HU184063B - Process for producing carbamoic-acid-phenyl-ester derivatives - Google Patents
Process for producing carbamoic-acid-phenyl-ester derivatives Download PDFInfo
- Publication number
- HU184063B HU184063B HUCI001984A HU184063B HU 184063 B HU184063 B HU 184063B HU CI001984 A HUCI001984 A HU CI001984A HU 184063 B HU184063 B HU 184063B
- Authority
- HU
- Hungary
- Prior art keywords
- acid
- formula
- acetone
- alkyl
- phenyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 14
- -1 saccharin compound Chemical class 0.000 claims abstract description 21
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 7
- 238000002360 preparation method Methods 0.000 claims abstract description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 19
- 239000003960 organic solvent Substances 0.000 claims description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical group C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- 150000002989 phenols Chemical class 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 3
- 230000006179 O-acylation Effects 0.000 claims description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 3
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 claims description 3
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical group C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 claims description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical group C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 2
- 125000005879 dioxolanyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- UUSUFQUCLACDTA-UHFFFAOYSA-N 1,2-dihydropyrene Chemical group C1=CC=C2C=CC3=CCCC4=CC=C1C2=C43 UUSUFQUCLACDTA-UHFFFAOYSA-N 0.000 claims 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Chemical group COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 abstract description 60
- 239000002253 acid Substances 0.000 abstract description 17
- 239000003795 chemical substances by application Substances 0.000 abstract description 9
- 239000002904 solvent Substances 0.000 abstract description 5
- 230000010933 acylation Effects 0.000 abstract description 2
- 238000005917 acylation reaction Methods 0.000 abstract description 2
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical class NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 abstract description 2
- MLEVBPIRDRGCQE-UHFFFAOYSA-N [SH2]=N.CC1=C(C=CC=C1)NC(=O)C1=C(C(=O)O)C=CC=C1 Chemical compound [SH2]=N.CC1=C(C=CC=C1)NC(=O)C1=C(C(=O)O)C=CC=C1 MLEVBPIRDRGCQE-UHFFFAOYSA-N 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 239000011814 protection agent Substances 0.000 abstract 1
- 229940081974 saccharin Drugs 0.000 abstract 1
- 235000019204 saccharin Nutrition 0.000 abstract 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 abstract 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 48
- 238000003756 stirring Methods 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 10
- 239000012153 distilled water Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methyl urea Chemical compound CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 239000005711 Benzoic acid Substances 0.000 description 5
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Natural products CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 5
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000012948 isocyanate Substances 0.000 description 4
- 150000002513 isocyanates Chemical class 0.000 description 4
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 4
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 231100000331 toxic Toxicity 0.000 description 3
- 230000002588 toxic effect Effects 0.000 description 3
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- OLDRZWKGXUGNOW-UHFFFAOYSA-N [SH2]=N.CNC(=O)C1=CC=CC=C1C(O)=O Chemical compound [SH2]=N.CNC(=O)C1=CC=CC=C1C(O)=O OLDRZWKGXUGNOW-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 2
- UFEJKYYYVXYMMS-UHFFFAOYSA-N methylcarbamic acid Chemical compound CNC(O)=O UFEJKYYYVXYMMS-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- OTYKXVWEKXHDHH-UHFFFAOYSA-N (2-methoxyphenyl) n-methylcarbamate Chemical compound CNC(=O)OC1=CC=CC=C1OC OTYKXVWEKXHDHH-UHFFFAOYSA-N 0.000 description 1
- BPEXDDJJJGXJOE-UHFFFAOYSA-N (4-methylphenyl) n-tert-butylcarbamate Chemical compound CC1=CC=C(OC(=O)NC(C)(C)C)C=C1 BPEXDDJJJGXJOE-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- JWQYZECMEPOAPF-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalen-2-ol Chemical compound C1=CC=C2CC(O)CCC2=C1 JWQYZECMEPOAPF-UHFFFAOYSA-N 0.000 description 1
- XROQKUFKUWMFEY-UHFFFAOYSA-N 1,2-dimethylindol-5-ol Chemical compound OC1=CC=C2N(C)C(C)=CC2=C1 XROQKUFKUWMFEY-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QCGCZQXNAUVPKJ-UHFFFAOYSA-N 2-(4-hydroxy-5-methoxycyclohexa-2,4-dien-1-ylidene)acetonitrile Chemical compound COC1=C(O)C=CC(=CC#N)C1 QCGCZQXNAUVPKJ-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- HTWIZMNMTWYQRN-UHFFFAOYSA-N 2-methyl-1,3-dioxolane Chemical compound CC1OCCO1 HTWIZMNMTWYQRN-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- KCEGBVVSJJFOPO-UHFFFAOYSA-N [SH2]=N.OC(=O)C1=CC=CC=C1C(=O)NCC1=CC=CC=C1 Chemical compound [SH2]=N.OC(=O)C1=CC=CC=C1C(=O)NCC1=CC=CC=C1 KCEGBVVSJJFOPO-UHFFFAOYSA-N 0.000 description 1
- 238000003916 acid precipitation Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- OKHGVUANQHMSCH-UHFFFAOYSA-N benzhydryl(phenyl)carbamic acid Chemical compound C=1C=CC=CC=1N(C(=O)O)C(C=1C=CC=CC=1)C1=CC=CC=C1 OKHGVUANQHMSCH-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- GTCAXTIRRLKXRU-UHFFFAOYSA-N carbamic acid methyl ester Natural products COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 1
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- JPXIYUADQNFRCK-UHFFFAOYSA-N n-(3-methylphenyl)formamide Chemical compound CC1=CC=CC(NC=O)=C1 JPXIYUADQNFRCK-UHFFFAOYSA-N 0.000 description 1
- DZIRZHBFUPWNFK-UHFFFAOYSA-N n-alkylphthalic monoamide Chemical compound CNC(=O)C1=CC=CC=C1C(O)=O DZIRZHBFUPWNFK-UHFFFAOYSA-N 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ICGNCPZDLALZBU-UHFFFAOYSA-N phenyl n-butylcarbamate Chemical compound CCCCNC(=O)OC1=CC=CC=C1 ICGNCPZDLALZBU-UHFFFAOYSA-N 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- PBDIJXYBHFECQC-UHFFFAOYSA-N quinolin-8-yl n-phenylcarbamate Chemical compound C=1C=CC2=CC=CN=C2C=1OC(=O)NC1=CC=CC=C1 PBDIJXYBHFECQC-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/86—Benzo [b] furans; Hydrogenated benzo [b] furans with an oxygen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI001984 HU184063B (en) | 1979-11-08 | 1979-11-08 | Process for producing carbamoic-acid-phenyl-ester derivatives |
| DE19803040633 DE3040633A1 (de) | 1979-11-08 | 1980-10-29 | Verfahren zur herstellung von carbaminsaeurephenylesterderivaten durch acylierung sowie dafuer verwendete acylierungsmittel |
| PL22765180A PL127976B1 (en) | 1979-11-08 | 1980-11-04 | Process for preparing phenyl esters of carbamic acids |
| CS744780A CS219932B2 (en) | 1979-11-08 | 1980-11-04 | Method of making the derivatives of the phenylester of the carbamic acid |
| YU280880A YU280880A (en) | 1979-11-08 | 1980-11-04 | Method of o-acylation of phenol derivatives |
| FR8023596A FR2469399A1 (fr) | 1979-11-08 | 1980-11-05 | Procede de o-acylation de derives de phenol et compositions acylantes a cet effet |
| SU803003801A SU1176833A3 (ru) | 1979-11-08 | 1980-11-05 | Способ получени производных фенилового эфира карбаминовой кислоты |
| DD23091580A DD159637A5 (de) | 1979-11-08 | 1980-11-05 | Acylierungsmittel zur acylierung von phenolischen hydroxylgruppen |
| JP15476980A JPS5683461A (en) | 1979-11-08 | 1980-11-05 | Ooacylation of phenol derivative and acylating composition therefor |
| DD22498880A DD154100A5 (de) | 1979-11-08 | 1980-11-05 | Verfahren zur herstellung von carbaminsaeureester-derivaten durch o-acylierung |
| GB8035667A GB2065639B (en) | 1979-11-08 | 1980-11-06 | N-carbamoyl-saccharin derivatives and their use as acylating agents in the preparation of phenyl carbamate derivatives |
| US06/246,412 US4315861A (en) | 1979-11-08 | 1981-03-23 | Process for O-acylating phenol derivatives and acylating compositions for this purpose |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI001984 HU184063B (en) | 1979-11-08 | 1979-11-08 | Process for producing carbamoic-acid-phenyl-ester derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU184063B true HU184063B (en) | 1984-06-28 |
Family
ID=10994773
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HUCI001984 HU184063B (en) | 1979-11-08 | 1979-11-08 | Process for producing carbamoic-acid-phenyl-ester derivatives |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JPS5683461A (enExample) |
| CS (1) | CS219932B2 (enExample) |
| DD (2) | DD154100A5 (enExample) |
| DE (1) | DE3040633A1 (enExample) |
| FR (1) | FR2469399A1 (enExample) |
| GB (1) | GB2065639B (enExample) |
| HU (1) | HU184063B (enExample) |
| PL (1) | PL127976B1 (enExample) |
| SU (1) | SU1176833A3 (enExample) |
| YU (1) | YU280880A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU185294B (en) * | 1980-12-29 | 1984-12-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing substituted urea derivatives |
| FR2612186B1 (fr) * | 1987-03-09 | 1989-07-21 | Poudres & Explosifs Ste Nale | Carbonyl 2,2' bis (alkyl-4 oxadiazolidines-1,2,4-diones-3,5), leur procede de preparation et leur utilisation comme intermediaires de synthese dans la preparation de carbamates |
| JP2582864B2 (ja) * | 1987-06-25 | 1997-02-19 | イーライ・リリー・アンド・カンパニー | 尿素誘導体の製造方法 |
| JP4821680B2 (ja) * | 2007-03-30 | 2011-11-24 | 大日本印刷株式会社 | 塩基増殖剤、それを用いた樹脂組成物、及び物品 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE792313A (fr) * | 1971-12-06 | 1973-03-30 | Quimco Gmbh | Procede de preparation de carbamates mono substitues sur l'atome d'azote et produits obtenus |
| HU167249B (enExample) * | 1973-04-24 | 1975-09-27 |
-
1979
- 1979-11-08 HU HUCI001984 patent/HU184063B/hu unknown
-
1980
- 1980-10-29 DE DE19803040633 patent/DE3040633A1/de active Granted
- 1980-11-04 CS CS744780A patent/CS219932B2/cs unknown
- 1980-11-04 PL PL22765180A patent/PL127976B1/pl unknown
- 1980-11-04 YU YU280880A patent/YU280880A/xx unknown
- 1980-11-05 FR FR8023596A patent/FR2469399A1/fr active Granted
- 1980-11-05 DD DD22498880A patent/DD154100A5/de not_active IP Right Cessation
- 1980-11-05 SU SU803003801A patent/SU1176833A3/ru active
- 1980-11-05 JP JP15476980A patent/JPS5683461A/ja active Pending
- 1980-11-05 DD DD23091580A patent/DD159637A5/de not_active IP Right Cessation
- 1980-11-06 GB GB8035667A patent/GB2065639B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| PL227651A1 (enExample) | 1981-08-21 |
| JPS5683461A (en) | 1981-07-08 |
| YU280880A (en) | 1983-12-31 |
| FR2469399A1 (fr) | 1981-05-22 |
| GB2065639A (en) | 1981-07-01 |
| FR2469399B1 (enExample) | 1984-05-11 |
| CS219932B2 (en) | 1983-03-25 |
| DD159637A5 (de) | 1983-03-23 |
| SU1176833A3 (ru) | 1985-08-30 |
| DE3040633A1 (de) | 1981-05-21 |
| DE3040633C2 (enExample) | 1989-01-05 |
| GB2065639B (en) | 1983-10-26 |
| DD154100A5 (de) | 1982-02-24 |
| PL127976B1 (en) | 1983-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE60020753T2 (de) | 4-Nitroxybutylester von Naproxen | |
| DE2024694B2 (de) | Verfahren zur Herstellung von 3,4-Dihydro-1,2,3-oxathiazin-4-onen | |
| DE2541342A1 (de) | Neue phenoxyalkylcarbonsaeuren und verfahren zur herstellung derselben | |
| HU184063B (en) | Process for producing carbamoic-acid-phenyl-ester derivatives | |
| US4151353A (en) | Carbamoyl halide compositions | |
| DE602004002692T2 (de) | Verfahren zur Herstellung von Topiramate | |
| EP0002735A2 (de) | Verfahren zur Herstellung von Piperonylidencrotonsäureamiden | |
| CH616416A5 (enExample) | ||
| US4315861A (en) | Process for O-acylating phenol derivatives and acylating compositions for this purpose | |
| DE2546165A1 (de) | Thiazolidinderivate und verfahren zu ihrer herstellung | |
| US2791603A (en) | Process for preparing carbamates of tertiary acetylenic carbinols | |
| US4323469A (en) | Process for O-acylating phenol derivatives and acylating compositions for this purpose | |
| US4344883A (en) | Production of N-chlorosulfinylcarbamate esters | |
| US4261897A (en) | N-Chlorosulfinylcarbamate esters | |
| EP0102055B1 (de) | Verfahren zur Herstellung halogensubstituierter 2-Aminobenzthiazole | |
| Stenseth et al. | Halophenyl and 8-Quinolyl Carbonates. | |
| DE2351556C2 (de) | Verfahren zur Herstellung von N-Halogenformyl-carbamidsäurehalogeniden | |
| KR930009041B1 (ko) | 3,3,4'-트리클로로카르바아닐라이드의 제조방법 | |
| US4208510A (en) | Preparation of 3-aryl-isoxazol-5-yl benzoates | |
| US5621132A (en) | Process for making alkyl N-alkyl or N-aryl-thiocarbamates | |
| SU698511A3 (ru) | Гербицидна композици | |
| SU173787A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ а-НАФТИЛХЛОРКАРБОНАТ^ ]1>& t | |
| AT239252B (de) | Verfahren zur partiellen oder vollständigen Carbamylierung von zweiwertigen Alkoholen oder von deren partiell O-substituierten Derivaten | |
| DE2556039C2 (de) | Verfahren zur Herstellung von N,N-Dialkylaminophenyl-chlorformiat-hydrochloriden | |
| DE1261855B (de) | Verfahren zur Herstellung von reinem 2-N,N-Dimethylcarbamyl-3-methyl-pyrazolyl-(5)-N,N-dimethylcarbamat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |