HU196396B - Process for n-alkylating dihydro-lisergic acid - Google Patents
Process for n-alkylating dihydro-lisergic acid Download PDFInfo
- Publication number
- HU196396B HU196396B HU864145A HU414586A HU196396B HU 196396 B HU196396 B HU 196396B HU 864145 A HU864145 A HU 864145A HU 414586 A HU414586 A HU 414586A HU 196396 B HU196396 B HU 196396B
- Authority
- HU
- Hungary
- Prior art keywords
- sub
- acid
- mmol
- alkyl
- formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 33
- 239000002253 acid Substances 0.000 title description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 13
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical class [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 claims abstract description 3
- 229940077388 benzenesulfonate Drugs 0.000 claims abstract description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical group [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 30
- 238000002360 preparation method Methods 0.000 claims description 10
- 239000000463 material Substances 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 239000000010 aprotic solvent Substances 0.000 claims description 2
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 2
- -1 bromo, methyl Chemical group 0.000 abstract description 16
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 13
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- 238000005804 alkylation reaction Methods 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 230000029936 alkylation Effects 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- ORBSYPFBZQJNJE-MPKXVKKWSA-N (6ar,9r,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1=CC([C@H]2C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ORBSYPFBZQJNJE-MPKXVKKWSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 239000002168 alkylating agent Substances 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 229940100198 alkylating agent Drugs 0.000 description 5
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 150000002475 indoles Chemical class 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- XGYGRQGHYWSQOV-POWSATBFSA-N (6ar,10ar)-7-methyl-4-pentan-3-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1([C@@H]2[C@H](N(CC(C2)C(O)=O)C)C2)=CC=CC3=C1C2=CN3C(CC)CC XGYGRQGHYWSQOV-POWSATBFSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 230000002152 alkylating effect Effects 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000004503 metal oxide affinity chromatography Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- QDCCHSDAIHXEKD-POWSATBFSA-N (6ar,10ar)-4-cyclopentyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C([C@@H]1[C@@H](C=2C=CC=C3C4=2)CC(CN1C)C(O)=O)C4=CN3C1CCCC1 QDCCHSDAIHXEKD-POWSATBFSA-N 0.000 description 1
- NAGMITMLYCSORO-RJPUVWTNSA-N (6ar,10ar)-7-methyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1([C@@H]2[C@H](N(CC(C2)C(O)=O)C)C2)=CC=CC3=C1C2=CN3C(C)C NAGMITMLYCSORO-RJPUVWTNSA-N 0.000 description 1
- BLRHMMGNCXNXJL-UHFFFAOYSA-N 1-methylindole Chemical compound C1=CC=C2N(C)C=CC2=C1 BLRHMMGNCXNXJL-UHFFFAOYSA-N 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- DQAHNGDSMVTVLQ-UHFFFAOYSA-N CCC(C(C)C)c1ccc(cc1)S(O)(=O)=O Chemical compound CCC(C(C)C)c1ccc(cc1)S(O)(=O)=O DQAHNGDSMVTVLQ-UHFFFAOYSA-N 0.000 description 1
- 206010007270 Carcinoid syndrome Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 206010026749 Mania Diseases 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 206010029216 Nervousness Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 206010047115 Vasculitis Diseases 0.000 description 1
- DXGTUUQHTDOFFQ-UHFFFAOYSA-N [N].C1=CC=C2NC=CC2=C1 Chemical group [N].C1=CC=C2NC=CC2=C1 DXGTUUQHTDOFFQ-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000004596 appetite loss Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- OVHDZBAFUMEXCX-UHFFFAOYSA-N benzyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1=CC=CC=C1 OVHDZBAFUMEXCX-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- ZWOQVPFVARFZSF-UHFFFAOYSA-N cyclopentyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC1CCCC1 ZWOQVPFVARFZSF-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- RHGUXDUPXYFCTE-ZWNOBZJWSA-N ergoline Chemical class C1=CC([C@@H]2[C@H](NCCC2)C2)=C3C2=CNC3=C1 RHGUXDUPXYFCTE-ZWNOBZJWSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 235000021266 loss of appetite Nutrition 0.000 description 1
- 208000019017 loss of appetite Diseases 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000013014 purified material Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000012925 reference material Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/782,339 US4734501A (en) | 1985-10-01 | 1985-10-01 | N-alkylation of dihydrolysergic acid |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT41779A HUT41779A (en) | 1987-05-28 |
| HU196396B true HU196396B (en) | 1988-11-28 |
Family
ID=25125737
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU864145A HU196396B (en) | 1985-10-01 | 1986-09-30 | Process for n-alkylating dihydro-lisergic acid |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4734501A (index.php) |
| EP (1) | EP0219256B1 (index.php) |
| JP (1) | JPH0670049B2 (index.php) |
| KR (1) | KR870001680B1 (index.php) |
| CN (1) | CN1013446B (index.php) |
| AT (1) | ATE62483T1 (index.php) |
| AU (1) | AU578169B2 (index.php) |
| CA (1) | CA1296323C (index.php) |
| DE (1) | DE3678665D1 (index.php) |
| DK (1) | DK170044B1 (index.php) |
| EG (1) | EG17902A (index.php) |
| ES (1) | ES2002393A6 (index.php) |
| GR (1) | GR862463B (index.php) |
| HK (1) | HK24192A (index.php) |
| HU (1) | HU196396B (index.php) |
| IE (1) | IE58690B1 (index.php) |
| IL (1) | IL80194A (index.php) |
| NZ (1) | NZ217721A (index.php) |
| PH (1) | PH23030A (index.php) |
| PT (1) | PT83449B (index.php) |
| SU (1) | SU1486062A3 (index.php) |
| ZA (1) | ZA867417B (index.php) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2584719B1 (fr) * | 1985-07-11 | 1987-10-02 | Rhone Poulenc Sante | Procede de preparation des derives n-methyles du lysergol et du methoxy-10a lumilysergol |
| US4968802A (en) * | 1985-10-01 | 1990-11-06 | Eli Lilly And Company | Process of making alkoxy cycloalkanol esters of dihydrolysergic acid |
| US4845224A (en) * | 1985-10-01 | 1989-07-04 | Eli Lilly And Company | Cycloalkanol esters of dihydrolysergic acid having peripheral serotonin antagonist properties |
| IL80193A0 (en) * | 1985-10-01 | 1986-12-31 | Lilly Co Eli | Esters of dihydrolysergic acid |
| US4906639A (en) * | 1985-10-01 | 1990-03-06 | Eli Lilly And Company | Cycloalkanol esters of dihydrolysergic acid |
| US4914107A (en) * | 1989-01-17 | 1990-04-03 | Eli Lilly And Company | Method for selectively blocking 5-HT2 receptors |
| US5441961A (en) * | 1992-08-27 | 1995-08-15 | Eli Lilly And Company | Substituted cyclo or bicycloalkylamides of (8β)-6-(substituted) ergolines |
| WO2004087637A1 (en) * | 2003-03-31 | 2004-10-14 | Takasago International Corporation | Production of n-alkylamide compounds |
| CN102775402B (zh) * | 2011-05-13 | 2015-08-26 | 上海现代制药股份有限公司 | 一种制备二氢麦角酸的中间体及其制备方法 |
| RU2615949C1 (ru) * | 2015-11-18 | 2017-04-11 | Федеральное государственное казенное образовательное учреждение высшего профессионального образования "Калининградский пограничный институт Федеральной службы безопасности Российской Федерации" | Способ сигнализационного прикрытия т-образного перекрестка дорог |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1095296A (index.php) * | 1900-01-01 | |||
| US3183234A (en) * | 1963-11-21 | 1965-05-11 | Lilly Co Eli | Octahydroindoloquinolines |
| US3580916A (en) * | 1969-02-20 | 1971-05-25 | Lilly Co Eli | Hydroxyesters of hexa- and octahydroindoloquinolines |
| YU40004B (en) * | 1977-07-21 | 1985-06-30 | Lek Tovarna Farmacevtskih | Praocess for preparing n-substituted esters of 9,10-dihydrlysergic acid |
| DE3304361A1 (de) * | 1982-02-17 | 1983-08-25 | Sandoz-Patent-GmbH, 7850 Lörrach | Mutterkornalkaloide, verfahren zu deren herstellung sowie diese verbindungen enthaltende pharmazeutische zusammensetzungen |
| IL80193A0 (en) * | 1985-10-01 | 1986-12-31 | Lilly Co Eli | Esters of dihydrolysergic acid |
-
1985
- 1985-10-01 US US06/782,339 patent/US4734501A/en not_active Expired - Lifetime
-
1986
- 1986-09-29 NZ NZ217721A patent/NZ217721A/xx unknown
- 1986-09-29 CA CA000519289A patent/CA1296323C/en not_active Expired - Lifetime
- 1986-09-29 ZA ZA867417A patent/ZA867417B/xx unknown
- 1986-09-29 PT PT83449A patent/PT83449B/pt not_active IP Right Cessation
- 1986-09-29 IL IL80194A patent/IL80194A/xx not_active IP Right Cessation
- 1986-09-29 GR GR862463A patent/GR862463B/el unknown
- 1986-09-29 DE DE8686307442T patent/DE3678665D1/de not_active Expired - Lifetime
- 1986-09-29 EG EG610/86A patent/EG17902A/xx active
- 1986-09-29 AT AT86307442T patent/ATE62483T1/de active
- 1986-09-29 EP EP86307442A patent/EP0219256B1/en not_active Expired - Lifetime
- 1986-09-29 AU AU63209/86A patent/AU578169B2/en not_active Ceased
- 1986-09-29 PH PH34317A patent/PH23030A/en unknown
- 1986-09-30 ES ES8602321A patent/ES2002393A6/es not_active Expired
- 1986-09-30 IE IE258786A patent/IE58690B1/en not_active IP Right Cessation
- 1986-09-30 HU HU864145A patent/HU196396B/hu not_active IP Right Cessation
- 1986-09-30 SU SU864028225A patent/SU1486062A3/ru active
- 1986-09-30 KR KR1019860008206A patent/KR870001680B1/ko not_active Expired
- 1986-09-30 DK DK466786A patent/DK170044B1/da not_active IP Right Cessation
- 1986-09-30 CN CN86106720A patent/CN1013446B/zh not_active Expired
- 1986-09-30 JP JP61234255A patent/JPH0670049B2/ja not_active Expired - Lifetime
-
1992
- 1992-04-02 HK HK241/92A patent/HK24192A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3678665D1 (de) | 1991-05-16 |
| GR862463B (index.php) | 1987-02-02 |
| DK466786A (da) | 1987-04-02 |
| US4734501A (en) | 1988-03-29 |
| CA1296323C (en) | 1992-02-25 |
| HUT41779A (en) | 1987-05-28 |
| KR870001680B1 (ko) | 1987-09-22 |
| EP0219256B1 (en) | 1991-04-10 |
| ZA867417B (en) | 1988-04-27 |
| SU1486062A3 (ru) | 1989-06-07 |
| IL80194A0 (en) | 1986-12-31 |
| CN1013446B (zh) | 1991-08-07 |
| ATE62483T1 (de) | 1991-04-15 |
| AU578169B2 (en) | 1988-10-13 |
| AU6320986A (en) | 1987-04-02 |
| PH23030A (en) | 1989-03-10 |
| NZ217721A (en) | 1989-02-24 |
| IE862587L (en) | 1987-04-01 |
| EP0219256A1 (en) | 1987-04-22 |
| KR870004027A (ko) | 1987-05-07 |
| DK170044B1 (da) | 1995-05-08 |
| EG17902A (en) | 1991-03-30 |
| PT83449A (en) | 1986-10-01 |
| JPS6284083A (ja) | 1987-04-17 |
| DK466786D0 (da) | 1986-09-30 |
| CN86106720A (zh) | 1987-04-01 |
| JPH0670049B2 (ja) | 1994-09-07 |
| PT83449B (pt) | 1989-05-12 |
| IL80194A (en) | 1990-12-23 |
| IE58690B1 (en) | 1993-11-03 |
| ES2002393A6 (es) | 1988-08-01 |
| HK24192A (en) | 1992-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU221978B1 (hu) | Új eritromicinszármazékok előállítására alkalmazható intermedierek | |
| JP4664814B2 (ja) | イミダゾリジン誘導体 | |
| FR2529547A1 (fr) | Derives n-imidazolyliques de composes bicycliques, leur procede de preparation et leur utilisation dans le reglage de l'hemostase vasculaire | |
| US11739057B2 (en) | Polymorphic forms of Belinostat and processes for preparation thereof | |
| HU196396B (en) | Process for n-alkylating dihydro-lisergic acid | |
| JP3030780B2 (ja) | 光学活性なケテンジチオアセタール誘導体及びその製造方法 | |
| JP3148281B2 (ja) | ラクタム誘導体の製造法 | |
| IE66980B1 (en) | Novel neplanocin derivatives | |
| WO2005084664A1 (ja) | インドール誘導体及びその用途 | |
| US7781598B2 (en) | Process for the preparation of substituted indoles | |
| US4801590A (en) | Pyrido(1,8)naphthyridinones, and their use as pharmaceuticals | |
| RU1817776C (ru) | Способ получени (4-амино-2,6-диметилфенилсульфонил)нитрометана | |
| EP0356673A2 (en) | Substituted 5,6,7,8-tetrahydroimidazo[1,5-a]pyridines and process for their preparation | |
| US4001276A (en) | α-Alkyl(or aryl)thio-5-hydroxytryptophan derivative and the preparation process thereof | |
| US4960888A (en) | Preparation of 6-amino-1,2-dihydro-1-hydroxy-2-imino-4-piperidinopyrimidine compounds | |
| KR100241263B1 (ko) | N-알킬옥시카르보닐-베타-알킬술포닐발린 화합물의 제조방법 | |
| HU195218B (en) | Process for production of derivatives of substituated in position 5 or 6 beta-carbolin-3-carbonic acid esther and containing them medical preparatives | |
| KR101680396B1 (ko) | N[5(3디메틸아미노-아크릴로일)2플루오로페닐]n메틸아세트아미드의 제조를 위한 공정 | |
| US3892766A (en) | Process for the preparation of 4-keto-1,2,3,4-tetrahydrocarbazole | |
| US4977274A (en) | 4-hydroxyindole derivatives, the process for preparation thereof and their use | |
| Cirrincione et al. | REARRANGEMENTS OF N-UREIDOPYRROLES: A CASE OF MONONUCLEAR HETEROCYCLIC REARRANGEMENT INVOLVING AN AROMATIC HETEROCYCLE AS CARBON-NITROGEN-NITROGEN SEQUENCE | |
| PL189248B1 (pl) | Sposób wytwarzania 1-(p-metoksybenzoilo)-2-pirolidonu | |
| CS255876B2 (en) | Process for preparing new 10 alpha-methoxy-6-methyl-ergolines | |
| US20040039203A1 (en) | Process for the preparation of 1,5-disubstituted-3-amino-1,2,4,-triazoles and substituted aminoguanidines as intermediate compounds | |
| JP2015113324A (ja) | クロメノン化合物の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |