FI60098C - Lagringsbestaendig blandning som vid loesning i vatten ger upphov till en loesning med effektiv antimikrobisk verkan - Google Patents
Lagringsbestaendig blandning som vid loesning i vatten ger upphov till en loesning med effektiv antimikrobisk verkan Download PDFInfo
- Publication number
- FI60098C FI60098C FI773531A FI773531A FI60098C FI 60098 C FI60098 C FI 60098C FI 773531 A FI773531 A FI 773531A FI 773531 A FI773531 A FI 773531A FI 60098 C FI60098 C FI 60098C
- Authority
- FI
- Finland
- Prior art keywords
- loesning
- acid
- aromatic
- water
- alkali
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 36
- -1 aromatic acrylic acid derivative Chemical class 0.000 claims description 26
- 239000002253 acid Substances 0.000 claims description 24
- 125000003118 aryl group Chemical group 0.000 claims description 18
- 239000003513 alkali Substances 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 230000000845 anti-microbial effect Effects 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 5
- 150000004965 peroxy acids Chemical class 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 150000003863 ammonium salts Chemical class 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000004423 acyloxy group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 23
- 150000007513 acids Chemical class 0.000 description 13
- 150000003839 salts Chemical class 0.000 description 9
- 150000004967 organic peroxy acids Chemical class 0.000 description 8
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 7
- 238000003776 cleavage reaction Methods 0.000 description 7
- 230000007017 scission Effects 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 150000001447 alkali salts Chemical class 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 230000007797 corrosion Effects 0.000 description 4
- 238000005260 corrosion Methods 0.000 description 4
- 239000000645 desinfectant Substances 0.000 description 4
- 238000004090 dissolution Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000005054 agglomeration Methods 0.000 description 3
- 230000002776 aggregation Effects 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 150000008051 alkyl sulfates Chemical class 0.000 description 3
- 230000000249 desinfective effect Effects 0.000 description 3
- 239000003599 detergent Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- GJAWHXHKYYXBSV-UHFFFAOYSA-N quinolinic acid Chemical compound OC(=O)C1=CC=CN=C1C(O)=O GJAWHXHKYYXBSV-UHFFFAOYSA-N 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- 238000004659 sterilization and disinfection Methods 0.000 description 2
- IQJVXCIYYQAIKL-UHFFFAOYSA-N 1-(4-bromophenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one Chemical group CSC(SC)=CC(=O)C1=CC=C(Br)C=C1 IQJVXCIYYQAIKL-UHFFFAOYSA-N 0.000 description 1
- LDMOEFOXLIZJOW-UHFFFAOYSA-N 1-dodecanesulfonic acid Chemical compound CCCCCCCCCCCCS(O)(=O)=O LDMOEFOXLIZJOW-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- XISJAYFEDONCPX-UHFFFAOYSA-N 2-(4-methylbenzoyl)oxybenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)OC1=CC=CC=C1C(O)=O XISJAYFEDONCPX-UHFFFAOYSA-N 0.000 description 1
- IXRKYOKMWFSHFS-UHFFFAOYSA-N 2-(4-tert-butylbenzoyl)oxybenzoic acid Chemical compound C1=CC(C(C)(C)C)=CC=C1C(=O)OC1=CC=CC=C1C(O)=O IXRKYOKMWFSHFS-UHFFFAOYSA-N 0.000 description 1
- QSOVSKMNRYAVJR-UHFFFAOYSA-N 2-benzoyloxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC(=O)C1=CC=CC=C1 QSOVSKMNRYAVJR-UHFFFAOYSA-N 0.000 description 1
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- HPUYJGLLYOMGEU-UHFFFAOYSA-N 3-(4-methylbenzoyl)oxybenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)OC1=CC=CC(C(O)=O)=C1 HPUYJGLLYOMGEU-UHFFFAOYSA-N 0.000 description 1
- CMBKRJGERJTDEP-UHFFFAOYSA-N 3-[(4-methoxyphenyl)methoxy]benzoic acid Chemical compound C1=CC(OC)=CC=C1COC1=CC=CC(C(O)=O)=C1 CMBKRJGERJTDEP-UHFFFAOYSA-N 0.000 description 1
- NGMYCWFGNSXLMP-UHFFFAOYSA-N 3-acetyloxybenzoic acid Chemical compound CC(=O)OC1=CC=CC(C(O)=O)=C1 NGMYCWFGNSXLMP-UHFFFAOYSA-N 0.000 description 1
- MEUAICCVSAZKMX-UHFFFAOYSA-N 3-benzoyloxybenzoic acid Chemical group OC(=O)C1=CC=CC(OC(=O)C=2C=CC=CC=2)=C1 MEUAICCVSAZKMX-UHFFFAOYSA-N 0.000 description 1
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- MRHKYNGTQLHYPG-UHFFFAOYSA-N 4-(4-methylbenzoyl)oxybenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)OC1=CC=C(C(O)=O)C=C1 MRHKYNGTQLHYPG-UHFFFAOYSA-N 0.000 description 1
- CVLHGLWXLDOELD-UHFFFAOYSA-N 4-(Propan-2-yl)benzenesulfonic acid Chemical compound CC(C)C1=CC=C(S(O)(=O)=O)C=C1 CVLHGLWXLDOELD-UHFFFAOYSA-N 0.000 description 1
- WWDSYRTXXSXZLS-UHFFFAOYSA-N 4-[(4-methoxyphenyl)methoxy]benzoic acid Chemical compound C1=CC(OC)=CC=C1COC1=CC=C(C(O)=O)C=C1 WWDSYRTXXSXZLS-UHFFFAOYSA-N 0.000 description 1
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical group CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- IAPQCQCJCOIPGG-UHFFFAOYSA-N 4-methoxybenzenecarboperoxoic acid Chemical compound COC1=CC=C(C(=O)OO)C=C1 IAPQCQCJCOIPGG-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- MNPYETDBTVUTDQ-UHFFFAOYSA-N 4-propanoyloxybenzoic acid Chemical group CCC(=O)OC1=CC=C(C(O)=O)C=C1 MNPYETDBTVUTDQ-UHFFFAOYSA-N 0.000 description 1
- TZAJCDOWOPBMKD-UHFFFAOYSA-N 4-tert-butylbenzenecarboperoxoic acid Chemical compound CC(C)(C)C1=CC=C(C(=O)OO)C=C1 TZAJCDOWOPBMKD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 1
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000000721 bacterilogical effect Effects 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 230000009474 immediate action Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical compound OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- XVASUAIDEWZALR-UHFFFAOYSA-N n-methyl-n-[methyl(tridecyl)amino]oxytridecan-1-amine Chemical class CCCCCCCCCCCCCN(C)ON(C)CCCCCCCCCCCCC XVASUAIDEWZALR-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- SBOJXQVPLKSXOG-UHFFFAOYSA-N o-amino-hydroxylamine Chemical class NON SBOJXQVPLKSXOG-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical class OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920001522 polyglycol ester Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- CZPZWMPYEINMCF-UHFFFAOYSA-N propaneperoxoic acid Chemical compound CCC(=O)OO CZPZWMPYEINMCF-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 235000019794 sodium silicate Nutrition 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- QULKDBMYSOOKMH-UHFFFAOYSA-N sulfo hydrogen carbonate Chemical compound OC(=O)OS(O)(=O)=O QULKDBMYSOOKMH-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000010257 thawing Methods 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/16—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing the group; Thio analogues thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2701133A DE2701133C3 (de) | 1977-01-13 | 1977-01-13 | Lagerfähige, beim Lösen in Wasser eine Lösung mit hoher antimikrobieller Wirkung ergebende Mischung |
| DE2701133 | 1977-01-13 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI773531A7 FI773531A7 (fi) | 1978-07-14 |
| FI60098B FI60098B (fi) | 1981-08-31 |
| FI60098C true FI60098C (fi) | 1981-12-10 |
Family
ID=5998570
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI773531A FI60098C (fi) | 1977-01-13 | 1977-11-22 | Lagringsbestaendig blandning som vid loesning i vatten ger upphov till en loesning med effektiv antimikrobisk verkan |
Country Status (13)
| Country | Link |
|---|---|
| AT (1) | ATA785777A (enExample) |
| BE (1) | BE861167A (enExample) |
| CH (1) | CH631869A5 (enExample) |
| DE (1) | DE2701133C3 (enExample) |
| DK (1) | DK154533C (enExample) |
| FI (1) | FI60098C (enExample) |
| FR (1) | FR2377203A1 (enExample) |
| GB (1) | GB1566671A (enExample) |
| IE (1) | IE46299B1 (enExample) |
| LU (1) | LU78578A1 (enExample) |
| NL (1) | NL7800463A (enExample) |
| NO (1) | NO145707C (enExample) |
| SE (1) | SE440846B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2817858C2 (de) * | 1978-04-24 | 1986-01-30 | Schülke & Mayr GmbH, 2000 Norderstedt | Lagerfähiges, antimikrobielles Konzentrat auf Persäurebasis |
| DE3046769C2 (de) * | 1980-12-12 | 1993-12-02 | Schülke & Mayr GmbH, 2000 Norderstedt | Die Verwendung von Caroat als viruzides Mittel |
| DE3543500A1 (de) * | 1985-12-10 | 1987-06-11 | Schuelke & Mayr Gmbh | Waessrige loesung aromatischer percarbonsaeuren und deren verwendung |
| US5350563A (en) * | 1986-02-06 | 1994-09-27 | Steris Corporation | Cold sterilant with extended active life |
| US5116575A (en) * | 1986-02-06 | 1992-05-26 | Steris Corporation | Powdered anti-microbial composition |
| DE3615787A1 (de) * | 1986-05-10 | 1987-11-12 | Fresenius Ag | Desinfektionsmittel |
| US4917815A (en) * | 1988-06-10 | 1990-04-17 | Sterling Drug Inc. | Stable aqueous aromatic percarboxylic acid solution |
| US5002687A (en) * | 1989-04-13 | 1991-03-26 | Lever Brothers Company, Division Of Conopco, Inc. | Fabric washing compositions |
| WO1995020876A1 (en) * | 1994-02-07 | 1995-08-10 | Warwick International Group Limited | Oxidising compositions |
| US5723095A (en) * | 1995-12-28 | 1998-03-03 | Steris Corporation | Cleaner concentrate formulation for biological waste fluid handling systems |
| DE19651415A1 (de) | 1996-12-11 | 1998-06-18 | Henkel Ecolab Gmbh & Co Ohg | Verfahren zur Instrumentendesinfektion |
| FR2790390B1 (fr) * | 1999-03-05 | 2002-08-02 | Anios Lab Sarl | Procede de preparation d'une composition antimicrobienne |
| DE19962344A1 (de) | 1999-12-23 | 2001-07-12 | Henkel Ecolab Gmbh & Co Ohg | Verfahren und Mittel zur Reinigung und Desinfektion von empfindlichen medizinischen Geräten |
| DE19962342A1 (de) * | 1999-12-23 | 2001-07-12 | Henkel Ecolab Gmbh & Co Ohg | Persäuren mit guter Haftung auf Oberflächen |
| DE10214750A1 (de) * | 2002-04-03 | 2003-10-16 | Ecolab Gmbh & Co Ohg | Instrumentendesinfektion |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR319248A (fr) * | 1902-03-03 | 1902-11-07 | Page | Perfectionnements dans les compositions antiseptiques et les procédés pour les produire |
| DE807122C (de) * | 1950-02-04 | 1951-06-25 | Krisp Kg Kukirol | Verfahren zur Herstellung stark wirksamer bakterizider und desinfizierender Mittel |
| NL209345A (enExample) * | 1955-07-27 | |||
| FR1354160A (fr) * | 1963-01-11 | 1964-03-06 | Air Liquide | Procédé de préparation de mélanges oxydants à base d'acide monoperphtalique |
| US3256198A (en) * | 1963-04-22 | 1966-06-14 | Monsanto Co | Compositions containing an oxygen releasing compound and an organic carbonate |
| GB1269677A (en) * | 1969-12-11 | 1972-04-06 | Procter & Gamble Ltd | Bleaching composition |
| DE2026240B2 (de) * | 1970-05-29 | 1979-08-23 | Henkel Kgaa, 4000 Duesseldorf | Verwendung wäßriger Lösungen eines Desinfektionsmittels zur Desinfektion medizinischer Geräte und Instrumente |
| NL173919C (nl) * | 1970-05-29 | 1984-04-02 | Henkel Kgaa | Werkwijze voor het desinfecteren van medische apparaten en instrumenten. |
| GB1395006A (en) * | 1971-04-30 | 1975-05-21 | Unilever Ltd | Activators for per compounds |
-
1977
- 1977-01-13 DE DE2701133A patent/DE2701133C3/de not_active Expired
- 1977-11-03 AT AT785777A patent/ATA785777A/de unknown
- 1977-11-14 CH CH1388277A patent/CH631869A5/de not_active IP Right Cessation
- 1977-11-22 FI FI773531A patent/FI60098C/fi not_active IP Right Cessation
- 1977-11-24 LU LU78578A patent/LU78578A1/xx unknown
- 1977-11-24 BE BE182908A patent/BE861167A/xx not_active IP Right Cessation
- 1977-11-25 NO NO774045A patent/NO145707C/no unknown
- 1977-11-30 FR FR7736033A patent/FR2377203A1/fr active Granted
- 1977-12-20 SE SE7714473A patent/SE440846B/sv not_active IP Right Cessation
-
1978
- 1978-01-13 DK DK017478A patent/DK154533C/da not_active IP Right Cessation
- 1978-01-13 IE IE76/78A patent/IE46299B1/en unknown
- 1978-01-13 GB GB1360/78A patent/GB1566671A/en not_active Expired
- 1978-01-13 NL NL7800463A patent/NL7800463A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| NO774045L (no) | 1978-07-14 |
| ATA785777A (de) | 1979-04-15 |
| LU78578A1 (enExample) | 1978-04-20 |
| DK154533C (da) | 1989-05-01 |
| DE2701133C3 (de) | 1985-08-29 |
| NO145707B (no) | 1982-02-08 |
| IE46299B1 (en) | 1983-04-20 |
| BE861167A (fr) | 1978-03-16 |
| FR2377203A1 (fr) | 1978-08-11 |
| SE7714473L (sv) | 1978-07-14 |
| DK17478A (da) | 1978-07-14 |
| IE780076L (en) | 1978-07-13 |
| SE440846B (sv) | 1985-08-26 |
| DE2701133A1 (de) | 1978-07-20 |
| NL7800463A (nl) | 1978-07-17 |
| GB1566671A (en) | 1980-05-08 |
| DE2701133B2 (de) | 1978-10-26 |
| FI60098B (fi) | 1981-08-31 |
| NO145707C (no) | 1982-05-26 |
| CH631869A5 (en) | 1982-09-15 |
| FI773531A7 (fi) | 1978-07-14 |
| DK154533B (da) | 1988-11-28 |
| FR2377203B1 (enExample) | 1980-08-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI60098C (fi) | Lagringsbestaendig blandning som vid loesning i vatten ger upphov till en loesning med effektiv antimikrobisk verkan | |
| US5891392A (en) | Ready to use aqueous hard surface cleaning and disinfecting compositions containing hydrogen peroxide | |
| ES2206757T3 (es) | Procedimiento para la preparacion de soluciones de acido percarboxilico. | |
| JP2843438B2 (ja) | 組成物とその使用方法 | |
| US3992146A (en) | Process of using biocidal solutions containing copper sulfate | |
| WO1994024869A1 (en) | Germicidal composition | |
| US5545349A (en) | Bleaching composition | |
| JP3882206B2 (ja) | カビ取り剤組成物 | |
| CA2303266C (en) | Method of disinfecting and inhibiting mold and mildew growth on non-porous hard surfaces | |
| JPS5925899A (ja) | 衛生化組成物 | |
| JP3334363B2 (ja) | カビ取り剤組成物およびカビの漂白方法 | |
| US7615187B2 (en) | Organic peroxyacid precursors | |
| US20160362634A1 (en) | All-In-One Air Cleaner/Odor Eliminator, Surface Disinfectant and Surface Multipurpose/All Purpose Cleaner | |
| RU2217170C2 (ru) | Дезинфицирующее средство | |
| JPH07119436B2 (ja) | 洗浄剤組成物 | |
| JP5143378B2 (ja) | アセタールによる殺菌性芳香族ジアルデヒドの形成 | |
| JP4726329B2 (ja) | 微生物コントロール剤 | |
| RO117540B1 (ro) | Compozitie dezinfectanta-detergenta | |
| CS705986A2 (en) | Herbicide and method of its active substance production | |
| RU2408388C1 (ru) | Способ получения антимикробной композиции и набор для ее получения | |
| JP3710181B2 (ja) | 水性カビ取り剤用組成物および2剤型カビ取り剤 | |
| JPH05156293A (ja) | 硬質表面用漂白洗浄剤組成物 | |
| EP0920803B1 (en) | Disinfectant composition comprising glutaraldehyde and phenolic compounds | |
| JP2756026B2 (ja) | 漂白剤組成物 | |
| JPH0525497A (ja) | 硬質表面の漂白洗浄方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: SCHUELKE & MAYR GMBH |