FI71152C - Nytt foerfarande foer framstaellning av 1,2-dihydro-1h-imidazo/1,2-a/ /1,4/bensodiazepin-1-on-derivat och deras salter - Google Patents
Nytt foerfarande foer framstaellning av 1,2-dihydro-1h-imidazo/1,2-a/ /1,4/bensodiazepin-1-on-derivat och deras salter Download PDFInfo
- Publication number
- FI71152C FI71152C FI821058A FI821058A FI71152C FI 71152 C FI71152 C FI 71152C FI 821058 A FI821058 A FI 821058A FI 821058 A FI821058 A FI 821058A FI 71152 C FI71152 C FI 71152C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- compound
- dihydro
- imidazo
- benzodiazepin
- Prior art date
Links
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 39
- 150000001875 compounds Chemical class 0.000 claims description 22
- 238000002360 preparation method Methods 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- -1 4-phenylpiperazin-1-yl Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 235000005985 organic acids Nutrition 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- LWTIGXOKZKJDEN-UHFFFAOYSA-N 2-benzazepin-1-one Chemical class O=C1N=CC=CC2=CC=CC=C12 LWTIGXOKZKJDEN-UHFFFAOYSA-N 0.000 claims 1
- 235000020357 syrup Nutrition 0.000 claims 1
- 239000006188 syrup Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N Vilsmeier-Haack reagent Natural products CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 5
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 229940049706 benzodiazepine Drugs 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- IVLIBVDZIYFXBZ-UHFFFAOYSA-N 1-(cyclopropylmethyl)piperazine Chemical group C1CNCCN1CC1CC1 IVLIBVDZIYFXBZ-UHFFFAOYSA-N 0.000 description 1
- MSSDTZLYNMFTKN-UHFFFAOYSA-N 1-Piperazinecarboxaldehyde Chemical compound O=CN1CCNCC1 MSSDTZLYNMFTKN-UHFFFAOYSA-N 0.000 description 1
- LKTRGYCDCTYFTM-UHFFFAOYSA-N 2,4-benzodiazepin-1-one Chemical class O=C1N=CN=CC2=CC=CC=C12 LKTRGYCDCTYFTM-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000003791 organic solvent mixture Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8106171A FR2502621B1 (https=) | 1981-03-27 | 1981-03-27 | |
| FR8106171 | 1981-03-27 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI821058A0 FI821058A0 (fi) | 1982-03-25 |
| FI821058L FI821058L (fi) | 1982-09-28 |
| FI71152B FI71152B (fi) | 1986-08-14 |
| FI71152C true FI71152C (fi) | 1986-11-24 |
Family
ID=9256708
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI821058A FI71152C (fi) | 1981-03-27 | 1982-03-25 | Nytt foerfarande foer framstaellning av 1,2-dihydro-1h-imidazo/1,2-a/ /1,4/bensodiazepin-1-on-derivat och deras salter |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS57169483A (https=) |
| AU (1) | AU549222B2 (https=) |
| CA (1) | CA1175823A (https=) |
| CH (1) | CH651565A5 (https=) |
| DE (1) | DE3211243A1 (https=) |
| DK (1) | DK153404C (https=) |
| ES (1) | ES8302712A1 (https=) |
| FI (1) | FI71152C (https=) |
| FR (1) | FR2502621B1 (https=) |
| GB (1) | GB2095674B (https=) |
| HU (1) | HU185092B (https=) |
| IT (1) | IT1147917B (https=) |
| MA (1) | MA19416A1 (https=) |
| NL (1) | NL193246C (https=) |
| PT (1) | PT74669B (https=) |
| SE (2) | SE8200271L (https=) |
| ZA (1) | ZA821141B (https=) |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3872090A (en) * | 1972-07-12 | 1975-03-18 | Boehringer Sohn Ingelheim | 3-(amino-methylene)-5-phenyl-1,4-benzodiazepin-2-ones |
| IL48888A (en) * | 1975-02-15 | 1979-03-12 | Roussel Uclaf | 2-aminomethylene-1,2-dihydro-6-phenyl-1h-imidazo(1,2-a)(1,4) benzodiazepin-1-ones, process for their preparation andpharmaceutical compositions incorporating them |
-
1981
- 1981-03-27 FR FR8106171A patent/FR2502621B1/fr not_active Expired
-
1982
- 1982-01-19 SE SE8200271D patent/SE8200271L/xx not_active Application Discontinuation
- 1982-01-19 SE SE8200271A patent/SE448731B/sv not_active IP Right Cessation
- 1982-02-03 ES ES509284A patent/ES8302712A1/es not_active Expired
- 1982-02-22 ZA ZA821141A patent/ZA821141B/xx unknown
- 1982-02-26 AU AU80947/82A patent/AU549222B2/en not_active Expired
- 1982-03-18 MA MA19621A patent/MA19416A1/fr unknown
- 1982-03-19 IT IT48036/82A patent/IT1147917B/it active
- 1982-03-23 NL NL8201208A patent/NL193246C/nl not_active IP Right Cessation
- 1982-03-24 JP JP57045728A patent/JPS57169483A/ja active Pending
- 1982-03-25 FI FI821058A patent/FI71152C/fi not_active IP Right Cessation
- 1982-03-26 DK DK138682A patent/DK153404C/da not_active IP Right Cessation
- 1982-03-26 CH CH1896/82A patent/CH651565A5/fr not_active IP Right Cessation
- 1982-03-26 HU HU82939A patent/HU185092B/hu not_active IP Right Cessation
- 1982-03-26 DE DE19823211243 patent/DE3211243A1/de active Granted
- 1982-03-26 GB GB8208933A patent/GB2095674B/en not_active Expired
- 1982-03-26 CA CA000399537A patent/CA1175823A/fr not_active Expired
- 1982-03-26 PT PT74669A patent/PT74669B/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS57169483A (en) | 1982-10-19 |
| PT74669B (fr) | 1985-01-08 |
| FR2502621B1 (https=) | 1983-10-28 |
| SE8200271L (sv) | 1982-09-28 |
| NL193246B (nl) | 1998-12-01 |
| NL8201208A (nl) | 1982-10-18 |
| ZA821141B (en) | 1983-01-26 |
| FI821058A0 (fi) | 1982-03-25 |
| FR2502621A1 (https=) | 1982-10-01 |
| SE448731B (sv) | 1987-03-16 |
| DK153404B (da) | 1988-07-11 |
| DE3211243A1 (de) | 1982-10-07 |
| GB2095674A (en) | 1982-10-06 |
| DK138682A (da) | 1982-09-28 |
| MA19416A1 (fr) | 1982-10-01 |
| AU8094782A (en) | 1982-09-30 |
| GB2095674B (en) | 1984-10-10 |
| DK153404C (da) | 1988-11-21 |
| PT74669A (fr) | 1982-04-01 |
| IT8248036A0 (it) | 1982-03-19 |
| CH651565A5 (fr) | 1985-09-30 |
| ES509284A0 (es) | 1983-01-16 |
| HU185092B (en) | 1984-11-28 |
| IT1147917B (it) | 1986-11-26 |
| FI821058L (fi) | 1982-09-28 |
| ES8302712A1 (es) | 1983-01-16 |
| FI71152B (fi) | 1986-08-14 |
| AU549222B2 (en) | 1986-01-23 |
| DE3211243C2 (https=) | 1993-05-19 |
| NL193246C (nl) | 1999-04-02 |
| CA1175823A (fr) | 1984-10-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3983120A (en) | Process for the preparation of optionally substituted 1,2,3,5-tetrahydroimidazo[2,1-b]quinazolin-2-ones | |
| US3983119A (en) | Process for the preparation of optionally substituted 1,2,3,5-tetrahydroimidazo[2,1-b]quinazolin-2-ones | |
| Hardtmann et al. | Synthesis and biological evaluation of some 10-substituted 2, 3-dihydroimidazo [2, 1-b] quinazolin-5 (10H)-ones, a new class of bronchodilators | |
| Suzuki et al. | Synthesis and antiallergy activity of [1, 3, 4] thiadiazolo [3, 2-a]-1, 2, 3-triazolo [4, 5-d] pyrimidin-9 (3H)-one Derivatives. I | |
| FI71152B (fi) | Nytt foerfarande foer framstaellning av 1,2-dihydro-1h-imidazo/1,2-a//1,4/bensodiazepin-1-on-derivat och deras salter | |
| CA1057752A (en) | Imidazo-and pyrimido (2,1-b) quinazolines and preparation thereof | |
| NO873108L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive 1,4-benzodiazepiner. | |
| RU2042678C1 (ru) | Способ получения 6,7- дихлор -1,5- дигидроимидазо (2,1-(b) -хиназолин-2- (3н)-она, промежуточные для их получения и способ их получения | |
| CA1057287A (en) | Amino-2 imidazoles | |
| US3936444A (en) | Production of aryl lactam-hydrazones | |
| NL8501099A (nl) | Werkwijze voor het bereiden van nieuwe 2-arylamino-2-imidazolinederivaten. | |
| US3507863A (en) | Isoindolones and method for preparing same | |
| Doleschall et al. | Condensed 1, 3, 5-triazepines—II: The synthesis of 2, 3-dihydro-1H-imidazo [1, 2-a][1, 3, 5] benzotriazepin-5 (6H)-ones and-thiones | |
| US3474135A (en) | N-(omega-aminoalkylene)-aminoalkyl sulfonic acids | |
| US3483198A (en) | Pyrimidobenzothiazines | |
| KOSASAYAMA et al. | Cyclic Guanidines. VI. synthesis of hypoglycemic tricyclic guanidines | |
| HU206090B (en) | Process for producing new 1-phenyl-1,4-dihydro-3-amino-4-oxopyridazine derivatives and pharmaceutical compositions comprising such compounds as active ingredient | |
| US3503976A (en) | Production of pyrimidines bearing halogen as substituent in the 5-position | |
| US3928349A (en) | Nitroimidazolyl-triazolo-pyridazine compounds | |
| US3560515A (en) | New thiazolobenzodiazepine compounds and methods for their production | |
| DK155326B (da) | Fremgangsmaade til fremstilling af 1,4-benzodiazepin-2-on-derivater | |
| TAYLOR et al. | Some Further Reactions of α-Cyanobenzyl Benzenesulfonate1 | |
| US3931226A (en) | Process for the preparation of diazepino[1,2-a]indoles | |
| Kobayashi | Pyrimidine-Fused 1, 4-Benzodiazepines. Reaction of 1, 4-Benzodiazepines with Formamide–POCl 3 | |
| CA1055491A (en) | Process for the manufacture of benzodiazepine derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PC | Transfer of assignment of patent |
Owner name: HOECHST MARION ROUSSEL |
|
| MA | Patent expired |
Owner name: AVENTIS PHARMA S.A. |