GB1402498A - Triazine derivatives their production and their medicinal use - Google Patents
Triazine derivatives their production and their medicinal useInfo
- Publication number
- GB1402498A GB1402498A GB4397173A GB4397173A GB1402498A GB 1402498 A GB1402498 A GB 1402498A GB 4397173 A GB4397173 A GB 4397173A GB 4397173 A GB4397173 A GB 4397173A GB 1402498 A GB1402498 A GB 1402498A
- Authority
- GB
- United Kingdom
- Prior art keywords
- amino
- group
- alkyl
- atom
- haloalkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000003918 triazines Chemical class 0.000 title abstract 2
- -1 nitro, cyano, amino Chemical group 0.000 abstract 6
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 239000004480 active ingredient Substances 0.000 abstract 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 2
- 125000001188 haloalkyl group Chemical group 0.000 abstract 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- IDQNBVFPZMCDDN-UHFFFAOYSA-N 2-Amino-4,6-dimethylpyrimidine Chemical compound CC1=CC(C)=NC(N)=N1 IDQNBVFPZMCDDN-UHFFFAOYSA-N 0.000 abstract 1
- GHCFWKFREBNSPC-UHFFFAOYSA-N 2-Amino-4-methylpyrimidine Chemical compound CC1=CC=NC(N)=N1 GHCFWKFREBNSPC-UHFFFAOYSA-N 0.000 abstract 1
- QUQAUBVKOVPUQO-UHFFFAOYSA-N 4-carbamoyl-1h-imidazole-5-carboxylic acid Chemical compound NC(=O)C=1NC=NC=1C(O)=O QUQAUBVKOVPUQO-UHFFFAOYSA-N 0.000 abstract 1
- KAHHAPNRIQLSFT-UHFFFAOYSA-N 5-methoxypyrimidin-2-amine Chemical compound COC1=CN=C(N)N=C1 KAHHAPNRIQLSFT-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 206010037075 Protozoal infections Diseases 0.000 abstract 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 125000004442 acylamino group Chemical group 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 abstract 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 230000000842 anti-protozoal effect Effects 0.000 abstract 1
- 239000003904 antiprotozoal agent Substances 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 1
- 125000001589 carboacyl group Chemical group 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- YOWAEZWWQFSEJD-UHFFFAOYSA-N quinoxalin-2-amine Chemical compound C1=CC=CC2=NC(N)=CN=C21 YOWAEZWWQFSEJD-UHFFFAOYSA-N 0.000 abstract 1
- 150000003839 salts Chemical group 0.000 abstract 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 abstract 1
- 229940124530 sulfonamide Drugs 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C275/36—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with at least one of the oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. N-aryloxyphenylureas
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
- A61P33/02—Antiprotozoals, e.g. for leishmaniasis, trichomoniasis, toxoplasmosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/58—Y being a hetero atom
- C07C275/60—Y being an oxygen atom, e.g. allophanic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/64—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups singly-bound to oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C335/18—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Tropical Medicine & Parasitology (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Fodder In General (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2246109A DE2246109A1 (de) | 1972-09-20 | 1972-09-20 | 1-(4-phenoxy-phenyl)-1,3,5-triazinderivate, ein verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1402498A true GB1402498A (en) | 1975-08-06 |
Family
ID=5856837
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4397173A Expired GB1402498A (en) | 1972-09-20 | 1973-09-19 | Triazine derivatives their production and their medicinal use |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3933814A (https=) |
| JP (2) | JPS5826347B2 (https=) |
| AT (1) | AT329574B (https=) |
| AU (1) | AU476126B2 (https=) |
| BE (1) | BE805034A (https=) |
| CA (1) | CA1020555A (https=) |
| CH (1) | CH599180A5 (https=) |
| CS (1) | CS185628B2 (https=) |
| DE (1) | DE2246109A1 (https=) |
| DK (1) | DK144943C (https=) |
| ES (1) | ES418887A1 (https=) |
| FI (1) | FI54302C (https=) |
| FR (1) | FR2199999B1 (https=) |
| GB (1) | GB1402498A (https=) |
| HU (1) | HU167216B (https=) |
| IL (1) | IL43243A (https=) |
| IT (1) | IT1037048B (https=) |
| NL (1) | NL7312864A (https=) |
| NO (1) | NO138532C (https=) |
| PL (1) | PL84194B1 (https=) |
| SE (1) | SE402103B (https=) |
| SU (1) | SU489333A3 (https=) |
| ZA (1) | ZA737408B (https=) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2413722C3 (de) * | 1974-03-21 | 1982-04-08 | Bayer Ag, 5090 Leverkusen | Neue 1-(4-Phenoxy-phenyl)-1,3,5-triazin-Derivate, ein Verfahren zu ihrer Herstellung sowie ihre Anwendung als Arzneimittel |
| DE2650014A1 (de) * | 1976-10-30 | 1978-05-03 | Bayer Ag | 1-(4-phenoxy-phenyl)-1,3,5-triazin- derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2718799A1 (de) * | 1977-04-27 | 1978-11-09 | Bayer Ag | 1-(4-phenoxy-phenyl)-1,3,5-triazin- derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel und wachstumsfoerderer |
| EP0025010B1 (de) * | 1979-07-03 | 1983-07-20 | Ciba-Geigy Ag | Thioharnstoffderivate und Isothioharnstoffderivate, Verfahren zu ihrer Herstellung, diese Verbindungen enthaltende Mittel und ihre Verwendung zur Bekämpfung von Schädlingen |
| US4328247A (en) * | 1979-09-19 | 1982-05-04 | Ciba-Geigy Corporation | Phenoxyphenylisothioureas, production thereof and use thereof in pest control, and phenoxyphenylthioureas as intermediates for the production of the phenoxyphenylisothioureas and use thereof in pest control |
| US4376646A (en) * | 1980-03-18 | 1983-03-15 | Ciba-Geigy Corporation | Herbicidal N-[4-(3'-alkoxyphenoxy)-phenyl]-N'-methylureas |
| DE3271848D1 (en) * | 1981-12-03 | 1986-07-31 | Basf Ag | 1,3,5-triazinones, process for their preparation and their use in combating undesired plant growth |
| JPS606442U (ja) * | 1983-06-24 | 1985-01-17 | アイカ工業株式会社 | 天板 |
| DE3405241A1 (de) * | 1984-02-15 | 1985-08-29 | Bayer Ag, 5090 Leverkusen | 1-/4-(benzothia- oder -oxazol-2-ylthio- oder -2-yloxy) phenyl/-1,3,5-triazin-2,4,6-(1h,3h,5h)-trione, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| JPS6178774A (ja) * | 1984-09-25 | 1986-04-22 | Sumitomo Chem Co Ltd | 6−アルキルチオ−1,3,5−トリアジン−2,4(1h,3h)−ジオン誘導体の製造法 |
| US5447957A (en) * | 1994-06-02 | 1995-09-05 | Smithkline Beecham Corp. | Anti-inflammatory compounds |
| US5883095A (en) * | 1997-08-07 | 1999-03-16 | University Of Kentucky Research Foundation | Formulations and methods to treat and prevent equine protozoal myeloencephalitis |
| SK282727B6 (sk) * | 1997-12-19 | 2002-11-06 | Slovakofarma, A. S. | 1,3-Disubstituované močoviny - inhibítory ACAT a spôsob ich prípravy |
| WO2003037346A1 (en) * | 2001-10-31 | 2003-05-08 | Cell Therapeutics, Inc. | 6-phenyl-n-phenyl-(1,3,5) -triazine-2,4-diamine derivatives and related compounds with lysophphosphatidic acid acyltransferase beta (lpaat-beta) inhibitory activity for use in the treatment of cancer |
| US7419984B2 (en) * | 2002-10-17 | 2008-09-02 | Cell Therapeutics, Inc. | Pyrimidines and uses thereof |
| US6875781B2 (en) * | 2003-04-04 | 2005-04-05 | Cell Therapeutics, Inc. | Pyridines and uses thereof |
| RU2451678C1 (ru) * | 2011-04-01 | 2012-05-27 | Государственное образовательное учреждение высшего профессионального образования Волгоградский государственный технический университет (ВолгГТУ) | Способ получения 6-(3-феноксифенилзамещенных) 2,4-диамино-симм-триазинов |
| MX2020008816A (es) | 2018-02-26 | 2020-09-28 | AlzeCure Pharma AB | Derivados de triazina para el tratamiento de enfermedades relacionadas con neurotrofinas. |
| GB201810668D0 (en) | 2018-06-28 | 2018-08-15 | Stiftelsen Alzecure | New compounds |
| GB201810669D0 (en) | 2018-06-28 | 2018-08-15 | Stiftelsen Alzecure | New compounds |
| IL315313A (en) * | 2018-08-24 | 2024-10-01 | Xeniopro GmbH | Aromatic molecules for use in the treatment of pathological conditions |
| TW202400588A (zh) * | 2022-02-28 | 2024-01-01 | 香港商維泰瑞隆(香港)生物科技有限公司 | Rip1調製劑、其製備及用途 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3669961A (en) * | 1969-05-27 | 1972-06-13 | Goodrich Co B F | Process for the preparation of hydroxybenzyl esters of cyanuric acid |
| DE1927921A1 (de) * | 1969-05-31 | 1970-12-03 | Bayer Ag | s-Triazinderivate |
-
1972
- 1972-09-20 DE DE2246109A patent/DE2246109A1/de not_active Withdrawn
-
1973
- 1973-09-12 CS CS7300006327A patent/CS185628B2/cs unknown
- 1973-09-17 US US05/397,812 patent/US3933814A/en not_active Expired - Lifetime
- 1973-09-17 IL IL7343243A patent/IL43243A/en unknown
- 1973-09-18 CA CA181,347A patent/CA1020555A/en not_active Expired
- 1973-09-18 JP JP48104600A patent/JPS5826347B2/ja not_active Expired
- 1973-09-18 CH CH1334973A patent/CH599180A5/xx not_active IP Right Cessation
- 1973-09-18 JP JP10460173A patent/JPS5738563B2/ja not_active Expired
- 1973-09-18 FI FI2901/73A patent/FI54302C/fi active
- 1973-09-18 NL NL7312864A patent/NL7312864A/xx unknown
- 1973-09-18 IT IT29090/73A patent/IT1037048B/it active
- 1973-09-18 AU AU60401/73A patent/AU476126B2/en not_active Expired
- 1973-09-18 AT AT803973A patent/AT329574B/de active
- 1973-09-19 ZA ZA737408*A patent/ZA737408B/xx unknown
- 1973-09-19 BE BE135796A patent/BE805034A/xx not_active IP Right Cessation
- 1973-09-19 ES ES418887A patent/ES418887A1/es not_active Expired
- 1973-09-19 SE SE7312773A patent/SE402103B/xx unknown
- 1973-09-19 GB GB4397173A patent/GB1402498A/en not_active Expired
- 1973-09-19 DK DK512373A patent/DK144943C/da not_active IP Right Cessation
- 1973-09-19 PL PL1973165307A patent/PL84194B1/pl unknown
- 1973-09-19 SU SU1961676A patent/SU489333A3/ru active
- 1973-09-19 NO NO733665A patent/NO138532C/no unknown
- 1973-09-20 FR FR7333793A patent/FR2199999B1/fr not_active Expired
- 1973-09-20 HU HUBA2980A patent/HU167216B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ATA803973A (de) | 1975-08-15 |
| AU476126B2 (en) | 1976-09-09 |
| IL43243A (en) | 1976-11-30 |
| JPS5826347B2 (ja) | 1983-06-02 |
| IT1037048B (it) | 1979-11-10 |
| IL43243A0 (en) | 1973-11-28 |
| HU167216B (https=) | 1975-09-27 |
| DE2246109A1 (de) | 1974-03-28 |
| AU6040173A (en) | 1975-03-20 |
| FR2199999A1 (https=) | 1974-04-19 |
| CH599180A5 (https=) | 1978-05-12 |
| AT329574B (de) | 1976-05-25 |
| SU489333A3 (ru) | 1975-10-25 |
| FR2199999B1 (https=) | 1977-09-09 |
| NO138532B (no) | 1978-06-12 |
| JPS4969689A (https=) | 1974-07-05 |
| SE402103B (sv) | 1978-06-19 |
| FI54302B (fi) | 1978-07-31 |
| ES418887A1 (es) | 1976-03-01 |
| DK144943C (da) | 1982-11-29 |
| CA1020555A (en) | 1977-11-08 |
| CS185628B2 (en) | 1978-10-31 |
| ZA737408B (en) | 1974-08-28 |
| NO138532C (no) | 1978-09-20 |
| PL84194B1 (https=) | 1976-03-31 |
| JPS4969814A (https=) | 1974-07-05 |
| FI54302C (fi) | 1978-11-10 |
| DK144943B (da) | 1982-07-12 |
| JPS5738563B2 (https=) | 1982-08-16 |
| US3933814A (en) | 1976-01-20 |
| NL7312864A (https=) | 1974-03-22 |
| BE805034A (fr) | 1974-03-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1402498A (en) | Triazine derivatives their production and their medicinal use | |
| GB1309835A (en) | Trialkoxy-quinazolines | |
| GB1355718A (en) | 2-amino-5-chloro-thiazole derivatives | |
| GB1450801A (en) | Pyridinecarboxamide sulphonylurea hypoglycemic agents | |
| GB1384894A (en) | Anthelmintic methods and compositions | |
| ES8306752A1 (es) | Un procedimiento para la preparacion de nuevos derivados de benzamina. | |
| GB1051388A (https=) | ||
| GB1423266A (en) | 2-substituted thio-s-triazolo-1,5-a pyrimidines | |
| GB1203430A (en) | Heterocyclic spiro compounds | |
| GB1433916A (en) | Thiophosphoric acid amides as nematocides insecticides and acaricides | |
| GB1255751A (en) | Herbicidal agents | |
| GB1367305A (en) | Benzodiazocine derivatives | |
| GB1292417A (en) | 4-amino-2-(5-nitro-2-thienyl) quinazolines, their preparation, and compositions containing them | |
| GB1180249A (en) | Quinoxaline Compounds, their preparation and Compositions containing them | |
| GB1367597A (en) | Pyrrolidine derivative | |
| GB1227936A (https=) | ||
| GB1221407A (en) | 0,2,3,4-tetrahydro-7-substituted-6-sulfamyl-4-quinazolinones, process for preparing the same and pharmaceutical compositions comprising the same | |
| GB1437753A (en) | Acylaminophenyl-acetamidine compounds their production and their medicinal use | |
| IE41222L (en) | Uracil derivatives | |
| GB1135947A (en) | Novel biologically active derivatives of phenanthridone | |
| GB1249396A (en) | 7-halo-6-sulfamyl-2-spiro or dialkyl-4-quinazolinones | |
| GB1434099A (en) | 1,3-diazocine derivatives | |
| GB1426603A (en) | Amidine derivatives | |
| GB1199857A (en) | o-Substituted 2-Phenylimino-1-Azacycloheptanes and their production | |
| GB1212459A (en) | Naphthacene derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |