HU192415B - New process for peneme derivatives - Google Patents
New process for peneme derivatives Download PDFInfo
- Publication number
 - HU192415B HU192415B HU843056A HU305684A HU192415B HU 192415 B HU192415 B HU 192415B HU 843056 A HU843056 A HU 843056A HU 305684 A HU305684 A HU 305684A HU 192415 B HU192415 B HU 192415B
 - Authority
 - HU
 - Hungary
 - Prior art keywords
 - group
 - formula
 - tert
 - compound
 - penem
 - Prior art date
 
Links
- 238000000034 method Methods 0.000 title claims description 35
 - HHXMXAQDOUCLDN-RXMQYKEDSA-N penem Chemical class S1C=CN2C(=O)C[C@H]21 HHXMXAQDOUCLDN-RXMQYKEDSA-N 0.000 title description 3
 - MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical class O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 claims abstract description 14
 - 239000012442 inert solvent Substances 0.000 claims abstract description 6
 - 150000002903 organophosphorus compounds Chemical class 0.000 claims abstract description 6
 - 150000002961 penems Chemical class 0.000 claims abstract description 5
 - 150000001875 compounds Chemical class 0.000 claims description 49
 - -1 formyloxy group Chemical group 0.000 claims description 44
 - 238000002360 preparation method Methods 0.000 claims description 35
 - 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 15
 - YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 14
 - 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 11
 - 238000006243 chemical reaction Methods 0.000 claims description 10
 - CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 8
 - 239000008096 xylene Substances 0.000 claims description 8
 - UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
 - ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 6
 - 239000001257 hydrogen Substances 0.000 claims description 6
 - 229910052739 hydrogen Inorganic materials 0.000 claims description 6
 - 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 6
 - BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 claims description 6
 - 125000004423 acyloxy group Chemical group 0.000 claims description 5
 - 125000000217 alkyl group Chemical group 0.000 claims description 5
 - 150000003839 salts Chemical class 0.000 claims description 4
 - 125000006729 (C2-C5) alkenyl group Chemical group 0.000 claims description 3
 - 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
 - 229910052736 halogen Inorganic materials 0.000 claims description 3
 - OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims description 3
 - 239000007858 starting material Substances 0.000 claims description 2
 - 125000005042 acyloxymethyl group Chemical group 0.000 claims 1
 - 125000005103 alkyl silyl group Chemical group 0.000 claims 1
 - 125000005843 halogen group Chemical group 0.000 claims 1
 - 230000003301 hydrolyzing effect Effects 0.000 claims 1
 - 150000002500 ions Chemical class 0.000 claims 1
 - 239000012948 isocyanate Substances 0.000 claims 1
 - 125000003944 tolyl group Chemical group 0.000 claims 1
 - 239000003242 anti bacterial agent Substances 0.000 abstract description 3
 - 229940088710 antibiotic agent Drugs 0.000 abstract description 3
 - 239000000543 intermediate Substances 0.000 abstract description 3
 - 238000004519 manufacturing process Methods 0.000 abstract description 2
 - 239000003795 chemical substances by application Substances 0.000 abstract 1
 - 239000000243 solution Substances 0.000 description 22
 - YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
 - 238000002474 experimental method Methods 0.000 description 19
 - XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
 - HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
 - 239000000047 product Substances 0.000 description 12
 - WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
 - 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 10
 - 238000001228 spectrum Methods 0.000 description 10
 - QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
 - 239000011541 reaction mixture Substances 0.000 description 8
 - 238000002211 ultraviolet spectrum Methods 0.000 description 8
 - PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
 - UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
 - 238000002329 infrared spectrum Methods 0.000 description 7
 - 125000006239 protecting group Chemical group 0.000 description 7
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
 - VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
 - HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
 - 239000000203 mixture Substances 0.000 description 6
 - 229910052708 sodium Inorganic materials 0.000 description 6
 - DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
 - VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
 - 239000000741 silica gel Substances 0.000 description 5
 - 229910002027 silica gel Inorganic materials 0.000 description 5
 - 239000011734 sodium Substances 0.000 description 5
 - 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
 - YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
 - CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
 - LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
 - MYMJFVNSFNDTKW-UHFFFAOYSA-N 2-[tert-butyl(diphenyl)silyl]oxyethanethioic s-acid Chemical compound C=1C=CC=CC=1[Si](OCC(S)=O)(C(C)(C)C)C1=CC=CC=C1 MYMJFVNSFNDTKW-UHFFFAOYSA-N 0.000 description 3
 - HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
 - ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
 - 229910000019 calcium carbonate Inorganic materials 0.000 description 3
 - 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
 - 239000007795 chemical reaction product Substances 0.000 description 3
 - 238000004587 chromatography analysis Methods 0.000 description 3
 - 239000012043 crude product Substances 0.000 description 3
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
 - VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
 - 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
 - 235000017557 sodium bicarbonate Nutrition 0.000 description 3
 - 239000007787 solid Substances 0.000 description 3
 - 239000002904 solvent Substances 0.000 description 3
 - ZIKDRABZWRPAOU-JBZHPUCOSA-N (4-nitrophenyl)methyl 2-[3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxoazetidin-1-yl]-2-oxoacetate Chemical compound [Si](C)(C)(C(C)(C)C)O[C@H](C)C1C(N(C1)C(C(=O)OCC1=CC=C(C=C1)[N+](=O)[O-])=O)=O ZIKDRABZWRPAOU-JBZHPUCOSA-N 0.000 description 2
 - CSCPPACGZOOCGX-MICDWDOJSA-N 1-deuteriopropan-2-one Chemical compound [2H]CC(C)=O CSCPPACGZOOCGX-MICDWDOJSA-N 0.000 description 2
 - GRNOZCCBOFGDCL-UHFFFAOYSA-N 2,2,2-trichloroacetyl isocyanate Chemical compound ClC(Cl)(Cl)C(=O)N=C=O GRNOZCCBOFGDCL-UHFFFAOYSA-N 0.000 description 2
 - NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
 - IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
 - IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
 - JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
 - 238000005481 NMR spectroscopy Methods 0.000 description 2
 - CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
 - HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
 - QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
 - 239000012267 brine Substances 0.000 description 2
 - 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
 - 238000004440 column chromatography Methods 0.000 description 2
 - 238000001704 evaporation Methods 0.000 description 2
 - 230000008020 evaporation Effects 0.000 description 2
 - 150000002367 halogens Chemical group 0.000 description 2
 - 125000006502 nitrobenzyl group Chemical group 0.000 description 2
 - 229910052757 nitrogen Inorganic materials 0.000 description 2
 - 239000012299 nitrogen atmosphere Substances 0.000 description 2
 - 239000012044 organic layer Substances 0.000 description 2
 - 238000005949 ozonolysis reaction Methods 0.000 description 2
 - 239000002244 precipitate Substances 0.000 description 2
 - HNOLIWBAJVIBOU-UHFFFAOYSA-N prop-2-enyl 2-chloro-2-oxoacetate Chemical compound ClC(=O)C(=O)OCC=C HNOLIWBAJVIBOU-UHFFFAOYSA-N 0.000 description 2
 - 238000000746 purification Methods 0.000 description 2
 - HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical class [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 2
 - HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
 - 125000001424 substituent group Chemical group 0.000 description 2
 - FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
 - RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
 - XINQFOMFQFGGCQ-UHFFFAOYSA-L (2-dodecoxy-2-oxoethyl)-[6-[(2-dodecoxy-2-oxoethyl)-dimethylazaniumyl]hexyl]-dimethylazanium;dichloride Chemical compound [Cl-].[Cl-].CCCCCCCCCCCCOC(=O)C[N+](C)(C)CCCCCC[N+](C)(C)CC(=O)OCCCCCCCCCCCC XINQFOMFQFGGCQ-UHFFFAOYSA-L 0.000 description 1
 - DMEYZPJEFHGESJ-CPWLGJMPSA-M (5R,6Z)-6-(6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [O-]C(=O)C1=CS[C@H]2N1C(=O)\C2=C\C1=CN2CCOCC2=N1 DMEYZPJEFHGESJ-CPWLGJMPSA-M 0.000 description 1
 - 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 description 1
 - 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
 - YQIVPKQHCIFNNV-UHFFFAOYSA-N 1-prop-1-enylazetidin-2-one Chemical compound CC=CN1CCC1=O YQIVPKQHCIFNNV-UHFFFAOYSA-N 0.000 description 1
 - GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
 - 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
 - GNFTZDOKVXKIBK-UHFFFAOYSA-N 3-(2-methoxyethoxy)benzohydrazide Chemical compound COCCOC1=CC=CC(C(=O)NN)=C1 GNFTZDOKVXKIBK-UHFFFAOYSA-N 0.000 description 1
 - DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 1
 - QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
 - WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
 - 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 1
 - OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
 - ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
 - 101150065749 Churc1 gene Proteins 0.000 description 1
 - 102100034741 Cyclin-dependent kinase 20 Human genes 0.000 description 1
 - XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
 - XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
 - 101500014379 Lymnaea stagnalis Ovulation hormone Proteins 0.000 description 1
 - 102100038239 Protein Churchill Human genes 0.000 description 1
 - UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
 - 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
 - FZKGLCPKPZBGLX-ROXVQFJHSA-N acetyloxymethyl (5r,6s)-3-(carbamoyloxymethyl)-6-[(1r)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound S1C(COC(N)=O)=C(C(=O)OCOC(C)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 FZKGLCPKPZBGLX-ROXVQFJHSA-N 0.000 description 1
 - 125000002015 acyclic group Chemical group 0.000 description 1
 - 125000001931 aliphatic group Chemical group 0.000 description 1
 - 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 1
 - 125000003342 alkenyl group Chemical group 0.000 description 1
 - 235000019270 ammonium chloride Nutrition 0.000 description 1
 - 239000004599 antimicrobial Substances 0.000 description 1
 - 239000008346 aqueous phase Substances 0.000 description 1
 - 239000012298 atmosphere Substances 0.000 description 1
 - 230000003115 biocidal effect Effects 0.000 description 1
 - 230000015572 biosynthetic process Effects 0.000 description 1
 - GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
 - 229910052794 bromium Inorganic materials 0.000 description 1
 - 229910052799 carbon Inorganic materials 0.000 description 1
 - 150000007942 carboxylates Chemical class 0.000 description 1
 - 238000005119 centrifugation Methods 0.000 description 1
 - 239000000460 chlorine Substances 0.000 description 1
 - 229910052801 chlorine Inorganic materials 0.000 description 1
 - OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
 - DMSZORWOGDLWGN-UHFFFAOYSA-N ctk1a3526 Chemical compound NP(N)(N)=O DMSZORWOGDLWGN-UHFFFAOYSA-N 0.000 description 1
 - 125000004093 cyano group Chemical group *C#N 0.000 description 1
 - 125000004122 cyclic group Chemical group 0.000 description 1
 - 238000010511 deprotection reaction Methods 0.000 description 1
 - 229910001882 dioxygen Inorganic materials 0.000 description 1
 - 238000010828 elution Methods 0.000 description 1
 - 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
 - LKHYFCSSVZVVNF-UHFFFAOYSA-N ethyl hexanoate;sodium Chemical compound [Na].CCCCCC(=O)OCC LKHYFCSSVZVVNF-UHFFFAOYSA-N 0.000 description 1
 - 230000002349 favourable effect Effects 0.000 description 1
 - 239000000706 filtrate Substances 0.000 description 1
 - 238000001914 filtration Methods 0.000 description 1
 - 239000006260 foam Substances 0.000 description 1
 - 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
 - 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
 - 239000005457 ice water Substances 0.000 description 1
 - PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
 - 239000010410 layer Substances 0.000 description 1
 - 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
 - 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
 - 230000003287 optical effect Effects 0.000 description 1
 - 125000003431 oxalo group Chemical group 0.000 description 1
 - 239000001301 oxygen Substances 0.000 description 1
 - 229910052760 oxygen Inorganic materials 0.000 description 1
 - 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
 - NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
 - 229960000482 pethidine Drugs 0.000 description 1
 - 239000012071 phase Substances 0.000 description 1
 - AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
 - XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
 - OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
 - 238000010992 reflux Methods 0.000 description 1
 - 229920006395 saturated elastomer Polymers 0.000 description 1
 - 238000000926 separation method Methods 0.000 description 1
 - 125000004436 sodium atom Chemical group 0.000 description 1
 - 229940001584 sodium metabisulfite Drugs 0.000 description 1
 - 235000010262 sodium metabisulphite Nutrition 0.000 description 1
 - 229910052938 sodium sulfate Inorganic materials 0.000 description 1
 - 235000011152 sodium sulphate Nutrition 0.000 description 1
 - 238000004611 spectroscopical analysis Methods 0.000 description 1
 - 125000000547 substituted alkyl group Chemical group 0.000 description 1
 - 125000003831 tetrazolyl group Chemical group 0.000 description 1
 - RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
 - 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
 - C07D499/88—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
 - C07D499/04—Preparation
 - C07D499/06—Preparation by forming the ring or condensed ring systems
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
 - C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
 - C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
 - C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
 - C07D205/09—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
 - C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
 - C07F7/02—Silicon compounds
 - C07F7/08—Compounds having one or more C—Si linkages
 - C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
 - C07F7/1804—Compounds having Si-O-C linkages
 
 - 
        
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
 - Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
 - Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
 - Y02P20/00—Technologies relating to chemical industry
 - Y02P20/50—Improvements relating to the production of bulk chemicals
 - Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Organic Chemistry (AREA)
 - Health & Medical Sciences (AREA)
 - Life Sciences & Earth Sciences (AREA)
 - Engineering & Computer Science (AREA)
 - Biotechnology (AREA)
 - Molecular Biology (AREA)
 - Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
 - Nitrogen Condensed Heterocyclic Rings (AREA)
 - Plural Heterocyclic Compounds (AREA)
 
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| GB838321677A GB8321677D0 (en) | 1983-08-11 | 1983-08-11 | Preparation of penems | 
Publications (2)
| Publication Number | Publication Date | 
|---|---|
| HUT34984A HUT34984A (en) | 1985-05-28 | 
| HU192415B true HU192415B (en) | 1987-06-29 | 
Family
ID=10547172
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| HU843056A HU192415B (en) | 1983-08-11 | 1984-08-10 | New process for peneme derivatives | 
Country Status (20)
| Country | Link | 
|---|---|
| US (1) | US4631150A (en, 2012) | 
| JP (1) | JPS6058988A (en, 2012) | 
| KR (1) | KR910002098B1 (en, 2012) | 
| AT (1) | AT383808B (en, 2012) | 
| BE (1) | BE900316A (en, 2012) | 
| CA (1) | CA1279640C (en, 2012) | 
| CH (1) | CH663024A5 (en, 2012) | 
| DE (1) | DE3429102A1 (en, 2012) | 
| DK (1) | DK167926B1 (en, 2012) | 
| ES (1) | ES534892A0 (en, 2012) | 
| FI (1) | FI83521C (en, 2012) | 
| FR (1) | FR2550533B1 (en, 2012) | 
| GB (2) | GB8321677D0 (en, 2012) | 
| GR (1) | GR80102B (en, 2012) | 
| HU (1) | HU192415B (en, 2012) | 
| IL (1) | IL72612A (en, 2012) | 
| IT (1) | IT1209578B (en, 2012) | 
| NL (1) | NL8402478A (en, 2012) | 
| PT (1) | PT79065B (en, 2012) | 
| SE (1) | SE463514B (en, 2012) | 
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| GB8416651D0 (en) * | 1984-06-29 | 1984-08-01 | Erba Farmitalia | Penem derivatives | 
| US5215997A (en) * | 1985-09-11 | 1993-06-01 | Ciba-Geigy Corporation | Synthesis of beta-lactam compounds | 
| DE3688960D1 (de) * | 1985-09-11 | 1993-10-07 | Ciba Geigy | Synthese von Beta-Lactamverbindungen. | 
| ATE159021T1 (de) * | 1986-01-17 | 1997-10-15 | Beecham Group Plc | Verfahren zur herstellung von penem derivaten und zwischenprodukte zu dieser herstellung | 
| EP0233155A1 (de) * | 1986-02-14 | 1987-08-19 | Ciba-Geigy Ag | Aminoacyloxymethyl-Verbindungen | 
| US5215891A (en) * | 1986-10-15 | 1993-06-01 | Farmitalia Carlo Erba | Process for preparing penems | 
| EP0279781A3 (de) * | 1987-02-17 | 1989-07-26 | Ciba-Geigy Ag | Verfahren zur Herstellung von 4-Acetoxy-3-hydroxyethyl-azetidinon | 
| US5312914A (en) * | 1987-02-17 | 1994-05-17 | Ciba-Geigy Corp | Process for the manufacture of 4-acetoxy-3-hydroxyethyl-azetidinone | 
| GB8713515D0 (en) * | 1987-06-10 | 1987-07-15 | Erba Farmitalia | Methoxymethyl compounds | 
| US5364768A (en) * | 1987-07-07 | 1994-11-15 | Farmitalia Carlo Erba S.R.L. | Process for the preparation of penems | 
| GB2206578B (en) * | 1987-07-07 | 1991-07-03 | Erba Carlo Spa | Process for the preparation of penems | 
| US5191075A (en) * | 1988-10-19 | 1993-03-02 | Pfizer Inc | Process for the preparation of penems | 
| US4992543A (en) * | 1988-10-19 | 1991-02-12 | Pfizer Inc. | Penem derivatives | 
| US5273973A (en) * | 1988-10-24 | 1993-12-28 | Norwich Eaton Pharmaceuticals, Inc. | Antimicrobial quinolonyl esters | 
| US5328908A (en) * | 1988-10-24 | 1994-07-12 | Procter & Gamble Pharmaceuticals, Inc. | Antimicrobial quinolone thioureas | 
| US5180719A (en) * | 1988-10-24 | 1993-01-19 | Norwich Eaton Pharmaceuticals, Inc. | Antimicrobial quinolonyl lactam esters | 
| EP0997466A1 (en) * | 1988-10-24 | 2000-05-03 | PROCTER & GAMBLE PHARMACEUTICALS, INC. | Novel antimicrobial lactam-quinolones | 
| US5491139A (en) * | 1988-10-24 | 1996-02-13 | The Procter & Gamble Company | Antimicrobial quinolonyl lactams | 
| CA2001203C (en) * | 1988-10-24 | 2001-02-13 | Thomas P. Demuth, Jr. | Novel antimicrobial dithiocarbamoyl quinolones | 
| EP0399228A1 (de) * | 1989-04-29 | 1990-11-28 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von Penemverbindungen | 
| US5198544A (en) * | 1989-04-29 | 1993-03-30 | Hoechst Aktiengesellschaft | Process for the preparation of penem compounds | 
| ATE193890T1 (de) | 1990-04-18 | 2000-06-15 | Procter & Gamble Pharma | Antimikrobielle chinolonyl-lactame | 
| US5399679A (en) * | 1992-06-16 | 1995-03-21 | Farmitalia Carlo Erba S.R.L. | (1'R,3S,4R)4-acylthio azetidinones | 
| EP0597401A3 (en) * | 1992-11-11 | 1995-07-26 | Takeda Chemical Industries Ltd | Preparation of penemes. | 
| IT1286558B1 (it) * | 1996-02-27 | 1998-07-15 | Menarini Farma Ind | Processo per la preparazione di 2-alogenometil-penems e loro uso per la preparazione di penems antibatterici | 
| CN100417654C (zh) * | 2004-01-09 | 2008-09-10 | 中国医学科学院医药生物技术研究所 | 2-苯羧酸酯青霉烯类化合物及其制备方法和应用 | 
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| US4500457A (en) * | 1977-05-09 | 1985-02-19 | Ciba-Geigy Corporation | Process for preparing thia-aza compounds with a beta-lactam ring | 
| US4168314A (en) * | 1977-11-17 | 1979-09-18 | Merck & Co., Inc. | 6-(1'-Hydroxyethyl)-2-aminoethylthio-pen-2-em-3-carboxylic acid | 
| EP0003960B1 (de) * | 1978-02-02 | 1983-06-29 | Ciba-Geigy Ag | 6-Substituierte Thia-Azaverbindungen, ihre Herstellung und diese enthaltende pharmazeutische Präparate | 
| EP0013067A1 (en) * | 1978-12-22 | 1980-07-09 | Beecham Group Plc | Bicyclic beta-lactam antibacterial agents, their use in pharmaceutical compositions, processes for their preparation and intermediates for use in such processes | 
| GB2043639B (en) * | 1979-02-24 | 1983-07-20 | Erba Farmitalia | 3-optionally substituted methyl-2-penem derivatives | 
| US4269771A (en) * | 1979-04-06 | 1981-05-26 | Farmitalia Carlo Erba | Total synthesis of 7-oxo-4-thia-1-azabicyclo-[3,2,0]-heptane-2-carboxyl derivatives useful as β-lactamase inhibitors and antibacterial agents | 
| FR2483924A1 (fr) * | 1980-06-06 | 1981-12-11 | Sankyo Co | Derives d'acide peneme-3-carboxylique, leurs procedes de preparation et leur application en therapeutique | 
| GB2079744A (en) * | 1980-07-04 | 1982-01-27 | Erba Farmitalia | 6-Alkyl-2-functionalized penems | 
| US4347183A (en) * | 1981-02-02 | 1982-08-31 | Schering Corporation | Process for the synthesis of penems and carbapenems | 
| JPS588084A (ja) * | 1981-07-08 | 1983-01-18 | Takeda Chem Ind Ltd | (6r)−置換−(5r)−ペネム−3−カルボン酸誘導体およびその製造法 | 
| US4411906A (en) * | 1981-11-25 | 1983-10-25 | Schering Corporation | (5R,6S,8R)-6-(1-Hydroxyethyl)-2-(2-fluoroethylthio)-penem-3-carboxylates | 
| US4508649A (en) * | 1981-12-11 | 1985-04-02 | Farmitalia Carlo Erba | Process for preparing optically active penems | 
| US4443373A (en) * | 1982-03-30 | 1984-04-17 | Schering Corporation | Process for the production of antibiotic penems | 
| US4584133A (en) * | 1983-11-07 | 1986-04-22 | Schering Corporation | Process for the production of penems | 
- 
        1983
        
- 1983-08-11 GB GB838321677A patent/GB8321677D0/en active Pending
 
 - 
        1984
        
- 1984-08-03 ES ES534892A patent/ES534892A0/es active Granted
 - 1984-08-06 IT IT8422234A patent/IT1209578B/it active
 - 1984-08-06 US US06/637,878 patent/US4631150A/en not_active Expired - Lifetime
 - 1984-08-07 IL IL72612A patent/IL72612A/xx not_active IP Right Cessation
 - 1984-08-07 DE DE19843429102 patent/DE3429102A1/de not_active Ceased
 - 1984-08-07 FR FR8412466A patent/FR2550533B1/fr not_active Expired
 - 1984-08-07 SE SE8404004A patent/SE463514B/sv not_active IP Right Cessation
 - 1984-08-07 AT AT0255884A patent/AT383808B/de not_active IP Right Cessation
 - 1984-08-08 JP JP59165031A patent/JPS6058988A/ja active Granted
 - 1984-08-08 DK DK382084A patent/DK167926B1/da not_active IP Right Cessation
 - 1984-08-08 BE BE0/213460A patent/BE900316A/fr not_active IP Right Cessation
 - 1984-08-08 FI FI843111A patent/FI83521C/fi not_active IP Right Cessation
 - 1984-08-09 GB GB08420236A patent/GB2144743B/en not_active Expired
 - 1984-08-10 KR KR1019840004797A patent/KR910002098B1/ko not_active Expired
 - 1984-08-10 HU HU843056A patent/HU192415B/hu not_active IP Right Cessation
 - 1984-08-10 PT PT79065A patent/PT79065B/pt not_active IP Right Cessation
 - 1984-08-10 GR GR80102A patent/GR80102B/el unknown
 - 1984-08-10 NL NL8402478A patent/NL8402478A/xx not_active Application Discontinuation
 - 1984-08-10 CA CA000460795A patent/CA1279640C/en not_active Expired - Lifetime
 - 1984-08-10 CH CH3855/84A patent/CH663024A5/de not_active IP Right Cessation
 
 
Also Published As
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| HU192415B (en) | New process for peneme derivatives | |
| HU189559B (en) | Process for preparing 2-penem compounds | |
| US4290947A (en) | Process for the preparation of thienamycin and intermediates | |
| Leanza et al. | An efficient synthesis of 2-substituted-thio-6-hydroxyethyl-penem-3-carboxylic acids via 2-thioxopenams | |
| US4683296A (en) | Carbapenem intermediates | |
| JPH0557980B2 (en, 2012) | ||
| DE3588039T2 (de) | Azetidinonderivate und Verfahren zu ihrer Herstellung. | |
| EP0146730B1 (en) | Process for the production of penems | |
| EP0167155B1 (en) | Beta-lactam compound and preparing thereof | |
| HU194250B (en) | Process for producing anhydro-penicillin derivatives | |
| US4508649A (en) | Process for preparing optically active penems | |
| EP0013067A1 (en) | Bicyclic beta-lactam antibacterial agents, their use in pharmaceutical compositions, processes for their preparation and intermediates for use in such processes | |
| HU192819B (en) | Process for preparing antibacterial penemic derivatives | |
| US4378315A (en) | Process for the preparation of thienamycin and intermediates | |
| US4739048A (en) | Process for the preparation of thienamycin and intermediates | |
| US4610820A (en) | Process for the preparation of thienamycin and intermediates | |
| US4400323A (en) | 3-[1-Hydroxyethyl]-4-carboxymethyl-azetidin-2-one | |
| DE3408196C2 (en, 2012) | ||
| US4736025A (en) | Process for the preparation of thienamycin and intermediates | |
| KR100262240B1 (ko) | 3-치환된-7-옥소-1-아자비사이클로3,2,0 헵트-2-엔-2-카복실레이트 화합물 및 그의 제조방법 | |
| EP0066301B1 (en) | Intermediates for the preparation of thienamycin and process for preparing the same | |
| US4885362A (en) | Azetidinone intermediates for 1-carba(dethia)caphalosporins | |
| JPS63107988A (ja) | 抗細菌活性を有する7−オキソ−4−チア−1−アザビシクロ〔3.2.0〕ヘプト−2−エン誘導体の製造法 | |
| US4663451A (en) | Process for the synthesis of penems and penams | |
| JPH05500210A (ja) | ペネムの製造方法 | 
Legal Events
| Date | Code | Title | Description | 
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |