PL127976B1 - Process for preparing phenyl esters of carbamic acids - Google Patents
Process for preparing phenyl esters of carbamic acids Download PDFInfo
- Publication number
- PL127976B1 PL127976B1 PL22765180A PL22765180A PL127976B1 PL 127976 B1 PL127976 B1 PL 127976B1 PL 22765180 A PL22765180 A PL 22765180A PL 22765180 A PL22765180 A PL 22765180A PL 127976 B1 PL127976 B1 PL 127976B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- alkyl
- compounds
- carbon atoms
- group
- Prior art date
Links
- 150000001715 carbamic acids Chemical class 0.000 title claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title description 2
- 238000000034 method Methods 0.000 claims description 30
- 150000001875 compounds Chemical class 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 239000002585 base Substances 0.000 claims description 10
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- -1 1,3-dioxolan-2-yl Chemical group 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- 238000005917 acylation reaction Methods 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 230000010933 acylation Effects 0.000 claims description 4
- 150000007529 inorganic bases Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 3
- 230000006179 O-acylation Effects 0.000 claims description 3
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 150000003512 tertiary amines Chemical class 0.000 claims description 3
- HHKQQYYSFUBFIO-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-2-carboxamide Chemical class C1=CC=C2S(=O)(=O)N(C(=O)N)C(=O)C2=C1 HHKQQYYSFUBFIO-UHFFFAOYSA-N 0.000 claims description 2
- WJGPNUBJBMCRQH-UHFFFAOYSA-N 2,2-dimethyl-2,3-dihydro-1-benzofuran-7-ol Chemical compound C1=CC(O)=C2OC(C)(C)CC2=C1 WJGPNUBJBMCRQH-UHFFFAOYSA-N 0.000 claims description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 42
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 39
- 239000000203 mixture Substances 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- 238000003756 stirring Methods 0.000 description 11
- 239000012948 isocyanate Substances 0.000 description 9
- 150000002513 isocyanates Chemical class 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical group Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000012153 distilled water Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000012452 mother liquor Substances 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- FFQQCJGNKKIRMD-UHFFFAOYSA-N methyl n-(3-hydroxyphenyl)carbamate Chemical compound COC(=O)NC1=CC=CC(O)=C1 FFQQCJGNKKIRMD-UHFFFAOYSA-N 0.000 description 3
- 235000019204 saccharin Nutrition 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 231100000331 toxic Toxicity 0.000 description 3
- 230000002588 toxic effect Effects 0.000 description 3
- YRQDSVXQHYMZIE-UHFFFAOYSA-N 2-(1,3-dioxolan-2-yl)phenol Chemical compound OC1=CC=CC=C1C1OCCO1 YRQDSVXQHYMZIE-UHFFFAOYSA-N 0.000 description 2
- QCGCZQXNAUVPKJ-UHFFFAOYSA-N 2-(4-hydroxy-5-methoxycyclohexa-2,4-dien-1-ylidene)acetonitrile Chemical compound COC1=C(O)C=CC(=CC#N)C1 QCGCZQXNAUVPKJ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229940081974 saccharin Drugs 0.000 description 2
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- YOSCIBHNIINXGQ-UHFFFAOYSA-N (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2.CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 YOSCIBHNIINXGQ-UHFFFAOYSA-N 0.000 description 1
- ZAGNMMRDHSEOPE-UHFFFAOYSA-N (2-chlorophenyl) n-methylcarbamate Chemical compound CNC(=O)OC1=CC=CC=C1Cl ZAGNMMRDHSEOPE-UHFFFAOYSA-N 0.000 description 1
- OTYKXVWEKXHDHH-UHFFFAOYSA-N (2-methoxyphenyl) n-methylcarbamate Chemical compound CNC(=O)OC1=CC=CC=C1OC OTYKXVWEKXHDHH-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- SNUSVOJPWBPLEF-UHFFFAOYSA-N [SH2]=N.CC1=CC=CC(NC(=O)C=2C(=CC=CC=2)C(O)=O)=C1 Chemical compound [SH2]=N.CC1=CC=CC(NC(=O)C=2C(=CC=CC=2)C(O)=O)=C1 SNUSVOJPWBPLEF-UHFFFAOYSA-N 0.000 description 1
- XNXURANYMGXTNI-UHFFFAOYSA-N [SH2]=N.OC(=O)C1=CC=CC=C1C(=O)NC1=CC=CC=C1 Chemical compound [SH2]=N.OC(=O)C1=CC=CC=C1C(=O)NC1=CC=CC=C1 XNXURANYMGXTNI-UHFFFAOYSA-N 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- WZJZMXBKUWKXTQ-UHFFFAOYSA-N desmedipham Chemical compound CCOC(=O)NC1=CC=CC(OC(=O)NC=2C=CC=CC=2)=C1 WZJZMXBKUWKXTQ-UHFFFAOYSA-N 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- KCLZXXMMEDEBMF-UHFFFAOYSA-N ethyl n-(3-hydroxyphenyl)carbamate Chemical compound CCOC(=O)NC1=CC=CC(O)=C1 KCLZXXMMEDEBMF-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 229910052736 halogen Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 230000005802 health problem Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- YJHWFLRDIYUEJM-UHFFFAOYSA-N methyl n-(3-carbamoyloxyphenyl)carbamate Chemical compound COC(=O)NC1=CC=CC(OC(N)=O)=C1 YJHWFLRDIYUEJM-UHFFFAOYSA-N 0.000 description 1
- 210000004877 mucosa Anatomy 0.000 description 1
- DZIRZHBFUPWNFK-UHFFFAOYSA-N n-alkylphthalic monoamide Chemical compound CNC(=O)C1=CC=CC=C1C(O)=O DZIRZHBFUPWNFK-UHFFFAOYSA-N 0.000 description 1
- XBXCNNQPRYLIDE-UHFFFAOYSA-M n-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ICGNCPZDLALZBU-UHFFFAOYSA-N phenyl n-butylcarbamate Chemical compound CCCCNC(=O)OC1=CC=CC=C1 ICGNCPZDLALZBU-UHFFFAOYSA-N 0.000 description 1
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical compound OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/86—Benzo [b] furans; Hydrogenated benzo [b] furans with an oxygen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI001984 HU184063B (en) | 1979-11-08 | 1979-11-08 | Process for producing carbamoic-acid-phenyl-ester derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL227651A1 PL227651A1 (enExample) | 1981-08-21 |
| PL127976B1 true PL127976B1 (en) | 1983-12-31 |
Family
ID=10994773
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL22765180A PL127976B1 (en) | 1979-11-08 | 1980-11-04 | Process for preparing phenyl esters of carbamic acids |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JPS5683461A (enExample) |
| CS (1) | CS219932B2 (enExample) |
| DD (2) | DD154100A5 (enExample) |
| DE (1) | DE3040633A1 (enExample) |
| FR (1) | FR2469399A1 (enExample) |
| GB (1) | GB2065639B (enExample) |
| HU (1) | HU184063B (enExample) |
| PL (1) | PL127976B1 (enExample) |
| SU (1) | SU1176833A3 (enExample) |
| YU (1) | YU280880A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU185294B (en) * | 1980-12-29 | 1984-12-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing substituted urea derivatives |
| FR2612186B1 (fr) * | 1987-03-09 | 1989-07-21 | Poudres & Explosifs Ste Nale | Carbonyl 2,2' bis (alkyl-4 oxadiazolidines-1,2,4-diones-3,5), leur procede de preparation et leur utilisation comme intermediaires de synthese dans la preparation de carbamates |
| JP2582864B2 (ja) * | 1987-06-25 | 1997-02-19 | イーライ・リリー・アンド・カンパニー | 尿素誘導体の製造方法 |
| JP4821680B2 (ja) * | 2007-03-30 | 2011-11-24 | 大日本印刷株式会社 | 塩基増殖剤、それを用いた樹脂組成物、及び物品 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE792313A (fr) * | 1971-12-06 | 1973-03-30 | Quimco Gmbh | Procede de preparation de carbamates mono substitues sur l'atome d'azote et produits obtenus |
| HU167249B (enExample) * | 1973-04-24 | 1975-09-27 |
-
1979
- 1979-11-08 HU HUCI001984 patent/HU184063B/hu unknown
-
1980
- 1980-10-29 DE DE19803040633 patent/DE3040633A1/de active Granted
- 1980-11-04 CS CS744780A patent/CS219932B2/cs unknown
- 1980-11-04 PL PL22765180A patent/PL127976B1/pl unknown
- 1980-11-04 YU YU280880A patent/YU280880A/xx unknown
- 1980-11-05 FR FR8023596A patent/FR2469399A1/fr active Granted
- 1980-11-05 DD DD22498880A patent/DD154100A5/de not_active IP Right Cessation
- 1980-11-05 SU SU803003801A patent/SU1176833A3/ru active
- 1980-11-05 JP JP15476980A patent/JPS5683461A/ja active Pending
- 1980-11-05 DD DD23091580A patent/DD159637A5/de not_active IP Right Cessation
- 1980-11-06 GB GB8035667A patent/GB2065639B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| PL227651A1 (enExample) | 1981-08-21 |
| JPS5683461A (en) | 1981-07-08 |
| YU280880A (en) | 1983-12-31 |
| FR2469399A1 (fr) | 1981-05-22 |
| GB2065639A (en) | 1981-07-01 |
| FR2469399B1 (enExample) | 1984-05-11 |
| CS219932B2 (en) | 1983-03-25 |
| DD159637A5 (de) | 1983-03-23 |
| SU1176833A3 (ru) | 1985-08-30 |
| HU184063B (en) | 1984-06-28 |
| DE3040633A1 (de) | 1981-05-21 |
| DE3040633C2 (enExample) | 1989-01-05 |
| GB2065639B (en) | 1983-10-26 |
| DD154100A5 (de) | 1982-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE46471B1 (en) | Novel oxime derivatives and their preparation | |
| PL169407B1 (pl) | Sposób wytwarzania nowych sulfonylomoczników PL PL | |
| FI59991B (fi) | Foerfarande foer framstaellning av 2-arylamino-2-imidazolin-derivat och deras salter | |
| US3564607A (en) | Halogenated aryloxyacetyl cyanamides | |
| EP0142670B1 (en) | A process for the preparation of known herbicidally active phenyl carbamates | |
| PL127976B1 (en) | Process for preparing phenyl esters of carbamic acids | |
| US4391976A (en) | Process for producing arylsulfamates | |
| EP0296864B1 (en) | Process for preparing ureas | |
| FI66605C (fi) | Framstaellningsfoerfarande foer 5-merkapto-1,2,3-triazoler | |
| PL129275B1 (en) | Process for preparing 1-amino-1,3,5-triazine-2,4/1h,3h/-diones | |
| US4035365A (en) | Triazinediones | |
| US4323469A (en) | Process for O-acylating phenol derivatives and acylating compositions for this purpose | |
| US5051513A (en) | Preparation of chlorinated nicotinaldehydes | |
| US4987233A (en) | Process for preparing herbicidal ureas and insecticidal carbamates and carbamate derivatives | |
| US4315861A (en) | Process for O-acylating phenol derivatives and acylating compositions for this purpose | |
| US3317531A (en) | Derivatives of pyridazonimines and a method for their preparation | |
| GB1595029A (en) | Manufacture of 2,1,3-thiadiazin-4-one-2,2-dioxide derivatives | |
| US4563533A (en) | Process for the preparation of halogen-substituted 2-aminobenzothiazoles | |
| US20070027324A1 (en) | Process for producing 5-substituted oxazole compounds and 5-substituted imidazole compounds | |
| FI66363B (fi) | Foerfarande foer framstaellning av 5-merkapto-1,2,3-triazoler | |
| US3210348A (en) | 6h-6-trichloromethylmercapto-dibenzo[c, e][1, 2]thiazine 5, 5-dioxide compounds | |
| US3697537A (en) | 2-(aryloxy)-2-thiazolinium compounds | |
| EP0146102A2 (en) | Process for preparing benzothiazine compounds | |
| US3682944A (en) | Certain 3-methylene diaxyphenyl-rhodanines | |
| GB1570912A (en) | Aromatic sulphonamido derivatives and process for their manufacture |