FI61482C - Foerfarande foer framstaellning av nya terapeutiskt anvaendbara n-aryl-n-(1-l-4-piperidinyl)-arylacetamider - Google Patents
Foerfarande foer framstaellning av nya terapeutiskt anvaendbara n-aryl-n-(1-l-4-piperidinyl)-arylacetamider Download PDFInfo
- Publication number
- FI61482C FI61482C FI762698A FI762698A FI61482C FI 61482 C FI61482 C FI 61482C FI 762698 A FI762698 A FI 762698A FI 762698 A FI762698 A FI 762698A FI 61482 C FI61482 C FI 61482C
- Authority
- FI
- Finland
- Prior art keywords
- parts
- piperidinyl
- phenyl
- formula
- compound
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 31
- 230000035764 nutrition Effects 0.000 title 1
- 235000016709 nutrition Nutrition 0.000 title 1
- 230000001225 therapeutic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 64
- 239000000203 mixture Substances 0.000 claims description 63
- -1 di-substituted phenyl Chemical group 0.000 claims description 61
- 150000003839 salts Chemical class 0.000 claims description 40
- 239000002253 acid Substances 0.000 claims description 32
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 26
- 239000000047 product Substances 0.000 claims description 26
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 229910052799 carbon Inorganic materials 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 13
- 239000007858 starting material Substances 0.000 claims description 13
- 125000006239 protecting group Chemical group 0.000 claims description 12
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims description 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 239000003960 organic solvent Substances 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- PZXDYQVSAFZTBI-UHFFFAOYSA-N n-(4-chlorophenyl)-2-phenyl-n-piperidin-4-ylacetamide Chemical compound C1=CC(Cl)=CC=C1N(C(=O)CC=1C=CC=CC=1)C1CCNCC1 PZXDYQVSAFZTBI-UHFFFAOYSA-N 0.000 claims description 8
- 238000005904 alkaline hydrolysis reaction Methods 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 150000001299 aldehydes Chemical class 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- IUKQLMGVFMDQDP-UHFFFAOYSA-N azane;piperidine Chemical group N.C1CCNCC1 IUKQLMGVFMDQDP-UHFFFAOYSA-N 0.000 claims description 2
- 239000012467 final product Substances 0.000 claims description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 claims description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 2
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims 2
- ORAWRMFWMOWNSJ-UHFFFAOYSA-N 2-(3-chlorophenyl)-N-(1-cyclohexylpiperidin-4-yl)-N-phenylacetamide Chemical compound ClC=1C=C(C=CC1)CC(=O)N(C1=CC=CC=C1)C1CCN(CC1)C1CCCCC1 ORAWRMFWMOWNSJ-UHFFFAOYSA-N 0.000 claims 1
- PYPMKORNJLTHGP-UHFFFAOYSA-N 2-(3-chlorophenyl)acetyl chloride Chemical compound ClC(=O)CC1=CC=CC(Cl)=C1 PYPMKORNJLTHGP-UHFFFAOYSA-N 0.000 claims 1
- 239000003086 colorant Substances 0.000 claims 1
- 238000009472 formulation Methods 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- NXQWJOQVXXKFON-UHFFFAOYSA-N n-(1-ethylpiperidin-4-yl)-2-phenylacetamide Chemical compound C1CN(CC)CCC1NC(=O)CC1=CC=CC=C1 NXQWJOQVXXKFON-UHFFFAOYSA-N 0.000 claims 1
- 125000003884 phenylalkyl group Chemical group 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 105
- 239000000243 solution Substances 0.000 description 68
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 60
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 59
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 57
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 57
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 44
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 41
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 39
- 239000011541 reaction mixture Substances 0.000 description 35
- 238000003756 stirring Methods 0.000 description 34
- 238000010992 reflux Methods 0.000 description 31
- 239000002585 base Substances 0.000 description 29
