FI75147C - Icke-joniska 5-c-substituerade 2,4,6-trijod-isoftalsyraderivat och framstaellning daerav. - Google Patents
Icke-joniska 5-c-substituerade 2,4,6-trijod-isoftalsyraderivat och framstaellning daerav. Download PDFInfo
- Publication number
- FI75147C FI75147C FI810031A FI810031A FI75147C FI 75147 C FI75147 C FI 75147C FI 810031 A FI810031 A FI 810031A FI 810031 A FI810031 A FI 810031A FI 75147 C FI75147 C FI 75147C
- Authority
- FI
- Finland
- Prior art keywords
- acid
- theory
- yield
- methyl
- dihydroxypropyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 36
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 4
- 239000002585 base Substances 0.000 claims description 35
- YLJAKJSGUDBOHG-UHFFFAOYSA-N 2,4,6-triiodobenzene-1,3,5-tricarboxylic acid Chemical group OC(=O)C1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I YLJAKJSGUDBOHG-UHFFFAOYSA-N 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 21
- 239000002872 contrast media Substances 0.000 claims description 19
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 17
- KHTGTPXXKOLMEH-UHFFFAOYSA-N 5-carbamoyl-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical group NC(=O)C1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I KHTGTPXXKOLMEH-UHFFFAOYSA-N 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 15
- 239000007864 aqueous solution Substances 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 230000008569 process Effects 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000002168 alkylating agent Substances 0.000 claims description 2
- 229940100198 alkylating agent Drugs 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 150000001470 diamides Chemical class 0.000 claims 3
- 125000004429 atom Chemical group 0.000 claims 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 46
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 35
- 238000003756 stirring Methods 0.000 description 31
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- -1 5-C-substituted 2,4,6-triiodoisophthalic acid Chemical class 0.000 description 25
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 17
- 238000007112 amidation reaction Methods 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Substances [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 13
- 239000007858 starting material Substances 0.000 description 13
- DAMMTPUDAGMEIL-UHFFFAOYSA-N 5-cyano-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I DAMMTPUDAGMEIL-UHFFFAOYSA-N 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- 230000009435 amidation Effects 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 7
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 239000002243 precursor Substances 0.000 description 7
- 235000010288 sodium nitrite Nutrition 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 125000003368 amide group Chemical group 0.000 description 6
- 125000004093 cyano group Chemical group *C#N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 238000007127 saponification reaction Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- SWNDUEDARACPMW-UHFFFAOYSA-N 1-(methylamino)propane-1,1-diol Chemical compound CCC(O)(O)NC SWNDUEDARACPMW-UHFFFAOYSA-N 0.000 description 4
- 239000000370 acceptor Substances 0.000 description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 4
- 238000003384 imaging method Methods 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical group CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- QEKPBYCXURULNE-UHFFFAOYSA-N 2-aminopropane-1,1-diol Chemical compound CC(N)C(O)O QEKPBYCXURULNE-UHFFFAOYSA-N 0.000 description 3
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000002583 angiography Methods 0.000 description 3
- 150000001491 aromatic compounds Chemical class 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 210000003743 erythrocyte Anatomy 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- UEQABUISLVYURQ-UHFFFAOYSA-N 2,4,6-triiodobenzene-1,3,5-tricarbonyl chloride Chemical compound ClC(=O)C1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I UEQABUISLVYURQ-UHFFFAOYSA-N 0.000 description 2
- SRBNFMSMBDTDQR-UHFFFAOYSA-N 3,5-dicarbamoyl-2,4,6-triiodobenzoic acid Chemical compound NC(=O)C1=C(I)C(C(N)=O)=C(I)C(C(O)=O)=C1I SRBNFMSMBDTDQR-UHFFFAOYSA-N 0.000 description 2
- XDQVNEPRVOLVJW-UHFFFAOYSA-N 3,5-dicyano-2,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C(C#N)=C(I)C(C#N)=C1I XDQVNEPRVOLVJW-UHFFFAOYSA-N 0.000 description 2
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 2
- FSIGSEQSDOYJFY-UHFFFAOYSA-N 5-cyano-2,4,6-triiodobenzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=C(I)C(C#N)=C(I)C(C(Cl)=O)=C1I FSIGSEQSDOYJFY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 239000004157 Nitrosyl chloride Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- RXDLGFMMQFNVLI-UHFFFAOYSA-N [Na].[Na].[Ca] Chemical compound [Na].[Na].[Ca] RXDLGFMMQFNVLI-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 2
- 238000006359 acetalization reaction Methods 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000003957 anion exchange resin Substances 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- OWMVSZAMULFTJU-UHFFFAOYSA-N bis-tris Chemical compound OCCN(CCO)C(CO)(CO)CO OWMVSZAMULFTJU-UHFFFAOYSA-N 0.000 description 2
- 239000003729 cation exchange resin Substances 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229940039231 contrast media Drugs 0.000 description 2
- 150000001879 copper Chemical class 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 125000001033 ether group Chemical group 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 230000002496 gastric effect Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000009608 myelography Methods 0.000 description 2
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 2
- 235000019392 nitrosyl chloride Nutrition 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 125000001749 primary amide group Chemical group 0.000 description 2
- 238000002601 radiography Methods 0.000 description 2
- 125000003156 secondary amide group Chemical group 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- PKPZZAVJXDZHDW-LJTMIZJLSA-N (2r,3r,4r,5s)-6-(methylamino)hexane-1,2,3,4,5-pentol;hydrochloride Chemical compound Cl.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO PKPZZAVJXDZHDW-LJTMIZJLSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- VMJNTFXCTXAXTC-UHFFFAOYSA-N 2,2-difluoro-1,3-benzodioxole-5-carbonitrile Chemical group C1=C(C#N)C=C2OC(F)(F)OC2=C1 VMJNTFXCTXAXTC-UHFFFAOYSA-N 0.000 description 1
- WCYKDIPEKAXBSK-UHFFFAOYSA-N 2,4,6-triiodo-5-(methylcarbamoyl)benzene-1,3-dicarboxylic acid Chemical compound CNC(=O)C1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I WCYKDIPEKAXBSK-UHFFFAOYSA-N 0.000 description 1
- IPHVGAPABXWWLO-UHFFFAOYSA-N 2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical class OC(=O)C1=C(I)C=C(I)C(C(O)=O)=C1I IPHVGAPABXWWLO-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- DFJACSJACSDRSG-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;calcium;sodium Chemical compound [Na].[Na].[Ca].OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O DFJACSJACSDRSG-UHFFFAOYSA-N 0.000 description 1
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 1
- SRXFDRZQJCOLAH-UHFFFAOYSA-N 2-amino-2-methylpropane-1,1,3-triol Chemical compound OCC(N)(C)C(O)O SRXFDRZQJCOLAH-UHFFFAOYSA-N 0.000 description 1
- ISYUEOQBUKAYBX-UHFFFAOYSA-N 2-aminoethanol;dihydrochloride Chemical compound Cl.Cl.NCCO ISYUEOQBUKAYBX-UHFFFAOYSA-N 0.000 description 1
- XCZKKZXWDBOGPA-UHFFFAOYSA-N 2-phenylbenzene-1,4-diol Chemical compound OC1=CC=C(O)C(C=2C=CC=CC=2)=C1 XCZKKZXWDBOGPA-UHFFFAOYSA-N 0.000 description 1
- YSWWITLPDXXKGO-UHFFFAOYSA-N 3-[bis(2-hydroxyethyl)carbamoyl]-5-cyano-2,4,6-triiodobenzoic acid Chemical compound OCCN(CCO)C(=O)C1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I YSWWITLPDXXKGO-UHFFFAOYSA-N 0.000 description 1
- AQUHOLYGJVTFOD-UHFFFAOYSA-N 3-acetamido-5-cyano-2,4,6-triiodobenzoic acid Chemical compound CC(=O)NC1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I AQUHOLYGJVTFOD-UHFFFAOYSA-N 0.000 description 1
- PMLGQXIKBPFHJZ-UHFFFAOYSA-N 3-aminobutane-1,2,4-triol Chemical compound OCC(N)C(O)CO PMLGQXIKBPFHJZ-UHFFFAOYSA-N 0.000 description 1
- PMSWABQMOYRMGV-UHFFFAOYSA-N 3-carbamoyl-5-(2-hydroxyethylcarbamoyl)-2,4,6-triiodobenzoic acid Chemical compound NC(=O)C1=C(I)C(C(O)=O)=C(I)C(C(=O)NCCO)=C1I PMSWABQMOYRMGV-UHFFFAOYSA-N 0.000 description 1
- FBJFERLDRNCWAF-UHFFFAOYSA-N 3-carbamoyl-5-(dimethylcarbamoyl)-2,4,6-triiodobenzoic acid Chemical compound CN(C)C(=O)C1=C(I)C(C(N)=O)=C(I)C(C(O)=O)=C1I FBJFERLDRNCWAF-UHFFFAOYSA-N 0.000 description 1
- ILYPLPSVHXXMDS-UHFFFAOYSA-N 3-carbamoyl-5-[2-hydroxyethyl(methyl)carbamoyl]-2,4,6-triiodobenzoic acid Chemical compound OCCN(C)C(=O)C1=C(I)C(C(N)=O)=C(I)C(C(O)=O)=C1I ILYPLPSVHXXMDS-UHFFFAOYSA-N 0.000 description 1
- WRXPJJPJHDCFBH-UHFFFAOYSA-N 3-carbamoyl-5-cyano-2,4,6-triiodobenzoic acid Chemical compound NC(=O)C1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I WRXPJJPJHDCFBH-UHFFFAOYSA-N 0.000 description 1
- DOOSUBKMJXCJNJ-UHFFFAOYSA-N 3-cyano-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid Chemical compound CNC(=O)C1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I DOOSUBKMJXCJNJ-UHFFFAOYSA-N 0.000 description 1
- AIKIGMCZANIEFY-UHFFFAOYSA-N 3-cyano-5-(2,3-dihydroxypropylcarbamoyl)-2,4,6-triiodobenzoyl chloride Chemical compound OCC(O)CNC(=O)C1=C(I)C(C#N)=C(I)C(C(Cl)=O)=C1I AIKIGMCZANIEFY-UHFFFAOYSA-N 0.000 description 1
- LIEMEZIWWSBUQF-UHFFFAOYSA-N 3-cyano-5-(2-hydroxyethylcarbamoyl)-2,4,6-triiodobenzoic acid Chemical compound OCCNC(=O)C1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I LIEMEZIWWSBUQF-UHFFFAOYSA-N 0.000 description 1
- AKRANBXVBGMKLM-UHFFFAOYSA-N 3-cyano-5-(hydroxymethyl)-2,4,6-triiodobenzoic acid Chemical compound OCC1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I AKRANBXVBGMKLM-UHFFFAOYSA-N 0.000 description 1
- XQEFFEKXCKNRKX-UHFFFAOYSA-N 3-cyano-5-[2-hydroxyethyl(methyl)carbamoyl]-2,4,6-triiodobenzoic acid Chemical compound OCCN(C)C(=O)C1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I XQEFFEKXCKNRKX-UHFFFAOYSA-N 0.000 description 1
- ASKVWXSOWXHYFI-UHFFFAOYSA-N 4-amino-2,5,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound NC1=C(I)C(I)=C(C(O)=O)C(I)=C1C(O)=O ASKVWXSOWXHYFI-UHFFFAOYSA-N 0.000 description 1
- JUTYTUPERDUCJI-UHFFFAOYSA-N 5-(dimethylcarbamoyl)-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound CN(C)C(=O)C1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I JUTYTUPERDUCJI-UHFFFAOYSA-N 0.000 description 1
- JEZJSNULLBSYHV-UHFFFAOYSA-N 5-amino-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I JEZJSNULLBSYHV-UHFFFAOYSA-N 0.000 description 1
- WHOWWQUQUAXBHH-UHFFFAOYSA-N 5-carbamoyl-2,4,6-triiodobenzene-1,3-dicarbonyl chloride Chemical compound NC(=O)C1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I WHOWWQUQUAXBHH-UHFFFAOYSA-N 0.000 description 1
- UTGUDNBBTXBIQH-UHFFFAOYSA-N 5-carbonochloridoyl-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=C(I)C(C(O)=O)=C(I)C(C(Cl)=O)=C1I UTGUDNBBTXBIQH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-N Gluconic acid Natural products OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 1
- 102000008100 Human Serum Albumin Human genes 0.000 description 1
- 108091006905 Human Serum Albumin Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- YQNFBOJPTAXAKV-OMCISZLKSA-N Iopodic acid Chemical compound CN(C)\C=N\C1=C(I)C=C(I)C(CCC(O)=O)=C1I YQNFBOJPTAXAKV-OMCISZLKSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- DTAFLBZLAZYRDX-UHFFFAOYSA-N OOOOOO Chemical compound OOOOOO DTAFLBZLAZYRDX-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 238000000297 Sandmeyer reaction Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 description 1
- XXFXTBNFFMQVKJ-UHFFFAOYSA-N [diphenyl(trityloxy)methyl]benzene Chemical class C=1C=CC=CC=1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)OC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 XXFXTBNFFMQVKJ-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000012042 active reagent Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- FYXKZNLBZKRYSS-UHFFFAOYSA-N benzene-1,2-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C(Cl)=O FYXKZNLBZKRYSS-UHFFFAOYSA-N 0.000 description 1
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 231100000045 chemical toxicity Toxicity 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 238000002405 diagnostic procedure Methods 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical class [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940009662 edetate Drugs 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 229960002442 glucosamine Drugs 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002497 iodine compounds Chemical class 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229940029409 ipodate Drugs 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000005907 ketalization reaction Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000004304 potassium nitrite Substances 0.000 description 1
- 235000010289 potassium nitrite Nutrition 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229940037001 sodium edetate Drugs 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- KUCXZFXESBSRSM-UHFFFAOYSA-M sodium;3,5-dicarbamoyl-2,4,6-triiodobenzoate Chemical compound [Na+].NC(=O)C1=C(I)C(C(N)=O)=C(I)C(C([O-])=O)=C1I KUCXZFXESBSRSM-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
- 238000007487 urography Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/64—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings
- C07C233/67—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/68—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/69—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom of an acyclic saturated carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Polyesters Or Polycarbonates (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
- Polyurethanes Or Polyureas (AREA)
- Dental Preparations (AREA)
- Physical Deposition Of Substances That Are Components Of Semiconductor Devices (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Medicines Containing Plant Substances (AREA)
- Steroid Compounds (AREA)
- Absorbent Articles And Supports Therefor (AREA)
- Investigating Or Analysing Biological Materials (AREA)
- Hydrogenated Pyridines (AREA)
- Detergent Compositions (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3001292 | 1980-01-11 | ||
| DE19803001292 DE3001292A1 (de) | 1980-01-11 | 1980-01-11 | Nichtionische 5-c-substituierte 2,4,6-trijod-isophthalsaeure-derivate |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI810031L FI810031L (fi) | 1981-07-12 |
| FI75147B FI75147B (fi) | 1988-01-29 |
| FI75147C true FI75147C (fi) | 1988-05-09 |
Family
ID=6092104
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI810031A FI75147C (fi) | 1980-01-11 | 1981-01-07 | Icke-joniska 5-c-substituerade 2,4,6-trijod-isoftalsyraderivat och framstaellning daerav. |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US5047228A (enFirst) |
| EP (1) | EP0032387B1 (enFirst) |
| JP (1) | JPS579741A (enFirst) |
| AT (1) | ATE5189T1 (enFirst) |
| AU (1) | AU546142B2 (enFirst) |
| CA (1) | CA1201126A (enFirst) |
| CS (2) | CS221815B2 (enFirst) |
| DD (1) | DD156969A5 (enFirst) |
| DE (2) | DE3001292A1 (enFirst) |
| DK (1) | DK159846C (enFirst) |
| EG (1) | EG15038A (enFirst) |
| ES (3) | ES8200647A1 (enFirst) |
| FI (1) | FI75147C (enFirst) |
| GR (1) | GR73164B (enFirst) |
| HU (1) | HU185234B (enFirst) |
| IE (1) | IE50805B1 (enFirst) |
| IL (1) | IL61873A (enFirst) |
| NO (1) | NO158182C (enFirst) |
| PT (1) | PT72326B (enFirst) |
| YU (2) | YU326680A (enFirst) |
| ZA (1) | ZA81150B (enFirst) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS56127373A (en) * | 1980-01-31 | 1981-10-06 | Univ California | Novel amino-dioxepane intermediate for synthesizing novel nonionic contrast agent |
| FR2512014A1 (fr) * | 1981-08-28 | 1983-03-04 | Guerbet Sa | Composes bromes utilisables dans des produits opacifiants |
| US4567034A (en) * | 1984-09-07 | 1986-01-28 | E. R. Squibb & Sons, Inc. | Esters of diatrizoic acid as X-ray contrast agents |
| IL94718A (en) * | 1989-07-05 | 1994-10-21 | Schering Ag | Non-ionic carboxamide contrast agent and method of preparation |
| US5698739A (en) * | 1989-07-05 | 1997-12-16 | Schering Aktiengesellschaft | Carboxamide non-ionic contrast media |
| US5463080A (en) * | 1992-08-27 | 1995-10-31 | Bracco International B.V. | 2,4,6-triiodo-1,3-benzenedicarboxylic acid compounds used as radiolabelling reagents |
| US5312616A (en) * | 1993-03-11 | 1994-05-17 | Sterling Winthrop Inc. | Compositions of iodobenzoic acid derivatives in film-forming materials for visualization of the gastrointestinal tract |
| US5344638A (en) * | 1993-03-11 | 1994-09-06 | Sterling Winthrop Inc. | Compositions of iodobenzoic acid derivatives for visualization of the gastrointestinal tract |
| US6310243B1 (en) * | 1994-09-23 | 2001-10-30 | Nycomed Imaging As | Iodinated x-ray contrast media |
| GB9419203D0 (en) * | 1994-09-23 | 1994-11-09 | Nycomed Innovation Ab | Contrast media |
| AU6114396A (en) * | 1995-06-16 | 1997-01-15 | Biophysica Foundation | Formyl derivatives as nonionic contrast media |
| US5742205A (en) * | 1995-07-27 | 1998-04-21 | Scientific-Atlanta, Inc. | Field effect transistor cable television line amplifier |
| DE60020960T2 (de) * | 1999-04-30 | 2006-05-24 | Amersham Health As | Kontrastmittel |
| US6660248B2 (en) | 2000-11-10 | 2003-12-09 | William Marsh Rice University | Fullerene (C60)-based X-ray contrast agent for diagnostic imaging |
| US7166740B2 (en) | 2003-07-14 | 2007-01-23 | Schering Ag | Process for the production of triiodotrimesic acid |
| US7083516B2 (en) * | 2003-07-14 | 2006-08-01 | Schering Ag | Process for the production of triiodotrimesic acid |
| DE10332552B3 (de) * | 2003-07-14 | 2005-03-24 | Schering Ag | Verfahren zur Herstellung von Triiodtrimesinsäure |
| DE10332574B3 (de) * | 2003-07-14 | 2005-04-14 | Schering Ag | Verfahren zur Herstellung von Triiodtrimesinsäure |
| JP2005037464A (ja) * | 2003-07-16 | 2005-02-10 | Matsushita Electric Ind Co Ltd | 光導波路とその製造方法 |
| US20060009694A1 (en) * | 2004-05-17 | 2006-01-12 | Yousefzadeh David K | Methods of attenuating internal radiation exposure |
| EA011516B1 (ru) | 2005-01-13 | 2009-04-28 | Синвеншен Аг | Композиционный материал и способ его изготовления |
| US20080206862A1 (en) * | 2007-02-28 | 2008-08-28 | Cinvention Ag | High surface cultivation system bag |
| CA2677699A1 (en) * | 2007-02-28 | 2008-09-04 | Cinvention Ag | High surface cultivation system |
| DE102007058220A1 (de) | 2007-12-03 | 2009-06-04 | Bayer Schering Pharma Aktiengesellschaft | Dimere macrocyclisch substituierte Benzolderivate |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR7020080D0 (pt) * | 1969-06-27 | 1973-03-13 | Nyegaard & Co As | Processo para a preparacao de agentes de contraste para raio x |
| US4021481A (en) * | 1969-06-27 | 1977-05-03 | Nyegaard & Co. A/S | Amido derivatives of 2,4,6-triiodobenzoic acids containing at least one N-hydroxyalkyl and at least two hydroxyl groups |
| JPS5147702A (enFirst) * | 1974-10-18 | 1976-04-23 | Toyo Tire & Rubber Co | |
| CH608189A5 (enFirst) * | 1974-12-13 | 1978-12-29 | Savac Ag | |
| GB1491129A (en) * | 1975-06-04 | 1977-11-09 | Guerbet Sa | Iodo-benzene derivatives and an x-ray contrast medium containing them |
| GB1548594A (en) * | 1976-06-11 | 1979-07-18 | Nyegaard & Co As | Triiodoisophthalic acid amides |
| NL7905354A (nl) * | 1978-07-14 | 1980-01-16 | Schering Ag | Als roentgen-contrastmiddelen bruikbare trijoodbenzonitril-derivaten. |
-
1980
- 1980-01-11 DE DE19803001292 patent/DE3001292A1/de not_active Withdrawn
- 1980-12-24 YU YU03266/80A patent/YU326680A/xx unknown
- 1980-12-30 ES ES498252A patent/ES8200647A1/es not_active Expired
-
1981
- 1981-01-07 FI FI810031A patent/FI75147C/fi not_active IP Right Cessation
- 1981-01-07 IL IL61873A patent/IL61873A/xx unknown
- 1981-01-07 DD DD81226868A patent/DD156969A5/de unknown
- 1981-01-08 PT PT72326A patent/PT72326B/pt unknown
- 1981-01-09 ZA ZA00810150A patent/ZA81150B/xx unknown
- 1981-01-09 IE IE35/81A patent/IE50805B1/en not_active IP Right Cessation
- 1981-01-09 EP EP81100106A patent/EP0032387B1/de not_active Expired
- 1981-01-09 CA CA000368163A patent/CA1201126A/en not_active Expired
- 1981-01-09 HU HU8157A patent/HU185234B/hu unknown
- 1981-01-09 CS CS819230A patent/CS221815B2/cs unknown
- 1981-01-09 DK DK008881A patent/DK159846C/da not_active IP Right Cessation
- 1981-01-09 NO NO810069A patent/NO158182C/no unknown
- 1981-01-09 GR GR63834A patent/GR73164B/el unknown
- 1981-01-09 AU AU66096/81A patent/AU546142B2/en not_active Ceased
- 1981-01-09 CS CS81204A patent/CS221814B2/cs unknown
- 1981-01-09 AT AT81100106T patent/ATE5189T1/de not_active IP Right Cessation
- 1981-01-09 DE DE8181100106T patent/DE3161294D1/de not_active Expired
- 1981-01-11 EG EG8107A patent/EG15038A/xx active
- 1981-01-12 JP JP219581A patent/JPS579741A/ja active Granted
- 1981-02-13 ES ES499406A patent/ES8203335A1/es not_active Expired
- 1981-02-13 ES ES499409A patent/ES8201958A1/es not_active Expired
-
1983
- 1983-04-19 YU YU00891/83A patent/YU89183A/xx unknown
-
1989
- 1989-03-02 US US07/318,454 patent/US5047228A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI75147C (fi) | Icke-joniska 5-c-substituerade 2,4,6-trijod-isoftalsyraderivat och framstaellning daerav. | |
| FI73199C (fi) | Trijoderade isoftalsyradiamider anvaendbara saosom skuggivande substanser i roentgenkontrastmedel, foerfarande foer framstaellning av dessa samt roentgenkontrastmedel som innehaoller dessa. | |
| US3701771A (en) | N-(2,4,6-triiodobenzoyl)-sugar amines | |
| US4239747A (en) | Dicarboxylic acid bis(3,5-dicarbamoyl-2,4,6-triiodoanilides) useful as x-ray contrast agents | |
| FI93208B (fi) | Dikarboksyylihappo-bis(3,5-dikarbamoyyli-2,4,6-trijodianilideja), menetelmä niiden valmistamiseksi sekä niitä sisältävät röntgenvarjoaineet | |
| JP5290773B2 (ja) | 造影剤 | |
| US5698739A (en) | Carboxamide non-ionic contrast media | |
| RU2147592C1 (ru) | Иодсодержащие дендримерные полимеры, способ их получения и диагностическое средство для рентгенодиагностики | |
| JP3249112B2 (ja) | 非イオン性化合物及び該化合物を含有する放射線造影剤組成物 | |
| FI93209B (fi) | Substituoituja dikarboksyylihappo-bis(3,5-dikarbamoyyli-2,4,6-trijodianilideja) menetelmä niiden valmistamiseksi sekä niiden käyttö röntgenvarjoaineiden valmistamiseksi | |
| US4328202A (en) | Ionic 5-C-substituted 2,4,6-triiodoisophthalic acid derivatives | |
| US3541141A (en) | Bis-triiodoisophthalamic acid compounds | |
| JPS63500522A (ja) | イオン性コントラスト媒体からの非イオン性ポリオ−ルコントラスト媒体 | |
| JPS6318574B2 (enFirst) | ||
| JP2807852B2 (ja) | 新規キレート化剤、該キレート化剤と金属原子との錯化合物及びそれを含む診断剤 | |
| CS223899B2 (cs) | Způsob výroby monoamidových sloučenin kyseliny 2,4,6-trijodisoftalové C-substituované v poloze 5 | |
| WO2008123779A1 (en) | Trisubstituted triazamacrocycli c compounds and their use as contrast agents | |
| WO2007055580A1 (en) | Contrast agents and diagnostic compositions based on iodine-containing cyanuric acid derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: SCHERING AKTIENGESELLSCHAFT |