FI62049C - Foerfarande foer framstaellning av indanderivat - Google Patents
Foerfarande foer framstaellning av indanderivat Download PDFInfo
- Publication number
- FI62049C FI62049C FI763625A FI763625A FI62049C FI 62049 C FI62049 C FI 62049C FI 763625 A FI763625 A FI 763625A FI 763625 A FI763625 A FI 763625A FI 62049 C FI62049 C FI 62049C
- Authority
- FI
- Finland
- Prior art keywords
- compound
- mixture
- added
- general formula
- solution
- Prior art date
Links
- -1 sulfonylmethyl Chemical group 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 25
- 239000002904 solvent Substances 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 239000002585 base Substances 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical class C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000003153 chemical reaction reagent Substances 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- AMECRMCTYSTXNV-UHFFFAOYSA-N isocyano(sulfonyl)methane Chemical compound O=S(=O)=C[N+]#[C-] AMECRMCTYSTXNV-UHFFFAOYSA-N 0.000 claims 1
- 230000011987 methylation Effects 0.000 claims 1
- 238000007069 methylation reaction Methods 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 51
- 239000000203 mixture Substances 0.000 description 42
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 238000000034 method Methods 0.000 description 18
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- 239000013078 crystal Substances 0.000 description 16
- 239000000284 extract Substances 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000004821 distillation Methods 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 238000001914 filtration Methods 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 238000011534 incubation Methods 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 238000000921 elemental analysis Methods 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 4
- WZAJBIXBRFTJRC-UHFFFAOYSA-N 4-(4-methylbenzoyl)-2,3-dihydro-1h-indene-1-carboxylic acid Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=CC2=C1CCC2C(O)=O WZAJBIXBRFTJRC-UHFFFAOYSA-N 0.000 description 4
- FXUBHWHRMVGJOG-UHFFFAOYSA-N 4-benzoyl-2,3-dihydro-1h-indene-1-carboxylic acid Chemical compound OC(=O)C1CCC2=C1C=CC=C2C(=O)C1=CC=CC=C1 FXUBHWHRMVGJOG-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- GREYVSOWISPLEK-UHFFFAOYSA-N 4-(4-methylbenzoyl)-2,3-dihydroinden-1-one Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=CC2=C1CCC2=O GREYVSOWISPLEK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 150000002468 indanes Chemical class 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 238000010183 spectrum analysis Methods 0.000 description 3
- MSSNFZVCPWFZHW-UHFFFAOYSA-N 4-(4-chlorobenzoyl)-2,3-dihydro-1h-indene-1-carboxylic acid Chemical compound OC(=O)C1CCC2=C1C=CC=C2C(=O)C1=CC=C(Cl)C=C1 MSSNFZVCPWFZHW-UHFFFAOYSA-N 0.000 description 2
- BAZOIHGIIQZVEN-UHFFFAOYSA-N 4-benzoyl-2,3-dihydroinden-1-one Chemical compound C=1C=CC=2C(=O)CCC=2C=1C(=O)C1=CC=CC=C1 BAZOIHGIIQZVEN-UHFFFAOYSA-N 0.000 description 2
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 2
- BKEWDCUQDVDPHC-UHFFFAOYSA-N 5-cyclohexyl-2,3-dihydro-1h-indene-1-carboxylic acid Chemical compound C=1C=C2C(C(=O)O)CCC2=CC=1C1CCCCC1 BKEWDCUQDVDPHC-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- OIRAEJWYWSAQNG-UHFFFAOYSA-N Clidanac Chemical compound ClC=1C=C2C(C(=O)O)CCC2=CC=1C1CCCCC1 OIRAEJWYWSAQNG-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- BBRYSETUUIQILU-UHFFFAOYSA-N 2,3-dihydro-1h-inden-1-yl-(4-methylphenyl)methanone Chemical compound C1=CC(C)=CC=C1C(=O)C1C2=CC=CC=C2CC1 BBRYSETUUIQILU-UHFFFAOYSA-N 0.000 description 1
- JBQMFBWTKWOSQX-UHFFFAOYSA-N 2,3-dihydro-1h-indene-1-carboxylic acid Chemical class C1=CC=C2C(C(=O)O)CCC2=C1 JBQMFBWTKWOSQX-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- FDRLLMAFDMQAJY-UHFFFAOYSA-N 4-(4-chlorobenzoyl)-2,3-dihydroinden-1-one Chemical compound C1=CC(Cl)=CC=C1C(=O)C1=CC=CC2=C1CCC2=O FDRLLMAFDMQAJY-UHFFFAOYSA-N 0.000 description 1
- BBJUVHSGARWBMB-UHFFFAOYSA-N 5-cyclohexyl-2,3-dihydroinden-1-one Chemical compound C=1C=C2C(=O)CCC2=CC=1C1CCCCC1 BBJUVHSGARWBMB-UHFFFAOYSA-N 0.000 description 1
- OXKUWKMVTHKKBG-UHFFFAOYSA-N 6-chloro-5-cyclohexyl-2,3-dihydroinden-1-one Chemical compound ClC1=CC=2C(=O)CCC=2C=C1C1CCCCC1 OXKUWKMVTHKKBG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- IUGLZXOLKUUORP-UHFFFAOYSA-N N-[[4-(4-methylbenzoyl)-2,3-dihydroinden-1-ylidene]-(4-methylphenyl)sulfonylmethyl]formamide Chemical compound C(=O)NC(=C1CCC2=C(C=CC=C12)C(C1=CC=C(C=C1)C)=O)S(=O)(=O)C1=CC=C(C)C=C1 IUGLZXOLKUUORP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- FJBFPHVGVWTDIP-UHFFFAOYSA-N dibromomethane Chemical compound BrCBr FJBFPHVGVWTDIP-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- QNXSIUBBGPHDDE-UHFFFAOYSA-N indan-1-one Chemical class C1=CC=C2C(=O)CCC2=C1 QNXSIUBBGPHDDE-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002527 isonitriles Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C61/00—Compounds having carboxyl groups bound to carbon atoms of rings other than six-membered aromatic rings
- C07C61/16—Unsaturated compounds
- C07C61/39—Unsaturated compounds containing six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP15235875 | 1975-12-19 | ||
| JP50152358A JPS6012341B2 (ja) | 1975-12-19 | 1975-12-19 | インダン誘導体の製造法 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI763625A7 FI763625A7 (de) | 1977-06-20 |
| FI62049B FI62049B (fi) | 1982-07-30 |
| FI62049C true FI62049C (fi) | 1982-11-10 |
Family
ID=15538786
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI763625A FI62049C (fi) | 1975-12-19 | 1976-12-17 | Foerfarande foer framstaellning av indanderivat |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS6012341B2 (de) |
| AT (1) | AT346837B (de) |
| AU (1) | AU505609B2 (de) |
| BE (1) | BE849561A (de) |
| CA (1) | CA1076139A (de) |
| CH (1) | CH603534A5 (de) |
| DE (1) | DE2656784A1 (de) |
| DK (1) | DK568476A (de) |
| ES (1) | ES454292A1 (de) |
| FI (1) | FI62049C (de) |
| FR (1) | FR2336371A1 (de) |
| GB (1) | GB1537906A (de) |
| GR (1) | GR62073B (de) |
| HU (1) | HU171842B (de) |
| MX (1) | MX3741E (de) |
| NL (1) | NL7614110A (de) |
| NO (1) | NO764290L (de) |
| SE (1) | SE419213B (de) |
| SU (1) | SU667127A3 (de) |
| ZA (1) | ZA767225B (de) |
-
1975
- 1975-12-19 JP JP50152358A patent/JPS6012341B2/ja not_active Expired
-
1976
- 1976-12-03 ZA ZA767225A patent/ZA767225B/xx unknown
- 1976-12-07 AT AT905576A patent/AT346837B/de not_active IP Right Cessation
- 1976-12-08 MX MX765197U patent/MX3741E/es unknown
- 1976-12-13 GB GB51889/76A patent/GB1537906A/en not_active Expired
- 1976-12-13 HU HU76TA00001420A patent/HU171842B/hu unknown
- 1976-12-14 GR GR52398A patent/GR62073B/el unknown
- 1976-12-14 AU AU20553/76A patent/AU505609B2/en not_active Expired
- 1976-12-15 DE DE19762656784 patent/DE2656784A1/de not_active Withdrawn
- 1976-12-16 ES ES454292A patent/ES454292A1/es not_active Expired
- 1976-12-16 CA CA268,042A patent/CA1076139A/en not_active Expired
- 1976-12-16 SE SE7614169A patent/SE419213B/xx unknown
- 1976-12-17 BE BE173403A patent/BE849561A/xx not_active IP Right Cessation
- 1976-12-17 FR FR7638182A patent/FR2336371A1/fr active Granted
- 1976-12-17 NL NL7614110A patent/NL7614110A/xx not_active Application Discontinuation
- 1976-12-17 NO NO764290A patent/NO764290L/no unknown
- 1976-12-17 CH CH1594676A patent/CH603534A5/xx not_active IP Right Cessation
- 1976-12-17 DK DK568476A patent/DK568476A/da unknown
- 1976-12-17 FI FI763625A patent/FI62049C/fi not_active IP Right Cessation
- 1976-12-17 SU SU762429706A patent/SU667127A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| SE419213B (sv) | 1981-07-20 |
| JPS5277044A (en) | 1977-06-29 |
| AU505609B2 (en) | 1979-11-29 |
| SE7614169L (sv) | 1977-06-20 |
| ZA767225B (en) | 1977-11-30 |
| SU667127A3 (ru) | 1979-06-05 |
| JPS6012341B2 (ja) | 1985-04-01 |
| HU171842B (hu) | 1978-03-28 |
| NO764290L (de) | 1977-06-21 |
| NL7614110A (nl) | 1977-06-21 |
| FR2336371A1 (fr) | 1977-07-22 |
| DE2656784A1 (de) | 1977-06-30 |
| FI62049B (fi) | 1982-07-30 |
| ES454292A1 (es) | 1977-12-16 |
| CH603534A5 (de) | 1978-08-31 |
| FR2336371B1 (de) | 1980-05-16 |
| GR62073B (en) | 1979-02-20 |
| MX3741E (es) | 1981-06-05 |
| AT346837B (de) | 1978-11-27 |
| CA1076139A (en) | 1980-04-22 |
| AU2055376A (en) | 1978-06-22 |
| DK568476A (da) | 1977-06-20 |
| BE849561A (fr) | 1977-06-17 |
| GB1537906A (en) | 1979-01-10 |
| FI763625A7 (de) | 1977-06-20 |
| ATA905576A (de) | 1978-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU182666B (en) | Process for preparing cyclobutanone derivatives | |
| JPH0794420B2 (ja) | 置換フェノキシアセトアルデヒドオキシム類の製造方法 | |
| NO163403B (no) | Trisubstituerte benzosyre-mellomprodukter. | |
| US2734904A (en) | Xcxnhxc-nh | |
| EP3265439B1 (de) | Verfahren zur herstellung von 3-chloro-2-vinylphenylsulfonaten | |
| US3997533A (en) | Process for the preparation of 7-acylamino-desacetoxycephalosporanic derivatives | |
| JP6702623B2 (ja) | メデトミジンの合成に有用な3−アリールブタナールなどの化合物の調製方法 | |
| FI62049C (fi) | Foerfarande foer framstaellning av indanderivat | |
| JPS6045631B2 (ja) | フエニルグリオキザル酸エステの製造法 | |
| EP0135304B1 (de) | Verfahren zur Herstellung von substituierten Benzamiden | |
| US4317920A (en) | Arylacetic acid derivatives | |
| US4186270A (en) | Process for making 2-(4-isobutylphenyl)propionic acid and related compounds | |
| NO139782B (no) | Fremgangsmaate til fremstilling av derivater av 3-benzoylfenyleddiksyre eller 2-(3-benzoylfenyl)-propionsyre | |
| FI66833C (fi) | Foerfarande och mellanprodukt foer framstaellning av fenylalkylkarboxylsyraderivat | |
| US4080505A (en) | α-Chlorocarboxylic acids | |
| US4925970A (en) | Process for producing cyclohexadiene thioether | |
| US4264500A (en) | Process of making 6-chloro-α-methyl-carbazole-2-acetic acid | |
| HU216093B (hu) | Eljárás 2,4,6-trimetil-fenil-ecetsav előállítására | |
| US4213905A (en) | Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid salts | |
| BE858864A (fr) | Nouveaux esters d'acides phenyl- et pyridine-3-carboxylique et procede permettant leur preparation | |
| EP0012512B1 (de) | Verfahren zur Herstellung von Alkyl- oder 2-Alkenyl-4,6-diacetyl-Resorcine; 2-Allyl-4,6-diacetyl-Recorcin | |
| FI56671C (fi) | Foerfarande foer framstaellning av indan-1-karboxylsyraderivat | |
| JPS644508B2 (de) | ||
| US3833573A (en) | Phenothiazine derivatives | |
| EP0309626A1 (de) | Verfahren zur Herstellung von Dibenzothiepin-Derivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: TAKEDA CHEMICAL INDUSTRIES, LTD. |