GB1409275A - Reinforced thermoplastic compositions - Google Patents
Reinforced thermoplastic compositionsInfo
- Publication number
- GB1409275A GB1409275A GB4526272A GB4526272A GB1409275A GB 1409275 A GB1409275 A GB 1409275A GB 4526272 A GB4526272 A GB 4526272A GB 4526272 A GB4526272 A GB 4526272A GB 1409275 A GB1409275 A GB 1409275A
- Authority
- GB
- United Kingdom
- Prior art keywords
- poly
- terephthalate
- fibres
- weight
- copolymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title abstract 6
- 229920001169 thermoplastic Polymers 0.000 title 1
- 239000004416 thermosoftening plastic Substances 0.000 title 1
- -1 alkylene glycol Chemical compound 0.000 abstract 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 abstract 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 abstract 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 abstract 2
- 229920000728 polyester Polymers 0.000 abstract 2
- 229920000642 polymer Polymers 0.000 abstract 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 abstract 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 abstract 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 abstract 1
- 244000043261 Hevea brasiliensis Species 0.000 abstract 1
- 229920000459 Nitrile rubber Polymers 0.000 abstract 1
- 239000004952 Polyamide Substances 0.000 abstract 1
- 239000004698 Polyethylene Substances 0.000 abstract 1
- 239000004793 Polystyrene Substances 0.000 abstract 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 abstract 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 abstract 1
- 229920002433 Vinyl chloride-vinyl acetate copolymer Polymers 0.000 abstract 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 abstract 1
- 125000001931 aliphatic group Chemical group 0.000 abstract 1
- 239000004411 aluminium Substances 0.000 abstract 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract 1
- 229910052782 aluminium Inorganic materials 0.000 abstract 1
- 239000010425 asbestos Substances 0.000 abstract 1
- NTXGQCSETZTARF-UHFFFAOYSA-N buta-1,3-diene;prop-2-enenitrile Chemical compound C=CC=C.C=CC#N NTXGQCSETZTARF-UHFFFAOYSA-N 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 239000006229 carbon black Substances 0.000 abstract 1
- 239000000919 ceramic Substances 0.000 abstract 1
- 239000008119 colloidal silica Substances 0.000 abstract 1
- 230000005494 condensation Effects 0.000 abstract 1
- 238000009833 condensation Methods 0.000 abstract 1
- 229920001577 copolymer Polymers 0.000 abstract 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 abstract 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 abstract 1
- 229920006244 ethylene-ethyl acrylate Polymers 0.000 abstract 1
- 239000003063 flame retardant Substances 0.000 abstract 1
- 239000003365 glass fiber Substances 0.000 abstract 1
- CAYGQBVSOZLICD-UHFFFAOYSA-N hexabromobenzene Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1Br CAYGQBVSOZLICD-UHFFFAOYSA-N 0.000 abstract 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 abstract 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 abstract 1
- 239000000155 melt Substances 0.000 abstract 1
- 239000000178 monomer Substances 0.000 abstract 1
- 229920003052 natural elastomer Polymers 0.000 abstract 1
- 229920001194 natural rubber Polymers 0.000 abstract 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 abstract 1
- 229920002647 polyamide Polymers 0.000 abstract 1
- 229920000573 polyethylene Polymers 0.000 abstract 1
- 229920002959 polymer blend Polymers 0.000 abstract 1
- 239000004926 polymethyl methacrylate Substances 0.000 abstract 1
- 229920000306 polymethylpentene Polymers 0.000 abstract 1
- 229920002223 polystyrene Polymers 0.000 abstract 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 abstract 1
- 239000004810 polytetrafluoroethylene Substances 0.000 abstract 1
- 229920000915 polyvinyl chloride Polymers 0.000 abstract 1
- 239000004800 polyvinyl chloride Substances 0.000 abstract 1
- 239000005033 polyvinylidene chloride Substances 0.000 abstract 1
- 239000000843 powder Substances 0.000 abstract 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 abstract 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 abstract 1
- 239000010453 quartz Substances 0.000 abstract 1
- 239000012763 reinforcing filler Substances 0.000 abstract 1
- 229910052895 riebeckite Inorganic materials 0.000 abstract 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 abstract 1
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L101/00—Compositions of unspecified macromolecular compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L55/00—Compositions of homopolymers or copolymers, obtained by polymerisation reactions only involving carbon-to-carbon unsaturated bonds, not provided for in groups C08L23/00 - C08L53/00
- C08L55/02—ABS [Acrylonitrile-Butadiene-Styrene] polymers
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S260/00—Chemistry of carbon compounds
- Y10S260/35—Crystallization
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/185,886 US4013613A (en) | 1971-10-01 | 1971-10-01 | Reinforced intercrystalline thermoplastic polyester compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1409275A true GB1409275A (en) | 1975-10-08 |
Family
ID=22682820
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4526272A Expired GB1409275A (en) | 1971-10-01 | 1972-10-02 | Reinforced thermoplastic compositions |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US4013613A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5755739B2 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2248242A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2154800B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1409275A (cg-RX-API-DMAC10.html) |
| IT (1) | IT968548B (cg-RX-API-DMAC10.html) |
| NL (1) | NL174263C (cg-RX-API-DMAC10.html) |
Cited By (141)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4117034A (en) | 1975-08-11 | 1978-09-26 | Borg-Warner Corporation | Amorphous polyester graft polymer alloys |
| US4332855A (en) | 1978-04-14 | 1982-06-01 | Raychem Corporation | Polymeric compositions |
| EP0693495A1 (de) | 1994-07-22 | 1996-01-24 | Bayer Ag | Mehrkernige Phosphorsäureester |
| EP0704488A2 (de) | 1994-09-30 | 1996-04-03 | Bayer Ag | Polycarbonat-Formmassen mit verbesserter Zähigkeit |
| WO2001092179A1 (de) | 2000-05-26 | 2001-12-06 | Sunyx Surface Nanotechnologies Gmbh | Substrat mit gering lichtstreuender, ultraphober oberfläche und verfahren zu seiner herstellung |
| DE102007006493A1 (de) | 2007-02-09 | 2008-08-14 | Lanxess Deutschland Gmbh | Leichtbauteil in Hybridbauweise |
| DE102007016786A1 (de) | 2007-04-05 | 2008-10-09 | Bayer Materialscience Ag | Polycarbonat-Formmassen |
| DE102007040927A1 (de) | 2007-08-30 | 2009-03-05 | Bayer Materialscience Ag | Verfahren zur Herstellung schlagzähmodifizierter gefüllter Polycarbonat-Zusammensetzungen |
| DE102007061761A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007061760A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polyalkylenterephthalat/Polycarbonat-Zusammensetzungen |
| DE102008016260A1 (de) | 2008-03-29 | 2009-10-01 | Bayer Materialscience Ag | Schlagzähmodifizierte Polyalkylenterephthalat/Polycarbonat-Zusammensetzungen |
| DE102008024672A1 (de) | 2008-05-21 | 2009-11-26 | Bayer Materialscience Ag | Tieftemperaturzähe Polycarbonat-Blends |
| DE102008032205A1 (de) | 2008-07-09 | 2010-01-14 | Lanxess Deutschland Gmbh | Fließverbesserte Thermoplasten |
| DE102008048204A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend Talk |
| DE102008048202A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend plättchen- oder schuppförmigen anorganischen Füllstoff ausgenommen Talk |
| DE102008048201A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend isotropen Füllstoff |
| DE202008015399U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Dachstruktur |
| DE202008015396U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Fahrwerkstruktur |
| DE202008015398U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Ölwanne |
| DE202008015401U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Sitzstrukturen |
| DE202008015400U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Instrumententafel |
| DE202008015392U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Pedalstruktur |
| DE202008015394U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Längsträgerstruktur |
| DE202008015395U1 (de) | 2008-11-19 | 2010-04-22 | Lanxess Deutschland Gmbh | Vorderwagenstruktur |
| DE202008015397U1 (de) | 2008-11-19 | 2010-04-22 | Lanxess Deutschland Gmbh | Säulenstruktur |
| DE202008015391U1 (de) | 2008-11-19 | 2010-04-22 | Lanxess Deutschland Gmbh | Türen- und Klappenstrukturen |
| DE102008058224A1 (de) | 2008-11-19 | 2010-05-20 | Lanxess Deutschland Gmbh | Leichtbauteil in Hybridbauweise |
| DE102009005762A1 (de) | 2008-12-23 | 2010-06-24 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102008058225A1 (de) | 2008-11-19 | 2010-07-08 | Lanxess Deutschland Gmbh | Leichtbauteil in Hybridbauweise |
| WO2010094416A1 (de) | 2009-02-19 | 2010-08-26 | Bayer Materialscience Ag | Compoundierungsverfahren zur herstellung von polymer-zusammensetzungen mit reduziertem gehalt an flüchtigen organischen verbindungen |
| EP2233519A1 (de) | 2009-03-27 | 2010-09-29 | LANXESS Deutschland GmbH | Glühdrahtbeständige Polyester |
| WO2010108617A1 (de) | 2009-03-26 | 2010-09-30 | Bayer Materialscience Ag | Schlagzähmodifizierte polycarbonat-zusammensetzungen zur herstellung metallisierter formkörper mit homogenem oberflächenglanz |
| DE102009020090A1 (de) | 2009-05-06 | 2010-11-11 | Lanxess Deutschland Gmbh | Reduktion des Einflusses der Wasseraufnahme auf die elektrische Leitfähigkeit von elektrisch leitfähigen Polyamid-Formmassen |
| DE102009034767A1 (de) | 2009-07-25 | 2011-01-27 | Lanxess Deutschland Gmbh & Co. Kg | Organoblechstrukturbauteil |
| WO2011015286A1 (de) | 2009-08-01 | 2011-02-10 | Bayer Materialscience Ag | Verbesserte haftung zwischen thermoplasten und polyurethan |
| DE102009058180A1 (de) | 2009-12-15 | 2011-06-16 | Bayer Materialscience Ag | Verfahren zur Herstellung von Polyurethan-Verbundbauteilen |
| WO2011070043A1 (de) | 2009-12-08 | 2011-06-16 | Bayer Materialscience Ag | Verfahren zur herstellung von polyurethan-verbundbauteilen sowie diese verbundbauteile |
| WO2011070044A1 (de) | 2009-12-08 | 2011-06-16 | Bayer Materialscience Ag | Verbundbauteile mit verbesserter haftung aus polycarbonat- / polyesterzusammensetzungen und polyurethan |
| WO2011073289A1 (en) | 2009-12-18 | 2011-06-23 | Bayer Materialscience Ag | Scratch-resistant, impact-resistant polycarbonate moulding compositions with good mechanical properties i |
| WO2011073290A1 (en) | 2009-12-18 | 2011-06-23 | Bayer Materialscience Ag | Scratch-resistant, impact-resistant polycarbonate moulding compositions having good mechanical properties ii |
| WO2011073291A1 (en) | 2009-12-18 | 2011-06-23 | Bayer Materialscience Ag | Flameproofed, impact-modified, scratch-resistant polycarbonate moulding compositions with good mechanical properties |
| DE102009058182A1 (de) | 2009-12-15 | 2011-06-30 | Bayer MaterialScience AG, 51373 | Verbundbauteile mit verbesserter Haftung aus Polycarbonat- / Polyesterzusammensetzungen und Polyurethan |
| WO2011098490A1 (de) | 2010-02-13 | 2011-08-18 | Bayer Materialscience Ag | Verwendung von mischungen zur herstellung schlagzähmodifizierter thermoplastischer zusammensetzungen |
| EP2365030A1 (de) | 2010-03-10 | 2011-09-14 | LANXESS Deutschland GmbH | -N=C=N- enthaltende Verbindungen zur Verhinderung des thermischen Abbaus von Metall-dialkylphosphinat enthaltenden Polyalkylenterephthalaten in der Schmelze |
| EP2365028A1 (de) | 2010-03-10 | 2011-09-14 | LANXESS Deutschland GmbH | -N=C=N- enthaltende Verbindungen zur Verhinderung des thermischen Abbaus von Metall-dialkylphosphinat enthaltenden Polyalkylenterephthalaten in der Schmelze |
| WO2011124540A1 (de) | 2010-04-07 | 2011-10-13 | Bayer Materialscience Ag | Flammgeschützte polycarbonat-zusammensetzungen |
| WO2012007501A1 (de) | 2010-07-14 | 2012-01-19 | Bayer Materialscience Ag | Vorrichtung und verfahren zur herstellung von produkten aus pigmenthaltigen polymermischungen |
| WO2012025481A1 (de) | 2010-08-24 | 2012-03-01 | Bayer Materialscience Ag | SCHLAGZÄHMODIFIZIERTE POLYESTER/POLYCARBONAT-ZUSAMMENSETZUNGEN MIT VERBESSERTER REIßDEHNUNG |
| DE102010042939A1 (de) | 2010-10-26 | 2012-04-26 | Bayer Materialscience Aktiengesellschaft | Fugenlose Heckklappe |
| US8178603B2 (en) | 2008-12-23 | 2012-05-15 | Bayer Materialscience Ag | Flameproofed impact-modified polycarbonate compositions |
| DE102010053483A1 (de) | 2010-12-04 | 2012-06-06 | Lanxess Deutschland Gmbh | =N=C=N- enthaltende Verbindung zur Verhinderung des thermischen Abbaus in Schmelzen |
| EP2463338A1 (de) | 2010-12-13 | 2012-06-13 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2465896A1 (de) | 2010-12-14 | 2012-06-20 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2468810A1 (de) | 2010-12-23 | 2012-06-27 | Lanxess Deutschland GmbH | Mit gemahlenem Glas gefüllte flammwidrige Polyamidzusammensetzungen |
| WO2012084865A1 (de) | 2010-12-23 | 2012-06-28 | Bayer Materialscience Ag | Verfahren zur verbesserung der russdispergierung |
| WO2012084848A1 (de) | 2010-12-23 | 2012-06-28 | Bayer Materialscience Ag | Antistatische polycarbonat-formmassen |
| DE202010017765U1 (de) | 2010-12-23 | 2012-07-11 | Lanxess Deutschland Gmbh | Mit gemahlenem Glas gefüllte Zusammensetzungen |
| WO2013060687A1 (de) | 2011-10-26 | 2013-05-02 | Bayer Intellectual Property Gmbh | Stabilisierte polycarbonatzusammensetzungen mit abmischungen aus kieselsäure und einer anorganischen säure |
| WO2013060685A1 (de) | 2011-10-26 | 2013-05-02 | Bayer Intellectual Property Gmbh | Verfahren zur herstellung und stabilisierung von schlagzähmodifizierten polycarbonat- zusammensetzungen unter verwendung von verdünnten lösungen saurer verbindungen |
| WO2013079478A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Mehrschichtkörper aus polycarbonat mit tiefenglanzeffekt |
| WO2013079555A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Formkörper mit hoher oberflächengüte |
| WO2013124232A1 (de) | 2012-02-20 | 2013-08-29 | Bayer Intellectual Property Gmbh | Mehrschichtaufbau als reflektor |
| EP2657298A1 (de) | 2012-04-27 | 2013-10-30 | Bayer MaterialScience AG | PC/ABS-Zusammensetzungen mit guter thermischer und chemischer Beständigkeit |
| WO2013178563A2 (de) | 2012-06-01 | 2013-12-05 | Bayer Materialscience Ag | Mehrschichtaufbau als reflektor |
| WO2014095981A1 (de) | 2012-12-20 | 2014-06-26 | Bayer Materialscience Ag | Mehrschichtkörper aus polycarbonat mit hoher bewitterungsstabilität |
| DE202014008607U1 (de) | 2014-10-31 | 2014-11-24 | Lanxess Deutschland Gmbh | Polyamidzusammensetzungen |
| EP2818297A1 (de) | 2013-06-25 | 2014-12-31 | LANXESS Deutschland GmbH | Spritzgießverfahren |
| WO2015052114A1 (de) | 2013-10-08 | 2015-04-16 | Bayer Materialscience Ag | Faserverbundwerkstoff, verwendung dafür und verfahren zu dessen herstellung |
| WO2015055719A1 (de) | 2013-10-18 | 2015-04-23 | Bayer Materialscience Ag | Polycarbonatzusammensetzungen mit verbesserter haftung zu polyurethanschichten |
| EP2878625A1 (de) | 2013-11-27 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2878626A1 (de) | 2013-11-27 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2878631A1 (de) | 2013-11-28 | 2015-06-03 | LANXESS Deutschland GmbH | Polyamid Zusammensetzungen |
| EP2878619A1 (de) | 2013-12-02 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2878629A1 (de) | 2013-11-27 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2878628A1 (de) | 2013-11-27 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| DE102014000612A1 (de) | 2014-01-18 | 2015-07-23 | Lanxess Deutschland Gmbh | Polyester Zusammensetzungen |
| DE102014000613A1 (de) | 2014-01-18 | 2015-07-23 | Lanxess Deutschland Gmbh | Polyester Zusammensetzungen |
| EP2915841A1 (de) | 2014-03-04 | 2015-09-09 | LANXESS Deutschland GmbH | Polyester Zusammensetzung |
| EP2924067A1 (de) | 2014-03-26 | 2015-09-30 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP2924062A1 (de) | 2014-03-27 | 2015-09-30 | LANXESS Deutschland GmbH | Flammwidrige Polyamidzusammensetzungen |
| EP2924066A1 (de) | 2014-03-26 | 2015-09-30 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP2924070A1 (de) | 2014-03-26 | 2015-09-30 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP2942367A1 (de) | 2014-05-05 | 2015-11-11 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| DE202014009839U1 (de) | 2014-12-11 | 2016-03-15 | Lanxess Deutschland Gmbh | Flammgeschützte Faser-Matrix-Halbzeuge |
| EP3020752A1 (de) | 2014-11-17 | 2016-05-18 | LANXESS Deutschland GmbH | Flammgeschützte Faser-Matrix-Halbzeuge |
| EP3034554A1 (de) | 2014-12-19 | 2016-06-22 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP3067388A1 (de) | 2015-03-09 | 2016-09-14 | LANXESS Deutschland GmbH | Thermoplastische formmassen |
| EP3067387A1 (de) | 2015-03-09 | 2016-09-14 | LANXESS Deutschland GmbH | Thermoplastische formmassen |
| WO2016202399A1 (de) | 2015-06-18 | 2016-12-22 | Covestro Deutschland Ag | Flammgeschütze polycarbonat-polyester-zusammensetzungen |
| EP3133103A1 (de) | 2015-08-21 | 2017-02-22 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP3135708A1 (de) | 2015-08-26 | 2017-03-01 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| WO2017065762A1 (en) | 2015-10-14 | 2017-04-20 | Covestro Llc | Phosphazene modified polycarbonate molded battery cooling device |
| EP3239224A2 (de) | 2016-04-28 | 2017-11-01 | LANXESS Deutschland GmbH | Thermoplastische formmassen |
| EP3239228A1 (de) | 2016-04-28 | 2017-11-01 | LANXESS Deutschland GmbH | Polybutylenterephthalat zusammensetzungen |
| WO2017186663A1 (de) | 2016-04-27 | 2017-11-02 | Covestro Deutschland Ag | Antistatische thermoplastische formmassen |
| WO2017186690A1 (de) | 2016-04-27 | 2017-11-02 | Covestro Deutschland Ag | Antistatische und lichtstabile thermoplastische polycarbonat-formmassen |
| WO2018015557A1 (de) | 2016-07-22 | 2018-01-25 | Covestro Deutschland Ag | Kratzfeste polycarbonat-zusammensetzungen mit guter thermischer stabilität |
| WO2018060081A1 (de) | 2016-09-27 | 2018-04-05 | Covestro Deutschland Ag | Frontscheibe für kraftfahrzeug |
| WO2018122137A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Verbundbauteil |
| WO2018122141A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen mit guten mechanischen eigenschaften |
| WO2018122139A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Zusammensetzung und thermoplastische formmasse mit guter kerbschlagzähigkeit und verbesserter schmelzestabilität |
| WO2018164666A1 (en) | 2017-03-07 | 2018-09-13 | Covestro Llc | Two shot injection molding process for thermoplastic parts |
| WO2019016369A1 (de) | 2017-07-21 | 2019-01-24 | Covestro Deutschland Ag | Talkgefüllte zusammensetzung und thermoplastische formmasse |
| WO2019025483A1 (de) | 2017-08-04 | 2019-02-07 | Covestro Deutschland Ag | Polycarbonat-zusammensetzung und polycarbonat-formmasse mit verbesserter fliessfähigkeit |
| WO2019076494A1 (de) | 2017-10-16 | 2019-04-25 | Covestro Deutschland Ag | Flammwidrige polycarbonat-zusammensetzung mit geringem bisphenol-a gehalt |
| WO2019076495A1 (de) | 2017-10-16 | 2019-04-25 | Covestro Deutschland Ag | Flammwidrige, füllstoff-verstärkte polycarbonat-zusammensetzung mit geringem bisphenol-a gehalt |
| WO2019121272A1 (de) | 2017-12-20 | 2019-06-27 | Covestro Deutschland Ag | Polycarbonat-zusammensetzung mit guter flammwidrigkeit |
| WO2019121463A1 (de) | 2017-12-19 | 2019-06-27 | Covestro Deutschland Ag | Thermoplastische zusammensetzungen mit guter stabilität |
| WO2019170569A1 (de) | 2018-03-07 | 2019-09-12 | Covestro Deutschland Ag | Artikel für lebensmittelkontaktanwendungen |
| EP3546511A1 (de) | 2018-03-26 | 2019-10-02 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| WO2019185627A1 (de) | 2018-03-28 | 2019-10-03 | Covestro Deutschland Ag | Zusammensetzung und thermoplastische formmasse zur herstellung von formkörpern mit erhöhtem glanz |
| WO2019197270A1 (en) | 2018-04-09 | 2019-10-17 | Covestro Deutschland Ag | Glass fiber reinforced thermoplastic compositions with good mechanical properties |
| WO2021037705A1 (en) | 2019-08-28 | 2021-03-04 | Covestro Intellectual Property Gmbh & Co. Kg | Flame-retardant polycarbonate composition and molded parts as well as articles made therefrom |
| WO2021043654A1 (de) | 2019-09-04 | 2021-03-11 | Covestro Intellectual Property Gmbh & Co. Kg | Polyphosphazen und formmasse enthaltend das polyphosphazen |
| WO2021076561A1 (en) | 2019-10-15 | 2021-04-22 | Covestro Llc | Three part headlamp assembly |
| WO2021110550A1 (en) | 2019-12-04 | 2021-06-10 | Covestro Intellectual Property Gmbh & Co. Kg | Flame retardant impact-modified polycarbonate composition |
| WO2021116239A1 (en) | 2019-12-13 | 2021-06-17 | Covestro Deutschland Ag | Layered structures with cutting lines |
| WO2021138113A1 (en) | 2020-01-02 | 2021-07-08 | Covestro Llc | Chemical resistant polycarbonate blend compositions |
| WO2021233727A1 (de) | 2020-05-18 | 2021-11-25 | Covestro Deutschland Ag | Polycarbonat blend mit verringerten störgeräuschen |
| US11207871B2 (en) | 2014-09-11 | 2021-12-28 | Covestro Ag | Bezel for motor vehicle glazing systems |
| WO2022058222A1 (de) | 2020-09-18 | 2022-03-24 | Covestro Deutschland Ag | Mehrschichtkörper für diffuse durchleuchtung |
| EP4047073A1 (de) | 2021-02-17 | 2022-08-24 | Covestro Deutschland AG | Pyrolyse von polycarbonat-haltigem material zur wiedergewinnung von rohstoffen |
| WO2022228954A1 (en) | 2021-04-26 | 2022-11-03 | Covestro Deutschland Ag | Flame retardant polycarbonate composition with high comparative tracking index |
| EP4092081A1 (en) | 2021-05-18 | 2022-11-23 | Covestro Deutschland AG | Flame retardant polycarbonate composition with high comparative tracking index |
| WO2023006614A1 (en) | 2021-07-27 | 2023-02-02 | Covestro Deutschland Ag | Hydrolysis-resistant polycarbonate composition |
| EP4177301A1 (de) | 2021-11-03 | 2023-05-10 | Covestro Deutschland AG | Polyphosphazen und formmasse enthaltend das polyphosphazen |
| EP4198076A1 (en) | 2021-12-16 | 2023-06-21 | Covestro Deutschland AG | Process for recovery of rubber-modified vinyl(co)polymer |
| EP4201987A1 (de) | 2021-12-22 | 2023-06-28 | Covestro Deutschland AG | Pyrolyse von polycarbonat-haltigem material in kombination mit phosphorhaltiger organischer verbindung zur wiedergewinnung von rohstoffen |
| US20230212333A1 (en) * | 2020-06-10 | 2023-07-06 | Röhm Gmbh | Thermoplastic moulding composition with improved weathering resistance |
| EP4245521A1 (de) | 2022-03-16 | 2023-09-20 | Covestro Deutschland AG | Metallschicht enthaltender mehrschichtkörper für diffuse durchleuchtung |
| EP4245529A1 (de) | 2022-03-16 | 2023-09-20 | Covestro Deutschland AG | Durchleuchtbarer mehrschichtkörper mit thermo- oder druckempfindlicher dekorationsschicht |
| WO2023202910A1 (de) | 2022-04-19 | 2023-10-26 | Covestro Deutschland Ag | Verfahren zur herstellung einer plastischen masse mit verbesserten eigenschaften |
| EP4311839A1 (de) | 2022-07-28 | 2024-01-31 | Covestro Deutschland AG | Mineralgefüllte polycarbonat-blend-formmasse mit niedrigem bpa-gehalt und verfahren zu ihrer herstellung |
| WO2024206154A1 (en) | 2023-03-24 | 2024-10-03 | Covestro Llc | Thermal stabilization package for polycarbonate/acrylonitrile-butadiene-styrene blends |
| WO2025073535A1 (de) | 2023-10-02 | 2025-04-10 | Covestro Deutschland Ag | Gefüllte zusammensetzung und thermoplastische formmasse zur herstellung von formkörpern mit guter oberflächenkosmetik und reduziertem gehalt an freiem bisphenol a |
| WO2025078222A1 (de) | 2023-10-12 | 2025-04-17 | Covestro Deutschland Ag | Verfahren zur herstellung einer plastiischen masse mit verbesserten eigenschaften. |
| WO2025082842A1 (de) | 2023-10-17 | 2025-04-24 | Covestro Deutschland Ag | Verfahren zur herstellung eines verbundbauteils umfassend den schritt des kontaktlosen aufbringens eines flüssigen beschichtungsmittels |
| EP4552819A1 (en) | 2023-11-10 | 2025-05-14 | Covestro LLC | Plate metal insert molding with polycarbonate and polycarbonate blends |
| WO2025132581A1 (de) | 2023-12-21 | 2025-06-26 | Covestro Deutschland Ag | Verfahren zur herstellung eines verbundbauteils umfassend einen träger mit spezifischem oh-gehalt |
| EP4600008A1 (en) | 2024-02-08 | 2025-08-13 | Covestro LLC | Sacrificial section for more sustainable plastic parts |
| WO2025242778A1 (en) | 2024-05-23 | 2025-11-27 | Covestro Deutschland Ag | Talc filled polycarbonate composition with good surface appearance and low content of free bisphenol a |
Families Citing this family (126)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT963692B (it) * | 1972-08-03 | 1974-01-21 | Montedison Spa | Poliesteri antiurto |
| JPS5121664B2 (cg-RX-API-DMAC10.html) * | 1972-09-12 | 1976-07-03 | ||
| JPS5222378B2 (cg-RX-API-DMAC10.html) * | 1973-05-04 | 1977-06-17 | ||
| DE2425806A1 (de) * | 1973-06-14 | 1975-01-30 | Goodyear Tire & Rubber | Vertraegliche und homogene mischung aus polyvinylchlorid und copolestern |
| CA1059676A (en) * | 1973-06-14 | 1979-07-31 | Clyde E. Gleim | Flame retardant polyester compositions |
| JPS5615434B2 (cg-RX-API-DMAC10.html) * | 1973-10-15 | 1981-04-10 | ||
| JPS50110451A (cg-RX-API-DMAC10.html) * | 1974-02-13 | 1975-08-30 | ||
| JPS5224941B2 (cg-RX-API-DMAC10.html) * | 1974-05-25 | 1977-07-05 | ||
| JPS5224942B2 (cg-RX-API-DMAC10.html) * | 1974-06-03 | 1977-07-05 | ||
| US4002581A (en) * | 1975-12-08 | 1977-01-11 | General Electric Company | Foamed thermoplastic compositions of a linear polyester and an ionically crosslinked copolymer |
| US4111892A (en) * | 1976-05-24 | 1978-09-05 | Mitsubishi Rayon Co., Ltd. | Reinforced fire retardant resin composition improved in electrical characteristics |
| NL184903C (nl) * | 1976-06-11 | 1989-12-01 | Monsanto Co | Werkwijze voor de bereiding van een elastoplastisch materiaal, dat een thermoplastische, lineaire, kristallijne polyester en een verknoopte rubber bevat. |
| US4101502A (en) * | 1977-04-01 | 1978-07-18 | Gaf Corporation | Interpolymers of poly (butylene terephthalate) |
| US4195011A (en) * | 1977-07-11 | 1980-03-25 | Gaf Corporation | Injection molding compositions |
| US4140670A (en) * | 1977-07-11 | 1979-02-20 | Gaf Corporation | PBT Injection molding composition |
| US4168259A (en) * | 1977-07-11 | 1979-09-18 | Gaf Corporation | Glass reinforced PBT resins |
| US4157325A (en) * | 1977-07-11 | 1979-06-05 | Gaf Corporation | PBT molding compositions |
| US4244859A (en) * | 1977-11-15 | 1981-01-13 | Teijin Limited | Aromatic polyester composition |
| JPS5483052A (en) * | 1977-12-15 | 1979-07-02 | Teijin Ltd | Fiberglass reinforced polyester resin composition |
| US4140671A (en) * | 1977-12-30 | 1979-02-20 | General Electric Company | Warp-resistant flame-retarded reinforced thermoplastic compositions |
| US4157997A (en) * | 1978-03-20 | 1979-06-12 | General Electric Company | Polyalkylene terephthalate and organopolysiloxane-polycarbonate block copolymer blends |
| US4221694A (en) * | 1978-11-20 | 1980-09-09 | Hooker Chemicals & Plastics Corp. | Glass-filled polybutylene terephthalate compositions of diminished warpage |
| DE2966999D1 (en) * | 1978-12-06 | 1984-06-20 | Gen Electric | Modified polyester compositions |
| US4467057A (en) * | 1978-12-06 | 1984-08-21 | General Electric Company | Modified polyester composition |
| US4280948A (en) * | 1979-02-02 | 1981-07-28 | General Electric Company | Modified polyester compositions |
| US4373047A (en) * | 1979-02-12 | 1983-02-08 | General Electric Company | Flame retardant thermoplastic compositions with reduced bloom |
| US4219628A (en) * | 1979-04-02 | 1980-08-26 | Eastman Kodak Company | Molding composition from polyester blends |
| US4414352A (en) * | 1979-05-01 | 1983-11-08 | General Electric Company | Thermoplastic molding compositions and process |
| WO1980002430A1 (en) * | 1979-05-01 | 1980-11-13 | Gen Electric | Thermoplastic molding composition and process |
| US4259458A (en) * | 1979-08-09 | 1981-03-31 | Union Carbide Corporation | Polyarylate containing blends |
| US4229340A (en) * | 1979-08-27 | 1980-10-21 | Celanese Corporation | Glass fiber-reinforced polyethylene terephthalate/polyamide blends |
| US4304709A (en) * | 1979-11-01 | 1981-12-08 | Hooker Chemicals & Plastics Corp. | Polymer blends with improved hydrolytic stability |
| US4322333A (en) * | 1979-11-05 | 1982-03-30 | General Electric Company | Reinforced PBT-copolyaromatic/aliphatic block copolyesters |
| US4369136A (en) * | 1980-03-31 | 1983-01-18 | Union Carbide Corporation | Poly(aryl ether) containing blends |
| EP0044141B1 (en) * | 1980-07-14 | 1985-04-17 | Imperial Chemical Industries Plc | Filled compositions of thermoplastic polyamide and polyester |
| US4369280A (en) * | 1981-08-04 | 1983-01-18 | General Electric Company | Polybutylene terephthalate molding compositions and articles molded therefrom |
| BR8304832A (pt) * | 1982-09-29 | 1984-09-04 | Gen Electric | Combinacoes de ingredientes de polimeros,composicao,interdispersao de polimeros,artigo de cabo,interdispersao quimicamente reticulavel e composicao reticulavel |
| US4564658A (en) * | 1982-11-24 | 1986-01-14 | General Electric Company | Thermoplastic polyester-linear low density polyethylene molding compositions |
| US4476274A (en) * | 1983-01-03 | 1984-10-09 | General Electric Company | Linear low density polyethylene impact modifier for thermoplastic polyesters |
| JPS59219362A (ja) * | 1983-05-27 | 1984-12-10 | Sumitomo Naugatuck Co Ltd | 熱可塑性樹脂組成物 |
| EP0133641A1 (en) * | 1983-06-28 | 1985-03-06 | General Electric Company | Flame retardant thermoplastic polyester compositions |
| DE3420544C2 (de) * | 1984-06-01 | 1986-04-10 | Diehl GmbH & Co, 8500 Nürnberg | Adhäsionsmittel zum Verbinden von Oberflächen in explosive Ladungen enthaltende Munitionen |
| DE3422862A1 (de) * | 1984-06-20 | 1986-01-02 | Bayer Ag, 5090 Leverkusen | Thermoplastische formmassen auf basis von polyalkylenterephthalat und polymerisat sowie verfahren zu ihrer herstellung |
| US4542177A (en) * | 1984-06-29 | 1985-09-17 | Mobay Chemical Corporation | Thermoplastic polyester molding composition having an improved impact performance |
| GB8428982D0 (en) * | 1984-11-16 | 1984-12-27 | Raychem Ltd | Polymer composition |
| DE3445570A1 (de) * | 1984-12-14 | 1986-06-19 | Basf Ag, 6700 Ludwigshafen | Selbstverloeschende thermoplastische polyesterformmassen |
| FR2577230B1 (fr) * | 1985-02-08 | 1987-03-06 | Charbonnages Ste Chimique | Nouvelles compositions de resines polymeriques a base d'acrylonitrile-butadiene-styrene a proprietes ameliorees |
| EP0211903B1 (en) * | 1985-02-13 | 1991-09-11 | Bridges Corporation Pty. Ltd. | Modified polyester thermosetting resin compositions |
| US4684686A (en) * | 1985-02-25 | 1987-08-04 | General Electric Company | Glass fiber reinforced polyester molding compositions containing metal powders |
| US4619971A (en) * | 1985-03-29 | 1986-10-28 | General Electric Company | Linear polyester resin blends with high impact resistance |
| US5079297A (en) * | 1985-08-02 | 1992-01-07 | General Electric Company | Solvent-resistant, compatible blends of polyphenylene ethers and thermoplastic polyesters |
| US5081184A (en) * | 1985-08-02 | 1992-01-14 | General Electric Company | Solvent-resistant, compatible blends of polyphenylene ethers and linear polyesters |
| JPH0694533B2 (ja) * | 1986-01-16 | 1994-11-24 | 三菱レイヨン株式会社 | 熱可塑性ポリエステル樹脂組成物 |
| US4829113A (en) * | 1986-02-25 | 1989-05-09 | Celanese Corporation | Stabilized aromatic polyester compositions |
| US4725347A (en) * | 1986-05-02 | 1988-02-16 | The Dow Chemical Company | Reinforced bipolar electrolytic cell frame |
| US5115016A (en) * | 1986-12-30 | 1992-05-19 | General Electric Company | Reinforced polyester molding compositions having high gloss and improved resistance to warping |
| DE3883607T2 (de) * | 1987-06-03 | 1994-04-21 | Ube Industries | Harzzusammensetzungen und daraus hergestellte Formkörper. |
| US5210134A (en) * | 1987-08-24 | 1993-05-11 | Allied Signal | High impact, styrenic polymer/thermoplastic polymer grafted blends |
| DE3881700T2 (de) * | 1987-08-24 | 1993-09-16 | Allied Signal Inc | Schlagfeste styrenpolymer/thermoplastpolymer-mischung. |
| US5346967A (en) * | 1987-11-04 | 1994-09-13 | General Electric Company | Blends of thermoplastic polyester resins and amorphous polyamides |
| JP2608439B2 (ja) * | 1988-01-25 | 1997-05-07 | 三菱レイヨン株式会社 | 耐衝撃性樹脂組成物 |
| DE3804392A1 (de) * | 1988-02-12 | 1989-08-24 | Basf Ag | Fuellstoffhaltige polyamid-formmassen mit verbesserter oberflaeche und lackierbarkeit |
| US5286812A (en) * | 1988-02-19 | 1994-02-15 | University Of Massachusetts | High performance blends of aromatic polyimides with aromatic polyethersulfones |
| US5047450A (en) * | 1988-04-05 | 1991-09-10 | Phillips Petroleum Company | Polyethylene terephthalate molding resin blends |
| US5041476A (en) * | 1988-04-05 | 1991-08-20 | Phillips Petroleum Company | Rapidly crystallizing polyethylene terephthalate blends |
| US5030680A (en) * | 1988-04-05 | 1991-07-09 | Phillips Petroleum Company | Rapidly crystallizing polyethylene terephthalate blends |
| DE68923813T2 (de) * | 1988-04-18 | 1996-03-21 | Gen Electric | Lösungsmittelbeständige, verträgliche Mischungen von Polyphenylenäthern und thermoplastischen Polyestern. |
| US4879346A (en) * | 1988-06-10 | 1989-11-07 | General Electric Company | Blends of a silicone-polycarbonate block copolymer with a compatibilized alloy of polyphenylene ether resin/polyester resin |
| JP2570393B2 (ja) * | 1988-06-30 | 1997-01-08 | 住友化学工業株式会社 | 熱可塑性樹脂組成物 |
| US5206290A (en) * | 1988-07-06 | 1993-04-27 | Sumitomo Chemical Company | Thermoplastic resin composition |
| US5073416A (en) * | 1988-11-21 | 1991-12-17 | General Electric Company | Articles from mixed scrap plastics |
| DE3903102A1 (de) * | 1989-02-02 | 1990-08-09 | Bayer Ag | Mischungen aus polyalkylenterephthalaten, neuen polycarbonaten und elastomeren |
| US5001178A (en) * | 1989-03-06 | 1991-03-19 | General Electric Company | Thermoplastic molding compositions |
| EP0393616B1 (en) * | 1989-04-19 | 1994-12-21 | Mitsubishi Rayon Co., Ltd. | Thermoplastic polyester resin composition |
| US5179163A (en) * | 1989-05-11 | 1993-01-12 | Hoechst Celanese Corporation | Elastomer compositions made from blends of copolyester elastomers and copolymers of ethylene and ethyl acrylate |
| DE3919043A1 (de) * | 1989-06-10 | 1990-12-13 | Bayer Ag | Polycarbonat-formmassen |
| JP2542119B2 (ja) * | 1989-11-01 | 1996-10-09 | ポリプラスチックス株式会社 | 熱可塑性相互侵入網目構造体及びその形成法 |
| US5384359A (en) * | 1989-11-08 | 1995-01-24 | General Electric Company | Compatibilized compositions of polyphenylene ether, polyester resins and polycarbonate-polyester copolymers |
| JPH06340794A (ja) * | 1990-06-22 | 1994-12-13 | E I Du Pont De Nemours & Co | ポリアセタール配合物 |
| US5208277A (en) * | 1991-07-15 | 1993-05-04 | Phillips Petroleum Company | Glass reinforced blends of higher α-olefins and polyesters optionally compatibilized with carboxylated polyolefins |
| DE4138574A1 (de) * | 1991-11-23 | 1993-05-27 | Basf Ag | Thermoplastische formmassen auf der basis von thermoplastischen polyestern und methylmethacrylatpolymerisaten |
| EP0695785B1 (de) | 1994-08-01 | 1998-05-20 | Bayer Ag | Mischungen aus Polycarbonat, phenolisch hydroxyfunktionellen verzweigten Dimerfettsäurepolyestern und gegebenenfalls Pfropfpolymerisat |
| DE4429319A1 (de) | 1994-08-18 | 1996-02-22 | Bayer Ag | Flammgeschützte thermoplastische Polycarbonat-Formmassen |
| DE4443164A1 (de) | 1994-12-05 | 1996-06-13 | Bayer Ag | Flammgeschützte, thermoplastische Polycarbonat-Formmassen |
| US6087591A (en) * | 1995-04-26 | 2000-07-11 | Nguyen; Phu D. | Insulated electrical conductors |
| DE19543186A1 (de) | 1995-11-20 | 1997-05-22 | Bayer Ag | Flammgeschützte themoplastische Formkörper mit verbesserten Eigenschaften |
| DE19545289A1 (de) | 1995-12-05 | 1997-06-12 | Bayer Ag | Thermoplastische Massen mit verbessertem Röntgenkontrast |
| US6437054B1 (en) | 1999-02-17 | 2002-08-20 | General Electric Company | Composition of polyester sulfonate salt ionomer, polyamide and polyepoxide |
| US6858671B2 (en) * | 2001-12-04 | 2005-02-22 | General Electric Company | Method of manufacture of polyester molding compositions and articles produced therefrom |
| US7461503B2 (en) * | 2002-06-26 | 2008-12-09 | Alliant Techsystems Inc. | Low-cost, low-density, ablative rubber insulation for rocket motors |
| DE10231334A1 (de) * | 2002-07-11 | 2004-01-22 | Bayer Ag | Mit polymeren Phosphorigsäureestern stabilisierte Thermoplaste |
| KR100874996B1 (ko) * | 2004-06-08 | 2008-12-19 | 란세스 도이치란트 게엠베하 | 열가소성 폴리에스테르를 기재로 하는 유동성이 개선된성형 화합물 |
| JP4620734B2 (ja) | 2004-06-08 | 2011-01-26 | ランクセス・ドイチュランド・ゲーエムベーハー | 改良された流動性を有するポリアミド成形用組成物 |
| US7230066B2 (en) * | 2004-12-16 | 2007-06-12 | General Electric Company | Polycarbonate—ultem block copolymers |
| DE102006006167A1 (de) * | 2005-04-06 | 2006-10-12 | Lanxess Deutschland Gmbh | Formmassen auf Basis eines thermoplastischen Polycarbonats |
| EP2997964A1 (en) * | 2006-04-05 | 2016-03-23 | OPKO Health, Inc. | Pharmaceutical formulations comprising salts of (5s,8s)-8-[{(1 r)-1-(3,5-bis-trifluoromethyl)phenyl]- ethoxy}-methyl]-8-phenyl-1,7-diazaspiro[4.5]decan-2-one and their medical use |
| US8323436B2 (en) | 2007-03-28 | 2012-12-04 | The United States Of America As Represented By The Secretary Of The Army | Transparent, reinforced, composite fiber and articles made therefrom |
| WO2009082114A1 (en) * | 2007-12-21 | 2009-07-02 | Cheil Industries Inc. | Polymer alloy composition |
| DE102009005763A1 (de) | 2009-01-23 | 2010-07-29 | Lanxess Deutschland Gmbh | Rahmenseitenteil einer Kraftfahrzeug Karosserie |
| US20150210651A1 (en) | 2012-08-23 | 2015-07-30 | Bayer Materialscience Ag | Vapour deposition of organic uv absorbers onto plastic substrates |
| EP2700455A1 (de) | 2012-08-23 | 2014-02-26 | Bayer MaterialScience AG | Nasslackapplikation auf Kunststoffsubstraten mit Plasmahärtung |
| US10233309B2 (en) * | 2016-08-08 | 2019-03-19 | Innovative Plastics And Molding Inc. | Cellulose fiber thermoplastic composition having a cosmetic appearance and molding thereof |
| EP3287493A1 (de) | 2016-08-26 | 2018-02-28 | LANXESS Deutschland GmbH | Polyesterzusammensetzungen |
| EP3290469A1 (de) | 2016-09-01 | 2018-03-07 | LANXESS Deutschland GmbH | Thermoplastische formmassen |
| EP3290475A1 (de) | 2016-09-01 | 2018-03-07 | LANXESS Deutschland GmbH | Thermoplastische formmassen |
| ES3005839T3 (en) | 2016-09-06 | 2025-03-17 | Envalior Deutschland Gmbh | Polyalkylene terephthalate compositions |
| EP3431538A1 (de) | 2017-07-17 | 2019-01-23 | LANXESS Deutschland GmbH | Zusammensetzungen enthaltend polymeres carbodiimid, epoxid und polyester-basierte polymere, deren herstellung und verwendung |
| DE202017004083U1 (de) | 2017-07-29 | 2017-08-11 | Bond-Laminates Gmbh | Faser-Matrix-Halbzeuge mit abdichtenden Decklagen |
| CN113728051A (zh) | 2019-03-15 | 2021-11-30 | 朗盛德国有限责任公司 | 高压部件 |
| WO2020187702A1 (de) | 2019-03-15 | 2020-09-24 | Lanxess Deutschland Gmbh | Hochvoltkomponenten |
| EP3792302A1 (de) | 2019-09-10 | 2021-03-17 | LANXESS Deutschland GmbH | Hochvoltkomponenten |
| EP3792303A1 (de) | 2019-09-10 | 2021-03-17 | LANXESS Deutschland GmbH | Hochvoltkomponenten |
| EP3868553A1 (de) | 2020-02-18 | 2021-08-25 | LANXESS Deutschland GmbH | Mehrschichtverbundwerkstoff |
| EP3868817A1 (de) | 2020-02-19 | 2021-08-25 | LANXESS Deutschland GmbH | Hochvoltkomponenten |
| EP3868818B1 (de) | 2020-02-19 | 2025-02-19 | Envalior Deutschland GmbH | Hochvoltkomponenten |
| EP3957680A1 (en) * | 2020-08-17 | 2022-02-23 | SHPP Global Technologies B.V. | Compositions and articles of wave transmission and improved dimensional stability, radar cover material |
| CN117083331A (zh) | 2021-03-26 | 2023-11-17 | 朗盛德国有限责任公司 | 聚酰胺组合物 |
| JP2024511491A (ja) | 2021-03-26 | 2024-03-13 | ランクセス・ドイチュランド・ゲーエムベーハー | ポリアミド組成物 |
| EP4074718A1 (de) | 2021-04-15 | 2022-10-19 | LANXESS Deutschland GmbH | Stabilisatoren für polymere |
| EP4105270A1 (de) | 2021-06-15 | 2022-12-21 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP4177311A1 (de) | 2021-11-04 | 2023-05-10 | LANXESS Performance Materials GmbH | Verwendung von polyamid 6 |
| US20250304767A1 (en) | 2022-05-12 | 2025-10-02 | Envalior Deutschland Gmbh | Creep-resistant polyester compositions |
| US20250257211A1 (en) | 2022-09-28 | 2025-08-14 | Covestro Deutschland Ag | Polycarbonate composition |
| EP4357418A1 (en) | 2022-10-18 | 2024-04-24 | Covestro Deutschland AG | Polycarbonate composition |
| WO2024200029A1 (en) | 2023-03-24 | 2024-10-03 | Covestro Deutschland Ag | Polycarbonate composition |
| WO2025003257A1 (en) | 2023-06-30 | 2025-01-02 | Covestro Deutschland Ag | Polycarbonate composition |
Family Cites Families (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA879151A (en) * | 1971-08-24 | Celanese Corporation | Polyalkylene terephthalate molding resin | |
| US3005795A (en) * | 1957-12-10 | 1961-10-24 | Du Pont | Thermoplastic resins containing finely divided, fibrous polytetrafluoroethylene |
| NL270833A (cg-RX-API-DMAC10.html) * | 1960-10-31 | |||
| BE634942A (cg-RX-API-DMAC10.html) * | 1962-07-27 | 1900-01-01 | ||
| NL148074B (nl) * | 1964-09-25 | 1975-12-15 | Gen Electric | Werkwijze voor het oxydatief koppelen van dihalogeenfenolen. |
| US3329740A (en) * | 1965-07-06 | 1967-07-04 | United Shoe Machinery Corp | Thermoplastic adhesive prepared from crystallizable polyester resins and amorphous phenoxy resin |
| NL6513222A (cg-RX-API-DMAC10.html) * | 1965-10-13 | 1965-12-27 | ||
| US3435093A (en) * | 1965-12-17 | 1969-03-25 | Du Pont | Polymer blends of polyethylene terephthalate and alpha-olefin,alpha,beta-unsaturated carboxylic acid copolymers |
| DE1694168A1 (de) * | 1967-07-18 | 1971-06-09 | Hoechst Ag | Thermoplastische Polyesterformmassen |
| DE1694173A1 (de) * | 1967-07-22 | 1971-06-09 | Hoechst Ag | Thermoplastische Polyesterformmassen |
| GB1241168A (en) * | 1967-08-29 | 1971-07-28 | Ici Ltd | Polyethylene terephthalate moulding compositions |
| DE1694200A1 (de) * | 1967-10-10 | 1971-10-21 | Hoechst Ag | Thermoplastische Formmassen |
| DE1694204A1 (de) * | 1967-10-11 | 1971-04-08 | Hoechst Ag | Thermoplastische Formmassen aus Polyestern |
| US3546320A (en) * | 1968-03-25 | 1970-12-08 | Sun Oil Co | Polyalkylene terephthalate molding composition |
| US3639331A (en) * | 1968-03-25 | 1972-02-01 | Dart Ind Inc | Glass fiber reinforced resins containing dispersion aid |
| DE1769231A1 (de) * | 1968-04-24 | 1972-03-02 | Hoechst Ag | Thermoplastische Formmassen aus Polyestern und Polyamiden |
| US3516957A (en) * | 1968-04-29 | 1970-06-23 | Eastman Kodak Co | Thermoplastic polyester composition containing organic ester mold release agent |
| US3579609A (en) * | 1968-09-23 | 1971-05-18 | Minnesota Mining & Mfg | Flex-resistant polyester film containing olefin or polytetramethylene oxide additive polymer |
| GB1285747A (en) * | 1968-12-17 | 1972-08-16 | Asahi Chemical Ind | Glass fibre-reinforced polystyrene compositions and their manufacture |
| US3644574A (en) * | 1969-07-17 | 1972-02-22 | Eastman Kodak Co | Shaped articles of blends of polyesters and polyvinyls |
| BE755317A (fr) * | 1969-08-29 | 1971-02-26 | Celanese Corp | Resine de moulage et son procede de production |
| BE756520A (fr) * | 1969-09-25 | 1971-03-23 | Ici Ltd | Melanges de polymeres thermoplastiques |
| US3644267A (en) * | 1970-01-28 | 1972-02-22 | Eastman Kodak Co | Low-viscosity high-strength thermoplastic adhesive |
| US3624024A (en) * | 1970-02-24 | 1971-11-30 | Eastman Kodak Co | Flame retardant poly(tetramethylene terephthalate) molding compositions |
| US3673139A (en) * | 1970-04-06 | 1972-06-27 | Sandoz Ltd | Process for the production of injection moulded and extrusion moulded polyester products |
| US3671487A (en) * | 1971-05-05 | 1972-06-20 | Gen Electric | Glass reinforced polyester resins containing polytetrafluoroethylene and flame retardant additives |
| JPS4825053A (cg-RX-API-DMAC10.html) * | 1971-08-04 | 1973-04-02 | ||
| US3953394A (en) * | 1971-11-15 | 1976-04-27 | General Electric Company | Polyester alloys and molding compositions containing the same |
| US4046837A (en) * | 1972-09-25 | 1977-09-06 | Eastman Kodak Company | Polyester-polyolefin blend film or coating composition |
-
1971
- 1971-10-01 US US05/185,886 patent/US4013613A/en not_active Expired - Lifetime
-
1972
- 1972-10-02 JP JP47098876A patent/JPS5755739B2/ja not_active Expired
- 1972-10-02 FR FR7234903A patent/FR2154800B1/fr not_active Expired
- 1972-10-02 GB GB4526272A patent/GB1409275A/en not_active Expired
- 1972-10-02 NL NLAANVRAGE7213315,A patent/NL174263C/xx not_active IP Right Cessation
- 1972-10-02 IT IT29997/72A patent/IT968548B/it active
- 1972-10-02 DE DE19722248242 patent/DE2248242A1/de not_active Withdrawn
-
1976
- 1976-08-25 US US05/717,533 patent/US4097446A/en not_active Expired - Lifetime
Cited By (186)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4117034A (en) | 1975-08-11 | 1978-09-26 | Borg-Warner Corporation | Amorphous polyester graft polymer alloys |
| US4332855A (en) | 1978-04-14 | 1982-06-01 | Raychem Corporation | Polymeric compositions |
| EP0693495A1 (de) | 1994-07-22 | 1996-01-24 | Bayer Ag | Mehrkernige Phosphorsäureester |
| EP0704488A2 (de) | 1994-09-30 | 1996-04-03 | Bayer Ag | Polycarbonat-Formmassen mit verbesserter Zähigkeit |
| WO2001092179A1 (de) | 2000-05-26 | 2001-12-06 | Sunyx Surface Nanotechnologies Gmbh | Substrat mit gering lichtstreuender, ultraphober oberfläche und verfahren zu seiner herstellung |
| DE102007006493A1 (de) | 2007-02-09 | 2008-08-14 | Lanxess Deutschland Gmbh | Leichtbauteil in Hybridbauweise |
| DE102007016786A1 (de) | 2007-04-05 | 2008-10-09 | Bayer Materialscience Ag | Polycarbonat-Formmassen |
| US8288456B2 (en) | 2007-08-30 | 2012-10-16 | Bayer Materialscience Ag | Process for the production of impact-modified filled polycarbonate compositions |
| DE102007040927A1 (de) | 2007-08-30 | 2009-03-05 | Bayer Materialscience Ag | Verfahren zur Herstellung schlagzähmodifizierter gefüllter Polycarbonat-Zusammensetzungen |
| DE102007061761A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007061760A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polyalkylenterephthalat/Polycarbonat-Zusammensetzungen |
| DE102008016260A1 (de) | 2008-03-29 | 2009-10-01 | Bayer Materialscience Ag | Schlagzähmodifizierte Polyalkylenterephthalat/Polycarbonat-Zusammensetzungen |
| DE102008024672A1 (de) | 2008-05-21 | 2009-11-26 | Bayer Materialscience Ag | Tieftemperaturzähe Polycarbonat-Blends |
| DE102008032205A1 (de) | 2008-07-09 | 2010-01-14 | Lanxess Deutschland Gmbh | Fließverbesserte Thermoplasten |
| DE102008048204A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend Talk |
| DE102008048202A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend plättchen- oder schuppförmigen anorganischen Füllstoff ausgenommen Talk |
| DE102008048201A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend isotropen Füllstoff |
| DE202008015397U1 (de) | 2008-11-19 | 2010-04-22 | Lanxess Deutschland Gmbh | Säulenstruktur |
| DE102008058224A1 (de) | 2008-11-19 | 2010-05-20 | Lanxess Deutschland Gmbh | Leichtbauteil in Hybridbauweise |
| DE202008015401U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Sitzstrukturen |
| DE202008015400U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Instrumententafel |
| DE202008015392U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Pedalstruktur |
| DE202008015394U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Längsträgerstruktur |
| DE202008015395U1 (de) | 2008-11-19 | 2010-04-22 | Lanxess Deutschland Gmbh | Vorderwagenstruktur |
| US8080296B2 (en) | 2008-11-19 | 2011-12-20 | Lanxess Deutschland Gmbh | Lightweight component of hybrid design |
| DE202008015391U1 (de) | 2008-11-19 | 2010-04-22 | Lanxess Deutschland Gmbh | Türen- und Klappenstrukturen |
| DE202008015396U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Fahrwerkstruktur |
| DE102008058225A1 (de) | 2008-11-19 | 2010-07-08 | Lanxess Deutschland Gmbh | Leichtbauteil in Hybridbauweise |
| US8383242B2 (en) | 2008-11-19 | 2013-02-26 | Lanxess Deutschland Gmbh | Lightweight component of hybrid |
| DE202008015399U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Dachstruktur |
| DE202008015398U1 (de) | 2008-11-19 | 2010-04-08 | Lanxess Deutschland Gmbh | Ölwanne |
| US8178603B2 (en) | 2008-12-23 | 2012-05-15 | Bayer Materialscience Ag | Flameproofed impact-modified polycarbonate compositions |
| DE102009005762A1 (de) | 2008-12-23 | 2010-06-24 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102009009680A1 (de) | 2009-02-19 | 2010-08-26 | Bayer Materialscience Ag | Compoundierungsverfahren zur Herstellung von Polymer-Zusammensetzungen mit reduziertem Gehalt an flüchtigen organischen Verbindungen |
| WO2010094416A1 (de) | 2009-02-19 | 2010-08-26 | Bayer Materialscience Ag | Compoundierungsverfahren zur herstellung von polymer-zusammensetzungen mit reduziertem gehalt an flüchtigen organischen verbindungen |
| US8680201B2 (en) | 2009-02-19 | 2014-03-25 | Bayer Materialscience Ag | Compounding method for producing polymer compositions with a reduced content of volatile organic compounds |
| DE102009015039A1 (de) | 2009-03-26 | 2010-09-30 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen zur Herstellung metallisierter Formkörper mit homogenem Oberflächenglanz |
| US8703869B2 (en) | 2009-03-26 | 2014-04-22 | Bayer Materialscience Ag | Impact-modified polycarbonate compositions for the production of metallised mouldings with homogeneous surface gloss |
| WO2010108617A1 (de) | 2009-03-26 | 2010-09-30 | Bayer Materialscience Ag | Schlagzähmodifizierte polycarbonat-zusammensetzungen zur herstellung metallisierter formkörper mit homogenem oberflächenglanz |
| EP2233519A1 (de) | 2009-03-27 | 2010-09-29 | LANXESS Deutschland GmbH | Glühdrahtbeständige Polyester |
| DE102009020090A1 (de) | 2009-05-06 | 2010-11-11 | Lanxess Deutschland Gmbh | Reduktion des Einflusses der Wasseraufnahme auf die elektrische Leitfähigkeit von elektrisch leitfähigen Polyamid-Formmassen |
| DE202010001918U1 (de) | 2009-07-25 | 2011-06-27 | LANXESS Deutschland GmbH, 51373 | Organoblechstrukturbauteil |
| DE102009034767A1 (de) | 2009-07-25 | 2011-01-27 | Lanxess Deutschland Gmbh & Co. Kg | Organoblechstrukturbauteil |
| WO2011015286A1 (de) | 2009-08-01 | 2011-02-10 | Bayer Materialscience Ag | Verbesserte haftung zwischen thermoplasten und polyurethan |
| WO2011070043A1 (de) | 2009-12-08 | 2011-06-16 | Bayer Materialscience Ag | Verfahren zur herstellung von polyurethan-verbundbauteilen sowie diese verbundbauteile |
| WO2011070044A1 (de) | 2009-12-08 | 2011-06-16 | Bayer Materialscience Ag | Verbundbauteile mit verbesserter haftung aus polycarbonat- / polyesterzusammensetzungen und polyurethan |
| US8852744B2 (en) | 2009-12-08 | 2014-10-07 | Bayer Materialscience Ag | Composite components with improved adhesion of polycarbonate/polyester compositions and polyurethane |
| DE102009058180A1 (de) | 2009-12-15 | 2011-06-16 | Bayer Materialscience Ag | Verfahren zur Herstellung von Polyurethan-Verbundbauteilen |
| DE102009058182A1 (de) | 2009-12-15 | 2011-06-30 | Bayer MaterialScience AG, 51373 | Verbundbauteile mit verbesserter Haftung aus Polycarbonat- / Polyesterzusammensetzungen und Polyurethan |
| WO2011073291A1 (en) | 2009-12-18 | 2011-06-23 | Bayer Materialscience Ag | Flameproofed, impact-modified, scratch-resistant polycarbonate moulding compositions with good mechanical properties |
| WO2011073290A1 (en) | 2009-12-18 | 2011-06-23 | Bayer Materialscience Ag | Scratch-resistant, impact-resistant polycarbonate moulding compositions having good mechanical properties ii |
| WO2011073289A1 (en) | 2009-12-18 | 2011-06-23 | Bayer Materialscience Ag | Scratch-resistant, impact-resistant polycarbonate moulding compositions with good mechanical properties i |
| EP2360206A1 (de) | 2010-02-13 | 2011-08-24 | Bayer MaterialScience AG | Verwendung von Mischungen zur Herstellung schlagzähmodifizierter thermoplastischer Zusammensetzungen |
| WO2011098490A1 (de) | 2010-02-13 | 2011-08-18 | Bayer Materialscience Ag | Verwendung von mischungen zur herstellung schlagzähmodifizierter thermoplastischer zusammensetzungen |
| EP2365030A1 (de) | 2010-03-10 | 2011-09-14 | LANXESS Deutschland GmbH | -N=C=N- enthaltende Verbindungen zur Verhinderung des thermischen Abbaus von Metall-dialkylphosphinat enthaltenden Polyalkylenterephthalaten in der Schmelze |
| EP2365028A1 (de) | 2010-03-10 | 2011-09-14 | LANXESS Deutschland GmbH | -N=C=N- enthaltende Verbindungen zur Verhinderung des thermischen Abbaus von Metall-dialkylphosphinat enthaltenden Polyalkylenterephthalaten in der Schmelze |
| DE102010013991A1 (de) | 2010-04-07 | 2011-10-13 | Bayer Materialscience Ag | Flammgeschützte Polycarbonat-Zusammensetzungen |
| WO2011124540A1 (de) | 2010-04-07 | 2011-10-13 | Bayer Materialscience Ag | Flammgeschützte polycarbonat-zusammensetzungen |
| WO2012007501A1 (de) | 2010-07-14 | 2012-01-19 | Bayer Materialscience Ag | Vorrichtung und verfahren zur herstellung von produkten aus pigmenthaltigen polymermischungen |
| WO2012025481A1 (de) | 2010-08-24 | 2012-03-01 | Bayer Materialscience Ag | SCHLAGZÄHMODIFIZIERTE POLYESTER/POLYCARBONAT-ZUSAMMENSETZUNGEN MIT VERBESSERTER REIßDEHNUNG |
| DE102010039712A1 (de) | 2010-08-24 | 2012-03-01 | Bayer Materialscience Aktiengesellschaft | Schlagzähmodifizierte Polyester/Polycarbonat-Zusammensetzungen mit verbesserter Reißdehnung |
| WO2012055873A2 (de) | 2010-10-26 | 2012-05-03 | Bayer Materialscience Ag | Fugenlose heckklappe |
| DE102010042939A1 (de) | 2010-10-26 | 2012-04-26 | Bayer Materialscience Aktiengesellschaft | Fugenlose Heckklappe |
| DE102010053483A1 (de) | 2010-12-04 | 2012-06-06 | Lanxess Deutschland Gmbh | =N=C=N- enthaltende Verbindung zur Verhinderung des thermischen Abbaus in Schmelzen |
| EP2463338A1 (de) | 2010-12-13 | 2012-06-13 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| US9834657B2 (en) | 2010-12-13 | 2017-12-05 | Lanxess Deutschland, Gmbh | Polyester compositions |
| WO2012079904A1 (de) | 2010-12-13 | 2012-06-21 | Lanxess Deutschland Gmbh | Polyester zusammensetzungen |
| WO2012080361A1 (de) | 2010-12-14 | 2012-06-21 | Lanxess Deutschland Gmbh | Polyester zusammensetzungen |
| EP2465896A1 (de) | 2010-12-14 | 2012-06-20 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| WO2012084848A1 (de) | 2010-12-23 | 2012-06-28 | Bayer Materialscience Ag | Antistatische polycarbonat-formmassen |
| DE202010017765U1 (de) | 2010-12-23 | 2012-07-11 | Lanxess Deutschland Gmbh | Mit gemahlenem Glas gefüllte Zusammensetzungen |
| EP2468809A1 (de) | 2010-12-23 | 2012-06-27 | LANXESS Deutschland GmbH | Zusammensetzungen |
| EP2468810A1 (de) | 2010-12-23 | 2012-06-27 | Lanxess Deutschland GmbH | Mit gemahlenem Glas gefüllte flammwidrige Polyamidzusammensetzungen |
| WO2012084865A1 (de) | 2010-12-23 | 2012-06-28 | Bayer Materialscience Ag | Verfahren zur verbesserung der russdispergierung |
| WO2013060687A1 (de) | 2011-10-26 | 2013-05-02 | Bayer Intellectual Property Gmbh | Stabilisierte polycarbonatzusammensetzungen mit abmischungen aus kieselsäure und einer anorganischen säure |
| WO2013060685A1 (de) | 2011-10-26 | 2013-05-02 | Bayer Intellectual Property Gmbh | Verfahren zur herstellung und stabilisierung von schlagzähmodifizierten polycarbonat- zusammensetzungen unter verwendung von verdünnten lösungen saurer verbindungen |
| WO2013079555A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Formkörper mit hoher oberflächengüte |
| WO2013079478A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Mehrschichtkörper aus polycarbonat mit tiefenglanzeffekt |
| WO2013124232A1 (de) | 2012-02-20 | 2013-08-29 | Bayer Intellectual Property Gmbh | Mehrschichtaufbau als reflektor |
| WO2013124017A1 (de) | 2012-02-20 | 2013-08-29 | Bayer Materialscience Ag | Mehrschichtaufbau als reflektor mit erhöhter mechanischer stabilität |
| EP2657298A1 (de) | 2012-04-27 | 2013-10-30 | Bayer MaterialScience AG | PC/ABS-Zusammensetzungen mit guter thermischer und chemischer Beständigkeit |
| WO2013160371A1 (de) | 2012-04-27 | 2013-10-31 | Bayer Materialscience Ag | Pc/abs-zusammensetzungen mit guter thermischer und chemischer beständigkeit |
| WO2013178563A2 (de) | 2012-06-01 | 2013-12-05 | Bayer Materialscience Ag | Mehrschichtaufbau als reflektor |
| WO2014095981A1 (de) | 2012-12-20 | 2014-06-26 | Bayer Materialscience Ag | Mehrschichtkörper aus polycarbonat mit hoher bewitterungsstabilität |
| US9845412B2 (en) | 2012-12-20 | 2017-12-19 | Covestro Deutschland Ag | Multi-layer body made of polycarbonate with high weathering resistance |
| EP2818297A1 (de) | 2013-06-25 | 2014-12-31 | LANXESS Deutschland GmbH | Spritzgießverfahren |
| WO2015052114A1 (de) | 2013-10-08 | 2015-04-16 | Bayer Materialscience Ag | Faserverbundwerkstoff, verwendung dafür und verfahren zu dessen herstellung |
| WO2015055719A1 (de) | 2013-10-18 | 2015-04-23 | Bayer Materialscience Ag | Polycarbonatzusammensetzungen mit verbesserter haftung zu polyurethanschichten |
| EP2878628A1 (de) | 2013-11-27 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2878625A1 (de) | 2013-11-27 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2878629A1 (de) | 2013-11-27 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2878626A1 (de) | 2013-11-27 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2878630A1 (de) | 2013-11-28 | 2015-06-03 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP2878631A1 (de) | 2013-11-28 | 2015-06-03 | LANXESS Deutschland GmbH | Polyamid Zusammensetzungen |
| EP2878619A1 (de) | 2013-12-02 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2878620A1 (de) | 2013-12-02 | 2015-06-03 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| DE102014000612A1 (de) | 2014-01-18 | 2015-07-23 | Lanxess Deutschland Gmbh | Polyester Zusammensetzungen |
| DE102014000613A1 (de) | 2014-01-18 | 2015-07-23 | Lanxess Deutschland Gmbh | Polyester Zusammensetzungen |
| EP2915841A1 (de) | 2014-03-04 | 2015-09-09 | LANXESS Deutschland GmbH | Polyester Zusammensetzung |
| EP2924070A1 (de) | 2014-03-26 | 2015-09-30 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP2924066A1 (de) | 2014-03-26 | 2015-09-30 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP2924065A1 (de) | 2014-03-26 | 2015-09-30 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP2924069A1 (de) | 2014-03-26 | 2015-09-30 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP2924068A1 (de) | 2014-03-26 | 2015-09-30 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| US9908997B2 (en) | 2014-03-26 | 2018-03-06 | Lanxess Deutschland Gmbh | Polyamide compositions |
| EP2924067A1 (de) | 2014-03-26 | 2015-09-30 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP2924062A1 (de) | 2014-03-27 | 2015-09-30 | LANXESS Deutschland GmbH | Flammwidrige Polyamidzusammensetzungen |
| EP2942367A1 (de) | 2014-05-05 | 2015-11-11 | LANXESS Deutschland GmbH | Polyester Zusammensetzungen |
| EP2942368A1 (de) | 2014-05-05 | 2015-11-11 | LANXESS Deutschland GmbH | Polyester zusammensetzungen |
| US11207871B2 (en) | 2014-09-11 | 2021-12-28 | Covestro Ag | Bezel for motor vehicle glazing systems |
| EP3015500A1 (de) | 2014-10-31 | 2016-05-04 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| DE202014008607U1 (de) | 2014-10-31 | 2014-11-24 | Lanxess Deutschland Gmbh | Polyamidzusammensetzungen |
| EP3020753A1 (de) | 2014-11-17 | 2016-05-18 | LANXESS Deutschland GmbH | Flammgeschützte faser-matrix-halbzeuge |
| EP3020752A1 (de) | 2014-11-17 | 2016-05-18 | LANXESS Deutschland GmbH | Flammgeschützte Faser-Matrix-Halbzeuge |
| DE202014009839U1 (de) | 2014-12-11 | 2016-03-15 | Lanxess Deutschland Gmbh | Flammgeschützte Faser-Matrix-Halbzeuge |
| EP3034554A1 (de) | 2014-12-19 | 2016-06-22 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP3034553A1 (de) | 2014-12-19 | 2016-06-22 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP3067388A1 (de) | 2015-03-09 | 2016-09-14 | LANXESS Deutschland GmbH | Thermoplastische formmassen |
| EP3067387A1 (de) | 2015-03-09 | 2016-09-14 | LANXESS Deutschland GmbH | Thermoplastische formmassen |
| EP3133112A1 (de) | 2015-03-09 | 2017-02-22 | LANXESS Deutschland GmbH | Thermoplastische Formmassen |
| WO2016202399A1 (de) | 2015-06-18 | 2016-12-22 | Covestro Deutschland Ag | Flammgeschütze polycarbonat-polyester-zusammensetzungen |
| EP3133104A1 (de) | 2015-08-21 | 2017-02-22 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP3133103A1 (de) | 2015-08-21 | 2017-02-22 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP3135708A1 (de) | 2015-08-26 | 2017-03-01 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP3135707A1 (de) | 2015-08-26 | 2017-03-01 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| WO2017065762A1 (en) | 2015-10-14 | 2017-04-20 | Covestro Llc | Phosphazene modified polycarbonate molded battery cooling device |
| WO2017066596A1 (en) | 2015-10-14 | 2017-04-20 | Covestro Llc | Phosphazene modified polycarbonate molded battery cooling device |
| WO2017186663A1 (de) | 2016-04-27 | 2017-11-02 | Covestro Deutschland Ag | Antistatische thermoplastische formmassen |
| WO2017186690A1 (de) | 2016-04-27 | 2017-11-02 | Covestro Deutschland Ag | Antistatische und lichtstabile thermoplastische polycarbonat-formmassen |
| EP3239224A2 (de) | 2016-04-28 | 2017-11-01 | LANXESS Deutschland GmbH | Thermoplastische formmassen |
| EP3239228A1 (de) | 2016-04-28 | 2017-11-01 | LANXESS Deutschland GmbH | Polybutylenterephthalat zusammensetzungen |
| WO2018015557A1 (de) | 2016-07-22 | 2018-01-25 | Covestro Deutschland Ag | Kratzfeste polycarbonat-zusammensetzungen mit guter thermischer stabilität |
| WO2018060081A1 (de) | 2016-09-27 | 2018-04-05 | Covestro Deutschland Ag | Frontscheibe für kraftfahrzeug |
| WO2018122137A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Verbundbauteil |
| WO2018122141A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen mit guten mechanischen eigenschaften |
| WO2018122139A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Zusammensetzung und thermoplastische formmasse mit guter kerbschlagzähigkeit und verbesserter schmelzestabilität |
| WO2018164666A1 (en) | 2017-03-07 | 2018-09-13 | Covestro Llc | Two shot injection molding process for thermoplastic parts |
| WO2019016369A1 (de) | 2017-07-21 | 2019-01-24 | Covestro Deutschland Ag | Talkgefüllte zusammensetzung und thermoplastische formmasse |
| WO2019025483A1 (de) | 2017-08-04 | 2019-02-07 | Covestro Deutschland Ag | Polycarbonat-zusammensetzung und polycarbonat-formmasse mit verbesserter fliessfähigkeit |
| WO2019076494A1 (de) | 2017-10-16 | 2019-04-25 | Covestro Deutschland Ag | Flammwidrige polycarbonat-zusammensetzung mit geringem bisphenol-a gehalt |
| WO2019076495A1 (de) | 2017-10-16 | 2019-04-25 | Covestro Deutschland Ag | Flammwidrige, füllstoff-verstärkte polycarbonat-zusammensetzung mit geringem bisphenol-a gehalt |
| EP4431562A2 (de) | 2017-12-19 | 2024-09-18 | Covestro Deutschland AG | Thermoplastische zusammensetzungen mit guter stabilität |
| WO2019121463A1 (de) | 2017-12-19 | 2019-06-27 | Covestro Deutschland Ag | Thermoplastische zusammensetzungen mit guter stabilität |
| WO2019121272A1 (de) | 2017-12-20 | 2019-06-27 | Covestro Deutschland Ag | Polycarbonat-zusammensetzung mit guter flammwidrigkeit |
| WO2019170569A1 (de) | 2018-03-07 | 2019-09-12 | Covestro Deutschland Ag | Artikel für lebensmittelkontaktanwendungen |
| EP3546511A1 (de) | 2018-03-26 | 2019-10-02 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP3546510A1 (de) | 2018-03-26 | 2019-10-02 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| WO2019185627A1 (de) | 2018-03-28 | 2019-10-03 | Covestro Deutschland Ag | Zusammensetzung und thermoplastische formmasse zur herstellung von formkörpern mit erhöhtem glanz |
| US11485855B2 (en) | 2018-03-28 | 2022-11-01 | Covestro Intellectual Property Gmbh & Co. Kg | Composition and thermoplastic moulding compound for production of moulded articles having elevated gloss |
| WO2019197270A1 (en) | 2018-04-09 | 2019-10-17 | Covestro Deutschland Ag | Glass fiber reinforced thermoplastic compositions with good mechanical properties |
| WO2021037705A1 (en) | 2019-08-28 | 2021-03-04 | Covestro Intellectual Property Gmbh & Co. Kg | Flame-retardant polycarbonate composition and molded parts as well as articles made therefrom |
| WO2021043654A1 (de) | 2019-09-04 | 2021-03-11 | Covestro Intellectual Property Gmbh & Co. Kg | Polyphosphazen und formmasse enthaltend das polyphosphazen |
| WO2021076561A1 (en) | 2019-10-15 | 2021-04-22 | Covestro Llc | Three part headlamp assembly |
| US11732130B2 (en) | 2019-12-04 | 2023-08-22 | Covestro Intellectual Property Gmbh & Co. Kg | Flame retardant impact-modified polycarbonate composition |
| WO2021110550A1 (en) | 2019-12-04 | 2021-06-10 | Covestro Intellectual Property Gmbh & Co. Kg | Flame retardant impact-modified polycarbonate composition |
| WO2021116239A1 (en) | 2019-12-13 | 2021-06-17 | Covestro Deutschland Ag | Layered structures with cutting lines |
| WO2021138113A1 (en) | 2020-01-02 | 2021-07-08 | Covestro Llc | Chemical resistant polycarbonate blend compositions |
| WO2021233727A1 (de) | 2020-05-18 | 2021-11-25 | Covestro Deutschland Ag | Polycarbonat blend mit verringerten störgeräuschen |
| US12503528B2 (en) * | 2020-06-10 | 2025-12-23 | Röhm Gmbh | Thermoplastic moulding composition with improved weathering resistance |
| US20230212333A1 (en) * | 2020-06-10 | 2023-07-06 | Röhm Gmbh | Thermoplastic moulding composition with improved weathering resistance |
| WO2022058222A1 (de) | 2020-09-18 | 2022-03-24 | Covestro Deutschland Ag | Mehrschichtkörper für diffuse durchleuchtung |
| EP4047073A1 (de) | 2021-02-17 | 2022-08-24 | Covestro Deutschland AG | Pyrolyse von polycarbonat-haltigem material zur wiedergewinnung von rohstoffen |
| WO2022174963A1 (de) | 2021-02-17 | 2022-08-25 | Covestro Deutschland Ag | Pyrolyse von polycarbonat-haltigem material zur wiedergewinnung von rohstoffen |
| WO2022228954A1 (en) | 2021-04-26 | 2022-11-03 | Covestro Deutschland Ag | Flame retardant polycarbonate composition with high comparative tracking index |
| EP4092081A1 (en) | 2021-05-18 | 2022-11-23 | Covestro Deutschland AG | Flame retardant polycarbonate composition with high comparative tracking index |
| WO2023006614A1 (en) | 2021-07-27 | 2023-02-02 | Covestro Deutschland Ag | Hydrolysis-resistant polycarbonate composition |
| EP4177301A1 (de) | 2021-11-03 | 2023-05-10 | Covestro Deutschland AG | Polyphosphazen und formmasse enthaltend das polyphosphazen |
| WO2023110654A1 (en) | 2021-12-16 | 2023-06-22 | Covestro Deutschland Ag | Process for recovery of rubber-modified vinyl(co)polymer |
| EP4198076A1 (en) | 2021-12-16 | 2023-06-21 | Covestro Deutschland AG | Process for recovery of rubber-modified vinyl(co)polymer |
| WO2023118104A1 (de) | 2021-12-22 | 2023-06-29 | Covestro Deutschland Ag | Pyrolyse von polycarbonat-haltigem material in kombination mit phosphorhaltiger organischer verbindung zur wiedergewinnung von rohstoffen |
| EP4201987A1 (de) | 2021-12-22 | 2023-06-28 | Covestro Deutschland AG | Pyrolyse von polycarbonat-haltigem material in kombination mit phosphorhaltiger organischer verbindung zur wiedergewinnung von rohstoffen |
| WO2023174781A1 (de) | 2022-03-16 | 2023-09-21 | Covestro Deutschland Ag | Metallschicht enthaltender mehrschichtkörper für diffuse durchleuchtung |
| EP4245521A1 (de) | 2022-03-16 | 2023-09-20 | Covestro Deutschland AG | Metallschicht enthaltender mehrschichtkörper für diffuse durchleuchtung |
| EP4245529A1 (de) | 2022-03-16 | 2023-09-20 | Covestro Deutschland AG | Durchleuchtbarer mehrschichtkörper mit thermo- oder druckempfindlicher dekorationsschicht |
| WO2023174782A1 (de) | 2022-03-16 | 2023-09-21 | Covestro Deutschland Ag | Durchleuchtbarer mehrschichtkörper mit thermo- oder druckempfindlicher dekorationsschicht |
| WO2023202910A1 (de) | 2022-04-19 | 2023-10-26 | Covestro Deutschland Ag | Verfahren zur herstellung einer plastischen masse mit verbesserten eigenschaften |
| EP4311839A1 (de) | 2022-07-28 | 2024-01-31 | Covestro Deutschland AG | Mineralgefüllte polycarbonat-blend-formmasse mit niedrigem bpa-gehalt und verfahren zu ihrer herstellung |
| WO2024022964A1 (de) | 2022-07-28 | 2024-02-01 | Covestro Deutschland Ag | Mineralgefüllte polycarbonat-blend-formmasse mit niedrigem bpa-gehalt und verfahren zu ihrer herstellung |
| WO2024206154A1 (en) | 2023-03-24 | 2024-10-03 | Covestro Llc | Thermal stabilization package for polycarbonate/acrylonitrile-butadiene-styrene blends |
| WO2025073535A1 (de) | 2023-10-02 | 2025-04-10 | Covestro Deutschland Ag | Gefüllte zusammensetzung und thermoplastische formmasse zur herstellung von formkörpern mit guter oberflächenkosmetik und reduziertem gehalt an freiem bisphenol a |
| WO2025078222A1 (de) | 2023-10-12 | 2025-04-17 | Covestro Deutschland Ag | Verfahren zur herstellung einer plastiischen masse mit verbesserten eigenschaften. |
| WO2025082842A1 (de) | 2023-10-17 | 2025-04-24 | Covestro Deutschland Ag | Verfahren zur herstellung eines verbundbauteils umfassend den schritt des kontaktlosen aufbringens eines flüssigen beschichtungsmittels |
| EP4552819A1 (en) | 2023-11-10 | 2025-05-14 | Covestro LLC | Plate metal insert molding with polycarbonate and polycarbonate blends |
| WO2025132581A1 (de) | 2023-12-21 | 2025-06-26 | Covestro Deutschland Ag | Verfahren zur herstellung eines verbundbauteils umfassend einen träger mit spezifischem oh-gehalt |
| EP4600008A1 (en) | 2024-02-08 | 2025-08-13 | Covestro LLC | Sacrificial section for more sustainable plastic parts |
| WO2025242778A1 (en) | 2024-05-23 | 2025-11-27 | Covestro Deutschland Ag | Talc filled polycarbonate composition with good surface appearance and low content of free bisphenol a |
Also Published As
| Publication number | Publication date |
|---|---|
| US4097446A (en) | 1978-06-27 |
| NL174263C (nl) | 1984-05-16 |
| JPS4856742A (cg-RX-API-DMAC10.html) | 1973-08-09 |
| JPS5755739B2 (cg-RX-API-DMAC10.html) | 1982-11-26 |
| FR2154800A1 (cg-RX-API-DMAC10.html) | 1973-05-11 |
| IT968548B (it) | 1974-03-20 |
| US4013613A (en) | 1977-03-22 |
| DE2248242A1 (de) | 1973-04-12 |
| NL7213315A (cg-RX-API-DMAC10.html) | 1973-04-03 |
| AU4730972A (en) | 1974-05-02 |
| FR2154800B1 (cg-RX-API-DMAC10.html) | 1978-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1409275A (en) | Reinforced thermoplastic compositions | |
| US3624024A (en) | Flame retardant poly(tetramethylene terephthalate) molding compositions | |
| CA1052489A (en) | Glass fibre-reinforced flame-resistant thermoplastic polyester moulding compositions | |
| GB1360121A (en) | Flame retardant glass reinforced polyester resins | |
| GB1459648A (en) | Flame retardant thermoplastic polymer compositions | |
| US3736278A (en) | Nil shrink unsaturated polyester resin composition | |
| GB1403210A (en) | Thermoplastic copolyesters | |
| KR890003837A (ko) | 폴리에테르-에스테르아미드 및 영구적 대전방지 수지 조성물 | |
| BR8403731A (pt) | Composicao e mistura | |
| GB1387498A (en) | Non-dripping flame retardant glass reinforced polyester resins | |
| GB1489526A (en) | Polyalkylene terephthalate polymer moulding resins | |
| GB1536832A (en) | Thermoplastic moulding compositions | |
| GB1523226A (en) | Resin composition and a process for preparing same | |
| GB1221210A (en) | Thermoplastic moulding compositions containing polyesters | |
| GB1382363A (en) | Reinforced thermoplastic compositions | |
| US3641201A (en) | Acid resistant polyester resins | |
| GB1378463A (en) | Thermosetting moulding compositions | |
| GB1464196A (en) | Moulding materials based on polyvinyl chloride | |
| GB1100605A (en) | Improvements in or relating to polyester materials | |
| CA2120299A1 (en) | Radon barrier film forming compositions | |
| GB1485614A (en) | Flame-retardant resin compositions | |
| GB1417535A (en) | Flame retardant polyester compositions | |
| JPS54143494A (en) | Unsaturated polyester resin composition | |
| JPS57143349A (en) | Flame-retardant polyester resin composition | |
| GB1449735A (en) | Flame-retardant polyester moulding compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PE20 | Patent expired after termination of 20 years |