FI87776C - Foerfarande foer framstaellning av terapeutiskt aktiva substituerade benzamider - Google Patents
Foerfarande foer framstaellning av terapeutiskt aktiva substituerade benzamider Download PDFInfo
- Publication number
- FI87776C FI87776C FI871828A FI871828A FI87776C FI 87776 C FI87776 C FI 87776C FI 871828 A FI871828 A FI 871828A FI 871828 A FI871828 A FI 871828A FI 87776 C FI87776 C FI 87776C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- amino
- compound
- formula
- hydrogen
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 71
- 238000000034 method Methods 0.000 title claims description 41
- 230000008569 process Effects 0.000 title claims description 19
- 150000003936 benzamides Chemical class 0.000 title claims description 10
- 229940054066 benzamide antipsychotics Drugs 0.000 title claims 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 205
- 150000001875 compounds Chemical class 0.000 claims description 195
- -1 1,2-benzisoxazolyl Chemical group 0.000 claims description 106
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 42
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 38
- 239000002253 acid Substances 0.000 claims description 35
- 239000001257 hydrogen Substances 0.000 claims description 33
- 229910052739 hydrogen Inorganic materials 0.000 claims description 33
- 150000003839 salts Chemical class 0.000 claims description 33
- 229910052736 halogen Inorganic materials 0.000 claims description 25
- 150000002367 halogens Chemical class 0.000 claims description 25
- 150000002431 hydrogen Chemical group 0.000 claims description 21
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 20
- 150000001204 N-oxides Chemical class 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 17
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 13
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 claims description 9
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- BZORFPDSXLZWJF-UHFFFAOYSA-N N,N-dimethyl-1,4-phenylenediamine Chemical group CN(C)C1=CC=C(N)C=C1 BZORFPDSXLZWJF-UHFFFAOYSA-N 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 150000001721 carbon Chemical group 0.000 claims description 7
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 7
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000004803 chlorobenzyl group Chemical group 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 5
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 125000004175 fluorobenzyl group Chemical group 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 3
- IRFRTRMQNPJOAG-UHFFFAOYSA-N 4-amino-n-[(4-benzylmorpholin-2-yl)methyl]-2-butoxy-5-chlorobenzamide Chemical group CCCCOC1=CC(N)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C=CC=CC=2)C1 IRFRTRMQNPJOAG-UHFFFAOYSA-N 0.000 claims description 3
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 3
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 3
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 2
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000006012 2-chloroethoxy group Chemical group 0.000 claims description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Chemical group 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 2
- 125000002946 cyanobenzyl group Chemical group 0.000 claims description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000005921 isopentoxy group Chemical group 0.000 claims description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 2
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 claims description 2
- 125000005544 phthalimido group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000006493 trifluoromethyl benzyl group Chemical group 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 claims 1
- 239000000243 solution Substances 0.000 description 115
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 84
- 239000000203 mixture Substances 0.000 description 74
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 71
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 70
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 68
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 65
- 239000002904 solvent Substances 0.000 description 60
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 57
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 51
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 48
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 45
- 239000011541 reaction mixture Substances 0.000 description 45
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 42
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 39
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- 239000003921 oil Substances 0.000 description 35
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 34
- 235000019341 magnesium sulphate Nutrition 0.000 description 34
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 33
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- 229920006395 saturated elastomer Polymers 0.000 description 33
- 239000011780 sodium chloride Substances 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 31
- 239000012044 organic layer Substances 0.000 description 27
- 230000000694 effects Effects 0.000 description 23
- 239000002244 precipitate Substances 0.000 description 23
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 22
- 239000012458 free base Substances 0.000 description 22
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 19
- 239000007858 starting material Substances 0.000 description 19
- 238000003756 stirring Methods 0.000 description 19
- RKQQPHIGNSVEOH-UHFFFAOYSA-N 4-amino-5-chloro-2-hexoxybenzoic acid Chemical compound CCCCCCOC1=CC(N)=C(Cl)C=C1C(O)=O RKQQPHIGNSVEOH-UHFFFAOYSA-N 0.000 description 17
- 239000000706 filtrate Substances 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 15
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 239000002585 base Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 210000003169 central nervous system Anatomy 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- 238000011282 treatment Methods 0.000 description 8
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 7
- 125000002947 alkylene group Chemical group 0.000 description 7
- 238000007796 conventional method Methods 0.000 description 7
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 230000035484 reaction time Effects 0.000 description 7
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 6
- RVEATKYEARPWRE-UHFFFAOYSA-N 4-amino-5-chloro-2-methoxybenzoic acid Chemical compound COC1=CC(N)=C(Cl)C=C1C(O)=O RVEATKYEARPWRE-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 150000008065 acid anhydrides Chemical class 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 6
- 239000003638 chemical reducing agent Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 230000002496 gastric effect Effects 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- CKZVBXBEDDAEFE-UHFFFAOYSA-N (4-benzylmorpholin-2-yl)methanamine Chemical compound C1COC(CN)CN1CC1=CC=CC=C1 CKZVBXBEDDAEFE-UHFFFAOYSA-N 0.000 description 5
- YPELFRMCRYSPKZ-UHFFFAOYSA-N 4-amino-5-chloro-2-ethoxy-N-({4-[(4-fluorophenyl)methyl]morpholin-2-yl}methyl)benzamide Chemical compound CCOC1=CC(N)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C=CC(F)=CC=2)C1 YPELFRMCRYSPKZ-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- JHSPPBBJOLKJDH-UHFFFAOYSA-N [4-[(4-fluorophenyl)methyl]morpholin-2-yl]methanamine Chemical compound C1COC(CN)CN1CC1=CC=C(F)C=C1 JHSPPBBJOLKJDH-UHFFFAOYSA-N 0.000 description 5
- 230000030136 gastric emptying Effects 0.000 description 5
- 230000005176 gastrointestinal motility Effects 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000008194 pharmaceutical composition Substances 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 229960000581 salicylamide Drugs 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 4
- XWGYOMHQGQZRLC-UHFFFAOYSA-N 4-amino-5-chloro-2-ethoxybenzoic acid Chemical compound CCOC1=CC(N)=C(Cl)C=C1C(O)=O XWGYOMHQGQZRLC-UHFFFAOYSA-N 0.000 description 4
- GVWRZZNYCOTWNN-UHFFFAOYSA-N 4-benzyl-2-(chloromethyl)morpholine Chemical compound C1COC(CCl)CN1CC1=CC=CC=C1 GVWRZZNYCOTWNN-UHFFFAOYSA-N 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 239000012320 chlorinating reagent Substances 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 150000008282 halocarbons Chemical class 0.000 description 4
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 4
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 230000002123 temporal effect Effects 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 238000005303 weighing Methods 0.000 description 4
- ZWNMRNMIZKFLBZ-UHFFFAOYSA-N 2-(4-benzylmorpholin-2-yl)ethanamine Chemical compound C1COC(CCN)CN1CC1=CC=CC=C1 ZWNMRNMIZKFLBZ-UHFFFAOYSA-N 0.000 description 3
- LRZSAGKIMYFLHY-UHFFFAOYSA-N 2-hydroxypropane-1,2,3-tricarboxylic acid;dihydrate Chemical compound O.O.OC(=O)CC(O)(C(O)=O)CC(O)=O LRZSAGKIMYFLHY-UHFFFAOYSA-N 0.000 description 3
- ODYRBQWYNNOGQN-UHFFFAOYSA-N 4-[[2-(aminomethyl)morpholin-4-yl]methyl]benzonitrile Chemical compound C1COC(CN)CN1CC1=CC=C(C#N)C=C1 ODYRBQWYNNOGQN-UHFFFAOYSA-N 0.000 description 3
- JCHJDTYDCITBBN-UHFFFAOYSA-N 4-acetamido-2-acetyloxy-5-chlorobenzoic acid Chemical compound CC(=O)NC1=CC(OC(C)=O)=C(C(O)=O)C=C1Cl JCHJDTYDCITBBN-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 241000416162 Astragalus gummifer Species 0.000 description 3
- YASYEJJMZJALEJ-UHFFFAOYSA-N Citric acid monohydrate Chemical compound O.OC(=O)CC(O)(C(O)=O)CC(O)=O YASYEJJMZJALEJ-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229920001615 Tragacanth Polymers 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000007059 acute toxicity Effects 0.000 description 3
- 231100000403 acute toxicity Toxicity 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 3
- 229960004106 citric acid Drugs 0.000 description 3
- 229960002303 citric acid monohydrate Drugs 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 239000003623 enhancer Substances 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 229960004503 metoclopramide Drugs 0.000 description 3
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 description 3
- IYDYAXXGLUZOJN-UHFFFAOYSA-N n-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]acetamide Chemical compound C1COC(CNC(=O)C)CN1CC1=CC=C(F)C=C1 IYDYAXXGLUZOJN-UHFFFAOYSA-N 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 3
- 238000011321 prophylaxis Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 210000002784 stomach Anatomy 0.000 description 3
- 239000000196 tragacanth Substances 0.000 description 3
- 235000010487 tragacanth Nutrition 0.000 description 3
- 229940116362 tragacanth Drugs 0.000 description 3
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 2
- XUZFLQOWHVNBQZ-UHFFFAOYSA-N (4-benzyl-1,4-oxazepan-2-yl)methanamine Chemical compound C1CCOC(CN)CN1CC1=CC=CC=C1 XUZFLQOWHVNBQZ-UHFFFAOYSA-N 0.000 description 2
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 2
- XNTCJVGYFWBECT-UHFFFAOYSA-N 1-[(2-chlorophenyl)methylamino]propan-2-ol Chemical compound CC(O)CNCC1=CC=CC=C1Cl XNTCJVGYFWBECT-UHFFFAOYSA-N 0.000 description 2
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 2
- ANOOTOPTCJRUPK-UHFFFAOYSA-N 1-iodohexane Chemical compound CCCCCCI ANOOTOPTCJRUPK-UHFFFAOYSA-N 0.000 description 2
- YVENDIOSKPJMLX-UHFFFAOYSA-N 2-(4-benzylmorpholin-2-yl)ethanol Chemical compound C1COC(CCO)CN1CC1=CC=CC=C1 YVENDIOSKPJMLX-UHFFFAOYSA-N 0.000 description 2
- AVKUQDNGOBWLKN-UHFFFAOYSA-N 2-(4-benzylmorpholin-2-yl)ethyl acetate Chemical compound C1COC(CCOC(=O)C)CN1CC1=CC=CC=C1 AVKUQDNGOBWLKN-UHFFFAOYSA-N 0.000 description 2
- YAQSVEHQDFSDCR-UHFFFAOYSA-N 2-[(4-benzylmorpholin-2-yl)methyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CC(OCC1)CN1CC1=CC=CC=C1 YAQSVEHQDFSDCR-UHFFFAOYSA-N 0.000 description 2
- UFUUZLWIJHVFJZ-UHFFFAOYSA-N 2-acetamido-4-(dimethylamino)-5-nitrobenzoic acid Chemical compound CN(C)C1=CC(NC(C)=O)=C(C(O)=O)C=C1[N+]([O-])=O UFUUZLWIJHVFJZ-UHFFFAOYSA-N 0.000 description 2
- GSZUVVWNNPZIGN-UHFFFAOYSA-N 2-acetamido-4-chloro-5-nitrobenzoic acid Chemical compound CC(=O)NC1=CC(Cl)=C([N+]([O-])=O)C=C1C(O)=O GSZUVVWNNPZIGN-UHFFFAOYSA-N 0.000 description 2
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 2
- MNNOFRJMHLQDOE-UHFFFAOYSA-N 2-fluoro-5-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC=C(F)C(C(O)=O)=C1 MNNOFRJMHLQDOE-UHFFFAOYSA-N 0.000 description 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 2
- FDAXHDFKDZSHQV-UHFFFAOYSA-N 3-(4-benzylmorpholin-2-yl)propan-1-amine Chemical compound C1COC(CCCN)CN1CC1=CC=CC=C1 FDAXHDFKDZSHQV-UHFFFAOYSA-N 0.000 description 2
- SVSQYRJKZKOKCP-UHFFFAOYSA-N 3-(4-benzylmorpholin-2-yl)propanenitrile Chemical compound C1COC(CCC#N)CN1CC1=CC=CC=C1 SVSQYRJKZKOKCP-UHFFFAOYSA-N 0.000 description 2
- MBXYDAFAUGAUJB-UHFFFAOYSA-N 3-morpholin-2-ylpropanenitrile Chemical compound N#CCCC1CNCCO1 MBXYDAFAUGAUJB-UHFFFAOYSA-N 0.000 description 2
- HFOOMTWBZCIGSL-UHFFFAOYSA-N 4-acetamido-2-ethoxy-n-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]benzamide Chemical compound CCOC1=CC(NC(C)=O)=CC=C1C(=O)NCC1OCCN(CC=2C=CC(F)=CC=2)C1 HFOOMTWBZCIGSL-UHFFFAOYSA-N 0.000 description 2
- ZSFLDBIRNKAYSV-UHFFFAOYSA-N 4-acetamido-5-chloro-2-ethoxy-n-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]benzamide Chemical compound CCOC1=CC(NC(C)=O)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C=CC(F)=CC=2)C1 ZSFLDBIRNKAYSV-UHFFFAOYSA-N 0.000 description 2
- HLPODFYVEMCHBL-UHFFFAOYSA-N 4-amino-n-[(4-benzylmorpholin-2-yl)methyl]-5-chloro-2-methoxybenzamide Chemical compound COC1=CC(N)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C=CC=CC=2)C1 HLPODFYVEMCHBL-UHFFFAOYSA-N 0.000 description 2
- KZKOWXZFTMYRSE-UHFFFAOYSA-N 5-chloro-4-(dimethylamino)-2-methoxybenzoic acid Chemical compound COC1=CC(N(C)C)=C(Cl)C=C1C(O)=O KZKOWXZFTMYRSE-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 208000007882 Gastritis Diseases 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- 206010047700 Vomiting Diseases 0.000 description 2
- DWXFDGVDGNNQBO-UHFFFAOYSA-N [4-[3-(4-chlorophenoxy)propyl]morpholin-2-yl]methanamine Chemical compound C1COC(CN)CN1CCCOC1=CC=C(Cl)C=C1 DWXFDGVDGNNQBO-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- FPZOUXYSPHCLRV-UHFFFAOYSA-N benzyl 2-(2-acetyloxyethyl)morpholine-4-carboxylate Chemical compound C1COC(CCOC(=O)C)CN1C(=O)OCC1=CC=CC=C1 FPZOUXYSPHCLRV-UHFFFAOYSA-N 0.000 description 2
- MLXBQSCAFOXTSR-UHFFFAOYSA-N benzyl 2-(2-chloroethyl)morpholine-4-carboxylate Chemical compound C1COC(CCCl)CN1C(=O)OCC1=CC=CC=C1 MLXBQSCAFOXTSR-UHFFFAOYSA-N 0.000 description 2
- YLOMZAUJLNQHRO-UHFFFAOYSA-N benzyl 2-(2-cyanoethyl)morpholine-4-carboxylate Chemical compound C1COC(CCC#N)CN1C(=O)OCC1=CC=CC=C1 YLOMZAUJLNQHRO-UHFFFAOYSA-N 0.000 description 2
- JLXGHWHTUOCXQX-UHFFFAOYSA-N benzyl 2-(2-hydroxyethyl)morpholine-4-carboxylate Chemical compound C1COC(CCO)CN1C(=O)OCC1=CC=CC=C1 JLXGHWHTUOCXQX-UHFFFAOYSA-N 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 230000002708 enhancing effect Effects 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 2
- WZFOBUJYPANZMG-UHFFFAOYSA-N ethyl 2-(4-benzylmorpholin-2-yl)acetate Chemical compound C1COC(CC(=O)OCC)CN1CC1=CC=CC=C1 WZFOBUJYPANZMG-UHFFFAOYSA-N 0.000 description 2
- YOWFFMYWBHTEJD-UHFFFAOYSA-N ethyl 2-[(1,3-dioxoisoindol-2-yl)methyl]morpholine-4-carboxylate Chemical compound C1N(C(=O)OCC)CCOC1CN1C(=O)C2=CC=CC=C2C1=O YOWFFMYWBHTEJD-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- QAYQKAPOTVSWLS-UHFFFAOYSA-N methyl 2-ethoxybenzoate Chemical compound CCOC1=CC=CC=C1C(=O)OC QAYQKAPOTVSWLS-UHFFFAOYSA-N 0.000 description 2
- VEXJDAUJQLLGAZ-UHFFFAOYSA-N methyl 4-acetamido-5-chloro-2-hexoxybenzoate Chemical compound CCCCCCOC1=CC(NC(C)=O)=C(Cl)C=C1C(=O)OC VEXJDAUJQLLGAZ-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- KJBLQGHJOCAOJP-UHFFFAOYSA-N metoclopramide hydrochloride Chemical compound O.Cl.CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC KJBLQGHJOCAOJP-UHFFFAOYSA-N 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- UGPSGKBXOZVVCV-UHFFFAOYSA-N n-(morpholin-2-ylmethyl)acetamide Chemical compound CC(=O)NCC1CNCCO1 UGPSGKBXOZVVCV-UHFFFAOYSA-N 0.000 description 2
- JARCELFZNGRBJT-UHFFFAOYSA-N n-[(4-benzylmorpholin-2-yl)methyl]acetamide Chemical compound C1COC(CNC(=O)C)CN1CC1=CC=CC=C1 JARCELFZNGRBJT-UHFFFAOYSA-N 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 125000006505 p-cyanobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C#N)C([H])([H])* 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000003444 phase transfer catalyst Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- VDVJGIYXDVPQLP-UHFFFAOYSA-N piperonylic acid Chemical compound OC(=O)C1=CC=C2OCOC2=C1 VDVJGIYXDVPQLP-UHFFFAOYSA-N 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000001226 reprecipitation Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 239000001119 stannous chloride Substances 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- YAKKATWFMLCGMI-UHFFFAOYSA-N (4-phenylmorpholin-2-yl)methanamine Chemical compound C1COC(CN)CN1C1=CC=CC=C1 YAKKATWFMLCGMI-UHFFFAOYSA-N 0.000 description 1
- NMCDGBASPMWQJD-WLHGVMLRSA-N (e)-but-2-enedioic acid;n-[(4-ethylmorpholin-2-yl)methyl]-2-methoxybenzamide Chemical compound OC(=O)\C=C\C(O)=O.C1N(CC)CCOC1CNC(=O)C1=CC=CC=C1OC NMCDGBASPMWQJD-WLHGVMLRSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- DBUAYOWCIUQXQW-UHFFFAOYSA-N 1,3-benzodioxole-4-carboxylic acid Chemical compound OC(=O)C1=CC=CC2=C1OCO2 DBUAYOWCIUQXQW-UHFFFAOYSA-N 0.000 description 1
- ZNGWEEUXTBNKFR-UHFFFAOYSA-N 1,4-oxazepane Chemical group C1CNCCOC1 ZNGWEEUXTBNKFR-UHFFFAOYSA-N 0.000 description 1
- IZXWCDITFDNEBY-UHFFFAOYSA-N 1-(chloromethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCl)C=C1 IZXWCDITFDNEBY-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- PAJODHVUXYNOJU-UHFFFAOYSA-N 1-amino-3-(2-chlorophenyl)-2,2-dimethylpropan-1-ol Chemical compound ClC1=C(CC(C(O)N)(C)C)C=CC=C1 PAJODHVUXYNOJU-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- AEHKBYHYSYENDS-UHFFFAOYSA-N 1-ethoxy-2h-quinoline Chemical compound C1=CC=C2N(OCC)CC=CC2=C1 AEHKBYHYSYENDS-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 1
- IMCDTSZTCIFXNN-UHFFFAOYSA-N 2-(4-benzylmorpholin-2-yl)acetonitrile Chemical compound C1COC(CC#N)CN1CC1=CC=CC=C1 IMCDTSZTCIFXNN-UHFFFAOYSA-N 0.000 description 1
- CQCIVIABGBSMEI-UHFFFAOYSA-N 2-(azidomethyl)-4-benzylmorpholine Chemical compound C1COC(CN=[N+]=[N-])CN1CC1=CC=CC=C1 CQCIVIABGBSMEI-UHFFFAOYSA-N 0.000 description 1
- YVJGCQAEHPDHCM-UHFFFAOYSA-N 2-(benzylamino)-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1NCC1=CC=CC=C1 YVJGCQAEHPDHCM-UHFFFAOYSA-N 0.000 description 1
- YFTKHVYQEPCOPM-UHFFFAOYSA-N 2-(chloromethyl)-4-[(2-chlorophenyl)methyl]-6-methylmorpholine Chemical compound C1C(CCl)OC(C)CN1CC1=CC=CC=C1Cl YFTKHVYQEPCOPM-UHFFFAOYSA-N 0.000 description 1
- RUKGENFOLCBVLY-UHFFFAOYSA-N 2-(chloromethyl)-4-phenylmorpholine Chemical compound C1COC(CCl)CN1C1=CC=CC=C1 RUKGENFOLCBVLY-UHFFFAOYSA-N 0.000 description 1
- KPVWVXISFIMMAB-UHFFFAOYSA-N 2-(cyclopropylamino)-5-sulfamoylbenzoic acid Chemical compound OC(=O)C1=CC(S(=O)(=O)N)=CC=C1NC1CC1 KPVWVXISFIMMAB-UHFFFAOYSA-N 0.000 description 1
- FPCAJFZDQXKYRW-UHFFFAOYSA-N 2-(hexylamino)-5-nitrobenzoic acid Chemical compound CCCCCCNC1=CC=C([N+]([O-])=O)C=C1C(O)=O FPCAJFZDQXKYRW-UHFFFAOYSA-N 0.000 description 1
- DUILGEYLVHGSEE-UHFFFAOYSA-N 2-(oxiran-2-ylmethyl)isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CC1CO1 DUILGEYLVHGSEE-UHFFFAOYSA-N 0.000 description 1
- KWEPMOQQKUYWIN-UHFFFAOYSA-N 2-[(4-fluorophenyl)methylamino]ethanol Chemical compound OCCNCC1=CC=C(F)C=C1 KWEPMOQQKUYWIN-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- BTDSTEXXTSDBLO-UHFFFAOYSA-N 2-[4-[(2-chlorophenyl)methyl]-5,5-dimethylmorpholin-3-yl]ethanamine Chemical compound NCCC1N(C(COC1)(C)C)CC1=C(C=CC=C1)Cl BTDSTEXXTSDBLO-UHFFFAOYSA-N 0.000 description 1
- SONOHJNKSOBNKY-UHFFFAOYSA-N 2-acetamido-4-chlorobenzoic acid Chemical compound CC(=O)NC1=CC(Cl)=CC=C1C(O)=O SONOHJNKSOBNKY-UHFFFAOYSA-N 0.000 description 1
- JQRZFRQCKBWJNP-UHFFFAOYSA-N 2-amino-4-(dimethylamino)-5-nitrobenzoic acid Chemical compound CN(C)C1=CC(N)=C(C(O)=O)C=C1[N+]([O-])=O JQRZFRQCKBWJNP-UHFFFAOYSA-N 0.000 description 1
- JQSBIZXYGOCDSY-UHFFFAOYSA-N 2-amino-4-(methylamino)-5-nitrobenzoic acid Chemical compound CNC1=CC(N)=C(C(O)=O)C=C1[N+]([O-])=O JQSBIZXYGOCDSY-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical group CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- XDZMPRGFOOFSBL-UHFFFAOYSA-N 2-ethoxybenzoic acid Chemical compound CCOC1=CC=CC=C1C(O)=O XDZMPRGFOOFSBL-UHFFFAOYSA-N 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N 2-hydroxy-pyridine Natural products OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- QUEKGYQTRJVEQC-UHFFFAOYSA-N 2516-96-3 Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1Cl QUEKGYQTRJVEQC-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- ZQJXSIOFSZYGMH-UHFFFAOYSA-N 3-(benzylamino)propan-1-ol Chemical compound OCCCNCC1=CC=CC=C1 ZQJXSIOFSZYGMH-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- JESNSNMMTLYFGV-UHFFFAOYSA-N 3-chloro-2-methoxybenzamide Chemical compound COC1=C(Cl)C=CC=C1C(N)=O JESNSNMMTLYFGV-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- FXAHCXPEXLCFFY-UHFFFAOYSA-N 4-(chloromethyl)morpholine Chemical compound ClCN1CCOCC1 FXAHCXPEXLCFFY-UHFFFAOYSA-N 0.000 description 1
- BCZLYNFDOJXWGN-UHFFFAOYSA-N 4-(morpholin-4-ylmethyl)benzonitrile Chemical compound C1=CC(C#N)=CC=C1CN1CCOCC1 BCZLYNFDOJXWGN-UHFFFAOYSA-N 0.000 description 1
- OTJMOIFNCHDSAG-UHFFFAOYSA-N 4-[(2-chlorophenyl)methyl]-2-methylmorpholine Chemical compound ClC1=C(CN2CCOC(C2)C)C=CC=C1 OTJMOIFNCHDSAG-UHFFFAOYSA-N 0.000 description 1
- ICNWZXFWTBMBKT-UHFFFAOYSA-N 4-acetamido-5-chloro-2-ethoxybenzoic acid Chemical compound CCOC1=CC(NC(C)=O)=C(Cl)C=C1C(O)=O ICNWZXFWTBMBKT-UHFFFAOYSA-N 0.000 description 1
- XVVYSVVBPMJRAB-UHFFFAOYSA-N 4-acetamidobenzamide Chemical class CC(=O)NC1=CC=C(C(N)=O)C=C1 XVVYSVVBPMJRAB-UHFFFAOYSA-N 0.000 description 1
- IMGMDZSNZZJYQC-UHFFFAOYSA-N 4-amino-5-chloro-2-methoxy-n-(morpholin-2-ylmethyl)benzamide Chemical compound COC1=CC(N)=C(Cl)C=C1C(=O)NCC1OCCNC1 IMGMDZSNZZJYQC-UHFFFAOYSA-N 0.000 description 1
- SGEPBJGKGOHLHC-UHFFFAOYSA-N 4-amino-5-chloro-n-[[4-[(2-chlorophenyl)methyl]morpholin-2-yl]methyl]-2-ethoxybenzamide Chemical compound CCOC1=CC(N)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C(=CC=CC=2)Cl)C1 SGEPBJGKGOHLHC-UHFFFAOYSA-N 0.000 description 1
- KCOZHDFHIVRDPG-UHFFFAOYSA-N 4-amino-5-chloro-n-[[4-[(2-fluorophenyl)methyl]morpholin-2-yl]methyl]-2-hydroxybenzamide Chemical compound C1=C(Cl)C(N)=CC(O)=C1C(=O)NCC1OCCN(CC=2C(=CC=CC=2)F)C1 KCOZHDFHIVRDPG-UHFFFAOYSA-N 0.000 description 1
- OWIUGUVNWRNUID-UHFFFAOYSA-N 4-amino-5-chloro-n-[[4-[(3-chlorophenyl)methyl]morpholin-2-yl]methyl]-2-hydroxybenzamide Chemical compound C1=C(Cl)C(N)=CC(O)=C1C(=O)NCC1OCCN(CC=2C=C(Cl)C=CC=2)C1 OWIUGUVNWRNUID-UHFFFAOYSA-N 0.000 description 1
- RDUJCVYCCPKYSR-UHFFFAOYSA-N 4-amino-n-[2-(4-benzylmorpholin-2-yl)ethyl]-5-chloro-2-ethoxybenzamide Chemical compound CCOC1=CC(N)=C(Cl)C=C1C(=O)NCCC1OCCN(CC=2C=CC=CC=2)C1 RDUJCVYCCPKYSR-UHFFFAOYSA-N 0.000 description 1
- QJNVJWLJAYAWEI-UHFFFAOYSA-N 4-amino-n-[2-(4-benzylmorpholin-2-yl)ethyl]-5-chloro-2-methoxybenzamide Chemical compound COC1=CC(N)=C(Cl)C=C1C(=O)NCCC1OCCN(CC=2C=CC=CC=2)C1 QJNVJWLJAYAWEI-UHFFFAOYSA-N 0.000 description 1
- UVTNCRCSZDFKQV-UHFFFAOYSA-N 4-amino-n-[3-(4-benzylmorpholin-2-yl)propyl]-5-chloro-2-methoxybenzamide Chemical compound COC1=CC(N)=C(Cl)C=C1C(=O)NCCCC1OCCN(CC=2C=CC=CC=2)C1 UVTNCRCSZDFKQV-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- AZEIRPAUJXANCS-UHFFFAOYSA-N 4-ethoxybenzamide Chemical compound CCOC1=CC=C(C(N)=O)C=C1 AZEIRPAUJXANCS-UHFFFAOYSA-N 0.000 description 1
- PDKBNJFZYQVYKF-UHFFFAOYSA-N 5-(dimethylsulfamoyl)-2-(methylamino)benzoic acid Chemical compound CNC1=CC=C(S(=O)(=O)N(C)C)C=C1C(O)=O PDKBNJFZYQVYKF-UHFFFAOYSA-N 0.000 description 1
- SPLPERBFJNXJRZ-UHFFFAOYSA-N 5-(dimethylsulfamoyl)-2-fluorobenzoic acid Chemical compound CN(C)S(=O)(=O)C1=CC=C(F)C(C(O)=O)=C1 SPLPERBFJNXJRZ-UHFFFAOYSA-N 0.000 description 1
- SZGVEGLNNJFISE-UHFFFAOYSA-N 5-chloro-2-ethoxy-4-nitrobenzoic acid Chemical compound CCOC1=CC([N+]([O-])=O)=C(Cl)C=C1C(O)=O SZGVEGLNNJFISE-UHFFFAOYSA-N 0.000 description 1
- CDUYYXSMTAZNGT-UHFFFAOYSA-N 5-chloro-2-hydroxy-3-methylbenzamide Chemical compound CC1=CC(Cl)=CC(C(N)=O)=C1O CDUYYXSMTAZNGT-UHFFFAOYSA-N 0.000 description 1
- HAKXXXVBNLKWAU-UHFFFAOYSA-N 5-chloro-2-methoxy-3-methylbenzamide Chemical compound COC1=C(C)C=C(Cl)C=C1C(N)=O HAKXXXVBNLKWAU-UHFFFAOYSA-N 0.000 description 1
- ZNWIZSBLPIUGJI-UHFFFAOYSA-N 5-chloro-n-[[4-[(4-cyanophenyl)methyl]morpholin-2-yl]methyl]-4-(dimethylamino)-2-methoxybenzamide Chemical compound COC1=CC(N(C)C)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C=CC(=CC=2)C#N)C1 ZNWIZSBLPIUGJI-UHFFFAOYSA-N 0.000 description 1
- CISMZCVQNVNWJW-UHFFFAOYSA-N 5-chlorosulfonyl-2-fluorobenzoic acid Chemical compound OC(=O)C1=CC(S(Cl)(=O)=O)=CC=C1F CISMZCVQNVNWJW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 208000015163 Biliary Tract disease Diseases 0.000 description 1
- POMLYIFGGFZGMM-WLHGVMLRSA-N C(\C=C\C(=O)O)(=O)O.NC1=CC(=C(C(=O)NCC2CN(CCO2)CC2=CC=CC=C2)C=C1Cl)OCCCC Chemical compound C(\C=C\C(=O)O)(=O)O.NC1=CC(=C(C(=O)NCC2CN(CCO2)CC2=CC=CC=C2)C=C1Cl)OCCCC POMLYIFGGFZGMM-WLHGVMLRSA-N 0.000 description 1
- BHDUWLKBHFLMPE-UHFFFAOYSA-N CC1CN(C(CO1)CCCl)CC2=CC=CC=C2Cl Chemical compound CC1CN(C(CO1)CCCl)CC2=CC=CC=C2Cl BHDUWLKBHFLMPE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 208000009132 Catalepsy Diseases 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 206010010774 Constipation Diseases 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PLUBXMRUUVWRLT-UHFFFAOYSA-N Ethyl methanesulfonate Chemical compound CCOS(C)(=O)=O PLUBXMRUUVWRLT-UHFFFAOYSA-N 0.000 description 1
- 206010015995 Eyelid ptosis Diseases 0.000 description 1
- 206010059024 Gastrointestinal toxicity Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 101100450563 Mus musculus Serpind1 gene Proteins 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- 206010028813 Nausea Diseases 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 206010029333 Neurosis Diseases 0.000 description 1
- 206010061876 Obstruction Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 239000004373 Pullulan Substances 0.000 description 1
- 229920001218 Pullulan Polymers 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 229910006074 SO2NH2 Inorganic materials 0.000 description 1
- SKZKKFZAGNVIMN-UHFFFAOYSA-N Salicilamide Chemical compound NC(=O)C1=CC=CC=C1O SKZKKFZAGNVIMN-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 206010047853 Waxy flexibility Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- VIAYODHUVXCRFB-UHFFFAOYSA-N [4-[(2-chlorophenyl)methyl]-5,5-dimethylmorpholin-2-yl]methanamine Chemical compound CC1(C)COC(CN)CN1CC1=CC=CC=C1Cl VIAYODHUVXCRFB-UHFFFAOYSA-N 0.000 description 1
- HSPSHZXMUKHKPV-UHFFFAOYSA-N [4-[(2-chlorophenyl)methyl]-6-methylmorpholin-2-yl]methanamine Chemical compound C1C(CN)OC(C)CN1CC1=CC=CC=C1Cl HSPSHZXMUKHKPV-UHFFFAOYSA-N 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- INNSZZHSFSFSGS-UHFFFAOYSA-N acetic acid;titanium Chemical compound [Ti].CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O INNSZZHSFSFSGS-UHFFFAOYSA-N 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000005530 alkylenedioxy group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 229940031955 anhydrous lanolin Drugs 0.000 description 1
- 208000022531 anorexia Diseases 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000000891 anti-reserpine Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 229940125683 antiemetic agent Drugs 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- FKPSBYZGRQJIMO-UHFFFAOYSA-M benzyl(triethyl)azanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC1=CC=CC=C1 FKPSBYZGRQJIMO-UHFFFAOYSA-M 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N beta-methyl-butyric acid Natural products CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000001465 calcium Nutrition 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- CSTBBLHIGMTEAZ-UHFFFAOYSA-N chloroform;ethyl acetate;hexane Chemical compound ClC(Cl)Cl.CCCCCC.CCOC(C)=O CSTBBLHIGMTEAZ-UHFFFAOYSA-N 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 208000023652 chronic gastritis Diseases 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 239000012059 conventional drug carrier Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 206010061428 decreased appetite Diseases 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000001335 demethylating effect Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- YDVNLQGCLLPHAH-UHFFFAOYSA-N dichloromethane;hydrate Chemical compound O.ClCCl YDVNLQGCLLPHAH-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 201000006549 dyspepsia Diseases 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000000095 emetic effect Effects 0.000 description 1
- 208000028299 esophageal disease Diseases 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- PUEKXXRSLTWHEW-UHFFFAOYSA-N ethyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]morpholine-4-carboxylate Chemical compound C1N(C(=O)OCC)CCOC1CNC(=O)C1=CC(Cl)=C(N)C=C1OC PUEKXXRSLTWHEW-UHFFFAOYSA-N 0.000 description 1
- IJNIKEUNRANIBE-UHFFFAOYSA-N ethyl 3-(aminomethyl)morpholine-4-carboxylate Chemical compound CCOC(=O)N1CCOCC1CN IJNIKEUNRANIBE-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 208000021302 gastroesophageal reflux disease Diseases 0.000 description 1
- 231100000414 gastrointestinal toxicity Toxicity 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- MOTRZVVGCFFABN-UHFFFAOYSA-N hexane;2-propan-2-yloxypropane Chemical compound CCCCCC.CC(C)OC(C)C MOTRZVVGCFFABN-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- DCPMPXBYPZGNDC-UHFFFAOYSA-N hydron;methanediimine;chloride Chemical compound Cl.N=C=N DCPMPXBYPZGNDC-UHFFFAOYSA-N 0.000 description 1
- 239000001341 hydroxy propyl starch Substances 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 235000013828 hydroxypropyl starch Nutrition 0.000 description 1
- 230000001965 increasing effect Effects 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940031703 low substituted hydroxypropyl cellulose Drugs 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229960003511 macrogol Drugs 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- VBBPDQQIZOEHIR-UHFFFAOYSA-N methyl 4-acetamido-2-hexoxybenzoate Chemical compound CCCCCCOC1=CC(NC(C)=O)=CC=C1C(=O)OC VBBPDQQIZOEHIR-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- QGEUDBIRXMKEKB-UHFFFAOYSA-N methyl 5-chloro-2-ethoxybenzoate Chemical compound CCOC1=CC=C(Cl)C=C1C(=O)OC QGEUDBIRXMKEKB-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- MBABOKRGFJTBAE-UHFFFAOYSA-N methyl methanesulfonate Chemical compound COS(C)(=O)=O MBABOKRGFJTBAE-UHFFFAOYSA-N 0.000 description 1
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- HKVOVSYVRRXILB-UHFFFAOYSA-N n-[(4-benzylmorpholin-2-yl)methyl]-1,3-benzodioxole-4-carboxamide Chemical compound C=1C=CC=2OCOC=2C=1C(=O)NCC(OCC1)CN1CC1=CC=CC=C1 HKVOVSYVRRXILB-UHFFFAOYSA-N 0.000 description 1
- VDBITLPJLASHCL-UHFFFAOYSA-N n-[[4-[(2-chlorophenyl)methyl]-6-methylmorpholin-2-yl]methyl]acetamide Chemical compound C1C(CNC(C)=O)OC(C)CN1CC1=CC=CC=C1Cl VDBITLPJLASHCL-UHFFFAOYSA-N 0.000 description 1
- WIIQTHTVTPDPQV-UHFFFAOYSA-N n-[[4-[3-(4-chlorophenoxy)propyl]morpholin-2-yl]methyl]acetamide Chemical compound C1COC(CNC(=O)C)CN1CCCOC1=CC=C(Cl)C=C1 WIIQTHTVTPDPQV-UHFFFAOYSA-N 0.000 description 1
- 230000008693 nausea Effects 0.000 description 1
- 208000015238 neurotic disease Diseases 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- MQAYFGXOFCEZRW-UHFFFAOYSA-N oxane-2-carboxylic acid Chemical compound OC(=O)C1CCCCO1 MQAYFGXOFCEZRW-UHFFFAOYSA-N 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229950008882 polysorbate Drugs 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- SAALQYKUFCIMHR-UHFFFAOYSA-N propan-2-ol;2-propan-2-yloxypropane Chemical compound CC(C)O.CC(C)OC(C)C SAALQYKUFCIMHR-UHFFFAOYSA-N 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 201000003004 ptosis Diseases 0.000 description 1
- 235000019423 pullulan Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 1
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- 235000021195 test diet Nutrition 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 230000008673 vomiting Effects 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D267/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D267/02—Seven-membered rings
- C07D267/08—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D267/10—Seven-membered rings having the hetero atoms in positions 1 and 4 not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10155286 | 1986-04-30 | ||
| JP10155286 | 1986-04-30 | ||
| JP31509086 | 1986-12-31 | ||
| JP31509086 | 1986-12-31 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI871828A0 FI871828A0 (fi) | 1987-04-27 |
| FI871828A7 FI871828A7 (fi) | 1987-10-31 |
| FI87776B FI87776B (fi) | 1992-11-13 |
| FI87776C true FI87776C (fi) | 1993-02-25 |
Family
ID=26442419
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI871828A FI87776C (fi) | 1986-04-30 | 1987-04-27 | Foerfarande foer framstaellning av terapeutiskt aktiva substituerade benzamider |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4870074A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0243959B1 (cg-RX-API-DMAC7.html) |
| KR (1) | KR870010030A (cg-RX-API-DMAC7.html) |
| AR (1) | AR242953A1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU592177B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1291135C (cg-RX-API-DMAC7.html) |
| CZ (1) | CZ284687B6 (cg-RX-API-DMAC7.html) |
| DE (1) | DE3781195T2 (cg-RX-API-DMAC7.html) |
| DK (1) | DK175281B1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2043617T3 (cg-RX-API-DMAC7.html) |
| FI (1) | FI87776C (cg-RX-API-DMAC7.html) |
| GR (1) | GR3005934T3 (cg-RX-API-DMAC7.html) |
| HK (1) | HK18194A (cg-RX-API-DMAC7.html) |
| HU (1) | HU198193B (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ220120A (cg-RX-API-DMAC7.html) |
| PH (1) | PH24049A (cg-RX-API-DMAC7.html) |
| SK (1) | SK279058B6 (cg-RX-API-DMAC7.html) |
| SU (1) | SU1597101A3 (cg-RX-API-DMAC7.html) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2640139A1 (fr) * | 1988-12-14 | 1990-06-15 | Delagrange Laboratoires | Application de benzamides substitues comme gastromoteurs |
| US5395832A (en) * | 1991-02-15 | 1995-03-07 | Hokuriku Seiyaku Co., Ltd. | Benzamide derivatives |
| TW243449B (cg-RX-API-DMAC7.html) * | 1991-02-15 | 1995-03-21 | Hokuriku Pharmaceutical | |
| CA2186623A1 (en) * | 1994-03-30 | 1995-10-21 | Takeshi Kawakita | Benzoic acid compound and use thereof as medicine |
| US5864039A (en) * | 1994-03-30 | 1999-01-26 | Yoshitomi Pharmaceutical Industries, Ltd. | Benzoic acid compounds and use thereof as medicaments |
| PT827500E (pt) * | 1995-05-23 | 2002-04-29 | Janssen Pharmaceutica Nv | Derivados de (2-morfolinilmetil)benzamida |
| JP2001064177A (ja) * | 1999-08-16 | 2001-03-13 | Schering Ag | ベンズアミド誘導体を有効成分とする製剤 |
| BR0114323A (pt) | 2000-09-29 | 2003-07-01 | Glaxo Group Ltd | Composto ou um seu sal ou solvato farmaceuticamente aceitável, composição farmacêutica, uso do composto ou de um seu sal ou solvato farmaceuticamente aceitável, método de tratamento ou profilaxia de doenças inflamatórias, e, processo para preparar o composto |
| DE60108420T2 (de) * | 2000-11-28 | 2005-12-22 | Smithkline Beecham P.L.C., Brentford | Morpholinderivate als antagonisten an orexinrezeptoren |
| JP4829417B2 (ja) * | 2001-03-26 | 2011-12-07 | 明夫 乾 | インスリン抵抗性改善薬 |
| HUP0402611A2 (hu) * | 2001-10-08 | 2005-07-28 | Sun Pharmaceutical Industries Limited | Görcsoldó hatóanyag szakaszos leadására szolgáló rendszer |
| GB0208158D0 (en) * | 2002-03-28 | 2002-05-22 | Glaxo Group Ltd | Novel compounds |
| GB0207447D0 (en) * | 2002-03-28 | 2002-05-08 | Glaxo Group Ltd | Novel compounds |
| GB0207449D0 (en) * | 2002-03-28 | 2002-05-08 | Glaxo Group Ltd | Novel compounds |
| HUP0201980A3 (en) * | 2002-06-13 | 2008-06-30 | Richter Gedeon Nyrt | Process for preparing a benzamide derivative and intermediates thereof |
| CN1913876B (zh) * | 2003-12-09 | 2013-06-26 | 大日本住友制药株式会社 | 含药物的颗粒和包含这种颗粒的固体制剂 |
| US8138204B2 (en) * | 2004-01-07 | 2012-03-20 | Aryx Therapeutics, Inc. | Stereoisomeric compounds and methods for the treatment of gastrointestinal and central nervous system disorders |
| US8524736B2 (en) | 2004-01-07 | 2013-09-03 | Armetheon, Inc. | Stereoisomeric compounds and methods for the treatment of gastrointestinal and central nervous system disorders |
| JP5200288B2 (ja) * | 2004-01-07 | 2013-06-05 | アルメテオン、インコーポレイテッド | 胃腸疾患および中枢神経系疾患の治療のための立体異性体化合物と方法 |
| PL1801108T3 (pl) | 2004-09-08 | 2013-04-30 | Mitsubishi Tanabe Pharma Corp | Związki morfolinowe do leczenia stanów zapalnych |
| AR054623A1 (es) * | 2005-06-23 | 2007-07-04 | Astrazeneca Ab | PROCESO PARA PREPARAR DERIVADOS DE BENCIMIDAZOL Y COMPUESTOS INTERMEDIARIOS DE SíNTESIS DE LOS MISMOS. |
| BRPI0615691A8 (pt) * | 2005-08-31 | 2017-08-15 | Aryx Therapeutics Inc | Método para a preparação de 6-((3s,4r)-4-(4-amino-5-cloro-2-metoxibenzamido)-3-metoxipiperidin-1-il) hexanoato de (r)-quinuclidin-3-ila ou sal do mesmo |
| EP1971602A4 (en) * | 2005-12-20 | 2009-11-11 | Merck & Co Inc | AGONISTS OF THE NIACIN RECEPTOR, COMPOSITIONS CONTAINING SUCH COMPOUNDS AND TREATMENT PROCEDURES |
| KR100750593B1 (ko) * | 2006-03-16 | 2007-08-20 | 동우신테크 주식회사 | 치환된 벤즈아미드 유도체의 제조방법 |
| WO2007149929A1 (en) * | 2006-06-23 | 2007-12-27 | Aryx Therapeutics, Inc. | Piperidine derivatives for the treatment of gastrointestinal and cns disorders |
| AU2008242703B2 (en) * | 2007-04-19 | 2011-08-18 | Concert Pharmaceuticals Inc. | Deuterated morpholinyl compounds |
| CN101402633A (zh) * | 2007-09-11 | 2009-04-08 | 上海恒瑞医药有限公司 | 苯甲酰胺类衍生物、其制备方法及其在医药上的用途 |
| EP2251005B1 (en) | 2008-02-13 | 2012-10-10 | Dainippon Sumitomo Pharma Co., Ltd. | Orally disintegrating tablets |
| TWI423967B (zh) * | 2008-02-21 | 2014-01-21 | Dainippon Sumitomo Pharma Co | 醯胺衍生物及含有其之醫藥組合物 |
| EP2465495A4 (en) | 2009-08-11 | 2013-01-23 | Dainippon Sumitomo Pharma Co | TABLET WITH FAST DECOMPOSITION IN THE MOUTH AND TWO OR MORE TYPES OF PARTICLES |
| WO2011107903A1 (en) | 2010-03-04 | 2011-09-09 | Ranbaxy Laboratories Limited | Highly pure mosapride citrate dihydrate and processes for its preparation |
| PL2678331T3 (pl) | 2011-02-25 | 2016-12-30 | Pochodne diaminopirymidyny i sposoby ich wytwarzania | |
| KR101657616B1 (ko) | 2013-05-24 | 2016-09-19 | 주식회사유한양행 | 피리미딘 고리를 포함하는 바이사이클릭 유도체 및 그의 제조방법 |
| TWI794171B (zh) | 2016-05-11 | 2023-03-01 | 美商滬亞生物國際有限公司 | Hdac抑制劑與pd-l1抑制劑之組合治療 |
| TWI808055B (zh) | 2016-05-11 | 2023-07-11 | 美商滬亞生物國際有限公司 | Hdac 抑制劑與 pd-1 抑制劑之組合治療 |
| CN111349052B (zh) * | 2020-04-07 | 2021-02-12 | 福建海西新药创制有限公司 | 一种枸橼酸莫沙必利的合成方法 |
| CN114560822B (zh) * | 2020-11-27 | 2024-05-28 | 鲁南制药集团股份有限公司 | 一种莫沙必利的二羧酸晶体 |
| CN114591260B (zh) * | 2020-12-05 | 2025-07-11 | 鲁南制药集团股份有限公司 | 一种莫沙必利有机酸盐 |
| CN119241463A (zh) * | 2024-10-22 | 2025-01-03 | 吉林修正药业新药开发有限公司 | 一种枸橼酸莫沙必利杂质化合物及其制备方法 |
| CN119241464A (zh) * | 2024-10-22 | 2025-01-03 | 吉林修正药业新药开发有限公司 | 一种枸橼酸莫沙必利杂质化合物及其制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH451142A (de) * | 1965-01-19 | 1968-05-15 | Sandoz Ag | Verfahren zur Herstellung neuer basisch substituierter Benzoesäureamide |
| US4029786A (en) * | 1972-08-11 | 1977-06-14 | Imperial Chemical Industries Limited | Morpholine derivatives for treating depression |
| US4323503A (en) * | 1976-08-04 | 1982-04-06 | Societe D'etudes Scientifiques Et Industrielles De L'ile-De-France | Substituted 2,3-alkylene di (oxy) benzamides and derivatives |
| US4210754A (en) * | 1977-02-01 | 1980-07-01 | Hoffmann-La Roche Inc. | Morpholino containing benzamides |
| US4692445A (en) * | 1983-04-29 | 1987-09-08 | Rorer Pharmaceutical Corporation | Bicyclic benzenoid aminoalkylene ethers and thioethers, pharmaceutical compositions and use |
| FR2575158B1 (fr) * | 1984-12-20 | 1987-10-02 | Pf Medicament | Arylalcoyloxymethyl-2 morpholines, leur preparation et leur application en tant que medicaments utiles dans le traitement des troubles du systeme nerveux central |
| JPH0390274A (ja) * | 1989-08-28 | 1991-04-16 | Furukawa Alum Co Ltd | Al又はAl合金の気相ろう付法 |
-
1987
- 1987-04-24 US US07/042,474 patent/US4870074A/en not_active Expired - Lifetime
- 1987-04-24 SK SK2897-87A patent/SK279058B6/sk unknown
- 1987-04-24 CZ CS872897A patent/CZ284687B6/cs not_active IP Right Cessation
- 1987-04-27 FI FI871828A patent/FI87776C/fi not_active IP Right Cessation
- 1987-04-28 NZ NZ220120A patent/NZ220120A/xx unknown
- 1987-04-28 CA CA000535794A patent/CA1291135C/en not_active Expired - Lifetime
- 1987-04-29 HU HU871946A patent/HU198193B/hu unknown
- 1987-04-29 DK DK198702187A patent/DK175281B1/da not_active IP Right Cessation
- 1987-04-29 PH PH35203A patent/PH24049A/en unknown
- 1987-04-29 ES ES87106266T patent/ES2043617T3/es not_active Expired - Lifetime
- 1987-04-29 SU SU874202484A patent/SU1597101A3/ru active
- 1987-04-29 EP EP87106266A patent/EP0243959B1/en not_active Expired - Lifetime
- 1987-04-29 DE DE8787106266T patent/DE3781195T2/de not_active Expired - Lifetime
- 1987-04-30 KR KR870004220A patent/KR870010030A/ko not_active Withdrawn
- 1987-04-30 AU AU72275/87A patent/AU592177B2/en not_active Expired
- 1987-04-30 AR AR87307449A patent/AR242953A1/es active
-
1992
- 1992-10-12 GR GR920402254T patent/GR3005934T3/el unknown
-
1994
- 1994-03-03 HK HK181/94A patent/HK18194A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| HU198193B (en) | 1989-08-28 |
| SU1597101A3 (ru) | 1990-09-30 |
| NZ220120A (en) | 1989-06-28 |
| CA1291135C (en) | 1991-10-22 |
| US4870074A (en) | 1989-09-26 |
| GR3005934T3 (cg-RX-API-DMAC7.html) | 1993-06-07 |
| DK218787A (da) | 1987-10-31 |
| DK175281B1 (da) | 2004-08-09 |
| HK18194A (en) | 1994-03-11 |
| FI87776B (fi) | 1992-11-13 |
| SK289787A3 (en) | 1998-06-03 |
| HUT45514A (en) | 1988-07-28 |
| SK279058B6 (sk) | 1998-06-03 |
| EP0243959B1 (en) | 1992-08-19 |
| CZ284687B6 (cs) | 1999-02-17 |
| DE3781195T2 (de) | 1993-02-18 |
| EP0243959A1 (en) | 1987-11-04 |
| FI871828A0 (fi) | 1987-04-27 |
| CZ289787A3 (cs) | 1998-11-11 |
| DK218787D0 (da) | 1987-04-29 |
| PH24049A (en) | 1990-03-05 |
| AR242953A1 (es) | 1993-06-30 |
| AU592177B2 (en) | 1990-01-04 |
| FI871828A7 (fi) | 1987-10-31 |
| ES2043617T3 (es) | 1994-01-01 |
| DE3781195D1 (de) | 1992-09-24 |
| AU7227587A (en) | 1987-11-05 |
| KR870010030A (ko) | 1987-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI87776C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva substituerade benzamider | |
| ES2279009T3 (es) | Derivados de lactama como antagonistas de receptores 11cby humanos. | |
| US6294555B1 (en) | 1-[(1-Substituted-4-piperidinyl)methyl]-4-piperidine derivative, process for producing the same, medicinal compositions containing the same and intermediates of these compounds | |
| US5281590A (en) | 2-H and 3-alkoxy or hydroxy-8-substituted-dibenz[b,f]-[1,4]oxazepine-10(11)-carboxylic acid, substituted hydrazides for the treatment of osteoporosis | |
| SK154196A3 (en) | Piperazine derivatives, preparation method thereof and their use as 5ht1a antagonists | |
| EP1131321B1 (en) | Indole derivatives and their use as serotonin receptor ligands | |
| NO301586B1 (no) | Dibenz£b,f|£1,4|oksazepin-11(10H)oner, fremgangsmåte til fremstilling derav og farmasöytisk preparat inneholdende dem | |
| WO1991010650A1 (en) | Piperidine and pyrrolidine derivatives | |
| JPH0977742A (ja) | 新規なベンズアミド誘導体 | |
| US4749703A (en) | Calcium antagonist piperazine derivatives, and compositions therefor | |
| US7220777B2 (en) | Lactam derivatives as antagonists for human 11cby receptors | |
| US6528504B2 (en) | Oxazepine derivatives and medicine containing the same | |
| DK149889B (da) | Analogifremgangsmaade til fremstilling af dibenzo(d,g)(1,3,6)dioxazocinderivater eller syreadditionssalte deraf | |
| US7320973B2 (en) | Dihydrodiaryloxazepine derivative and pharmaceutical composition containing the same | |
| KR950008530B1 (ko) | 치환된 벤즈아미드 유도체, 그 제조방법 및 이를 함유하는 약학적 조성물 | |
| KR20040074102A (ko) | 카르복실산 유도체 | |
| ALAGARSAMY et al. | Sinteza i farmakološko ispitivanje novih 4-(3-etilfenil)-1-supstituiranih 4H-[1, 2, 4] triazolo [4, 3-a] kinazolin-5-ona kao nove klase H1-antihistaminika | |
| GB2153354A (en) | Novel therapeutically active compounds of the formula | |
| JPWO2000040570A1 (ja) | オキサゼピン誘導体及び該誘導体を含有する医薬 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG | Patent granted |
Owner name: DAINIPPON PHARMACEUTICAL CO., LTD. |
|
| MA | Patent expired |