HU218676B - Antimikrobiális karbapenemszármazékok, ilyen vegyületeket tartalmazó gyógyászati készítmények és eljárás ezek előállítására - Google Patents
Antimikrobiális karbapenemszármazékok, ilyen vegyületeket tartalmazó gyógyászati készítmények és eljárás ezek előállítására Download PDFInfo
- Publication number
- HU218676B HU218676B HU9300677A HU9300677A HU218676B HU 218676 B HU218676 B HU 218676B HU 9300677 A HU9300677 A HU 9300677A HU 9300677 A HU9300677 A HU 9300677A HU 218676 B HU218676 B HU 218676B
- Authority
- HU
- Hungary
- Prior art keywords
- multiplet
- formula
- group
- methyl
- ylcarbonyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 142
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 10
- 238000002360 preparation method Methods 0.000 title claims abstract description 10
- 238000000034 method Methods 0.000 title claims description 13
- 230000000845 anti-microbial effect Effects 0.000 title abstract description 3
- YZBQHRLRFGPBSL-RXMQYKEDSA-N carbapenem Chemical class C1C=CN2C(=O)C[C@H]21 YZBQHRLRFGPBSL-RXMQYKEDSA-N 0.000 title abstract 2
- 150000003839 salts Chemical class 0.000 claims abstract description 33
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 20
- 239000001257 hydrogen Substances 0.000 claims abstract description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 20
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 18
- -1 4-Amidinopiperazin-1-ylcarbonyl Chemical group 0.000 claims description 140
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 65
- 125000006239 protecting group Chemical group 0.000 claims description 13
- BSIMZHVOQZIAOY-SCSAIBSYSA-N 1-carbapenem-3-carboxylic acid Chemical class OC(=O)C1=CC[C@@H]2CC(=O)N12 BSIMZHVOQZIAOY-SCSAIBSYSA-N 0.000 claims description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 125000004429 atom Chemical group 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 150000002500 ions Chemical class 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 3
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 208000015181 infectious disease Diseases 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 2
- 230000002265 prevention Effects 0.000 claims description 2
- FMIOOGWLBUDLOZ-RZBMREITSA-N (5S)-3-[5-(4-carbamimidoyl-1,4-diazepane-1-carbonyl)-1-methylpyrrolidin-3-yl]sulfanyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C(N)(=N)N1CCN(CCC1)C(=O)C1N(CC(C1)SC=1C([C@H]2N(C=1C(=O)O)C(C2C(C)O)=O)C)C FMIOOGWLBUDLOZ-RZBMREITSA-N 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 230000000813 microbial effect Effects 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 180
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 75
- 230000002829 reductive effect Effects 0.000 description 62
- 239000000243 solution Substances 0.000 description 59
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 51
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- 238000006243 chemical reaction Methods 0.000 description 45
- 239000000203 mixture Substances 0.000 description 40
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 40
- 239000000843 powder Substances 0.000 description 39
- 238000002329 infrared spectrum Methods 0.000 description 36
- 239000011541 reaction mixture Substances 0.000 description 34
- 239000002904 solvent Substances 0.000 description 33
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 32
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 24
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 17
- 239000012267 brine Substances 0.000 description 17
- 238000001816 cooling Methods 0.000 description 17
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 17
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 16
- 235000017557 sodium bicarbonate Nutrition 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 15
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- 239000003480 eluent Substances 0.000 description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- 108090000204 Dipeptidase 1 Proteins 0.000 description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 9
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 102000003850 Dipeptidase 1 Human genes 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 238000004440 column chromatography Methods 0.000 description 7
- 238000002955 isolation Methods 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 230000002411 adverse Effects 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- NFUHGQVNWQOHQB-UHFFFAOYSA-N sodium;trimethylsilyl propanoate Chemical class [Na].CCC(=O)O[Si](C)(C)C NFUHGQVNWQOHQB-UHFFFAOYSA-N 0.000 description 6
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 5
- WKDDRNSBRWANNC-UHFFFAOYSA-N Thienamycin Natural products C1C(SCCN)=C(C(O)=O)N2C(=O)C(C(O)C)C21 WKDDRNSBRWANNC-UHFFFAOYSA-N 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 125000003460 beta-lactamyl group Chemical group 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Chemical group 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000000460 chlorine Chemical group 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- ZSKVGTPCRGIANV-ZXFLCMHBSA-N imipenem Chemical compound C1C(SCC\N=C\N)=C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 ZSKVGTPCRGIANV-ZXFLCMHBSA-N 0.000 description 4
- 229960002182 imipenem Drugs 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000010898 silica gel chromatography Methods 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- SCTCHKRDLHASAC-UHFFFAOYSA-N (4-nitrophenyl)methyl (nz)-n-[amino(piperazin-1-yl)methylidene]carbamate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)NC(=N)N1CCNCC1 SCTCHKRDLHASAC-UHFFFAOYSA-N 0.000 description 3
- MHSGOABISYIYKP-UHFFFAOYSA-N (4-nitrophenyl)methyl carbonochloridate Chemical compound [O-][N+](=O)C1=CC=C(COC(Cl)=O)C=C1 MHSGOABISYIYKP-UHFFFAOYSA-N 0.000 description 3
- KRSILVAJCIGMKY-UHFFFAOYSA-N (4-nitrophenyl)methyl pyrrolidine-1-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1CCCC1 KRSILVAJCIGMKY-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229940088710 antibiotic agent Drugs 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 244000052616 bacterial pathogen Species 0.000 description 3
- 230000003115 biocidal effect Effects 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 235000008504 concentrate Nutrition 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000002198 insoluble material Substances 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000004060 metabolic process Effects 0.000 description 3
- 230000004962 physiological condition Effects 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000001226 reprecipitation Methods 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- BANNWXSWIYMOGM-STQMWFEESA-N (2s,4s)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1CS[C@@H]1CN(C)[C@H](C(O)=O)C1 BANNWXSWIYMOGM-STQMWFEESA-N 0.000 description 2
- QYSPLVFBTQSSQW-HOTGVXAUSA-N (3-aminoazetidin-1-yl)-[(2s,4s)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidin-2-yl]methanone Chemical compound C1=CC(OC)=CC=C1CS[C@@H]1CN(C)[C@H](C(=O)N2CC(N)C2)C1 QYSPLVFBTQSSQW-HOTGVXAUSA-N 0.000 description 2
- PDVFSPNIEOYOQL-UHFFFAOYSA-N (4-methylphenyl)sulfonyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OS(=O)(=O)C1=CC=C(C)C=C1 PDVFSPNIEOYOQL-UHFFFAOYSA-N 0.000 description 2
- MABUHBVEZUMUME-HOTGVXAUSA-N (4-nitrophenyl)methyl (2s,4s)-2-[3-(dimethylamino)azetidine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate Chemical compound C1C(N(C)C)CN1C(=O)[C@H]1N(C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)C[C@@H](S)C1 MABUHBVEZUMUME-HOTGVXAUSA-N 0.000 description 2
- PBCKXLVCCOURLL-UHFFFAOYSA-N (4-nitrophenyl)methyl (ne)-n-(aminomethylidene)carbamate Chemical compound [O-][N+](=O)C1=CC=C(COC(=O)NC=N)C=C1 PBCKXLVCCOURLL-UHFFFAOYSA-N 0.000 description 2
- NJYZWIGYXHDQEJ-COXVUDFISA-N (4-nitrophenyl)methyl (ne)-n-[amino-[(2r)-2-methyl-4-[(2s,4s)-1-methyl-4-sulfanylpyrrolidine-2-carbonyl]piperazin-1-yl]methylidene]carbamate Chemical compound C([C@H]1C)N(C(=O)[C@H]2N(C[C@@H](S)C2)C)CCN1C(=N)NC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 NJYZWIGYXHDQEJ-COXVUDFISA-N 0.000 description 2
