HU185092B - New process for preparing imidazo-benzodizephine derivatives and salts thereof - Google Patents
New process for preparing imidazo-benzodizephine derivatives and salts thereof Download PDFInfo
- Publication number
- HU185092B HU185092B HU82939A HU93982A HU185092B HU 185092 B HU185092 B HU 185092B HU 82939 A HU82939 A HU 82939A HU 93982 A HU93982 A HU 93982A HU 185092 B HU185092 B HU 185092B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- acid
- compound
- salts
- benzodizephine
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title description 6
- 238000004519 manufacturing process Methods 0.000 title 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 30
- 150000001875 compounds Chemical class 0.000 claims description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 210000003608 fece Anatomy 0.000 claims 1
- 239000010871 livestock manure Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- -1 4-ethylpiperazin-1-yl Chemical group 0.000 description 6
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- CWKDVPRCCDFZMR-UHFFFAOYSA-N 2-[[5-(2-chlorophenyl)-7-nitro-3h-1,4-benzodiazepin-2-yl]amino]acetic acid Chemical compound N=1CC(NCC(=O)O)=NC2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1Cl CWKDVPRCCDFZMR-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 2
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 2
- JQTMGOLZSBTZMS-UHFFFAOYSA-N 4-methylpiperazine-1-carbaldehyde Chemical compound CN1CCN(C=O)CC1 JQTMGOLZSBTZMS-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- IBYCDDNFZLAIAO-UHFFFAOYSA-N 2,4-dihydroimidazo[1,2-a][1,4]benzodiazepin-1-one Chemical compound C1N=CC2=CC=CC=C2N2C(=O)CN=C21 IBYCDDNFZLAIAO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000002921 anti-spasmodic effect Effects 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000003158 myorelaxant agent Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8106171A FR2502621B1 (https=) | 1981-03-27 | 1981-03-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU185092B true HU185092B (en) | 1984-11-28 |
Family
ID=9256708
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU82939A HU185092B (en) | 1981-03-27 | 1982-03-26 | New process for preparing imidazo-benzodizephine derivatives and salts thereof |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS57169483A (https=) |
| AU (1) | AU549222B2 (https=) |
| CA (1) | CA1175823A (https=) |
| CH (1) | CH651565A5 (https=) |
| DE (1) | DE3211243A1 (https=) |
| DK (1) | DK153404C (https=) |
| ES (1) | ES8302712A1 (https=) |
| FI (1) | FI71152C (https=) |
| FR (1) | FR2502621B1 (https=) |
| GB (1) | GB2095674B (https=) |
| HU (1) | HU185092B (https=) |
| IT (1) | IT1147917B (https=) |
| MA (1) | MA19416A1 (https=) |
| NL (1) | NL193246C (https=) |
| PT (1) | PT74669B (https=) |
| SE (2) | SE448731B (https=) |
| ZA (1) | ZA821141B (https=) |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3872090A (en) * | 1972-07-12 | 1975-03-18 | Boehringer Sohn Ingelheim | 3-(amino-methylene)-5-phenyl-1,4-benzodiazepin-2-ones |
| IL48888A (en) * | 1975-02-15 | 1979-03-12 | Roussel Uclaf | 2-aminomethylene-1,2-dihydro-6-phenyl-1h-imidazo(1,2-a)(1,4) benzodiazepin-1-ones, process for their preparation andpharmaceutical compositions incorporating them |
-
1981
- 1981-03-27 FR FR8106171A patent/FR2502621B1/fr not_active Expired
-
1982
- 1982-01-19 SE SE8200271A patent/SE448731B/sv not_active IP Right Cessation
- 1982-01-19 SE SE8200271D patent/SE8200271L/xx not_active Application Discontinuation
- 1982-02-03 ES ES509284A patent/ES8302712A1/es not_active Expired
- 1982-02-22 ZA ZA821141A patent/ZA821141B/xx unknown
- 1982-02-26 AU AU80947/82A patent/AU549222B2/en not_active Expired
- 1982-03-18 MA MA19621A patent/MA19416A1/fr unknown
- 1982-03-19 IT IT48036/82A patent/IT1147917B/it active
- 1982-03-23 NL NL8201208A patent/NL193246C/nl not_active IP Right Cessation
- 1982-03-24 JP JP57045728A patent/JPS57169483A/ja active Pending
- 1982-03-25 FI FI821058A patent/FI71152C/fi not_active IP Right Cessation
- 1982-03-26 DE DE19823211243 patent/DE3211243A1/de active Granted
- 1982-03-26 DK DK138682A patent/DK153404C/da not_active IP Right Cessation
- 1982-03-26 GB GB8208933A patent/GB2095674B/en not_active Expired
- 1982-03-26 HU HU82939A patent/HU185092B/hu not_active IP Right Cessation
- 1982-03-26 CA CA000399537A patent/CA1175823A/fr not_active Expired
- 1982-03-26 CH CH1896/82A patent/CH651565A5/fr not_active IP Right Cessation
- 1982-03-26 PT PT74669A patent/PT74669B/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL8201208A (nl) | 1982-10-18 |
| FI71152C (fi) | 1986-11-24 |
| FR2502621B1 (https=) | 1983-10-28 |
| AU8094782A (en) | 1982-09-30 |
| DK138682A (da) | 1982-09-28 |
| NL193246C (nl) | 1999-04-02 |
| CA1175823A (fr) | 1984-10-09 |
| IT1147917B (it) | 1986-11-26 |
| FI821058L (fi) | 1982-09-28 |
| MA19416A1 (fr) | 1982-10-01 |
| PT74669B (fr) | 1985-01-08 |
| FI821058A0 (fi) | 1982-03-25 |
| GB2095674B (en) | 1984-10-10 |
| ES509284A0 (es) | 1983-01-16 |
| AU549222B2 (en) | 1986-01-23 |
| NL193246B (nl) | 1998-12-01 |
| ZA821141B (en) | 1983-01-26 |
| FI71152B (fi) | 1986-08-14 |
| PT74669A (fr) | 1982-04-01 |
| IT8248036A0 (it) | 1982-03-19 |
| SE8200271L (sv) | 1982-09-28 |
| DE3211243C2 (https=) | 1993-05-19 |
| CH651565A5 (fr) | 1985-09-30 |
| ES8302712A1 (es) | 1983-01-16 |
| DK153404C (da) | 1988-11-21 |
| SE448731B (sv) | 1987-03-16 |
| JPS57169483A (en) | 1982-10-19 |
| DK153404B (da) | 1988-07-11 |
| FR2502621A1 (https=) | 1982-10-01 |
| GB2095674A (en) | 1982-10-06 |
| DE3211243A1 (de) | 1982-10-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2124015C1 (ru) | Производные пирроло [2,3-d] пиримидинов, фармацевтическая композиция, пирроло [2,3-d] пиримидины, производные пиррола | |
| Taylor et al. | Synthesis of pyrazolo 3, 4-dpyrimidine analogues of the potent agent N-4-2-2-amino-4 3H-oxo-7H-pyrrolo 2, 3-dpyrimidin-5-yl ethylbenzoyl-L-glutamic acid (LY231514) | |
| US4548820A (en) | Xanthine compounds | |
| EP1362048B1 (en) | Triazolo compounds as mmp inhibitors | |
| Chern et al. | Studies on quinazolines. 5. 2, 3-Dihydroimidazo [1, 2-c] quinazoline derivatives: a novel class of potent and selective. alpha. 1-adrenoceptor antagonists and antihypertensive agents | |
| US5086178A (en) | Fluorinated diazabicycloalkane derivatives | |
| JPS60172980A (ja) | イミダゾ−ル化合物 | |
| US4025513A (en) | Synthesis for the preparation of tetracyclic compounds | |
| PL173738B1 (pl) | Sposób wytwarzania pochodnych pirolo(2,3-d)pirymidyny | |
| SU906377A3 (ru) | Способ получени производных эрголина | |
| HU201057B (en) | Process for producing 6-phenyl-3-(piperazinyl-alkyl)-1h,3h-pyrimidin-2,4-dion derivatives and pharmaceutical compositions containing them | |
| JPS6147466A (ja) | アミン誘導体 | |
| HU182662B (en) | Process for producing pyrimido-2-benzodiazepine derivatives | |
| US4582833A (en) | 2-(substituted-1-piperazinyl)[1,2,4]triazolo[1,5-a]pyrimidines | |
| HU185092B (en) | New process for preparing imidazo-benzodizephine derivatives and salts thereof | |
| HU193721B (en) | Process for preparing trans-(+,-)-octahydro-pyrimido /4,5-g/ quinoline derivatives | |
| US4746658A (en) | 2-phenyl-imidazo-pyrazines, -pyridazines and -triazines | |
| US4226768A (en) | Process for the preparation of imidazobenzodiazepines | |
| AU612146B2 (en) | Novel intermediates and process for preparation of histamine H2-antagonists | |
| SE450120B (sv) | Nya dimetoxikinazolinderivat till anvendning for framstellning av 2(4-substituerade piperazin-1-yl)-4-amino-6,7-dimetoxikinazoliner | |
| Peet et al. | Preparation of imidazo [2, 1‐b] quinazolin‐5 (3H)‐ones and related tricyclic systems using a novel, double displacement reaction | |
| SU999967A3 (ru) | Способ получени 6-N-замещенных 6-амино-3-пиридазинилгидразинов или их солей | |
| US3947417A (en) | Triazolobenzodiazepine derivatives | |
| NO820303L (no) | Fremgangsmaate ved fremstilling av nye tricykliske pyrroler | |
| JPH09194463A (ja) | 光学純度が高い1,2,3,4−テトラヒドロ−3−イソキノリンカルボン酸及びその誘導体の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HPC4 | Succession in title of patentee |
Owner name: HOECHST MARION ROUSSEL, FR |
|
| HMM4 | Cancellation of final prot. due to non-payment of fee |