HU194879B - Process for producing 1,6-naphtiridine derivatives and pharmaceutical compositions containing them - Google Patents
Process for producing 1,6-naphtiridine derivatives and pharmaceutical compositions containing them Download PDFInfo
- Publication number
- HU194879B HU194879B HU853212A HU321285A HU194879B HU 194879 B HU194879 B HU 194879B HU 853212 A HU853212 A HU 853212A HU 321285 A HU321285 A HU 321285A HU 194879 B HU194879 B HU 194879B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- methyl
- naphthyridine
- dihydro
- carbon atoms
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 19
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 4
- -1 alkyl radical Chemical class 0.000 claims abstract description 58
- 150000003839 salts Chemical class 0.000 claims abstract description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 20
- VSOSXKMEQPYESP-UHFFFAOYSA-N 1,6-naphthyridine Chemical class C1=CN=CC2=CC=CN=C21 VSOSXKMEQPYESP-UHFFFAOYSA-N 0.000 claims abstract description 9
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 6
- 201000010099 disease Diseases 0.000 claims abstract description 5
- 150000001875 compounds Chemical class 0.000 claims description 37
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 239000000010 aprotic solvent Substances 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical class O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 239000007858 starting material Substances 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 7
- 150000001350 alkyl halides Chemical class 0.000 claims description 7
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 150000004703 alkoxides Chemical class 0.000 claims description 5
- 125000003282 alkyl amino group Chemical group 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 239000012433 hydrogen halide Substances 0.000 claims description 5
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 230000002792 vascular Effects 0.000 claims description 4
- OZAAQZBOCURTEH-UHFFFAOYSA-N 2-[benzyl(methyl)amino]ethyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(=O)OCCN(C)CC=2C=CC=CC=2)C1C1=CC=CC=C1C(F)(F)F OZAAQZBOCURTEH-UHFFFAOYSA-N 0.000 claims description 3
- 238000010934 O-alkylation reaction Methods 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims 5
- 239000000370 acceptor Substances 0.000 claims 4
- VHSIAYLBCLUAFT-UHFFFAOYSA-N n-[3-acetyl-6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-1-methyl-2-oxo-1,8-naphthyridin-4-yl]acetamide Chemical class C=1C=C(Cl)C=CC=1C=1C=C2C(NC(=O)C)=C(C(C)=O)C(=O)N(C)C2=NC=1C1=CC=C(Cl)C=C1Cl VHSIAYLBCLUAFT-UHFFFAOYSA-N 0.000 claims 4
- 229910000095 alkaline earth hydride Inorganic materials 0.000 claims 2
- 125000005530 alkylenedioxy group Chemical group 0.000 claims 2
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims 2
- 239000003937 drug carrier Substances 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- 125000003386 piperidinyl group Chemical group 0.000 claims 2
- QGMYIPJEQYWPSE-UHFFFAOYSA-N ethyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-1,6-naphthyridine-2-carboxylate Chemical compound C(C)OC(=O)C1(NC2=CC=NC(=C2C(C1)C1=C(C=CC=C1)C(F)(F)F)OC(C)C)C QGMYIPJEQYWPSE-UHFFFAOYSA-N 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 210000004204 blood vessel Anatomy 0.000 abstract description 2
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 abstract 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Substances 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 abstract 1
- 125000001072 heteroaryl group Chemical group 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 82
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 54
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 39
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 33
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 20
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 230000001225 therapeutic effect Effects 0.000 description 8
- HOVXHSHAXPTANC-UHFFFAOYSA-N 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(O)=O)C1C1=CC=CC=C1C(F)(F)F HOVXHSHAXPTANC-UHFFFAOYSA-N 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 230000008602 contraction Effects 0.000 description 6
- 230000000297 inotrophic effect Effects 0.000 description 6
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical compound C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- HSUGRBWQSSZJOP-RTWAWAEBSA-N diltiazem Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=CC=C2S1 HSUGRBWQSSZJOP-RTWAWAEBSA-N 0.000 description 5
- 229960004166 diltiazem Drugs 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 229940127291 Calcium channel antagonist Drugs 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- 241000283973 Oryctolagus cuniculus Species 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 230000005284 excitation Effects 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 210000003540 papillary muscle Anatomy 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 3
- ZQKMVHXJWJNEQG-UHFFFAOYSA-N 1h-1,6-naphthyridin-2-one Chemical class C1=NC=CC2=NC(O)=CC=C21 ZQKMVHXJWJNEQG-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000005662 Paraffin oil Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- KVPKWOWFDGOPOB-UHFFFAOYSA-N benzyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC=C1C(F)(F)F KVPKWOWFDGOPOB-UHFFFAOYSA-N 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 230000002526 effect on cardiovascular system Effects 0.000 description 3
- 230000028161 membrane depolarization Effects 0.000 description 3
- 210000000056 organ Anatomy 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 210000002460 smooth muscle Anatomy 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- NHWIEYPXOMFZSC-UHFFFAOYSA-N 2-methyl-4-(3-nitrophenyl)-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(O)=O)C1C1=CC=CC([N+]([O-])=O)=C1 NHWIEYPXOMFZSC-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000006906 Vascular Ring Diseases 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- ACZJZGLXRPZSLI-UHFFFAOYSA-N diethyl 2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1C(F)(F)F ACZJZGLXRPZSLI-UHFFFAOYSA-N 0.000 description 2
- WDCDAAMJNUHOIY-UHFFFAOYSA-N ethyl acetate;2-propan-2-yloxypropane Chemical compound CCOC(C)=O.CC(C)OC(C)C WDCDAAMJNUHOIY-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- HUKPMUKCYXQYNF-UHFFFAOYSA-N methyl 2-methyl-4-(2-nitrophenyl)-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)[N+](=O)[O-])OC(C)C)C HUKPMUKCYXQYNF-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- VNNNNQTZWBUWEG-UHFFFAOYSA-N (1-benzylpyrrolidin-3-yl)methyl 2-methyl-4-(3-nitrophenyl)-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(=O)OCC2CN(CC=3C=CC=CC=3)CC2)C1C1=CC=CC([N+]([O-])=O)=C1 VNNNNQTZWBUWEG-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- BWKAYBPLDRWMCJ-UHFFFAOYSA-N 1,1-diethoxy-n,n-dimethylmethanamine Chemical compound CCOC(N(C)C)OCC BWKAYBPLDRWMCJ-UHFFFAOYSA-N 0.000 description 1
- ZEZJPIDPVXJEME-UHFFFAOYSA-N 2,4-Dihydroxypyridine Chemical compound OC=1C=CNC(=O)C=1 ZEZJPIDPVXJEME-UHFFFAOYSA-N 0.000 description 1
- BZHMBWZPUJHVEE-UHFFFAOYSA-N 2,4-dimethylpentane Chemical compound CC(C)CC(C)C BZHMBWZPUJHVEE-UHFFFAOYSA-N 0.000 description 1
- FHYABEAASSIIKA-UHFFFAOYSA-N 2,6-naphthyridine-3-carboxylic acid Chemical compound N1=CC=C2C=NC(C(=O)O)=CC2=C1 FHYABEAASSIIKA-UHFFFAOYSA-N 0.000 description 1
- GKNOIHQOZNUTFX-UHFFFAOYSA-N 2-(dimethylamino)ethyl 5-methoxy-2-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OC)=NC=CC=2NC(C)=C(C(=O)OCCN(C)C)C1C1=CC=CC=C1C(F)(F)F GKNOIHQOZNUTFX-UHFFFAOYSA-N 0.000 description 1
- ZDVRPKUWYQVVDX-UHFFFAOYSA-N 2-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC=C1C=O ZDVRPKUWYQVVDX-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- HCKWJKWXDJQZPG-UHFFFAOYSA-N 2-methylpropyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C(C)C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC(C)C)C HCKWJKWXDJQZPG-UHFFFAOYSA-N 0.000 description 1
- XETVXLXTDFVQLH-UHFFFAOYSA-N 2-methylsulfanylethyl 2-methyl-4-(3-nitrophenyl)-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound CSCCOC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C XETVXLXTDFVQLH-UHFFFAOYSA-N 0.000 description 1
- ZJGTZFKMTJVDGU-UHFFFAOYSA-N 2-phenoxyethyl 4-[2-(difluoromethoxy)phenyl]-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(=O)OCCOC=2C=CC=CC=2)C1C1=CC=CC=C1OC(F)F ZJGTZFKMTJVDGU-UHFFFAOYSA-N 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- RFFRYTQZANLXBS-OGMHIBOISA-N C(C(=O)O)(=O)O.C(\C=C\C1=CC=CC=C1)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC(C)C)C.C(C(=O)O)(=O)O.C(C(=O)O)(=O)O.C(C)(C)OC1=C2C(C(=C(NC2=CC=N1)C)C(=O)OC\C=C\C1=CC=CC=C1)C1=C(C=CC=C1)C(F)(F)F Chemical compound C(C(=O)O)(=O)O.C(\C=C\C1=CC=CC=C1)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC(C)C)C.C(C(=O)O)(=O)O.C(C(=O)O)(=O)O.C(C)(C)OC1=C2C(C(=C(NC2=CC=N1)C)C(=O)OC\C=C\C1=CC=CC=C1)C1=C(C=CC=C1)C(F)(F)F RFFRYTQZANLXBS-OGMHIBOISA-N 0.000 description 1
- SOZVHDVKPOEWKN-UHFFFAOYSA-N C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OCC)C Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OCC)C SOZVHDVKPOEWKN-UHFFFAOYSA-N 0.000 description 1
- AYYPDGQSMSKHKF-UHFFFAOYSA-N C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C AYYPDGQSMSKHKF-UHFFFAOYSA-N 0.000 description 1
- ZWHSXLRXIAIFQD-UHFFFAOYSA-N C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=NC=CC=C1)OC(C)C)C Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=NC=CC=C1)OC(C)C)C ZWHSXLRXIAIFQD-UHFFFAOYSA-N 0.000 description 1
- SUQKMYDNLPXLAF-UHFFFAOYSA-N C(C1=CC=CC=C1)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C Chemical compound C(C1=CC=CC=C1)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C SUQKMYDNLPXLAF-UHFFFAOYSA-N 0.000 description 1
- 108090000312 Calcium Channels Proteins 0.000 description 1
- 102000003922 Calcium Channels Human genes 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- 208000018152 Cerebral disease Diseases 0.000 description 1
- WGCRDSVFPGZFJN-UHFFFAOYSA-N Cl.C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC(C)C)C Chemical compound Cl.C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC(C)C)C WGCRDSVFPGZFJN-UHFFFAOYSA-N 0.000 description 1
- XEGMTJHDQRREIV-UHFFFAOYSA-N Cl.C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC(C)CC)C Chemical compound Cl.C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC(C)CC)C XEGMTJHDQRREIV-UHFFFAOYSA-N 0.000 description 1
- PHRLZRWUNGBKQD-UHFFFAOYSA-N Cl.Cl.CN(CCOC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C)C Chemical compound Cl.Cl.CN(CCOC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C)C PHRLZRWUNGBKQD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241000330845 Marssonina coronariae Species 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 241000283977 Oryctolagus Species 0.000 description 1
- 208000018262 Peripheral vascular disease Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 208000010378 Pulmonary Embolism Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- FAXZRVHEQZVZEY-QMRFKDRMSA-N [(2r)-butan-2-yl] 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound CC[C@@H](C)OC(=O)C1=C(C)NC2=CC=NC(OC(C)C)=C2C1C1=CC=CC=C1C(F)(F)F FAXZRVHEQZVZEY-QMRFKDRMSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- QQOBRRFOVWGIMD-OJAKKHQRSA-N azaribine Chemical compound CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](COC(=O)C)O[C@H]1N1C(=O)NC(=O)C=N1 QQOBRRFOVWGIMD-OJAKKHQRSA-N 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000000480 calcium channel blocker Substances 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 206010008118 cerebral infarction Diseases 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007979 citrate buffer Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- YJCNZTHTFHXUQZ-UHFFFAOYSA-N dibenzyl 2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC=1NC(C)=C(C(=O)OCC=2C=CC=CC=2)C(C=2C(=CC=CC=2)C(F)(F)F)C=1C(=O)OCC1=CC=CC=C1 YJCNZTHTFHXUQZ-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- WETASBBGAYPDOP-UHFFFAOYSA-N diethyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3,8-dicarboxylate Chemical compound C(C)OC(=O)C1=C(NC2=C(C=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC(C)C)C(=O)OCC)C WETASBBGAYPDOP-UHFFFAOYSA-N 0.000 description 1
- KALSHWKRMSJLAB-UHFFFAOYSA-N dimethyl 4-(2-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1F KALSHWKRMSJLAB-UHFFFAOYSA-N 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- MXEAMWZLFSOMFP-UHFFFAOYSA-N ethyl 2-methyl-5-(2-methylpropoxy)-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OCC(C)C)C MXEAMWZLFSOMFP-UHFFFAOYSA-N 0.000 description 1
- HUQQGWQOVHUQMX-UHFFFAOYSA-N ethyl 2-methyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-4,6-dihydro-1h-1,6-naphthyridine-3-carboxylate Chemical compound CCOC(=O)C1=C(C)NC=2C=CNC(=O)C=2C1C1=CC=CC=C1C(F)(F)F HUQQGWQOVHUQMX-UHFFFAOYSA-N 0.000 description 1
- XVXQOAYCEUDQTQ-UHFFFAOYSA-N ethyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound CCOC(=O)C1=C(C)NC2=CC=NC(OC(C)C)=C2C1C1=CC=CC=C1C(F)(F)F XVXQOAYCEUDQTQ-UHFFFAOYSA-N 0.000 description 1
- RSIUXWAQSLEMBP-UHFFFAOYSA-N ethyl 2-methyl-5-propan-2-yloxy-4-[3-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)C(F)(F)F)OC(C)C)C RSIUXWAQSLEMBP-UHFFFAOYSA-N 0.000 description 1
- RNRBOZPQYXBQKU-UHFFFAOYSA-N ethyl 2-methyl-5-propan-2-yloxy-4-[4-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC=C(C=C1)C(F)(F)F)OC(C)C)C RNRBOZPQYXBQKU-UHFFFAOYSA-N 0.000 description 1
- CTALVDCQTJJABM-UHFFFAOYSA-N ethyl 2-methyl-5-propoxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OCCC)C CTALVDCQTJJABM-UHFFFAOYSA-N 0.000 description 1
- RPFOGFYLYUIZHQ-UHFFFAOYSA-N ethyl 4-(1,3-benzodioxol-4-yl)-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound CCOC(=O)C1=C(C)NC2=CC=NC(OC(C)C)=C2C1C1=CC=CC2=C1OCO2 RPFOGFYLYUIZHQ-UHFFFAOYSA-N 0.000 description 1
- UOMHSPONCFHIED-UHFFFAOYSA-N ethyl 4-(2-methoxyphenyl)-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)OC)OC(C)C)C UOMHSPONCFHIED-UHFFFAOYSA-N 0.000 description 1
- SWLCRQNDFFNALF-UHFFFAOYSA-N ethyl 4-[2-chloro-3-(trifluoromethyl)phenyl]-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C(=CC=C1)C(F)(F)F)Cl)OC(C)C)C SWLCRQNDFFNALF-UHFFFAOYSA-N 0.000 description 1
- CAVVBKNLBLFAFO-UHFFFAOYSA-N ethyl 5-butoxy-2-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OCCCC)C CAVVBKNLBLFAFO-UHFFFAOYSA-N 0.000 description 1
- CKLPUQLPXQOAJX-UHFFFAOYSA-N ethyl 5-methoxy-2-methyl-4-(3-nitrophenyl)-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC)C CKLPUQLPXQOAJX-UHFFFAOYSA-N 0.000 description 1
- RLDAKUXOONYZPQ-UHFFFAOYSA-N ethyl 5-methoxy-2-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC)C RLDAKUXOONYZPQ-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- MOTRZVVGCFFABN-UHFFFAOYSA-N hexane;2-propan-2-yloxypropane Chemical compound CCCCCC.CC(C)OC(C)C MOTRZVVGCFFABN-UHFFFAOYSA-N 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- XNNDQMXXPKMBGV-UHFFFAOYSA-N methyl 2-methyl-4-(3-nitrophenyl)-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C XNNDQMXXPKMBGV-UHFFFAOYSA-N 0.000 description 1
- FLCZQWGPAKTSIT-UHFFFAOYSA-N methyl 2-methyl-4-phenyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC2=CC=NC(OC(C)C)=C2C1C1=CC=CC=C1 FLCZQWGPAKTSIT-UHFFFAOYSA-N 0.000 description 1
- FABRLWWYXLJYPC-UHFFFAOYSA-N methyl 2-methyl-5-oxo-4-phenyl-4,6-dihydro-1h-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC=2C=CNC(=O)C=2C1C1=CC=CC=C1 FABRLWWYXLJYPC-UHFFFAOYSA-N 0.000 description 1
- IGBXGCJQCMMVAP-UHFFFAOYSA-N methyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)(C)OC1=C2C(C(=C(NC2=CC=N1)C)C(=O)OC)C1=C(C=CC=C1)C(F)(F)F IGBXGCJQCMMVAP-UHFFFAOYSA-N 0.000 description 1
- QICUWYIEYGXPFD-UHFFFAOYSA-N methyl 2-methyl-5-propoxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OCCC)C QICUWYIEYGXPFD-UHFFFAOYSA-N 0.000 description 1
- HOSCHJTVYALXHU-UHFFFAOYSA-N methyl 4-(2-bromophenyl)-5-methoxy-2-methyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)Br)OC)C HOSCHJTVYALXHU-UHFFFAOYSA-N 0.000 description 1
- LTAGJUFCZXKBGK-UHFFFAOYSA-N methyl 4-(2-chloro-6-fluorophenyl)-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1F)Cl)OC(C)C)C LTAGJUFCZXKBGK-UHFFFAOYSA-N 0.000 description 1
- IKSXWGZRDWATLC-UHFFFAOYSA-N methyl 4-(2-fluorophenyl)-2-methyl-5-oxo-4,6-dihydro-1h-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC=2C=CNC(=O)C=2C1C1=CC=CC=C1F IKSXWGZRDWATLC-UHFFFAOYSA-N 0.000 description 1
- FMFXXNLKXNZQMM-UHFFFAOYSA-N methyl 4-(3-chloro-2-fluorophenyl)-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C(=CC=C1)Cl)F)OC(C)C)C FMFXXNLKXNZQMM-UHFFFAOYSA-N 0.000 description 1
- KGJJDIFEODINJP-UHFFFAOYSA-N methyl 4-(3-chloro-2-fluorophenyl)-5-methoxy-2-methyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C(=CC=C1)Cl)F)OC)C KGJJDIFEODINJP-UHFFFAOYSA-N 0.000 description 1
- NKSLLSOMUISTON-UHFFFAOYSA-N methyl 5-methoxy-2-methyl-4-phenyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC2=CC=NC(OC)=C2C1C1=CC=CC=C1 NKSLLSOMUISTON-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- HYIMSNHJOBLJNT-UHFFFAOYSA-N nifedipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O HYIMSNHJOBLJNT-UHFFFAOYSA-N 0.000 description 1
- 229960001597 nifedipine Drugs 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- MWXFBQMLEBUEQN-UHFFFAOYSA-N propan-2-yl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC(C)C)C MWXFBQMLEBUEQN-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000005477 standard model Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000002966 stenotic effect Effects 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- XZHXJNDVBJYFIO-UHFFFAOYSA-N tert-butyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)(C)(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC(C)C)C XZHXJNDVBJYFIO-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- DWCSXQCXXITVKE-UHFFFAOYSA-N triethyloxidanium Chemical class CC[O+](CC)CC DWCSXQCXXITVKE-UHFFFAOYSA-N 0.000 description 1
- 230000003639 vasoconstrictive effect Effects 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 230000002861 ventricular Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Liquid Crystal Substances (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843431303 DE3431303A1 (de) | 1984-08-25 | 1984-08-25 | 1,6-naphthyridin-derivate, verfahren zu deren herstellung und deren verwendung |
| DE19853502790 DE3502790A1 (de) | 1985-01-29 | 1985-01-29 | 1,6-naphthyridin-derivate, verfahren zu deren herstellung und deren verwendung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT39448A HUT39448A (en) | 1986-09-29 |
| HU194879B true HU194879B (en) | 1988-03-28 |
Family
ID=25824189
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU853212A HU194879B (en) | 1984-08-25 | 1985-08-23 | Process for producing 1,6-naphtiridine derivatives and pharmaceutical compositions containing them |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4711901A (enExample) |
| EP (1) | EP0173933B1 (enExample) |
| KR (1) | KR890000706B1 (enExample) |
| AT (1) | ATE48276T1 (enExample) |
| AU (1) | AU576887B2 (enExample) |
| BG (1) | BG43691A3 (enExample) |
| CA (1) | CA1263118A (enExample) |
| DE (1) | DE3574471D1 (enExample) |
| DK (1) | DK165247C (enExample) |
| ES (1) | ES8604960A1 (enExample) |
| FI (1) | FI80697C (enExample) |
| GR (1) | GR852040B (enExample) |
| HU (1) | HU194879B (enExample) |
| IE (1) | IE58364B1 (enExample) |
| IL (2) | IL75987A (enExample) |
| NO (1) | NO161493C (enExample) |
| NZ (1) | NZ213218A (enExample) |
| PH (4) | PH21177A (enExample) |
| PL (1) | PL146668B1 (enExample) |
| RO (1) | RO92245B (enExample) |
| SU (1) | SU1395143A3 (enExample) |
| YU (2) | YU45000B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3431303A1 (de) * | 1984-08-25 | 1986-02-27 | Goedecke Ag | 1,6-naphthyridin-derivate, verfahren zu deren herstellung und deren verwendung |
| DE3906406C1 (enExample) * | 1989-03-01 | 1990-10-25 | Goedecke Ag, 1000 Berlin, De | |
| DE3906460C1 (enExample) * | 1989-03-01 | 1990-11-15 | Goedecke Ag, 1000 Berlin, De | |
| TW263498B (enExample) * | 1993-11-10 | 1995-11-21 | Takeda Pharm Industry Co Ltd | |
| DE102006026583A1 (de) | 2006-06-07 | 2007-12-13 | Bayer Healthcare Aktiengesellschaft | Aryl-substituierte hetero-bicyclische Verbindungen und ihre Verwendung |
| DE102006026585A1 (de) | 2006-06-07 | 2007-12-13 | Bayer Healthcare Aktiengesellschaft | Substituierte 4-Aryl-1,4-dihydro-1,6-naphthyridine und ihre Verwendung |
| DE102007009494A1 (de) | 2007-02-27 | 2008-08-28 | Bayer Healthcare Ag | Substituierte 4-Aryl-1, 4-dihydro-1,6-naphthyridinamide und ihre Verwendung |
| CN116655627A (zh) * | 2014-08-01 | 2023-08-29 | 拜耳医药股份有限公司 | 一种化合物的制备方法及其纯化以用作活性药物成分 |
| HRP20191476T1 (hr) * | 2015-08-21 | 2019-11-15 | Bayer Pharma AG | Postupak za pripravu (4s)-4-(4-cijano-2-metoksifenil)-5-etoksi-2,8-dimetil-1,4-dihidro-1-6-naftiridin-3-karboksamida i povrat (4s)-4-(4-cijano-2-metoksifenil)-5-etoksi-2,8-dimetil-1,4-dihidro-1-6-naftiridin-3-karboksamida elektrokemijskim postupcima |
| PT3337800T (pt) * | 2015-08-21 | 2019-08-05 | Bayer Pharma AG | Método para a preparação de (4s)-4-(4-ciano-2-metoxi fenil)-5-etoxi-2,8-dimetil-1,4-di-hidro-1-6-naftiridina-3- carboxamida e purificação do mesmo para a utilização como ingrediente farmacêutico ativo |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4304914A (en) * | 1980-07-07 | 1981-12-08 | Usv Pharmaceutical Corporation | Naphthyridone derivatives |
| DE3327650A1 (de) * | 1983-07-30 | 1985-02-14 | Gödecke AG, 1000 Berlin | 1,6-naphthyridinon-derivate, verfahren zu deren herstellung und deren verwendung bei der bekaempfung von gefaesserkrankungen |
-
1985
- 1985-07-31 IL IL8575987Q patent/IL75987A/xx not_active IP Right Cessation
- 1985-08-01 IL IL75987A patent/IL75987A0/xx not_active IP Right Cessation
- 1985-08-15 SU SU853936405A patent/SU1395143A3/ru active
- 1985-08-21 RO RO119914A patent/RO92245B/ro unknown
- 1985-08-21 BG BG071530A patent/BG43691A3/xx unknown
- 1985-08-22 FI FI853233A patent/FI80697C/fi not_active IP Right Cessation
- 1985-08-22 GR GR852040A patent/GR852040B/el unknown
- 1985-08-23 NO NO853329A patent/NO161493C/no unknown
- 1985-08-23 DE DE8585110646T patent/DE3574471D1/de not_active Expired - Fee Related
- 1985-08-23 HU HU853212A patent/HU194879B/hu not_active IP Right Cessation
- 1985-08-23 YU YU1348/85A patent/YU45000B/xx unknown
- 1985-08-23 EP EP85110646A patent/EP0173933B1/de not_active Expired
- 1985-08-23 CA CA000489290A patent/CA1263118A/en not_active Expired
- 1985-08-23 IE IE208585A patent/IE58364B1/en not_active IP Right Cessation
- 1985-08-23 AU AU46626/85A patent/AU576887B2/en not_active Ceased
- 1985-08-23 PL PL1985255118A patent/PL146668B1/pl unknown
- 1985-08-23 PH PH32684A patent/PH21177A/en unknown
- 1985-08-23 NZ NZ213218A patent/NZ213218A/en unknown
- 1985-08-23 AT AT85110646T patent/ATE48276T1/de not_active IP Right Cessation
- 1985-08-23 ES ES546366A patent/ES8604960A1/es not_active Expired
- 1985-08-23 DK DK384485A patent/DK165247C/da not_active IP Right Cessation
- 1985-08-24 KR KR1019850006133A patent/KR890000706B1/ko not_active Expired
-
1986
- 1986-07-30 US US06/891,712 patent/US4711901A/en not_active Expired - Lifetime
- 1986-10-03 PH PH34326A patent/PH23379A/en unknown
- 1986-10-03 PH PH34327A patent/PH23411A/en unknown
-
1987
- 1987-06-17 PH PH35419A patent/PH24762A/en unknown
-
1988
- 1988-01-26 YU YU14588A patent/YU47010B/sh unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0089167B1 (en) | Dihydropyridine anti-ischaemic and antihypertensive agents, processes for their production, and pharmaceutical compositions containing them | |
| CA1205480A (en) | Dihydropyridine anti-ischaemic and antihypertensive agents, processes for their production, and pharmaceutical compositions containing them | |
| CA2493227A1 (en) | Preparation of 1h-imidazo[4,5-c]quinolin-4-amines via1h-imidazo [4,5-c]quinolin-4-phthalimide intermediates | |
| PL208708B1 (pl) | Polimorficzne formy chlorowodorku 1-4-(5-cyjanoindolo-3 -ylo) butylo-4- (2-karbamoilobenzofurano-5-ylo) piperazyny, sposób ich otrzymywania, ich zastosowanie w terapii zaburzeń medycznych i zawierające je kompozycje farmaceutyczne | |
| GB2292143A (en) | Pyrrolo-pyridine derivatives | |
| IE831730L (en) | Quinoline derivatives | |
| JP2002507611A (ja) | イミダゾロン食欲抑制薬:ii.フェニル誘導体 | |
| JPWO2014017515A1 (ja) | 4−[5−(ピリジン−4−イル)−1h−1,2,4−トリアゾール−3−イル]ピリジン−2−カルボニトリルの結晶多形およびその製造方法 | |
| PL140573B1 (en) | Method of obtaining new dihydropyridine derivatives | |
| HU194879B (en) | Process for producing 1,6-naphtiridine derivatives and pharmaceutical compositions containing them | |
| DE10237883A1 (de) | Substituierte Isoxazolderivate und ihre Verwendung in der Pharmazie | |
| KR20110036842A (ko) | 판크라티스타틴의 질소화된 유도체 | |
| US4681882A (en) | 4-alkoxy-pyrido[2,3-d]pyrimidine derivatives | |
| US5397780A (en) | Pyrroloazepine derivative | |
| US4801590A (en) | Pyrido(1,8)naphthyridinones, and their use as pharmaceuticals | |
| WO2004014873A1 (ja) | 4-置換キナゾリン-8-カルボン酸アミド誘導体とその薬理上許容される付加塩 | |
| EP0378468B1 (fr) | Dérivés des bisarylalcènes, leurs procédés de préparation et les compositions pharmaceutiques qui les contiennent | |
| US4760081A (en) | 1,6-naphthyridine derivatives useful for treating diseases of the blood vessels | |
| US4677108A (en) | 4-oxo-pyrido[2,3-d]pyrimidinone derivatives | |
| US5668131A (en) | Substituted aminoalkylaminopyridines | |
| JP3919272B2 (ja) | キナゾリン系化合物 | |
| JPH07126255A (ja) | キナゾリン系化合物 | |
| JP2000501086A (ja) | ピリドピリミジン | |
| KR100766851B1 (ko) | 신규한 α-케토 아미드 유도체 및 그의 제조 방법 | |
| JP2000344771A (ja) | 8−シクロペンチル−6−エチル−3−[置換]−5,8−ジヒドロ−4H−1,2,3a,7,8−ペンタアザ−as−インダセンの製造方法およびそれに有用な中間体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |