR036775A1/es active IP Right Grant
- 2002-09-10 KR KR1020047003225A patent/KR100927025B1/ko not_active Expired - Lifetime
- 2002-09-10 PT PT02799360T patent/PT1429613E/pt unknown
- 2002-09-10 KR KR1020097019065A patent/KR100979997B1/ko not_active Expired - Lifetime
- 2002-09-10 ES ES02799360T patent/ES2280615T3/es not_active Expired - Lifetime
- 2002-09-10 AU AU2002333811A patent/AU2002333811B8/en not_active Expired
- 2002-09-10 CN CNB028182499A patent/CN1326457C/zh not_active Expired - Lifetime
- 2002-09-10 US US10/489,092 patent/US20050009705A1/en not_active Abandoned
- 2002-09-10 HR HR20040359A patent/HRP20040359A2/hr not_active IP Right Cessation
- 2002-09-10 WO PCT/EP2002/010104 patent/WO2003026427A1/de active Application Filing
- 2002-09-10 RS YUP-245/04A patent/RS51046B/sr unknown
- 2002-09-10 PL PL367511A patent/PL207754B1/pl unknown
- 2002-09-10 HU HU0402116A patent/HU230218B1/hu active Protection Beyond IP Right Term
- 2002-09-10 EP EP02799360A patent/EP1429613B1/de not_active Expired - Lifetime
- 2002-09-10 DE DE50209305T patent/DE50209305D1/de not_active Expired - Lifetime
- 2002-09-10 MX MXPA04002641A patent/MXPA04002641A/es active IP Right Grant
- 2002-09-10 RU RU2004112214/04A patent/RU2308834C2/ru active Protection Beyond IP Right Term
- 2002-09-10 JP JP2003530081A patent/JP4610895B2/ja not_active Expired - Lifetime
- 2002-09-10 CA CA2460922A patent/CA2460922C/en not_active Expired - Lifetime
- 2002-09-10 CA CA2695675A patent/CA2695675C/en not_active Expired - Lifetime
- 2002-10-09 UA UA20040402902A patent/UA77010C2/uk unknown
-
2004
- 2004-03-17 ZA ZA2004/02129A patent/ZA200402129B/en unknown
- 2004-04-19 CO CO04035728A patent/CO5580725A2/es active IP Right Grant
-
2009
- 2009-12-22 JP JP2009290184A patent/JP2010100638A/ja active Pending
-
2013
- 2013-04-30 US US13/873,656 patent/US9968091B2/en not_active Expired - Lifetime
-
2015
- 2015-11-24 US US14/950,588 patent/US10524475B2/en not_active Expired - Lifetime
-
2016
- 2016-01-21 HU HUS1600007C patent/HUS1600007I1/hu unknown
- 2016-08-05 NL NL350074C patent/NL350074I2/nl unknown
- 2016-08-18 BE BE2016C043C patent/BE2016C043I2/fr unknown
-
2017
- 2017-02-02 NL NL350078C patent/NL350078I2/nl unknown
- 2017-09-20 FR FR17C1034C patent/FR17C1034I2/fr active Active
- 2017-11-15 BE BE2017C050C patent/BE2017C050I2/fr unknown
- 2017-12-07 NL NL350082C patent/NL350082I2/nl unknown
-
2018
- 2018-04-20 FR FR18C1015C patent/FR18C1015I2/fr active Active
-
2019
- 2019-11-21 US US16/690,200 patent/US20200085058A1/en not_active Abandoned
-
2020
- 2020-07-27 HU HUS2000029C patent/HUS2000029I1/hu unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU230218B1 (hu) | Szubsztituált tién-3-il-szulfonilamino(tio)karbonil-triazolin-(ti)onokon és széfenereken alapuló szelektív herbicidek | |
| KR890002084B1 (ko) | N-페닐설포닐-n'-피리미디닐-및-트리아지닐-우레아의 제조방법 | |
| MXPA96005256A (en) | Aminofenilsulfonilureas aciladas, procedures for its preparation and its use as herbicides and plan growth regulators | |
| AU627462B2 (en) | (hetero)aryloxynaphthalenes having substituents bonded via sulphur | |
| BG65806B1 (bg) | N-(5,7-ДИМЕТОКСИ[1,2,4] ТРИАЗОЛО[1,5-а] ПИРИМИДИН-2-ИЛ) АРИЛСУЛФОНАМИДНИ СЪЕДИНЕНИЯ И ТЯХНОТО ИЗПОЛЗВАНЕ КАТО ХЕРБИЦИДИ | |
| HU230493B1 (hu) | Gyomirtó szert és antidótumot tartalmazó kombináció | |
| ES2329592T3 (es) | Combinacion de herbicidas y antidotos. | |
| HU199064B (en) | Compositions determining growth of plants containing 1-/methyl-amino/-cyclopropane-1-carboxylic acid derivatives as active components and process for producing 1-/methyl-amino/-cyclopropane-1-carboxylic acid derivatives | |
| SA03240058B1 (ar) | توليفات لمبيدات أعشاب تشتمل على مركبات sulfonylureas معينة | |
| JPS59181252A (ja) | N−フエニルスルホニル−n′−ピリミジニル尿素および同トリアジニル尿素 | |
| CS252829B2 (en) | Herbicide and fungicide | |
| CN109293640B (zh) | 一种取代的含氮杂芳环甲酰胺衍生物及其除草组合物和用途 | |
| DE2050346A1 (de) | Neue heterocyclische Verbindungen | |
| BR112013018077B1 (pt) | Composições herbicidas compatíveis com a safra da planta contendo herbicidas e agentes de proteção | |
| EP0074595B1 (de) | Substituierte Phenylsulfonylharnstoff- Derivate, Verfahren und neue Zwischenprodukte zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| JPS62249903A (ja) | チアジアゾリル尿素を含有する落葉剤 | |
| CA2896396A1 (en) | Plant growth regulating compounds | |
| KR900008397B1 (ko) | N-아릴설포닐-n'-트리아졸일우레아류의 제조방법 | |
| JPS6133188A (ja) | 新規な除草剤として有効なスルホニル尿素 | |
| CA2897509C (en) | Substituted amino azoles as plant growth regulators | |
| CA1223587A (en) | 1-(2-trifluoromethoxy-phenylsulphonyl)-3-heteroaryl- (thio)ureas | |
| CH628499A5 (de) | Mittel zur beeinflussung des pflanzenwachstums. | |
| EP0138983A1 (en) | PLANT REGULATORS OF N-PHENYL-N '- (PYRIDINYL-N-OXIDE) UREA. | |
| JPS5855481A (ja) | ヘテロ−置換されたピリド−4−オン誘導体類、それらの製造方法及び除草剤としてのそれらの使用 | |
| EP0046069A1 (en) | Herbicidal and plant growth regulant diphenylpyridazinones |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| GB9A | Succession in title |
Owner name: BAYER INTELLECTUAL PROPERTY GMBH, DE Free format text: FORMER OWNER(S): BAYER CROPSCIENCE AG, DE |
|
| AA1S | Information on application for a supplementary protection certificate |
Free format text: PRODUCT NAME: COMBINATION OF THIENCARBAZONE-METHYL AND IZOXADIFEN-ETHYL; REGISTRATION NO/DATE: 04.2/6516-1/2015 20150723 Spc suppl protection certif: S1600007 Filing date: 20160121 Expiry date: 20220910 |
|
| FG4S | Grant of supplementary protection certificate |
Spc suppl protection certif: S1600007 Filing date: 20160121 Expiry date: 20220910 Extension date: 20270910 |
|
| GB9A | Succession in title |
Owner name: BAYER CROPSCIENCE AKTIENGESELLSCHAFT, DE Free format text: FORMER OWNER(S): BAYER CROPSCIENCE AG, DE; BAYER INTELLECTUAL PROPERTY GMBH, DE |
|
| FG4S | Grant of supplementary protection certificate |
Free format text: PRODUCT NAME: COMBINATION OF THIENCARBAZONE-METHYL AND MEFENPYR-DIETHYL; NAT. REGISTRATION NO/DATE: 6300/1829-1/2020 20200529; FIRST REGISTRATION: 3818 20170324 Spc suppl protection certif: S2000029 Filing date: 20200727 Expiry date: 20220910 Extension date: 20270910 |