- AKYYURPUIANXHR-UHFFFAOYSA-N (4-nitrophenyl)methyl (nz)-n-(1-aminoethylidene)carbamate Chemical compound CC(=N)NC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 AKYYURPUIANXHR-UHFFFAOYSA-N 0.000 description 2
- ZXFAFEGHKFQBDW-PMPSAXMXSA-N (4-nitrophenyl)methyl n-carbamimidoyl-n-[(3r)-1-[(2s,4s)-1-methyl-4-sulfanylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]carbamate Chemical compound CN1C[C@@H](S)C[C@H]1C(=O)N1C[C@H](N(C(N)=N)C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)CC1 ZXFAFEGHKFQBDW-PMPSAXMXSA-N 0.000 description 2
- XGEZNSVNSMSIJO-IRXDYDNUSA-N (4-nitrophenyl)methyl n-methyl-n-[4-[(2s,4s)-1-methyl-4-sulfanylpyrrolidine-2-carbonyl]piperazine-1-carboximidoyl]carbamate Chemical compound C1CN(C(=O)[C@H]2N(C[C@@H](S)C2)C)CCN1C(=N)N(C)C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 XGEZNSVNSMSIJO-IRXDYDNUSA-N 0.000 description 2
- ARVCHJPVCYTOEA-PEZGRIKUSA-N (4r,5s,6s)-3-[(3s,5s)-5-(4-carbamimidoylpiperazine-1-carbonyl)-1-methylpyrrolidin-3-yl]sulfanyl-6-[(1r)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound O=C([C@@H]1C[C@@H](CN1C)SC=1[C@H](C)[C@@H]2[C@H](C(N2C=1C(O)=O)=O)[C@H](O)C)N1CCN(C(N)=N)CC1 ARVCHJPVCYTOEA-PEZGRIKUSA-N 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- UTXSJCMAGHSVIE-UHFFFAOYSA-N 1-(azetidin-3-yl)imidazole;dihydrochloride Chemical compound Cl.Cl.C1NCC1N1C=NC=C1 UTXSJCMAGHSVIE-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 2
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 2
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- ZSIAANIILFGLQH-UHFFFAOYSA-N C1(=CC=CC=C1)[ClH]P(=O)(Cl)[ClH]C1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)[ClH]P(=O)(Cl)[ClH]C1=CC=CC=C1 ZSIAANIILFGLQH-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 102100020743 Dipeptidase 1 Human genes 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Chemical compound OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- WKDDRNSBRWANNC-ATRFCDNQSA-N Thienamycin Chemical compound C1C(SCCN)=C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 WKDDRNSBRWANNC-ATRFCDNQSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- BHIIGRBMZRSDRI-UHFFFAOYSA-N [chloro(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(Cl)OC1=CC=CC=C1 BHIIGRBMZRSDRI-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- OOSDLMAZIRAMDN-UHFFFAOYSA-N azetidin-3-amine;dihydrochloride Chemical compound Cl.Cl.NC1CNC1 OOSDLMAZIRAMDN-UHFFFAOYSA-N 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 description 2
- MSVZMUILYMLJCF-UHFFFAOYSA-N (1-benzhydrylazetidin-3-yl) methanesulfonate Chemical compound C1C(OS(=O)(=O)C)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 MSVZMUILYMLJCF-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- JQWUEVPNOSPHNN-OALUTQOASA-N (2s,4s)-4-[(4-methoxyphenyl)methylsulfanyl]-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1CS[C@@H]1CN(C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)[C@H](C(O)=O)C1 JQWUEVPNOSPHNN-OALUTQOASA-N 0.000 description 1
- RUJYDUQFMRFOBI-ZEQRLZLVSA-N (4-nitrophenyl)methyl (2S,4S)-4-[(4-methoxyphenyl)methylsulfanyl]-2-[3-(1,2,4-triazol-1-yl)azetidine-1-carbonyl]pyrrolidine-1-carboxylate Chemical compound C1=CC(OC)=CC=C1CS[C@@H]1CN(C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)[C@H](C(=O)N2CC(C2)N2N=CN=C2)C1 RUJYDUQFMRFOBI-ZEQRLZLVSA-N 0.000 description 1
- VNSORCKADYKVSF-VXKWHMMOSA-N (4-nitrophenyl)methyl (2s,4s)-2-(3-aminoazetidine-1-carbonyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate Chemical compound C1=CC(OC)=CC=C1CS[C@@H]1CN(C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)[C@H](C(=O)N2CC(N)C2)C1 VNSORCKADYKVSF-VXKWHMMOSA-N 0.000 description 1
- QMOJVQCNOMJZOT-IRXDYDNUSA-N (4-nitrophenyl)methyl (2s,4s)-2-(3-imidazol-1-ylazetidine-1-carbonyl)-4-sulfanylpyrrolidine-1-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1[C@H](C(=O)N2CC(C2)N2C=NC=C2)C[C@H](S)C1 QMOJVQCNOMJZOT-IRXDYDNUSA-N 0.000 description 1
- UPNFBVCZAYMUAR-VSDWSMLSSA-N (4-nitrophenyl)methyl (2s,4s)-2-[(3r)-3-methyl-4-[(e)-n'-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate Chemical compound C([C@H]1C)N(C(=O)[C@H]2N(C[C@@H](S)C2)C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)CCN1C(=N)NC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 UPNFBVCZAYMUAR-VSDWSMLSSA-N 0.000 description 1
- SSUBBXZBKKWORU-SFTDATJTSA-N (4-nitrophenyl)methyl (2s,4s)-2-[3-[(4-nitrophenyl)methoxycarbonylamino]azetidine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)NC1CN(C(=O)[C@H]2N(C[C@@H](S)C2)C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)C1 SSUBBXZBKKWORU-SFTDATJTSA-N 0.000 description 1
- FRJYJTPBOMGHIK-VMPREFPWSA-N (4-nitrophenyl)methyl (2s,4s)-4-[(4-methoxyphenyl)methylsulfanyl]-2-[3-[(4-nitrophenyl)methoxycarbonylamino]azetidine-1-carbonyl]pyrrolidine-1-carboxylate Chemical compound C1=CC(OC)=CC=C1CS[C@@H]1CN(C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)[C@H](C(=O)N2CC(C2)NC(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)C1 FRJYJTPBOMGHIK-VMPREFPWSA-N 0.000 description 1
- MXPDNPAIJIFTDY-HOTGVXAUSA-N (4-nitrophenyl)methyl (ne)-n-[amino-[4-[(2s,4s)-1-methyl-4-sulfanylpyrrolidine-2-carbonyl]piperazin-1-yl]methylidene]carbamate Chemical compound CN1C[C@@H](S)C[C@H]1C(=O)N1CCN(C(=N)NC(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)CC1 MXPDNPAIJIFTDY-HOTGVXAUSA-N 0.000 description 1
- DFSDTZJXONBARJ-ZEQRLZLVSA-N (4-nitrophenyl)methyl (nz)-n-[amino-[4-[(2s,4s)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]piperazin-1-yl]methylidene]carbamate Chemical compound C1=CC(OC)=CC=C1CS[C@@H]1CN(C)[C@H](C(=O)N2CCN(CC2)C(=N)NC(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)C1 DFSDTZJXONBARJ-ZEQRLZLVSA-N 0.000 description 1
- DLSXYGVBTQJTEC-ZEQRLZLVSA-N (4-nitrophenyl)methyl 3-amino-3-[1-[(2s,4s)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]azetidin-3-yl]iminopropanoate Chemical compound C1=CC(OC)=CC=C1CS[C@@H]1CN(C)[C@H](C(=O)N2CC(C2)NC(=N)CC(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)C1 DLSXYGVBTQJTEC-ZEQRLZLVSA-N 0.000 description 1
- ZVAPAKFZITWAHK-UHFFFAOYSA-N (4-nitrophenyl)methyl 3-sulfanylpyrrolidine-1-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1CC(S)CC1 ZVAPAKFZITWAHK-UHFFFAOYSA-N 0.000 description 1
- DTJSUHGTACWMBR-GJZGRUSLSA-N (4-nitrophenyl)methyl n-[1-[(2s,4s)-1-methyl-4-sulfanylpyrrolidine-2-carbonyl]azetidin-3-yl]carbamate Chemical compound CN1C[C@@H](S)C[C@H]1C(=O)N1CC(NC(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)C1 DTJSUHGTACWMBR-GJZGRUSLSA-N 0.000 description 1
- MVYZOAJDMNGKDN-GOTSBHOMSA-N (4-nitrophenyl)methyl n-[1-[(2s,4s)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]azetidin-3-yl]carbamate Chemical compound C1=CC(OC)=CC=C1CS[C@@H]1CN(C)[C@H](C(=O)N2CC(C2)NC(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)C1 MVYZOAJDMNGKDN-GOTSBHOMSA-N 0.000 description 1
- ZXFAFEGHKFQBDW-JYJNAYRXSA-N (4-nitrophenyl)methyl n-carbamimidoyl-n-[(3s)-1-[(2s,4s)-1-methyl-4-sulfanylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]carbamate Chemical compound CN1C[C@@H](S)C[C@H]1C(=O)N1C[C@@H](N(C(N)=N)C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)CC1 ZXFAFEGHKFQBDW-JYJNAYRXSA-N 0.000 description 1
- CMWGOSZJDLEVOQ-YDEIVXIUSA-N (4r,5r,6s)-6-[(1r)-1-hydroxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound C[C@H]1C(=O)C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 CMWGOSZJDLEVOQ-YDEIVXIUSA-N 0.000 description 1
- FQWGQNPNUJXRHN-PEZGRIKUSA-N (4r,5s,6s)-3-[(3s,5s)-5-(4-carbamimidoyl-1,4-diazepane-1-carbonyl)pyrrolidin-3-yl]sulfanyl-6-[(1r)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound O=C([C@H]1NC[C@H](C1)SC=1[C@H](C)[C@@H]2[C@H](C(N2C=1C(O)=O)=O)[C@H](O)C)N1CCCN(C(N)=N)CC1 FQWGQNPNUJXRHN-PEZGRIKUSA-N 0.000 description 1
- ZLVQEXZKHQNVBG-ILJVOIDVSA-N (4r,5s,6s)-3-[(3s,5s)-5-[(3r)-4-carbamimidoyl-3-methylpiperazine-1-carbonyl]-1-methylpyrrolidin-3-yl]sulfanyl-6-[(1r)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound O=C([C@@H]1C[C@@H](CN1C)SC=1[C@H](C)[C@@H]2[C@H](C(N2C=1C(O)=O)=O)[C@H](O)C)N1CCN(C(N)=N)[C@H](C)C1 ZLVQEXZKHQNVBG-ILJVOIDVSA-N 0.000 description 1
- GHVPALUYEPHDLC-PFWIPMOTSA-N (4r,5s,6s)-3-[(3s,5s)-5-[3-(diaminomethylideneamino)azetidine-1-carbonyl]pyrrolidin-3-yl]sulfanyl-6-[(1r)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound O=C([C@H]1NC[C@H](C1)SC=1[C@H](C)[C@@H]2[C@H](C(N2C=1C(O)=O)=O)[C@H](O)C)N1CC(N=C(N)N)C1 GHVPALUYEPHDLC-PFWIPMOTSA-N 0.000 description 1
- VEGQCRFMAKDGNS-MXWNMBBBSA-N (4r,5s,6s)-3-[(3s,5s)-5-[4-(diaminomethylideneamino)piperidine-1-carbonyl]-1-methylpyrrolidin-3-yl]sulfanyl-6-[(1r)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound O=C([C@@H]1C[C@@H](CN1C)SC=1[C@H](C)[C@@H]2[C@H](C(N2C=1C(O)=O)=O)[C@H](O)C)N1CCC(N=C(N)N)CC1 VEGQCRFMAKDGNS-MXWNMBBBSA-N 0.000 description 1
- SNLDTESQCCRXFT-TXDCLXLTSA-N (4r,5s,6s)-3-[(3s,5s)-5-[4-(diaminomethylideneamino)piperidine-1-carbonyl]pyrrolidin-3-yl]sulfanyl-6-[(1r)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound O=C([C@H]1NC[C@H](C1)SC=1[C@H](C)[C@@H]2[C@H](C(N2C=1C(O)=O)=O)[C@H](O)C)N1CCC(N=C(N)N)CC1 SNLDTESQCCRXFT-TXDCLXLTSA-N 0.000 description 1
- CMWGOSZJDLEVOQ-QTSLKERKSA-N (4r,5s,6s)-6-[(1r)-1-hydroxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound C[C@H]1C(=O)C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@@H]21 CMWGOSZJDLEVOQ-QTSLKERKSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HJNMURUFTHCDES-UHFFFAOYSA-N 1-(1-benzhydrylazetidin-3-yl)imidazole Chemical compound C1C(N2C=NC=C2)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 HJNMURUFTHCDES-UHFFFAOYSA-N 0.000 description 1
- SPVBOJBSURLBDS-UHFFFAOYSA-N 1-(azetidin-3-yl)-1,2,4-triazole;hydrochloride Chemical compound Cl.C1NCC1N1N=CN=C1 SPVBOJBSURLBDS-UHFFFAOYSA-N 0.000 description 1
- KGENPKAWPRUNIG-UHFFFAOYSA-N 1-[chloro(ethyl)phosphoryl]ethane Chemical compound CCP(Cl)(=O)CC KGENPKAWPRUNIG-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000606124 Bacteroides fragilis Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- ZYUZLEUJKZZXNN-UHFFFAOYSA-N C1=CC(CC(N)C(O)=O)=CC=C1OS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 Chemical group C1=CC(CC(N)C(O)=O)=CC=C1OS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 ZYUZLEUJKZZXNN-UHFFFAOYSA-N 0.000 description 1
- LPKFJCYDAWZCCT-UHFFFAOYSA-N C1CCN(C1)C(=O)N2CC(C2)N(C(=N)N)C(=O)OCC3=CC=C(C=C3)[N+](=O)[O-] Chemical compound C1CCN(C1)C(=O)N2CC(C2)N(C(=N)N)C(=O)OCC3=CC=C(C=C3)[N+](=O)[O-] LPKFJCYDAWZCCT-UHFFFAOYSA-N 0.000 description 1
- VPMQHGLPEZEGOM-UHFFFAOYSA-N C1CCN(C1)C(=O)N2CCC(CC2)N(C(=N)N)C(=O)OCC3=CC=C(C=C3)[N+](=O)[O-] Chemical compound C1CCN(C1)C(=O)N2CCC(CC2)N(C(=N)N)C(=O)OCC3=CC=C(C=C3)[N+](=O)[O-] VPMQHGLPEZEGOM-UHFFFAOYSA-N 0.000 description 1
- RMYOYDRQJBHLRV-HNNXBMFYSA-N C1CCN(C1)C(=O)N2CC[C@@H](C2)N(C(=N)N)C(=O)OCC3=CC=C(C=C3)[N+](=O)[O-] Chemical compound C1CCN(C1)C(=O)N2CC[C@@H](C2)N(C(=N)N)C(=O)OCC3=CC=C(C=C3)[N+](=O)[O-] RMYOYDRQJBHLRV-HNNXBMFYSA-N 0.000 description 1
- BQVRYYISFZSTTI-IRXDYDNUSA-N CN1C[C@@H](S)C[C@H]1C(=O)N1CC(N(C(C)=N)C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)C1 Chemical compound CN1C[C@@H](S)C[C@H]1C(=O)N1CC(N(C(C)=N)C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)C1 BQVRYYISFZSTTI-IRXDYDNUSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- GHIKWPSQPLPZHR-YKXIHYLHSA-N Cl.CC1C=C(N2[C@H]1CC2=O)C(=O)O Chemical compound Cl.CC1C=C(N2[C@H]1CC2=O)C(=O)O GHIKWPSQPLPZHR-YKXIHYLHSA-N 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000588914 Enterobacter Species 0.000 description 1
- 241000194032 Enterococcus faecalis Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- FCLZCOCSZQNREK-UHFFFAOYSA-N Pyrrolidine, hydrochloride Chemical compound Cl.C1CCNC1 FCLZCOCSZQNREK-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 241000607768 Shigella Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 241000193998 Streptococcus pneumoniae Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- OMOPIAOKQJWPEF-UHFFFAOYSA-N [bromo(phenyl)phosphoryl]benzene Chemical compound C=1C=CC=CC=1P(=O)(Br)C1=CC=CC=C1 OMOPIAOKQJWPEF-UHFFFAOYSA-N 0.000 description 1
- CVNMBKFJYRAHPO-UHFFFAOYSA-N [chloro(methyl)phosphoryl]methane Chemical compound CP(C)(Cl)=O CVNMBKFJYRAHPO-UHFFFAOYSA-N 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005205 alkoxycarbonyloxyalkyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- FDPKMJDUXJFKOI-UHFFFAOYSA-N azetidin-3-amine Chemical compound NC1CNC1 FDPKMJDUXJFKOI-UHFFFAOYSA-N 0.000 description 1
- 125000004567 azetidin-3-yl group Chemical group N1CC(C1)* 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- MLWPJXZKQOPTKZ-UHFFFAOYSA-N benzenesulfonyl benzenesulfonate Chemical compound C=1C=CC=CC=1S(=O)(=O)OS(=O)(=O)C1=CC=CC=C1 MLWPJXZKQOPTKZ-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000003782 beta lactam antibiotic agent Substances 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 125000006003 dichloroethyl group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000006001 difluoroethyl group Chemical group 0.000 description 1
- CGDXUTMWWHKMOE-UHFFFAOYSA-N difluoromethanesulfonic acid Chemical compound OS(=O)(=O)C(F)F CGDXUTMWWHKMOE-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940032049 enterococcus faecalis Drugs 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- CCJXQRNXZKSOGJ-UHFFFAOYSA-N ethylsulfonyl ethanesulfonate Chemical compound CCS(=O)(=O)OS(=O)(=O)CC CCJXQRNXZKSOGJ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 125000005816 fluoropropyl group Chemical group [H]C([H])(F)C([H])([H])C([H])([H])* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 229950006191 gluconic acid Drugs 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229960000448 lactic acid Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- HQRPHMAXFVUBJX-UHFFFAOYSA-M lithium;hydrogen carbonate Chemical compound [Li+].OC([O-])=O HQRPHMAXFVUBJX-UHFFFAOYSA-M 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229940099690 malic acid Drugs 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical group COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- KWUZCAVKPCRJPO-UHFFFAOYSA-N n-ethyl-4-(6-methyl-1,3-benzothiazol-2-yl)aniline Chemical compound C1=CC(NCC)=CC=C1C1=NC2=CC=C(C)C=C2S1 KWUZCAVKPCRJPO-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229940116315 oxalic acid Drugs 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- DQOHQFZECPUYHK-UHFFFAOYSA-N piperazine-1,4-diium;2,2,2-trifluoroacetate Chemical compound C1C[NH2+]CC[NH2+]1.[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F DQOHQFZECPUYHK-UHFFFAOYSA-N 0.000 description 1
- ZTWBXCGKRKUYSY-UHFFFAOYSA-N piperazine-1-carboximidamide Chemical compound NC(=N)N1CCNCC1 ZTWBXCGKRKUYSY-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 229940031000 streptococcus pneumoniae Drugs 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- AUDOKQUXQRAOEJ-UHFFFAOYSA-N tert-butyl 4-[(z)-n'-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C(=N)NC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 AUDOKQUXQRAOEJ-UHFFFAOYSA-N 0.000 description 1
- MJNAHJKRZWPBSX-UHFFFAOYSA-N tert-butyl 4-carbamimidoylpiperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(N)=N)CC1 MJNAHJKRZWPBSX-UHFFFAOYSA-N 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 1
- 241001148471 unidentified anaerobic bacterium Species 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000002132 β-lactam antibiotic Substances 0.000 description 1
- 229940124586 β-lactam antibiotics Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D477/00—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring
- C07D477/10—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D477/12—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached in position 6
- C07D477/16—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached in position 6 with hetero atoms or carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 3
- C07D477/20—Sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Materials For Medical Uses (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5216392 | 1992-03-11 | ||
| JP24495392 | 1992-09-14 | ||
| JP24657892 | 1992-09-16 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HU9300677D0 HU9300677D0 (en) | 1993-05-28 |
| HUT64071A HUT64071A (en) | 1993-11-29 |
| HU218676B true HU218676B (hu) | 2000-10-28 |
Family
ID=27294566
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU9300677A HU218676B (hu) | 1992-03-11 | 1993-03-10 | Antimikrobiális karbapenemszármazékok, ilyen vegyületeket tartalmazó gyógyászati készítmények és eljárás ezek előállítására |
Country Status (18)
| Country | Link |
|---|---|
| EP (1) | EP0560613B1 (cg-RX-API-DMAC10.html) |
| KR (1) | KR100258225B1 (cg-RX-API-DMAC10.html) |
| CN (1) | CN1037180C (cg-RX-API-DMAC10.html) |
| AT (1) | ATE173733T1 (cg-RX-API-DMAC10.html) |
| AU (1) | AU664422B2 (cg-RX-API-DMAC10.html) |
| CA (1) | CA2091486A1 (cg-RX-API-DMAC10.html) |
| CZ (1) | CZ290002B6 (cg-RX-API-DMAC10.html) |
| DE (1) | DE69322188T2 (cg-RX-API-DMAC10.html) |
| DK (1) | DK0560613T3 (cg-RX-API-DMAC10.html) |
| ES (1) | ES2125945T3 (cg-RX-API-DMAC10.html) |
| FI (1) | FI103046B1 (cg-RX-API-DMAC10.html) |
| HU (1) | HU218676B (cg-RX-API-DMAC10.html) |
| IL (1) | IL105020A (cg-RX-API-DMAC10.html) |
| MX (1) | MX9301361A (cg-RX-API-DMAC10.html) |
| NO (1) | NO303730B1 (cg-RX-API-DMAC10.html) |
| NZ (1) | NZ247129A (cg-RX-API-DMAC10.html) |
| RU (1) | RU2097383C1 (cg-RX-API-DMAC10.html) |
| TW (1) | TW249803B (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7041660B2 (en) | 1999-07-06 | 2006-05-09 | Sankyo Company, Limited | Crystalline 1-methylcarbapenem derivatives |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2093514C1 (ru) * | 1991-06-04 | 1997-10-20 | Санкио Компани Лимитед | Производные 1-метилкарбапенема и способ их получения |
| GB9515975D0 (en) | 1995-08-04 | 1995-10-04 | Zeneca Ltd | Chemical compounds |
| PT882728E (pt) * | 1995-12-21 | 2002-11-29 | Sankyo Co | Derivados de 1-metilcarbapenem |
| ES2180977T3 (es) * | 1996-04-26 | 2003-02-16 | Sankyo Co | Un derivado de 1-metilcarbapenem. |
| AU4020897A (en) | 1996-08-17 | 1998-03-06 | Zeneca Limited | 3-mercaptopyrrolidines as farnesyl protein transferase inhibitors |
| AU1415500A (en) * | 1998-12-07 | 2000-06-26 | Sankyo Company Limited | 1-methylcarbapenem derivatives |
| GB9930318D0 (en) | 1999-12-22 | 2000-02-09 | Zeneca Ltd | Novel compounds |
| GB9930317D0 (en) | 1999-12-22 | 2000-02-09 | Zeneca Ltd | Novel compounds |
| RS52410B (sr) * | 2001-09-26 | 2013-02-28 | Merck Sharp & Dohme Corp. | Postupak izrade jedinjenja karbapenema |
| EP1698375B1 (en) * | 2003-12-25 | 2014-04-02 | Ono Pharmaceutical Co., Ltd. | Azetidine ring compounds and drugs comprising the same |
| CN101367814B (zh) * | 2007-06-28 | 2010-12-15 | 山东轩竹医药科技有限公司 | 被巯基吡咯烷甲酰哌啶取代的培南衍生物 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1283906C (en) * | 1983-05-09 | 1991-05-07 | Makoto Sunagawa | .beta.-LACTAM COMPOUNDS AND PRODUCTION THEREOF |
| DE3780344T2 (de) * | 1986-03-27 | 1993-01-28 | Sumitomo Pharma | Beta-lactam-verbindungen und deren herstellung. |
| CA2036163C (en) * | 1990-02-14 | 2001-06-19 | Makoto Sunagawa | Novel beta-lactam compounds and their production |
| IE910606A1 (en) * | 1990-02-23 | 1991-08-28 | Sankyo Co | Carbapenem derivatives having antibiotic activity, their¹preparation and their use |
| GB9107363D0 (en) * | 1991-04-08 | 1991-05-22 | Ici Plc | Antibiotic compounds |
| RU2093514C1 (ru) * | 1991-06-04 | 1997-10-20 | Санкио Компани Лимитед | Производные 1-метилкарбапенема и способ их получения |
| EP0636133A1 (en) * | 1992-04-13 | 1995-02-01 | Fujisawa Pharmaceutical Co., Ltd. | Substituted 3-pyrrolidinylthio-carbapenems as antimicrobial agents |
-
1993
- 1993-03-10 FI FI931079A patent/FI103046B1/fi active IP Right Grant
- 1993-03-10 HU HU9300677A patent/HU218676B/hu not_active IP Right Cessation
- 1993-03-10 CZ CZ1993393A patent/CZ290002B6/cs not_active IP Right Cessation
- 1993-03-11 MX MX9301361A patent/MX9301361A/es not_active IP Right Cessation
- 1993-03-11 AT AT93301872T patent/ATE173733T1/de not_active IP Right Cessation
- 1993-03-11 NO NO930884A patent/NO303730B1/no not_active IP Right Cessation
- 1993-03-11 CA CA002091486A patent/CA2091486A1/en not_active Abandoned
- 1993-03-11 RU RU9393004678A patent/RU2097383C1/ru not_active IP Right Cessation
- 1993-03-11 ES ES93301872T patent/ES2125945T3/es not_active Expired - Lifetime
- 1993-03-11 DK DK93301872T patent/DK0560613T3/da active
- 1993-03-11 TW TW082101810A patent/TW249803B/zh active
- 1993-03-11 DE DE69322188T patent/DE69322188T2/de not_active Expired - Fee Related
- 1993-03-11 NZ NZ247129A patent/NZ247129A/en unknown
- 1993-03-11 AU AU35151/93A patent/AU664422B2/en not_active Ceased
- 1993-03-11 EP EP93301872A patent/EP0560613B1/en not_active Expired - Lifetime
- 1993-03-11 IL IL105020A patent/IL105020A/xx not_active IP Right Cessation
- 1993-03-11 CN CN93104412A patent/CN1037180C/zh not_active Expired - Fee Related
- 1993-03-11 KR KR1019930003664A patent/KR100258225B1/ko not_active Expired - Fee Related
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7041660B2 (en) | 1999-07-06 | 2006-05-09 | Sankyo Company, Limited | Crystalline 1-methylcarbapenem derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| HK1011976A1 (en) | 1999-07-23 |
| HUT64071A (en) | 1993-11-29 |
| AU664422B2 (en) | 1995-11-16 |
| ES2125945T3 (es) | 1999-03-16 |
| FI103046B (fi) | 1999-04-15 |
| FI931079A0 (fi) | 1993-03-10 |
| NO303730B1 (no) | 1998-08-24 |
| FI103046B1 (fi) | 1999-04-15 |
| EP0560613A1 (en) | 1993-09-15 |
| MX9301361A (es) | 1994-01-31 |
| IL105020A0 (en) | 1993-07-08 |
| IL105020A (en) | 1997-04-15 |
| KR930019674A (ko) | 1993-10-18 |
| HU9300677D0 (en) | 1993-05-28 |
| DE69322188D1 (de) | 1999-01-07 |
| EP0560613B1 (en) | 1998-11-25 |
| TW249803B (cg-RX-API-DMAC10.html) | 1995-06-21 |
| FI931079L (fi) | 1993-09-12 |
| CN1079472A (zh) | 1993-12-15 |
| NZ247129A (en) | 1994-09-27 |
| DK0560613T3 (da) | 1999-08-09 |
| ATE173733T1 (de) | 1998-12-15 |
| CA2091486A1 (en) | 1993-09-12 |
| AU3515193A (en) | 1993-09-16 |
| NO930884D0 (no) | 1993-03-11 |
| KR100258225B1 (ko) | 2000-08-01 |
| CZ290002B6 (cs) | 2002-05-15 |
| NO930884L (no) | 1993-09-13 |
| CZ39393A3 (en) | 1993-12-15 |
| RU2097383C1 (ru) | 1997-11-27 |
| CN1037180C (zh) | 1998-01-28 |
| DE69322188T2 (de) | 1999-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4925838A (en) | 3-pyrrolidinylthio-1-azabicyclo[3.2.0]-hept-2-ene-2-carboxylic acid compounds | |
| FI96863C (fi) | Menetelmä lääkeaineina käyttökelpoisten /2-(1-homopiperatsiinikarbonyyli)pyrrolidin-4-yylitio/-6-(1-hydroksietyyli)-1-karbapen-2-eemi-3-karboksylaattisuolojen valmistamiseksi | |
| HU196800B (en) | Process for producing carbepeneme derivatives and pharmaceutical compositions containing them as active component | |
| HU218289B (en) | 1-methyl carbapenem derivatives, process for their producing and pharmaceutical compositions comprising the same | |
| HU218676B (hu) | Antimikrobiális karbapenemszármazékok, ilyen vegyületeket tartalmazó gyógyászati készítmények és eljárás ezek előállítására | |
| CA2241092C (en) | 1-methylcarbapenem derivatives | |
| EP0442497B1 (en) | Novel beta-lactam compounds and their production | |
| US5441949A (en) | Carbapenem antibiotic compounds | |
| HU196071B (en) | Process for production of carbopenems and medical compounds containing such compositions | |
| RU2162088C2 (ru) | 1-метилкарбапенем или его фармакологически приемлемые соли, композиция, способ предупреждения или лечения бактериальных инфекций | |
| KR970007946B1 (ko) | 2-(2-치환된 피롤리딘-4-일)티오-카바페넴 유도체 | |
| EP0202048B1 (en) | Carbapenem derivatives, their preparation, and pharmaceutical compositions containing them | |
| EP0449191A1 (en) | 2-(Substituted pyrrolidinylthio)carbapenem derivatives | |
| JP3199300B2 (ja) | 1−メチルカルバペネム誘導体 | |
| JP2955276B2 (ja) | 1−メチルカルバペネム誘導体を含有する抗菌剤 | |
| JP2965922B2 (ja) | 1−メチルカルバペネム誘導体 | |
| JP3344662B2 (ja) | カルバペネム−3−カルボン酸誘導体 | |
| JP3384768B2 (ja) | 1−メチルカルバペネム誘導体を含有する医薬 | |
| WO1994005667A1 (en) | Carbapenem derivatives and processes for preparing the same | |
| JPH10168081A (ja) | 1−メチルカルバペネム誘導体 | |
| JPH04234886A (ja) | 1−アザビシクロ[3.2.0]ヘプト−2−エン−2−カルボン酸化合物 | |
| HK1018260B (en) | A 1-methylcarbapenem derivative |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |