SE440846B - Lagringsbar fast blandning som vid upplosning i vatten ger en starkt antimikrobiell losning - Google Patents
Lagringsbar fast blandning som vid upplosning i vatten ger en starkt antimikrobiell losningInfo
- Publication number
- SE440846B SE440846B SE7714473A SE7714473A SE440846B SE 440846 B SE440846 B SE 440846B SE 7714473 A SE7714473 A SE 7714473A SE 7714473 A SE7714473 A SE 7714473A SE 440846 B SE440846 B SE 440846B
- Authority
- SE
- Sweden
- Prior art keywords
- acid
- mixture
- water
- aromatic
- molecular weight
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title claims description 18
- 230000000845 anti-microbial effect Effects 0.000 title claims description 6
- 239000008247 solid mixture Substances 0.000 title claims description 4
- 239000004599 antimicrobial Substances 0.000 title 1
- 239000002253 acid Substances 0.000 claims description 33
- 239000000203 mixture Substances 0.000 claims description 30
- 125000003118 aryl group Chemical group 0.000 claims description 15
- 150000007513 acids Chemical class 0.000 claims description 14
- 150000004965 peroxy acids Chemical class 0.000 claims description 10
- 239000003513 alkali Substances 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 5
- 239000003599 detergent Substances 0.000 claims description 4
- 230000007797 corrosion Effects 0.000 claims description 3
- 238000005260 corrosion Methods 0.000 claims description 3
- 239000003112 inhibitor Substances 0.000 claims description 3
- 239000000654 additive Substances 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 3
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 125000004423 acyloxy group Chemical group 0.000 claims 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 1
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- 239000011230 binding agent Substances 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 239000003381 stabilizer Substances 0.000 claims 1
- 230000000087 stabilizing effect Effects 0.000 claims 1
- -1 acetylmethyl Chemical group 0.000 description 30
- 239000000243 solution Substances 0.000 description 18
- 229910052783 alkali metal Inorganic materials 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 10
- 239000000126 substance Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 7
- 150000001340 alkali metals Chemical class 0.000 description 5
- 150000001447 alkali salts Chemical class 0.000 description 5
- 235000014820 Galium aparine Nutrition 0.000 description 4
- 240000005702 Galium aparine Species 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 238000003776 cleavage reaction Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 4
- 230000007017 scission Effects 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000645 desinfectant Substances 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000007257 deesterification reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 150000004967 organic peroxy acids Chemical class 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 229960004889 salicylic acid Drugs 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 229960001922 sodium perborate Drugs 0.000 description 2
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000004659 sterilization and disinfection Methods 0.000 description 2
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- QSOVSKMNRYAVJR-UHFFFAOYSA-N 2-benzoyloxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC(=O)C1=CC=CC=C1 QSOVSKMNRYAVJR-UHFFFAOYSA-N 0.000 description 1
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- BEYCHVCFWUVKNJ-UHFFFAOYSA-N 3-(4-methoxybenzoyl)oxybenzoic acid Chemical compound C1=CC(OC)=CC=C1C(=O)OC1=CC=CC(C(O)=O)=C1 BEYCHVCFWUVKNJ-UHFFFAOYSA-N 0.000 description 1
- HPUYJGLLYOMGEU-UHFFFAOYSA-N 3-(4-methylbenzoyl)oxybenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)OC1=CC=CC(C(O)=O)=C1 HPUYJGLLYOMGEU-UHFFFAOYSA-N 0.000 description 1
- FDCMZOYSEHNDCP-UHFFFAOYSA-N 4-(4-methoxybenzoyl)oxybenzoic acid Chemical compound C1=CC(OC)=CC=C1C(=O)OC1=CC=C(C(O)=O)C=C1 FDCMZOYSEHNDCP-UHFFFAOYSA-N 0.000 description 1
- MRHKYNGTQLHYPG-UHFFFAOYSA-N 4-(4-methylbenzoyl)oxybenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)OC1=CC=C(C(O)=O)C=C1 MRHKYNGTQLHYPG-UHFFFAOYSA-N 0.000 description 1
- CVLHGLWXLDOELD-UHFFFAOYSA-N 4-(Propan-2-yl)benzenesulfonic acid Chemical compound CC(C)C1=CC=C(S(O)(=O)=O)C=C1 CVLHGLWXLDOELD-UHFFFAOYSA-N 0.000 description 1
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical compound CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 1
- ZLVFYUORUHNMBO-UHFFFAOYSA-N 4-bromo-2,6-dimethylphenol Chemical compound CC1=CC(Br)=CC(C)=C1O ZLVFYUORUHNMBO-UHFFFAOYSA-N 0.000 description 1
- AQSCHALQLXXKKC-UHFFFAOYSA-N 4-phenylmethoxybenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OCC1=CC=CC=C1 AQSCHALQLXXKKC-UHFFFAOYSA-N 0.000 description 1
- MNPYETDBTVUTDQ-UHFFFAOYSA-N 4-propanoyloxybenzoic acid Chemical compound CCC(=O)OC1=CC=C(C(O)=O)C=C1 MNPYETDBTVUTDQ-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241001164374 Calyx Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical class OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 1
- 241001181114 Neta Species 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000000721 bacterilogical effect Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 235000013351 cheese Nutrition 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000000249 desinfective effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- LVPMIMZXDYBCDF-UHFFFAOYSA-N isocinchomeronic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)N=C1 LVPMIMZXDYBCDF-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 235000010292 orthophenyl phenol Nutrition 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- 235000015067 sauces Nutrition 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/16—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing the group; Thio analogues thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2701133A DE2701133C3 (de) | 1977-01-13 | 1977-01-13 | Lagerfähige, beim Lösen in Wasser eine Lösung mit hoher antimikrobieller Wirkung ergebende Mischung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7714473L SE7714473L (sv) | 1978-07-14 |
| SE440846B true SE440846B (sv) | 1985-08-26 |
Family
ID=5998570
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7714473A SE440846B (sv) | 1977-01-13 | 1977-12-20 | Lagringsbar fast blandning som vid upplosning i vatten ger en starkt antimikrobiell losning |
Country Status (13)
| Country | Link |
|---|---|
| AT (1) | ATA785777A (enExample) |
| BE (1) | BE861167A (enExample) |
| CH (1) | CH631869A5 (enExample) |
| DE (1) | DE2701133C3 (enExample) |
| DK (1) | DK154533C (enExample) |
| FI (1) | FI60098C (enExample) |
| FR (1) | FR2377203A1 (enExample) |
| GB (1) | GB1566671A (enExample) |
| IE (1) | IE46299B1 (enExample) |
| LU (1) | LU78578A1 (enExample) |
| NL (1) | NL7800463A (enExample) |
| NO (1) | NO145707C (enExample) |
| SE (1) | SE440846B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2817858C2 (de) * | 1978-04-24 | 1986-01-30 | Schülke & Mayr GmbH, 2000 Norderstedt | Lagerfähiges, antimikrobielles Konzentrat auf Persäurebasis |
| DE3046769C2 (de) * | 1980-12-12 | 1993-12-02 | Schülke & Mayr GmbH, 2000 Norderstedt | Die Verwendung von Caroat als viruzides Mittel |
| DE3543500A1 (de) * | 1985-12-10 | 1987-06-11 | Schuelke & Mayr Gmbh | Waessrige loesung aromatischer percarbonsaeuren und deren verwendung |
| US5350563A (en) * | 1986-02-06 | 1994-09-27 | Steris Corporation | Cold sterilant with extended active life |
| US5116575A (en) * | 1986-02-06 | 1992-05-26 | Steris Corporation | Powdered anti-microbial composition |
| DE3615787A1 (de) * | 1986-05-10 | 1987-11-12 | Fresenius Ag | Desinfektionsmittel |
| US4917815A (en) * | 1988-06-10 | 1990-04-17 | Sterling Drug Inc. | Stable aqueous aromatic percarboxylic acid solution |
| US5002687A (en) * | 1989-04-13 | 1991-03-26 | Lever Brothers Company, Division Of Conopco, Inc. | Fabric washing compositions |
| AU1584495A (en) * | 1994-02-07 | 1995-08-21 | Warwick International Group Limited | Oxidising compositions |
| US5723095A (en) * | 1995-12-28 | 1998-03-03 | Steris Corporation | Cleaner concentrate formulation for biological waste fluid handling systems |
| DE19651415A1 (de) | 1996-12-11 | 1998-06-18 | Henkel Ecolab Gmbh & Co Ohg | Verfahren zur Instrumentendesinfektion |
| FR2790390B1 (fr) * | 1999-03-05 | 2002-08-02 | Anios Lab Sarl | Procede de preparation d'une composition antimicrobienne |
| DE19962342A1 (de) * | 1999-12-23 | 2001-07-12 | Henkel Ecolab Gmbh & Co Ohg | Persäuren mit guter Haftung auf Oberflächen |
| DE19962344A1 (de) | 1999-12-23 | 2001-07-12 | Henkel Ecolab Gmbh & Co Ohg | Verfahren und Mittel zur Reinigung und Desinfektion von empfindlichen medizinischen Geräten |
| DE10214750A1 (de) * | 2002-04-03 | 2003-10-16 | Ecolab Gmbh & Co Ohg | Instrumentendesinfektion |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR319248A (fr) * | 1902-03-03 | 1902-11-07 | Page | Perfectionnements dans les compositions antiseptiques et les procédés pour les produire |
| DE807122C (de) * | 1950-02-04 | 1951-06-25 | Krisp Kg Kukirol | Verfahren zur Herstellung stark wirksamer bakterizider und desinfizierender Mittel |
| NL209345A (enExample) * | 1955-07-27 | |||
| FR1354160A (fr) * | 1963-01-11 | 1964-03-06 | Air Liquide | Procédé de préparation de mélanges oxydants à base d'acide monoperphtalique |
| US3256198A (en) * | 1963-04-22 | 1966-06-14 | Monsanto Co | Compositions containing an oxygen releasing compound and an organic carbonate |
| GB1269677A (en) * | 1969-12-11 | 1972-04-06 | Procter & Gamble Ltd | Bleaching composition |
| SE401448B (sv) * | 1970-05-29 | 1978-05-16 | Henkel Kgaa | Vattenlosningar av ett desinfektionsmedel for desinfektion av medicinska redskap och instrument pa basis av aktivt syre |
| DE2026240B2 (de) * | 1970-05-29 | 1979-08-23 | Henkel Kgaa, 4000 Duesseldorf | Verwendung wäßriger Lösungen eines Desinfektionsmittels zur Desinfektion medizinischer Geräte und Instrumente |
| GB1395006A (en) * | 1971-04-30 | 1975-05-21 | Unilever Ltd | Activators for per compounds |
-
1977
- 1977-01-13 DE DE2701133A patent/DE2701133C3/de not_active Expired
- 1977-11-03 AT AT785777A patent/ATA785777A/de unknown
- 1977-11-14 CH CH1388277A patent/CH631869A5/de not_active IP Right Cessation
- 1977-11-22 FI FI773531A patent/FI60098C/fi not_active IP Right Cessation
- 1977-11-24 LU LU78578A patent/LU78578A1/xx unknown
- 1977-11-24 BE BE182908A patent/BE861167A/xx not_active IP Right Cessation
- 1977-11-25 NO NO774045A patent/NO145707C/no unknown
- 1977-11-30 FR FR7736033A patent/FR2377203A1/fr active Granted
- 1977-12-20 SE SE7714473A patent/SE440846B/sv not_active IP Right Cessation
-
1978
- 1978-01-13 DK DK017478A patent/DK154533C/da not_active IP Right Cessation
- 1978-01-13 NL NL7800463A patent/NL7800463A/xx not_active Application Discontinuation
- 1978-01-13 IE IE76/78A patent/IE46299B1/en unknown
- 1978-01-13 GB GB1360/78A patent/GB1566671A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7800463A (nl) | 1978-07-17 |
| BE861167A (fr) | 1978-03-16 |
| NO145707B (no) | 1982-02-08 |
| DK154533B (da) | 1988-11-28 |
| FI773531A7 (fi) | 1978-07-14 |
| DE2701133C3 (de) | 1985-08-29 |
| FI60098C (fi) | 1981-12-10 |
| DE2701133B2 (de) | 1978-10-26 |
| CH631869A5 (en) | 1982-09-15 |
| FI60098B (fi) | 1981-08-31 |
| IE780076L (en) | 1978-07-13 |
| NO145707C (no) | 1982-05-26 |
| FR2377203A1 (fr) | 1978-08-11 |
| DK154533C (da) | 1989-05-01 |
| DE2701133A1 (de) | 1978-07-20 |
| GB1566671A (en) | 1980-05-08 |
| ATA785777A (de) | 1979-04-15 |
| SE7714473L (sv) | 1978-07-14 |
| FR2377203B1 (enExample) | 1980-08-22 |
| DK17478A (da) | 1978-07-14 |
| IE46299B1 (en) | 1983-04-20 |
| LU78578A1 (enExample) | 1978-04-20 |
| NO774045L (no) | 1978-07-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE440846B (sv) | Lagringsbar fast blandning som vid upplosning i vatten ger en starkt antimikrobiell losning | |
| TWI235034B (en) | Non-aqueous or low-water suspension concentrates of mixtures of active compounds for crop protection | |
| US2607738A (en) | Bleaching, sterilizing, disinfecting, and deterging compositions | |
| CA1305721C (en) | Sulfone peroxycarboxylic acids | |
| NZ244750A (en) | Disinfectant compositions containing a lower aliphatic peracid, a hydrogen peroxide stabilizer, and a corrosion inhibitor in an aqueous solution | |
| DE19616693A1 (de) | Enolester als Bleichaktivatoren für Wasch- und Reinigungsmittel | |
| HU230485B1 (hu) | Optikailag aktív, herbicid hatású (R)-fenoxi-propionsav-N-metil-N-(2-fluor-fenil)-amid | |
| JPH09506607A (ja) | 過カルボン酸 | |
| IL44410A (en) | Carbanilides, their preparation and preparation containing them | |
| WO2012059050A1 (zh) | 取代的联芳香基苯磺酰胺类化合物与用途 | |
| EP0147207A1 (en) | Disinfectants | |
| US2953491A (en) | Fungicide | |
| US2893911A (en) | 1, 2-bis(alkylsulfoxy)-1, 2-dihaloethylenes and fungicidal compositions comprising them | |
| JPH0327304A (ja) | 消毒剤濃厚液 | |
| CA3179386A1 (en) | Substituted isophthalic acid diamides | |
| NO134051B (enExample) | ||
| GB2223946A (en) | Herbicidal compositions and their use | |
| US4655824A (en) | Certain trifluoromethoxy-phenoxy-pyridines having herbicidal activity | |
| DE2047573A1 (de) | Mittel zur Herstellung von Kaltbleichflotten, insbesondere von kaltbleichwirksamen Waschlaugen | |
| US2914392A (en) | Method of destroying vegetation | |
| US3925473A (en) | Herbicidal oxime esters of phenoxyalkanoic esters and their use as selective herbicides | |
| CA3179394A1 (en) | Substituted isophthalic acid diamides | |
| USRE24868E (en) | Halophenyl j | |
| US4777176A (en) | Fungicidal compositions containing piperidine compounds | |
| EP1123375B1 (en) | Thickened liquid hydrogen peroxide bleach compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7714473-1 Effective date: 19930709 Format of ref document f/p: F |