HU197913B - Process for producing thiazolo-, thiazino- and thiazepinopyrimidine derivatives - Google Patents
Process for producing thiazolo-, thiazino- and thiazepinopyrimidine derivatives Download PDFInfo
- Publication number
- HU197913B HU197913B HU551286A HU551286A HU197913B HU 197913 B HU197913 B HU 197913B HU 551286 A HU551286 A HU 551286A HU 551286 A HU551286 A HU 551286A HU 197913 B HU197913 B HU 197913B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- hydrogen
- compound
- reaction
- carried out
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 39
- 230000008569 process Effects 0.000 title claims abstract description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 49
- 239000001257 hydrogen Substances 0.000 claims abstract description 31
- 238000002360 preparation method Methods 0.000 claims abstract description 29
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 20
- QCAWOHUJKPKOMD-UHFFFAOYSA-N 4,6-diamino-1h-pyrimidine-2-thione Chemical compound NC1=CC(N)=NC(S)=N1 QCAWOHUJKPKOMD-UHFFFAOYSA-N 0.000 claims abstract description 15
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 10
- 150000002431 hydrogen Chemical group 0.000 claims abstract description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 7
- 150000003230 pyrimidines Chemical class 0.000 claims abstract description 7
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 claims abstract description 6
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 78
- -1 alkali metal bicarbonate Chemical class 0.000 claims description 37
- 150000003839 salts Chemical class 0.000 claims description 28
- 239000002253 acid Substances 0.000 claims description 27
- 239000011541 reaction mixture Substances 0.000 claims description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 23
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical group [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 14
- 229910052794 bromium Inorganic materials 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 230000003308 immunostimulating effect Effects 0.000 claims description 9
- 239000003960 organic solvent Substances 0.000 claims description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 6
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 claims description 6
- 238000010992 reflux Methods 0.000 claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 5
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 206010029897 Obsessive thoughts Diseases 0.000 claims description 4
- 150000008065 acid anhydrides Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000004677 hydrates Chemical class 0.000 claims description 4
- 150000002540 isothiocyanates Chemical class 0.000 claims description 4
- 239000002516 radical scavenger Substances 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 230000010933 acylation Effects 0.000 claims description 3
- 238000005917 acylation reaction Methods 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 3
- 150000008041 alkali metal carbonates Chemical group 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 claims description 2
- 229960001438 immunostimulant agent Drugs 0.000 claims description 2
- 239000003022 immunostimulating agent Substances 0.000 claims description 2
- 150000003462 sulfoxides Chemical class 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims 1
- 239000011230 binding agent Substances 0.000 claims 1
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- 210000000987 immune system Anatomy 0.000 abstract description 5
- 230000004936 stimulating effect Effects 0.000 abstract description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 abstract 1
- 101150065749 Churc1 gene Proteins 0.000 abstract 1
- 102100038239 Protein Churchill Human genes 0.000 abstract 1
- 239000000825 pharmaceutical preparation Substances 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 35
- 238000004458 analytical method Methods 0.000 description 22
- 229910052757 nitrogen Inorganic materials 0.000 description 18
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- 238000002844 melting Methods 0.000 description 15
- 230000008018 melting Effects 0.000 description 15
- 235000019441 ethanol Nutrition 0.000 description 14
- 239000002585 base Substances 0.000 description 12
- 229960005486 vaccine Drugs 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 210000004027 cell Anatomy 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- 230000036039 immunity Effects 0.000 description 5
- 210000004698 lymphocyte Anatomy 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 231100000433 cytotoxic Toxicity 0.000 description 4
- 230000001472 cytotoxic effect Effects 0.000 description 4
- 230000002163 immunogen Effects 0.000 description 4
- 239000012429 reaction media Substances 0.000 description 4
- 230000009257 reactivity Effects 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000427 antigen Substances 0.000 description 3
- 108091007433 antigens Proteins 0.000 description 3
- 102000036639 antigens Human genes 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 210000003743 erythrocyte Anatomy 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 244000052769 pathogen Species 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 229940086542 triethylamine Drugs 0.000 description 3
- REGFWZVTTFGQOJ-UHFFFAOYSA-N 4,5-dihydro-1,3-thiazol-2-amine Chemical compound NC1=NCCS1 REGFWZVTTFGQOJ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 208000035473 Communicable disease Diseases 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 241001494479 Pecora Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 230000024932 T cell mediated immunity Effects 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- ZOJBYZNEUISWFT-UHFFFAOYSA-N allyl isothiocyanate Chemical compound C=CCN=C=S ZOJBYZNEUISWFT-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical class 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 230000002238 attenuated effect Effects 0.000 description 2
- MDKCFLQDBWCQCV-UHFFFAOYSA-N benzyl isothiocyanate Chemical compound S=C=NCC1=CC=CC=C1 MDKCFLQDBWCQCV-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- HBNYJWAFDZLWRS-UHFFFAOYSA-N ethyl isothiocyanate Chemical compound CCN=C=S HBNYJWAFDZLWRS-UHFFFAOYSA-N 0.000 description 2
- 230000002068 genetic effect Effects 0.000 description 2
- 230000002519 immonomodulatory effect Effects 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 230000001717 pathogenic effect Effects 0.000 description 2
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- UWTUEMKLYAGTNQ-OWOJBTEDSA-N (e)-1,2-dibromoethene Chemical group Br\C=C\Br UWTUEMKLYAGTNQ-OWOJBTEDSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- SHKKTLSDGJRCTR-UHFFFAOYSA-N 1,2-dibromoethylbenzene Chemical compound BrCC(Br)C1=CC=CC=C1 SHKKTLSDGJRCTR-UHFFFAOYSA-N 0.000 description 1
- XFNJYAKDBJUJAJ-UHFFFAOYSA-N 1,2-dibromopropane Chemical compound CC(Br)CBr XFNJYAKDBJUJAJ-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ZVUPZOCDOUTPAT-UHFFFAOYSA-N 2H-1,3-thiazin-3-ium bromide Chemical compound [Br-].S1C[NH+]=CC=C1 ZVUPZOCDOUTPAT-UHFFFAOYSA-N 0.000 description 1
- COIWVQMDYLYDEE-UHFFFAOYSA-N 5-imino-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-7-amine Chemical compound NC1=CC(=N)N2CCSC2=N1 COIWVQMDYLYDEE-UHFFFAOYSA-N 0.000 description 1
- VXIGCHPPYCNAAT-UHFFFAOYSA-N 5-imino-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-7-amine;hydrobromide Chemical compound Br.NC1=CC(=N)N2CCSC2=N1 VXIGCHPPYCNAAT-UHFFFAOYSA-N 0.000 description 1
- HXOIDKSFAHIPOW-UHFFFAOYSA-N 5-imino-2-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-7-amine;hydrobromide Chemical compound Br.S1C2=NC(N)=CC(=N)N2CC1C1=CC=CC=C1 HXOIDKSFAHIPOW-UHFFFAOYSA-N 0.000 description 1
- QYNWRTYZXSHSCH-UHFFFAOYSA-N 5-imino-[1,3]thiazolo[3,2-a]pyrimidin-7-amine;hydrate;hydrobromide Chemical compound O.Br.NC1=CC(=N)N2C=CSC2=N1 QYNWRTYZXSHSCH-UHFFFAOYSA-N 0.000 description 1
- RDTNWFGFTOKLPA-UHFFFAOYSA-N 5h-[1,3]thiazolo[3,2-a]pyrimidine;hydrobromide Chemical compound Br.C1C=CN=C2SC=CN12 RDTNWFGFTOKLPA-UHFFFAOYSA-N 0.000 description 1
- UJABRLDFXPAVAT-UHFFFAOYSA-N 6-imino-3,4-dihydro-2h-pyrimido[2,1-b][1,3]thiazin-8-amine;hydrobromide Chemical compound Br.C1CCSC2=NC(N)=CC(=N)N21 UJABRLDFXPAVAT-UHFFFAOYSA-N 0.000 description 1
- MZNDEMJFAPFSNI-UHFFFAOYSA-N 6-imino-3-methyl-2h-pyrimido[2,1-b][1,3]thiazin-8-amine;hydrobromide Chemical compound Br.S1CC(C)=CN2C1=NC(N)=CC2=N MZNDEMJFAPFSNI-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- YZENQGBVHTYEQJ-UHFFFAOYSA-N C(C1=CC=CC=C1)NC(=S)NC=1N=C2N(C(C=1)=N)CCS2 Chemical compound C(C1=CC=CC=C1)NC(=S)NC=1N=C2N(C(C=1)=N)CCS2 YZENQGBVHTYEQJ-UHFFFAOYSA-N 0.000 description 1
- QTYSVRIOOHBJKP-UHFFFAOYSA-N C1(=CC=CC=C1)NC(=S)NC=1N=C2N(C(C1)=N)CCS2 Chemical compound C1(=CC=CC=C1)NC(=S)NC=1N=C2N(C(C1)=N)CCS2 QTYSVRIOOHBJKP-UHFFFAOYSA-N 0.000 description 1
- CAUFPXNGLTVRAE-UHFFFAOYSA-N C1(=CC=CC=C1)NC(=S)NC=1N=C2SCCCN2C(C=1)=N Chemical compound C1(=CC=CC=C1)NC(=S)NC=1N=C2SCCCN2C(C=1)=N CAUFPXNGLTVRAE-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- YDFSEPBNLQKMTC-UHFFFAOYSA-N Cl.CCNC(=S)NC1=CC(=N)N2CCSC2=N1 Chemical compound Cl.CCNC(=S)NC1=CC(=N)N2CCSC2=N1 YDFSEPBNLQKMTC-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 206010018910 Haemolysis Diseases 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- 206010061598 Immunodeficiency Diseases 0.000 description 1
- 208000029462 Immunodeficiency disease Diseases 0.000 description 1
- 150000000994 L-ascorbates Chemical class 0.000 description 1
- NTXGVAMLNJBXCX-UHFFFAOYSA-N N-(5-acetylimino-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)acetamide hydrochloride Chemical compound Cl.CC(=O)NC1=CC(=NC(C)=O)N2CCSC2=N1 NTXGVAMLNJBXCX-UHFFFAOYSA-N 0.000 description 1
- QAADZYUXQLUXFX-UHFFFAOYSA-N N-phenylmethylthioformamide Natural products S=CNCC1=CC=CC=C1 QAADZYUXQLUXFX-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- XQHVIWXISRAXOM-UHFFFAOYSA-N O.O.C(O)(O)=O.NC=1N=C2SCCCN2C(C1)=N Chemical compound O.O.C(O)(O)=O.NC=1N=C2SCCCN2C(C1)=N XQHVIWXISRAXOM-UHFFFAOYSA-N 0.000 description 1
- HIAVMSYTICWXRI-UHFFFAOYSA-N O.O.Cl.NC=1N=C2N(C(C1)=N)CCS2 Chemical compound O.O.Cl.NC=1N=C2N(C(C1)=N)CCS2 HIAVMSYTICWXRI-UHFFFAOYSA-N 0.000 description 1
- 210000001744 T-lymphocyte Anatomy 0.000 description 1
- 238000003673 Traube synthesis reaction Methods 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000000735 allogeneic effect Effects 0.000 description 1
- 235000016720 allyl isothiocyanate Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000035584 blastogenesis Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000000601 blood cell Anatomy 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 230000002032 cellular defenses Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000008614 cellular interaction Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 235000019788 craving Nutrition 0.000 description 1
- 239000000824 cytostatic agent Substances 0.000 description 1
- 230000001085 cytostatic effect Effects 0.000 description 1
- 230000007123 defense Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000001605 fetal effect Effects 0.000 description 1
- 239000012997 ficoll-paque Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000008588 hemolysis Effects 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 230000001900 immune effect Effects 0.000 description 1
- 230000037189 immune system physiology Effects 0.000 description 1
- 230000007813 immunodeficiency Effects 0.000 description 1
- 238000012744 immunostaining Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- YDNLNVZZTACNJX-UHFFFAOYSA-N isocyanatomethylbenzene Chemical compound O=C=NCC1=CC=CC=C1 YDNLNVZZTACNJX-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000002906 microbiologic effect Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000010172 mouse model Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 229940117953 phenylisothiocyanate Drugs 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 238000013310 pig model Methods 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- BATMYWDOUUWCJE-UHFFFAOYSA-N pyrimidin-1-ium;bromide Chemical compound Br.C1=CN=CN=C1 BATMYWDOUUWCJE-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 238000002255 vaccination Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Landscapes
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (34)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU551286A HU197913B (en) | 1986-12-30 | 1986-12-30 | Process for producing thiazolo-, thiazino- and thiazepinopyrimidine derivatives |
| ZA879379A ZA879379B (en) | 1986-12-30 | 1987-12-14 | Pyrimidine derivatives |
| US07/136,420 US4921854A (en) | 1986-12-30 | 1987-12-22 | Condensed thiazolopyrimidine, pyrimido-thiazine or thiazepine pyrimidine compounds |
| DE19873743935 DE3743935A1 (de) | 1986-12-30 | 1987-12-23 | Kondensierte pyrimidinderivate mit einem an den pyrimidinring ankondensierten, ein schwefelatom aufweisenden ring, verfahren zu ihrer herstellung und diese enthaltende arzneimittel sowie 2-(halogenalkylenthio)- beziehungsweise 2-(halogenvinylenthio)-4,6-di-(amino)-pyrimidine und verfahren zur herstellung der letzteren |
| CH5083/87A CH676599A5 (cs) | 1986-12-30 | 1987-12-28 | |
| PH36312A PH24384A (en) | 1986-12-30 | 1987-12-29 | Aminoalkanoyl-dibenzo (d,g) (1,3,6) dioxazocines and composition thereof |
| NL8703148A NL8703148A (nl) | 1986-12-30 | 1987-12-29 | Pyrimidinederivaten. |
| YU241987A YU46433B (sh) | 1986-12-30 | 1987-12-29 | Postupak za dobijanje kondenzovanih derivata pirimidina |
| PH36314A PH24290A (en) | 1986-12-30 | 1987-12-29 | Pyrimidine derivatives,pharmaceutical compositions containing them and method of use thereof |
| CS8710090A CZ278692B6 (en) | 1986-12-30 | 1987-12-29 | Process for preparing condensed pyrimidine derivatives |
| CN87105992A CN1024277C (zh) | 1986-12-30 | 1987-12-29 | 嘧啶衍生物的制备方法 |
| DK692587A DK692587A (da) | 1986-12-30 | 1987-12-30 | Pyrimidinderivater |
| ES8703764A ES2008945A6 (es) | 1986-12-30 | 1987-12-30 | Procedimiento de preparacion de nuevos derivados pirimidinas condensados. |
| DD31178987A DD279676A5 (de) | 1986-12-30 | 1987-12-30 | Verfahren zur herstellung von neuen kondensierten pyrimidinderivaten |
| SU874203951A SU1650014A3 (ru) | 1986-12-30 | 1987-12-30 | Способ получени конденсированных производных пиримидина, их фармацевтически приемлемых кислых аддитивных солей или кислых аддитивных солей гидратов |
| FR878718366A FR2609033B1 (fr) | 1986-12-30 | 1987-12-30 | Derives de la pyrimidine, leur preparation et compositions les contenant |
| KR1019870015441A KR940002669B1 (ko) | 1986-12-30 | 1987-12-30 | 피리미딘 유도체 |
| IL84988A IL84988A0 (en) | 1986-12-30 | 1987-12-30 | Pyrimidine derivatives,their preparation and pharmaceutical compositions containing them |
| GR872084A GR872084B (en) | 1986-12-30 | 1987-12-30 | Preparation process of pyrimidine derivatives |
| AT0345187A AT397802B (de) | 1986-12-30 | 1987-12-30 | Pyrimidinderivate |
| SE8705196A SE8705196L (sv) | 1986-12-30 | 1987-12-30 | Pyrimidinderivat |
| PL1987269811A PL149618B1 (en) | 1986-12-30 | 1987-12-30 | Method of obtaining novel derivatives of pyrimidine |
| BG082461A BG82461A (bg) | 1986-12-30 | 1987-12-30 | Пиримидинови производни |
| FI875766A FI86637C (fi) | 1986-12-30 | 1987-12-30 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara tiazolo/3,2a/ pyrimidinderivat. |
| IT8723272A IT1233444B (it) | 1986-12-30 | 1987-12-30 | Derivati pirimidinici condensati e procedimento per la loro preparazione. |
| BE8701500A BE1003067A5 (fr) | 1986-12-30 | 1987-12-30 | Derives de la pyrimidine. |
| AU83144/87A AU597770B2 (en) | 1986-12-30 | 1987-12-30 | Pyrimidine derivatives |
| PL28053287A PL151086B1 (en) | 1986-12-30 | 1987-12-30 | Process for preparing condensed pyrimidine derivatives |
| GB8730297A GB2199581B (en) | 1986-12-30 | 1987-12-30 | Pyrimidine derivatives |
| CA000555670A CA1324788C (en) | 1986-12-30 | 1987-12-30 | Pyrimidine derivatives |
| JP63000044A JPS63174991A (ja) | 1986-12-30 | 1988-01-04 | 新規な縮合ピリミジン誘導体及び製薬的に使用し得るその酸付加塩 |
| SU884613153A SU1746885A3 (ru) | 1986-12-30 | 1988-12-26 | Способ получени 7-амино-5-имино-2,3-дигидро-5Н-тиазоло[3,2-а]пиримидина, или его фармацевтически приемлемых кислотно-аддитивных солей, или гидратов |
| YU4989A YU46483B (sh) | 1986-12-30 | 1989-01-11 | Postupak za dobijanje kondenzovanih derivata pirimidina |
| CS892398A CZ278709B6 (en) | 1986-12-30 | 1989-04-18 | Process for preparing condensed pyrimidine derivatives |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU551286A HU197913B (en) | 1986-12-30 | 1986-12-30 | Process for producing thiazolo-, thiazino- and thiazepinopyrimidine derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT46022A HUT46022A (en) | 1988-09-28 |
| HU197913B true HU197913B (en) | 1989-06-28 |
Family
ID=10970379
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU551286A HU197913B (en) | 1986-12-30 | 1986-12-30 | Process for producing thiazolo-, thiazino- and thiazepinopyrimidine derivatives |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS63174991A (cs) |
| CZ (1) | CZ278692B6 (cs) |
| DD (1) | DD279676A5 (cs) |
| HU (1) | HU197913B (cs) |
| IT (1) | IT1233444B (cs) |
| PL (1) | PL151086B1 (cs) |
| SU (1) | SU1746885A3 (cs) |
| ZA (1) | ZA879379B (cs) |
-
1986
- 1986-12-30 HU HU551286A patent/HU197913B/hu not_active IP Right Cessation
-
1987
- 1987-12-14 ZA ZA879379A patent/ZA879379B/xx unknown
- 1987-12-29 CZ CS8710090A patent/CZ278692B6/cs unknown
- 1987-12-30 PL PL28053287A patent/PL151086B1/pl unknown
- 1987-12-30 DD DD31178987A patent/DD279676A5/de not_active IP Right Cessation
- 1987-12-30 IT IT8723272A patent/IT1233444B/it active
-
1988
- 1988-01-04 JP JP63000044A patent/JPS63174991A/ja active Granted
- 1988-12-26 SU SU884613153A patent/SU1746885A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| CZ278692B6 (en) | 1994-05-18 |
| IT8723272A0 (it) | 1987-12-30 |
| PL151086B1 (en) | 1990-07-31 |
| ZA879379B (en) | 1988-10-26 |
| HUT46022A (en) | 1988-09-28 |
| JPH0584319B2 (cs) | 1993-12-01 |
| CS1009087A2 (en) | 1990-09-12 |
| IT1233444B (it) | 1992-04-01 |
| SU1746885A3 (ru) | 1992-07-07 |
| JPS63174991A (ja) | 1988-07-19 |
| DD279676A5 (de) | 1990-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69202243T2 (de) | 2,4-Diaminochinazolin-Derivate, um die Antitumorwirkung zu erhöhen. | |
| EP0082023A2 (en) | Thienopyrimidine derivatives, their preparation and their medical use | |
| DE69201559T2 (de) | Pyrimidinderivate zur erhöhung der antitumoraktivität. | |
| DE69112192T2 (de) | Antiherpes-Castanosperminester. | |
| US4921854A (en) | Condensed thiazolopyrimidine, pyrimido-thiazine or thiazepine pyrimidine compounds | |
| US3542785A (en) | 2-hydroxy-4-aryl-quinolines | |
| HU197913B (en) | Process for producing thiazolo-, thiazino- and thiazepinopyrimidine derivatives | |
| US4705787A (en) | Quinazolinone derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| US3311628A (en) | Derivatives of pyrrolo [2, 3-d] pyrimidine | |
| EP0454060B1 (de) | 3-(Mercaptoalkyl)-chinazolin-2,4(1H,3H)-dione, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen | |
| US3296261A (en) | 6-hydroxy-pyrimidine-5-acetamides | |
| EP0211157B1 (de) | Isoxazolderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutischen Präparate | |
| US4452982A (en) | Process for the preparation of nitrogen-bridgehead condensed pyrimidine compounds, and pharmaceutical compositions containing them | |
| SU1355131A3 (ru) | Способ получени замещенных производных карбокситиазоло[3,2-а]пиримидина или их фармацевтически приемлемых солей | |
| US3755314A (en) | Novel 2-acryloyl benzimidazoles, their process of preparation and their therapeutic application | |
| EP0003360A1 (de) | Neue Azathianaphthalinderivate, Verfahren zu ihrer Herstellung, diese enthaltende pharmazeutische Präparate und ihre Verwendung | |
| EP0004059B1 (en) | Synthesis of 1-(thiocarbamoyl)-2-imidazolidinone and immunosuppressive compositions containing it | |
| DE2647322A1 (de) | Bicyclomycinderivate und verfahren zu ihrer herstellung | |
| KR790000979B1 (ko) | N-2-(6-하이드록시벤조치아조릴)-n'-페닐(혹은 치환된 페닐) 우레아류의 제조방법 | |
| US3668205A (en) | Benzylamino quinazolinyl formamidine compounds | |
| JPS63301881A (ja) | インドリルピペリジン誘導体 | |
| CZ278709B6 (en) | Process for preparing condensed pyrimidine derivatives | |
| DD298784A5 (de) | 3-(mercaptoalkyl)chinazolin-2,4(1h,3h)-dione, verfahren zu ihrer herstellung und pharmazeutische zubereitungen | |
| JP2000504305A (ja) | Ｈ▲下２▼受容体拮抗剤としての（４−（３−アミノメチルフェニル）チアゾール−２−イル）グアニジン類 | |
| JPS606944B2 (ja) | 新規ウラシル誘導体の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |