FI80697C - Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,6-naftyridinderivat. - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,6-naftyridinderivat. Download PDFInfo
- Publication number
- FI80697C FI80697C FI853233A FI853233A FI80697C FI 80697 C FI80697 C FI 80697C FI 853233 A FI853233 A FI 853233A FI 853233 A FI853233 A FI 853233A FI 80697 C FI80697 C FI 80697C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- naphthyridine
- dihydro
- isopropoxy
- carboxylate
- Prior art date
Links
- VSOSXKMEQPYESP-UHFFFAOYSA-N 1,6-naphthyridine Chemical class C1=CN=CC2=CC=CN=C21 VSOSXKMEQPYESP-UHFFFAOYSA-N 0.000 title claims abstract description 10
- 238000000034 method Methods 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 5
- -1 alkyl radical Chemical class 0.000 claims abstract description 73
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 18
- 150000003839 salts Chemical class 0.000 claims abstract description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims description 36
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical class O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 239000000010 aprotic solvent Substances 0.000 claims description 5
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 238000010934 O-alkylation reaction Methods 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000004703 alkoxides Chemical class 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- 238000003776 cleavage reaction Methods 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 230000007017 scission Effects 0.000 claims description 3
- 239000000370 acceptor Substances 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 239000012433 hydrogen halide Substances 0.000 claims description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 2
- VHSIAYLBCLUAFT-UHFFFAOYSA-N n-[3-acetyl-6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-1-methyl-2-oxo-1,8-naphthyridin-4-yl]acetamide Chemical compound C=1C=C(Cl)C=CC=1C=1C=C2C(NC(=O)C)=C(C(C)=O)C(=O)N(C)C2=NC=1C1=CC=C(Cl)C=C1Cl VHSIAYLBCLUAFT-UHFFFAOYSA-N 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000004950 trifluoroalkyl group Chemical group 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract description 4
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 abstract description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Substances 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 210000004204 blood vessel Anatomy 0.000 abstract 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 abstract 1
- 201000010099 disease Diseases 0.000 abstract 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract 1
- 125000001072 heteroaryl group Chemical group 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 78
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 59
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 33
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 26
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- HOVXHSHAXPTANC-UHFFFAOYSA-N 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(O)=O)C1C1=CC=CC=C1C(F)(F)F HOVXHSHAXPTANC-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 230000001225 therapeutic effect Effects 0.000 description 6
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical compound C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000008602 contraction Effects 0.000 description 5
- HSUGRBWQSSZJOP-RTWAWAEBSA-N diltiazem Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=CC=C2S1 HSUGRBWQSSZJOP-RTWAWAEBSA-N 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 230000000638 stimulation Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 4
