FI80021C - Foerfarande foer framstaellning av nikotinsyranitriler samt vid deras framstaellning anvaendbara mellanprodukter. - Google Patents
Foerfarande foer framstaellning av nikotinsyranitriler samt vid deras framstaellning anvaendbara mellanprodukter. Download PDFInfo
- Publication number
- FI80021C FI80021C FI831730A FI831730A FI80021C FI 80021 C FI80021 C FI 80021C FI 831730 A FI831730 A FI 831730A FI 831730 A FI831730 A FI 831730A FI 80021 C FI80021 C FI 80021C
- Authority
- FI
- Finland
- Prior art keywords
- pyridinyl
- ketone
- lower alkyl
- methyl
- ethoxy
- Prior art date
Links
- -1 nicotinic acid nitriles Chemical class 0.000 title claims description 68
- 238000000034 method Methods 0.000 title claims description 31
- 238000002360 preparation method Methods 0.000 title claims description 14
- 239000011664 nicotinic acid Substances 0.000 title claims description 3
- 229960003512 nicotinic acid Drugs 0.000 title claims description 3
- 239000000543 intermediate Substances 0.000 title description 9
- PVNIIMVLHYAWGP-UHFFFAOYSA-N nicotinic acid Natural products OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 title 1
- 235000001968 nicotinic acid Nutrition 0.000 title 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 51
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 50
- 125000000217 alkyl group Chemical group 0.000 claims description 44
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 36
- 150000002576 ketones Chemical class 0.000 claims description 30
- 150000003839 salts Chemical class 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 19
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 claims description 18
- 239000011541 reaction mixture Substances 0.000 claims description 17
- IATKKGJZTHMRBF-UHFFFAOYSA-N 4-ethoxy-3-pyridin-4-ylbut-3-en-2-one Chemical group CCOC=C(C(C)=O)C1=CC=NC=C1 IATKKGJZTHMRBF-UHFFFAOYSA-N 0.000 claims description 15
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 4
- 238000002955 isolation Methods 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 239000000047 product Substances 0.000 description 19
- 229960000583 acetic acid Drugs 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 239000007787 solid Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- 239000000203 mixture Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 11
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 10
- TWACACMBUVITDN-UHFFFAOYSA-N 6-methyl-2-oxo-5-pyridin-4-yl-1h-pyridine-3-carboxylic acid Chemical compound N1C(=O)C(C(O)=O)=CC(C=2C=CN=CC=2)=C1C TWACACMBUVITDN-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000003756 stirring Methods 0.000 description 7
- GZPHSAQLYPIAIN-UHFFFAOYSA-N 3-pyridinecarbonitrile Chemical compound N#CC1=CC=CN=C1 GZPHSAQLYPIAIN-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- ILRVKOYYFFNXDB-UHFFFAOYSA-N 1-pyridin-4-ylpropan-2-one Chemical compound CC(=O)CC1=CC=NC=C1 ILRVKOYYFFNXDB-UHFFFAOYSA-N 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 5
- OJVKUKRZKKCYGI-UHFFFAOYSA-N 1-ethoxy-2-pyridin-4-ylhex-1-en-3-one Chemical compound C(CC)C(=O)C(=COCC)C1=CC=NC=C1 OJVKUKRZKKCYGI-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000008367 deionised water Substances 0.000 description 4
- 229910021641 deionized water Inorganic materials 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- IUVCFHHAEHNCFT-INIZCTEOSA-N 2-[(1s)-1-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-6-fluoro-3-(3-fluorophenyl)chromen-4-one Chemical compound C1=C(F)C(OC(C)C)=CC=C1C(C1=C(N)N=CN=C11)=NN1[C@@H](C)C1=C(C=2C=C(F)C=CC=2)C(=O)C2=CC(F)=CC=C2O1 IUVCFHHAEHNCFT-INIZCTEOSA-N 0.000 description 3
- UMIQEVFXIUSPBY-UHFFFAOYSA-N 2-oxo-6-propyl-5-pyridin-4-yl-1h-pyridine-3-carboxylic acid Chemical compound N1C(=O)C(C(O)=O)=CC(C=2C=CN=CC=2)=C1CCC UMIQEVFXIUSPBY-UHFFFAOYSA-N 0.000 description 3
- KUZVARGVJQDUEP-UHFFFAOYSA-N 6-methyl-2-oxo-5-pyridin-3-yl-1h-pyridine-3-carboxylic acid Chemical compound N1C(=O)C(C(O)=O)=CC(C=2C=NC=CC=2)=C1C KUZVARGVJQDUEP-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 239000000919 ceramic Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- FBLVQXITSLUNLI-UHFFFAOYSA-N 1-pyridin-4-ylbutan-2-one Chemical compound CCC(=O)CC1=CC=NC=C1 FBLVQXITSLUNLI-UHFFFAOYSA-N 0.000 description 2
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 159000000021 acetate salts Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000003177 cardiotonic effect Effects 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- 150000002905 orthoesters Chemical class 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000006513 pyridinyl methyl group Chemical group 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000012552 review Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical group CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- AAWZDTNXLSGCEK-UHFFFAOYSA-N 1,3,4,5-Tetrahydroxycyclohexanecarboxylic acid Chemical compound OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LCEJYTZYBXTSIX-UHFFFAOYSA-N 1-(2,6-dimethylpyridin-4-yl)propan-2-one Chemical compound CC(=O)CC1=CC(C)=NC(C)=C1 LCEJYTZYBXTSIX-UHFFFAOYSA-N 0.000 description 1
- KVBRNDROCOGHBU-UHFFFAOYSA-N 1-(2-methylpyridin-4-yl)propan-2-one Chemical compound CC(=O)CC1=CC=NC(C)=C1 KVBRNDROCOGHBU-UHFFFAOYSA-N 0.000 description 1
- RWNXXQFJBALKAX-UHFFFAOYSA-N 1-(dipropoxymethoxy)propane Chemical compound CCCOC(OCCC)OCCC RWNXXQFJBALKAX-UHFFFAOYSA-N 0.000 description 1
- TZTXTIBZSSSFDI-UHFFFAOYSA-N 1-pyridin-2-ylpropan-2-one Chemical compound CC(=O)CC1=CC=CC=N1 TZTXTIBZSSSFDI-UHFFFAOYSA-N 0.000 description 1
- WPDJRDYNRNXPBX-UHFFFAOYSA-N 1-pyridin-3-ylpropan-2-one Chemical compound CC(=O)CC1=CC=CN=C1 WPDJRDYNRNXPBX-UHFFFAOYSA-N 0.000 description 1
- HHKKDDOOJGFETF-UHFFFAOYSA-N 1-pyridin-4-ylpentan-2-one Chemical compound CCCC(=O)CC1=CC=NC=C1 HHKKDDOOJGFETF-UHFFFAOYSA-N 0.000 description 1
- DERAACKMMNJAFU-UHFFFAOYSA-N 2-ethoxy-1,3-dioxane-4,6-dione Chemical compound CCOC1OC(=O)CC(=O)O1 DERAACKMMNJAFU-UHFFFAOYSA-N 0.000 description 1
- MSNLSPMORDLFEW-UHFFFAOYSA-N 2-oxo-5-pyridin-2-yl-1h-pyridine-3-carboxylic acid Chemical compound N1C(=O)C(C(=O)O)=CC(C=2N=CC=CC=2)=C1 MSNLSPMORDLFEW-UHFFFAOYSA-N 0.000 description 1
- CMKWMYHEICJJHZ-UHFFFAOYSA-N 2-oxo-5-pyridin-4-yl-3h-pyridine-3-carboxylic acid Chemical compound C1=NC(=O)C(C(=O)O)C=C1C1=CC=NC=C1 CMKWMYHEICJJHZ-UHFFFAOYSA-N 0.000 description 1
- VNJJKSONSCWWRI-UHFFFAOYSA-N 3-pyridin-4-ylbut-3-en-2-one Chemical compound CC(=O)C(=C)C1=CC=NC=C1 VNJJKSONSCWWRI-UHFFFAOYSA-N 0.000 description 1
- SLTYHJNNPGXHGM-UHFFFAOYSA-N 4-ethoxy-3-pyridin-3-ylbut-3-en-2-one Chemical compound CC(=O)C(=COCC)C=1C=NC=CC=1 SLTYHJNNPGXHGM-UHFFFAOYSA-N 0.000 description 1
- PYEQXRGCKMHVDP-UHFFFAOYSA-N 4-methyl-2-oxo-5-pyridin-4-yl-1h-pyridine-3-carboxamide Chemical compound N1C(=O)C(C(N)=O)=C(C)C(C=2C=CN=CC=2)=C1 PYEQXRGCKMHVDP-UHFFFAOYSA-N 0.000 description 1
- JCTPLVWHJQUYBY-UHFFFAOYSA-N 4-pyridin-4-ylbut-3-en-2-one Chemical compound CC(=O)C=CC1=CC=NC=C1 JCTPLVWHJQUYBY-UHFFFAOYSA-N 0.000 description 1
- FOFFCZXMXBBSHO-UHFFFAOYSA-N 6-ethyl-2-oxo-5-pyridin-4-yl-1h-pyridine-3-carboxylic acid Chemical compound N1C(=O)C(C(O)=O)=CC(C=2C=CN=CC=2)=C1CC FOFFCZXMXBBSHO-UHFFFAOYSA-N 0.000 description 1
- GOZQHIFDQHUGLH-UHFFFAOYSA-N CCC(=O)C(C)C(COCC)C1=CC=NC=C1 Chemical compound CCC(=O)C(C)C(COCC)C1=CC=NC=C1 GOZQHIFDQHUGLH-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical class NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 235000019887 Solka-Floc® Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- ZEMAAYXNKBMRGV-UHFFFAOYSA-N diethyl 2-(ethoxymethyl)propanedioate Chemical compound CCOCC(C(=O)OCC)C(=O)OCC ZEMAAYXNKBMRGV-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical class CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- AHNJTQYTRPXLLG-UHFFFAOYSA-N lithium;diethylazanide Chemical compound [Li+].CC[N-]CC AHNJTQYTRPXLLG-UHFFFAOYSA-N 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 235000005152 nicotinamide Nutrition 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/50—Ketonic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/381,162 US4417054A (en) | 1982-05-24 | 1982-05-24 | 2-(Lower-alkoxy)-1-(pyridinyl)ethenyl lower-alkyl ketones |
| US38106282 | 1982-05-24 | ||
| US06/381,062 US4413127A (en) | 1982-05-24 | 1982-05-24 | Preparation of 1,2-dihydro-6-(lower alkyl)-2-oxo-5-(pyridinyl)nicotinonitriles |
| US38116282 | 1982-05-24 | ||
| US47196183 | 1983-03-03 | ||
| US06/471,961 US4469871A (en) | 1982-05-24 | 1983-03-03 | Process for preparing 2-(lower-alkoxy)-1-(pyridinyl) ethenyl lower-alkyl ketones |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI831730A0 FI831730A0 (fi) | 1983-05-17 |
| FI831730L FI831730L (fi) | 1983-11-25 |
| FI80021B FI80021B (fi) | 1989-12-29 |
| FI80021C true FI80021C (fi) | 1990-04-10 |
Family
ID=27409519
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI831730A FI80021C (fi) | 1982-05-24 | 1983-05-17 | Foerfarande foer framstaellning av nikotinsyranitriler samt vid deras framstaellning anvaendbara mellanprodukter. |
Country Status (14)
| Country | Link |
|---|---|
| EP (1) | EP0095152B1 (index.php) |
| KR (2) | KR880002354B1 (index.php) |
| AU (1) | AU559149B2 (index.php) |
| DE (1) | DE3367091D1 (index.php) |
| DK (1) | DK157488C (index.php) |
| ES (2) | ES8506693A1 (index.php) |
| FI (1) | FI80021C (index.php) |
| GR (1) | GR78573B (index.php) |
| HK (1) | HK79591A (index.php) |
| IE (1) | IE55135B1 (index.php) |
| IL (1) | IL68671A (index.php) |
| NO (1) | NO163008C (index.php) |
| NZ (1) | NZ204175A (index.php) |
| PT (1) | PT76710B (index.php) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4976774A (en) * | 1984-07-20 | 1990-12-11 | The Board Of Governors For Higher Education, State Of Rhode Island And Providence Plantations | 1-(4'-pyridyl)-4-pyridone, its derivatives and herbicidal use thereof |
| CN111377858B (zh) * | 2018-12-30 | 2023-04-07 | 鲁南制药集团股份有限公司 | 一种米力农的制备方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2824121A (en) * | 1954-11-04 | 1958-02-18 | Kay Fries Chemicals Inc | Process for preparation of oxy alkylidene compounds |
| US4072746A (en) * | 1975-10-14 | 1978-02-07 | Sterling Drug Inc. | 3-Amino-5-(pyridinyl)-2(1H)-pyridinones |
| DE2909287A1 (de) * | 1979-03-09 | 1980-09-18 | Bayer Ag | 3-substituierte pyridin-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| US4223149A (en) * | 1979-07-26 | 1980-09-16 | Sterling Drug Inc. | Process for producing 3-cyano-5-(pyridinyl)-2(1H)-pyridinones |
| US4313951A (en) * | 1979-11-26 | 1982-02-02 | Sterling Drug Inc. | 3-Substituted-6-(lower-alkyl)-5-(pyridinyl)-2(1H)-pyridinones, their cardiotonic use and intermediates therefor |
| US4310670A (en) * | 1980-02-26 | 1982-01-12 | Sterling Drug Inc. | Low-temperature, aqueous conversion of 4-picoline derivative to 5-cyano-[3,4'-bipyridin]-6(1H)-one |
| NZ196573A (en) * | 1980-03-28 | 1984-03-16 | Sterling Drug Inc | 6-pyrid-(3 or 4)-yl-(1h or 3h)-imidazo (4,5-b)pyridines |
| US4347363A (en) * | 1981-09-17 | 1982-08-31 | Sterling Drug Inc. | Process for preparing 1,2-dihydro-6-methyl-2-oxo-5-(pyridinyl)nicotinonitriles |
-
1983
- 1983-05-09 NZ NZ204175A patent/NZ204175A/xx unknown
- 1983-05-09 NO NO831638A patent/NO163008C/no not_active IP Right Cessation
- 1983-05-10 AU AU14423/83A patent/AU559149B2/en not_active Expired
- 1983-05-12 IL IL68671A patent/IL68671A/xx not_active IP Right Cessation
- 1983-05-17 FI FI831730A patent/FI80021C/fi not_active IP Right Cessation
- 1983-05-17 PT PT76710A patent/PT76710B/pt unknown
- 1983-05-17 IE IE1155/83A patent/IE55135B1/en not_active IP Right Cessation
- 1983-05-18 ES ES522506A patent/ES8506693A1/es not_active Expired
- 1983-05-18 KR KR1019830002192A patent/KR880002354B1/ko not_active Expired
- 1983-05-18 KR KR1019880012161D patent/KR890001543B1/ko not_active Expired
- 1983-05-18 GR GR71382A patent/GR78573B/el unknown
- 1983-05-19 DK DK224283A patent/DK157488C/da not_active IP Right Cessation
- 1983-05-19 DE DE8383104984T patent/DE3367091D1/de not_active Expired
- 1983-05-19 EP EP83104984A patent/EP0095152B1/en not_active Expired
-
1984
- 1984-09-17 ES ES535990A patent/ES8601132A1/es not_active Expired
-
1991
- 1991-10-10 HK HK795/91A patent/HK79591A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IE831155L (en) | 1983-11-24 |
| PT76710A (en) | 1983-06-01 |
| DK157488B (da) | 1990-01-15 |
| NZ204175A (en) | 1985-12-13 |
| PT76710B (en) | 1985-12-27 |
| EP0095152A1 (en) | 1983-11-30 |
| KR850001191A (ko) | 1985-03-16 |
| ES535990A0 (es) | 1985-10-16 |
| IE55135B1 (en) | 1990-06-06 |
| KR880002354B1 (ko) | 1988-10-29 |
| FI80021B (fi) | 1989-12-29 |
| DK224283D0 (da) | 1983-05-19 |
| AU559149B2 (en) | 1987-02-26 |
| DK157488C (da) | 1990-06-11 |
| EP0095152B1 (en) | 1986-10-22 |
| DK224283A (da) | 1983-11-25 |
| NO163008C (no) | 1990-03-21 |
| ES8601132A1 (es) | 1985-10-16 |
| FI831730A0 (fi) | 1983-05-17 |
| ES522506A0 (es) | 1985-08-01 |
| IL68671A0 (en) | 1983-09-30 |
| IL68671A (en) | 1986-07-31 |
| HK79591A (en) | 1991-10-18 |
| GR78573B (index.php) | 1984-09-27 |
| NO831638L (no) | 1983-11-25 |
| FI831730L (fi) | 1983-11-25 |
| NO163008B (no) | 1989-12-11 |
| ES8506693A1 (es) | 1985-08-01 |
| KR890001543B1 (ko) | 1989-05-08 |
| AU1442383A (en) | 1983-12-01 |
| DE3367091D1 (en) | 1986-11-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU999971A3 (ru) | Способ получени производных пиримидона-4 или их кислотно-аддитивных солей | |
| DK151331B (da) | Analogifremgangsmaade til fremstilling af 5-pyridinyl-2(1h)-pyridinon-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| JPH0127064B2 (index.php) | ||
| CS183291A3 (en) | Process for preparing substituted and unsubstituted 2,3-pyridine carboxylate | |
| HU180081B (en) | Process for producing hystamine antagonic 2-amino-pirimidone derivatives | |
| FI80021C (fi) | Foerfarande foer framstaellning av nikotinsyranitriler samt vid deras framstaellning anvaendbara mellanprodukter. | |
| US4504482A (en) | [5(or 4)-(Pyridinyl)-2-pyrimidinyl]ureas and cardiotonic use thereof | |
| US4469871A (en) | Process for preparing 2-(lower-alkoxy)-1-(pyridinyl) ethenyl lower-alkyl ketones | |
| JP4097291B2 (ja) | 置換バリンアミド誘導体の製造方法 | |
| JP3219946B2 (ja) | 新規製造中間体及びピリジン誘導体の製造方法 | |
| US4417054A (en) | 2-(Lower-alkoxy)-1-(pyridinyl)ethenyl lower-alkyl ketones | |
| LU82648A1 (fr) | Procede de preparation de 1,2-dihydro-2-oxo-5-(pyridinyl)nicotinonitriles | |
| US4305943A (en) | 4-Amino-6-(pyridinyl)-3(2H)-pyridazinones and their use as cardiotonics | |
| RU2228929C2 (ru) | Способ получения 3s-3-амино-3-пиридилпропионовой кислоты и ее производных и промежуточное вещество | |
| US4346221A (en) | Preparation of 4-amino-6-(pyridinyl)-3(2H)-pyridazinones from 6-(pyridinyl)-3(2H)-pyridazinones | |
| US4337253A (en) | 4,5-Dihydro-2-methyl-6-(4-pyridinyl)-3(2H)-pyridazinone and its use as a cardiotonic | |
| US4304776A (en) | 4-Substituted-6-(pyridinyl)-3(2h)-pyridazinones and their use as intermediates and cardiotonics | |
| US4304775A (en) | 3-Hydrazino-6-(pyridinyl) pyridazines and cardiotonic use thereof | |
| US4560753A (en) | 2-Substituted-pyrido[2,3-d]pyrimidin-5(8H)-ones | |
| US4338446A (en) | Di-(lower-alkyl)hydroxy-[2-oxo-2-(pyridinyl)ethyl]-propanedioates | |
| FI76787C (fi) | Foerfarande foer framstaellning av 5-(cyan eller karbamyl)-/3-4'-bipyridin/-6(1h)-on och iminiumsalt till anvaendning som mellanprodukt i foerfarandet. | |
| SE451722B (sv) | 1-pyridinyl-2-(dialkylamino)-etenyl-alkylketoner anvendbara som intermediater vid framstellning av pyridinoner med kardiotoniska egenskaper | |
| FI77851C (fi) | 1-pyridinyl-2- (dialkylamino)etenylalkylketoner. | |
| US4354026A (en) | 3-Chloro-6-(pyridinyl)-pyridazines | |
| SU1020003A3 (ru) | Способ получени производных пиримидона |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| TC | Name/ company changed in patent |
Owner name: SANOFI PHARMACEUTICALS, INC. |
|
| PC | Transfer of assignment of patent |
Owner name: SANOFI PHARMACEUTICALS, INC. |
|
| MA | Patent expired |
Owner name: SANOFI-SYNTHELABO INC. |