HRP20030056A2 - Remedial agent for anxiety neurosis or depression and piperazine derivative - Google Patents
Remedial agent for anxiety neurosis or depression and piperazine derivativeInfo
- Publication number
- HRP20030056A2 HRP20030056A2 HR20030056A HRP20030056A HRP20030056A2 HR P20030056 A2 HRP20030056 A2 HR P20030056A2 HR 20030056 A HR20030056 A HR 20030056A HR P20030056 A HRP20030056 A HR P20030056A HR P20030056 A2 HRP20030056 A2 HR P20030056A2
- Authority
- HR
- Croatia
- Prior art keywords
- group
- substituted
- substance
- hydrogen atom
- alkyl
- Prior art date
Links
- 208000019901 Anxiety disease Diseases 0.000 title claims description 18
- 208000020401 Depressive disease Diseases 0.000 title claims description 16
- 150000004885 piperazines Chemical class 0.000 title claims description 11
- 230000000246 remedial effect Effects 0.000 title 1
- -1 1-cyanoethyl group Chemical group 0.000 claims description 96
- 238000002360 preparation method Methods 0.000 claims description 61
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 39
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 27
- 125000001624 naphthyl group Chemical group 0.000 claims description 27
- 125000003277 amino group Chemical group 0.000 claims description 26
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 25
- 102000008316 Type 4 Melanocortin Receptor Human genes 0.000 claims description 17
- 108010021436 Type 4 Melanocortin Receptor Proteins 0.000 claims description 17
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 16
- 125000000027 (C1-C10) alkoxy group Chemical group 0.000 claims description 15
- 125000005843 halogen group Chemical group 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 11
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 230000001225 therapeutic effect Effects 0.000 claims description 10
- 239000002464 receptor antagonist Substances 0.000 claims description 8
- 229940044551 receptor antagonist Drugs 0.000 claims description 8
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 125000000747 amidyl group Chemical group [H][N-]* 0.000 claims description 3
- 125000005493 quinolyl group Chemical group 0.000 claims description 3
- 125000004193 piperazinyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 239000004615 ingredient Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 description 215
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 174
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 111
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 95
- 239000000243 solution Substances 0.000 description 94
- 230000002829 reductive effect Effects 0.000 description 70
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 67
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 63
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 60
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 57
- 238000000034 method Methods 0.000 description 48
- 238000001914 filtration Methods 0.000 description 46
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 45
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 44
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 42
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 41
- 239000012442 inert solvent Substances 0.000 description 41
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 39
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 39
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 39
- 239000000706 filtrate Substances 0.000 description 38
- 238000006243 chemical reaction Methods 0.000 description 37
- 238000012360 testing method Methods 0.000 description 36
- 239000003153 chemical reaction reagent Substances 0.000 description 35
- 238000003756 stirring Methods 0.000 description 34
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 33
- 229920006395 saturated elastomer Polymers 0.000 description 33
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 32
- 239000012044 organic layer Substances 0.000 description 31
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 30
- 238000001035 drying Methods 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 26
- 239000000203 mixture Substances 0.000 description 25
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 23
- 239000003921 oil Substances 0.000 description 23
- 238000003786 synthesis reaction Methods 0.000 description 23
- 241000700159 Rattus Species 0.000 description 22
- 238000004440 column chromatography Methods 0.000 description 22
- 230000009467 reduction Effects 0.000 description 22
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 22
- 239000000499 gel Substances 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 21
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 20
- 239000013543 active substance Substances 0.000 description 20
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 20
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 18
- 239000011780 sodium chloride Substances 0.000 description 18
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 17
- 230000015572 biosynthetic process Effects 0.000 description 17
- 230000000704 physical effect Effects 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 16
- 230000009435 amidation Effects 0.000 description 15
- 238000007112 amidation reaction Methods 0.000 description 15
- 239000013078 crystal Substances 0.000 description 15
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 15
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 15
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 15
- 235000017557 sodium bicarbonate Nutrition 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- 239000002253 acid Substances 0.000 description 14
- 239000007864 aqueous solution Substances 0.000 description 14
- 239000003638 chemical reducing agent Substances 0.000 description 14
- 238000000605 extraction Methods 0.000 description 14
- 230000002378 acidificating effect Effects 0.000 description 13
- 239000003795 chemical substances by application Substances 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- 238000002474 experimental method Methods 0.000 description 12
- 238000010438 heat treatment Methods 0.000 description 12
- 238000005160 1H NMR spectroscopy Methods 0.000 description 11
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 11
- 150000001298 alcohols Chemical class 0.000 description 11
- 150000002170 ethers Chemical class 0.000 description 11
- 229930195733 hydrocarbon Natural products 0.000 description 11
- 150000002430 hydrocarbons Chemical class 0.000 description 11
- 239000012280 lithium aluminium hydride Substances 0.000 description 11
- 230000003287 optical effect Effects 0.000 description 11
- 239000012312 sodium hydride Substances 0.000 description 11
- 229910000104 sodium hydride Inorganic materials 0.000 description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 150000007529 inorganic bases Chemical class 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 7
- 102400000740 Melanocyte-stimulating hormone alpha Human genes 0.000 description 7
- 101710200814 Melanotropin alpha Proteins 0.000 description 7
- 229910052782 aluminium Inorganic materials 0.000 description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 7
- 229910052796 boron Inorganic materials 0.000 description 7
- 230000007935 neutral effect Effects 0.000 description 7
- 230000009182 swimming Effects 0.000 description 7
- WHNFPRLDDSXQCL-UAZQEYIDSA-N α-msh Chemical compound C([C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(N)=O)NC(=O)[C@H](CO)NC(C)=O)C1=CC=C(O)C=C1 WHNFPRLDDSXQCL-UAZQEYIDSA-N 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 125000003368 amide group Chemical group 0.000 description 6
- 235000011114 ammonium hydroxide Nutrition 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 239000011976 maleic acid Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 125000006239 protecting group Chemical group 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 5
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 5
- 230000005526 G1 to G0 transition Effects 0.000 description 5
- 102000004378 Melanocortin Receptors Human genes 0.000 description 5
- 108090000950 Melanocortin Receptors Proteins 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 150000008065 acid anhydrides Chemical class 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 5
- 239000002168 alkylating agent Substances 0.000 description 5
- 229940100198 alkylating agent Drugs 0.000 description 5
- 239000005557 antagonist Substances 0.000 description 5
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 5
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 5
- 238000009833 condensation Methods 0.000 description 5
- 230000005494 condensation Effects 0.000 description 5
- ZWWWLCMDTZFSOO-UHFFFAOYSA-N diethoxyphosphorylformonitrile Chemical compound CCOP(=O)(C#N)OCC ZWWWLCMDTZFSOO-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- NMEDDPXMECRPET-UHFFFAOYSA-N piperazine tetrahydrochloride Chemical compound Cl.Cl.Cl.Cl.C1CNCCN1 NMEDDPXMECRPET-UHFFFAOYSA-N 0.000 description 5
- WZFLZCSBNMNGCI-UHFFFAOYSA-N 1-[2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(4-naphthalen-1-ylbutyl)piperazine;hydrochloride Chemical compound Cl.C1CN(C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 WZFLZCSBNMNGCI-UHFFFAOYSA-N 0.000 description 4
- QHXGAGNEAXASFC-UHFFFAOYSA-N 3-(ethyliminomethylideneamino)-1-n,1-n'-dimethylpropane-1,1-diamine Chemical compound CCN=C=NCCC(NC)NC QHXGAGNEAXASFC-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 230000000049 anti-anxiety effect Effects 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000010511 deprotection reaction Methods 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 238000011835 investigation Methods 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N phenylmethanesulfonyl fluoride Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 4
- 238000005303 weighing Methods 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- JJTXBSBEWWRAPA-UHFFFAOYSA-N 1-(4-naphthalen-1-ylbutyl)piperazine;dihydrochloride Chemical compound Cl.Cl.C=1C=CC2=CC=CC=C2C=1CCCCN1CCNCC1 JJTXBSBEWWRAPA-UHFFFAOYSA-N 0.000 description 3
- RKBNFEAEGYIUBW-UHFFFAOYSA-N 1-[2-(4-fluorophenyl)-2-piperazin-1-ylethyl]-4-(4-naphthalen-1-ylbutyl)piperazine;tetrahydrochloride Chemical compound Cl.Cl.Cl.Cl.C1=CC(F)=CC=C1C(N1CCNCC1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 RKBNFEAEGYIUBW-UHFFFAOYSA-N 0.000 description 3
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 3
- NVEHQWMWLZFQIE-UHFFFAOYSA-N 2-(4-fluorophenyl)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2h-pyridin-4-yl]acetic acid Chemical compound C1N(C(=O)OC(C)(C)C)CCC(C(C(O)=O)C=2C=CC(F)=CC=2)=C1 NVEHQWMWLZFQIE-UHFFFAOYSA-N 0.000 description 3
- SZLCRPWPBZFTHK-UHFFFAOYSA-N 2-(4-fluorophenyl)-2-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1(O)C(C(O)=O)C1=CC=C(F)C=C1 SZLCRPWPBZFTHK-UHFFFAOYSA-N 0.000 description 3
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 3
- LZTJXGNPPQWOHG-UHFFFAOYSA-N 3-(ethyliminomethylideneamino)-1-n,1-n'-dimethylpropane-1,1-diamine;hydrochloride Chemical compound Cl.CCN=C=NCCC(NC)NC LZTJXGNPPQWOHG-UHFFFAOYSA-N 0.000 description 3
- VNPAKJCSTHGWFB-UHFFFAOYSA-N 3-[2-[4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazin-1-yl]-1-(4-propan-2-ylpiperazin-1-yl)ethyl]benzamide Chemical compound COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1CC(C=1C=C(C=CC=1)C(N)=O)N1CCN(C(C)C)CC1 VNPAKJCSTHGWFB-UHFFFAOYSA-N 0.000 description 3
- KFUAVDKJOGDOFI-UHFFFAOYSA-N 4,5-dihydrooxazaborole Chemical compound C1CB=NO1 KFUAVDKJOGDOFI-UHFFFAOYSA-N 0.000 description 3
- XUFLOMDWKZQGNH-UHFFFAOYSA-N 4-[2-[4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazin-1-yl]-1-(4-propan-2-ylpiperazin-1-yl)ethyl]benzamide Chemical compound COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1CC(C=1C=CC(=CC=1)C(N)=O)N1CCN(C(C)C)CC1 XUFLOMDWKZQGNH-UHFFFAOYSA-N 0.000 description 3
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 3
- 101800000414 Corticotropin Proteins 0.000 description 3
- 102400000739 Corticotropin Human genes 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- 108090000189 Neuropeptides Proteins 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 150000008051 alkyl sulfates Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 230000001430 anti-depressive effect Effects 0.000 description 3
- 230000036506 anxiety Effects 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- 229940098773 bovine serum albumin Drugs 0.000 description 3
- IDLFZVILOHSSID-OVLDLUHVSA-N corticotropin Chemical compound C([C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)NC(=O)[C@@H](N)CO)C1=CC=C(O)C=C1 IDLFZVILOHSSID-OVLDLUHVSA-N 0.000 description 3
- 229960000258 corticotropin Drugs 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 3
- 239000002274 desiccant Substances 0.000 description 3
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 3
- 229940008406 diethyl sulfate Drugs 0.000 description 3
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 125000004914 dipropylamino group Chemical group C(CC)N(CCC)* 0.000 description 3
- 230000035622 drinking Effects 0.000 description 3
- 239000003651 drinking water Substances 0.000 description 3
- 235000020188 drinking water Nutrition 0.000 description 3
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 3
- 238000007429 general method Methods 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- CVVIJWRCGSYCMB-UHFFFAOYSA-N hydron;piperazine;dichloride Chemical compound Cl.Cl.C1CNCCN1 CVVIJWRCGSYCMB-UHFFFAOYSA-N 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 229910052987 metal hydride Inorganic materials 0.000 description 3
- 150000004681 metal hydrides Chemical class 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 125000006308 propyl amino group Chemical group 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000001525 receptor binding assay Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 3
- 229940066771 systemic antihistamines piperazine derivative Drugs 0.000 description 3
- JVVNHZFDERRNFS-UKFGXMPHSA-N (Z)-but-2-enedioic acid 4-[1-(4-methylpiperazin-1-yl)-2-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]ethyl]aniline Chemical compound OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.C1CN(C)CCN1C(C=1C=CC(N)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 JVVNHZFDERRNFS-UKFGXMPHSA-N 0.000 description 2
- WVVPKRZNNZKLPF-UKFGXMPHSA-N (z)-but-2-enedioic acid;1-[1-(4-fluorophenyl)-2-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]ethyl]-4-propan-2-ylpiperazine Chemical compound OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.C1CN(C(C)C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 WVVPKRZNNZKLPF-UKFGXMPHSA-N 0.000 description 2
- XNJMGYQOXBPXJW-UKFGXMPHSA-N (z)-but-2-enedioic acid;1-[2-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(4-naphthalen-1-ylbutyl)piperazine Chemical compound OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.C1=CC(OC)=CC=C1C(N1CCN(C)CC1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 XNJMGYQOXBPXJW-UKFGXMPHSA-N 0.000 description 2
- WYQHZFKFDCSLLG-UHFFFAOYSA-N 1-(4-fluorophenyl)-2-[4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazin-1-yl]ethanol Chemical compound COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1CC(O)C1=CC=C(F)C=C1 WYQHZFKFDCSLLG-UHFFFAOYSA-N 0.000 description 2
- ZVVKGQDFEZSWNM-UHFFFAOYSA-N 1-(4-methoxyphenyl)-2-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]ethanone Chemical compound C1=CC(OC)=CC=C1C(=O)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 ZVVKGQDFEZSWNM-UHFFFAOYSA-N 0.000 description 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 2
- UESNQFLPADGGQE-UHFFFAOYSA-N 1-[1-(4-fluorophenyl)-2-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]ethyl]-4-propan-2-ylpiperazine Chemical compound C1CN(C(C)C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 UESNQFLPADGGQE-UHFFFAOYSA-N 0.000 description 2
- LXYNSRGSZRHNAF-UHFFFAOYSA-N 1-[1-(4-fluorophenyl)-2-[4-[4-(2-propan-2-yloxynaphthalen-1-yl)butyl]piperazin-1-yl]ethyl]-4-propan-2-ylpiperazine Chemical compound CC(C)OC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1CC(C=1C=CC(F)=CC=1)N1CCN(C(C)C)CC1 LXYNSRGSZRHNAF-UHFFFAOYSA-N 0.000 description 2
- LDFZEQMRPQGXTF-UHFFFAOYSA-N 1-[1-(4-fluorophenyl)-2-piperazin-1-ylethyl]-4-methylpiperazine Chemical compound C1CN(C)CCN1C(C=1C=CC(F)=CC=1)CN1CCNCC1 LDFZEQMRPQGXTF-UHFFFAOYSA-N 0.000 description 2
- WQOPKMNALJBALB-UHFFFAOYSA-N 1-[2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(4-naphthalen-1-ylbutyl)piperazine Chemical compound C1CN(C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 WQOPKMNALJBALB-UHFFFAOYSA-N 0.000 description 2
- TVUMWUVPLRRYHP-UHFFFAOYSA-N 1-[2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(4-naphthalen-1-ylbutyl)piperazine;tetrahydrochloride Chemical compound Cl.Cl.Cl.Cl.C1CN(C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 TVUMWUVPLRRYHP-UHFFFAOYSA-N 0.000 description 2
- HMQVCJIGWYHYGP-UHFFFAOYSA-N 1-[2-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(4-naphthalen-1-ylbutyl)piperazine Chemical compound C1=CC(OC)=CC=C1C(N1CCN(C)CC1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 HMQVCJIGWYHYGP-UHFFFAOYSA-N 0.000 description 2
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 2
- AXYWIHHYTYOZEB-UHFFFAOYSA-N 2-(4-fluorophenyl)-1-[4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazin-1-yl]-2-(1-propan-2-ylpiperidin-4-yl)ethanone Chemical compound COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1C(=O)C(C=1C=CC(F)=CC=1)C1CCN(C(C)C)CC1 AXYWIHHYTYOZEB-UHFFFAOYSA-N 0.000 description 2
- LMTQRNURRYURFX-UHFFFAOYSA-N 2-(4-fluorophenyl)-2-(1-methyl-3,6-dihydro-2h-pyridin-4-yl)-1-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]ethanone Chemical compound C1N(C)CCC(C(C(=O)N2CCN(CCCCC=3C4=CC=CC=C4C=CC=3)CC2)C=2C=CC(F)=CC=2)=C1 LMTQRNURRYURFX-UHFFFAOYSA-N 0.000 description 2
- HSUPOANEILCPGZ-UHFFFAOYSA-N 2-(4-fluorophenyl)-2-(4-hydroxy-1-methylpiperidin-4-yl)-1-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]ethanone Chemical compound C1CN(C)CCC1(O)C(C=1C=CC(F)=CC=1)C(=O)N1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 HSUPOANEILCPGZ-UHFFFAOYSA-N 0.000 description 2
- GSIWCWPTTARLGU-UHFFFAOYSA-N 2-(4-fluorophenyl)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1C(C(O)=O)C1=CC=C(F)C=C1 GSIWCWPTTARLGU-UHFFFAOYSA-N 0.000 description 2
- ICVNPQMUUHPPOK-UHFFFAOYSA-N 2-(4-fluorophenyl)oxirane Chemical compound C1=CC(F)=CC=C1C1OC1 ICVNPQMUUHPPOK-UHFFFAOYSA-N 0.000 description 2
- PYNYHMRMZOGVML-UHFFFAOYSA-N 2-bromopropanenitrile Chemical compound CC(Br)C#N PYNYHMRMZOGVML-UHFFFAOYSA-N 0.000 description 2
- UJZWJOQRSMOFMA-UHFFFAOYSA-N 2-chloro-1-(4-fluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C=C1 UJZWJOQRSMOFMA-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- IGUSAMHSYVGVOR-UHFFFAOYSA-N 4-[1-(4-fluorophenyl)-2-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]ethyl]-1-methylpiperidin-4-ol Chemical compound C1CN(C)CCC1(O)C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 IGUSAMHSYVGVOR-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 239000000637 Melanocyte-Stimulating Hormone Substances 0.000 description 2
- 108010007013 Melanocyte-Stimulating Hormones Proteins 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- HHCRCTBBAVDRCY-UKFGXMPHSA-N OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.C1CN(C(=N)N)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 Chemical compound OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.C1CN(C(=N)N)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 HHCRCTBBAVDRCY-UKFGXMPHSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000002249 anxiolytic agent Substances 0.000 description 2
- 230000006399 behavior Effects 0.000 description 2
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 210000000170 cell membrane Anatomy 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- CDHICTNQMQYRSM-UHFFFAOYSA-N di(propan-2-yl)alumane Chemical compound CC(C)[AlH]C(C)C CDHICTNQMQYRSM-UHFFFAOYSA-N 0.000 description 2
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- QKOWHCVKIXGXCI-UHFFFAOYSA-N ethyl 4-[2-(4-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboxylate;hydrochloride Chemical compound Cl.C1CN(C(=O)OCC)CCN1CC(O)C1=CC=C(F)C=C1 QKOWHCVKIXGXCI-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 2
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- IWYDHOAUDWTVEP-UHFFFAOYSA-N mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 230000009871 nonspecific binding Effects 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 description 2
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 2
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 2
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 2
- 229910000105 potassium hydride Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000000159 protein binding assay Methods 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 238000011552 rat model Methods 0.000 description 2
- 230000003938 response to stress Effects 0.000 description 2
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- MXPYMKHYKHYYMP-UHFFFAOYSA-N tert-butyl 4-[1-(4-fluorophenyl)-2-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]-2-oxoethyl]-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(C(C(=O)N2CCN(CCCCC=3C4=CC=CC=C4C=CC=3)CC2)C=2C=CC(F)=CC=2)=C1 MXPYMKHYKHYYMP-UHFFFAOYSA-N 0.000 description 2
- SBZGWYPOLFMBRT-UHFFFAOYSA-N tert-butyl 4-[1-(4-fluorophenyl)-2-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]-2-oxoethyl]-4-hydroxypiperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1(O)C(C=1C=CC(F)=CC=1)C(=O)N1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 SBZGWYPOLFMBRT-UHFFFAOYSA-N 0.000 description 2
- VSUJNUBHMUVACE-UHFFFAOYSA-N tert-butyl 4-[1-(4-fluorophenyl)-2-[4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazin-1-yl]-2-oxoethyl]piperidine-1-carboxylate Chemical compound COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1C(=O)C(C=1C=CC(F)=CC=1)C1CCN(C(=O)OC(C)(C)C)CC1 VSUJNUBHMUVACE-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000005505 thiomorpholino group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- YONLFQNRGZXBBF-ZIAGYGMSSA-N (2r,3r)-2,3-dibenzoyloxybutanedioic acid Chemical compound O([C@@H](C(=O)O)[C@@H](OC(=O)C=1C=CC=CC=1)C(O)=O)C(=O)C1=CC=CC=C1 YONLFQNRGZXBBF-ZIAGYGMSSA-N 0.000 description 1
- YONLFQNRGZXBBF-KBPBESRZSA-N (2s,3s)-2,3-dibenzoyloxybutanedioic acid Chemical compound O([C@H](C(=O)O)[C@H](OC(=O)C=1C=CC=CC=1)C(O)=O)C(=O)C1=CC=CC=C1 YONLFQNRGZXBBF-KBPBESRZSA-N 0.000 description 1
- 125000006625 (C3-C8) cycloalkyloxy group Chemical group 0.000 description 1
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical compound C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 description 1
- 229930007886 (R)-camphor Natural products 0.000 description 1
- IWYDHOAUDWTVEP-SSDOTTSWSA-N (R)-mandelic acid Chemical compound OC(=O)[C@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-SSDOTTSWSA-N 0.000 description 1
- YTUJPDRINJYLOV-UKFGXMPHSA-N (Z)-but-2-enedioic acid 1-[4-[4-[2-(4-fluorophenyl)-2-(4-propan-2-ylpiperazin-1-yl)ethyl]piperazin-1-yl]butyl]naphthalen-2-ol Chemical compound OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.C1CN(C(C)C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2O)CC1 YTUJPDRINJYLOV-UKFGXMPHSA-N 0.000 description 1
- GRLMRDJKJFOICD-UKFGXMPHSA-N (z)-but-2-enedioic acid;1-[1-(4-fluorophenyl)-2-[4-[4-(2-propan-2-yloxynaphthalen-1-yl)butyl]piperazin-1-yl]ethyl]-4-propan-2-ylpiperazine Chemical compound OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.CC(C)OC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1CC(C=1C=CC(F)=CC=1)N1CCN(C(C)C)CC1 GRLMRDJKJFOICD-UKFGXMPHSA-N 0.000 description 1
- UKNWIPTVNNHGRJ-UKFGXMPHSA-N (z)-but-2-enedioic acid;6-fluoro-3-[4-[4-[2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]piperazin-1-yl]butyl]-1,2-benzoxazole Chemical compound OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.C1CN(C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=C(F)C=C3ON=2)CC1 UKNWIPTVNNHGRJ-UKFGXMPHSA-N 0.000 description 1
- GOFIUEUUROFVMA-UHFFFAOYSA-N 1-(1h-indol-5-yl)ethanone Chemical compound CC(=O)C1=CC=C2NC=CC2=C1 GOFIUEUUROFVMA-UHFFFAOYSA-N 0.000 description 1
- VXXLGGWVJNOKQR-UHFFFAOYSA-N 1-(4-methoxyphenyl)-2-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]ethanol Chemical compound C1=CC(OC)=CC=C1C(O)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 VXXLGGWVJNOKQR-UHFFFAOYSA-N 0.000 description 1
- SLGLZEJKMBCODK-UHFFFAOYSA-N 1-[1-(4-fluorophenyl)-2-[4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazin-1-yl]ethyl]-4-propan-2-ylpiperazine Chemical compound COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1CC(C=1C=CC(F)=CC=1)N1CCN(C(C)C)CC1 SLGLZEJKMBCODK-UHFFFAOYSA-N 0.000 description 1
- VGDBONHXEQIVFN-UHFFFAOYSA-N 1-[1-(4-fluorophenyl)-2-[4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazin-1-yl]ethyl]-4-propan-2-ylpiperazine;tetrahydrochloride Chemical compound Cl.Cl.Cl.Cl.COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1CC(C=1C=CC(F)=CC=1)N1CCN(C(C)C)CC1 VGDBONHXEQIVFN-UHFFFAOYSA-N 0.000 description 1
- XDMBPMSJLAAMSG-UHFFFAOYSA-N 1-[2-(4-fluorophenyl)-2-(1-methyl-3,6-dihydro-2h-pyridin-4-yl)ethyl]-4-(4-naphthalen-1-ylbutyl)piperazine Chemical compound C1N(C)CCC(C(CN2CCN(CCCCC=3C4=CC=CC=C4C=CC=3)CC2)C=2C=CC(F)=CC=2)=C1 XDMBPMSJLAAMSG-UHFFFAOYSA-N 0.000 description 1
- YQAIQMBVUVSWQU-UHFFFAOYSA-N 1-[2-(4-fluorophenyl)-2-(1-propan-2-ylpiperidin-4-yl)ethyl]-4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazine Chemical compound COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1CC(C=1C=CC(F)=CC=1)C1CCN(C(C)C)CC1 YQAIQMBVUVSWQU-UHFFFAOYSA-N 0.000 description 1
- DQPIAJYSOYFWDS-UHFFFAOYSA-N 1-[2-(4-fluorophenyl)-2-(1-propan-2-ylpiperidin-4-yl)ethyl]-4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazine;trihydrochloride Chemical compound Cl.Cl.Cl.COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1CC(C=1C=CC(F)=CC=1)C1CCN(C(C)C)CC1 DQPIAJYSOYFWDS-UHFFFAOYSA-N 0.000 description 1
- YHKOSBKWKMYRFN-UHFFFAOYSA-N 1-[2-(4-fluorophenyl)-2-piperidin-4-ylethyl]-4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazine Chemical compound COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1CC(C=1C=CC(F)=CC=1)C1CCNCC1 YHKOSBKWKMYRFN-UHFFFAOYSA-N 0.000 description 1
- YMNZQBMLVJWVJX-UHFFFAOYSA-N 1-[4-(2-methoxynaphthalen-1-yl)butyl]piperazine Chemical compound COC1=CC=C2C=CC=CC2=C1CCCCN1CCNCC1 YMNZQBMLVJWVJX-UHFFFAOYSA-N 0.000 description 1
- VAWSYHYOTVUJPC-UHFFFAOYSA-N 1-[4-[2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]piperazin-1-yl]-4-naphthalen-1-ylbutan-1-one Chemical compound C1CN(C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(C(=O)CCCC=2C3=CC=CC=C3C=CC=2)CC1 VAWSYHYOTVUJPC-UHFFFAOYSA-N 0.000 description 1
- XLLUJHDMWQXGMF-UHFFFAOYSA-N 1-[4-[4-[2-(4-fluorophenyl)-2-(4-propan-2-ylpiperazin-1-yl)ethyl]piperazin-1-yl]butyl]naphthalen-2-ol Chemical compound C1CN(C(C)C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2O)CC1 XLLUJHDMWQXGMF-UHFFFAOYSA-N 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- KNTNXJQQOXWSOG-UHFFFAOYSA-N 1-propan-2-ylpiperazine;dihydrochloride Chemical compound Cl.Cl.CC(C)N1CCNCC1 KNTNXJQQOXWSOG-UHFFFAOYSA-N 0.000 description 1
- NTOIKDYVJIWVSU-UHFFFAOYSA-N 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid Chemical compound C1=CC(C)=CC=C1C(=O)C(O)(C(O)=O)C(O)(C(O)=O)C(=O)C1=CC=C(C)C=C1 NTOIKDYVJIWVSU-UHFFFAOYSA-N 0.000 description 1
- ZXBJMKSFZNUNSE-UHFFFAOYSA-N 2-(4-fluorophenyl)-1-[4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazin-1-yl]-2-piperidin-4-ylethanone;dihydrochloride Chemical compound Cl.Cl.COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1C(=O)C(C=1C=CC(F)=CC=1)C1CCNCC1 ZXBJMKSFZNUNSE-UHFFFAOYSA-N 0.000 description 1
- OYSIMHQRYFUNAS-UHFFFAOYSA-N 2-(4-fluorophenyl)-1-[4-[4-(2-methoxynaphthalen-1-yl)butyl]piperazin-1-yl]-2-piperidin-4-ylethanone;hydrochloride Chemical compound Cl.COC1=CC=C2C=CC=CC2=C1CCCCN(CC1)CCN1C(=O)C(C=1C=CC(F)=CC=1)C1CCNCC1 OYSIMHQRYFUNAS-UHFFFAOYSA-N 0.000 description 1
- MGKPFALCNDRSQD-UHFFFAOYSA-N 2-(4-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(F)C=C1 MGKPFALCNDRSQD-UHFFFAOYSA-N 0.000 description 1
- XQJAHBHCLXUGEP-UHFFFAOYSA-N 2-bromo-1-(4-methoxyphenyl)ethanone Chemical compound COC1=CC=C(C(=O)CBr)C=C1 XQJAHBHCLXUGEP-UHFFFAOYSA-N 0.000 description 1
- UTKMVZHKCYSJOM-UHFFFAOYSA-N 2-bromo-2-methylbutanenitrile Chemical compound CCC(C)(Br)C#N UTKMVZHKCYSJOM-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- QBSPVMANXRNJLM-UHFFFAOYSA-N 3-(4-chlorobutyl)-6-fluoro-1,2-benzoxazole Chemical compound FC1=CC=C2C(CCCCCl)=NOC2=C1 QBSPVMANXRNJLM-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- HGMITUYOCPPQLE-UHFFFAOYSA-N 3-quinuclidinyl benzilate Chemical compound C1N(CC2)CCC2C1OC(=O)C(O)(C=1C=CC=CC=1)C1=CC=CC=C1 HGMITUYOCPPQLE-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- XCQFZIFIUMBSAO-UHFFFAOYSA-N 4-(dimethylamino)naphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(N(C)C)=CC=C(C=O)C2=C1 XCQFZIFIUMBSAO-UHFFFAOYSA-N 0.000 description 1
- IVIZACRIAHNCCE-UHFFFAOYSA-N 4-[1-(4-fluorophenyl)-2-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]ethyl]-1-methylpiperidin-4-ol;trihydrochloride Chemical compound Cl.Cl.Cl.C1CN(C)CCC1(O)C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 IVIZACRIAHNCCE-UHFFFAOYSA-N 0.000 description 1
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- LZVCOUNJXYIOQA-UHFFFAOYSA-N 4-naphthalen-1-ylbutanoic acid Chemical compound C1=CC=C2C(CCCC(=O)O)=CC=CC2=C1 LZVCOUNJXYIOQA-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- HSDGHKFNMLBDAS-UHFFFAOYSA-N 6-fluoro-3-[4-[4-[2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]piperazin-1-yl]butyl]-1,2-benzoxazole Chemical compound C1CN(C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=C(F)C=C3ON=2)CC1 HSDGHKFNMLBDAS-UHFFFAOYSA-N 0.000 description 1
- VCDGSBJCRYTLNU-OBYDGYHJSA-N 9-[(1R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-9-borabicyclo[3.3.1]nonane Chemical compound C1CCC2CCCC1B2C1CC(C2(C)C)C[C@]2([H])C1C VCDGSBJCRYTLNU-OBYDGYHJSA-N 0.000 description 1
- VCDGSBJCRYTLNU-IKXAHOJESA-N 9-[(5s)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-9-borabicyclo[3.3.1]nonane Chemical compound C1CCC2CCCC1B2C1CC(C2(C)C)C[C@@]2([H])C1C VCDGSBJCRYTLNU-IKXAHOJESA-N 0.000 description 1
- 239000000275 Adrenocorticotropic Hormone Substances 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- ZWCHCCNBXVUZHO-UHFFFAOYSA-N C(C=C/C(=O)O)(=O)O.C(C=C/C(=O)O)(=O)O.C(C=C/C(=O)O)(=O)O.N1CCNCC1 Chemical compound C(C=C/C(=O)O)(=O)O.C(C=C/C(=O)O)(=O)O.C(C=C/C(=O)O)(=O)O.N1CCNCC1 ZWCHCCNBXVUZHO-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 239000000055 Corticotropin-Releasing Hormone Substances 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 108010008364 Melanocortins Proteins 0.000 description 1
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229920005372 Plexiglas® Polymers 0.000 description 1
- 239000012327 Ruthenium complex Substances 0.000 description 1
- 108010071390 Serum Albumin Proteins 0.000 description 1
- 102000007562 Serum Albumin Human genes 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- VMWZRHGIAVCFNS-UHFFFAOYSA-J aluminum;lithium;tetrahydroxide Chemical compound [Li+].[OH-].[OH-].[OH-].[OH-].[Al+3] VMWZRHGIAVCFNS-UHFFFAOYSA-J 0.000 description 1
- AOPRFYAPABFRPU-UHFFFAOYSA-N amino(imino)methanesulfonic acid Chemical compound NC(=N)S(O)(=O)=O AOPRFYAPABFRPU-UHFFFAOYSA-N 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000002180 anti-stress Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 230000007529 anxiety like behavior Effects 0.000 description 1
- 230000000338 anxiogenic effect Effects 0.000 description 1
- 238000009876 asymmetric hydrogenation reaction Methods 0.000 description 1
- 235000015278 beef Nutrition 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000012888 bovine serum Substances 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- LSPHULWDVZXLIL-QUBYGPBYSA-N camphoric acid Chemical compound CC1(C)[C@H](C(O)=O)CC[C@]1(C)C(O)=O LSPHULWDVZXLIL-QUBYGPBYSA-N 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229940084030 carboxymethylcellulose calcium Drugs 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000000062 cyclohexylmethoxy group Chemical group [H]C([H])(O*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004410 cyclooctyloxy group Chemical group C1(CCCCCCC1)O* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000131 cyclopropyloxy group Chemical group C1(CC1)O* 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000006612 decyloxy group Chemical group 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- NFPQSYSYZRLXGE-UHFFFAOYSA-N ethyl 4-[2-(4-fluorophenyl)-2-oxoethyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1CC(=O)C1=CC=C(F)C=C1 NFPQSYSYZRLXGE-UHFFFAOYSA-N 0.000 description 1
- XRNHMFNVDOUQLK-UHFFFAOYSA-N ethyl 4-[2-chloro-2-(4-fluorophenyl)ethyl]piperazine-1-carboxylate;hydrochloride Chemical compound Cl.C1CN(C(=O)OCC)CCN1CC(Cl)C1=CC=C(F)C=C1 XRNHMFNVDOUQLK-UHFFFAOYSA-N 0.000 description 1
- LNOQURRKNJKKBU-UHFFFAOYSA-N ethyl piperazine-1-carboxylate Chemical compound CCOC(=O)N1CCNCC1 LNOQURRKNJKKBU-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005446 heptyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 230000009610 hypersensitivity Effects 0.000 description 1
- 210000003016 hypothalamus Anatomy 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000000185 intracerebroventricular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000005921 isopentoxy group Chemical group 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002865 melanocortin Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- PUUZLWLFYQFYCF-UHFFFAOYSA-N n-ethylethanamine;hexane;propan-2-ol Chemical compound CC(C)O.CCNCC.CCCCCC PUUZLWLFYQFYCF-UHFFFAOYSA-N 0.000 description 1
- 230000000955 neuroendocrine Effects 0.000 description 1
- 210000000607 neurosecretory system Anatomy 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006611 nonyloxy group Chemical group 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005447 octyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- BDOLXPFAFMNDOK-UHFFFAOYSA-N oxazaborolidine Chemical compound B1CCON1 BDOLXPFAFMNDOK-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 230000007310 pathophysiology Effects 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000002263 peptidergic effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- AUYNWRLEXAPZAJ-UHFFFAOYSA-N piperazine;trihydrochloride Chemical compound Cl.Cl.Cl.C1CNCCN1 AUYNWRLEXAPZAJ-UHFFFAOYSA-N 0.000 description 1
- OHEDMAIVEXQCOZ-UHFFFAOYSA-N piperidine;dihydrochloride Chemical compound Cl.Cl.C1CCNCC1 OHEDMAIVEXQCOZ-UHFFFAOYSA-N 0.000 description 1
- 230000001817 pituitary effect Effects 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- 239000003488 releasing hormone Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 102220305863 rs1015663503 Human genes 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 230000009870 specific binding Effects 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 1
- PHFOGMRGTJFEJF-UHFFFAOYSA-N tert-butyl 4-[1-(4-fluorophenyl)-2-[4-(4-naphthalen-1-ylbutyl)piperazin-1-yl]ethyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C(C=1C=CC(F)=CC=1)CN1CCN(CCCCC=2C3=CC=CC=C3C=CC=2)CC1 PHFOGMRGTJFEJF-UHFFFAOYSA-N 0.000 description 1
- ROUYFJUVMYHXFJ-UHFFFAOYSA-N tert-butyl 4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)CC1 ROUYFJUVMYHXFJ-UHFFFAOYSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- GRGCWBWNLSTIEN-UHFFFAOYSA-N trifluoromethanesulfonyl chloride Chemical compound FC(F)(F)S(Cl)(=O)=O GRGCWBWNLSTIEN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/496—Non-condensed piperazines containing further heterocyclic rings, e.g. rifampin, thiothixene or sparfloxacin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/22—Anxiolytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/24—Antidepressants
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Organic Chemistry (AREA)
- Epidemiology (AREA)
- Biomedical Technology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Psychiatry (AREA)
- Pain & Pain Management (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2000192856 | 2000-06-27 | ||
| PCT/JP2001/005524 WO2002000259A1 (fr) | 2000-06-27 | 2001-06-27 | Agent therapeutique contre l'anxiete nevrotique ou la depression et derive de piperazine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HRP20030056A2 true HRP20030056A2 (en) | 2005-02-28 |
Family
ID=18691931
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HR20030056A HRP20030056A2 (en) | 2000-06-27 | 2003-01-27 | Remedial agent for anxiety neurosis or depression and piperazine derivative |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US6949552B2 (zh) |
| EP (1) | EP1295608A4 (zh) |
| JP (1) | JP5002881B2 (zh) |
| KR (1) | KR20030013470A (zh) |
| CN (1) | CN1438897A (zh) |
| AU (2) | AU6634201A (zh) |
| BG (1) | BG107371A (zh) |
| BR (1) | BR0111976A (zh) |
| CA (1) | CA2413506A1 (zh) |
| CZ (1) | CZ20024165A3 (zh) |
| EA (2) | EA200500087A1 (zh) |
| EE (1) | EE200200717A (zh) |
| HR (1) | HRP20030056A2 (zh) |
| HU (1) | HUP0301719A2 (zh) |
| IL (1) | IL153706A0 (zh) |
| MX (1) | MXPA02012707A (zh) |
| NO (1) | NO20026122L (zh) |
| NZ (1) | NZ523800A (zh) |
| PL (1) | PL360286A1 (zh) |
| SK (1) | SK18322002A3 (zh) |
| WO (1) | WO2002000259A1 (zh) |
| ZA (1) | ZA200210386B (zh) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL360286A1 (en) | 2000-06-27 | 2004-09-06 | Taisho Pharmaceutical Co.Ltd. | Remedial agent for anxiety neurosis or depression and piperazine derivative |
| EP1425029A4 (en) | 2001-08-10 | 2006-06-07 | Palatin Technologies Inc | PEPTIDOMIMETICS OF BIOLOGICALLY ACTIVE METALLOPEPTIDES |
| US7732451B2 (en) | 2001-08-10 | 2010-06-08 | Palatin Technologies, Inc. | Naphthalene-containing melanocortin receptor-specific small molecule |
| US7655658B2 (en) | 2001-08-10 | 2010-02-02 | Palatin Technologies, Inc. | Thieno [2,3-D]pyrimidine-2,4-dione melanocortin-specific compounds |
| US7718802B2 (en) | 2001-08-10 | 2010-05-18 | Palatin Technologies, Inc. | Substituted melanocortin receptor-specific piperazine compounds |
| US7456184B2 (en) | 2003-05-01 | 2008-11-25 | Palatin Technologies Inc. | Melanocortin receptor-specific compounds |
| JPWO2003053927A1 (ja) * | 2001-12-21 | 2005-04-28 | 大正製薬株式会社 | ピペラジン誘導体 |
| US7968548B2 (en) * | 2003-05-01 | 2011-06-28 | Palatin Technologies, Inc. | Melanocortin receptor-specific piperazine compounds with diamine groups |
| US7727990B2 (en) | 2003-05-01 | 2010-06-01 | Palatin Technologies, Inc. | Melanocortin receptor-specific piperazine and keto-piperazine compounds |
| US7727991B2 (en) | 2003-05-01 | 2010-06-01 | Palatin Technologies, Inc. | Substituted melanocortin receptor-specific single acyl piperazine compounds |
| US7491723B2 (en) | 2003-10-14 | 2009-02-17 | Wyeth | Alkanol and cycloalkanol-amine derivatives and methods of their use |
| US7419980B2 (en) * | 2003-10-14 | 2008-09-02 | Wyeth | Fused-aryl and heteroaryl derivatives and methods of their use |
| US7709484B1 (en) | 2004-04-19 | 2010-05-04 | Palatin Technologies, Inc. | Substituted melanocortin receptor-specific piperazine compounds |
| AR054435A1 (es) * | 2005-04-04 | 2007-06-27 | Takeda Pharmaceutical | Agente para profilaxis o terapia contra la depresion o desorden de ansiedad |
| US20070021433A1 (en) | 2005-06-03 | 2007-01-25 | Jian-Qiang Fan | Pharmacological chaperones for treating obesity |
| US7834017B2 (en) | 2006-08-11 | 2010-11-16 | Palatin Technologies, Inc. | Diamine-containing, tetra-substituted piperazine compounds having identical 1- and 4-substituents |
| WO2008039863A2 (en) * | 2006-09-27 | 2008-04-03 | Braincells, Inc. | Composition comprising a melanocortin receptor (mcr) modulating agent alone or in combination with a second neurogenic agent for treating nervous system disorders |
| EP2072050A1 (en) | 2007-12-21 | 2009-06-24 | Santhera Pharmaceuticals (Schweiz) AG | Compounds with anti-emetic effect |
| JP2013503835A (ja) | 2009-09-07 | 2013-02-04 | ヴィフォール （インターナショナル） アクチェンゲゼルシャフト | 新規なエタンジアミン系ヘプシジン拮抗薬 |
| WO2012027495A1 (en) | 2010-08-27 | 2012-03-01 | University Of The Pacific | Piperazinylpyrimidine analogues as protein kinase inhibitors |
| CA2825098C (en) | 2011-01-27 | 2020-03-10 | Universite De Montreal | Pyrazolopyridine and pyrazolopyrimidine derivatives as melanocortin-4 receptor modulators |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1317053A (fr) * | 1961-03-17 | 1963-02-01 | Soc Ind Fab Antibiotiques Sifa | Nouveaux dérivés de la pipérazine, et procédé de préparation |
| CA918659A (en) * | 1969-07-31 | 1973-01-09 | Yoshitomi Pharmaceutical Industries | 11-(4-substituted-1-piperazinyl)-dibenzo (b,f) (1,4) thiazepines |
| FR2601364B1 (fr) * | 1986-07-09 | 1988-10-21 | Adir | Nouveaux derives de la piperazine dione-2,6, leurs procedes de preparation et les compositions pharmaceutiques qui les contiennent. |
| GB9021453D0 (en) * | 1990-10-03 | 1990-11-14 | Wyeth John & Brother Ltd | Piperazine derivatives |
| JPH0641071A (ja) * | 1991-09-06 | 1994-02-15 | Taisho Pharmaceut Co Ltd | インドール酢酸エステル誘導体 |
| GB9200293D0 (en) * | 1992-01-08 | 1992-02-26 | Wyeth John & Brother Ltd | Piperazine derivatives |
| SE9700620D0 (sv) * | 1997-02-21 | 1997-02-21 | Wapharm Ab | Cykliska peptider med selektivitet för MSH-receptor subtyper |
| AU742425B2 (en) | 1998-06-11 | 2002-01-03 | Merck & Co., Inc. | Spiropiperidine derivatives as melanocortin receptor agonists |
| PL360286A1 (en) | 2000-06-27 | 2004-09-06 | Taisho Pharmaceutical Co.Ltd. | Remedial agent for anxiety neurosis or depression and piperazine derivative |
-
2001
- 2001-06-27 PL PL36028601A patent/PL360286A1/xx not_active Application Discontinuation
- 2001-06-27 EA EA200500087A patent/EA200500087A1/ru unknown
- 2001-06-27 CZ CZ20024165A patent/CZ20024165A3/cs unknown
- 2001-06-27 IL IL15370601A patent/IL153706A0/xx unknown
- 2001-06-27 BR BR0111976-1A patent/BR0111976A/pt not_active IP Right Cessation
- 2001-06-27 WO PCT/JP2001/005524 patent/WO2002000259A1/ja not_active Application Discontinuation
- 2001-06-27 EE EEP200200717A patent/EE200200717A/xx unknown
- 2001-06-27 AU AU6634201A patent/AU6634201A/xx not_active Withdrawn
- 2001-06-27 JP JP2002505040A patent/JP5002881B2/ja not_active Expired - Fee Related
- 2001-06-27 CN CN01811767A patent/CN1438897A/zh active Pending
- 2001-06-27 EP EP01943844A patent/EP1295608A4/en not_active Withdrawn
- 2001-06-27 US US10/311,429 patent/US6949552B2/en not_active Expired - Fee Related
- 2001-06-27 HU HU0301719A patent/HUP0301719A2/hu unknown
- 2001-06-27 MX MXPA02012707A patent/MXPA02012707A/es unknown
- 2001-06-27 AU AU2001266342A patent/AU2001266342B2/en not_active Ceased
- 2001-06-27 NZ NZ523800A patent/NZ523800A/en unknown
- 2001-06-27 CA CA002413506A patent/CA2413506A1/en not_active Abandoned
- 2001-06-27 KR KR1020027017682A patent/KR20030013470A/ko not_active Application Discontinuation
- 2001-06-27 SK SK1832-2002A patent/SK18322002A3/sk unknown
- 2001-06-27 EA EA200300071A patent/EA005737B1/ru not_active IP Right Cessation
-
2002
- 2002-12-11 BG BG107371A patent/BG107371A/bg unknown
- 2002-12-19 NO NO20026122A patent/NO20026122L/no not_active Application Discontinuation
- 2002-12-20 ZA ZA200210386A patent/ZA200210386B/en unknown
-
2003
- 2003-01-27 HR HR20030056A patent/HRP20030056A2/hr not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| EP1295608A4 (en) | 2004-03-31 |
| EA200300071A1 (ru) | 2003-06-26 |
| EP1295608A1 (en) | 2003-03-26 |
| BG107371A (bg) | 2003-08-29 |
| HUP0301719A2 (hu) | 2003-09-29 |
| PL360286A1 (en) | 2004-09-06 |
| AU2001266342B2 (en) | 2005-01-27 |
| NO20026122D0 (no) | 2002-12-19 |
| BR0111976A (pt) | 2003-12-09 |
| WO2002000259A1 (fr) | 2002-01-03 |
| EA005737B1 (ru) | 2005-06-30 |
| SK18322002A3 (sk) | 2003-09-11 |
| NO20026122L (no) | 2003-02-25 |
| IL153706A0 (en) | 2003-07-06 |
| US6949552B2 (en) | 2005-09-27 |
| US20030186992A1 (en) | 2003-10-02 |
| EA200500087A1 (ru) | 2005-06-30 |
| CN1438897A (zh) | 2003-08-27 |
| KR20030013470A (ko) | 2003-02-14 |
| CA2413506A1 (en) | 2002-12-20 |
| EE200200717A (et) | 2004-08-16 |
| ZA200210386B (en) | 2004-02-10 |
| JP5002881B2 (ja) | 2012-08-15 |
| AU6634201A (en) | 2002-01-08 |
| CZ20024165A3 (cs) | 2004-03-17 |
| NZ523800A (en) | 2005-02-25 |
| MXPA02012707A (es) | 2003-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HRP20030056A2 (en) | Remedial agent for anxiety neurosis or depression and piperazine derivative | |
| KR100197454B1 (ko) | 디아자비시클릭 뉴로키닌 길항제 | |
| KR100883236B1 (ko) | 케모카인 수용체 길항제 | |
| AP299A (en) | Quinuclidine derivatives. | |
| JP4488891B2 (ja) | Ｎ−［フェニル（ピペリジン−２−イル）メチル］ベンズアミド誘導体、その製造法、およびその治療用途 | |
| AU688120B2 (en) | New piperidine compounds, process for their preparation and the pharmaceutical compositions which contain them | |
| EP2262784B1 (en) | Inhibitors of the chemokine receptor cxcr3 | |
| US5214055A (en) | Aminopiperidine 4-oxo-4H-chromen-2-yl compounds | |
| JP2002501898A (ja) | ケモカイン受容体活性の環状アミン調節剤 | |
| JP2005506949A (ja) | ケモカイン受容体の調節剤としてのジアミン | |
| TW200306830A (en) | N-[phenyl (piperidin-2-yl) methyl] benzamide derivatives, their preparation and their application in therapy | |
| JPH06340620A (ja) | 新規なアミノピペリジン、アミノピロリジンおよびアミノパー ヒドロアゼピン化合物 | |
| JPWO2003053927A1 (ja) | ピペラジン誘導体 | |
| JP2003512355A (ja) | ケモカイン受容体活性のモジュレータとしての二環式および三環式アミン | |
| EP1294699B1 (en) | Modulators of tnf- alpha signalling | |
| AU2016217461A1 (en) | Amide compounds as 5-HT4 receptor agonists | |
| JPH11514671A (ja) | ムスカリン様アンタゴニストとしての１，４―ジ―置換ピペリジン | |
| CN115702141A (zh) | 环丁基-脲衍生物 | |
| WO2009052708A1 (fr) | 1-(3-amino-propyl)-pipéridin-4-yl-amides, compositions pharmaceutiques, leurs procédés de préparation et utilisations | |
| JP2008539244A (ja) | オピオイド受容体アゴニスト化合物および痛みの治療におけるその使用 | |
| RU2469033C2 (ru) | СОЕДИНЕНИЯ ДИБЕНЗО[b,f][1,4]ОКСАЗАПИНА | |
| EA006203B1 (ru) | Гетероарильные производные, их получение и применение | |
| TW523516B (en) | Spiro[piperidine-4,1'-pyrrolo[3,4-C]pyrrole] | |
| JP2007500758A (ja) | ケモカイン受容体活性のモジュレーターとしてのｎ−ウレイドアルキル−ピペリジン | |
| CZ112699A3 (cs) | Deriváty N-(2-benzothiazolyl)-1-piperidinethanaminu, způsob jejich výroby a farmaceutické prostředky, které je obsahují |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A1OB | Publication of a patent application | ||
| OBST | Application withdrawn |