- 229940127291 Calcium channel antagonist Drugs 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 229960004166 diltiazem Drugs 0.000 description 4
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 4
- 230000000297 inotrophic effect Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 210000003205 muscle Anatomy 0.000 description 4
- 229960001597 nifedipine Drugs 0.000 description 4
- HYIMSNHJOBLJNT-UHFFFAOYSA-N nifedipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O HYIMSNHJOBLJNT-UHFFFAOYSA-N 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- 239000005662 Paraffin oil Substances 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- ZEZJPIDPVXJEME-UHFFFAOYSA-N 2,4-Dihydroxypyridine Chemical compound OC=1C=CNC(=O)C=1 ZEZJPIDPVXJEME-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 208000024172 Cardiovascular disease Diseases 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FAXZRVHEQZVZEY-QMRFKDRMSA-N [(2r)-butan-2-yl] 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound CC[C@@H](C)OC(=O)C1=C(C)NC2=CC=NC(OC(C)C)=C2C1C1=CC=CC=C1C(F)(F)F FAXZRVHEQZVZEY-QMRFKDRMSA-N 0.000 description 2
- TWMJGSKMKDTGQS-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl] 1,6-naphthyridine-3-carboxylate Chemical compound FC(C1=C(C=CC=C1)OC(=O)C=1C=NC2=CC=NC=C2C=1)(F)F TWMJGSKMKDTGQS-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- KVPKWOWFDGOPOB-UHFFFAOYSA-N benzyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC=C1C(F)(F)F KVPKWOWFDGOPOB-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 208000026106 cerebrovascular disease Diseases 0.000 description 2
- AVSRSZCPQDWEEU-UHFFFAOYSA-N ethyl 2-methyl-4-(2-methylphenyl)-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C)OC(C)C)C AVSRSZCPQDWEEU-UHFFFAOYSA-N 0.000 description 2
- VCCOEMCFIYFRPA-UHFFFAOYSA-N ethyl 4-(2-chlorophenyl)-5-methoxy-2-methyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)Cl)OC)C VCCOEMCFIYFRPA-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000028161 membrane depolarization Effects 0.000 description 2
- FABRLWWYXLJYPC-UHFFFAOYSA-N methyl 2-methyl-5-oxo-4-phenyl-4,6-dihydro-1h-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC=2C=CNC(=O)C=2C1C1=CC=CC=C1 FABRLWWYXLJYPC-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229960003975 potassium Drugs 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 210000002460 smooth muscle Anatomy 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- XSEDITYHJFKUOV-UHFFFAOYSA-N (1-benzylpiperidin-3-yl) 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(=O)OC2CN(CC=3C=CC=CC=3)CCC2)C1C1=CC=CC=C1C(F)(F)F XSEDITYHJFKUOV-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- BWKAYBPLDRWMCJ-UHFFFAOYSA-N 1,1-diethoxy-n,n-dimethylmethanamine Chemical compound CCOC(N(C)C)OCC BWKAYBPLDRWMCJ-UHFFFAOYSA-N 0.000 description 1
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DTQIBVJDCJZFTK-UHFFFAOYSA-N 1,6-naphthyridine-3-carboxylic acid Chemical compound C1=CN=CC2=CC(C(=O)O)=CN=C21 DTQIBVJDCJZFTK-UHFFFAOYSA-N 0.000 description 1
- PFLJUDQWKIHVQV-UHFFFAOYSA-N 2-(dibenzylamino)ethyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(=O)OCCN(CC=2C=CC=CC=2)CC=2C=CC=CC=2)C1C1=CC=CC=C1C(F)(F)F PFLJUDQWKIHVQV-UHFFFAOYSA-N 0.000 description 1
- XKDYRJXQOXSYIL-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methyl-4-(3-nitrophenyl)-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound CN(CCOC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C)C XKDYRJXQOXSYIL-UHFFFAOYSA-N 0.000 description 1
- GKNOIHQOZNUTFX-UHFFFAOYSA-N 2-(dimethylamino)ethyl 5-methoxy-2-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OC)=NC=CC=2NC(C)=C(C(=O)OCCN(C)C)C1C1=CC=CC=C1C(F)(F)F GKNOIHQOZNUTFX-UHFFFAOYSA-N 0.000 description 1
- ZDVRPKUWYQVVDX-UHFFFAOYSA-N 2-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC=C1C=O ZDVRPKUWYQVVDX-UHFFFAOYSA-N 0.000 description 1
- GNZRHHOOAMOXST-UHFFFAOYSA-N 2-aminoethyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(=O)OCCN)C1C1=CC=CC=C1C(F)(F)F GNZRHHOOAMOXST-UHFFFAOYSA-N 0.000 description 1
- NHWIEYPXOMFZSC-UHFFFAOYSA-N 2-methyl-4-(3-nitrophenyl)-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(O)=O)C1C1=CC=CC([N+]([O-])=O)=C1 NHWIEYPXOMFZSC-UHFFFAOYSA-N 0.000 description 1
- CJWXCSDYOGCVCP-UHFFFAOYSA-N 2-methyl-5-(2-methylpropoxy)-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid Chemical compound C1=2C(OCC(C)C)=NC=CC=2NC(C)=C(C(O)=O)C1C1=CC=CC=C1C(F)(F)F CJWXCSDYOGCVCP-UHFFFAOYSA-N 0.000 description 1
- OIQQGNUQZVBYMD-UHFFFAOYSA-N 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid;dihydrochloride Chemical compound Cl.Cl.C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(O)=O)C1C1=CC=CC=C1C(F)(F)F OIQQGNUQZVBYMD-UHFFFAOYSA-N 0.000 description 1
- CAAMVAZOWCIHHI-UHFFFAOYSA-N 2-phenoxyethyl 2-methyl-5-(2-methylpropoxy)-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OCC(C)C)=NC=CC=2NC(C)=C(C(=O)OCCOC=2C=CC=CC=2)C1C1=CC=CC=C1C(F)(F)F CAAMVAZOWCIHHI-UHFFFAOYSA-N 0.000 description 1
- ZJGTZFKMTJVDGU-UHFFFAOYSA-N 2-phenoxyethyl 4-[2-(difluoromethoxy)phenyl]-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(=O)OCCOC=2C=CC=CC=2)C1C1=CC=CC=C1OC(F)F ZJGTZFKMTJVDGU-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- YABBMMCELGQAKF-UHFFFAOYSA-N 4-(2,1,3-benzoxadiazol-4-yl)-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid Chemical compound C1=CC2=NON=C2C(C2C(=C(C)NC=3C=CN=C(C2=3)OC(C)C)C(O)=O)=C1 YABBMMCELGQAKF-UHFFFAOYSA-N 0.000 description 1
- SHHDBERUHLNHHU-UHFFFAOYSA-N 4-(2-cyanophenyl)-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(O)=O)C1C1=CC=CC=C1C#N SHHDBERUHLNHHU-UHFFFAOYSA-N 0.000 description 1
- RIEXKVAWNFVIPP-UHFFFAOYSA-N 4-[2-(trifluoromethyl)phenyl]-1,6-naphthyridine-3-carboxylic acid Chemical compound FC(C1=C(C=CC=C1)C1=C(C=NC2=CC=NC=C12)C(=O)O)(F)F RIEXKVAWNFVIPP-UHFFFAOYSA-N 0.000 description 1
- DTWVSCPJQJZITF-UHFFFAOYSA-N 4-[2-chloro-3-(trifluoromethyl)phenyl]-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid Chemical compound C1=2C(OC(C)C)=NC=CC=2NC(C)=C(C(O)=O)C1C1=CC=CC(C(F)(F)F)=C1Cl DTWVSCPJQJZITF-UHFFFAOYSA-N 0.000 description 1
- TYBDNOYAFUVVHB-UHFFFAOYSA-N 5-methoxycarbonyl-2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3-carboxylic acid Chemical compound COC(=O)C1=C(C)NC(C)=C(C(O)=O)C1C1=CC=CC=C1 TYBDNOYAFUVVHB-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- SOZVHDVKPOEWKN-UHFFFAOYSA-N C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OCC)C Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OCC)C SOZVHDVKPOEWKN-UHFFFAOYSA-N 0.000 description 1
- FNGYXEVRKYJQBJ-UHFFFAOYSA-N C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(SC=C1)C(F)F)OC(C)C)C Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(SC=C1)C(F)F)OC(C)C)C FNGYXEVRKYJQBJ-UHFFFAOYSA-N 0.000 description 1
- AYYPDGQSMSKHKF-UHFFFAOYSA-N C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)[N+](=O)[O-])OC(C)C)C AYYPDGQSMSKHKF-UHFFFAOYSA-N 0.000 description 1
- WMAMQPCJZCRLLP-UHFFFAOYSA-N CC1=C(C(C2=C(N1)C=CN=C2OC(C)C)C3=CC=CC=C3C(F)(F)F)C(=O)OCC4CC4 Chemical compound CC1=C(C(C2=C(N1)C=CN=C2OC(C)C)C3=CC=CC=C3C(F)(F)F)C(=O)OCC4CC4 WMAMQPCJZCRLLP-UHFFFAOYSA-N 0.000 description 1
- NMSYYYBXIYFDQI-UHFFFAOYSA-N CC1=C(C(C2=C(N1)C=CN=C2OCC(C)C)C3=C(C(=CC=C3)C(F)(F)F)Cl)C(=O)O Chemical compound CC1=C(C(C2=C(N1)C=CN=C2OCC(C)C)C3=C(C(=CC=C3)C(F)(F)F)Cl)C(=O)O NMSYYYBXIYFDQI-UHFFFAOYSA-N 0.000 description 1
- AXNWCBWCNNLBKZ-UHFFFAOYSA-N CC1=C(C(C2=C(N1C)C=CN=C2OC(C)C)C3=CC=CC=C3)C(=O)OC Chemical compound CC1=C(C(C2=C(N1C)C=CN=C2OC(C)C)C3=CC=CC=C3)C(=O)OC AXNWCBWCNNLBKZ-UHFFFAOYSA-N 0.000 description 1
- IFCBHAWXOLLFNM-UHFFFAOYSA-N CC1=C(CC2=C(N1C3=C(C=CC=C3Cl)F)C=CN=C2OC(C)C)C(=O)O Chemical compound CC1=C(CC2=C(N1C3=C(C=CC=C3Cl)F)C=CN=C2OC(C)C)C(=O)O IFCBHAWXOLLFNM-UHFFFAOYSA-N 0.000 description 1
- HUPAUILZJJBMDO-UHFFFAOYSA-N CCOC(=O)C1=C(N(C2=C(C1)C(=NC=C2)OC(C)C)C3=CC=CC=C3Cl)C Chemical compound CCOC(=O)C1=C(N(C2=C(C1)C(=NC=C2)OC(C)C)C3=CC=CC=C3Cl)C HUPAUILZJJBMDO-UHFFFAOYSA-N 0.000 description 1
- YKXCKHUVDUWUFB-UHFFFAOYSA-N COC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1Cl)Cl)OC(C)C)C Chemical compound COC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1Cl)Cl)OC(C)C)C YKXCKHUVDUWUFB-UHFFFAOYSA-N 0.000 description 1
- ILEMUJGZKUHZFV-UHFFFAOYSA-N COC(=O)C1=CN=C2C=CN=CC2=C1C3=CC=CC=C3 Chemical compound COC(=O)C1=CN=C2C=CN=CC2=C1C3=CC=CC=C3 ILEMUJGZKUHZFV-UHFFFAOYSA-N 0.000 description 1
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 1
- 108090000312 Calcium Channels Proteins 0.000 description 1
- 102000003922 Calcium Channels Human genes 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 101100295741 Gallus gallus COR4 gene Proteins 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 208000018262 Peripheral vascular disease Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 206010037437 Pulmonary thrombosis Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 208000006906 Vascular Ring Diseases 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 210000001841 basilar artery Anatomy 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 230000002213 calciumantagonistic effect Effects 0.000 description 1
- 230000036459 cardiodepression Effects 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 206010008118 cerebral infarction Diseases 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 239000007979 citrate buffer Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ACZJZGLXRPZSLI-UHFFFAOYSA-N diethyl 2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1C(F)(F)F ACZJZGLXRPZSLI-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- KALSHWKRMSJLAB-UHFFFAOYSA-N dimethyl 4-(2-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1F KALSHWKRMSJLAB-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- UCVXUWXKLFEYHX-UHFFFAOYSA-N ethyl 2-methyl-4-phenyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound CCOC(=O)C1=C(C)NC2=CC=NC(OC(C)C)=C2C1C1=CC=CC=C1 UCVXUWXKLFEYHX-UHFFFAOYSA-N 0.000 description 1
- HUQQGWQOVHUQMX-UHFFFAOYSA-N ethyl 2-methyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-4,6-dihydro-1h-1,6-naphthyridine-3-carboxylate Chemical compound CCOC(=O)C1=C(C)NC=2C=CNC(=O)C=2C1C1=CC=CC=C1C(F)(F)F HUQQGWQOVHUQMX-UHFFFAOYSA-N 0.000 description 1
- XVXQOAYCEUDQTQ-UHFFFAOYSA-N ethyl 2-methyl-5-propan-2-yloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound CCOC(=O)C1=C(C)NC2=CC=NC(OC(C)C)=C2C1C1=CC=CC=C1C(F)(F)F XVXQOAYCEUDQTQ-UHFFFAOYSA-N 0.000 description 1
- RSIUXWAQSLEMBP-UHFFFAOYSA-N ethyl 2-methyl-5-propan-2-yloxy-4-[3-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC(=CC=C1)C(F)(F)F)OC(C)C)C RSIUXWAQSLEMBP-UHFFFAOYSA-N 0.000 description 1
- RNRBOZPQYXBQKU-UHFFFAOYSA-N ethyl 2-methyl-5-propan-2-yloxy-4-[4-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=CC=C(C=C1)C(F)(F)F)OC(C)C)C RNRBOZPQYXBQKU-UHFFFAOYSA-N 0.000 description 1
- CTALVDCQTJJABM-UHFFFAOYSA-N ethyl 2-methyl-5-propoxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OCCC)C CTALVDCQTJJABM-UHFFFAOYSA-N 0.000 description 1
- YMADKVDPPPEXHH-UHFFFAOYSA-N ethyl 4-(2-cyanophenyl)-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound CCOC(=O)C1=C(C)NC2=CC=NC(OC(C)C)=C2C1C1=CC=CC=C1C#N YMADKVDPPPEXHH-UHFFFAOYSA-N 0.000 description 1
- NOXBZNLTSHEXMQ-UHFFFAOYSA-N ethyl 4-(2-fluorophenyl)-5-methoxy-2-methyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)F)OC)C NOXBZNLTSHEXMQ-UHFFFAOYSA-N 0.000 description 1
- AGUJEPAQSMGRBD-UHFFFAOYSA-N ethyl 4-[2-(difluoromethoxy)phenyl]-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound CCOC(=O)C1=C(C)NC2=CC=NC(OC(C)C)=C2C1C1=CC=CC=C1OC(F)F AGUJEPAQSMGRBD-UHFFFAOYSA-N 0.000 description 1
- SWLCRQNDFFNALF-UHFFFAOYSA-N ethyl 4-[2-chloro-3-(trifluoromethyl)phenyl]-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C(=CC=C1)C(F)(F)F)Cl)OC(C)C)C SWLCRQNDFFNALF-UHFFFAOYSA-N 0.000 description 1
- RLDAKUXOONYZPQ-UHFFFAOYSA-N ethyl 5-methoxy-2-methyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound C(C)OC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)C(F)(F)F)OC)C RLDAKUXOONYZPQ-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000036450 inotropism Effects 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000001055 magnesium Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- CINNTLODRMZKKS-UHFFFAOYSA-N methyl 4-(2-bromophenyl)-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)Br)OC(C)C)C CINNTLODRMZKKS-UHFFFAOYSA-N 0.000 description 1
- OFCBHMRUCZKLDI-UHFFFAOYSA-N methyl 4-(2-bromophenyl)-5-methoxy-1,2-dimethyl-4H-1,6-naphthyridine-3-carboxylate Chemical compound CN1C(=C(C(C2=C(N=CC=C12)OC)C1=C(C=CC=C1)Br)C(=O)OC)C OFCBHMRUCZKLDI-UHFFFAOYSA-N 0.000 description 1
- IKSXWGZRDWATLC-UHFFFAOYSA-N methyl 4-(2-fluorophenyl)-2-methyl-5-oxo-4,6-dihydro-1h-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC=2C=CNC(=O)C=2C1C1=CC=CC=C1F IKSXWGZRDWATLC-UHFFFAOYSA-N 0.000 description 1
- CUIWILCDCJQRSV-UHFFFAOYSA-N methyl 4-(2-fluorophenyl)-2-methyl-5-propan-2-yloxy-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(NC2=CC=NC(=C2C1C1=C(C=CC=C1)F)OC(C)C)C CUIWILCDCJQRSV-UHFFFAOYSA-N 0.000 description 1
- NKSLLSOMUISTON-UHFFFAOYSA-N methyl 5-methoxy-2-methyl-4-phenyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC2=CC=NC(OC)=C2C1C1=CC=CC=C1 NKSLLSOMUISTON-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000022082 negative regulation of vasoconstriction Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 230000009090 positive inotropic effect Effects 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005624 silicic acid group Chemical class 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000005477 standard model Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000002966 stenotic effect Effects 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- DWCSXQCXXITVKE-UHFFFAOYSA-N triethyloxidanium Chemical class CC[O+](CC)CC DWCSXQCXXITVKE-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- QDNCLIPKBNMUPP-UHFFFAOYSA-N trimethyloxidanium Chemical group C[O+](C)C QDNCLIPKBNMUPP-UHFFFAOYSA-N 0.000 description 1
- 230000002861 ventricular Effects 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Liquid Crystal Substances (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3431303 | 1984-08-25 | ||
| DE19843431303 DE3431303A1 (de) | 1984-08-25 | 1984-08-25 | 1,6-naphthyridin-derivate, verfahren zu deren herstellung und deren verwendung |
| DE19853502790 DE3502790A1 (de) | 1985-01-29 | 1985-01-29 | 1,6-naphthyridin-derivate, verfahren zu deren herstellung und deren verwendung |
| DE3502790 | 1985-01-29 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI853233A0 FI853233A0 (fi) | 1985-08-22 |
| FI853233L FI853233L (fi) | 1986-02-26 |
| FI80697B FI80697B (fi) | 1990-03-30 |
| FI80697C true FI80697C (fi) | 1990-07-10 |
Family
ID=25824189
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI853233A FI80697C (fi) | 1984-08-25 | 1985-08-22 | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,6-naftyridinderivat. |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4711901A (enExample) |
| EP (1) | EP0173933B1 (enExample) |
| KR (1) | KR890000706B1 (enExample) |
| AT (1) | ATE48276T1 (enExample) |
| AU (1) | AU576887B2 (enExample) |
| BG (1) | BG43691A3 (enExample) |
| CA (1) | CA1263118A (enExample) |
| DE (1) | DE3574471D1 (enExample) |
| DK (1) | DK165247C (enExample) |
| ES (1) | ES8604960A1 (enExample) |
| FI (1) | FI80697C (enExample) |
| GR (1) | GR852040B (enExample) |
| HU (1) | HU194879B (enExample) |
| IE (1) | IE58364B1 (enExample) |
| IL (2) | IL75987A (enExample) |
| NO (1) | NO161493C (enExample) |
| NZ (1) | NZ213218A (enExample) |
| PH (4) | PH21177A (enExample) |
| PL (1) | PL146668B1 (enExample) |
| RO (1) | RO92245B (enExample) |
| SU (1) | SU1395143A3 (enExample) |
| YU (2) | YU45000B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3431303A1 (de) * | 1984-08-25 | 1986-02-27 | Goedecke Ag | 1,6-naphthyridin-derivate, verfahren zu deren herstellung und deren verwendung |
| DE3906406C1 (enExample) * | 1989-03-01 | 1990-10-25 | Goedecke Ag, 1000 Berlin, De | |
| DE3906460C1 (enExample) * | 1989-03-01 | 1990-11-15 | Goedecke Ag, 1000 Berlin, De | |
| TW263498B (enExample) * | 1993-11-10 | 1995-11-21 | Takeda Pharm Industry Co Ltd | |
| DE102006026583A1 (de) | 2006-06-07 | 2007-12-13 | Bayer Healthcare Aktiengesellschaft | Aryl-substituierte hetero-bicyclische Verbindungen und ihre Verwendung |
| DE102006026585A1 (de) | 2006-06-07 | 2007-12-13 | Bayer Healthcare Aktiengesellschaft | Substituierte 4-Aryl-1,4-dihydro-1,6-naphthyridine und ihre Verwendung |
| DE102007009494A1 (de) | 2007-02-27 | 2008-08-28 | Bayer Healthcare Ag | Substituierte 4-Aryl-1, 4-dihydro-1,6-naphthyridinamide und ihre Verwendung |
| CN116655627A (zh) * | 2014-08-01 | 2023-08-29 | 拜耳医药股份有限公司 | 一种化合物的制备方法及其纯化以用作活性药物成分 |
| HRP20191476T1 (hr) * | 2015-08-21 | 2019-11-15 | Bayer Pharma AG | Postupak za pripravu (4s)-4-(4-cijano-2-metoksifenil)-5-etoksi-2,8-dimetil-1,4-dihidro-1-6-naftiridin-3-karboksamida i povrat (4s)-4-(4-cijano-2-metoksifenil)-5-etoksi-2,8-dimetil-1,4-dihidro-1-6-naftiridin-3-karboksamida elektrokemijskim postupcima |
| PT3337800T (pt) * | 2015-08-21 | 2019-08-05 | Bayer Pharma AG | Método para a preparação de (4s)-4-(4-ciano-2-metoxi fenil)-5-etoxi-2,8-dimetil-1,4-di-hidro-1-6-naftiridina-3- carboxamida e purificação do mesmo para a utilização como ingrediente farmacêutico ativo |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4304914A (en) * | 1980-07-07 | 1981-12-08 | Usv Pharmaceutical Corporation | Naphthyridone derivatives |
| DE3327650A1 (de) * | 1983-07-30 | 1985-02-14 | Gödecke AG, 1000 Berlin | 1,6-naphthyridinon-derivate, verfahren zu deren herstellung und deren verwendung bei der bekaempfung von gefaesserkrankungen |
-
1985
- 1985-07-31 IL IL8575987Q patent/IL75987A/xx not_active IP Right Cessation
- 1985-08-01 IL IL75987A patent/IL75987A0/xx not_active IP Right Cessation
- 1985-08-15 SU SU853936405A patent/SU1395143A3/ru active
- 1985-08-21 RO RO119914A patent/RO92245B/ro unknown
- 1985-08-21 BG BG071530A patent/BG43691A3/xx unknown
- 1985-08-22 FI FI853233A patent/FI80697C/fi not_active IP Right Cessation
- 1985-08-22 GR GR852040A patent/GR852040B/el unknown
- 1985-08-23 NO NO853329A patent/NO161493C/no unknown
- 1985-08-23 DE DE8585110646T patent/DE3574471D1/de not_active Expired - Fee Related
- 1985-08-23 HU HU853212A patent/HU194879B/hu not_active IP Right Cessation
- 1985-08-23 YU YU1348/85A patent/YU45000B/xx unknown
- 1985-08-23 EP EP85110646A patent/EP0173933B1/de not_active Expired
- 1985-08-23 CA CA000489290A patent/CA1263118A/en not_active Expired
- 1985-08-23 IE IE208585A patent/IE58364B1/en not_active IP Right Cessation
- 1985-08-23 AU AU46626/85A patent/AU576887B2/en not_active Ceased
- 1985-08-23 PL PL1985255118A patent/PL146668B1/pl unknown
- 1985-08-23 PH PH32684A patent/PH21177A/en unknown
- 1985-08-23 NZ NZ213218A patent/NZ213218A/en unknown
- 1985-08-23 AT AT85110646T patent/ATE48276T1/de not_active IP Right Cessation
- 1985-08-23 ES ES546366A patent/ES8604960A1/es not_active Expired
- 1985-08-23 DK DK384485A patent/DK165247C/da not_active IP Right Cessation
- 1985-08-24 KR KR1019850006133A patent/KR890000706B1/ko not_active Expired
-
1986
- 1986-07-30 US US06/891,712 patent/US4711901A/en not_active Expired - Lifetime
- 1986-10-03 PH PH34326A patent/PH23379A/en unknown
- 1986-10-03 PH PH34327A patent/PH23411A/en unknown
-
1987
- 1987-06-17 PH PH35419A patent/PH24762A/en unknown
-
1988
- 1988-01-26 YU YU14588A patent/YU47010B/sh unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2246399T3 (es) | 1,2,3,4-tetrahidroisoquinolinas como antagonistas derivados del receptor de urotensina ii. | |
| JP2000256358A (ja) | ピラゾール誘導体 | |
| PL192411B1 (pl) | Pochodne amidowe, kompozycja farmaceutyczna zawierająca takie związki oraz jej zastosowanie | |
| FI80697C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,6-naftyridinderivat. | |
| WO2007129111A1 (en) | Diazepine derivatives as 5-ht2a antagonists | |
| EP0393766A2 (en) | New 3-N substituted carbamoyl-indole derivatives | |
| PL140573B1 (en) | Method of obtaining new dihydropyridine derivatives | |
| CS235334B2 (en) | Method of 1,4-dihydropyridines production | |
| EP0462696B1 (en) | Novel pyrido [2,3-f][1,4] thiazepines and pyrido [3,2-b][1,5] benzothiazepines | |
| EP0216247A2 (en) | Use of alpha 2 adrenergic receptor antagonists for the production of pharmaceutical compositions for treating colonic spasm, irritable bowel syndrome and constipation and process for preparing such pharmaceutical compositions | |
| CZ396591A3 (en) | Enantiomers of 1,4-dihydropyridine process of their preparation and pharmaceutical compositions prepared therefrom | |
| EP0557526B1 (en) | Pyrroloazepine compound | |
| JP2002507988A (ja) | 化合物 | |
| US4681882A (en) | 4-alkoxy-pyrido[2,3-d]pyrimidine derivatives | |
| US5523305A (en) | Tachykinin receptor antagonists, isoquinolones and their production | |
| IE913005A1 (en) | Indolonaphthyridines | |
| AU655841B2 (en) | Pyrroloazepine derivative | |
| US4751228A (en) | 1,6-naphthyridine derivatives | |
| JPWO1997017970A1 (ja) | カイニン酸神経細胞毒性阻害剤及びピリドチアジン誘導体 | |
| JPH08501287A (ja) | アミド誘導体 | |
| US4760081A (en) | 1,6-naphthyridine derivatives useful for treating diseases of the blood vessels | |
| US4321384A (en) | Antihypertensive agents | |
| KR20000075642A (ko) | 세로토닌-2 수용체 길항작용 및 알파 1-저해 작용을 갖는 피롤로티아진 및 피롤로티아제핀 화합물 | |
| US4677108A (en) | 4-oxo-pyrido[2,3-d]pyrimidinone derivatives | |
| US4681881A (en) | 5-alkoxy-pyrido[4,3-d]pyrimidine derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: GOEDECKE AKTIENGESELLSCHAFT |