- 239000000706 filtrate Substances 0.000 description 27
- 239000000543 intermediate Substances 0.000 description 24
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 24
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 22
- 239000007787 solid Substances 0.000 description 22
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 21
- 239000000284 extract Substances 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- 229960001701 chloroform Drugs 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 17
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 16
- 239000000460 chlorine Substances 0.000 description 16
- 239000012458 free base Substances 0.000 description 16
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 16
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 13
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 13
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 12
- 238000001816 cooling Methods 0.000 description 12
- 239000003480 eluent Substances 0.000 description 11
- 229910000029 sodium carbonate Inorganic materials 0.000 description 11
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 150000001408 amides Chemical class 0.000 description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 9
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 9
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 6
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- 238000004440 column chromatography Methods 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 239000012279 sodium borohydride Substances 0.000 description 6
- 229910000033 sodium borohydride Inorganic materials 0.000 description 6
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 5
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical class OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 5
- 239000000908 ammonium hydroxide Substances 0.000 description 5
- 150000002825 nitriles Chemical class 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 235000011181 potassium carbonates Nutrition 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 238000010934 O-alkylation reaction Methods 0.000 description 3
- 238000005903 acid hydrolysis reaction Methods 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000002431 hydrogen Chemical group 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000002028 premature Effects 0.000 description 3
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 3
- 229930192474 thiophene Natural products 0.000 description 3
- WTOYUGZUPNQZHG-UHFFFAOYSA-N (4-anilino-1-benzylpiperidin-4-yl)methanol Chemical compound C1CC(CO)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 WTOYUGZUPNQZHG-UHFFFAOYSA-N 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- QBUUEBUUMUYSIY-UHFFFAOYSA-N 1-benzyl-4-(methoxymethyl)-n-phenylpiperidin-4-amine Chemical compound C1CC(COC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 QBUUEBUUMUYSIY-UHFFFAOYSA-N 0.000 description 2
- BGGKEDDFKBVTDK-UHFFFAOYSA-N 2-(3-methylphenyl)acetyl chloride Chemical compound CC1=CC=CC(CC(Cl)=O)=C1 BGGKEDDFKBVTDK-UHFFFAOYSA-N 0.000 description 2
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 2
- MKBOBWSGAIPQGV-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenyl-1-propan-2-ylpiperidin-4-amine Chemical compound C=1C=CC=CC=1NC1(COC)CCN(C(C)C)CC1 MKBOBWSGAIPQGV-UHFFFAOYSA-N 0.000 description 2
- MWJKXKBVWIHKOB-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenylpiperidin-4-amine Chemical compound C=1C=CC=CC=1NC1(COC)CCNCC1 MWJKXKBVWIHKOB-UHFFFAOYSA-N 0.000 description 2
- QNDVTIFLVWHAJR-UHFFFAOYSA-N 4-anilino-1-benzylpiperidine-4-carboxylic acid;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)O)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 QNDVTIFLVWHAJR-UHFFFAOYSA-N 0.000 description 2
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 2
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical compound CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- AIJULSRZWUXGPQ-UHFFFAOYSA-N Methylglyoxal Chemical compound CC(=O)C=O AIJULSRZWUXGPQ-UHFFFAOYSA-N 0.000 description 2
- 230000006181 N-acylation Effects 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001266 acyl halides Chemical class 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 150000004645 aluminates Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000003288 anthiarrhythmic effect Effects 0.000 description 2
- 239000011260 aqueous acid Substances 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- GPASGQWFOBSQJW-UHFFFAOYSA-N ethyl 4-(2,6-dimethyl-n-(2-phenylacetyl)anilino)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1N(C=1C(=CC=CC=1C)C)C(=O)CC1=CC=CC=C1 GPASGQWFOBSQJW-UHFFFAOYSA-N 0.000 description 2
- IEWGVRLUCGRTRP-UHFFFAOYSA-N ethyl 4-(4-chloro-n-(2-phenylacetyl)anilino)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=CC=C1 IEWGVRLUCGRTRP-UHFFFAOYSA-N 0.000 description 2
- WGJODELPMZVVJA-UHFFFAOYSA-N ethyl 4-anilino-1-benzylpiperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)OCC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 WGJODELPMZVVJA-UHFFFAOYSA-N 0.000 description 2
- LUBGFMZTGFXIIN-UHFFFAOYSA-N ethyl 4-oxopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)CC1 LUBGFMZTGFXIIN-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- PGHNBPLEZJYPMH-UHFFFAOYSA-N n-(1-benzylpiperidin-4-yl)pyridin-3-amine Chemical compound C=1C=CC=CC=1CN(CC1)CCC1NC1=CC=CN=C1 PGHNBPLEZJYPMH-UHFFFAOYSA-N 0.000 description 2
- JZMJTOMXVMWFES-UHFFFAOYSA-N n-(1-cyclopentylpiperidin-4-yl)pyrimidin-2-amine Chemical compound C1CCCC1N1CCC(NC=2N=CC=CN=2)CC1 JZMJTOMXVMWFES-UHFFFAOYSA-N 0.000 description 2
- CVTBGLRLBNLKPS-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-1-methylpiperidin-4-amine Chemical compound C1CN(C)CCC1NC1=C(C)C=CC=C1C CVTBGLRLBNLKPS-UHFFFAOYSA-N 0.000 description 2
- JLLCBWRGOGXRBX-UHFFFAOYSA-N n-(4-chlorophenyl)-1-propan-2-ylpiperidin-4-amine Chemical compound C1CN(C(C)C)CCC1NC1=CC=C(Cl)C=C1 JLLCBWRGOGXRBX-UHFFFAOYSA-N 0.000 description 2
- BGOHVARCGIKWKF-UHFFFAOYSA-N n-(4-chlorophenyl)-2-phenyl-n-piperidin-4-ylacetamide;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1N(C(=O)CC=1C=CC=CC=1)C1CCNCC1 BGOHVARCGIKWKF-UHFFFAOYSA-N 0.000 description 2
- HYVZYRXWWJQMTG-UHFFFAOYSA-N n-phenyl-1-propan-2-ylpiperidin-4-imine Chemical compound C1CN(C(C)C)CCC1=NC1=CC=CC=C1 HYVZYRXWWJQMTG-UHFFFAOYSA-N 0.000 description 2
- HQPSCRCCYZGOIV-UHFFFAOYSA-N n-piperidin-4-ylpyrimidin-2-amine Chemical compound C1CNCCC1NC1=NC=CC=N1 HQPSCRCCYZGOIV-UHFFFAOYSA-N 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- GJMLOLFRXRFRHB-WLHGVMLRSA-N (e)-but-2-enedioic acid;n-(1-cyclopentylpiperidin-4-yl)-2-(3-methylphenyl)-n-pyridin-3-ylacetamide Chemical compound OC(=O)\C=C\C(O)=O.CC1=CC=CC(CC(=O)N(C2CCN(CC2)C2CCCC2)C=2C=NC=CC=2)=C1 GJMLOLFRXRFRHB-WLHGVMLRSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QFHAQSIOWLYFSF-UHFFFAOYSA-N 1-(1-hydroxyethoxy)ethanol Chemical compound CC(O)OC(C)O QFHAQSIOWLYFSF-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 1
- SJZKULRDWHPHGG-UHFFFAOYSA-N 1-benzylpiperidin-4-one Chemical compound C1CC(=O)CCN1CC1=CC=CC=C1 SJZKULRDWHPHGG-UHFFFAOYSA-N 0.000 description 1
- CCDBCHAQIXKJCG-UHFFFAOYSA-N 1-propan-2-ylpiperidin-4-one Chemical compound CC(C)N1CCC(=O)CC1 CCDBCHAQIXKJCG-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- JDMFXJULNGEPOI-UHFFFAOYSA-N 2,6-dichloroaniline Chemical compound NC1=C(Cl)C=CC=C1Cl JDMFXJULNGEPOI-UHFFFAOYSA-N 0.000 description 1
- CJJURHKDGQSBLE-UHFFFAOYSA-N 2-(3,4-dichlorophenyl)acetyl chloride Chemical compound ClC(=O)CC1=CC=C(Cl)C(Cl)=C1 CJJURHKDGQSBLE-UHFFFAOYSA-N 0.000 description 1
- UMQUIRYNOVNYPA-UHFFFAOYSA-N 2-(4-chlorophenyl)acetyl chloride Chemical compound ClC(=O)CC1=CC=C(Cl)C=C1 UMQUIRYNOVNYPA-UHFFFAOYSA-N 0.000 description 1
- CXJOONIFSVSFAD-UHFFFAOYSA-N 2-(4-methoxyphenyl)acetyl chloride Chemical compound COC1=CC=C(CC(Cl)=O)C=C1 CXJOONIFSVSFAD-UHFFFAOYSA-N 0.000 description 1
- VRFJLUHAQPBTLE-UHFFFAOYSA-N 2-aminopiperidine-1-carboxylic acid Chemical compound NC1CCCCN1C(O)=O VRFJLUHAQPBTLE-UHFFFAOYSA-N 0.000 description 1
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 1
- KNSLGPATJQAECH-UHFFFAOYSA-N 2-phenylacetamide;hydrochloride Chemical compound Cl.NC(=O)CC1=CC=CC=C1 KNSLGPATJQAECH-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- PUFOFCNHIWPPNN-UHFFFAOYSA-N 4-anilino-1-benzylpiperidine-4-carboxamide Chemical compound C1CC(C(=O)N)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 PUFOFCNHIWPPNN-UHFFFAOYSA-N 0.000 description 1
- IBSJNAYBSKBCOW-UHFFFAOYSA-N 4-phenyl-1-propan-2-ylpiperidine Chemical compound C1CN(C(C)C)CCC1C1=CC=CC=C1 IBSJNAYBSKBCOW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 241000182988 Assa Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- UUHMFEJOVDGQTO-UHFFFAOYSA-N C1(=CC=CC=C1)CNC1C=NC=CC1=C1NCCCC1 Chemical compound C1(=CC=CC=C1)CNC1C=NC=CC1=C1NCCCC1 UUHMFEJOVDGQTO-UHFFFAOYSA-N 0.000 description 1
- KTJVPWVIRUDNBC-UHFFFAOYSA-N CC1=C(C(=CC=C1)C)C1CC(N(CC1)C(=O)OCC)N Chemical compound CC1=C(C(=CC=C1)C)C1CC(N(CC1)C(=O)OCC)N KTJVPWVIRUDNBC-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- APHVXPIHUCLDND-UHFFFAOYSA-N Cl.C(C)(=O)N.C1=CC=CC=C1 Chemical compound Cl.C(C)(=O)N.C1=CC=CC=C1 APHVXPIHUCLDND-UHFFFAOYSA-N 0.000 description 1
- SAOZQIAVVXAQFD-UHFFFAOYSA-N ClC=1C=C(SC1)CN(C(CC1=CC=CC=C1)=O)C1CCNCC1 Chemical compound ClC=1C=C(SC1)CN(C(CC1=CC=CC=C1)=O)C1CCNCC1 SAOZQIAVVXAQFD-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- JHLMNDSNKUZVFM-UHFFFAOYSA-N N1CCC(CC1)NC1CNCCC1 Chemical compound N1CCC(CC1)NC1CNCCC1 JHLMNDSNKUZVFM-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 1
- QHUZJFLMDIJMAJ-UHFFFAOYSA-N [Na].Cl.Cl Chemical compound [Na].Cl.Cl QHUZJFLMDIJMAJ-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- RMEDXOLNCUSCGS-UHFFFAOYSA-N droperidol Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CC=C(N2C(NC3=CC=CC=C32)=O)CC1 RMEDXOLNCUSCGS-UHFFFAOYSA-N 0.000 description 1
- 229960000394 droperidol Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- QMZDDBFLGAVLCG-UHFFFAOYSA-N ethyl 4-(2,6-dichlorophenyl)iminopiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1=NC1=C(Cl)C=CC=C1Cl QMZDDBFLGAVLCG-UHFFFAOYSA-N 0.000 description 1
- FDVHZWJXLOEMLH-UHFFFAOYSA-N ethyl 4-(2,6-dimethylanilino)piperidine-1-carboxylate;hydrochloride Chemical compound Cl.C1CN(C(=O)OCC)CCC1NC1=C(C)C=CC=C1C FDVHZWJXLOEMLH-UHFFFAOYSA-N 0.000 description 1
- MOVXNHXUSMSOGD-UHFFFAOYSA-N ethyl 4-(4-chloroanilino)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=CC=C(Cl)C=C1 MOVXNHXUSMSOGD-UHFFFAOYSA-N 0.000 description 1
- LIKFZBWZGQWAMR-UHFFFAOYSA-N ethyl 4-(pyridin-2-ylamino)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=CC=CC=N1 LIKFZBWZGQWAMR-UHFFFAOYSA-N 0.000 description 1
- JTDVIWLDSJAYEC-UHFFFAOYSA-N ethyl 4-(pyridin-2-ylamino)piperidine-1-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(C(=O)OCC)CCC1NC1=CC=CC=N1 JTDVIWLDSJAYEC-UHFFFAOYSA-N 0.000 description 1
- MULIJFXPCXLEPU-UHFFFAOYSA-N ethyl 4-pyridin-2-yliminopiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1=NC1=CC=CC=N1 MULIJFXPCXLEPU-UHFFFAOYSA-N 0.000 description 1
- BRJBQXWFFZKEJD-UHFFFAOYSA-N ethyl 4-pyrimidin-2-yliminopiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1=NC1=NC=CC=N1 BRJBQXWFFZKEJD-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229960002428 fentanyl Drugs 0.000 description 1
- IVLVTNPOHDFFCJ-UHFFFAOYSA-N fentanyl citrate Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C=1C=CC=CC=1N(C(=O)CC)C(CC1)CCN1CCC1=CC=CC=C1 IVLVTNPOHDFFCJ-UHFFFAOYSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- ZNBCKRDKBYESMW-UHFFFAOYSA-N methyl 4-(n-[2-(4-chlorophenyl)acetyl]anilino)-1-propan-2-ylpiperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C=1C=C(Cl)C=CC=1CC(=O)N(C=1C=CC=CC=1)C1(C(=O)OC)CCN(C(C)C)CC1 ZNBCKRDKBYESMW-UHFFFAOYSA-N 0.000 description 1
- NPNNCHCGYDKUTA-UHFFFAOYSA-N methyl 4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 NPNNCHCGYDKUTA-UHFFFAOYSA-N 0.000 description 1
- WIYLCEATVIZODY-UHFFFAOYSA-N methyl 4-anilino-1-propan-2-ylpiperidine-4-carboxylate Chemical compound C=1C=CC=CC=1NC1(C(=O)OC)CCN(C(C)C)CC1 WIYLCEATVIZODY-UHFFFAOYSA-N 0.000 description 1
- DVMSHHYWRCBCDO-UHFFFAOYSA-N methyl 4-anilinopiperidine-4-carboxylate Chemical compound C=1C=CC=CC=1NC1(C(=O)OC)CCNCC1 DVMSHHYWRCBCDO-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- NULMTSYISSJHAI-UHFFFAOYSA-N n,2-bis(4-chlorophenyl)-n-(1-ethylpiperidin-4-yl)acetamide;hydrochloride Chemical compound Cl.C1CN(CC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=C(Cl)C=C1 NULMTSYISSJHAI-UHFFFAOYSA-N 0.000 description 1
- JWZQOGXSBOXWCU-UHFFFAOYSA-N n,2-bis(4-chlorophenyl)-n-(1-propan-2-ylpiperidin-4-yl)acetamide Chemical compound C1CN(C(C)C)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=C(Cl)C=C1 JWZQOGXSBOXWCU-UHFFFAOYSA-N 0.000 description 1
- CFCQMLAMFCRMIO-UHFFFAOYSA-N n,2-bis(4-chlorophenyl)-n-(1-propylpiperidin-4-yl)acetamide Chemical compound C1CN(CCC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=C(Cl)C=C1 CFCQMLAMFCRMIO-UHFFFAOYSA-N 0.000 description 1
- XFXULBACFFSBLW-UHFFFAOYSA-N n,2-bis(4-chlorophenyl)-n-piperidin-4-ylacetamide Chemical compound C1=CC(Cl)=CC=C1CC(=O)N(C=1C=CC(Cl)=CC=1)C1CCNCC1 XFXULBACFFSBLW-UHFFFAOYSA-N 0.000 description 1
- QXQOYULBVHYPAP-UHFFFAOYSA-N n,2-diphenyl-n-(1-propan-2-ylpiperidin-4-yl)acetamide;hydrochloride Chemical compound Cl.C1CN(C(C)C)CCC1N(C=1C=CC=CC=1)C(=O)CC1=CC=CC=C1 QXQOYULBVHYPAP-UHFFFAOYSA-N 0.000 description 1
- NTEHWJBQADMGCG-UHFFFAOYSA-N n,n-dimethylformamide;nitrobenzene Chemical compound CN(C)C=O.[O-][N+](=O)C1=CC=CC=C1 NTEHWJBQADMGCG-UHFFFAOYSA-N 0.000 description 1
- AAGNDBZVXDLMJS-UHFFFAOYSA-N n-(1-cyclopentylpiperidin-4-yl)-2-(3-methylphenyl)-n-pyrimidin-2-ylacetamide;oxalic acid Chemical compound OC(=O)C(O)=O.CC1=CC=CC(CC(=O)N(C2CCN(CC2)C2CCCC2)C=2N=CC=CN=2)=C1 AAGNDBZVXDLMJS-UHFFFAOYSA-N 0.000 description 1
- MBDVECNSKKPYQB-UHFFFAOYSA-N n-(1-propan-2-ylpiperidin-4-yl)pyrimidin-2-amine Chemical compound C1CN(C(C)C)CCC1NC1=NC=CC=N1 MBDVECNSKKPYQB-UHFFFAOYSA-N 0.000 description 1
- KDTLBFKNCWWYHF-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-1-propylpiperidin-4-amine Chemical compound C1CN(CCC)CCC1NC1=C(C)C=CC=C1C KDTLBFKNCWWYHF-UHFFFAOYSA-N 0.000 description 1
- NYKYCCXAHBGMOF-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-2-phenyl-n-piperidin-4-ylacetamide Chemical compound CC1=CC=CC(C)=C1N(C(=O)CC=1C=CC=CC=1)C1CCNCC1 NYKYCCXAHBGMOF-UHFFFAOYSA-N 0.000 description 1
- VUIZXNOFBJYZET-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-2-phenyl-n-piperidin-4-ylacetamide;hydrobromide Chemical compound Br.CC1=CC=CC(C)=C1N(C(=O)CC=1C=CC=CC=1)C1CCNCC1 VUIZXNOFBJYZET-UHFFFAOYSA-N 0.000 description 1
- GJCQNXTVOLUQGH-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-n-(1-propylpiperidin-4-yl)-2-thiophen-2-ylacetamide Chemical compound C1CN(CCC)CCC1N(C=1C(=CC=CC=1C)C)C(=O)CC1=CC=CS1 GJCQNXTVOLUQGH-UHFFFAOYSA-N 0.000 description 1
- YBORSQLTSFNGCR-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-n-(1-propylpiperidin-4-yl)-2-thiophen-2-ylacetamide;dihydrochloride Chemical compound Cl.Cl.C1CN(CCC)CCC1N(C=1C(=CC=CC=1C)C)C(=O)CC1=CC=CS1 YBORSQLTSFNGCR-UHFFFAOYSA-N 0.000 description 1
- GCVDVSQZZZAYHM-UHFFFAOYSA-N n-(2,6-dimethylphenyl)piperidin-4-amine Chemical compound CC1=CC=CC(C)=C1NC1CCNCC1 GCVDVSQZZZAYHM-UHFFFAOYSA-N 0.000 description 1
- XDBCXBKGHRTYJO-UHFFFAOYSA-N n-(2,6-dimethylphenyl)piperidin-4-amine;dihydrobromide Chemical compound Br.Br.CC1=CC=CC(C)=C1NC1CCNCC1 XDBCXBKGHRTYJO-UHFFFAOYSA-N 0.000 description 1
- IDXQVTXVVVODGJ-UHFFFAOYSA-N n-(4-chlorophenyl)-1-prop-2-enylpiperidin-4-amine Chemical compound C1=CC(Cl)=CC=C1NC1CCN(CC=C)CC1 IDXQVTXVVVODGJ-UHFFFAOYSA-N 0.000 description 1
- CFHRNURGSMRQJF-UHFFFAOYSA-N n-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-n-(1-propan-2-ylpiperidin-4-yl)acetamide Chemical compound C1CN(C(C)C)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=C(Cl)C(Cl)=C1 CFHRNURGSMRQJF-UHFFFAOYSA-N 0.000 description 1
- PZCLNWWBKSADDQ-UHFFFAOYSA-N n-(4-chlorophenyl)-2-(3-methoxyphenyl)-n-piperidin-4-ylacetamide Chemical compound COC1=CC=CC(CC(=O)N(C2CCNCC2)C=2C=CC(Cl)=CC=2)=C1 PZCLNWWBKSADDQ-UHFFFAOYSA-N 0.000 description 1
- SZWWWQWPNRMACE-UHFFFAOYSA-N n-(4-chlorophenyl)-2-(4-hydroxyphenyl)-n-(1-propan-2-ylpiperidin-4-yl)acetamide;hydrochloride Chemical compound Cl.C1CN(C(C)C)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=C(O)C=C1 SZWWWQWPNRMACE-UHFFFAOYSA-N 0.000 description 1
- YKJGJUXPUWBJGE-UHFFFAOYSA-N n-(4-chlorophenyl)-2-(4-methylphenyl)-n-piperidin-4-ylacetamide Chemical compound C1=CC(C)=CC=C1CC(=O)N(C=1C=CC(Cl)=CC=1)C1CCNCC1 YKJGJUXPUWBJGE-UHFFFAOYSA-N 0.000 description 1
- FSFSWNBDCJVFGI-UHFFFAOYSA-N n-(4-chlorophenyl)-2-phenyl-n-(1-propan-2-ylpiperidin-4-yl)acetamide;hydron;chloride Chemical compound [Cl-].C1C[NH+](C(C)C)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=CC=C1 FSFSWNBDCJVFGI-UHFFFAOYSA-N 0.000 description 1
- UXSJDOSUZZIRQQ-UHFFFAOYSA-N n-(4-chlorophenyl)-2-phenyl-n-(1-propylpiperidin-4-yl)acetamide;hydrochloride Chemical compound Cl.C1CN(CCC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=CC=C1 UXSJDOSUZZIRQQ-UHFFFAOYSA-N 0.000 description 1
- RPYGYLFPBYZJTO-UHFFFAOYSA-N n-(4-chlorophenyl)-n-(1-ethylpiperidin-4-yl)-2-(3-methylphenyl)acetamide Chemical compound C1CN(CC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=CC(C)=C1 RPYGYLFPBYZJTO-UHFFFAOYSA-N 0.000 description 1
- HBKKNXYPMVLJNA-UHFFFAOYSA-N n-(4-chlorophenyl)-n-(1-ethylpiperidin-4-yl)-2-(4-fluorophenyl)acetamide Chemical compound C1CN(CC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=C(F)C=C1 HBKKNXYPMVLJNA-UHFFFAOYSA-N 0.000 description 1
- VXORAUIGBVEOOU-UHFFFAOYSA-N n-(4-chlorophenyl)-n-(1-ethylpiperidin-4-yl)-2-(4-methylphenyl)acetamide Chemical compound C1CN(CC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=C(C)C=C1 VXORAUIGBVEOOU-UHFFFAOYSA-N 0.000 description 1
- OKUKTFTVDGOSEF-UHFFFAOYSA-N n-(4-chlorophenyl)-n-(1-ethylpiperidin-4-yl)-2-phenylacetamide Chemical compound C1CN(CC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=CC=C1 OKUKTFTVDGOSEF-UHFFFAOYSA-N 0.000 description 1
- KCOHNRMFXQLTCW-UHFFFAOYSA-N n-(4-chlorophenyl)piperidin-4-amine Chemical compound C1=CC(Cl)=CC=C1NC1CCNCC1 KCOHNRMFXQLTCW-UHFFFAOYSA-N 0.000 description 1
- XSSYIBVJKPNELG-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-propan-2-ylpiperidin-4-yl]-n,2-diphenylacetamide;hydrochloride Chemical compound Cl.C=1C=CC=CC=1CC(=O)N(C=1C=CC=CC=1)C1(COC)CCN(C(C)C)CC1 XSSYIBVJKPNELG-UHFFFAOYSA-N 0.000 description 1
- BXHQWMYNPLCDME-UHFFFAOYSA-N n-phenyl-1-propan-2-ylpiperidin-4-amine Chemical compound C1CN(C(C)C)CCC1NC1=CC=CC=C1 BXHQWMYNPLCDME-UHFFFAOYSA-N 0.000 description 1
- SBSLCPHONZWKIE-UHFFFAOYSA-N n-piperidin-4-ylpyridin-2-amine Chemical compound C1CNCCC1NC1=CC=CC=N1 SBSLCPHONZWKIE-UHFFFAOYSA-N 0.000 description 1
- UUXXGTMOTIUHPW-UHFFFAOYSA-N n-piperidin-4-ylpyridin-3-amine Chemical compound C1CNCCC1NC1=CC=CN=C1 UUXXGTMOTIUHPW-UHFFFAOYSA-N 0.000 description 1
- BGEYIUJJXHLUPW-UHFFFAOYSA-N n-piperidin-4-ylpyrimidin-2-amine;dihydrochloride Chemical compound Cl.Cl.C1CNCCC1NC1=NC=CC=N1 BGEYIUJJXHLUPW-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 238000010641 nitrile hydrolysis reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000010606 normalization Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- XBXHCBLBYQEYTI-UHFFFAOYSA-N piperidin-4-ylmethanol Chemical compound OCC1CCNCC1 XBXHCBLBYQEYTI-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 1
- NRTLTGGGUQIRRT-UHFFFAOYSA-N triethylazanium;bromide Chemical compound [Br-].CC[NH+](CC)CC NRTLTGGGUQIRRT-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/06—Antiarrhythmics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
- C07D211/66—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4 having a hetero atom as the second substituent in position 4
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US61513175A | 1975-09-23 | 1975-09-23 | |
| US61513175 | 1975-09-23 | ||
| US71375676A | 1976-08-12 | 1976-08-12 | |
| US71375676 | 1976-08-12 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI762698A7 FI762698A7 (OSRAM) | 1977-03-24 |
| FI61482B FI61482B (fi) | 1982-04-30 |
| FI61482C true FI61482C (fi) | 1982-08-10 |
Family
ID=27087421
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI762698A FI61482C (fi) | 1975-09-23 | 1976-09-22 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara n-aryl-n-(1-l-4-piperidinyl)-arylacetamider |
Country Status (29)
| Country | Link |
|---|---|
| JP (1) | JPS6016417B2 (OSRAM) |
| AT (1) | AT363935B (OSRAM) |
| AU (1) | AU510029B2 (OSRAM) |
| BG (1) | BG27543A3 (OSRAM) |
| CA (1) | CA1068271A (OSRAM) |
| CH (1) | CH628623A5 (OSRAM) |
| CS (1) | CS222663B2 (OSRAM) |
| DE (1) | DE2642856A1 (OSRAM) |
| DK (1) | DK150478C (OSRAM) |
| ES (1) | ES451768A1 (OSRAM) |
| FI (1) | FI61482C (OSRAM) |
| FR (1) | FR2325377A1 (OSRAM) |
| GB (1) | GB1539473A (OSRAM) |
| GR (1) | GR58469B (OSRAM) |
| HU (1) | HU172964B (OSRAM) |
| IE (1) | IE43802B1 (OSRAM) |
| IL (1) | IL50522A (OSRAM) |
| IT (1) | IT1073893B (OSRAM) |
| LU (1) | LU75837A1 (OSRAM) |
| NL (1) | NL187267C (OSRAM) |
| NO (1) | NO147672C (OSRAM) |
| NZ (1) | NZ181972A (OSRAM) |
| PH (1) | PH12497A (OSRAM) |
| PL (2) | PL117323B1 (OSRAM) |
| PT (1) | PT65631B (OSRAM) |
| RO (1) | RO70079A (OSRAM) |
| SE (1) | SE427839B (OSRAM) |
| SU (1) | SU747424A3 (OSRAM) |
| YU (1) | YU39973B (OSRAM) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA765684B (en) * | 1975-09-23 | 1978-04-26 | Janssen Pharmaceutica Nv | Novel n-aryl-n-(1-l-4-piperidinyl)-arylacetamides |
| JPS62260786A (ja) * | 1986-05-08 | 1987-11-13 | 株式会社ヘキトク | 燻瓦の製造ラインにおける焼成工程後の表面仕上げ装置 |
| JO2769B1 (en) | 2005-10-26 | 2014-03-15 | جانسين فارماسوتيكا ان. في | Rapid decomposition of physiologically antagonistic agents of the 2-dopamine receptor |
| JO2642B1 (en) | 2006-12-08 | 2012-06-17 | جانسين فارماسوتيكا ان. في | Dopamine 2 receptor antagonists are rapidly hydrolyzed |
| JO2849B1 (en) | 2007-02-13 | 2015-03-15 | جانسين فارماسوتيكا ان. في | Dopamine 2 receptor antagonists are rapidly hydrolyzed |
| EP2148872A1 (en) * | 2007-04-23 | 2010-02-03 | Janssen Pharmaceutica, N.V. | Pyridine derivatives as fast dissociating dopamine 2 receptor antagonists |
| WO2008128995A1 (en) | 2007-04-23 | 2008-10-30 | Janssen Pharmaceutica N.V. | 4-alkoxypyridazine derivatives as fast dissociating dopamine 2 receptor antagonists |
| JP5431306B2 (ja) | 2007-04-23 | 2014-03-05 | ジヤンセン・フアーマシユーチカ・ナームローゼ・フエンノートシヤツプ | 高速解離性ドパミン2受容体アンタゴニストとしてのチア(ジア)ゾール |
| RU2502734C2 (ru) | 2008-07-03 | 2013-12-27 | Янссен Фармацевтика Нв | Замещенные 6-(1-пиперазинил)-пиридазины в качестве антагонистов 5-нт6 рецептора |
| AU2009275887B2 (en) | 2008-07-31 | 2013-06-20 | Janssen Pharmaceutica Nv | Piperazin-1-yl-trifluoromethyl-substituted-pyridines as fast dissociating dopamine 2 receptor antagonists |
| CN118496638B (zh) * | 2024-07-22 | 2024-11-22 | 海安浩驰科技有限公司 | 一种抗紫外车窗膜及其制备方法 |
-
1976
- 1976-09-06 NO NO763054A patent/NO147672C/no unknown
- 1976-09-08 NZ NZ181972A patent/NZ181972A/xx unknown
- 1976-09-16 FR FR7627870A patent/FR2325377A1/fr active Granted
- 1976-09-17 AU AU17878/76A patent/AU510029B2/en not_active Expired
- 1976-09-20 CA CA261,551A patent/CA1068271A/en not_active Expired
- 1976-09-20 RO RO7687590A patent/RO70079A/ro unknown
- 1976-09-20 LU LU75837A patent/LU75837A1/xx unknown
- 1976-09-21 GR GR51742A patent/GR58469B/el unknown
- 1976-09-21 IT IT51370/76A patent/IT1073893B/it active
- 1976-09-21 IL IL50522A patent/IL50522A/xx unknown
- 1976-09-21 JP JP51112527A patent/JPS6016417B2/ja not_active Expired
- 1976-09-21 GB GB39099/76A patent/GB1539473A/en not_active Expired
- 1976-09-21 CH CH1194876A patent/CH628623A5/de not_active IP Right Cessation
- 1976-09-22 CS CS766139A patent/CS222663B2/cs unknown
- 1976-09-22 AT AT0702976A patent/AT363935B/de not_active IP Right Cessation
- 1976-09-22 SE SE7610501A patent/SE427839B/xx not_active IP Right Cessation
- 1976-09-22 YU YU2336/76A patent/YU39973B/xx unknown
- 1976-09-22 FI FI762698A patent/FI61482C/fi not_active IP Right Cessation
- 1976-09-22 DK DK427876A patent/DK150478C/da active
- 1976-09-22 ES ES451768A patent/ES451768A1/es not_active Expired
- 1976-09-22 PH PH18928A patent/PH12497A/en unknown
- 1976-09-22 PL PL1976216213A patent/PL117323B1/pl unknown
- 1976-09-22 PL PL19257876A patent/PL192578A1/xx not_active IP Right Cessation
- 1976-09-22 PT PT65631A patent/PT65631B/pt unknown
- 1976-09-22 IE IE2095/76A patent/IE43802B1/en unknown
- 1976-09-22 HU HU76JA00000767A patent/HU172964B/hu not_active IP Right Cessation
- 1976-09-22 NL NLAANVRAGE7610513,A patent/NL187267C/xx not_active IP Right Cessation
- 1976-09-23 BG BG034265A patent/BG27543A3/xx unknown
- 1976-09-23 DE DE19762642856 patent/DE2642856A1/de active Granted
- 1976-09-23 SU SU762405548A patent/SU747424A3/ru active
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI61481C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara piperidinderivat | |
| FI61482C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara n-aryl-n-(1-l-4-piperidinyl)-arylacetamider | |
| US4126689A (en) | N-aryl-n-(1-alkyl-4-piperidinyl)-arylacetamides | |
| CA1183847A (en) | N-(3-hydroxy-4-piperidinyl)benzamide derivatives | |
| RU2037492C1 (ru) | Способ получения производных n-(3-гидрокси-4-пиперидинил)-(дигидробензофуран, дигидро-2н-бензопиран или дигидробензодиоксин)-карбоксамида, или их солей, или их стереохимически изомерной формы | |
| JP5852573B2 (ja) | 1−トリアゾール−2−ブタノール誘導体の製造法 | |
| US7265227B2 (en) | Piperidine derivatives useful as modulators of chemokine receptor activity | |
| US6605618B2 (en) | Heterocyclic beta-3 adrenergic receptor agonists | |
| FI77231C (fi) | Analogifoerfarande foer framstaellning av piperidinderivat som aer anvaendbara som antidepsessiva medel. | |
| NO154058B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive n-heterocyklyl-4-piperidinaminer. | |
| US4369184A (en) | 1-(Cyclohexyl)-4-aryl-4-piperidinecarboxylic acid derivatives | |
| NO160076B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive benzoksazol- og benzotianolaminderivater. | |
| FI82047C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara substituerade n-/(4-piperidinyl)alkyl/ bicykliska kondenserade oxazol- och tiazolaminer. | |
| HUE024949T2 (en) | Process for the preparation of substituted pyrimidine derivatives | |
| US3161637A (en) | 1-(gamma-aroyl-propyl)-4-(nu-arylcarbonyl amino) piperidines and related compounds | |
| US4197304A (en) | N-Aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| US4196210A (en) | N-Aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| FI64364B (fi) | Foerfarande foer framstaellning av analgetiskt aktiva n-fenyl-n-(4-piperidinyl)-amidderivat | |
| US4151286A (en) | N-aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| US3083205A (en) | Alkanoylamino and alkoxycarbonylamino derivatives of 1-(aroylalkyl)-4-arylpiperidines | |
| US6583159B1 (en) | Substitute 1-(piperidin-4-yl)-3-(aryl)-isothioureas, their preparation and therapeutic use | |
| DK153474B (da) | Analogifremgangsmaade til fremstilling af n-aryl-n-(4-piperidyl)-arylacetamidderivater | |
| EP1317432A1 (en) | Piperidine derivatives for use as 2,3-oxidosqualene-lanosterol cyclase inhibitors | |
| US4197303A (en) | N-Aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| US4208418A (en) | N-Aryl-N-(1-alkyl-4-piperidinyl)arylacetamides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: JANSSEN PHARMACEUTICA N.V. |