HU206085B - Process for producing optionally substituted pyridine-2,3-dicarboxylic acids - Google Patents
Process for producing optionally substituted pyridine-2,3-dicarboxylic acids Download PDFInfo
- Publication number
- HU206085B HU206085B HU891163A HU116389A HU206085B HU 206085 B HU206085 B HU 206085B HU 891163 A HU891163 A HU 891163A HU 116389 A HU116389 A HU 116389A HU 206085 B HU206085 B HU 206085B
- Authority
- HU
- Hungary
- Prior art keywords
- molar equivalents
- aqueous
- reaction mixture
- priority
- hydroxyquinoline
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 25
- GJAWHXHKYYXBSV-UHFFFAOYSA-N quinolinic acid Chemical class OC(=O)C1=CC=CN=C1C(O)=O GJAWHXHKYYXBSV-UHFFFAOYSA-N 0.000 title claims abstract description 20
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Inorganic materials Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 claims abstract description 34
- 238000002360 preparation method Methods 0.000 claims abstract description 22
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 21
- 230000003647 oxidation Effects 0.000 claims abstract description 20
- -1 substituted-8-hydroxyquinolines Chemical class 0.000 claims abstract description 15
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 55
- 239000011541 reaction mixture Substances 0.000 claims description 40
- 239000000243 solution Substances 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 13
- WJOHTKIAQIBFIO-UHFFFAOYSA-N 3-ethylquinolin-8-ol Chemical compound OC1=CC=CC2=CC(CC)=CN=C21 WJOHTKIAQIBFIO-UHFFFAOYSA-N 0.000 claims description 8
- MTAVBTGOXNGCJR-UHFFFAOYSA-N 5-ethylpyridine-2,3-dicarboxylic acid Chemical compound CCC1=CN=C(C(O)=O)C(C(O)=O)=C1 MTAVBTGOXNGCJR-UHFFFAOYSA-N 0.000 claims description 8
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 8
- 239000011707 mineral Substances 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 150000004325 8-hydroxyquinolines Chemical class 0.000 claims description 7
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 150000003248 quinolines Chemical class 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 6
- 150000007529 inorganic bases Chemical class 0.000 claims description 6
- 239000007858 starting material Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 238000003756 stirring Methods 0.000 claims description 4
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 claims description 3
- JUYUYCIJACTHMK-UHFFFAOYSA-N quinoline-8-sulfonyl chloride Chemical compound C1=CN=C2C(S(=O)(=O)Cl)=CC=CC2=C1 JUYUYCIJACTHMK-UHFFFAOYSA-N 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- JPIJMXOJEHMTPU-UHFFFAOYSA-N 5-methylpyridine-2,3-dicarboxylic acid Chemical compound CC1=CN=C(C(O)=O)C(C(O)=O)=C1 JPIJMXOJEHMTPU-UHFFFAOYSA-N 0.000 claims description 2
- WREVVZMUNPAPOV-UHFFFAOYSA-N 8-aminoquinoline Chemical compound C1=CN=C2C(N)=CC=CC2=C1 WREVVZMUNPAPOV-UHFFFAOYSA-N 0.000 claims description 2
- 238000001816 cooling Methods 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 239000005725 8-Hydroxyquinoline Substances 0.000 claims 2
- 229960003540 oxyquinoline Drugs 0.000 claims 2
- LHPOFWYKNOUJJN-UHFFFAOYSA-N 3-methylquinolin-8-ol Chemical compound OC1=CC=CC2=CC(C)=CN=C21 LHPOFWYKNOUJJN-UHFFFAOYSA-N 0.000 claims 1
- OQHHSGRZCKGLCY-UHFFFAOYSA-N 8-nitroquinoline Chemical compound C1=CN=C2C([N+](=O)[O-])=CC=CC2=C1 OQHHSGRZCKGLCY-UHFFFAOYSA-N 0.000 claims 1
- CTQMJYWDVABFRZ-UHFFFAOYSA-N cloxiquine Chemical compound C1=CN=C2C(O)=CC=C(Cl)C2=C1 CTQMJYWDVABFRZ-UHFFFAOYSA-N 0.000 claims 1
- 229950003660 cloxiquine Drugs 0.000 claims 1
- GYESAYHWISMZOK-UHFFFAOYSA-N quinolin-5-ol Chemical compound C1=CC=C2C(O)=CC=CC2=N1 GYESAYHWISMZOK-UHFFFAOYSA-N 0.000 claims 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 20
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 13
- 239000000047 product Substances 0.000 description 12
- 239000005708 Sodium hypochlorite Substances 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 229910019093 NaOCl Inorganic materials 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 2
- ACKBYYXIYCPBIT-UHFFFAOYSA-N 3-methylquinolin-8-ol;hydrochloride Chemical compound Cl.OC1=CC=CC2=CC(C)=CN=C21 ACKBYYXIYCPBIT-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- STNJBCKSHOAVAJ-UHFFFAOYSA-N Methacrolein Chemical compound CC(=C)C=O STNJBCKSHOAVAJ-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 229940035429 isobutyl alcohol Drugs 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- GMLDCZYTIPCVMO-UHFFFAOYSA-N 2-methylidenebutanal Chemical compound CCC(=C)C=O GMLDCZYTIPCVMO-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 238000006890 Doebner-Miller synthesis reaction Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 238000005614 Skraup synthesis reaction Methods 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- NLVZUORLSQCGFQ-UHFFFAOYSA-N furo[3,4-b]quinoline-1,3-dione Chemical class C1=CC=C2C=C3C(=O)OC(=O)C3=NC2=C1 NLVZUORLSQCGFQ-UHFFFAOYSA-N 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- YHUVMHKAHWKQBI-UHFFFAOYSA-N quinoline-2,3-dicarboxylic acid Chemical compound C1=CC=C2N=C(C(O)=O)C(C(=O)O)=CC2=C1 YHUVMHKAHWKQBI-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- RXLFQTYQVYELBJ-UHFFFAOYSA-N sodium;hydrogen peroxide;hypochlorite Chemical compound [Na+].OO.Cl[O-] RXLFQTYQVYELBJ-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/803—Processes of preparation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Quinoline Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US16635988A | 1988-03-10 | 1988-03-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU206085B true HU206085B (en) | 1992-08-28 |
Family
ID=22602953
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU891163A HU206085B (en) | 1988-03-10 | 1989-03-09 | Process for producing optionally substituted pyridine-2,3-dicarboxylic acids |
Country Status (17)
| Country | Link |
|---|---|
| EP (1) | EP0331899B1 (Direct) |
| JP (1) | JP2689394B2 (Direct) |
| KR (1) | KR970011790B1 (Direct) |
| CN (1) | CN1027813C (Direct) |
| AR (1) | AR246513A1 (Direct) |
| AT (1) | ATE104964T1 (Direct) |
| AU (1) | AU611000B2 (Direct) |
| BR (1) | BR8901092A (Direct) |
| CA (1) | CA1327584C (Direct) |
| DE (1) | DE68914869T2 (Direct) |
| DK (1) | DK169671B1 (Direct) |
| ES (1) | ES2063061T3 (Direct) |
| HU (1) | HU206085B (Direct) |
| IE (1) | IE64009B1 (Direct) |
| IL (1) | IL89142A (Direct) |
| TW (1) | TW198714B (Direct) |
| ZA (1) | ZA891821B (Direct) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2058625T3 (es) | 1989-03-22 | 1994-11-01 | American Cyanamid Co | Metodo para la oxidacion secuencial de quinolinas sustituidas para producir acidos piridin-2,3-dicarboxilicos sustituidos. |
| US5281713A (en) * | 1991-12-20 | 1994-01-25 | American Cyanamid Company | Process for the manufacture of 2-alkoxymethylacrolein |
| ATE165347T1 (de) * | 1993-12-28 | 1998-05-15 | American Cyanamid Co | Verfahren zur herstellung pyridin-2,3- dicarboxylicsäure |
| US5597924A (en) * | 1995-05-24 | 1997-01-28 | American Cyanamid Company | Coversion of substituted 8-chloroquinolines to substituted 8-hydroxyquinolines |
| NZ314904A (en) * | 1996-06-10 | 1998-06-26 | American Cyanamid Co | Preparation of a herbicidal [(5,6-dicarboxy-3-pyridyl)methyl]ammonium halide |
| CN109225323B (zh) * | 2018-10-26 | 2021-07-27 | 闽江学院 | 磺酸基官能化有机/无机双阳离子-钒掺杂杂多酸阴离子复合杂化体及其合成与应用 |
| CN113813895B (zh) * | 2021-07-20 | 2023-03-31 | 上海罕道医药科技有限公司 | 一种连续反应装置与一种5-硝基吡啶-3-甲酸的连续制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2028834T3 (es) * | 1986-09-12 | 1992-07-16 | American Cyanamid Company | Metodo para la preparacion de accidos piridin-2,3-dicarboxilico. |
-
1989
- 1989-02-01 IL IL89142A patent/IL89142A/xx unknown
- 1989-02-02 DE DE68914869T patent/DE68914869T2/de not_active Expired - Lifetime
- 1989-02-02 AT AT8989101766T patent/ATE104964T1/de not_active IP Right Cessation
- 1989-02-02 ES ES89101766T patent/ES2063061T3/es not_active Expired - Lifetime
- 1989-02-02 EP EP89101766A patent/EP0331899B1/en not_active Expired - Lifetime
- 1989-02-24 CN CN89100922A patent/CN1027813C/zh not_active Expired - Lifetime
- 1989-03-07 JP JP1053056A patent/JP2689394B2/ja not_active Expired - Lifetime
- 1989-03-08 CA CA000593053A patent/CA1327584C/en not_active Expired - Lifetime
- 1989-03-09 KR KR1019890002906A patent/KR970011790B1/ko not_active Expired - Fee Related
- 1989-03-09 AR AR89313384A patent/AR246513A1/es active
- 1989-03-09 HU HU891163A patent/HU206085B/hu not_active IP Right Cessation
- 1989-03-09 AU AU31187/89A patent/AU611000B2/en not_active Expired
- 1989-03-09 DK DK114789A patent/DK169671B1/da not_active IP Right Cessation
- 1989-03-09 ZA ZA891821A patent/ZA891821B/xx unknown
- 1989-03-09 BR BR898901092A patent/BR8901092A/pt not_active IP Right Cessation
- 1989-03-09 IE IE76489A patent/IE64009B1/en not_active IP Right Cessation
-
1990
- 1990-07-10 TW TW078101863A01A patent/TW198714B/zh active
Also Published As
| Publication number | Publication date |
|---|---|
| JP2689394B2 (ja) | 1997-12-10 |
| ES2063061T3 (es) | 1995-01-01 |
| EP0331899B1 (en) | 1994-04-27 |
| ATE104964T1 (de) | 1994-05-15 |
| IE64009B1 (en) | 1995-06-28 |
| KR970011790B1 (ko) | 1997-07-16 |
| KR890014487A (ko) | 1989-10-24 |
| BR8901092A (pt) | 1989-10-31 |
| EP0331899A3 (en) | 1990-09-12 |
| DE68914869T2 (de) | 1994-12-08 |
| AR246513A1 (es) | 1994-08-31 |
| AU611000B2 (en) | 1991-05-30 |
| CN1027813C (zh) | 1995-03-08 |
| EP0331899A2 (en) | 1989-09-13 |
| DK169671B1 (da) | 1995-01-09 |
| IL89142A0 (en) | 1989-09-10 |
| DK114789A (da) | 1989-09-11 |
| IL89142A (en) | 1993-04-04 |
| DK114789D0 (da) | 1989-03-09 |
| IE890764L (en) | 1989-09-10 |
| DE68914869D1 (de) | 1994-06-01 |
| TW198714B (Direct) | 1993-01-21 |
| AU3118789A (en) | 1989-09-14 |
| CA1327584C (en) | 1994-03-08 |
| CN1044463A (zh) | 1990-08-08 |
| ZA891821B (en) | 1989-11-29 |
| JPH01268677A (ja) | 1989-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR870001944B1 (ko) | 퀴놀린 카르복실산 유도체의 제조방법 | |
| HU206085B (en) | Process for producing optionally substituted pyridine-2,3-dicarboxylic acids | |
| KR0141483B1 (ko) | 치환된 피리딘-2,3-디카르복실산의 제조 방법 | |
| JPH06256257A (ja) | フルオロ−トリフルオロメチル安息香酸誘導体類 | |
| US3201406A (en) | Pyridylcoumarins | |
| JPH04230265A (ja) | キノリンカルボン酸の製造方法 | |
| US4814486A (en) | Method for the preparation of anilinofumarate | |
| US5166354A (en) | Quinoline derivatives and processes for the preparation thereof | |
| US5315007A (en) | Process for making DE ring intermediates for the synthesis of camptothecin and camptothecin analogs | |
| US4925970A (en) | Process for producing cyclohexadiene thioether | |
| NO824273L (no) | 6-(1-hydroksy-2-t-butylaminp-etyl)-pyridin-n-oksyd-derivater og fremgangsmaate for fremstilling og anvendelse derav | |
| JPH04290883A (ja) | キノリニウム塩およびその製造方法 | |
| US4904816A (en) | Process for the manufacture of anilinofumarate via chloromaleate or chlorofumarate or mixtures thereof | |
| KR870001624B1 (ko) | 퀴롤논 유도체의 합성 방법 | |
| US4699984A (en) | Preparation of intermediates to 6-fluoro-7-(2,6-dimethylpyridyl)quinoline carboxylic acids and compounds | |
| US4552963A (en) | Preparation of 1-alkyl-1,4-dihydro-4-oxo-7-(4-pyridyl)-3-quinolinecarboxylic acid | |
| US4847405A (en) | Method for the preparation of anilinofumarate [quinoline-2,3- dicarboxylic] | |
| US4727148A (en) | Certain aromatization process for preparing 1-alkyl-1,4-dihydro-4-oxo-7-(4-pyridyl)-3-quinoline carboxylic acid | |
| KR900001219B1 (ko) | 퀴놀린 유도체의 제조방법 | |
| US4990648A (en) | Process for producing an alkylthiobenzoate | |
| EP0245913B1 (en) | Process for preparing 6,7-dihydro-5,8-dimethyl-9-fluoro-1-oxo-1H,5H-benzo[i,j]quinolizine-2-carboxylic acid | |
| IE43737B1 (en) | 3-hydroxymethylene-6,7-dimethoxy-2-methyl-4-oxo-1,2,3,4-tetrahydro-1-quinoline carboxylic acid esters | |
| US4649202A (en) | Brominative aromatization of 4-cyclohexenylpyridines | |
| KR100310786B1 (ko) | 광학활성 퀴놀론카르복실산 유도체의 제조방법 | |
| DK162517B (da) | 3-hydroxy-3-(2-methyl-5-pyridyl)-propionsyrealkylestere samt fremgangsmaade til fremstilling deraf |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |